repo_name
stringlengths
5
100
path
stringlengths
4
375
copies
stringclasses
991 values
size
stringlengths
4
7
content
stringlengths
666
1M
license
stringclasses
15 values
msvbhat/distaf
distaf/util.py
1
4872
# This file is part of DiSTAF # Copyright (C) 2015-2016 Red Hat, Inc. <http://www.redhat.com> # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License along # with this program; if not, write to the Free Software Foundation, Inc., # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. from types import FunctionType from distaf.client_rpyc import BigBang from distaf.config_parser import get_global_config, get_testcase_config testcases = {} test_list = {} test_seq = [] test_mounts = {} globl_configs = {} global_mode = None tc = None def distaf_init(config_file_string="config.yml"): """ The distaf init function which calls the BigBang """ config_files = config_file_string.split() global globl_configs, global_mode, tc globl_configs = get_global_config(config_files) global_mode = globl_configs['global_mode'] tc = BigBang(globl_configs) return globl_configs def inject_gluster_logs(label, servers=''): """ Injects the label in gluster related logs This is mainly to help identifying what was going on during the test case @parameter: A label string which will be injected to gluster logs A list of servers in which this log inejection should be done @returns: None """ if servers == '': servers = tc.all_nodes cmd = "for file in `find $(gluster --print-logdir) -type f " \ "-name '*.log'`; do echo \"%s\" >> $file; done" % label tc.run_servers(cmd, servers=servers, verbose=False) return None def testcase(name): def decorator(func): tc_config = get_testcase_config(func.__doc__) def wrapper(self): tc.logger.info("Starting the test: %s" % name) voltype, mount_proto = test_seq.pop(0) inject_gluster_logs("%s_%s" % (voltype, name)) _ret = True globl_configs['reuse_setup'] = tc_config['reuse_setup'] globl_configs.update(tc_config) globl_configs['voltype'] = voltype globl_configs['mount_proto'] = mount_proto if isinstance(func, FunctionType): _ret = func() else: try: func_obj = func(globl_configs) ret = func_obj.setup() if not ret: tc.logger.error("The setup of %s failed" % name) _ret = False if _ret: ret = func_obj.run() if not ret: tc.logger.error("The execution of testcase %s " \ "failed" % name) _ret = False ret = func_obj.teardown() if not ret: tc.logger.error("The teardown of %s failed" % name) _ret = False if len(test_seq) == 0 or voltype != test_seq[0][0]: tc.logger.info("Last test case to use %s volume type" \ % voltype) ret = func_obj.cleanup() if not ret: tc.logger.error("The cleanup of volume %s failed" \ % name) _ret = False except: tc.logger.exception("Exception while running %s" % name) _ret = False self.assertTrue(_ret, "Testcase %s failed" % name) inject_gluster_logs("%s_%s" % (voltype, name)) tc.logger.info("Ending the test: %s" % name) return _ret testcases[name] = wrapper if not global_mode and tc_config is not None: for voltype in tc_config['runs_on_volumes']: if voltype not in test_list: test_list[voltype] = [] if not tc_config['reuse_setup']: test_list[voltype].insert(0, name) else: test_list[voltype].append(name) test_mounts[name] = tc_config['runs_on_protocol'] return wrapper return decorator def distaf_finii(): """ The fini() function which closes all connection to the servers """ tc.fini()
gpl-2.0
pombredanne/psd-tools
tests/test_pixels.py
8
5675
# -*- coding: utf-8 -*- from __future__ import absolute_import, unicode_literals import pytest from psd_tools import PSDImage, Layer, Group from .utils import full_name PIXEL_COLORS = ( # filename probe point pixel value ('1layer.psd', (5, 5), (0x27, 0xBA, 0x0F)), ('group.psd', (10, 20), (0xFF, 0xFF, 0xFF)), ('hidden-groups.psd', (60, 100), (0xE1, 0x0B, 0x0B)), ('hidden-layer.psd', (0, 0), (0xFF, 0xFF, 0xFF)), # ('note.psd', (30, 30), (0, 0, 0)), # what is it? ('smart-object-slice.psd', (70, 80), (0xAC, 0x19, 0x19)), # XXX: what is this test about? ) TRANSPARENCY_PIXEL_COLORS = ( ('transparentbg-gimp.psd', (14, 14), (0xFF, 0xFF, 0xFF, 0x13)), ('2layers.psd', (70, 30), (0xF1, 0xF3, 0xC1)), # why gimp shows it as F2F4C2 ? ) MASK_PIXEL_COLORS = ( ('clipping-mask.psd', (182, 68), (0xDA, 0xE6, 0xF7)), # this is a clipped point ('mask.psd', (87, 7), (0xFF, 0xFF, 0xFF)), # mask truncates the layer here ) NO_LAYERS_PIXEL_COLORS = ( ('history.psd', (70, 85), (0x24, 0x26, 0x29)), ) PIXEL_COLORS_8BIT = (PIXEL_COLORS + NO_LAYERS_PIXEL_COLORS + MASK_PIXEL_COLORS + TRANSPARENCY_PIXEL_COLORS) PIXEL_COLORS_32BIT = ( ('32bit.psd', (75, 15), (136, 139, 145)), ('32bit.psd', (95, 15), (0, 0, 0)), ('300dpi.psd', (70, 30), (0, 0, 0)), ('300dpi.psd', (50, 60), (214, 59, 59)), ('gradient fill.psd', (10, 15), (235, 241, 250)), # background ('gradient fill.psd', (70, 50), (0, 0, 0)), # black circle ('gradient fill.psd', (50, 50), (205, 144, 110)), # filled ellipse ('pen-text.psd', (50, 50), (229, 93, 93)), ('pen-text.psd', (170, 40), (0, 0, 0)), ('vector mask.psd', (10, 15), (255, 255, 255)), ('vector mask.psd', (50, 90), (221, 227, 236)), ('transparentbg.psd', (0, 0), (255, 255, 255, 0)), ('transparentbg.psd', (50, 50), (0, 0, 0, 255)), ('32bit5x5.psd', (0, 0), (235, 241, 250)), # why not equal to 16bit5x5.psd? ('32bit5x5.psd', (4, 0), (0, 0, 0)), ('32bit5x5.psd', (1, 3), (46, 196, 104)), ) PIXEL_COLORS_16BIT = ( ('16bit5x5.psd', (0, 0), (236, 242, 251)), ('16bit5x5.psd', (4, 0), (0, 0, 0)), ('16bit5x5.psd', (1, 3), (46, 196, 104)), ) LAYER_COLORS = ( ('1layer.psd', 0, (5, 5), (0x27, 0xBA, 0x0F)), ('2layers.psd', 1, (5, 5), (0x27, 0xBA, 0x0F)), ('2layers.psd', 1, (70, 30), (0x27, 0xBA, 0x0F)), ('2layers.psd', 0, (0, 0), (0, 0, 0, 0)), ('2layers.psd', 0, (62, 26), (0xF2, 0xF4, 0xC2, 0xFE)), ) LAYER_COLORS_MULTIBYTE = ( ('16bit5x5.psd', 1, (0, 0), (236, 242, 251, 255)), ('16bit5x5.psd', 1, (1, 3), (46, 196, 104, 255)), ('32bit5x5.psd', 1, (0, 0), (235, 241, 250, 255)), # why not equal to 16bit5x5.psd? ('32bit5x5.psd', 1, (1, 3), (46, 196, 104, 255)), ) def color_PIL(psd, point): im = psd.as_PIL() return im.getpixel(point) def color_pymaging(psd, point): im = psd.as_pymaging() return tuple(im.get_pixel(*point)) BACKENDS = [[color_PIL], [color_pymaging]] @pytest.mark.parametrize(["get_color"], BACKENDS) @pytest.mark.parametrize(["filename", "point", "color"], PIXEL_COLORS_8BIT) def test_composite(filename, point, color, get_color): psd = PSDImage.load(full_name(filename)) assert color == get_color(psd, point) @pytest.mark.parametrize(["filename", "point", "color"], PIXEL_COLORS_32BIT) def test_composite_32bit(filename, point, color): psd = PSDImage.load(full_name(filename)) assert color == color_PIL(psd, point) @pytest.mark.parametrize(["filename", "point", "color"], PIXEL_COLORS_16BIT) def test_composite_16bit(filename, point, color): psd = PSDImage.load(full_name(filename)) assert color == color_PIL(psd, point) @pytest.mark.parametrize(["filename", "layer_num", "point", "color"], LAYER_COLORS_MULTIBYTE) def test_layer_colors_multibyte(filename, layer_num, point, color): psd = PSDImage.load(full_name(filename)) layer = psd.layers[layer_num] assert color == color_PIL(layer, point) @pytest.mark.parametrize(["get_color"], BACKENDS) @pytest.mark.parametrize(["filename", "layer_num", "point", "color"], LAYER_COLORS) def test_layer_colors(filename, layer_num, point, color, get_color): psd = PSDImage.load(full_name(filename)) layer = psd.layers[layer_num] assert color == get_color(layer, point) @pytest.mark.parametrize(["filename", "point", "color"], PIXEL_COLORS + MASK_PIXEL_COLORS + TRANSPARENCY_PIXEL_COLORS) def test_layer_merging_size(filename, point, color): psd = PSDImage.load(full_name(filename)) merged_image = psd.as_PIL_merged() assert merged_image.size == psd.as_PIL().size @pytest.mark.parametrize(["filename", "point", "color"], PIXEL_COLORS) def test_layer_merging_pixels(filename, point, color): psd = PSDImage.load(full_name(filename)) merged_image = psd.as_PIL_merged() assert color[:3] == merged_image.getpixel(point)[:3] assert merged_image.getpixel(point)[3] == 255 # alpha channel @pytest.mark.xfail @pytest.mark.parametrize(["filename", "point", "color"], TRANSPARENCY_PIXEL_COLORS) def test_layer_merging_pixels_transparency(filename, point, color): psd = PSDImage.load(full_name(filename)) merged_image = psd.as_PIL_merged() assert color == merged_image.getpixel(point)
mit
jazkarta/edx-platform-for-isc
common/djangoapps/track/tests/test_util.py
239
1203
from datetime import datetime import json from pytz import UTC from django.test import TestCase from track.utils import DateTimeJSONEncoder class TestDateTimeJSONEncoder(TestCase): def test_datetime_encoding(self): a_naive_datetime = datetime(2012, 05, 01, 07, 27, 10, 20000) a_tz_datetime = datetime(2012, 05, 01, 07, 27, 10, 20000, tzinfo=UTC) a_date = a_naive_datetime.date() an_iso_datetime = '2012-05-01T07:27:10.020000+00:00' an_iso_date = '2012-05-01' obj = { 'number': 100, 'string': 'hello', 'object': {'a': 1}, 'a_datetime': a_naive_datetime, 'a_tz_datetime': a_tz_datetime, 'a_date': a_date, } to_json = json.dumps(obj, cls=DateTimeJSONEncoder) from_json = json.loads(to_json) self.assertEqual(from_json['number'], 100) self.assertEqual(from_json['string'], 'hello') self.assertEqual(from_json['object'], {'a': 1}) self.assertEqual(from_json['a_datetime'], an_iso_datetime) self.assertEqual(from_json['a_tz_datetime'], an_iso_datetime) self.assertEqual(from_json['a_date'], an_iso_date)
agpl-3.0
Red-M/CloudBot-legacy
plugins/tell.py
2
3615
""" tell.py: written by sklnd in July 2009 2010.01.25 - modified by Scaevolus""" import time import re from util import hook, timesince db_ready = [] def db_init(db, conn): """Check that our db has the tell table, create it if not.""" global db_ready if not conn.name in db_ready: db.execute("create table if not exists tell" "(user_to, user_from, message, chan, time," "primary key(user_to, message))") db.commit() db_ready.append(conn.name) def get_tells(db, user_to): return db.execute("select user_from, message, time, chan from tell where" " user_to=lower(?) order by time", (user_to.lower(),)).fetchall() @hook.singlethread @hook.event('PRIVMSG') def tellinput(inp, input=None, notice=None, db=None, nick=None, conn=None): if 'showtells' in input.msg.lower(): return db_init(db, conn) tells = get_tells(db, nick) if tells: user_from, message, time, chan = tells[0] reltime = timesince.timesince(time) reply = "{} sent you a message {} ago from {}: {}".format(user_from, reltime, chan, message) if len(tells) > 1: reply += " (+{} more, {}showtells to view)".format(len(tells) - 1, conn.conf["command_prefix"]) db.execute("delete from tell where user_to=lower(?) and message=?", (nick, message)) db.commit() notice(reply) @hook.command(autohelp=False) def showtells(inp, nick='', chan='', notice=None, db=None, conn=None): """showtells -- View all pending tell messages (sent in a notice).""" db_init(db, conn) tells = get_tells(db, nick) if not tells: notice("You have no pending tells.") return for tell in tells: user_from, message, time, chan = tell past = timesince.timesince(time) notice("{} sent you a message {} ago from {}: {}".format(user_from, past, chan, message)) db.execute("delete from tell where user_to=lower(?)", (nick,)) db.commit() @hook.command def tell(inp, nick='', chan='', db=None, input=None, notice=None, conn=None): """tell <nick> <message> -- Relay <message> to <nick> when <nick> is around.""" query = inp.split(' ', 1) if len(query) != 2: notice(tell.__doc__) return user_to = query[0].lower() message = query[1].strip() user_from = nick if chan.lower() == user_from.lower(): chan = 'a pm' if user_to == user_from.lower(): notice("Have you looked in a mirror lately?") return if user_to.lower() == input.conn.nick.lower(): # user is looking for us, being a smart-ass notice("Thanks for the message, {}!".format(user_from)) return if not re.match("^[A-Za-z0-9_|.\-\]\[]*$", user_to.lower()): notice("I can't send a message to that user!") return db_init(db, conn) if db.execute("select count() from tell where user_to=?", (user_to,)).fetchone()[0] >= 10: notice("That person has too many messages queued.") return try: db.execute("insert into tell(user_to, user_from, message, chan," "time) values(?,?,?,?,?)", (user_to, user_from, message, chan, time.time())) db.commit() except db.IntegrityError: notice("Message has already been queued.") return notice("Your message has been sent!")
gpl-3.0
swenson/sagewiki
unidecode/unidecode/x025.py
252
3871
data = ( '-', # 0x00 '-', # 0x01 '|', # 0x02 '|', # 0x03 '-', # 0x04 '-', # 0x05 '|', # 0x06 '|', # 0x07 '-', # 0x08 '-', # 0x09 '|', # 0x0a '|', # 0x0b '+', # 0x0c '+', # 0x0d '+', # 0x0e '+', # 0x0f '+', # 0x10 '+', # 0x11 '+', # 0x12 '+', # 0x13 '+', # 0x14 '+', # 0x15 '+', # 0x16 '+', # 0x17 '+', # 0x18 '+', # 0x19 '+', # 0x1a '+', # 0x1b '+', # 0x1c '+', # 0x1d '+', # 0x1e '+', # 0x1f '+', # 0x20 '+', # 0x21 '+', # 0x22 '+', # 0x23 '+', # 0x24 '+', # 0x25 '+', # 0x26 '+', # 0x27 '+', # 0x28 '+', # 0x29 '+', # 0x2a '+', # 0x2b '+', # 0x2c '+', # 0x2d '+', # 0x2e '+', # 0x2f '+', # 0x30 '+', # 0x31 '+', # 0x32 '+', # 0x33 '+', # 0x34 '+', # 0x35 '+', # 0x36 '+', # 0x37 '+', # 0x38 '+', # 0x39 '+', # 0x3a '+', # 0x3b '+', # 0x3c '+', # 0x3d '+', # 0x3e '+', # 0x3f '+', # 0x40 '+', # 0x41 '+', # 0x42 '+', # 0x43 '+', # 0x44 '+', # 0x45 '+', # 0x46 '+', # 0x47 '+', # 0x48 '+', # 0x49 '+', # 0x4a '+', # 0x4b '-', # 0x4c '-', # 0x4d '|', # 0x4e '|', # 0x4f '-', # 0x50 '|', # 0x51 '+', # 0x52 '+', # 0x53 '+', # 0x54 '+', # 0x55 '+', # 0x56 '+', # 0x57 '+', # 0x58 '+', # 0x59 '+', # 0x5a '+', # 0x5b '+', # 0x5c '+', # 0x5d '+', # 0x5e '+', # 0x5f '+', # 0x60 '+', # 0x61 '+', # 0x62 '+', # 0x63 '+', # 0x64 '+', # 0x65 '+', # 0x66 '+', # 0x67 '+', # 0x68 '+', # 0x69 '+', # 0x6a '+', # 0x6b '+', # 0x6c '+', # 0x6d '+', # 0x6e '+', # 0x6f '+', # 0x70 '/', # 0x71 '\\', # 0x72 'X', # 0x73 '-', # 0x74 '|', # 0x75 '-', # 0x76 '|', # 0x77 '-', # 0x78 '|', # 0x79 '-', # 0x7a '|', # 0x7b '-', # 0x7c '|', # 0x7d '-', # 0x7e '|', # 0x7f '#', # 0x80 '#', # 0x81 '#', # 0x82 '#', # 0x83 '#', # 0x84 '#', # 0x85 '#', # 0x86 '#', # 0x87 '#', # 0x88 '#', # 0x89 '#', # 0x8a '#', # 0x8b '#', # 0x8c '#', # 0x8d '#', # 0x8e '#', # 0x8f '#', # 0x90 '#', # 0x91 '#', # 0x92 '#', # 0x93 '-', # 0x94 '|', # 0x95 '[?]', # 0x96 '[?]', # 0x97 '[?]', # 0x98 '[?]', # 0x99 '[?]', # 0x9a '[?]', # 0x9b '[?]', # 0x9c '[?]', # 0x9d '[?]', # 0x9e '[?]', # 0x9f '#', # 0xa0 '#', # 0xa1 '#', # 0xa2 '#', # 0xa3 '#', # 0xa4 '#', # 0xa5 '#', # 0xa6 '#', # 0xa7 '#', # 0xa8 '#', # 0xa9 '#', # 0xaa '#', # 0xab '#', # 0xac '#', # 0xad '#', # 0xae '#', # 0xaf '#', # 0xb0 '#', # 0xb1 '^', # 0xb2 '^', # 0xb3 '^', # 0xb4 '^', # 0xb5 '>', # 0xb6 '>', # 0xb7 '>', # 0xb8 '>', # 0xb9 '>', # 0xba '>', # 0xbb 'V', # 0xbc 'V', # 0xbd 'V', # 0xbe 'V', # 0xbf '<', # 0xc0 '<', # 0xc1 '<', # 0xc2 '<', # 0xc3 '<', # 0xc4 '<', # 0xc5 '*', # 0xc6 '*', # 0xc7 '*', # 0xc8 '*', # 0xc9 '*', # 0xca '*', # 0xcb '*', # 0xcc '*', # 0xcd '*', # 0xce '*', # 0xcf '*', # 0xd0 '*', # 0xd1 '*', # 0xd2 '*', # 0xd3 '*', # 0xd4 '*', # 0xd5 '*', # 0xd6 '*', # 0xd7 '*', # 0xd8 '*', # 0xd9 '*', # 0xda '*', # 0xdb '*', # 0xdc '*', # 0xdd '*', # 0xde '*', # 0xdf '*', # 0xe0 '*', # 0xe1 '*', # 0xe2 '*', # 0xe3 '*', # 0xe4 '*', # 0xe5 '*', # 0xe6 '#', # 0xe7 '#', # 0xe8 '#', # 0xe9 '#', # 0xea '#', # 0xeb '^', # 0xec '^', # 0xed '^', # 0xee 'O', # 0xef '#', # 0xf0 '#', # 0xf1 '#', # 0xf2 '#', # 0xf3 '#', # 0xf4 '#', # 0xf5 '#', # 0xf6 '#', # 0xf7 '[?]', # 0xf8 '[?]', # 0xf9 '[?]', # 0xfa '[?]', # 0xfb '[?]', # 0xfc '[?]', # 0xfd '[?]', # 0xfe )
gpl-2.0
jakub-d/kubernetes
hack/lookup_pull.py
246
1299
#!/usr/bin/env python # Copyright 2015 The Kubernetes Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # Script to print out PR info in release note format. import json import sys import urllib2 PULLQUERY=("https://api.github.com/repos/" "GoogleCloudPlatform/kubernetes/pulls/{pull}") LOGIN="login" TITLE="title" USER="user" def print_pulls(pulls): for pull in pulls: d = json.loads(urllib2.urlopen(PULLQUERY.format(pull=pull)).read()) print "* {title} #{pull} ({author})".format( title=d[TITLE], pull=pull, author=d[USER][LOGIN]) if __name__ == "__main__": if len(sys.argv) < 2: print ("Usage: {cmd} <pulls>...: Prints out short " + "markdown description for PRs appropriate for release notes.") sys.exit(1) print_pulls(sys.argv[1:])
apache-2.0
snowballstem/snowball
python/stemwords.py
1
3437
import sys import codecs import snowballstemmer def usage(): print('''usage: %s [-l <language>] [-i <input file>] [-o <output file>] [-c <character encoding>] [-p[2]] [-h] The input file consists of a list of words to be stemmed, one per line. Words should be in lower case, but (for English) A-Z letters are mapped to their a-z equivalents anyway. If omitted, stdin is used. If -c is given, the argument is the character encoding of the input and output files. If it is omitted, the UTF-8 encoding is used. If -p is given the output file consists of each word of the input file followed by \"->\" followed by its stemmed equivalent. If -p2 is given the output file is a two column layout containing the input words in the first column and the stemmed eqivalents in the second column. Otherwise, the output file consists of the stemmed words, one per line. -h displays this help''' % sys.argv[0]) def main(): argv = sys.argv[1:] if len(argv) < 5: usage() else: pretty = 0 input = '' output = '' encoding = 'utf_8' language = 'English' show_help = False while len(argv): arg = argv[0] argv = argv[1:] if arg == '-h': show_help = True break elif arg == "-p": pretty = 1 elif arg == "-p2": pretty = 2 elif arg == "-l": if len(argv) == 0: show_help = True break language = argv[0] argv = argv[1:] elif arg == "-i": if len(argv) == 0: show_help = True break input = argv[0] argv = argv[1:] elif arg == "-o": if len(argv) == 0: show_help = True break output = argv[0] argv = argv[1:] elif arg == "-c": if len(argv) == 0: show_help = True break encoding = argv[0] if show_help or input == '' or output == '': usage() else: stemming(language, input, output, encoding, pretty) def stemming(lang, input, output, encoding, pretty): stemmer = snowballstemmer.stemmer(lang) with codecs.open(output, "w", encoding) as outfile: with codecs.open(input, "r", encoding) as infile: for original in infile.readlines(): original = original.strip() # Convert only ASCII-letters to lowercase, to match C behavior original = ''.join((c.lower() if 'A' <= c <= 'Z' else c for c in original)) stemmed = stemmer.stemWord(original) if pretty == 0: if stemmed != "": outfile.write(stemmed) elif pretty == 1: outfile.write(original, " -> ", stemmed) elif pretty == 2: outfile.write(original) if len(original) < 30: outfile.write(" " * (30 - len(original))) else: outfile.write("\n") outfile.write(" " * 30) outfile.write(stemmed) outfile.write('\n') main()
bsd-3-clause
markYoungH/chromium.src
media/tools/constrained_network_server/traffic_control.py
186
12569
# Copyright (c) 2012 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. """Traffic control library for constraining the network configuration on a port. The traffic controller sets up a constrained network configuration on a port. Traffic to the constrained port is forwarded to a specified server port. """ import logging import os import re import subprocess # The maximum bandwidth limit. _DEFAULT_MAX_BANDWIDTH_KBIT = 1000000 class TrafficControlError(BaseException): """Exception raised for errors in traffic control library. Attributes: msg: User defined error message. cmd: Command for which the exception was raised. returncode: Return code of running the command. stdout: Output of running the command. stderr: Error output of running the command. """ def __init__(self, msg, cmd=None, returncode=None, output=None, error=None): BaseException.__init__(self, msg) self.msg = msg self.cmd = cmd self.returncode = returncode self.output = output self.error = error def CheckRequirements(): """Checks if permissions are available to run traffic control commands. Raises: TrafficControlError: If permissions to run traffic control commands are not available. """ if os.geteuid() != 0: _Exec(['sudo', '-n', 'tc', '-help'], msg=('Cannot run \'tc\' command. Traffic Control must be run as root ' 'or have password-less sudo access to this command.')) _Exec(['sudo', '-n', 'iptables', '-help'], msg=('Cannot run \'iptables\' command. Traffic Control must be run ' 'as root or have password-less sudo access to this command.')) def CreateConstrainedPort(config): """Creates a new constrained port. Imposes packet level constraints such as bandwidth, latency, and packet loss on a given port using the specified configuration dictionary. Traffic to that port is forwarded to a specified server port. Args: config: Constraint configuration dictionary, format: port: Port to constrain (integer 1-65535). server_port: Port to redirect traffic on [port] to (integer 1-65535). interface: Network interface name (string). latency: Delay added on each packet sent (integer in ms). bandwidth: Maximum allowed upload bandwidth (integer in kbit/s). loss: Percentage of packets to drop (integer 0-100). Raises: TrafficControlError: If any operation fails. The message in the exception describes what failed. """ _CheckArgsExist(config, 'interface', 'port', 'server_port') _AddRootQdisc(config['interface']) try: _ConfigureClass('add', config) _AddSubQdisc(config) _AddFilter(config['interface'], config['port']) _AddIptableRule(config['interface'], config['port'], config['server_port']) except TrafficControlError as e: logging.debug('Error creating constrained port %d.\nError: %s\n' 'Deleting constrained port.', config['port'], e.error) DeleteConstrainedPort(config) raise e def DeleteConstrainedPort(config): """Deletes an existing constrained port. Deletes constraints set on a given port and the traffic forwarding rule from the constrained port to a specified server port. The original constrained network configuration used to create the constrained port must be passed in. Args: config: Constraint configuration dictionary, format: port: Port to constrain (integer 1-65535). server_port: Port to redirect traffic on [port] to (integer 1-65535). interface: Network interface name (string). bandwidth: Maximum allowed upload bandwidth (integer in kbit/s). Raises: TrafficControlError: If any operation fails. The message in the exception describes what failed. """ _CheckArgsExist(config, 'interface', 'port', 'server_port') try: # Delete filters first so it frees the class. _DeleteFilter(config['interface'], config['port']) finally: try: # Deleting the class deletes attached qdisc as well. _ConfigureClass('del', config) finally: _DeleteIptableRule(config['interface'], config['port'], config['server_port']) def TearDown(config): """Deletes the root qdisc and all iptables rules. Args: config: Constraint configuration dictionary, format: interface: Network interface name (string). Raises: TrafficControlError: If any operation fails. The message in the exception describes what failed. """ _CheckArgsExist(config, 'interface') command = ['sudo', 'tc', 'qdisc', 'del', 'dev', config['interface'], 'root'] try: _Exec(command, msg='Could not delete root qdisc.') finally: _DeleteAllIpTableRules() def _CheckArgsExist(config, *args): """Check that the args exist in config dictionary and are not None. Args: config: Any dictionary. *args: The list of key names to check. Raises: TrafficControlError: If any key name does not exist in config or is None. """ for key in args: if key not in config.keys() or config[key] is None: raise TrafficControlError('Missing "%s" parameter.' % key) def _AddRootQdisc(interface): """Sets up the default root qdisc. Args: interface: Network interface name. Raises: TrafficControlError: If adding the root qdisc fails for a reason other than it already exists. """ command = ['sudo', 'tc', 'qdisc', 'add', 'dev', interface, 'root', 'handle', '1:', 'htb'] try: _Exec(command, msg=('Error creating root qdisc. ' 'Make sure you have root access')) except TrafficControlError as e: # Ignore the error if root already exists. if not 'File exists' in e.error: raise e def _ConfigureClass(option, config): """Adds or deletes a class and qdisc attached to the root. The class specifies bandwidth, and qdisc specifies delay and packet loss. The class ID is based on the config port. Args: option: Adds or deletes a class option [add|del]. config: Constraint configuration dictionary, format: port: Port to constrain (integer 1-65535). interface: Network interface name (string). bandwidth: Maximum allowed upload bandwidth (integer in kbit/s). """ # Use constrained port as class ID so we can attach the qdisc and filter to # it, as well as delete the class, using only the port number. class_id = '1:%x' % config['port'] if 'bandwidth' not in config.keys() or not config['bandwidth']: bandwidth = _DEFAULT_MAX_BANDWIDTH_KBIT else: bandwidth = config['bandwidth'] bandwidth = '%dkbit' % bandwidth command = ['sudo', 'tc', 'class', option, 'dev', config['interface'], 'parent', '1:', 'classid', class_id, 'htb', 'rate', bandwidth, 'ceil', bandwidth] _Exec(command, msg=('Error configuring class ID %s using "%s" command.' % (class_id, option))) def _AddSubQdisc(config): """Adds a qdisc attached to the class identified by the config port. Args: config: Constraint configuration dictionary, format: port: Port to constrain (integer 1-65535). interface: Network interface name (string). latency: Delay added on each packet sent (integer in ms). loss: Percentage of packets to drop (integer 0-100). """ port_hex = '%x' % config['port'] class_id = '1:%x' % config['port'] command = ['sudo', 'tc', 'qdisc', 'add', 'dev', config['interface'], 'parent', class_id, 'handle', port_hex + ':0', 'netem'] # Check if packet-loss is set in the configuration. if 'loss' in config.keys() and config['loss']: loss = '%d%%' % config['loss'] command.extend(['loss', loss]) # Check if latency is set in the configuration. if 'latency' in config.keys() and config['latency']: latency = '%dms' % config['latency'] command.extend(['delay', latency]) _Exec(command, msg='Could not attach qdisc to class ID %s.' % class_id) def _AddFilter(interface, port): """Redirects packets coming to a specified port into the constrained class. Args: interface: Interface name to attach the filter to (string). port: Port number to filter packets with (integer 1-65535). """ class_id = '1:%x' % port command = ['sudo', 'tc', 'filter', 'add', 'dev', interface, 'protocol', 'ip', 'parent', '1:', 'prio', '1', 'u32', 'match', 'ip', 'sport', port, '0xffff', 'flowid', class_id] _Exec(command, msg='Error adding filter on port %d.' % port) def _DeleteFilter(interface, port): """Deletes the filter attached to the configured port. Args: interface: Interface name the filter is attached to (string). port: Port number being filtered (integer 1-65535). """ handle_id = _GetFilterHandleId(interface, port) command = ['sudo', 'tc', 'filter', 'del', 'dev', interface, 'protocol', 'ip', 'parent', '1:0', 'handle', handle_id, 'prio', '1', 'u32'] _Exec(command, msg='Error deleting filter on port %d.' % port) def _GetFilterHandleId(interface, port): """Searches for the handle ID of the filter identified by the config port. Args: interface: Interface name the filter is attached to (string). port: Port number being filtered (integer 1-65535). Returns: The handle ID. Raises: TrafficControlError: If handle ID was not found. """ command = ['sudo', 'tc', 'filter', 'list', 'dev', interface, 'parent', '1:'] output = _Exec(command, msg='Error listing filters.') # Search for the filter handle ID associated with class ID '1:port'. handle_id_re = re.search( '([0-9a-fA-F]{3}::[0-9a-fA-F]{3}).*(?=flowid 1:%x\s)' % port, output) if handle_id_re: return handle_id_re.group(1) raise TrafficControlError(('Could not find filter handle ID for class ID ' '1:%x.') % port) def _AddIptableRule(interface, port, server_port): """Forwards traffic from constrained port to a specified server port. Args: interface: Interface name to attach the filter to (string). port: Port of incoming packets (integer 1-65535). server_port: Server port to forward the packets to (integer 1-65535). """ # Preroute rules for accessing the port through external connections. command = ['sudo', 'iptables', '-t', 'nat', '-A', 'PREROUTING', '-i', interface, '-p', 'tcp', '--dport', port, '-j', 'REDIRECT', '--to-port', server_port] _Exec(command, msg='Error adding iptables rule for port %d.' % port) # Output rules for accessing the rule through localhost or 127.0.0.1 command = ['sudo', 'iptables', '-t', 'nat', '-A', 'OUTPUT', '-p', 'tcp', '--dport', port, '-j', 'REDIRECT', '--to-port', server_port] _Exec(command, msg='Error adding iptables rule for port %d.' % port) def _DeleteIptableRule(interface, port, server_port): """Deletes the iptable rule associated with specified port number. Args: interface: Interface name to attach the filter to (string). port: Port of incoming packets (integer 1-65535). server_port: Server port packets are forwarded to (integer 1-65535). """ command = ['sudo', 'iptables', '-t', 'nat', '-D', 'PREROUTING', '-i', interface, '-p', 'tcp', '--dport', port, '-j', 'REDIRECT', '--to-port', server_port] _Exec(command, msg='Error deleting iptables rule for port %d.' % port) command = ['sudo', 'iptables', '-t', 'nat', '-D', 'OUTPUT', '-p', 'tcp', '--dport', port, '-j', 'REDIRECT', '--to-port', server_port] _Exec(command, msg='Error adding iptables rule for port %d.' % port) def _DeleteAllIpTableRules(): """Deletes all iptables rules.""" command = ['sudo', 'iptables', '-t', 'nat', '-F'] _Exec(command, msg='Error deleting all iptables rules.') def _Exec(command, msg=None): """Executes a command. Args: command: Command list to execute. msg: Message describing the error in case the command fails. Returns: The standard output from running the command. Raises: TrafficControlError: If command fails. Message is set by the msg parameter. """ cmd_list = [str(x) for x in command] cmd = ' '.join(cmd_list) logging.debug('Running command: %s', cmd) p = subprocess.Popen(cmd_list, stdout=subprocess.PIPE, stderr=subprocess.PIPE) output, error = p.communicate() if p.returncode != 0: raise TrafficControlError(msg, cmd, p.returncode, output, error) return output.strip()
bsd-3-clause
marcelocure/django
tests/gis_tests/utils.py
327
1377
from unittest import skip from django.conf import settings from django.db import DEFAULT_DB_ALIAS def no_backend(test_func, backend): "Use this decorator to disable test on specified backend." if settings.DATABASES[DEFAULT_DB_ALIAS]['ENGINE'].rsplit('.')[-1] == backend: @skip("This test is skipped on '%s' backend" % backend) def inner(): pass return inner else: return test_func # Decorators to disable entire test functions for specific # spatial backends. def no_oracle(func): return no_backend(func, 'oracle') # Shortcut booleans to omit only portions of tests. _default_db = settings.DATABASES[DEFAULT_DB_ALIAS]['ENGINE'].rsplit('.')[-1] oracle = _default_db == 'oracle' postgis = _default_db == 'postgis' mysql = _default_db == 'mysql' spatialite = _default_db == 'spatialite' # MySQL spatial indices can't handle NULL geometries. gisfield_may_be_null = not mysql if oracle and 'gis' in settings.DATABASES[DEFAULT_DB_ALIAS]['ENGINE']: from django.contrib.gis.db.backends.oracle.models import OracleSpatialRefSys as SpatialRefSys elif postgis: from django.contrib.gis.db.backends.postgis.models import PostGISSpatialRefSys as SpatialRefSys elif spatialite: from django.contrib.gis.db.backends.spatialite.models import SpatialiteSpatialRefSys as SpatialRefSys else: SpatialRefSys = None
bsd-3-clause
chromium/chromium
components/policy/tools/generate_policy_source.py
1
66390
#!/usr/bin/env python3 # Copyright (c) 2012 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. '''python3 %(prog)s [options] Pass at least: --chrome-version-file <path to src/chrome/VERSION> or --all-chrome-versions --target-platform <which platform the target code will be generated for and can be one of (win, mac, linux, chromeos, ios)> --policy_templates <path to the policy_templates.json input file>.''' from argparse import ArgumentParser from collections import namedtuple from collections import OrderedDict from functools import partial import ast import codecs import json import os import re import sys import textwrap sys.path.insert( 0, os.path.join(os.path.dirname(__file__), os.pardir, os.pardir, os.pardir, 'third_party', 'six', 'src')) import six from xml.sax.saxutils import escape as xml_escape if sys.version_info.major == 2: string_type = basestring else: string_type = str CHROME_POLICY_KEY = 'SOFTWARE\\\\Policies\\\\Google\\\\Chrome' CHROMIUM_POLICY_KEY = 'SOFTWARE\\\\Policies\\\\Chromium' PLATFORM_STRINGS = { 'chrome_frame': ['win'], 'chrome_os': ['chrome_os'], 'android': ['android'], 'webview_android': ['android'], 'ios': ['ios'], 'chrome.win': ['win'], 'chrome.linux': ['linux'], 'chrome.mac': ['mac'], 'chrome.*': ['win', 'mac', 'linux'], 'chrome.win7': ['win'] } class PolicyDetails: """Parses a policy template and caches all its details.""" # Maps policy types to a tuple with 4 other types: # - the equivalent base::Value::Type or 'TYPE_EXTERNAL' if the policy # references external data # - the equivalent Protobuf field type # - the name of one of the protobufs for shared policy types # - the equivalent type in Android's App Restriction Schema # TODO(joaodasilva): refactor the 'dict' type into a more generic 'json' type # that can also be used to represent lists of other JSON objects. TYPE_MAP = { 'dict': ('Type::DICTIONARY', 'string', 'String', 'string'), 'external': ('TYPE_EXTERNAL', 'string', 'String', 'invalid'), 'int': ('Type::INTEGER', 'int64', 'Integer', 'integer'), 'int-enum': ('Type::INTEGER', 'int64', 'Integer', 'choice'), 'list': ('Type::LIST', 'StringList', 'StringList', 'string'), 'main': ('Type::BOOLEAN', 'bool', 'Boolean', 'bool'), 'string': ('Type::STRING', 'string', 'String', 'string'), 'string-enum': ('Type::STRING', 'string', 'String', 'choice'), 'string-enum-list': ('Type::LIST', 'StringList', 'StringList', 'multi-select'), } class EnumItem: def __init__(self, item): self.caption = PolicyDetails._RemovePlaceholders(item['caption']) self.value = item['value'] def _ConvertPlatform(self, platform): '''Converts product platform string in policy_templates.json to platform string that is defined in build config.''' if platform not in PLATFORM_STRINGS: raise RuntimeError('Platform "%s" is not supported' % platform) return PLATFORM_STRINGS[platform] def __init__(self, policy, chrome_major_version, target_platform, valid_tags): self.id = policy['id'] self.name = policy['name'] self.tags = policy.get('tags', None) self._CheckTagsValidity(valid_tags) features = policy.get('features', {}) self.can_be_recommended = features.get('can_be_recommended', False) self.can_be_mandatory = features.get('can_be_mandatory', True) self.internal_only = features.get('internal_only', False) self.is_deprecated = policy.get('deprecated', False) self.is_device_only = policy.get('device_only', False) self.is_future = policy.get('future', False) self.per_profile = features.get('per_profile', False) self.supported_chrome_os_management = policy.get( 'supported_chrome_os_management', ['active_directory', 'google_cloud']) self.schema = policy['schema'] self.validation_schema = policy.get('validation_schema') self.has_enterprise_default = 'default_for_enterprise_users' in policy if self.has_enterprise_default: self.enterprise_default = policy['default_for_enterprise_users'] self.platforms = set() self.future_on = set() for platform, version_range in map(lambda s: s.split(':'), policy.get('supported_on', [])): split_result = version_range.split('-') if len(split_result) != 2: raise RuntimeError('supported_on must have exactly one dash: "%s"' % p) (version_min, version_max) = split_result if version_min == '': raise RuntimeError('supported_on must define a start version: "%s"' % p) # Skip if filtering by Chromium version and the current Chromium version # does not support the policy. if chrome_major_version: if (int(version_min) > chrome_major_version or version_max != '' and int(version_max) < chrome_major_version): continue self.platforms.update(self._ConvertPlatform(platform)) for platform in policy.get('future_on', []): self.future_on.update(self._ConvertPlatform(platform)) if self.is_device_only and self.platforms.union(self.future_on) > set( ['chrome_os']): raise RuntimeError('device_only is only allowed for Chrome OS: "%s"' % self.name) self.is_supported = (target_platform in self.platforms or target_platform in self.future_on) self.is_future_on = target_platform in self.future_on self.is_future = self.is_future or self.is_future_on if policy['type'] not in PolicyDetails.TYPE_MAP: raise NotImplementedError( 'Unknown policy type for %s: %s' % (policy['name'], policy['type'])) self.policy_type, self.protobuf_type, self.policy_protobuf_type, \ self.restriction_type = PolicyDetails.TYPE_MAP[policy['type']] self.desc = '\n'.join( map(str.strip, PolicyDetails._RemovePlaceholders(policy['desc']).splitlines())) self.caption = PolicyDetails._RemovePlaceholders(policy['caption']) self.max_size = policy.get('max_size', 0) items = policy.get('items') if items is None: self.items = None else: self.items = [PolicyDetails.EnumItem(entry) for entry in items] PH_PATTERN = re.compile('<ph[^>]*>([^<]*|[^<]*<ex>([^<]*)</ex>[^<]*)</ph>') def _CheckTagsValidity(self, valid_tags): if self.tags == None: raise RuntimeError('Policy ' + self.name + ' has to contain a list of ' 'tags!\n An empty list is also valid but means ' 'setting this policy can never harm the user\'s ' 'privacy or security.\n') for tag in self.tags: if not tag in valid_tags: raise RuntimeError('Invalid Tag:' + tag + '!\n' 'Chose a valid tag from \'risk_tag_definitions\' (a ' 'subproperty of root in policy_templates.json)!') # Simplistic grit placeholder stripper. @staticmethod def _RemovePlaceholders(text): result = '' pos = 0 for m in PolicyDetails.PH_PATTERN.finditer(text): result += text[pos:m.start(0)] result += m.group(2) or m.group(1) pos = m.end(0) result += text[pos:] return result class PolicyAtomicGroup: """Parses a policy atomic group and caches its name and policy names""" def __init__(self, policy_group, available_policies, policies_already_in_group): self.id = policy_group['id'] self.name = policy_group['name'] self.policies = policy_group.get('policies', None) self._CheckPoliciesValidity(available_policies, policies_already_in_group) def _CheckPoliciesValidity(self, available_policies, policies_already_in_group): if self.policies == None or len(self.policies) <= 0: raise RuntimeError('Atomic policy group ' + self.name + ' has to contain a list of ' 'policies!\n') for policy in self.policies: if policy in policies_already_in_group: raise RuntimeError('Policy: ' + policy + ' cannot be in more than one atomic group ' 'in policy_templates.json)!') policies_already_in_group.add(policy) if not policy in available_policies: raise RuntimeError('Invalid policy: ' + policy + ' in atomic group ' + self.name + '.\n') def ParseVersionFile(version_path): chrome_major_version = None for line in open(version_path, 'r').readlines(): key, val = line.rstrip('\r\n').split('=', 1) if key == 'MAJOR': chrome_major_version = val break if chrome_major_version is None: raise RuntimeError('VERSION file does not contain major version.') return int(chrome_major_version) def main(): parser = ArgumentParser(usage=__doc__) parser.add_argument( '--pch', '--policy-constants-header', dest='header_path', help='generate header file of policy constants', metavar='FILE') parser.add_argument( '--pcc', '--policy-constants-source', dest='source_path', help='generate source file of policy constants', metavar='FILE') parser.add_argument( '--cpp', '--cloud-policy-protobuf', dest='cloud_policy_proto_path', help='generate cloud policy protobuf file', metavar='FILE') parser.add_argument( '--cpfrp', '--cloud-policy-full-runtime-protobuf', dest='cloud_policy_full_runtime_proto_path', help='generate cloud policy full runtime protobuf', metavar='FILE') parser.add_argument( '--csp', '--chrome-settings-protobuf', dest='chrome_settings_proto_path', help='generate chrome settings protobuf file', metavar='FILE') parser.add_argument( '--policy-common-definitions-protobuf', dest='policy_common_definitions_proto_path', help='policy common definitions protobuf file path', metavar='FILE') parser.add_argument( '--policy-common-definitions-full-runtime-protobuf', dest='policy_common_definitions_full_runtime_proto_path', help='generate policy common definitions full runtime protobuf file', metavar='FILE') parser.add_argument( '--csfrp', '--chrome-settings-full-runtime-protobuf', dest='chrome_settings_full_runtime_proto_path', help='generate chrome settings full runtime protobuf', metavar='FILE') parser.add_argument( '--ard', '--app-restrictions-definition', dest='app_restrictions_path', help='generate an XML file as specified by ' 'Android\'s App Restriction Schema', metavar='FILE') parser.add_argument( '--rth', '--risk-tag-header', dest='risk_header_path', help='generate header file for policy risk tags', metavar='FILE') parser.add_argument( '--crospch', '--cros-policy-constants-header', dest='cros_constants_header_path', help='generate header file of policy constants for use in ' 'Chrome OS', metavar='FILE') parser.add_argument( '--crospcc', '--cros-policy-constants-source', dest='cros_constants_source_path', help='generate source file of policy constants for use in ' 'Chrome OS', metavar='FILE') parser.add_argument( '--chrome-version-file', dest='chrome_version_file', help='path to src/chrome/VERSION', metavar='FILE') parser.add_argument( '--all-chrome-versions', action='store_true', dest='all_chrome_versions', default=False, help='do not restrict generated policies by chrome version') parser.add_argument( '--target-platform', dest='target_platform', help='the platform the generated code should run on - can be one of' '(win, mac, linux, chromeos, fuchsia)', metavar='PLATFORM') parser.add_argument( '--policy-templates-file', dest='policy_templates_file', help='path to the policy_templates.json input file', metavar='FILE') args = parser.parse_args() has_arg_error = False if not args.target_platform: print('Error: Missing --target-platform=<platform>') has_arg_error = True if not args.policy_templates_file: print('Error: Missing' ' --policy-templates-file=<path to policy_templates.json>') has_arg_error = True if not args.chrome_version_file and not args.all_chrome_versions: print('Error: Missing' ' --chrome-version-file=<path to src/chrome/VERSION>\n' ' or --all-chrome-versions') has_arg_error = True if has_arg_error: print('') parser.print_help() return 2 version_path = args.chrome_version_file target_platform = args.target_platform template_file_name = args.policy_templates_file # --target-platform accepts "chromeos" as its input because that's what is # used within GN. Within policy templates, "chrome_os" is used instead. if target_platform == 'chromeos': target_platform = 'chrome_os' if args.all_chrome_versions: chrome_major_version = None else: chrome_major_version = ParseVersionFile(version_path) template_file_contents = _LoadJSONFile(template_file_name) risk_tags = RiskTags(template_file_contents) policy_details = [ PolicyDetails(policy, chrome_major_version, target_platform, risk_tags.GetValidTags()) for policy in template_file_contents['policy_definitions'] if policy['type'] != 'group' ] risk_tags.ComputeMaxTags(policy_details) sorted_policy_details = sorted(policy_details, key=lambda policy: policy.name) policy_details_set = list(map((lambda x: x.name), policy_details)) policies_already_in_group = set() policy_atomic_groups = [ PolicyAtomicGroup(group, policy_details_set, policies_already_in_group) for group in template_file_contents['policy_atomic_group_definitions'] ] sorted_policy_atomic_groups = sorted( policy_atomic_groups, key=lambda group: group.name) def GenerateFile(path, writer, sorted=False, xml=False): if path: with codecs.open(path, 'w', encoding='utf-8') as f: _OutputGeneratedWarningHeader(f, template_file_name, xml) writer(sorted and sorted_policy_details or policy_details, sorted and sorted_policy_atomic_groups or policy_atomic_groups, target_platform, f, risk_tags) if args.header_path: GenerateFile(args.header_path, _WritePolicyConstantHeader, sorted=True) if args.source_path: GenerateFile(args.source_path, _WritePolicyConstantSource, sorted=True) if args.risk_header_path: GenerateFile(args.risk_header_path, _WritePolicyRiskTagHeader) if args.cloud_policy_proto_path: GenerateFile(args.cloud_policy_proto_path, _WriteCloudPolicyProtobuf) if (args.policy_common_definitions_full_runtime_proto_path and args.policy_common_definitions_proto_path): GenerateFile( args.policy_common_definitions_full_runtime_proto_path, partial(_WritePolicyCommonDefinitionsFullRuntimeProtobuf, args.policy_common_definitions_proto_path)) if args.cloud_policy_full_runtime_proto_path: GenerateFile(args.cloud_policy_full_runtime_proto_path, _WriteCloudPolicyFullRuntimeProtobuf) if args.chrome_settings_proto_path: GenerateFile(args.chrome_settings_proto_path, _WriteChromeSettingsProtobuf) if args.chrome_settings_full_runtime_proto_path: GenerateFile(args.chrome_settings_full_runtime_proto_path, _WriteChromeSettingsFullRuntimeProtobuf) if target_platform == 'android' and args.app_restrictions_path: GenerateFile(args.app_restrictions_path, _WriteAppRestrictions, xml=True) # Generated code for Chrome OS (unused in Chromium). if args.cros_constants_header_path: GenerateFile( args.cros_constants_header_path, _WriteChromeOSPolicyConstantsHeader, sorted=True) if args.cros_constants_source_path: GenerateFile( args.cros_constants_source_path, _WriteChromeOSPolicyConstantsSource, sorted=True) return 0 #------------------ shared helpers ---------------------------------# def _OutputGeneratedWarningHeader(f, template_file_path, xml_style): left_margin = '//' if xml_style: left_margin = ' ' f.write('<?xml version="1.0" encoding="utf-8"?>\n' '<!--\n') else: f.write('//\n') f.write(left_margin + ' DO NOT MODIFY THIS FILE DIRECTLY!\n') f.write(left_margin + ' IT IS GENERATED BY generate_policy_source.py\n') f.write(left_margin + ' FROM ' + template_file_path + '\n') if xml_style: f.write('-->\n\n') else: f.write(left_margin + '\n\n') COMMENT_WRAPPER = textwrap.TextWrapper() COMMENT_WRAPPER.width = 80 COMMENT_WRAPPER.initial_indent = '// ' COMMENT_WRAPPER.subsequent_indent = '// ' COMMENT_WRAPPER.replace_whitespace = False # Writes a comment, each line prefixed by // and wrapped to 80 spaces. def _OutputComment(f, comment): for line in six.ensure_text(comment).splitlines(): if len(line) == 0: f.write('//') else: f.write(COMMENT_WRAPPER.fill(line)) f.write('\n') def _LoadJSONFile(json_file): with codecs.open(json_file, 'r', encoding='utf-8') as f: text = f.read() return ast.literal_eval(text) #------------------ policy constants header ------------------------# def _WritePolicyConstantHeader(policies, policy_atomic_groups, target_platform, f, risk_tags): f.write('''#ifndef COMPONENTS_POLICY_POLICY_CONSTANTS_H_ #define COMPONENTS_POLICY_POLICY_CONSTANTS_H_ #include <cstdint> #include <string> #include "components/policy/core/common/policy_details.h" #include "components/policy/core/common/policy_map.h" #include "components/policy/proto/cloud_policy.pb.h" namespace policy { namespace internal { struct SchemaData; } ''') if target_platform == 'win': f.write('// The windows registry path where Chrome policy ' 'configuration resides.\n' 'extern const wchar_t kRegistryChromePolicyKey[];\n') f.write('''#if defined(OS_CHROMEOS) // Sets default profile policies values for enterprise users. void SetEnterpriseUsersProfileDefaults(PolicyMap* policy_map); // Sets default system-wide policies values for enterprise users. void SetEnterpriseUsersSystemWideDefaults(PolicyMap* policy_map); // Sets all default values for enterprise users. void SetEnterpriseUsersDefaults(PolicyMap* policy_map); #endif // Returns the PolicyDetails for |policy| if |policy| is a known // Chrome policy, otherwise returns nullptr. const PolicyDetails* GetChromePolicyDetails( const std::string& policy); // Returns the schema data of the Chrome policy schema. const internal::SchemaData* GetChromeSchemaData(); ''') f.write('// Key names for the policy settings.\n' 'namespace key {\n\n') for policy in policies: # TODO(joaodasilva): Include only supported policies in # configuration_policy_handler.cc and configuration_policy_handler_list.cc # so that these names can be conditional on 'policy.is_supported'. # http://crbug.com/223616 f.write('extern const char k' + policy.name + '[];\n') f.write('\n} // namespace key\n\n') f.write('// Group names for the policy settings.\n' 'namespace group {\n\n') for group in policy_atomic_groups: f.write('extern const char k' + group.name + '[];\n') f.write('\n} // namespace group\n\n') f.write('struct AtomicGroup {\n' ' const short id;\n' ' const char* policy_group;\n' ' const char* const* policies;\n' '};\n\n') f.write('extern const AtomicGroup kPolicyAtomicGroupMappings[];\n\n') f.write('extern const size_t kPolicyAtomicGroupMappingsLength;\n\n') f.write('enum class StringPolicyType {\n' ' STRING,\n' ' JSON,\n' ' EXTERNAL,\n' '};\n\n') # User policy proto pointers, one struct for each protobuf type. protobuf_types = _GetProtobufTypes(policies) for protobuf_type in protobuf_types: _WriteChromePolicyAccessHeader(f, protobuf_type) f.write('constexpr int64_t kDevicePolicyExternalDataResourceCacheSize = %d;\n' % _ComputeTotalDevicePolicyExternalDataMaxSize(policies)) f.write('\n} // namespace policy\n\n' '#endif // COMPONENTS_POLICY_POLICY_CONSTANTS_H_\n') def _WriteChromePolicyAccessHeader(f, protobuf_type): f.write('// Read access to the protobufs of all supported %s user policies.\n' % protobuf_type.lower()) f.write('struct %sPolicyAccess {\n' % protobuf_type) f.write(' const char* policy_key;\n' ' bool per_profile;\n' ' bool (enterprise_management::CloudPolicySettings::' '*has_proto)() const;\n' ' const enterprise_management::%sPolicyProto&\n' ' (enterprise_management::CloudPolicySettings::' '*get_proto)() const;\n' % protobuf_type) if protobuf_type == 'String': f.write(' const StringPolicyType type;\n') f.write('};\n') f.write('extern const %sPolicyAccess k%sPolicyAccess[];\n\n' % (protobuf_type, protobuf_type)) def _ComputeTotalDevicePolicyExternalDataMaxSize(policies): total_device_policy_external_data_max_size = 0 for policy in policies: if policy.is_device_only and policy.policy_type == 'TYPE_EXTERNAL': total_device_policy_external_data_max_size += policy.max_size return total_device_policy_external_data_max_size #------------------ policy constants source ------------------------# SchemaNodeKey = namedtuple('SchemaNodeKey', 'schema_type extra is_sensitive_value') SchemaNode = namedtuple( 'SchemaNode', 'schema_type extra is_sensitive_value has_sensitive_children comments') PropertyNode = namedtuple('PropertyNode', 'key schema') PropertiesNode = namedtuple( 'PropertiesNode', 'begin end pattern_end required_begin required_end additional name') RestrictionNode = namedtuple('RestrictionNode', 'first second') # A mapping of the simple schema types to base::Value::Types. SIMPLE_SCHEMA_NAME_MAP = { 'boolean': 'Type::BOOLEAN', 'integer': 'Type::INTEGER', 'null': 'Type::NONE', 'number': 'Type::DOUBLE', 'string': 'Type::STRING', } INVALID_INDEX = -1 MIN_INDEX = -1 MAX_INDEX = (1 << 15) - 1 # signed short in c++ MIN_POLICY_ID = 0 MAX_POLICY_ID = (1 << 16) - 1 # unsigned short MIN_EXTERNAL_DATA_SIZE = 0 MAX_EXTERNAL_DATA_SIZE = (1 << 32) - 1 # unsigned int32 class SchemaNodesGenerator: """Builds the internal structs to represent a JSON schema.""" def __init__(self, shared_strings): """Creates a new generator. |shared_strings| is a map of strings to a C expression that evaluates to that string at runtime. This mapping can be used to reuse existing string constants.""" self.shared_strings = shared_strings self.key_index_map = {} # |SchemaNodeKey| -> index in |schema_nodes| self.schema_nodes = [] # List of |SchemaNode|s self.property_nodes = [] # List of |PropertyNode|s self.properties_nodes = [] # List of |PropertiesNode|s self.restriction_nodes = [] # List of |RestrictionNode|s self.required_properties = [] self.int_enums = [] self.string_enums = [] self.ranges = {} self.id_map = {} def GetString(self, s): if s in self.shared_strings: return self.shared_strings[s] # Generate JSON escaped string, which is slightly different from desired # C/C++ escaped string. Known differences includes unicode escaping format. return json.dumps(s) def AppendSchema(self, schema_type, extra, is_sensitive_value, comment=''): # Find existing schema node with same structure. key_node = SchemaNodeKey(schema_type, extra, is_sensitive_value) if key_node in self.key_index_map: index = self.key_index_map[key_node] if comment: self.schema_nodes[index].comments.add(comment) return index # Create new schema node. index = len(self.schema_nodes) comments = {comment} if comment else set() schema_node = SchemaNode(schema_type, extra, is_sensitive_value, False, comments) self.schema_nodes.append(schema_node) self.key_index_map[key_node] = index return index def AppendRestriction(self, first, second): r = RestrictionNode(str(first), str(second)) if not r in self.ranges: self.ranges[r] = len(self.restriction_nodes) self.restriction_nodes.append(r) return self.ranges[r] def GetSimpleType(self, name, is_sensitive_value): return self.AppendSchema(SIMPLE_SCHEMA_NAME_MAP[name], INVALID_INDEX, is_sensitive_value, 'simple type: ' + name) def SchemaHaveRestriction(self, schema): return any(keyword in schema for keyword in ['minimum', 'maximum', 'enum', 'pattern']) def IsConsecutiveInterval(self, seq): sortedSeq = sorted(seq) return all( sortedSeq[i] + 1 == sortedSeq[i + 1] for i in range(len(sortedSeq) - 1)) def GetEnumIntegerType(self, schema, is_sensitive_value, name): assert all(type(x) == int for x in schema['enum']) possible_values = schema['enum'] if self.IsConsecutiveInterval(possible_values): index = self.AppendRestriction(max(possible_values), min(possible_values)) return self.AppendSchema( 'Type::INTEGER', index, is_sensitive_value, 'integer with enumeration restriction (use range instead): %s' % name) offset_begin = len(self.int_enums) self.int_enums += possible_values offset_end = len(self.int_enums) return self.AppendSchema('Type::INTEGER', self.AppendRestriction(offset_begin, offset_end), is_sensitive_value, 'integer with enumeration restriction: %s' % name) def GetEnumStringType(self, schema, is_sensitive_value, name): assert all(type(x) == str for x in schema['enum']) offset_begin = len(self.string_enums) self.string_enums += schema['enum'] offset_end = len(self.string_enums) return self.AppendSchema('Type::STRING', self.AppendRestriction(offset_begin, offset_end), is_sensitive_value, 'string with enumeration restriction: %s' % name) def GetEnumType(self, schema, is_sensitive_value, name): if len(schema['enum']) == 0: raise RuntimeError('Empty enumeration in %s' % name) elif schema['type'] == 'integer': return self.GetEnumIntegerType(schema, is_sensitive_value, name) elif schema['type'] == 'string': return self.GetEnumStringType(schema, is_sensitive_value, name) else: raise RuntimeError('Unknown enumeration type in %s' % name) def GetPatternType(self, schema, is_sensitive_value, name): if schema['type'] != 'string': raise RuntimeError('Unknown pattern type in %s' % name) pattern = schema['pattern'] # Try to compile the pattern to validate it, note that the syntax used # here might be slightly different from re2. # TODO(binjin): Add a python wrapper of re2 and use it here. re.compile(pattern) index = len(self.string_enums) self.string_enums.append(pattern) return self.AppendSchema('Type::STRING', self.AppendRestriction( index, index), is_sensitive_value, 'string with pattern restriction: %s' % name) def GetRangedType(self, schema, is_sensitive_value, name): if schema['type'] != 'integer': raise RuntimeError('Unknown ranged type in %s' % name) min_value_set, max_value_set = False, False if 'minimum' in schema: min_value = int(schema['minimum']) min_value_set = True if 'maximum' in schema: max_value = int(schema['maximum']) max_value_set = True if min_value_set and max_value_set and min_value > max_value: raise RuntimeError('Invalid ranged type in %s' % name) index = self.AppendRestriction( str(max_value) if max_value_set else 'INT_MAX', str(min_value) if min_value_set else 'INT_MIN') return self.AppendSchema('Type::INTEGER', index, is_sensitive_value, 'integer with ranged restriction: %s' % name) def Generate(self, schema, name): """Generates the structs for the given schema. |schema|: a valid JSON schema in a dictionary. |name|: the name of the current node, for the generated comments.""" if '$ref' in schema: if 'id' in schema: raise RuntimeError("Schemas with a $ref can't have an id") if not isinstance(schema['$ref'], string_type): raise RuntimeError("$ref attribute must be a string") return schema['$ref'] is_sensitive_value = schema.get('sensitiveValue', False) assert type(is_sensitive_value) is bool if schema['type'] in SIMPLE_SCHEMA_NAME_MAP: if not self.SchemaHaveRestriction(schema): # Simple types use shared nodes. return self.GetSimpleType(schema['type'], is_sensitive_value) elif 'enum' in schema: return self.GetEnumType(schema, is_sensitive_value, name) elif 'pattern' in schema: return self.GetPatternType(schema, is_sensitive_value, name) else: return self.GetRangedType(schema, is_sensitive_value, name) if schema['type'] == 'array': return self.AppendSchema( 'Type::LIST', self.GenerateAndCollectID(schema['items'], 'items of ' + name), is_sensitive_value) elif schema['type'] == 'object': # Reserve an index first, so that dictionaries come before their # properties. This makes sure that the root node is the first in the # SchemaNodes array. # This however, prevents de-duplication for object schemas since we could # only determine duplicates after all child schema nodes are generated as # well and then we couldn't remove the newly created schema node without # invalidating all child schema indices. index = len(self.schema_nodes) self.schema_nodes.append( SchemaNode('Type::DICTIONARY', INVALID_INDEX, is_sensitive_value, False, {name})) if 'additionalProperties' in schema: additionalProperties = self.GenerateAndCollectID( schema['additionalProperties'], 'additionalProperties of ' + name) else: additionalProperties = INVALID_INDEX # Properties must be sorted by name, for the binary search lookup. # Note that |properties| must be evaluated immediately, so that all the # recursive calls to Generate() append the necessary child nodes; if # |properties| were a generator then this wouldn't work. sorted_properties = sorted(schema.get('properties', {}).items()) properties = [ PropertyNode( self.GetString(key), self.GenerateAndCollectID(subschema, key)) for key, subschema in sorted_properties ] pattern_properties = [] for pattern, subschema in schema.get('patternProperties', {}).items(): pattern_properties.append( PropertyNode( self.GetString(pattern), self.GenerateAndCollectID(subschema, pattern))) begin = len(self.property_nodes) self.property_nodes += properties end = len(self.property_nodes) self.property_nodes += pattern_properties pattern_end = len(self.property_nodes) if index == 0: self.root_properties_begin = begin self.root_properties_end = end required_begin = len(self.required_properties) required_properties = schema.get('required', []) assert type(required_properties) is list assert all(type(x) == str for x in required_properties) self.required_properties += required_properties required_end = len(self.required_properties) # Check that each string in |required_properties| is in |properties|. properties = schema.get('properties', {}) for name in required_properties: assert name in properties extra = len(self.properties_nodes) self.properties_nodes.append( PropertiesNode(begin, end, pattern_end, required_begin, required_end, additionalProperties, name)) # Update index at |extra| now, since that was filled with a dummy value # when the schema node was created. self.schema_nodes[index] = self.schema_nodes[index]._replace(extra=extra) return index else: assert False def GenerateAndCollectID(self, schema, name): """A wrapper of Generate(), will take the return value, check and add 'id' attribute to self.id_map. The wrapper needs to be used for every call to Generate(). """ index = self.Generate(schema, name) if 'id' not in schema: return index id_str = schema['id'] if id_str in self.id_map: raise RuntimeError('Duplicated id: ' + id_str) self.id_map[id_str] = index return index def Write(self, f): """Writes the generated structs to the given file. |f| an open file to write to.""" f.write('const internal::SchemaNode kSchemas[] = {\n' '// Type' + ' ' * 27 + 'Extra IsSensitiveValue HasSensitiveChildren\n') for schema_node in self.schema_nodes: assert schema_node.extra >= MIN_INDEX and schema_node.extra <= MAX_INDEX comment = ('\n' + ' ' * 69 + '// ').join(sorted(schema_node.comments)) f.write(' { base::Value::%-19s %4s %-16s %-5s }, // %s\n' % (schema_node.schema_type + ',', str(schema_node.extra) + ',', str(schema_node.is_sensitive_value).lower() + ',', str(schema_node.has_sensitive_children).lower(), comment)) f.write('};\n\n') if self.property_nodes: f.write('const internal::PropertyNode kPropertyNodes[] = {\n' '// Property' + ' ' * 61 + 'Schema\n') for property_node in self.property_nodes: f.write(' { %-64s %6d },\n' % (property_node.key + ',', property_node.schema)) f.write('};\n\n') if self.properties_nodes: f.write('const internal::PropertiesNode kProperties[] = {\n' '// Begin End PatternEnd RequiredBegin RequiredEnd' ' Additional Properties\n') for properties_node in self.properties_nodes: for i in range(0, len(properties_node) - 1): assert (properties_node[i] >= MIN_INDEX and properties_node[i] <= MAX_INDEX) f.write( ' { %5d, %5d, %5d, %5d, %10d, %5d }, // %s\n' % properties_node) f.write('};\n\n') if self.restriction_nodes: f.write('const internal::RestrictionNode kRestrictionNodes[] = {\n') f.write('// FIRST, SECOND\n') for restriction_node in self.restriction_nodes: f.write(' {{ %-8s %4s}},\n' % (restriction_node.first + ',', restriction_node.second)) f.write('};\n\n') if self.required_properties: f.write('const char* const kRequiredProperties[] = {\n') for required_property in self.required_properties: f.write(' %s,\n' % self.GetString(required_property)) f.write('};\n\n') if self.int_enums: f.write('const int kIntegerEnumerations[] = {\n') for possible_values in self.int_enums: f.write(' %d,\n' % possible_values) f.write('};\n\n') if self.string_enums: f.write('const char* const kStringEnumerations[] = {\n') for possible_values in self.string_enums: f.write(' %s,\n' % self.GetString(possible_values)) f.write('};\n\n') f.write('const internal::SchemaData* GetChromeSchemaData() {\n') f.write(' static const internal::SchemaData kChromeSchemaData = {\n' ' kSchemas,\n') f.write(' kPropertyNodes,\n' if self.property_nodes else ' nullptr,\n') f.write(' kProperties,\n' if self.properties_nodes else ' nullptr,\n') f.write(' kRestrictionNodes,\n' if self. restriction_nodes else ' nullptr,\n') f.write(' kRequiredProperties,\n' if self. required_properties else ' nullptr,\n') f.write(' kIntegerEnumerations,\n' if self.int_enums else ' nullptr,\n') f.write( ' kStringEnumerations,\n' if self.string_enums else ' nullptr,\n') f.write(' %d, // validation_schema root index\n' % self.validation_schema_root_index) f.write(' };\n\n') f.write(' return &kChromeSchemaData;\n' '}\n\n') def GetByID(self, id_str): if not isinstance(id_str, string_type): return id_str if id_str not in self.id_map: raise RuntimeError('Invalid $ref: ' + id_str) return self.id_map[id_str] def ResolveID(self, index, tuple_type, params): simple_tuple = params[:index] + (self.GetByID( params[index]),) + params[index + 1:] return tuple_type(*simple_tuple) def ResolveReferences(self): """Resolve reference mapping, required to be called after Generate() After calling Generate(), the type of indices used in schema structures might be either int or string. An int type suggests that it's a resolved index, but for string type it's unresolved. Resolving a reference is as simple as looking up for corresponding ID in self.id_map, and replace the old index with the mapped index. """ self.schema_nodes = list( map(partial(self.ResolveID, 1, SchemaNode), self.schema_nodes)) self.property_nodes = list( map(partial(self.ResolveID, 1, PropertyNode), self.property_nodes)) self.properties_nodes = list( map(partial(self.ResolveID, 3, PropertiesNode), self.properties_nodes)) def FindSensitiveChildren(self): """Wrapper function, which calls FindSensitiveChildrenRecursive(). """ if self.schema_nodes: self.FindSensitiveChildrenRecursive(0, set()) def FindSensitiveChildrenRecursive(self, index, handled_schema_nodes): """Recursively compute |has_sensitive_children| for the schema node at |index| and all its child elements. A schema has sensitive children if any of its children has |is_sensitive_value|==True or has sensitive children itself. """ node = self.schema_nodes[index] if index in handled_schema_nodes: return node.has_sensitive_children or node.is_sensitive_value handled_schema_nodes.add(index) has_sensitive_children = False if node.schema_type == 'Type::DICTIONARY': properties_node = self.properties_nodes[node.extra] # Iterate through properties and patternProperties. for property_index in range(properties_node.begin, properties_node.pattern_end - 1): sub_index = self.property_nodes[property_index].schema has_sensitive_children |= self.FindSensitiveChildrenRecursive( sub_index, handled_schema_nodes) # AdditionalProperties if properties_node.additional != INVALID_INDEX: sub_index = properties_node.additional has_sensitive_children |= self.FindSensitiveChildrenRecursive( sub_index, handled_schema_nodes) elif node.schema_type == 'Type::LIST': sub_index = node.extra has_sensitive_children |= self.FindSensitiveChildrenRecursive( sub_index, handled_schema_nodes) if has_sensitive_children: self.schema_nodes[index] = self.schema_nodes[index]._replace( has_sensitive_children=True) return has_sensitive_children or node.is_sensitive_value def _GenerateDefaultValue(value): """Converts a JSON object into a base::Value entry. Returns a tuple, the first entry being a list of declaration statements to define the variable, the second entry being a way to access the variable. If no definition is needed, the first return value will be an empty list. If any error occurs, the second return value will be None (ie, no way to fetch the value). |value|: The deserialized value to convert to base::Value.""" if type(value) == bool or type(value) == int: return [], 'base::Value(%s)' % json.dumps(value) elif type(value) == str: return [], 'base::Value("%s")' % value elif type(value) == list: setup = ['base::Value default_value(base::Value::Type::LIST);'] for entry in value: decl, fetch = _GenerateDefaultValue(entry) # Nested lists are not supported. if decl: return [], None setup.append('default_value.Append(%s);' % fetch) return setup, 'std::move(default_value)' return [], None def _WritePolicyConstantSource(policies, policy_atomic_groups, target_platform, f, risk_tags): f.write('''#include "components/policy/policy_constants.h" #include <algorithm> #include <climits> #include <memory> #include "base/check_op.h" #include "base/stl_util.h" // base::size() #include "base/values.h" #include "build/branding_buildflags.h" #include "components/policy/core/common/policy_types.h" #include "components/policy/core/common/schema_internal.h" #include "components/policy/proto/cloud_policy.pb.h" #include "components/policy/risk_tag.h" namespace em = enterprise_management; namespace policy { ''') # Generate the Chrome schema. chrome_schema = { 'type': 'object', 'properties': {}, } chrome_validation_schema = { 'type': 'object', 'properties': {}, } shared_strings = {} for policy in policies: shared_strings[policy.name] = "key::k%s" % policy.name if policy.is_supported: chrome_schema['properties'][policy.name] = policy.schema if policy.validation_schema is not None: (chrome_validation_schema['properties'][policy.name] ) = policy.validation_schema # Note: this list must be kept in sync with the known property list of the # Chrome schema, so that binary searching in the PropertyNode array gets the # right index on this array as well. See the implementation of # GetChromePolicyDetails() below. # TODO(crbug.com/1074336): kChromePolicyDetails shouldn't be declare if there # is no policy. f.write( '''const __attribute__((unused)) PolicyDetails kChromePolicyDetails[] = { // is_deprecated is_future is_device_policy id max_external_data_size, risk tags ''') for policy in policies: if policy.is_supported: assert policy.id >= MIN_POLICY_ID and policy.id <= MAX_POLICY_ID assert (policy.max_size >= MIN_EXTERNAL_DATA_SIZE and policy.max_size <= MAX_EXTERNAL_DATA_SIZE) f.write(' // %s\n' % policy.name) f.write(' { %-14s%-10s%-17s%4s,%22s, %s },\n' % ('true,' if policy.is_deprecated else 'false,', 'true,' if policy.is_future_on else 'false, ', 'true,' if policy.is_device_only else 'false,', policy.id, policy.max_size, risk_tags.ToInitString(policy.tags))) f.write('};\n\n') schema_generator = SchemaNodesGenerator(shared_strings) schema_generator.GenerateAndCollectID(chrome_schema, 'root node') if chrome_validation_schema['properties']: schema_generator.validation_schema_root_index = \ schema_generator.GenerateAndCollectID(chrome_validation_schema, 'validation_schema root node') else: schema_generator.validation_schema_root_index = INVALID_INDEX schema_generator.ResolveReferences() schema_generator.FindSensitiveChildren() schema_generator.Write(f) f.write('\n') if schema_generator.property_nodes: f.write('namespace {\n') f.write('bool CompareKeys(const internal::PropertyNode& node,\n' ' const std::string& key) {\n' ' return node.key < key;\n' '}\n\n') f.write('} // namespace\n\n') if target_platform == 'win': f.write('#if BUILDFLAG(GOOGLE_CHROME_BRANDING)\n' 'const wchar_t kRegistryChromePolicyKey[] = ' 'L"' + CHROME_POLICY_KEY + '";\n' '#else\n' 'const wchar_t kRegistryChromePolicyKey[] = ' 'L"' + CHROMIUM_POLICY_KEY + '";\n' '#endif\n\n') # Setting enterprise defaults code generation. profile_policy_enterprise_defaults = "" system_wide_policy_enterprise_defaults = "" for policy in policies: if policy.has_enterprise_default and policy.is_supported: declare_default_stmts, fetch_default = _GenerateDefaultValue( policy.enterprise_default) if not fetch_default: raise RuntimeError('Type %s of policy %s is not supported at ' 'enterprise defaults' % (policy.policy_type, policy.name)) # Convert declare_default_stmts to a string with the correct indentation. if declare_default_stmts: declare_default = ' %s\n' % '\n '.join(declare_default_stmts) else: declare_default = '' setting_enterprise_default = ''' if (!policy_map->Get(key::k%s)) { %s policy_map->Set(key::k%s, POLICY_LEVEL_MANDATORY, POLICY_SCOPE_USER, POLICY_SOURCE_ENTERPRISE_DEFAULT, %s, nullptr); } ''' % (policy.name, declare_default, policy.name, fetch_default) if policy.per_profile: profile_policy_enterprise_defaults += setting_enterprise_default else: system_wide_policy_enterprise_defaults += setting_enterprise_default f.write('#if defined(OS_CHROMEOS)') f.write(''' void SetEnterpriseUsersProfileDefaults(PolicyMap* policy_map) { %s } ''' % profile_policy_enterprise_defaults) f.write(''' void SetEnterpriseUsersSystemWideDefaults(PolicyMap* policy_map) { %s } ''' % system_wide_policy_enterprise_defaults) f.write(''' void SetEnterpriseUsersDefaults(PolicyMap* policy_map) { SetEnterpriseUsersProfileDefaults(policy_map); SetEnterpriseUsersSystemWideDefaults(policy_map); } ''') f.write('#endif\n\n') f.write('const PolicyDetails* GetChromePolicyDetails(' 'const std::string& policy) {\n') if schema_generator.property_nodes: f.write(' // First index in kPropertyNodes of the Chrome policies.\n' ' static const int begin_index = %s;\n' ' // One-past-the-end of the Chrome policies in kPropertyNodes.\n' ' static const int end_index = %s;\n' % (schema_generator.root_properties_begin, schema_generator.root_properties_end)) f.write(''' const internal::PropertyNode* begin = kPropertyNodes + begin_index; const internal::PropertyNode* end = kPropertyNodes + end_index; const internal::PropertyNode* it = std::lower_bound(begin, end, policy, CompareKeys); if (it == end || it->key != policy) return nullptr; // This relies on kPropertyNodes from begin_index to end_index // having exactly the same policies (and in the same order) as // kChromePolicyDetails, so that binary searching on the first // gets the same results as a binary search on the second would. // However, kPropertyNodes has the policy names and // kChromePolicyDetails doesn't, so we obtain the index into // the second array by searching the first to avoid duplicating // the policy name pointers. // Offsetting |it| from |begin| here obtains the index we're // looking for. size_t index = it - begin; CHECK_LT(index, base::size(kChromePolicyDetails)); return kChromePolicyDetails + index; ''') else: f.write('return nullptr;') f.write('}\n\n') f.write('namespace key {\n\n') for policy in policies: # TODO(joaodasilva): Include only supported policies in # configuration_policy_handler.cc and configuration_policy_handler_list.cc # so that these names can be conditional on 'policy.is_supported'. # http://crbug.com/223616 f.write('const char k{name}[] = "{name}";\n'.format(name=policy.name)) f.write('\n} // namespace key\n\n') f.write('namespace group {\n\n') for group in policy_atomic_groups: f.write('const char k{name}[] = "{name}";\n'.format(name=group.name)) f.write('\n') f.write('namespace {\n\n') for group in policy_atomic_groups: f.write('const char* const %s[] = {' % (group.name)) for policy in group.policies: f.write('key::k%s, ' % (policy)) f.write('nullptr};\n') f.write('\n} // namespace\n') f.write('\n} // namespace group\n\n') atomic_groups_length = 0 f.write('const AtomicGroup kPolicyAtomicGroupMappings[] = {\n') for group in policy_atomic_groups: atomic_groups_length += 1 f.write(' {') f.write(' {id}, group::k{name}, group::{name}'.format( id=group.id, name=group.name)) f.write(' },\n') f.write('};\n\n') f.write('const size_t kPolicyAtomicGroupMappingsLength = %s;\n\n' % (atomic_groups_length)) supported_user_policies = [ p for p in policies if p.is_supported and not p.is_device_only ] protobuf_types = _GetProtobufTypes(supported_user_policies) for protobuf_type in protobuf_types: _WriteChromePolicyAccessSource(supported_user_policies, f, protobuf_type) f.write('\n} // namespace policy\n') # Return the StringPolicyType enum value for a particular policy type. def _GetStringPolicyType(policy_type): if policy_type == 'Type::STRING': return 'StringPolicyType::STRING' elif policy_type == 'Type::DICTIONARY': return 'StringPolicyType::JSON' elif policy_type == 'TYPE_EXTERNAL': return 'StringPolicyType::EXTERNAL' raise RuntimeError('Invalid string type: ' + policy_type + '!\n') # Writes an array that contains the pointers to the proto field for each policy # in |policies| of the given |protobuf_type|. def _WriteChromePolicyAccessSource(policies, f, protobuf_type): f.write('const %sPolicyAccess k%sPolicyAccess[] = {\n' % (protobuf_type, protobuf_type)) extra_args = '' for policy in policies: if policy.policy_protobuf_type == protobuf_type: name = policy.name if protobuf_type == 'String': extra_args = ',\n ' + _GetStringPolicyType(policy.policy_type) f.write(' {key::k%s,\n' ' %s,\n' ' &em::CloudPolicySettings::has_%s,\n' ' &em::CloudPolicySettings::%s%s},\n' % (name, str(policy.per_profile).lower(), name.lower(), name.lower(), extra_args)) # The list is nullptr-terminated. f.write(' {nullptr, false, nullptr, nullptr},\n' '};\n\n') #------------------ policy risk tag header -------------------------# class RiskTags(object): '''Generates files and strings to translate the parsed risk tags.''' # TODO(fhorschig|tnagel): Add, Check & Generate translation descriptions. def __init__(self, template_file_contents): self.max_tags = None self.enum_for_tag = OrderedDict() # Ordered by severity as stated in JSON. self._ReadRiskTagMetaData(template_file_contents) def GenerateEnum(self): values = [' ' + self.enum_for_tag[tag] for tag in self.enum_for_tag] values.append(' RISK_TAG_COUNT') values.append(' RISK_TAG_NONE') enum_text = 'enum RiskTag : uint8_t {\n' enum_text += ',\n'.join(values) + '\n};\n' return enum_text def GetMaxTags(self): return str(self.max_tags) def GetValidTags(self): return [tag for tag in self.enum_for_tag] def ToInitString(self, tags): all_tags = [self._ToEnum(tag) for tag in tags] all_tags += ["RISK_TAG_NONE" for missing in range(len(tags), self.max_tags)] str_tags = "{ " + ", ".join(all_tags) + " }" return "\n ".join(textwrap.wrap(str_tags, 69)) def ComputeMaxTags(self, policies): self.max_tags = 0 for policy in policies: if not policy.is_supported or policy.tags == None: continue self.max_tags = max(len(policy.tags), self.max_tags) def _ToEnum(self, tag): if tag in self.enum_for_tag: return self.enum_for_tag[tag] raise RuntimeError('Invalid Tag:' + tag + '!\n' 'Chose a valid tag from \'risk_tag_definitions\' (a ' 'subproperty of root in policy_templates.json)!') def _ReadRiskTagMetaData(self, template_file_contents): for tag in template_file_contents['risk_tag_definitions']: if tag.get('name', None) == None: raise RuntimeError('Tag in \'risk_tag_definitions\' without ' 'description found!') if tag.get('description', None) == None: raise RuntimeError('Tag ' + tag['name'] + ' has no description!') if tag.get('user-description', None) == None: raise RuntimeError('Tag ' + tag['name'] + ' has no user-description!') self.enum_for_tag[tag['name']] = "RISK_TAG_" + tag['name'].replace( "-", "_").upper() def _WritePolicyRiskTagHeader(policies, policy_atomic_groups, target_platform, f, risk_tags): f.write('''#ifndef CHROME_COMMON_POLICY_RISK_TAG_H_ #define CHROME_COMMON_POLICY_RISK_TAG_H_ #include <stddef.h> namespace policy { // The tag of a policy indicates which impact a policy can have on // a user's privacy and/or security. Ordered descending by // impact. // The explanation of the single tags is stated in // policy_templates.json within the 'risk_tag_definitions' tag. ''') f.write(risk_tags.GenerateEnum() + '\n') f.write('// This constant describes how many risk tags were used by the\n' '// policy which uses the most risk tags.\n' 'const size_t kMaxRiskTagCount = ' + risk_tags.GetMaxTags() + ';\n' '\n' '} // namespace policy\n\n' '\n' '#endif // CHROME_COMMON_POLICY_RISK_TAG_H_') #------------------ policy protobufs -------------------------------# # This code applies to both Active Directory and Google cloud management. CHROME_SETTINGS_PROTO_HEAD = ''' syntax = "proto2"; option optimize_for = LITE_RUNTIME; package enterprise_management; // For StringList and PolicyOptions. import "policy_common_definitions.proto"; ''' CLOUD_POLICY_PROTO_HEAD = ''' syntax = "proto2"; option optimize_for = LITE_RUNTIME; package enterprise_management; import "policy_common_definitions.proto"; ''' # Field IDs [1..RESERVED_IDS] will not be used in the wrapping protobuf. RESERVED_IDS = 2 def _WritePolicyProto(f, policy, fields): _OutputComment(f, policy.caption + '\n\n' + policy.desc) if policy.items is not None: _OutputComment(f, '\nValid values:') for item in policy.items: _OutputComment(f, ' %s: %s' % (str(item.value), item.caption)) if policy.policy_type == 'Type::DICTIONARY': _OutputComment( f, '\nValue schema:\n%s' % json.dumps( policy.schema, sort_keys=True, indent=4, separators=(',', ': '))) _OutputComment( f, '\nSupported on: %s' % ', '.join(sorted(list(policy.platforms.union(policy.future_on))))) if policy.can_be_recommended and not policy.can_be_mandatory: _OutputComment( f, '\nNote: this policy must have a RECOMMENDED ' + 'PolicyMode set in PolicyOptions.') f.write('message %sProto {\n' % policy.name) f.write(' optional PolicyOptions policy_options = 1;\n') f.write(' optional %s %s = 2;\n' % (policy.protobuf_type, policy.name)) f.write('}\n\n') fields += [ ' optional %sProto %s = %s;\n' % (policy.name, policy.name, policy.id + RESERVED_IDS) ] def _WriteChromeSettingsProtobuf(policies, policy_atomic_groups, target_platform, f, risk_tags): f.write(CHROME_SETTINGS_PROTO_HEAD) fields = [] f.write('// PBs for individual settings.\n\n') for policy in policies: # Note: This protobuf also gets the unsupported policies, since it's an # exhaustive list of all the supported user policies on any platform. if not policy.is_device_only: _WritePolicyProto(f, policy, fields) f.write('// --------------------------------------------------\n' '// Big wrapper PB containing the above groups.\n\n' 'message ChromeSettingsProto {\n') f.write(''.join(fields)) f.write('}\n\n') def _WriteChromeSettingsFullRuntimeProtobuf(policies, policy_atomic_groups, target_platform, f, risk_tags): # For full runtime, disable LITE_RUNTIME switch and import full runtime # version of cloud_policy.proto. f.write( CHROME_SETTINGS_PROTO_HEAD.replace( "option optimize_for = LITE_RUNTIME;", "//option optimize_for = LITE_RUNTIME;").replace( "import \"cloud_policy.proto\";", "import \"cloud_policy_full_runtime.proto\";").replace( "import \"policy_common_definitions.proto\";", "import \"policy_common_definitions_full_runtime.proto\";")) fields = [] f.write('// PBs for individual settings.\n\n') for policy in policies: # Note: This protobuf also gets the unsupported policies, since it's an # exhaustive list of all the supported user policies on any platform. if not policy.is_device_only: _WritePolicyProto(f, policy, fields) f.write('// --------------------------------------------------\n' '// Big wrapper PB containing the above groups.\n\n' 'message ChromeSettingsProto {\n') f.write(''.join(fields)) f.write('}\n\n') def _WriteCloudPolicyProtobuf(policies, policy_atomic_groups, target_platform, f, risk_tags): f.write(CLOUD_POLICY_PROTO_HEAD) f.write('message CloudPolicySettings {\n') for policy in policies: if policy.is_supported and not policy.is_device_only: f.write( ' optional %sPolicyProto %s = %s;\n' % (policy.policy_protobuf_type, policy.name, policy.id + RESERVED_IDS)) f.write('}\n\n') def _WriteCloudPolicyFullRuntimeProtobuf(policies, policy_atomic_groups, target_platform, f, risk_tags): # For full runtime, disable LITE_RUNTIME switch f.write( CLOUD_POLICY_PROTO_HEAD.replace( "option optimize_for = LITE_RUNTIME;", "//option optimize_for = LITE_RUNTIME;").replace( "import \"policy_common_definitions.proto\";", "import \"policy_common_definitions_full_runtime.proto\";")) f.write('message CloudPolicySettings {\n') for policy in policies: if policy.is_supported and not policy.is_device_only: f.write( ' optional %sPolicyProto %s = %s;\n' % (policy.policy_protobuf_type, policy.name, policy.id + RESERVED_IDS)) f.write('}\n\n') def _WritePolicyCommonDefinitionsFullRuntimeProtobuf( policy_common_definitions_proto_path, policies, policy_atomic_groups, target_platform, f, risk_tags): # For full runtime, disable LITE_RUNTIME switch with open(policy_common_definitions_proto_path, 'r') as proto_file: policy_common_definitions_proto_code = proto_file.read() f.write( policy_common_definitions_proto_code.replace( "option optimize_for = LITE_RUNTIME;", "//option optimize_for = LITE_RUNTIME;")) #------------------ Chrome OS policy constants header --------------# # This code applies to Active Directory management only. # Filter for _GetSupportedChromeOSPolicies(). def _IsSupportedChromeOSPolicy(type, policy): # Filter out unsupported policies. if not policy.is_supported: return False # Filter out device policies if user policies are requested. if type == 'user' and policy.is_device_only: return False # Filter out user policies if device policies are requested. if type == 'device' and not policy.is_device_only: return False # Filter out non-Active-Directory policies. if 'active_directory' not in policy.supported_chrome_os_management: return False return True # Returns a list of supported user and/or device policies `by filtering # |policies|. |type| may be 'user', 'device' or 'both'. def _GetSupportedChromeOSPolicies(policies, type): if (type not in ['user', 'device', 'both']): raise RuntimeError('Unsupported type "%s"' % type) return filter(partial(_IsSupportedChromeOSPolicy, type), policies) # Returns the list of all policy.policy_protobuf_type strings from |policies|. def _GetProtobufTypes(policies): return sorted(['Integer', 'Boolean', 'String', 'StringList']) # Writes the definition of an array that contains the pointers to the mutable # proto field for each policy in |policies| of the given |protobuf_type|. def _WriteChromeOSPolicyAccessHeader(f, protobuf_type): f.write('// Access to the mutable protobuf function of all supported ' '%s user\n// policies.\n' % protobuf_type.lower()) f.write('struct %sPolicyAccess {\n' ' const char* policy_key;\n' ' bool per_profile;\n' ' enterprise_management::%sPolicyProto*\n' ' (enterprise_management::CloudPolicySettings::' '*mutable_proto_ptr)();\n' '};\n' % (protobuf_type, protobuf_type)) f.write('extern const %sPolicyAccess k%sPolicyAccess[];\n\n' % (protobuf_type, protobuf_type)) # Writes policy_constants.h for use in Chrome OS. def _WriteChromeOSPolicyConstantsHeader(policies, policy_atomic_groups, target_platform, f, risk_tags): f.write('#ifndef __BINDINGS_POLICY_CONSTANTS_H_\n' '#define __BINDINGS_POLICY_CONSTANTS_H_\n\n') # Forward declarations. supported_user_policies = _GetSupportedChromeOSPolicies(policies, 'user') protobuf_types = _GetProtobufTypes(supported_user_policies) f.write('namespace enterprise_management {\n' 'class CloudPolicySettings;\n') for protobuf_type in protobuf_types: f.write('class %sPolicyProto;\n' % protobuf_type) f.write('} // namespace enterprise_management\n\n') f.write('namespace policy {\n\n') # Policy keys. all_supported_policies = _GetSupportedChromeOSPolicies(policies, 'both') f.write('// Registry key names for user and device policies.\n' 'namespace key {\n\n') for policy in all_supported_policies: f.write('extern const char k' + policy.name + '[];\n') f.write('\n} // namespace key\n\n') # Device policy keys. f.write('// NULL-terminated list of device policy registry key names.\n') f.write('extern const char* kDevicePolicyKeys[];\n\n') # User policy proto pointers, one struct for each protobuf type. for protobuf_type in protobuf_types: _WriteChromeOSPolicyAccessHeader(f, protobuf_type) f.write('} // namespace policy\n\n' '#endif // __BINDINGS_POLICY_CONSTANTS_H_\n') #------------------ Chrome OS policy constants source --------------# # Writes an array that contains the pointers to the mutable proto field for each # policy in |policies| of the given |protobuf_type|. def _WriteChromeOSPolicyAccessSource(policies, f, protobuf_type): f.write('constexpr %sPolicyAccess k%sPolicyAccess[] = {\n' % (protobuf_type, protobuf_type)) for policy in policies: if policy.policy_protobuf_type == protobuf_type: f.write( ' {key::k%s,\n' ' %s,\n' ' &em::CloudPolicySettings::mutable_%s},\n' % (policy.name, str(policy.per_profile).lower(), policy.name.lower())) # The list is nullptr-terminated. f.write(' {nullptr, false, nullptr},\n' '};\n\n') # Writes policy_constants.cc for use in Chrome OS. def _WriteChromeOSPolicyConstantsSource(policies, policy_atomic_groups, target_platform, f, risk_tags): f.write('#include "bindings/cloud_policy.pb.h"\n' '#include "bindings/policy_constants.h"\n\n' 'namespace em = enterprise_management;\n\n' 'namespace policy {\n\n') # Policy keys. all_supported_policies = _GetSupportedChromeOSPolicies(policies, 'both') f.write('namespace key {\n\n') for policy in all_supported_policies: f.write('const char k{name}[] = "{name}";\n'.format(name=policy.name)) f.write('\n} // namespace key\n\n') # Device policy keys. supported_device_policies = _GetSupportedChromeOSPolicies(policies, 'device') f.write('const char* kDevicePolicyKeys[] = {\n\n') for policy in supported_device_policies: f.write(' key::k%s,\n' % policy.name) f.write(' nullptr};\n\n') # User policy proto pointers, one struct for each protobuf type. supported_user_policies = _GetSupportedChromeOSPolicies(policies, 'user') protobuf_types = _GetProtobufTypes(supported_user_policies) for protobuf_type in protobuf_types: _WriteChromeOSPolicyAccessSource(supported_user_policies, f, protobuf_type) f.write('} // namespace policy\n') #------------------ app restrictions -------------------------------# def _WriteAppRestrictions(policies, policy_atomic_groups, target_platform, f, risk_tags): def WriteRestrictionCommon(key): f.write(' <restriction\n' ' android:key="%s"\n' % key) f.write(' android:title="@string/%sTitle"\n' % key) f.write(' android:description="@string/%sDesc"\n' % key) def WriteItemsDefinition(key): f.write(' android:entries="@array/%sEntries"\n' % key) f.write(' android:entryValues="@array/%sValues"\n' % key) def WriteAppRestriction(policy): policy_name = policy.name WriteRestrictionCommon(policy_name) if policy.items is not None: WriteItemsDefinition(policy_name) f.write(' android:restrictionType="%s"/>' % policy.restriction_type) f.write('\n\n') # _WriteAppRestrictions body f.write('<restrictions xmlns:android="' 'http://schemas.android.com/apk/res/android">\n\n') for policy in policies: if (policy.is_supported and policy.restriction_type != 'invalid' and not policy.is_deprecated and not policy.is_future and not policy.internal_only): WriteAppRestriction(policy) f.write('</restrictions>') if __name__ == '__main__': sys.exit(main())
bsd-3-clause
ader1990/linux-kernel-3-13-5-scsi-fix
tools/perf/scripts/python/Perf-Trace-Util/lib/Perf/Trace/SchedGui.py
12980
5411
# SchedGui.py - Python extension for perf script, basic GUI code for # traces drawing and overview. # # Copyright (C) 2010 by Frederic Weisbecker <fweisbec@gmail.com> # # This software is distributed under the terms of the GNU General # Public License ("GPL") version 2 as published by the Free Software # Foundation. try: import wx except ImportError: raise ImportError, "You need to install the wxpython lib for this script" class RootFrame(wx.Frame): Y_OFFSET = 100 RECT_HEIGHT = 100 RECT_SPACE = 50 EVENT_MARKING_WIDTH = 5 def __init__(self, sched_tracer, title, parent = None, id = -1): wx.Frame.__init__(self, parent, id, title) (self.screen_width, self.screen_height) = wx.GetDisplaySize() self.screen_width -= 10 self.screen_height -= 10 self.zoom = 0.5 self.scroll_scale = 20 self.sched_tracer = sched_tracer self.sched_tracer.set_root_win(self) (self.ts_start, self.ts_end) = sched_tracer.interval() self.update_width_virtual() self.nr_rects = sched_tracer.nr_rectangles() + 1 self.height_virtual = RootFrame.Y_OFFSET + (self.nr_rects * (RootFrame.RECT_HEIGHT + RootFrame.RECT_SPACE)) # whole window panel self.panel = wx.Panel(self, size=(self.screen_width, self.screen_height)) # scrollable container self.scroll = wx.ScrolledWindow(self.panel) self.scroll.SetScrollbars(self.scroll_scale, self.scroll_scale, self.width_virtual / self.scroll_scale, self.height_virtual / self.scroll_scale) self.scroll.EnableScrolling(True, True) self.scroll.SetFocus() # scrollable drawing area self.scroll_panel = wx.Panel(self.scroll, size=(self.screen_width - 15, self.screen_height / 2)) self.scroll_panel.Bind(wx.EVT_PAINT, self.on_paint) self.scroll_panel.Bind(wx.EVT_KEY_DOWN, self.on_key_press) self.scroll_panel.Bind(wx.EVT_LEFT_DOWN, self.on_mouse_down) self.scroll.Bind(wx.EVT_PAINT, self.on_paint) self.scroll.Bind(wx.EVT_KEY_DOWN, self.on_key_press) self.scroll.Bind(wx.EVT_LEFT_DOWN, self.on_mouse_down) self.scroll.Fit() self.Fit() self.scroll_panel.SetDimensions(-1, -1, self.width_virtual, self.height_virtual, wx.SIZE_USE_EXISTING) self.txt = None self.Show(True) def us_to_px(self, val): return val / (10 ** 3) * self.zoom def px_to_us(self, val): return (val / self.zoom) * (10 ** 3) def scroll_start(self): (x, y) = self.scroll.GetViewStart() return (x * self.scroll_scale, y * self.scroll_scale) def scroll_start_us(self): (x, y) = self.scroll_start() return self.px_to_us(x) def paint_rectangle_zone(self, nr, color, top_color, start, end): offset_px = self.us_to_px(start - self.ts_start) width_px = self.us_to_px(end - self.ts_start) offset_py = RootFrame.Y_OFFSET + (nr * (RootFrame.RECT_HEIGHT + RootFrame.RECT_SPACE)) width_py = RootFrame.RECT_HEIGHT dc = self.dc if top_color is not None: (r, g, b) = top_color top_color = wx.Colour(r, g, b) brush = wx.Brush(top_color, wx.SOLID) dc.SetBrush(brush) dc.DrawRectangle(offset_px, offset_py, width_px, RootFrame.EVENT_MARKING_WIDTH) width_py -= RootFrame.EVENT_MARKING_WIDTH offset_py += RootFrame.EVENT_MARKING_WIDTH (r ,g, b) = color color = wx.Colour(r, g, b) brush = wx.Brush(color, wx.SOLID) dc.SetBrush(brush) dc.DrawRectangle(offset_px, offset_py, width_px, width_py) def update_rectangles(self, dc, start, end): start += self.ts_start end += self.ts_start self.sched_tracer.fill_zone(start, end) def on_paint(self, event): dc = wx.PaintDC(self.scroll_panel) self.dc = dc width = min(self.width_virtual, self.screen_width) (x, y) = self.scroll_start() start = self.px_to_us(x) end = self.px_to_us(x + width) self.update_rectangles(dc, start, end) def rect_from_ypixel(self, y): y -= RootFrame.Y_OFFSET rect = y / (RootFrame.RECT_HEIGHT + RootFrame.RECT_SPACE) height = y % (RootFrame.RECT_HEIGHT + RootFrame.RECT_SPACE) if rect < 0 or rect > self.nr_rects - 1 or height > RootFrame.RECT_HEIGHT: return -1 return rect def update_summary(self, txt): if self.txt: self.txt.Destroy() self.txt = wx.StaticText(self.panel, -1, txt, (0, (self.screen_height / 2) + 50)) def on_mouse_down(self, event): (x, y) = event.GetPositionTuple() rect = self.rect_from_ypixel(y) if rect == -1: return t = self.px_to_us(x) + self.ts_start self.sched_tracer.mouse_down(rect, t) def update_width_virtual(self): self.width_virtual = self.us_to_px(self.ts_end - self.ts_start) def __zoom(self, x): self.update_width_virtual() (xpos, ypos) = self.scroll.GetViewStart() xpos = self.us_to_px(x) / self.scroll_scale self.scroll.SetScrollbars(self.scroll_scale, self.scroll_scale, self.width_virtual / self.scroll_scale, self.height_virtual / self.scroll_scale, xpos, ypos) self.Refresh() def zoom_in(self): x = self.scroll_start_us() self.zoom *= 2 self.__zoom(x) def zoom_out(self): x = self.scroll_start_us() self.zoom /= 2 self.__zoom(x) def on_key_press(self, event): key = event.GetRawKeyCode() if key == ord("+"): self.zoom_in() return if key == ord("-"): self.zoom_out() return key = event.GetKeyCode() (x, y) = self.scroll.GetViewStart() if key == wx.WXK_RIGHT: self.scroll.Scroll(x + 1, y) elif key == wx.WXK_LEFT: self.scroll.Scroll(x - 1, y) elif key == wx.WXK_DOWN: self.scroll.Scroll(x, y + 1) elif key == wx.WXK_UP: self.scroll.Scroll(x, y - 1)
gpl-2.0
aferr/TimingCompartments
configs/topologies/BaseTopology.py
15
2949
# Copyright (c) 2012 Advanced Micro Devices, Inc. # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer; # redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution; # neither the name of the copyright holders nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. # # Authors: Jason Power import m5 class BaseTopology(object): description = "BaseTopology" def __init__(self): """ When overriding place any objects created in configs/ruby/<protocol>.py that are needed in makeTopology (below) here. The minimum is usually all of the controllers created in the above file. """ def makeTopology(self, options, IntLink, ExtLink, Router): """ Called from configs/ruby/Ruby.py The return value is ( list(Router), list(IntLink), list(ExtLink)) The API of this function cannot change when subclassing!! Any additional information needed to create this topology should be passed into the constructor when it's instantiated in configs/ruby/<protocol>.py """ m5.util.fatal("BaseTopology should have been overridden!!") class SimpleTopology(BaseTopology): """ Provides methods needed for the topologies included in Ruby before topology changes. These topologies are "simple" in the sense that they only use a flat list of controllers to construct the topology. """ description = "SimpleTopology" def __init__(self, controllers): self.nodes = controllers def addController(self, controller): self.nodes.append(controller) def __len__(self): return len(self.nodes)
bsd-3-clause
helloworldajou/webserver
demos/classifier_webcam.py
4
7059
#!/usr/bin/env python2 # # Example to run classifier on webcam stream. # Brandon Amos & Vijayenthiran # 2016/06/21 # # Copyright 2015-2016 Carnegie Mellon University # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # Contrib: Vijayenthiran # This example file shows to run a classifier on webcam stream. You need to # run the classifier.py to generate classifier with your own dataset. # To run this file from the openface home dir: # ./demo/classifier_webcam.py <path-to-your-classifier> import time start = time.time() import argparse import cv2 import os import pickle import sys import numpy as np np.set_printoptions(precision=2) from sklearn.mixture import GMM import openface fileDir = os.path.dirname(os.path.realpath(__file__)) modelDir = os.path.join(fileDir, '..', 'models') dlibModelDir = os.path.join(modelDir, 'dlib') openfaceModelDir = os.path.join(modelDir, 'openface') def getRep(bgrImg): start = time.time() if bgrImg is None: raise Exception("Unable to load image/frame") rgbImg = cv2.cvtColor(bgrImg, cv2.COLOR_BGR2RGB) if args.verbose: print(" + Original size: {}".format(rgbImg.shape)) if args.verbose: print("Loading the image took {} seconds.".format(time.time() - start)) start = time.time() # Get the largest face bounding box # bb = align.getLargestFaceBoundingBox(rgbImg) #Bounding box # Get all bounding boxes bb = align.getAllFaceBoundingBoxes(rgbImg) if bb is None: # raise Exception("Unable to find a face: {}".format(imgPath)) return None if args.verbose: print("Face detection took {} seconds.".format(time.time() - start)) start = time.time() alignedFaces = [] for box in bb: alignedFaces.append( align.align( args.imgDim, rgbImg, box, landmarkIndices=openface.AlignDlib.OUTER_EYES_AND_NOSE)) if alignedFaces is None: raise Exception("Unable to align the frame") if args.verbose: print("Alignment took {} seconds.".format(time.time() - start)) start = time.time() reps = [] for alignedFace in alignedFaces: reps.append(net.forward(alignedFace)) if args.verbose: print("Neural network forward pass took {} seconds.".format( time.time() - start)) # print (reps) return reps def infer(img, args): with open(args.classifierModel, 'r') as f: if sys.version_info[0] < 3: (le, clf) = pickle.load(f) # le - label and clf - classifer else: (le, clf) = pickle.load(f, encoding='latin1') # le - label and clf - classifer reps = getRep(img) persons = [] confidences = [] for rep in reps: try: rep = rep.reshape(1, -1) except: print ("No Face detected") return (None, None) start = time.time() predictions = clf.predict_proba(rep).ravel() # print (predictions) maxI = np.argmax(predictions) # max2 = np.argsort(predictions)[-3:][::-1][1] persons.append(le.inverse_transform(maxI)) # print (str(le.inverse_transform(max2)) + ": "+str( predictions [max2])) # ^ prints the second prediction confidences.append(predictions[maxI]) if args.verbose: print("Prediction took {} seconds.".format(time.time() - start)) pass # print("Predict {} with {:.2f} confidence.".format(person.decode('utf-8'), confidence)) if isinstance(clf, GMM): dist = np.linalg.norm(rep - clf.means_[maxI]) print(" + Distance from the mean: {}".format(dist)) pass return (persons, confidences) if __name__ == '__main__': parser = argparse.ArgumentParser() parser.add_argument( '--dlibFacePredictor', type=str, help="Path to dlib's face predictor.", default=os.path.join( dlibModelDir, "shape_predictor_68_face_landmarks.dat")) parser.add_argument( '--networkModel', type=str, help="Path to Torch network model.", default=os.path.join( openfaceModelDir, 'nn4.small2.v1.t7')) parser.add_argument('--imgDim', type=int, help="Default image dimension.", default=96) parser.add_argument( '--captureDevice', type=int, default=0, help='Capture device. 0 for latop webcam and 1 for usb webcam') parser.add_argument('--width', type=int, default=320) parser.add_argument('--height', type=int, default=240) parser.add_argument('--threshold', type=float, default=0.5) parser.add_argument('--cuda', action='store_true') parser.add_argument('--verbose', action='store_true') parser.add_argument( 'classifierModel', type=str, help='The Python pickle representing the classifier. This is NOT the Torch network model, which can be set with --networkModel.') args = parser.parse_args() align = openface.AlignDlib(args.dlibFacePredictor) net = openface.TorchNeuralNet( args.networkModel, imgDim=args.imgDim, cuda=args.cuda) # Capture device. Usually 0 will be webcam and 1 will be usb cam. video_capture = cv2.VideoCapture(args.captureDevice) video_capture.set(3, args.width) video_capture.set(4, args.height) confidenceList = [] while True: ret, frame = video_capture.read() persons, confidences = infer(frame, args) print ("P: " + str(persons) + " C: " + str(confidences)) try: # append with two floating point precision confidenceList.append('%.2f' % confidences[0]) except: # If there is no face detected, confidences matrix will be empty. # We can simply ignore it. pass for i, c in enumerate(confidences): if c <= args.threshold: # 0.5 is kept as threshold for known face. persons[i] = "_unknown" # Print the person name and conf value on the frame cv2.putText(frame, "P: {} C: {}".format(persons, confidences), (50, 50), cv2.FONT_HERSHEY_SIMPLEX, 0.5, (255, 255, 255), 1) cv2.imshow('', frame) # quit the program on the press of key 'q' if cv2.waitKey(1) & 0xFF == ord('q'): break # When everything is done, release the capture video_capture.release() cv2.destroyAllWindows()
apache-2.0
ibinti/intellij-community
python/helpers/pycharm/__jb.for_twisted/twisted/plugins/teamcity_plugin.py
11
1180
import sys from teamcity.unittestpy import TeamcityTestResult from twisted.trial.reporter import Reporter from twisted.python.failure import Failure from twisted.plugins.twisted_trial import _Reporter class FailureWrapper(Failure): def __getitem__(self, key): return self.value[key] class TeamcityReporter(TeamcityTestResult, Reporter): def __init__(self, stream=sys.stdout, tbformat='default', realtime=False, publisher=None): TeamcityTestResult.__init__(self) Reporter.__init__(self, stream=stream, tbformat=tbformat, realtime=realtime, publisher=publisher) def addError(self, test, failure, *k): super(TeamcityReporter, self).addError(test, FailureWrapper(failure), *k) Teamcity = _Reporter("Teamcity Reporter", "twisted.plugins.teamcity_plugin", description="teamcity messages", longOpt="teamcity", shortOpt="teamcity", klass="TeamcityReporter")
apache-2.0
Lujeni/ansible
lib/ansible/modules/network/nxos/nxos_vrf.py
5
17884
#!/usr/bin/python # # This file is part of Ansible # # Ansible is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Ansible is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with Ansible. If not, see <http://www.gnu.org/licenses/>. # ANSIBLE_METADATA = {'metadata_version': '1.1', 'status': ['preview'], 'supported_by': 'network'} DOCUMENTATION = ''' --- module: nxos_vrf extends_documentation_fragment: nxos version_added: "2.1" short_description: Manages global VRF configuration. description: - This module provides declarative management of VRFs on CISCO NXOS network devices. author: - Jason Edelman (@jedelman8) - Gabriele Gerbino (@GGabriele) - Trishna Guha (@trishnaguha) notes: - Tested against NXOSv 7.3.(0)D1(1) on VIRL - Cisco NX-OS creates the default VRF by itself. Therefore, you're not allowed to use default as I(vrf) name in this module. - C(vrf) name must be shorter than 32 chars. - VRF names are not case sensible in NX-OS. Anyway, the name is stored just like it's inserted by the user and it'll not be changed again unless the VRF is removed and re-created. i.e. C(vrf=NTC) will create a VRF named NTC, but running it again with C(vrf=ntc) will not cause a configuration change. options: name: description: - Name of VRF to be managed. required: true aliases: [vrf] admin_state: description: - Administrative state of the VRF. default: up choices: ['up','down'] vni: description: - Specify virtual network identifier. Valid values are Integer or keyword 'default'. version_added: "2.2" rd: description: - VPN Route Distinguisher (RD). Valid values are a string in one of the route-distinguisher formats (ASN2:NN, ASN4:NN, or IPV4:NN); the keyword 'auto', or the keyword 'default'. version_added: "2.2" interfaces: description: - List of interfaces to check the VRF has been configured correctly or keyword 'default'. version_added: 2.5 associated_interfaces: description: - This is a intent option and checks the operational state of the for given vrf C(name) for associated interfaces. If the value in the C(associated_interfaces) does not match with the operational state of vrf interfaces on device it will result in failure. version_added: "2.5" aggregate: description: List of VRFs definitions. version_added: 2.5 purge: description: - Purge VRFs not defined in the I(aggregate) parameter. type: bool default: 'no' version_added: 2.5 state: description: - Manages desired state of the resource. default: present choices: ['present','absent'] description: description: - Description of the VRF or keyword 'default'. delay: description: - Time in seconds to wait before checking for the operational state on remote device. This wait is applicable for operational state arguments. default: 10 ''' EXAMPLES = ''' - name: Ensure ntc VRF exists on switch nxos_vrf: name: ntc description: testing state: present - name: Aggregate definition of VRFs nxos_vrf: aggregate: - { name: test1, description: Testing, admin_state: down } - { name: test2, interfaces: Ethernet1/2 } - name: Aggregate definitions of VRFs with Purge nxos_vrf: aggregate: - { name: ntc1, description: purge test1 } - { name: ntc2, description: purge test2 } state: present purge: yes - name: Delete VRFs exist on switch nxos_vrf: aggregate: - { name: ntc1 } - { name: ntc2 } state: absent - name: Assign interfaces to VRF declaratively nxos_vrf: name: test1 interfaces: - Ethernet2/3 - Ethernet2/5 - name: Check interfaces assigned to VRF nxos_vrf: name: test1 associated_interfaces: - Ethernet2/3 - Ethernet2/5 - name: Ensure VRF is tagged with interface Ethernet2/5 only (Removes from Ethernet2/3) nxos_vrf: name: test1 interfaces: - Ethernet2/5 - name: Delete VRF nxos_vrf: name: ntc state: absent ''' RETURN = ''' commands: description: commands sent to the device returned: always type: list sample: - vrf context ntc - no shutdown - interface Ethernet1/2 - no switchport - vrf member test2 ''' import re import time from copy import deepcopy from ansible.module_utils.basic import AnsibleModule from ansible.module_utils.network.nxos.nxos import load_config, run_commands from ansible.module_utils.network.nxos.nxos import nxos_argument_spec, get_interface_type from ansible.module_utils.network.common.utils import remove_default_spec def search_obj_in_list(name, lst): for o in lst: if o['name'] == name: return o def execute_show_command(command, module): if 'show run' not in command: output = 'json' else: output = 'text' cmds = [{ 'command': command, 'output': output, }] body = run_commands(module, cmds) return body def get_existing_vrfs(module): objs = list() command = "show vrf all" try: body = execute_show_command(command, module)[0] except IndexError: return list() try: vrf_table = body['TABLE_vrf']['ROW_vrf'] except (TypeError, IndexError, KeyError): return list() if isinstance(vrf_table, list): for vrf in vrf_table: obj = {} obj['name'] = vrf['vrf_name'] objs.append(obj) elif isinstance(vrf_table, dict): obj = {} obj['name'] = vrf_table['vrf_name'] objs.append(obj) return objs def map_obj_to_commands(updates, module): commands = list() want, have = updates state = module.params['state'] purge = module.params['purge'] args = ('rd', 'description', 'vni') for w in want: name = w['name'] admin_state = w['admin_state'] vni = w['vni'] interfaces = w.get('interfaces') or [] state = w['state'] del w['state'] obj_in_have = search_obj_in_list(name, have) if state == 'absent' and obj_in_have: commands.append('no vrf context {0}'.format(name)) elif state == 'present': if not obj_in_have: commands.append('vrf context {0}'.format(name)) for item in args: candidate = w.get(item) if candidate and candidate != 'default': cmd = item + ' ' + str(candidate) commands.append(cmd) if admin_state == 'up': commands.append('no shutdown') elif admin_state == 'down': commands.append('shutdown') commands.append('exit') if interfaces and interfaces[0] != 'default': for i in interfaces: commands.append('interface {0}'.format(i)) if get_interface_type(i) in ('ethernet', 'portchannel'): commands.append('no switchport') commands.append('vrf member {0}'.format(name)) else: # If vni is already configured on vrf, unconfigure it first. if vni: if obj_in_have.get('vni') and vni != obj_in_have.get('vni'): commands.append('no vni {0}'.format(obj_in_have.get('vni'))) for item in args: candidate = w.get(item) if candidate == 'default': if obj_in_have.get(item): cmd = 'no ' + item + ' ' + obj_in_have.get(item) commands.append(cmd) elif candidate and candidate != obj_in_have.get(item): cmd = item + ' ' + str(candidate) commands.append(cmd) if admin_state and admin_state != obj_in_have.get('admin_state'): if admin_state == 'up': commands.append('no shutdown') elif admin_state == 'down': commands.append('shutdown') if commands: commands.insert(0, 'vrf context {0}'.format(name)) commands.append('exit') if interfaces and interfaces[0] != 'default': if not obj_in_have['interfaces']: for i in interfaces: commands.append('vrf context {0}'.format(name)) commands.append('exit') commands.append('interface {0}'.format(i)) if get_interface_type(i) in ('ethernet', 'portchannel'): commands.append('no switchport') commands.append('vrf member {0}'.format(name)) elif set(interfaces) != set(obj_in_have['interfaces']): missing_interfaces = list(set(interfaces) - set(obj_in_have['interfaces'])) for i in missing_interfaces: commands.append('vrf context {0}'.format(name)) commands.append('exit') commands.append('interface {0}'.format(i)) if get_interface_type(i) in ('ethernet', 'portchannel'): commands.append('no switchport') commands.append('vrf member {0}'.format(name)) superfluous_interfaces = list(set(obj_in_have['interfaces']) - set(interfaces)) for i in superfluous_interfaces: commands.append('vrf context {0}'.format(name)) commands.append('exit') commands.append('interface {0}'.format(i)) if get_interface_type(i) in ('ethernet', 'portchannel'): commands.append('no switchport') commands.append('no vrf member {0}'.format(name)) elif interfaces and interfaces[0] == 'default': if obj_in_have['interfaces']: for i in obj_in_have['interfaces']: commands.append('vrf context {0}'.format(name)) commands.append('exit') commands.append('interface {0}'.format(i)) if get_interface_type(i) in ('ethernet', 'portchannel'): commands.append('no switchport') commands.append('no vrf member {0}'.format(name)) if purge: existing = get_existing_vrfs(module) if existing: for h in existing: if h['name'] in ('default', 'management'): pass else: obj_in_want = search_obj_in_list(h['name'], want) if not obj_in_want: commands.append('no vrf context {0}'.format(h['name'])) return commands def validate_vrf(name, module): if name == 'default': module.fail_json(msg='cannot use default as name of a VRF') elif len(name) > 32: module.fail_json(msg='VRF name exceeded max length of 32', name=name) else: return name def map_params_to_obj(module): obj = [] aggregate = module.params.get('aggregate') if aggregate: for item in aggregate: for key in item: if item.get(key) is None: item[key] = module.params[key] d = item.copy() d['name'] = validate_vrf(d['name'], module) obj.append(d) else: obj.append({ 'name': validate_vrf(module.params['name'], module), 'description': module.params['description'], 'vni': module.params['vni'], 'rd': module.params['rd'], 'admin_state': module.params['admin_state'], 'state': module.params['state'], 'interfaces': module.params['interfaces'], 'associated_interfaces': module.params['associated_interfaces'] }) return obj def get_value(arg, config, module): extra_arg_regex = re.compile(r'(?:{0}\s)(?P<value>.*)$'.format(arg), re.M) value = '' if arg in config: value = extra_arg_regex.search(config).group('value') return value def map_config_to_obj(want, element_spec, module): objs = list() for w in want: obj = deepcopy(element_spec) del obj['delay'] del obj['state'] command = 'show vrf {0}'.format(w['name']) try: body = execute_show_command(command, module)[0] vrf_table = body['TABLE_vrf']['ROW_vrf'] except (TypeError, IndexError): return list() name = vrf_table['vrf_name'] obj['name'] = name obj['admin_state'] = vrf_table['vrf_state'].lower() command = 'show run all | section vrf.context.{0}'.format(name) body = execute_show_command(command, module)[0] extra_params = ['vni', 'rd', 'description'] for param in extra_params: obj[param] = get_value(param, body, module) obj['interfaces'] = [] command = 'show vrf {0} interface'.format(name) try: body = execute_show_command(command, module)[0] vrf_int = body['TABLE_if']['ROW_if'] except (TypeError, IndexError): vrf_int = None if vrf_int: if isinstance(vrf_int, list): for i in vrf_int: intf = i['if_name'] obj['interfaces'].append(intf) elif isinstance(vrf_int, dict): intf = vrf_int['if_name'] obj['interfaces'].append(intf) objs.append(obj) return objs def check_declarative_intent_params(want, module, element_spec, result): have = None is_delay = False for w in want: if w.get('associated_interfaces') is None: continue if result['changed'] and not is_delay: time.sleep(module.params['delay']) is_delay = True if have is None: have = map_config_to_obj(want, element_spec, module) for i in w['associated_interfaces']: obj_in_have = search_obj_in_list(w['name'], have) if obj_in_have: interfaces = obj_in_have.get('interfaces') if interfaces is not None and i not in interfaces: module.fail_json(msg="Interface %s not configured on vrf %s" % (i, w['name'])) def vrf_error_check(module, commands, responses): """Checks for VRF config errors and executes a retry in some circumstances. """ pattern = 'ERROR: Deletion of VRF .* in progress' if re.search(pattern, str(responses)): # Allow delay/retry for VRF changes time.sleep(15) responses = load_config(module, commands, opts={'catch_clierror': True}) if re.search(pattern, str(responses)): module.fail_json(msg='VRF config (and retry) failure: %s ' % responses) module.warn('VRF config delayed by VRF deletion - passed on retry') def main(): """ main entry point for module execution """ element_spec = dict( name=dict(type='str', aliases=['vrf']), description=dict(type='str'), vni=dict(type='str'), rd=dict(type='str'), admin_state=dict(type='str', default='up', choices=['up', 'down']), interfaces=dict(type='list'), associated_interfaces=dict(type='list'), delay=dict(type='int', default=10), state=dict(type='str', default='present', choices=['present', 'absent']), ) aggregate_spec = deepcopy(element_spec) # remove default in aggregate spec, to handle common arguments remove_default_spec(aggregate_spec) argument_spec = dict( aggregate=dict(type='list', elements='dict', options=aggregate_spec), purge=dict(type='bool', default=False), ) argument_spec.update(element_spec) argument_spec.update(nxos_argument_spec) required_one_of = [['name', 'aggregate']] mutually_exclusive = [['name', 'aggregate']] module = AnsibleModule(argument_spec=argument_spec, required_one_of=required_one_of, mutually_exclusive=mutually_exclusive, supports_check_mode=True) warnings = list() result = {'changed': False} if warnings: result['warnings'] = warnings want = map_params_to_obj(module) have = map_config_to_obj(want, element_spec, module) commands = map_obj_to_commands((want, have), module) result['commands'] = commands if commands and not module.check_mode: responses = load_config(module, commands, opts={'catch_clierror': True}) vrf_error_check(module, commands, responses) result['changed'] = True check_declarative_intent_params(want, module, element_spec, result) module.exit_json(**result) if __name__ == '__main__': main()
gpl-3.0
sonaht/ansible
lib/ansible/modules/cloud/amazon/ec2_metric_alarm.py
57
11596
#!/usr/bin/python # This file is part of Ansible # # Ansible is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Ansible is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with Ansible. If not, see <http://www.gnu.org/licenses/>. ANSIBLE_METADATA = {'metadata_version': '1.0', 'status': ['stableinterface'], 'supported_by': 'curated'} DOCUMENTATION = """ module: ec2_metric_alarm short_description: "Create/update or delete AWS Cloudwatch 'metric alarms'" description: - Can create or delete AWS metric alarms. - Metrics you wish to alarm on must already exist. version_added: "1.6" author: "Zacharie Eakin (@zeekin)" options: state: description: - register or deregister the alarm required: true choices: ['present', 'absent'] name: description: - Unique name for the alarm required: true metric: description: - Name of the monitored metric (e.g. CPUUtilization) - Metric must already exist required: false namespace: description: - Name of the appropriate namespace ('AWS/EC2', 'System/Linux', etc.), which determines the category it will appear under in cloudwatch required: false statistic: description: - Operation applied to the metric - Works in conjunction with period and evaluation_periods to determine the comparison value required: false choices: ['SampleCount','Average','Sum','Minimum','Maximum'] comparison: description: - Determines how the threshold value is compared required: false choices: ['<=','<','>','>='] threshold: description: - Sets the min/max bound for triggering the alarm required: false period: description: - The time (in seconds) between metric evaluations required: false evaluation_periods: description: - The number of times in which the metric is evaluated before final calculation required: false unit: description: - The threshold's unit of measurement required: false choices: - 'Seconds' - 'Microseconds' - 'Milliseconds' - 'Bytes' - 'Kilobytes' - 'Megabytes' - 'Gigabytes' - 'Terabytes' - 'Bits' - 'Kilobits' - 'Megabits' - 'Gigabits' - 'Terabits' - 'Percent' - 'Count' - 'Bytes/Second' - 'Kilobytes/Second' - 'Megabytes/Second' - 'Gigabytes/Second' - 'Terabytes/Second' - 'Bits/Second' - 'Kilobits/Second' - 'Megabits/Second' - 'Gigabits/Second' - 'Terabits/Second' - 'Count/Second' - 'None' description: description: - A longer description of the alarm required: false dimensions: description: - Describes to what the alarm is applied required: false alarm_actions: description: - A list of the names action(s) taken when the alarm is in the 'alarm' status required: false insufficient_data_actions: description: - A list of the names of action(s) to take when the alarm is in the 'insufficient_data' status required: false ok_actions: description: - A list of the names of action(s) to take when the alarm is in the 'ok' status required: false extends_documentation_fragment: - aws - ec2 """ EXAMPLES = ''' - name: create alarm ec2_metric_alarm: state: present region: ap-southeast-2 name: "cpu-low" metric: "CPUUtilization" namespace: "AWS/EC2" statistic: Average comparison: "<=" threshold: 5.0 period: 300 evaluation_periods: 3 unit: "Percent" description: "This will alarm when a bamboo slave's cpu usage average is lower than 5% for 15 minutes " dimensions: {'InstanceId':'i-XXX'} alarm_actions: ["action1","action2"] ''' try: import boto.ec2.cloudwatch from boto.ec2.cloudwatch import CloudWatchConnection, MetricAlarm from boto.exception import BotoServerError HAS_BOTO = True except ImportError: HAS_BOTO = False def create_metric_alarm(connection, module): name = module.params.get('name') metric = module.params.get('metric') namespace = module.params.get('namespace') statistic = module.params.get('statistic') comparison = module.params.get('comparison') threshold = module.params.get('threshold') period = module.params.get('period') evaluation_periods = module.params.get('evaluation_periods') unit = module.params.get('unit') description = module.params.get('description') dimensions = module.params.get('dimensions') alarm_actions = module.params.get('alarm_actions') insufficient_data_actions = module.params.get('insufficient_data_actions') ok_actions = module.params.get('ok_actions') alarms = connection.describe_alarms(alarm_names=[name]) if not alarms: alm = MetricAlarm( name=name, metric=metric, namespace=namespace, statistic=statistic, comparison=comparison, threshold=threshold, period=period, evaluation_periods=evaluation_periods, unit=unit, description=description, dimensions=dimensions, alarm_actions=alarm_actions, insufficient_data_actions=insufficient_data_actions, ok_actions=ok_actions ) try: connection.create_alarm(alm) changed = True alarms = connection.describe_alarms(alarm_names=[name]) except BotoServerError as e: module.fail_json(msg=str(e)) else: alarm = alarms[0] changed = False for attr in ('comparison','metric','namespace','statistic','threshold','period','evaluation_periods','unit','description'): if getattr(alarm, attr) != module.params.get(attr): changed = True setattr(alarm, attr, module.params.get(attr)) #this is to deal with a current bug where you cannot assign '<=>' to the comparator when modifying an existing alarm comparison = alarm.comparison comparisons = {'<=' : 'LessThanOrEqualToThreshold', '<' : 'LessThanThreshold', '>=' : 'GreaterThanOrEqualToThreshold', '>' : 'GreaterThanThreshold'} alarm.comparison = comparisons[comparison] dim1 = module.params.get('dimensions') dim2 = alarm.dimensions for keys in dim1: if not isinstance(dim1[keys], list): dim1[keys] = [dim1[keys]] if keys not in dim2 or dim1[keys] != dim2[keys]: changed=True setattr(alarm, 'dimensions', dim1) for attr in ('alarm_actions','insufficient_data_actions','ok_actions'): action = module.params.get(attr) or [] # Boto and/or ansible may provide same elements in lists but in different order. # Compare on sets since they do not need any order. if set(getattr(alarm, attr)) != set(action): changed = True setattr(alarm, attr, module.params.get(attr)) try: if changed: connection.create_alarm(alarm) except BotoServerError as e: module.fail_json(msg=str(e)) result = alarms[0] module.exit_json(changed=changed, name=result.name, actions_enabled=result.actions_enabled, alarm_actions=result.alarm_actions, alarm_arn=result.alarm_arn, comparison=result.comparison, description=result.description, dimensions=result.dimensions, evaluation_periods=result.evaluation_periods, insufficient_data_actions=result.insufficient_data_actions, last_updated=result.last_updated, metric=result.metric, namespace=result.namespace, ok_actions=result.ok_actions, period=result.period, state_reason=result.state_reason, state_value=result.state_value, statistic=result.statistic, threshold=result.threshold, unit=result.unit) def delete_metric_alarm(connection, module): name = module.params.get('name') alarms = connection.describe_alarms(alarm_names=[name]) if alarms: try: connection.delete_alarms([name]) module.exit_json(changed=True) except BotoServerError as e: module.fail_json(msg=str(e)) else: module.exit_json(changed=False) def main(): argument_spec = ec2_argument_spec() argument_spec.update( dict( name=dict(required=True, type='str'), metric=dict(type='str'), namespace=dict(type='str'), statistic=dict(type='str', choices=['SampleCount', 'Average', 'Sum', 'Minimum', 'Maximum']), comparison=dict(type='str', choices=['<=', '<', '>', '>=']), threshold=dict(type='float'), period=dict(type='int'), unit=dict(type='str', choices=['Seconds', 'Microseconds', 'Milliseconds', 'Bytes', 'Kilobytes', 'Megabytes', 'Gigabytes', 'Terabytes', 'Bits', 'Kilobits', 'Megabits', 'Gigabits', 'Terabits', 'Percent', 'Count', 'Bytes/Second', 'Kilobytes/Second', 'Megabytes/Second', 'Gigabytes/Second', 'Terabytes/Second', 'Bits/Second', 'Kilobits/Second', 'Megabits/Second', 'Gigabits/Second', 'Terabits/Second', 'Count/Second', 'None']), evaluation_periods=dict(type='int'), description=dict(type='str'), dimensions=dict(type='dict', default={}), alarm_actions=dict(type='list'), insufficient_data_actions=dict(type='list'), ok_actions=dict(type='list'), state=dict(default='present', choices=['present', 'absent']), ) ) module = AnsibleModule(argument_spec=argument_spec) if not HAS_BOTO: module.fail_json(msg='boto required for this module') state = module.params.get('state') region, ec2_url, aws_connect_params = get_aws_connection_info(module) if region: try: connection = connect_to_aws(boto.ec2.cloudwatch, region, **aws_connect_params) except (boto.exception.NoAuthHandlerFound, AnsibleAWSError) as e: module.fail_json(msg=str(e)) else: module.fail_json(msg="region must be specified") if state == 'present': create_metric_alarm(connection, module) elif state == 'absent': delete_metric_alarm(connection, module) from ansible.module_utils.basic import * from ansible.module_utils.ec2 import * if __name__ == '__main__': main()
gpl-3.0
murraymeehan/marsyas
scripts/Python/batch.py
7
1475
import os from glob import glob inputDirectory = "../../../../Databases/taslp/"; outputDirectory = "../../../output3 "; testCommand = " "; #testCommand = " -q 1 "; beginCommand = "../../bin/release/peakClustering "; beginCommand = "..\\..\\bin\\release\\peakClustering.exe "; endCommand = " -P -f -S 0 -r -k 2 -c 3 -N music -i 250_2500 -o "+outputDirectory; execStyle=[ #hwps "-T 1 -s 20 -t hoabfb ", "-T 10 -s 20 -t hoabfb ", "-T 1 -s 20 -t hoabfb -u ", "-T 10 -s 20 -t hoabfb -u ", #virtanen "-T 1 -s 20 -t voabfb ", "-T 10 -s 20 -t voabfb ", "-T 1 -s 20 -t voabfb -u ", "-T 10 -s 20 -t voabfb -u ", #srinivasan criterion "-T 1 -s 20 -t soabfb ", "-T 10 -s 20 -t soabfb ", "-T 1 -s 20 -t soabfb -u ", "-T 10 -s 20 -t soabfb -u ", # amplitude only "-T 1 -s 20 -t abfb ", "-T 1 -s 20 -t abfb -u ", # harmonicity only "-T 1 -s 20 -t ho ", "-T 1 -s 20 -t ho -u ", "-T 1 -s 20 -t vo ", "-T 1 -s 20 -t vo -u ", "-T 1 -s 20 -t so ", "-T 1 -s 20 -t so -u ", # srinivasan algo " -s 1024 -npp -u -T 1 -t soabfb ", "-s 1024 -npp -u -T 10 -t soabfb "]; for style in execStyle: for name in glob(inputDirectory+"*V*.wav"): command = beginCommand+style+testCommand+endCommand+name print command os.system(command)
gpl-2.0
sathiamour/foursquared
util/oget.py
262
3416
#!/usr/bin/python """ Pull a oAuth protected page from foursquare. Expects ~/.oget to contain (one on each line): CONSUMER_KEY CONSUMER_KEY_SECRET USERNAME PASSWORD Don't forget to chmod 600 the file! """ import httplib import os import re import sys import urllib import urllib2 import urlparse import user from xml.dom import pulldom from xml.dom import minidom import oauth """From: http://groups.google.com/group/foursquare-api/web/oauth @consumer = OAuth::Consumer.new("consumer_token","consumer_secret", { :site => "http://foursquare.com", :scheme => :header, :http_method => :post, :request_token_path => "/oauth/request_token", :access_token_path => "/oauth/access_token", :authorize_path => "/oauth/authorize" }) """ SERVER = 'api.foursquare.com:80' CONTENT_TYPE_HEADER = {'Content-Type' :'application/x-www-form-urlencoded'} SIGNATURE_METHOD = oauth.OAuthSignatureMethod_HMAC_SHA1() AUTHEXCHANGE_URL = 'http://api.foursquare.com/v1/authexchange' def parse_auth_response(auth_response): return ( re.search('<oauth_token>(.*)</oauth_token>', auth_response).groups()[0], re.search('<oauth_token_secret>(.*)</oauth_token_secret>', auth_response).groups()[0] ) def create_signed_oauth_request(username, password, consumer): oauth_request = oauth.OAuthRequest.from_consumer_and_token( consumer, http_method='POST', http_url=AUTHEXCHANGE_URL, parameters=dict(fs_username=username, fs_password=password)) oauth_request.sign_request(SIGNATURE_METHOD, consumer, None) return oauth_request def main(): url = urlparse.urlparse(sys.argv[1]) # Nevermind that the query can have repeated keys. parameters = dict(urlparse.parse_qsl(url.query)) password_file = open(os.path.join(user.home, '.oget')) lines = [line.strip() for line in password_file.readlines()] if len(lines) == 4: cons_key, cons_key_secret, username, password = lines access_token = None else: cons_key, cons_key_secret, username, password, token, secret = lines access_token = oauth.OAuthToken(token, secret) consumer = oauth.OAuthConsumer(cons_key, cons_key_secret) if not access_token: oauth_request = create_signed_oauth_request(username, password, consumer) connection = httplib.HTTPConnection(SERVER) headers = {'Content-Type' :'application/x-www-form-urlencoded'} connection.request(oauth_request.http_method, AUTHEXCHANGE_URL, body=oauth_request.to_postdata(), headers=headers) auth_response = connection.getresponse().read() token = parse_auth_response(auth_response) access_token = oauth.OAuthToken(*token) open(os.path.join(user.home, '.oget'), 'w').write('\n'.join(( cons_key, cons_key_secret, username, password, token[0], token[1]))) oauth_request = oauth.OAuthRequest.from_consumer_and_token(consumer, access_token, http_method='POST', http_url=url.geturl(), parameters=parameters) oauth_request.sign_request(SIGNATURE_METHOD, consumer, access_token) connection = httplib.HTTPConnection(SERVER) connection.request(oauth_request.http_method, oauth_request.to_url(), body=oauth_request.to_postdata(), headers=CONTENT_TYPE_HEADER) print connection.getresponse().read() #print minidom.parse(connection.getresponse()).toprettyxml(indent=' ') if __name__ == '__main__': main()
apache-2.0
dmarteau/QGIS
python/plugins/db_manager/db_plugins/gpkg/sql_dictionary.py
71
1200
# -*- coding: utf-8 -*- """ *************************************************************************** sql_dictionary.py --------------------- Date : April 2012 Copyright : (C) 2012 by Giuseppe Sucameli Email : brush dot tyler at gmail dot com *************************************************************************** * * * This program is free software; you can redistribute it and/or modify * * it under the terms of the GNU General Public License as published by * * the Free Software Foundation; either version 2 of the License, or * * (at your option) any later version. * * * *************************************************************************** """ def getSqlDictionary(spatial=True): from ..spatialite.sql_dictionary import getSqlDictionary return getSqlDictionary(spatial) def getQueryBuilderDictionary(): from ..spatialite.sql_dictionary import getQueryBuilderDictionary return getQueryBuilderDictionary()
gpl-2.0
smourph/PGo-TrainerTools
pgoapi/protos/POGOProtos/Networking/Responses/GetIncensePokemonResponse_pb2.py
12
6521
# Generated by the protocol buffer compiler. DO NOT EDIT! # source: POGOProtos/Networking/Responses/GetIncensePokemonResponse.proto import sys _b=sys.version_info[0]<3 and (lambda x:x) or (lambda x:x.encode('latin1')) from google.protobuf import descriptor as _descriptor from google.protobuf import message as _message from google.protobuf import reflection as _reflection from google.protobuf import symbol_database as _symbol_database from google.protobuf import descriptor_pb2 # @@protoc_insertion_point(imports) _sym_db = _symbol_database.Default() from POGOProtos.Enums import PokemonId_pb2 as POGOProtos_dot_Enums_dot_PokemonId__pb2 DESCRIPTOR = _descriptor.FileDescriptor( name='POGOProtos/Networking/Responses/GetIncensePokemonResponse.proto', package='POGOProtos.Networking.Responses', syntax='proto3', serialized_pb=_b('\n?POGOProtos/Networking/Responses/GetIncensePokemonResponse.proto\x12\x1fPOGOProtos.Networking.Responses\x1a POGOProtos/Enums/PokemonId.proto\"\x85\x03\n\x19GetIncensePokemonResponse\x12Q\n\x06result\x18\x01 \x01(\x0e\x32\x41.POGOProtos.Networking.Responses.GetIncensePokemonResponse.Result\x12/\n\npokemon_id\x18\x02 \x01(\x0e\x32\x1b.POGOProtos.Enums.PokemonId\x12\x10\n\x08latitude\x18\x03 \x01(\x01\x12\x11\n\tlongitude\x18\x04 \x01(\x01\x12\x1a\n\x12\x65ncounter_location\x18\x05 \x01(\t\x12\x14\n\x0c\x65ncounter_id\x18\x06 \x01(\x06\x12\x1e\n\x16\x64isappear_timestamp_ms\x18\x07 \x01(\x03\"m\n\x06Result\x12\x1d\n\x19INCENSE_ENCOUNTER_UNKNOWN\x10\x00\x12\x1f\n\x1bINCENSE_ENCOUNTER_AVAILABLE\x10\x01\x12#\n\x1fINCENSE_ENCOUNTER_NOT_AVAILABLE\x10\x02\x62\x06proto3') , dependencies=[POGOProtos_dot_Enums_dot_PokemonId__pb2.DESCRIPTOR,]) _sym_db.RegisterFileDescriptor(DESCRIPTOR) _GETINCENSEPOKEMONRESPONSE_RESULT = _descriptor.EnumDescriptor( name='Result', full_name='POGOProtos.Networking.Responses.GetIncensePokemonResponse.Result', filename=None, file=DESCRIPTOR, values=[ _descriptor.EnumValueDescriptor( name='INCENSE_ENCOUNTER_UNKNOWN', index=0, number=0, options=None, type=None), _descriptor.EnumValueDescriptor( name='INCENSE_ENCOUNTER_AVAILABLE', index=1, number=1, options=None, type=None), _descriptor.EnumValueDescriptor( name='INCENSE_ENCOUNTER_NOT_AVAILABLE', index=2, number=2, options=None, type=None), ], containing_type=None, options=None, serialized_start=415, serialized_end=524, ) _sym_db.RegisterEnumDescriptor(_GETINCENSEPOKEMONRESPONSE_RESULT) _GETINCENSEPOKEMONRESPONSE = _descriptor.Descriptor( name='GetIncensePokemonResponse', full_name='POGOProtos.Networking.Responses.GetIncensePokemonResponse', filename=None, file=DESCRIPTOR, containing_type=None, fields=[ _descriptor.FieldDescriptor( name='result', full_name='POGOProtos.Networking.Responses.GetIncensePokemonResponse.result', index=0, number=1, type=14, cpp_type=8, label=1, has_default_value=False, default_value=0, message_type=None, enum_type=None, containing_type=None, is_extension=False, extension_scope=None, options=None), _descriptor.FieldDescriptor( name='pokemon_id', full_name='POGOProtos.Networking.Responses.GetIncensePokemonResponse.pokemon_id', index=1, number=2, type=14, cpp_type=8, label=1, has_default_value=False, default_value=0, message_type=None, enum_type=None, containing_type=None, is_extension=False, extension_scope=None, options=None), _descriptor.FieldDescriptor( name='latitude', full_name='POGOProtos.Networking.Responses.GetIncensePokemonResponse.latitude', index=2, number=3, type=1, cpp_type=5, label=1, has_default_value=False, default_value=float(0), message_type=None, enum_type=None, containing_type=None, is_extension=False, extension_scope=None, options=None), _descriptor.FieldDescriptor( name='longitude', full_name='POGOProtos.Networking.Responses.GetIncensePokemonResponse.longitude', index=3, number=4, type=1, cpp_type=5, label=1, has_default_value=False, default_value=float(0), message_type=None, enum_type=None, containing_type=None, is_extension=False, extension_scope=None, options=None), _descriptor.FieldDescriptor( name='encounter_location', full_name='POGOProtos.Networking.Responses.GetIncensePokemonResponse.encounter_location', index=4, number=5, type=9, cpp_type=9, label=1, has_default_value=False, default_value=_b("").decode('utf-8'), message_type=None, enum_type=None, containing_type=None, is_extension=False, extension_scope=None, options=None), _descriptor.FieldDescriptor( name='encounter_id', full_name='POGOProtos.Networking.Responses.GetIncensePokemonResponse.encounter_id', index=5, number=6, type=6, cpp_type=4, label=1, has_default_value=False, default_value=0, message_type=None, enum_type=None, containing_type=None, is_extension=False, extension_scope=None, options=None), _descriptor.FieldDescriptor( name='disappear_timestamp_ms', full_name='POGOProtos.Networking.Responses.GetIncensePokemonResponse.disappear_timestamp_ms', index=6, number=7, type=3, cpp_type=2, label=1, has_default_value=False, default_value=0, message_type=None, enum_type=None, containing_type=None, is_extension=False, extension_scope=None, options=None), ], extensions=[ ], nested_types=[], enum_types=[ _GETINCENSEPOKEMONRESPONSE_RESULT, ], options=None, is_extendable=False, syntax='proto3', extension_ranges=[], oneofs=[ ], serialized_start=135, serialized_end=524, ) _GETINCENSEPOKEMONRESPONSE.fields_by_name['result'].enum_type = _GETINCENSEPOKEMONRESPONSE_RESULT _GETINCENSEPOKEMONRESPONSE.fields_by_name['pokemon_id'].enum_type = POGOProtos_dot_Enums_dot_PokemonId__pb2._POKEMONID _GETINCENSEPOKEMONRESPONSE_RESULT.containing_type = _GETINCENSEPOKEMONRESPONSE DESCRIPTOR.message_types_by_name['GetIncensePokemonResponse'] = _GETINCENSEPOKEMONRESPONSE GetIncensePokemonResponse = _reflection.GeneratedProtocolMessageType('GetIncensePokemonResponse', (_message.Message,), dict( DESCRIPTOR = _GETINCENSEPOKEMONRESPONSE, __module__ = 'POGOProtos.Networking.Responses.GetIncensePokemonResponse_pb2' # @@protoc_insertion_point(class_scope:POGOProtos.Networking.Responses.GetIncensePokemonResponse) )) _sym_db.RegisterMessage(GetIncensePokemonResponse) # @@protoc_insertion_point(module_scope)
gpl-3.0
renegelinas/mi-instrument
mi/idk/platform/test/test_metadata.py
11
2605
#!/usr/bin/env python """ @package mi.idk.platform.test.test_metadata @file mi.idk/platform/test/test_metadata.py @author Bill French @brief test metadata object """ __author__ = 'Bill French' __license__ = 'Apache 2.0' from os.path import basename, dirname from os import makedirs from os.path import exists import sys from nose.plugins.attrib import attr from mock import Mock import unittest from mi.core.unit_test import MiUnitTest from mi.core.log import get_logger ; log = get_logger() from mi.idk.platform.metadata import Metadata from mi.idk.exceptions import InvalidParameters import os BASE_DIR = "/tmp" DRIVER_PATH = "test_driver/foo" METADATA_DIR = "/tmp/mi/platform/driver/test_driver/foo" METADATA_FILE = "metadata.yml" @attr('UNIT', group='mi') class TestMetadata(MiUnitTest): """ Test the metadata object """ def setUp(self): """ Setup the test case """ self.createMetadataFile() def createMetadataFile(self): """ """ self.addCleanup(self.removeMetadataFile) if(not exists(METADATA_DIR)): os.makedirs(METADATA_DIR) md_file = open("%s/%s" % (METADATA_DIR, METADATA_FILE), 'w') md_file.write("driver_metadata:\n") md_file.write(" author: Bill French\n") md_file.write(" driver_path: test_driver/foo\n") md_file.write(" driver_name: test_driver_foo\n") md_file.write(" email: wfrench@ucsd.edu\n") md_file.write(" release_notes: some note\n") md_file.write(" version: 0.2.2\n") md_file.close() def removeMetadataFile(self): filename = "%s/%s" % (METADATA_DIR, METADATA_FILE) if(exists(filename)): pass #os.unlink(filename) def test_constructor(self): """ Test object creation """ default_metadata = Metadata() self.assertTrue(default_metadata) specific_metadata = Metadata(DRIVER_PATH, BASE_DIR) self.assertTrue(specific_metadata) self.assertTrue(os.path.isfile(specific_metadata.metadata_path()), msg="file doesn't exist: %s" % specific_metadata.metadata_path()) self.assertEqual(specific_metadata.driver_path, "test_driver/foo") self.assertEqual(specific_metadata.driver_name, "test_driver_foo") self.assertEqual(specific_metadata.author, "Bill French") self.assertEqual(specific_metadata.email, "wfrench@ucsd.edu") self.assertEqual(specific_metadata.notes, "some note") self.assertEqual(specific_metadata.version, "0.2.2")
bsd-2-clause
pgoeser/gnuradio
gr-howto-write-a-block/apps/howto_square.py
36
2164
#!/usr/bin/env python ################################################## # Gnuradio Python Flow Graph # Title: Howto Square # Generated: Thu Nov 12 11:26:07 2009 ################################################## import howto from gnuradio import eng_notation from gnuradio import gr from gnuradio.eng_option import eng_option from gnuradio.gr import firdes from gnuradio.wxgui import scopesink2 from grc_gnuradio import wxgui as grc_wxgui from optparse import OptionParser import wx class howto_square(grc_wxgui.top_block_gui): def __init__(self): grc_wxgui.top_block_gui.__init__(self, title="Howto Square") ################################################## # Variables ################################################## self.samp_rate = samp_rate = 10e3 ################################################## # Blocks ################################################## self.sink = scopesink2.scope_sink_f( self.GetWin(), title="Input", sample_rate=samp_rate, v_scale=20, v_offset=0, t_scale=0.002, ac_couple=False, xy_mode=False, num_inputs=1, ) self.Add(self.sink.win) self.sink2 = scopesink2.scope_sink_f( self.GetWin(), title="Output", sample_rate=samp_rate, v_scale=0, v_offset=0, t_scale=0.002, ac_couple=False, xy_mode=False, num_inputs=1, ) self.Add(self.sink2.win) self.sqr = howto.square_ff() self.src = gr.vector_source_f(([float(n)-50 for n in range(100)]), True, 1) self.thr = gr.throttle(gr.sizeof_float*1, samp_rate) ################################################## # Connections ################################################## self.connect((self.thr, 0), (self.sqr, 0)) self.connect((self.src, 0), (self.thr, 0)) self.connect((self.thr, 0), (self.sink, 0)) self.connect((self.sqr, 0), (self.sink2, 0)) def set_samp_rate(self, samp_rate): self.samp_rate = samp_rate self.sink.set_sample_rate(self.samp_rate) self.sink2.set_sample_rate(self.samp_rate) if __name__ == '__main__': parser = OptionParser(option_class=eng_option, usage="%prog: [options]") (options, args) = parser.parse_args() tb = howto_square() tb.Run(True)
gpl-3.0
EricMuller/mynotes-backend
requirements/twisted/Twisted-17.1.0/src/twisted/test/test_paths.py
13
74412
# Copyright (c) Twisted Matrix Laboratories. # See LICENSE for details. """ Test cases covering L{twisted.python.filepath}. """ from __future__ import division, absolute_import import os, time, pickle, errno, stat from pprint import pformat from twisted.python.compat import _PY3, unicode from twisted.python.win32 import WindowsError, ERROR_DIRECTORY from twisted.python import filepath from twisted.python.runtime import platform from twisted.trial.unittest import SkipTest, SynchronousTestCase as TestCase from zope.interface.verify import verifyObject if not platform._supportsSymlinks(): symlinkSkip = "Platform does not support symlinks" else: symlinkSkip = None class BytesTestCase(TestCase): """ Override default method implementations to support byte paths. """ def mktemp(self): """ Return a temporary path, encoded as bytes. """ return TestCase.mktemp(self).encode("utf-8") class AbstractFilePathTests(BytesTestCase): """ Tests for L{IFilePath} implementations. """ f1content = b"file 1" f2content = b"file 2" def _mkpath(self, *p): x = os.path.abspath(os.path.join(self.cmn, *p)) self.all.append(x) return x def subdir(self, *dirname): os.mkdir(self._mkpath(*dirname)) def subfile(self, *dirname): return open(self._mkpath(*dirname), "wb") def setUp(self): self.now = time.time() cmn = self.cmn = os.path.abspath(self.mktemp()) self.all = [cmn] os.mkdir(cmn) self.subdir(b"sub1") with self.subfile(b"file1") as f: f.write(self.f1content) with self.subfile(b"sub1", b"file2") as f: f.write(self.f2content) self.subdir(b'sub3') self.subfile(b"sub3", b"file3.ext1").close() self.subfile(b"sub3", b"file3.ext2").close() self.subfile(b"sub3", b"file3.ext3").close() self.path = filepath.FilePath(cmn) self.root = filepath.FilePath(b"/") def test_verifyObject(self): """ Instances of the path type being tested provide L{IFilePath}. """ self.assertTrue(verifyObject(filepath.IFilePath, self.path)) def test_segmentsFromPositive(self): """ Verify that the segments between two paths are correctly identified. """ self.assertEqual( self.path.child(b"a").child(b"b").child(b"c").segmentsFrom(self.path), [b"a", b"b", b"c"]) def test_segmentsFromNegative(self): """ Verify that segmentsFrom notices when the ancestor isn't an ancestor. """ self.assertRaises( ValueError, self.path.child(b"a").child(b"b").child(b"c").segmentsFrom, self.path.child(b"d").child(b"c").child(b"e")) def test_walk(self): """ Verify that walking the path gives the same result as the known file hierarchy. """ x = [foo.path for foo in self.path.walk()] self.assertEqual(set(x), set(self.all)) def test_parents(self): """ L{FilePath.parents()} should return an iterator of every ancestor of the L{FilePath} in question. """ L = [] pathobj = self.path.child(b"a").child(b"b").child(b"c") fullpath = pathobj.path lastpath = fullpath thispath = os.path.dirname(fullpath) while lastpath != self.root.path: L.append(thispath) lastpath = thispath thispath = os.path.dirname(thispath) self.assertEqual([x.path for x in pathobj.parents()], L) def test_validSubdir(self): """ Verify that a valid subdirectory will show up as a directory, but not as a file, not as a symlink, and be listable. """ sub1 = self.path.child(b'sub1') self.assertTrue(sub1.exists(), "This directory does exist.") self.assertTrue(sub1.isdir(), "It's a directory.") self.assertFalse(sub1.isfile(), "It's a directory.") self.assertFalse(sub1.islink(), "It's a directory.") self.assertEqual(sub1.listdir(), [b'file2']) def test_invalidSubdir(self): """ Verify that a subdirectory that doesn't exist is reported as such. """ sub2 = self.path.child(b'sub2') self.assertFalse(sub2.exists(), "This directory does not exist.") def test_validFiles(self): """ Make sure that we can read existent non-empty files. """ f1 = self.path.child(b'file1') with f1.open() as f: self.assertEqual(f.read(), self.f1content) f2 = self.path.child(b'sub1').child(b'file2') with f2.open() as f: self.assertEqual(f.read(), self.f2content) def test_multipleChildSegments(self): """ C{fp.descendant([a, b, c])} returns the same L{FilePath} as is returned by C{fp.child(a).child(b).child(c)}. """ multiple = self.path.descendant([b'a', b'b', b'c']) single = self.path.child(b'a').child(b'b').child(b'c') self.assertEqual(multiple, single) def test_dictionaryKeys(self): """ Verify that path instances are usable as dictionary keys. """ f1 = self.path.child(b'file1') f1prime = self.path.child(b'file1') f2 = self.path.child(b'file2') dictoid = {} dictoid[f1] = 3 dictoid[f1prime] = 4 self.assertEqual(dictoid[f1], 4) self.assertEqual(list(dictoid.keys()), [f1]) self.assertIs(list(dictoid.keys())[0], f1) self.assertIsNot(list(dictoid.keys())[0], f1prime) # sanity check dictoid[f2] = 5 self.assertEqual(dictoid[f2], 5) self.assertEqual(len(dictoid), 2) def test_dictionaryKeyWithString(self): """ Verify that path instances are usable as dictionary keys which do not clash with their string counterparts. """ f1 = self.path.child(b'file1') dictoid = {f1: 'hello'} dictoid[f1.path] = 'goodbye' self.assertEqual(len(dictoid), 2) def test_childrenNonexistentError(self): """ Verify that children raises the appropriate exception for non-existent directories. """ self.assertRaises(filepath.UnlistableError, self.path.child(b'not real').children) def test_childrenNotDirectoryError(self): """ Verify that listdir raises the appropriate exception for attempting to list a file rather than a directory. """ self.assertRaises(filepath.UnlistableError, self.path.child(b'file1').children) def test_newTimesAreFloats(self): """ Verify that all times returned from the various new time functions are ints (and hopefully therefore 'high precision'). """ for p in self.path, self.path.child(b'file1'): self.assertEqual(type(p.getAccessTime()), float) self.assertEqual(type(p.getModificationTime()), float) self.assertEqual(type(p.getStatusChangeTime()), float) def test_oldTimesAreInts(self): """ Verify that all times returned from the various time functions are integers, for compatibility. """ for p in self.path, self.path.child(b'file1'): self.assertEqual(type(p.getatime()), int) self.assertEqual(type(p.getmtime()), int) self.assertEqual(type(p.getctime()), int) class FakeWindowsPath(filepath.FilePath): """ A test version of FilePath which overrides listdir to raise L{WindowsError}. """ def listdir(self): """ @raise WindowsError: always. """ if _PY3: # For Python 3.3 and higher, WindowsError is an alias for OSError. # The first argument to the OSError constructor is errno, and the fourth # argument is winerror. # For further details, refer to: # https://docs.python.org/3/library/exceptions.html#OSError # # On Windows, if winerror is set in the constructor, # the errno value in the constructor is ignored, and OSError internally # maps the winerror value to an errno value. raise WindowsError( None, "A directory's validness was called into question", self.path, ERROR_DIRECTORY) else: raise WindowsError( ERROR_DIRECTORY, "A directory's validness was called into question") class ListingCompatibilityTests(BytesTestCase): """ These tests verify compatibility with legacy behavior of directory listing. """ def test_windowsErrorExcept(self): """ Verify that when a WindowsError is raised from listdir, catching WindowsError works. """ fwp = FakeWindowsPath(self.mktemp()) self.assertRaises(filepath.UnlistableError, fwp.children) self.assertRaises(WindowsError, fwp.children) if not platform.isWindows(): test_windowsErrorExcept.skip = "Only relevant on on Windows." def test_alwaysCatchOSError(self): """ Verify that in the normal case where a directory does not exist, we will get an OSError. """ fp = filepath.FilePath(self.mktemp()) self.assertRaises(OSError, fp.children) def test_keepOriginalAttributes(self): """ Verify that the Unlistable exception raised will preserve the attributes of the previously-raised exception. """ fp = filepath.FilePath(self.mktemp()) ose = self.assertRaises(OSError, fp.children) d1 = list(ose.__dict__.keys()) d1.remove('originalException') d2 = list(ose.originalException.__dict__.keys()) d1.sort() d2.sort() self.assertEqual(d1, d2) class ExplodingFile: """ A C{file}-alike which raises exceptions from its I/O methods and keeps track of whether it has been closed. @ivar closed: A C{bool} which is C{False} until C{close} is called, then it is C{True}. """ closed = False def read(self, n=0): """ @raise IOError: Always raised. """ raise IOError() def write(self, what): """ @raise IOError: Always raised. """ raise IOError() def close(self): """ Mark the file as having been closed. """ self.closed = True def __enter__(self): return self def __exit__(self, exc_type, exc_value, traceback): self.close() class TrackingFilePath(filepath.FilePath): """ A subclass of L{filepath.FilePath} which maintains a list of all other paths created by clonePath. @ivar trackingList: A list of all paths created by this path via C{clonePath} (which also includes paths created by methods like C{parent}, C{sibling}, C{child}, etc (and all paths subsequently created by those paths, etc). @type trackingList: C{list} of L{TrackingFilePath} @ivar openedFiles: A list of all file objects opened by this L{TrackingFilePath} or any other L{TrackingFilePath} in C{trackingList}. @type openedFiles: C{list} of C{file} """ def __init__(self, path, alwaysCreate=False, trackingList=None): filepath.FilePath.__init__(self, path, alwaysCreate) if trackingList is None: trackingList = [] self.trackingList = trackingList self.openedFiles = [] def open(self, *a, **k): """ Override 'open' to track all files opened by this path. """ f = filepath.FilePath.open(self, *a, **k) self.openedFiles.append(f) return f def openedPaths(self): """ Return a list of all L{TrackingFilePath}s associated with this L{TrackingFilePath} that have had their C{open()} method called. """ return [path for path in self.trackingList if path.openedFiles] def clonePath(self, name): """ Override L{filepath.FilePath.clonePath} to give the new path a reference to the same tracking list. """ clone = TrackingFilePath(name, trackingList=self.trackingList) self.trackingList.append(clone) return clone class ExplodingFilePath(filepath.FilePath): """ A specialized L{FilePath} which always returns an instance of L{ExplodingFile} from its C{open} method. @ivar fp: The L{ExplodingFile} instance most recently returned from the C{open} method. """ def __init__(self, pathName, originalExploder=None): """ Initialize an L{ExplodingFilePath} with a name and a reference to the @param pathName: The path name as passed to L{filepath.FilePath}. @type pathName: C{str} @param originalExploder: The L{ExplodingFilePath} to associate opened files with. @type originalExploder: L{ExplodingFilePath} """ filepath.FilePath.__init__(self, pathName) if originalExploder is None: originalExploder = self self._originalExploder = originalExploder def open(self, mode=None): """ Create, save, and return a new C{ExplodingFile}. @param mode: Present for signature compatibility. Ignored. @return: A new C{ExplodingFile}. """ f = self._originalExploder.fp = ExplodingFile() return f def clonePath(self, name): return ExplodingFilePath(name, self._originalExploder) class PermissionsTests(BytesTestCase): """ Test Permissions and RWX classes """ def assertNotUnequal(self, first, second, msg=None): """ Tests that C{first} != C{second} is false. This method tests the __ne__ method, as opposed to L{assertEqual} (C{first} == C{second}), which tests the __eq__ method. Note: this should really be part of trial """ if first != second: if msg is None: msg = ''; if len(msg) > 0: msg += '\n' raise self.failureException( '%snot not unequal (__ne__ not implemented correctly):' '\na = %s\nb = %s\n' % (msg, pformat(first), pformat(second))) return first def test_rwxFromBools(self): """ L{RWX}'s constructor takes a set of booleans """ for r in (True, False): for w in (True, False): for x in (True, False): rwx = filepath.RWX(r, w, x) self.assertEqual(rwx.read, r) self.assertEqual(rwx.write, w) self.assertEqual(rwx.execute, x) rwx = filepath.RWX(True, True, True) self.assertTrue(rwx.read and rwx.write and rwx.execute) def test_rwxEqNe(self): """ L{RWX}'s created with the same booleans are equivalent. If booleans are different, they are not equal. """ for r in (True, False): for w in (True, False): for x in (True, False): self.assertEqual(filepath.RWX(r, w, x), filepath.RWX(r, w, x)) self.assertNotUnequal(filepath.RWX(r, w, x), filepath.RWX(r, w, x)) self.assertNotEqual(filepath.RWX(True, True, True), filepath.RWX(True, True, False)) self.assertNotEqual(3, filepath.RWX(True, True, True)) def test_rwxShorthand(self): """ L{RWX}'s shorthand string should be 'rwx' if read, write, and execute permission bits are true. If any of those permissions bits are false, the character is replaced by a '-'. """ def getChar(val, letter): if val: return letter return '-' for r in (True, False): for w in (True, False): for x in (True, False): rwx = filepath.RWX(r, w, x) self.assertEqual(rwx.shorthand(), getChar(r, 'r') + getChar(w, 'w') + getChar(x, 'x')) self.assertEqual(filepath.RWX(True, False, True).shorthand(), "r-x") def test_permissionsFromStat(self): """ L{Permissions}'s constructor takes a valid permissions bitmask and parsaes it to produce the correct set of boolean permissions. """ def _rwxFromStat(statModeInt, who): def getPermissionBit(what, who): return (statModeInt & getattr(stat, "S_I%s%s" % (what, who))) > 0 return filepath.RWX(*[getPermissionBit(what, who) for what in ('R', 'W', 'X')]) for u in range(0, 8): for g in range(0, 8): for o in range(0, 8): chmodString = "%d%d%d" % (u, g, o) chmodVal = int(chmodString, 8) perm = filepath.Permissions(chmodVal) self.assertEqual(perm.user, _rwxFromStat(chmodVal, "USR"), "%s: got user: %s" % (chmodString, perm.user)) self.assertEqual(perm.group, _rwxFromStat(chmodVal, "GRP"), "%s: got group: %s" % (chmodString, perm.group)) self.assertEqual(perm.other, _rwxFromStat(chmodVal, "OTH"), "%s: got other: %s" % (chmodString, perm.other)) perm = filepath.Permissions(0o777) for who in ("user", "group", "other"): for what in ("read", "write", "execute"): self.assertTrue(getattr(getattr(perm, who), what)) def test_permissionsEq(self): """ Two L{Permissions}'s that are created with the same bitmask are equivalent """ self.assertEqual(filepath.Permissions(0o777), filepath.Permissions(0o777)) self.assertNotUnequal(filepath.Permissions(0o777), filepath.Permissions(0o777)) self.assertNotEqual(filepath.Permissions(0o777), filepath.Permissions(0o700)) self.assertNotEqual(3, filepath.Permissions(0o777)) def test_permissionsShorthand(self): """ L{Permissions}'s shorthand string is the RWX shorthand string for its user permission bits, group permission bits, and other permission bits concatenated together, without a space. """ for u in range(0, 8): for g in range(0, 8): for o in range(0, 8): perm = filepath.Permissions(int("0o%d%d%d" % (u, g, o), 8)) self.assertEqual(perm.shorthand(), ''.join(x.shorthand() for x in ( perm.user, perm.group, perm.other))) self.assertEqual(filepath.Permissions(0o770).shorthand(), "rwxrwx---") class FilePathTests(AbstractFilePathTests): """ Test various L{FilePath} path manipulations. In particular, note that tests defined on this class instead of on the base class are only run against L{twisted.python.filepath}. """ def test_chmod(self): """ L{FilePath.chmod} modifies the permissions of the passed file as expected (using C{os.stat} to check). We use some basic modes that should work everywhere (even on Windows). """ for mode in (0o555, 0o777): self.path.child(b"sub1").chmod(mode) self.assertEqual( stat.S_IMODE(os.stat(self.path.child(b"sub1").path).st_mode), mode) def symlink(self, target, name): """ Create a symbolic link named C{name} pointing at C{target}. @type target: C{str} @type name: C{str} @raise SkipTest: raised if symbolic links are not supported on the host platform. """ if symlinkSkip: raise SkipTest(symlinkSkip) os.symlink(target, name) def createLinks(self): """ Create several symbolic links to files and directories. """ subdir = self.path.child(b"sub1") self.symlink(subdir.path, self._mkpath(b"sub1.link")) self.symlink(subdir.child(b"file2").path, self._mkpath(b"file2.link")) self.symlink(subdir.child(b"file2").path, self._mkpath(b"sub1", b"sub1.file2.link")) def test_realpathSymlink(self): """ L{FilePath.realpath} returns the path of the ultimate target of a symlink. """ self.createLinks() self.symlink(self.path.child(b"file2.link").path, self.path.child(b"link.link").path) self.assertEqual(self.path.child(b"link.link").realpath(), self.path.child(b"sub1").child(b"file2")) def test_realpathCyclicalSymlink(self): """ L{FilePath.realpath} raises L{filepath.LinkError} if the path is a symbolic link which is part of a cycle. """ self.symlink(self.path.child(b"link1").path, self.path.child(b"link2").path) self.symlink(self.path.child(b"link2").path, self.path.child(b"link1").path) self.assertRaises(filepath.LinkError, self.path.child(b"link2").realpath) def test_realpathNoSymlink(self): """ L{FilePath.realpath} returns the path itself if the path is not a symbolic link. """ self.assertEqual(self.path.child(b"sub1").realpath(), self.path.child(b"sub1")) def test_walkCyclicalSymlink(self): """ Verify that walking a path with a cyclical symlink raises an error """ self.createLinks() self.symlink(self.path.child(b"sub1").path, self.path.child(b"sub1").child(b"sub1.loopylink").path) def iterateOverPath(): return [foo.path for foo in self.path.walk()] self.assertRaises(filepath.LinkError, iterateOverPath) def test_walkObeysDescendWithCyclicalSymlinks(self): """ Verify that, after making a path with cyclical symlinks, when the supplied C{descend} predicate returns C{False}, the target is not traversed, as if it was a simple symlink. """ self.createLinks() # we create cyclical symlinks self.symlink(self.path.child(b"sub1").path, self.path.child(b"sub1").child(b"sub1.loopylink").path) def noSymLinks(path): return not path.islink() def iterateOverPath(): return [foo.path for foo in self.path.walk(descend=noSymLinks)] self.assertTrue(iterateOverPath()) def test_walkObeysDescend(self): """ Verify that when the supplied C{descend} predicate returns C{False}, the target is not traversed. """ self.createLinks() def noSymLinks(path): return not path.islink() x = [foo.path for foo in self.path.walk(descend=noSymLinks)] self.assertEqual(set(x), set(self.all)) def test_getAndSet(self): content = b'newcontent' self.path.child(b'new').setContent(content) newcontent = self.path.child(b'new').getContent() self.assertEqual(content, newcontent) content = b'content' self.path.child(b'new').setContent(content, b'.tmp') newcontent = self.path.child(b'new').getContent() self.assertEqual(content, newcontent) def test_getContentFileClosing(self): """ If reading from the underlying file raises an exception, L{FilePath.getContent} raises that exception after closing the file. """ fp = ExplodingFilePath(b"") self.assertRaises(IOError, fp.getContent) self.assertTrue(fp.fp.closed) def test_symbolicLink(self): """ Verify the behavior of the C{isLink} method against links and non-links. Also check that the symbolic link shares the directory property with its target. """ s4 = self.path.child(b"sub4") s3 = self.path.child(b"sub3") self.symlink(s3.path, s4.path) self.assertTrue(s4.islink()) self.assertFalse(s3.islink()) self.assertTrue(s4.isdir()) self.assertTrue(s3.isdir()) def test_linkTo(self): """ Verify that symlink creates a valid symlink that is both a link and a file if its target is a file, or a directory if its target is a directory. """ targetLinks = [ (self.path.child(b"sub2"), self.path.child(b"sub2.link")), (self.path.child(b"sub2").child(b"file3.ext1"), self.path.child(b"file3.ext1.link")) ] for target, link in targetLinks: target.linkTo(link) self.assertTrue(link.islink(), "This is a link") self.assertEqual(target.isdir(), link.isdir()) self.assertEqual(target.isfile(), link.isfile()) def test_linkToErrors(self): """ Verify C{linkTo} fails in the following case: - the target is in a directory that doesn't exist - the target already exists """ self.assertRaises(OSError, self.path.child(b"file1").linkTo, self.path.child(b'nosub').child(b'file1')) self.assertRaises(OSError, self.path.child(b"file1").linkTo, self.path.child(b'sub1').child(b'file2')) if symlinkSkip: test_symbolicLink.skip = symlinkSkip test_linkTo.skip = symlinkSkip test_linkToErrors.skip = symlinkSkip def testMultiExt(self): f3 = self.path.child(b'sub3').child(b'file3') exts = b'.foo', b'.bar', b'ext1', b'ext2', b'ext3' self.assertFalse(f3.siblingExtensionSearch(*exts)) f3e = f3.siblingExtension(b".foo") f3e.touch() self.assertFalse(not f3.siblingExtensionSearch(*exts).exists()) self.assertFalse(not f3.siblingExtensionSearch(b'*').exists()) f3e.remove() self.assertFalse(f3.siblingExtensionSearch(*exts)) def testPreauthChild(self): fp = filepath.FilePath(b'.') fp.preauthChild(b'foo/bar') self.assertRaises(filepath.InsecurePath, fp.child, u'/mon\u20acy') def testStatCache(self): p = self.path.child(b'stattest') p.touch() self.assertEqual(p.getsize(), 0) self.assertEqual(abs(p.getmtime() - time.time()) // 20, 0) self.assertEqual(abs(p.getctime() - time.time()) // 20, 0) self.assertEqual(abs(p.getatime() - time.time()) // 20, 0) self.assertTrue(p.exists()) self.assertTrue(p.exists()) # OOB removal: FilePath.remove() will automatically restat os.remove(p.path) # test caching self.assertTrue(p.exists()) p.restat(reraise=False) self.assertFalse(p.exists()) self.assertFalse(p.islink()) self.assertFalse(p.isdir()) self.assertFalse(p.isfile()) def testPersist(self): newpath = pickle.loads(pickle.dumps(self.path)) self.assertEqual(self.path.__class__, newpath.__class__) self.assertEqual(self.path.path, newpath.path) def testInsecureUNIX(self): self.assertRaises(filepath.InsecurePath, self.path.child, b"..") self.assertRaises(filepath.InsecurePath, self.path.child, b"/etc") self.assertRaises(filepath.InsecurePath, self.path.child, b"../..") def testInsecureWin32(self): self.assertRaises(filepath.InsecurePath, self.path.child, b"..\\..") self.assertRaises(filepath.InsecurePath, self.path.child, b"C:randomfile") if platform.getType() != 'win32': testInsecureWin32.skip = "Test will run only on Windows." def testInsecureWin32Whacky(self): """ Windows has 'special' filenames like NUL and CON and COM1 and LPR and PRN and ... god knows what else. They can be located anywhere in the filesystem. For obvious reasons, we do not wish to normally permit access to these. """ self.assertRaises(filepath.InsecurePath, self.path.child, b"CON") self.assertRaises(filepath.InsecurePath, self.path.child, b"C:CON") self.assertRaises(filepath.InsecurePath, self.path.child, r"C:\CON") if platform.getType() != 'win32': testInsecureWin32Whacky.skip = "Test will run only on Windows." def testComparison(self): self.assertEqual(filepath.FilePath(b'a'), filepath.FilePath(b'a')) self.assertTrue(filepath.FilePath(b'z') > filepath.FilePath(b'a')) self.assertTrue(filepath.FilePath(b'z') >= filepath.FilePath(b'a')) self.assertTrue(filepath.FilePath(b'a') >= filepath.FilePath(b'a')) self.assertTrue(filepath.FilePath(b'a') <= filepath.FilePath(b'a')) self.assertTrue(filepath.FilePath(b'a') < filepath.FilePath(b'z')) self.assertTrue(filepath.FilePath(b'a') <= filepath.FilePath(b'z')) self.assertTrue(filepath.FilePath(b'a') != filepath.FilePath(b'z')) self.assertTrue(filepath.FilePath(b'z') != filepath.FilePath(b'a')) self.assertFalse(filepath.FilePath(b'z') != filepath.FilePath(b'z')) def test_descendantOnly(self): """ If C{".."} is in the sequence passed to L{FilePath.descendant}, L{InsecurePath} is raised. """ self.assertRaises( filepath.InsecurePath, self.path.descendant, [u'mon\u20acy', u'..']) def testSibling(self): p = self.path.child(b'sibling_start') ts = p.sibling(b'sibling_test') self.assertEqual(ts.dirname(), p.dirname()) self.assertEqual(ts.basename(), b'sibling_test') ts.createDirectory() self.assertIn(ts, self.path.children()) def testTemporarySibling(self): ts = self.path.temporarySibling() self.assertEqual(ts.dirname(), self.path.dirname()) self.assertNotIn(ts.basename(), self.path.listdir()) ts.createDirectory() self.assertIn(ts, self.path.parent().children()) def test_temporarySiblingExtension(self): """ If L{FilePath.temporarySibling} is given an extension argument, it will produce path objects with that extension appended to their names. """ testExtension = b".test-extension" ts = self.path.temporarySibling(testExtension) self.assertTrue(ts.basename().endswith(testExtension), "%s does not end with %s" % ( ts.basename(), testExtension)) def test_removeDirectory(self): """ L{FilePath.remove} on a L{FilePath} that refers to a directory will recursively delete its contents. """ self.path.remove() self.assertFalse(self.path.exists()) def test_removeWithSymlink(self): """ For a path which is a symbolic link, L{FilePath.remove} just deletes the link, not the target. """ link = self.path.child(b"sub1.link") # setUp creates the sub1 child self.symlink(self.path.child(b"sub1").path, link.path) link.remove() self.assertFalse(link.exists()) self.assertTrue(self.path.child(b"sub1").exists()) def test_copyToDirectory(self): """ L{FilePath.copyTo} makes a copy of all the contents of the directory named by that L{FilePath} if it is able to do so. """ oldPaths = list(self.path.walk()) # Record initial state fp = filepath.FilePath(self.mktemp()) self.path.copyTo(fp) self.path.remove() fp.copyTo(self.path) newPaths = list(self.path.walk()) # Record double-copy state newPaths.sort() oldPaths.sort() self.assertEqual(newPaths, oldPaths) def test_copyToMissingDestFileClosing(self): """ If an exception is raised while L{FilePath.copyTo} is trying to open source file to read from, the destination file is closed and the exception is raised to the caller of L{FilePath.copyTo}. """ nosuch = self.path.child(b"nothere") # Make it look like something to copy, even though it doesn't exist. # This could happen if the file is deleted between the isfile check and # the file actually being opened. nosuch.isfile = lambda: True # We won't get as far as writing to this file, but it's still useful for # tracking whether we closed it. destination = ExplodingFilePath(self.mktemp()) self.assertRaises(IOError, nosuch.copyTo, destination) self.assertTrue(destination.fp.closed) def test_copyToFileClosing(self): """ If an exception is raised while L{FilePath.copyTo} is copying bytes between two regular files, the source and destination files are closed and the exception propagates to the caller of L{FilePath.copyTo}. """ destination = ExplodingFilePath(self.mktemp()) source = ExplodingFilePath(__file__) self.assertRaises(IOError, source.copyTo, destination) self.assertTrue(source.fp.closed) self.assertTrue(destination.fp.closed) def test_copyToDirectoryItself(self): """ L{FilePath.copyTo} fails with an OSError or IOError (depending on platform, as it propagates errors from open() and write()) when attempting to copy a directory to a child of itself. """ self.assertRaises((OSError, IOError), self.path.copyTo, self.path.child(b'file1')) def test_copyToWithSymlink(self): """ Verify that copying with followLinks=True copies symlink targets instead of symlinks """ self.symlink(self.path.child(b"sub1").path, self.path.child(b"link1").path) fp = filepath.FilePath(self.mktemp()) self.path.copyTo(fp) self.assertFalse(fp.child(b"link1").islink()) self.assertEqual([x.basename() for x in fp.child(b"sub1").children()], [x.basename() for x in fp.child(b"link1").children()]) def test_copyToWithoutSymlink(self): """ Verify that copying with followLinks=False copies symlinks as symlinks """ self.symlink(b"sub1", self.path.child(b"link1").path) fp = filepath.FilePath(self.mktemp()) self.path.copyTo(fp, followLinks=False) self.assertTrue(fp.child(b"link1").islink()) self.assertEqual(os.readlink(self.path.child(b"link1").path), os.readlink(fp.child(b"link1").path)) def test_copyToMissingSource(self): """ If the source path is missing, L{FilePath.copyTo} raises L{OSError}. """ path = filepath.FilePath(self.mktemp()) exc = self.assertRaises(OSError, path.copyTo, b'some other path') self.assertEqual(exc.errno, errno.ENOENT) def test_moveTo(self): """ Verify that moving an entire directory results into another directory with the same content. """ oldPaths = list(self.path.walk()) # Record initial state fp = filepath.FilePath(self.mktemp()) self.path.moveTo(fp) fp.moveTo(self.path) newPaths = list(self.path.walk()) # Record double-move state newPaths.sort() oldPaths.sort() self.assertEqual(newPaths, oldPaths) def test_moveToExistsCache(self): """ A L{FilePath} that has been moved aside with L{FilePath.moveTo} no longer registers as existing. Its previously non-existent target exists, though, as it was created by the call to C{moveTo}. """ fp = filepath.FilePath(self.mktemp()) fp2 = filepath.FilePath(self.mktemp()) fp.touch() # Both a sanity check (make sure the file status looks right) and an # enticement for stat-caching logic to kick in and remember that these # exist / don't exist. self.assertTrue(fp.exists()) self.assertFalse(fp2.exists()) fp.moveTo(fp2) self.assertFalse(fp.exists()) self.assertTrue(fp2.exists()) def test_moveToExistsCacheCrossMount(self): """ The assertion of test_moveToExistsCache should hold in the case of a cross-mount move. """ self.setUpFaultyRename() self.test_moveToExistsCache() def test_moveToSizeCache(self, hook=lambda : None): """ L{FilePath.moveTo} clears its destination's status cache, such that calls to L{FilePath.getsize} after the call to C{moveTo} will report the new size, not the old one. This is a separate test from C{test_moveToExistsCache} because it is intended to cover the fact that the destination's cache is dropped; test_moveToExistsCache doesn't cover this case because (currently) a file that doesn't exist yet does not cache the fact of its non- existence. """ fp = filepath.FilePath(self.mktemp()) fp2 = filepath.FilePath(self.mktemp()) fp.setContent(b"1234") fp2.setContent(b"1234567890") hook() # Sanity check / kick off caching. self.assertEqual(fp.getsize(), 4) self.assertEqual(fp2.getsize(), 10) # Actually attempting to replace a file on Windows would fail with # ERROR_ALREADY_EXISTS, but we don't need to test that, just the cached # metadata, so, delete the file ... os.remove(fp2.path) # ... but don't clear the status cache, as fp2.remove() would. self.assertEqual(fp2.getsize(), 10) fp.moveTo(fp2) self.assertEqual(fp2.getsize(), 4) def test_moveToSizeCacheCrossMount(self): """ The assertion of test_moveToSizeCache should hold in the case of a cross-mount move. """ self.test_moveToSizeCache(hook=self.setUpFaultyRename) def test_moveToError(self): """ Verify error behavior of moveTo: it should raises one of OSError or IOError if you want to move a path into one of its child. It's simply the error raised by the underlying rename system call. """ self.assertRaises((OSError, IOError), self.path.moveTo, self.path.child(b'file1')) def setUpFaultyRename(self): """ Set up a C{os.rename} that will fail with L{errno.EXDEV} on first call. This is used to simulate a cross-device rename failure. @return: a list of pair (src, dest) of calls to C{os.rename} @rtype: C{list} of C{tuple} """ invokedWith = [] def faultyRename(src, dest): invokedWith.append((src, dest)) if len(invokedWith) == 1: raise OSError(errno.EXDEV, 'Test-induced failure simulating ' 'cross-device rename failure') return originalRename(src, dest) originalRename = os.rename self.patch(os, "rename", faultyRename) return invokedWith def test_crossMountMoveTo(self): """ C{moveTo} should be able to handle C{EXDEV} error raised by C{os.rename} when trying to move a file on a different mounted filesystem. """ invokedWith = self.setUpFaultyRename() # Bit of a whitebox test - force os.rename, which moveTo tries # before falling back to a slower method, to fail, forcing moveTo to # use the slower behavior. self.test_moveTo() # A bit of a sanity check for this whitebox test - if our rename # was never invoked, the test has probably fallen into disrepair! self.assertTrue(invokedWith) def test_crossMountMoveToWithSymlink(self): """ By default, when moving a symlink, it should follow the link and actually copy the content of the linked node. """ invokedWith = self.setUpFaultyRename() f2 = self.path.child(b'file2') f3 = self.path.child(b'file3') self.symlink(self.path.child(b'file1').path, f2.path) f2.moveTo(f3) self.assertFalse(f3.islink()) self.assertEqual(f3.getContent(), b'file 1') self.assertTrue(invokedWith) def test_crossMountMoveToWithoutSymlink(self): """ Verify that moveTo called with followLinks=False actually create another symlink. """ invokedWith = self.setUpFaultyRename() f2 = self.path.child(b'file2') f3 = self.path.child(b'file3') self.symlink(self.path.child(b'file1').path, f2.path) f2.moveTo(f3, followLinks=False) self.assertTrue(f3.islink()) self.assertEqual(f3.getContent(), b'file 1') self.assertTrue(invokedWith) def test_createBinaryMode(self): """ L{FilePath.create} should always open (and write to) files in binary mode; line-feed octets should be unmodified. (While this test should pass on all platforms, it is only really interesting on platforms which have the concept of binary mode, i.e. Windows platforms.) """ path = filepath.FilePath(self.mktemp()) with path.create() as f: self.assertIn("b", f.mode) f.write(b"\n") with open(path.path, "rb") as fp: read = fp.read() self.assertEqual(read, b"\n") def testOpen(self): # Opening a file for reading when it does not already exist is an error nonexistent = self.path.child(b'nonexistent') e = self.assertRaises(IOError, nonexistent.open) self.assertEqual(e.errno, errno.ENOENT) # Opening a file for writing when it does not exist is okay writer = self.path.child(b'writer') with writer.open('w') as f: f.write(b'abc\ndef') # Make sure those bytes ended up there - and test opening a file for # reading when it does exist at the same time with writer.open() as f: self.assertEqual(f.read(), b'abc\ndef') # Re-opening that file in write mode should erase whatever was there. writer.open('w').close() with writer.open() as f: self.assertEqual(f.read(), b'') # Put some bytes in a file so we can test that appending does not # destroy them. appender = self.path.child(b'appender') with appender.open('w') as f: f.write(b'abc') with appender.open('a') as f: f.write(b'def') with appender.open('r') as f: self.assertEqual(f.read(), b'abcdef') # read/write should let us do both without erasing those bytes with appender.open('r+') as f: self.assertEqual(f.read(), b'abcdef') # ANSI C *requires* an fseek or an fgetpos between an fread and an # fwrite or an fwrite and an fread. We can't reliably get Python to # invoke fgetpos, so we seek to a 0 byte offset from the current # position instead. Also, Python sucks for making this seek # relative to 1 instead of a symbolic constant representing the # current file position. f.seek(0, 1) # Put in some new bytes for us to test for later. f.write(b'ghi') # Make sure those new bytes really showed up with appender.open('r') as f: self.assertEqual(f.read(), b'abcdefghi') # write/read should let us do both, but erase anything that's there # already. with appender.open('w+') as f: self.assertEqual(f.read(), b'') f.seek(0, 1) # Don't forget this! f.write(b'123') # super append mode should let us read and write and also position the # cursor at the end of the file, without erasing everything. with appender.open('a+') as f: # The order of these lines may seem surprising, but it is # necessary. The cursor is not at the end of the file until after # the first write. f.write(b'456') f.seek(0, 1) # Asinine. self.assertEqual(f.read(), b'') f.seek(0, 0) self.assertEqual(f.read(), b'123456') # Opening a file exclusively must fail if that file exists already. nonexistent.requireCreate(True) nonexistent.open('w').close() existent = nonexistent del nonexistent self.assertRaises((OSError, IOError), existent.open) def test_openWithExplicitBinaryMode(self): """ Due to a bug in Python 2.7 on Windows including multiple 'b' characters in the mode passed to the built-in open() will cause an error. FilePath.open() ensures that only a single 'b' character is included in the mode passed to the built-in open(). See http://bugs.python.org/issue7686 for details about the bug. """ writer = self.path.child(b'explicit-binary') with writer.open('wb') as file: file.write(b'abc\ndef') self.assertTrue(writer.exists) def test_openWithRedundantExplicitBinaryModes(self): """ Due to a bug in Python 2.7 on Windows including multiple 'b' characters in the mode passed to the built-in open() will cause an error. No matter how many 'b' modes are specified, FilePath.open() ensures that only a single 'b' character is included in the mode passed to the built-in open(). See http://bugs.python.org/issue7686 for details about the bug. """ writer = self.path.child(b'multiple-binary') with writer.open('wbb') as file: file.write(b'abc\ndef') self.assertTrue(writer.exists) def test_existsCache(self): """ Check that C{filepath.FilePath.exists} correctly restat the object if an operation has occurred in the mean time. """ fp = filepath.FilePath(self.mktemp()) self.assertFalse(fp.exists()) fp.makedirs() self.assertTrue(fp.exists()) def test_makedirsMakesDirectoriesRecursively(self): """ C{FilePath.makedirs} creates a directory at C{path}}, including recursively creating all parent directories leading up to the path. """ fp = filepath.FilePath(os.path.join( self.mktemp(), b"foo", b"bar", b"baz")) self.assertFalse(fp.exists()) fp.makedirs() self.assertTrue(fp.exists()) self.assertTrue(fp.isdir()) def test_makedirsMakesDirectoriesWithIgnoreExistingDirectory(self): """ Calling C{FilePath.makedirs} with C{ignoreExistingDirectory} set to C{True} has no effect if directory does not exist. """ fp = filepath.FilePath(self.mktemp()) self.assertFalse(fp.exists()) fp.makedirs(ignoreExistingDirectory=True) self.assertTrue(fp.exists()) self.assertTrue(fp.isdir()) def test_makedirsThrowsWithExistentDirectory(self): """ C{FilePath.makedirs} throws an C{OSError} exception when called on a directory that already exists. """ fp = filepath.FilePath(os.path.join(self.mktemp())) fp.makedirs() exception = self.assertRaises(OSError, fp.makedirs) self.assertEqual(exception.errno, errno.EEXIST) def test_makedirsAcceptsIgnoreExistingDirectory(self): """ C{FilePath.makedirs} succeeds when called on a directory that already exists and the c{ignoreExistingDirectory} argument is set to C{True}. """ fp = filepath.FilePath(self.mktemp()) fp.makedirs() self.assertTrue(fp.exists()) fp.makedirs(ignoreExistingDirectory=True) self.assertTrue(fp.exists()) def test_makedirsIgnoreExistingDirectoryExistAlreadyAFile(self): """ When C{FilePath.makedirs} is called with C{ignoreExistingDirectory} set to C{True} it throws an C{OSError} exceptions if path is a file. """ fp = filepath.FilePath(self.mktemp()) fp.create() self.assertTrue(fp.isfile()) exception = self.assertRaises( OSError, fp.makedirs, ignoreExistingDirectory=True) self.assertEqual(exception.errno, errno.EEXIST) def test_makedirsRaisesNonEexistErrorsIgnoreExistingDirectory(self): """ When C{FilePath.makedirs} is called with C{ignoreExistingDirectory} set to C{True} it raises an C{OSError} exception if exception errno is not EEXIST. """ def faultyMakedirs(path): raise OSError(errno.EACCES, 'Permission Denied') self.patch(os, 'makedirs', faultyMakedirs) fp = filepath.FilePath(self.mktemp()) exception = self.assertRaises( OSError, fp.makedirs, ignoreExistingDirectory=True) self.assertEqual(exception.errno, errno.EACCES) def test_changed(self): """ L{FilePath.changed} indicates that the L{FilePath} has changed, but does not re-read the status information from the filesystem until it is queried again via another method, such as C{getsize}. """ fp = filepath.FilePath(self.mktemp()) fp.setContent(b"12345") self.assertEqual(fp.getsize(), 5) # Someone else comes along and changes the file. with open(fp.path, 'wb') as fObj: fObj.write(b"12345678") # Sanity check for caching: size should still be 5. self.assertEqual(fp.getsize(), 5) fp.changed() # This path should look like we don't know what status it's in, not that # we know that it didn't exist when last we checked. self.assertIsNone(fp.statinfo) self.assertEqual(fp.getsize(), 8) def test_getPermissions_POSIX(self): """ Getting permissions for a file returns a L{Permissions} object for POSIX platforms (which supports separate user, group, and other permissions bits. """ for mode in (0o777, 0o700): self.path.child(b"sub1").chmod(mode) self.assertEqual(self.path.child(b"sub1").getPermissions(), filepath.Permissions(mode)) self.path.child(b"sub1").chmod(0o764) #sanity check self.assertEqual( self.path.child(b"sub1").getPermissions().shorthand(), "rwxrw-r--") def test_deprecateStatinfoGetter(self): """ Getting L{twisted.python.filepath.FilePath.statinfo} is deprecated. """ fp = filepath.FilePath(self.mktemp()) fp.statinfo warningInfo = self.flushWarnings([self.test_deprecateStatinfoGetter]) self.assertEqual(len(warningInfo), 1) self.assertEqual(warningInfo[0]['category'], DeprecationWarning) self.assertEqual( warningInfo[0]['message'], "twisted.python.filepath.FilePath.statinfo was deprecated in " "Twisted 15.0.0; please use other FilePath methods such as " "getsize(), isdir(), getModificationTime(), etc. instead") def test_deprecateStatinfoSetter(self): """ Setting L{twisted.python.filepath.FilePath.statinfo} is deprecated. """ fp = filepath.FilePath(self.mktemp()) fp.statinfo = None warningInfo = self.flushWarnings([self.test_deprecateStatinfoSetter]) self.assertEqual(len(warningInfo), 1) self.assertEqual(warningInfo[0]['category'], DeprecationWarning) self.assertEqual( warningInfo[0]['message'], "twisted.python.filepath.FilePath.statinfo was deprecated in " "Twisted 15.0.0; please use other FilePath methods such as " "getsize(), isdir(), getModificationTime(), etc. instead") def test_deprecateStatinfoSetterSets(self): """ Setting L{twisted.python.filepath.FilePath.statinfo} changes the value of _statinfo such that getting statinfo again returns the new value. """ fp = filepath.FilePath(self.mktemp()) fp.statinfo = None self.assertIsNone(fp.statinfo) def test_filePathNotDeprecated(self): """ While accessing L{twisted.python.filepath.FilePath.statinfo} is deprecated, the filepath itself is not. """ filepath.FilePath(self.mktemp()) warningInfo = self.flushWarnings([self.test_filePathNotDeprecated]) self.assertEqual(warningInfo, []) def test_getPermissions_Windows(self): """ Getting permissions for a file returns a L{Permissions} object in Windows. Windows requires a different test, because user permissions = group permissions = other permissions. Also, chmod may not be able to set the execute bit, so we are skipping tests that set the execute bit. """ # Change permission after test so file can be deleted self.addCleanup(self.path.child(b"sub1").chmod, 0o777) for mode in (0o777, 0o555): self.path.child(b"sub1").chmod(mode) self.assertEqual(self.path.child(b"sub1").getPermissions(), filepath.Permissions(mode)) self.path.child(b"sub1").chmod(0o511) #sanity check to make sure that # user=group=other permissions self.assertEqual(self.path.child(b"sub1").getPermissions().shorthand(), "r-xr-xr-x") def test_whetherBlockOrSocket(self): """ Ensure that a file is not a block or socket """ self.assertFalse(self.path.isBlockDevice()) self.assertFalse(self.path.isSocket()) def test_statinfoBitsNotImplementedInWindows(self): """ Verify that certain file stats are not available on Windows """ self.assertRaises(NotImplementedError, self.path.getInodeNumber) self.assertRaises(NotImplementedError, self.path.getDevice) self.assertRaises(NotImplementedError, self.path.getNumberOfHardLinks) self.assertRaises(NotImplementedError, self.path.getUserID) self.assertRaises(NotImplementedError, self.path.getGroupID) def test_statinfoBitsAreNumbers(self): """ Verify that file inode/device/nlinks/uid/gid stats are numbers in a POSIX environment """ if _PY3: numbers = int else: numbers = (int, long) c = self.path.child(b'file1') for p in self.path, c: self.assertIsInstance(p.getInodeNumber(), numbers) self.assertIsInstance(p.getDevice(), numbers) self.assertIsInstance(p.getNumberOfHardLinks(), numbers) self.assertIsInstance(p.getUserID(), numbers) self.assertIsInstance(p.getGroupID(), numbers) self.assertEqual(self.path.getUserID(), c.getUserID()) self.assertEqual(self.path.getGroupID(), c.getGroupID()) def test_statinfoNumbersAreValid(self): """ Verify that the right numbers come back from the right accessor methods for file inode/device/nlinks/uid/gid (in a POSIX environment) """ # specify fake statinfo information class FakeStat: st_ino = 200 st_dev = 300 st_nlink = 400 st_uid = 500 st_gid = 600 # monkey patch in a fake restat method for self.path fake = FakeStat() def fakeRestat(*args, **kwargs): self.path._statinfo = fake self.path.restat = fakeRestat # ensure that restat will need to be called to get values self.path._statinfo = None self.assertEqual(self.path.getInodeNumber(), fake.st_ino) self.assertEqual(self.path.getDevice(), fake.st_dev) self.assertEqual(self.path.getNumberOfHardLinks(), fake.st_nlink) self.assertEqual(self.path.getUserID(), fake.st_uid) self.assertEqual(self.path.getGroupID(), fake.st_gid) if platform.isWindows(): test_statinfoBitsAreNumbers.skip = True test_statinfoNumbersAreValid.skip = True test_getPermissions_POSIX.skip = True else: test_statinfoBitsNotImplementedInWindows.skip = "Test will run only on Windows." test_getPermissions_Windows.skip = "Test will run only on Windows." class SetContentTests(BytesTestCase): """ Tests for L{FilePath.setContent}. """ def test_write(self): """ Contents of the file referred to by a L{FilePath} can be written using L{FilePath.setContent}. """ pathString = self.mktemp() path = filepath.FilePath(pathString) path.setContent(b"hello, world") with open(pathString, "rb") as fObj: contents = fObj.read() self.assertEqual(b"hello, world", contents) def test_fileClosing(self): """ If writing to the underlying file raises an exception, L{FilePath.setContent} raises that exception after closing the file. """ fp = ExplodingFilePath(b"") self.assertRaises(IOError, fp.setContent, b"blah") self.assertTrue(fp.fp.closed) def test_nameCollision(self): """ L{FilePath.setContent} will use a different temporary filename on each invocation, so that multiple processes, threads, or reentrant invocations will not collide with each other. """ fp = TrackingFilePath(self.mktemp()) fp.setContent(b"alpha") fp.setContent(b"beta") # Sanity check: setContent should only open one derivative path each # time to store the temporary file. openedSiblings = fp.openedPaths() self.assertEqual(len(openedSiblings), 2) self.assertNotEqual(openedSiblings[0], openedSiblings[1]) def _assertOneOpened(self, fp, extension): """ Assert that the L{TrackingFilePath} C{fp} was used to open one sibling with the given extension. @param fp: A L{TrackingFilePath} which should have been used to open file at a sibling path. @type fp: L{TrackingFilePath} @param extension: The extension the sibling path is expected to have had. @type extension: L{bytes} @raise: C{self.failureException} is raised if the extension of the opened file is incorrect or if not exactly one file was opened using C{fp}. """ opened = fp.openedPaths() self.assertEqual(len(opened), 1, "expected exactly one opened file") self.assertTrue( opened[0].basename().endswith(extension), "%s does not end with %r extension" % ( opened[0].basename(), extension)) def test_defaultExtension(self): """ L{FilePath.setContent} creates temporary files with the extension I{.new} if no alternate extension value is given. """ fp = TrackingFilePath(self.mktemp()) fp.setContent(b"hello") self._assertOneOpened(fp, b".new") def test_customExtension(self): """ L{FilePath.setContent} creates temporary files with a user-supplied extension so that if it is somehow interrupted while writing them the file that it leaves behind will be identifiable. """ fp = TrackingFilePath(self.mktemp()) fp.setContent(b"goodbye", b"-something-else") self._assertOneOpened(fp, b"-something-else") class UnicodeFilePathTests(TestCase): """ L{FilePath} instances should have the same internal representation as they were instantiated with. """ def test_UnicodeInstantiation(self): """ L{FilePath} instantiated with a text path will return a text-mode FilePath. """ fp = filepath.FilePath(u'./mon\u20acy') self.assertEqual(type(fp.path), unicode) def test_UnicodeInstantiationBytesChild(self): """ Calling L{FilePath.child} on a text-mode L{FilePath} with a L{bytes} subpath will return a bytes-mode FilePath. """ fp = filepath.FilePath(u'./parent-mon\u20acy') child = fp.child(u'child-mon\u20acy'.encode('utf-8')) self.assertEqual(type(child.path), bytes) def test_UnicodeInstantiationUnicodeChild(self): """ Calling L{FilePath.child} on a text-mode L{FilePath} with a text subpath will return a text-mode FilePath. """ fp = filepath.FilePath(u'./parent-mon\u20acy') child = fp.child(u'mon\u20acy') self.assertEqual(type(child.path), unicode) def test_UnicodeInstantiationUnicodePreauthChild(self): """ Calling L{FilePath.preauthChild} on a text-mode L{FilePath} with a text subpath will return a text-mode FilePath. """ fp = filepath.FilePath(u'./parent-mon\u20acy') child = fp.preauthChild(u'mon\u20acy') self.assertEqual(type(child.path), unicode) def test_UnicodeInstantiationBytesPreauthChild(self): """ Calling L{FilePath.preauthChild} on a text-mode L{FilePath} with a bytes subpath will return a bytes-mode FilePath. """ fp = filepath.FilePath(u'./parent-mon\u20acy') child = fp.preauthChild(u'child-mon\u20acy'.encode('utf-8')) self.assertEqual(type(child.path), bytes) def test_BytesInstantiation(self): """ L{FilePath} instantiated with a L{bytes} path will return a bytes-mode FilePath. """ fp = filepath.FilePath(b"./") self.assertEqual(type(fp.path), bytes) def test_BytesInstantiationBytesChild(self): """ Calling L{FilePath.child} on a bytes-mode L{FilePath} with a bytes subpath will return a bytes-mode FilePath. """ fp = filepath.FilePath(b"./") child = fp.child(u'child-mon\u20acy'.encode('utf-8')) self.assertEqual(type(child.path), bytes) def test_BytesInstantiationUnicodeChild(self): """ Calling L{FilePath.child} on a bytes-mode L{FilePath} with a text subpath will return a text-mode FilePath. """ fp = filepath.FilePath(u'parent-mon\u20acy'.encode('utf-8')) child = fp.child(u"mon\u20acy") self.assertEqual(type(child.path), unicode) def test_BytesInstantiationBytesPreauthChild(self): """ Calling L{FilePath.preauthChild} on a bytes-mode L{FilePath} with a bytes subpath will return a bytes-mode FilePath. """ fp = filepath.FilePath(u'./parent-mon\u20acy'.encode('utf-8')) child = fp.preauthChild(u'child-mon\u20acy'.encode('utf-8')) self.assertEqual(type(child.path), bytes) def test_BytesInstantiationUnicodePreauthChild(self): """ Calling L{FilePath.preauthChild} on a bytes-mode L{FilePath} with a text subpath will return a text-mode FilePath. """ fp = filepath.FilePath(u'./parent-mon\u20acy'.encode('utf-8')) child = fp.preauthChild(u"mon\u20acy") self.assertEqual(type(child.path), unicode) def test_unicoderepr(self): """ The repr of a L{unicode} L{FilePath} shouldn't burst into flames. """ fp = filepath.FilePath(u"/mon\u20acy") reprOutput = repr(fp) if _PY3: self.assertEqual("FilePath('/mon\u20acy')", reprOutput) else: self.assertEqual("FilePath(u'/mon\\u20acy')", reprOutput) def test_bytesrepr(self): """ The repr of a L{bytes} L{FilePath} shouldn't burst into flames. """ fp = filepath.FilePath(u'/parent-mon\u20acy'.encode('utf-8')) reprOutput = repr(fp) if _PY3: self.assertEqual( "FilePath(b'/parent-mon\\xe2\\x82\\xacy')", reprOutput) else: self.assertEqual( "FilePath('/parent-mon\\xe2\\x82\\xacy')", reprOutput) def test_unicodereprWindows(self): """ The repr of a L{unicode} L{FilePath} shouldn't burst into flames. """ fp = filepath.FilePath(u"C:\\") reprOutput = repr(fp) if _PY3: self.assertEqual("FilePath('C:\\\\')", reprOutput) else: self.assertEqual("FilePath(u'C:\\\\')", reprOutput) def test_bytesreprWindows(self): """ The repr of a L{bytes} L{FilePath} shouldn't burst into flames. """ fp = filepath.FilePath(b"C:\\") reprOutput = repr(fp) if _PY3: self.assertEqual("FilePath(b'C:\\\\')", reprOutput) else: self.assertEqual("FilePath('C:\\\\')", reprOutput) if platform.isWindows(): test_unicoderepr.skip = "Test will not work on Windows" test_bytesrepr.skip = "Test will not work on Windows" else: test_unicodereprWindows.skip = "Test only works on Windows" test_bytesreprWindows.skip = "Test only works on Windows" def test_mixedTypeGlobChildren(self): """ C{globChildren} will return the same type as the pattern argument. """ fp = filepath.FilePath(u"/") children = fp.globChildren(b"*") self.assertIsInstance(children[0].path, bytes) def test_unicodeGlobChildren(self): """ C{globChildren} works with L{unicode}. """ fp = filepath.FilePath(u"/") children = fp.globChildren(u"*") self.assertIsInstance(children[0].path, unicode) def test_unicodeBasename(self): """ Calling C{basename} on an text- L{FilePath} returns L{unicode}. """ fp = filepath.FilePath(u"./") self.assertIsInstance(fp.basename(), unicode) def test_unicodeDirname(self): """ Calling C{dirname} on a text-mode L{FilePath} returns L{unicode}. """ fp = filepath.FilePath(u"./") self.assertIsInstance(fp.dirname(), unicode) def test_unicodeParent(self): """ Calling C{parent} on a text-mode L{FilePath} will return a text-mode L{FilePath}. """ fp = filepath.FilePath(u"./") parent = fp.parent() self.assertIsInstance(parent.path, unicode) def test_mixedTypeTemporarySibling(self): """ A L{bytes} extension to C{temporarySibling} will mean a L{bytes} mode L{FilePath} is returned. """ fp = filepath.FilePath(u"./mon\u20acy") tempSibling = fp.temporarySibling(b".txt") self.assertIsInstance(tempSibling.path, bytes) def test_unicodeTemporarySibling(self): """ A L{unicode} extension to C{temporarySibling} will mean a L{unicode} mode L{FilePath} is returned. """ fp = filepath.FilePath(u"/tmp/mon\u20acy") tempSibling = fp.temporarySibling(u".txt") self.assertIsInstance(tempSibling.path, unicode) def test_mixedTypeSiblingExtensionSearch(self): """ C{siblingExtensionSearch} called with L{bytes} on a L{unicode}-mode L{FilePath} will return a L{list} of L{bytes}-mode L{FilePath}s. """ fp = filepath.FilePath(u"./mon\u20acy") sibling = filepath.FilePath(fp._asTextPath() + u".txt") sibling.touch() newPath = fp.siblingExtensionSearch(b".txt") self.assertIsInstance(newPath, filepath.FilePath) self.assertIsInstance(newPath.path, bytes) def test_unicodeSiblingExtensionSearch(self): """ C{siblingExtensionSearch} called with L{unicode} on a L{unicode}-mode L{FilePath} will return a L{list} of L{unicode}-mode L{FilePath}s. """ fp = filepath.FilePath(u"./mon\u20acy") sibling = filepath.FilePath(fp._asTextPath() + u".txt") sibling.touch() newPath = fp.siblingExtensionSearch(u".txt") self.assertIsInstance(newPath, filepath.FilePath) self.assertIsInstance(newPath.path, unicode) def test_mixedTypeSiblingExtension(self): """ C{siblingExtension} called with L{bytes} on a L{unicode}-mode L{FilePath} will return a L{bytes}-mode L{FilePath}. """ fp = filepath.FilePath(u"./mon\u20acy") sibling = filepath.FilePath(fp._asTextPath() + u".txt") sibling.touch() newPath = fp.siblingExtension(b".txt") self.assertIsInstance(newPath, filepath.FilePath) self.assertIsInstance(newPath.path, bytes) def test_unicodeSiblingExtension(self): """ C{siblingExtension} called with L{unicode} on a L{unicode}-mode L{FilePath} will return a L{unicode}-mode L{FilePath}. """ fp = filepath.FilePath(u"./mon\u20acy") sibling = filepath.FilePath(fp._asTextPath() + u".txt") sibling.touch() newPath = fp.siblingExtension(u".txt") self.assertIsInstance(newPath, filepath.FilePath) self.assertIsInstance(newPath.path, unicode) def test_mixedTypeChildSearchPreauth(self): """ C{childSearchPreauth} called with L{bytes} on a L{unicode}-mode L{FilePath} will return a L{bytes}-mode L{FilePath}. """ fp = filepath.FilePath(u"./mon\u20acy") fp.createDirectory() self.addCleanup(lambda: fp.remove()) child = fp.child("text.txt") child.touch() newPath = fp.childSearchPreauth(b"text.txt") self.assertIsInstance(newPath, filepath.FilePath) self.assertIsInstance(newPath.path, bytes) def test_unicodeChildSearchPreauth(self): """ C{childSearchPreauth} called with L{unicode} on a L{unicode}-mode L{FilePath} will return a L{unicode}-mode L{FilePath}. """ fp = filepath.FilePath(u"./mon\u20acy") fp.createDirectory() self.addCleanup(lambda: fp.remove()) child = fp.child("text.txt") child.touch() newPath = fp.childSearchPreauth(u"text.txt") self.assertIsInstance(newPath, filepath.FilePath) self.assertIsInstance(newPath.path, unicode) def test_asBytesModeFromUnicode(self): """ C{asBytesMode} on a L{unicode}-mode L{FilePath} returns a new L{bytes}-mode L{FilePath}. """ fp = filepath.FilePath(u"./tmp") newfp = fp.asBytesMode() self.assertIsNot(fp, newfp) self.assertIsInstance(newfp.path, bytes) def test_asTextModeFromBytes(self): """ C{asBytesMode} on a L{unicode}-mode L{FilePath} returns a new L{bytes}-mode L{FilePath}. """ fp = filepath.FilePath(b"./tmp") newfp = fp.asTextMode() self.assertIsNot(fp, newfp) self.assertIsInstance(newfp.path, unicode) def test_asBytesModeFromBytes(self): """ C{asBytesMode} on a L{bytes}-mode L{FilePath} returns the same L{bytes}-mode L{FilePath}. """ fp = filepath.FilePath(b"./tmp") newfp = fp.asBytesMode() self.assertIs(fp, newfp) self.assertIsInstance(newfp.path, bytes) def test_asTextModeFromUnicode(self): """ C{asTextMode} on a L{unicode}-mode L{FilePath} returns the same L{unicode}-mode L{FilePath}. """ fp = filepath.FilePath(u"./tmp") newfp = fp.asTextMode() self.assertIs(fp, newfp) self.assertIsInstance(newfp.path, unicode) def test_asBytesModeFromUnicodeWithEncoding(self): """ C{asBytesMode} with an C{encoding} argument uses that encoding when coercing the L{unicode}-mode L{FilePath} to a L{bytes}-mode L{FilePath}. """ fp = filepath.FilePath(u"\u2603") newfp = fp.asBytesMode(encoding="utf-8") self.assertIn(b"\xe2\x98\x83", newfp.path) def test_asTextModeFromBytesWithEncoding(self): """ C{asTextMode} with an C{encoding} argument uses that encoding when coercing the L{bytes}-mode L{FilePath} to a L{unicode}-mode L{FilePath}. """ fp = filepath.FilePath(b'\xe2\x98\x83') newfp = fp.asTextMode(encoding="utf-8") self.assertIn(u"\u2603", newfp.path) def test_asBytesModeFromUnicodeWithUnusableEncoding(self): """ C{asBytesMode} with an C{encoding} argument that can't be used to encode the unicode path raises a L{UnicodeError}. """ fp = filepath.FilePath(u"\u2603") with self.assertRaises(UnicodeError): fp.asBytesMode(encoding="ascii") def test_asTextModeFromBytesWithUnusableEncoding(self): """ C{asTextMode} with an C{encoding} argument that can't be used to encode the unicode path raises a L{UnicodeError}. """ fp = filepath.FilePath(b"\u2603") with self.assertRaises(UnicodeError): fp.asTextMode(encoding="utf-32")
mit
blockstack/packaging
imported/future/src/libpasteurize/fixes/fix_add_all_future_builtins.py
60
1270
""" For the ``future`` package. Adds this import line:: from builtins import (ascii, bytes, chr, dict, filter, hex, input, int, list, map, next, object, oct, open, pow, range, round, str, super, zip) to a module, irrespective of whether each definition is used. Adds these imports after any other imports (in an initial block of them). """ from __future__ import unicode_literals from lib2to3 import fixer_base from libfuturize.fixer_util import touch_import_top class FixAddAllFutureBuiltins(fixer_base.BaseFix): BM_compatible = True PATTERN = "file_input" run_order = 1 def transform(self, node, results): # import_str = """(ascii, bytes, chr, dict, filter, hex, input, # int, list, map, next, object, oct, open, pow, # range, round, str, super, zip)""" touch_import_top(u'builtins', '*', node) # builtins = """ascii bytes chr dict filter hex input # int list map next object oct open pow # range round str super zip""" # for builtin in sorted(builtins.split(), reverse=True): # touch_import_top(u'builtins', builtin, node)
gpl-3.0
manpen/thrill
frontends/swig_python/python_test.py
4
4291
#!/usr/bin/env python ########################################################################## # frontends/swig_python/python_test.py # # Part of Project Thrill - http://project-thrill.org # # Copyright (C) 2015 Timo Bingmann <tb@panthema.net> # # All rights reserved. Published under the BSD-2 license in the LICENSE file. ########################################################################## import unittest import threading import sys import thrill class TryThread(threading.Thread): def __init__(self, **kwargs): threading.Thread.__init__(self, **kwargs) self.exception = None def run(self): try: threading.Thread.run(self) except Exception: self.exception = sys.exc_info() raise def run_thrill_threads(num_threads, thread_func): # construct a local context mock network ctxs = thrill.PyContext.ConstructLoopback(num_threads, 1) # but then start python threads for each context threads = [] for thrid in range(0, num_threads): t = TryThread(target=thread_func, args=(ctxs[thrid],)) t.start() threads.append(t) # wait for computation to finish for thr in threads: thr.join() # check for exceptions for thr in threads: if thr.exception: raise Exception(thr.exception) def run_tests(thread_func): for num_threads in [1, 2, 5]: run_thrill_threads(num_threads, thread_func) class TestOperations(unittest.TestCase): def test_generate_allgather(self): def test(ctx): test_size = 1024 dia1 = ctx.Generate( lambda x: [int(x), "hello %d" % (x)], test_size) self.assertEqual(dia1.Size(), test_size) check = [[int(x), "hello %d" % (x)] for x in range(0, test_size)] self.assertEqual(dia1.AllGather(), check) run_tests(test) def test_generate_map_allgather(self): def test(ctx): test_size = 1024 dia1 = ctx.Generate(lambda x: int(x), test_size) self.assertEqual(dia1.Size(), test_size) dia2 = dia1.Map(lambda x: [int(x), "hello %d" % (x)]) check = [[int(x), "hello %d" % (x)] for x in range(0, test_size)] self.assertEqual(dia2.Size(), test_size) self.assertEqual(dia2.AllGather(), check) dia3 = dia1.Map(lambda x: [int(x), "two %d" % (x)]) check = [[int(x), "two %d" % (x)] for x in range(0, test_size)] self.assertEqual(dia3.Size(), test_size) self.assertEqual(dia3.AllGather(), check) run_tests(test) def test_distribute_map_filter_allgather(self): def test(ctx): test_size = 1024 dia1 = ctx.Distribute([x * x for x in range(0, test_size)]) self.assertEqual(dia1.Size(), test_size) dia2 = dia1.Map(lambda x: [int(x), "hello %d" % (x)]) dia3 = dia2.Filter(lambda x: x[0] >= 16 and x[0] < 10000) check = [[int(x * x), "hello %d" % (x * x)] for x in range(4, 100)] self.assertEqual(dia3.AllGather(), check) run_tests(test) def my_generator(self, index): #print("generator at index", index) return (index, "hello at %d" % (index)) def my_thread(self, ctx): print("thread in python, rank", ctx.my_rank()) dia1 = ctx.Generate(lambda x: [int(x), x], 50) dia2 = dia1.Map(lambda x: (x[0], x[1] + " mapped")) s = dia2.Size() print("Size:", s) self.assertEqual(s, 50) print("AllGather:", dia2.AllGather()) dia3 = dia2.ReduceBy(lambda x: x[0] % 10, lambda x, y: (x + y)) print("dia3.Size:", dia3.Size()) print("dia3.AllGather:", dia3.AllGather()) dia4 = dia3.Filter(lambda x: x[0] == 2) print("dia4.AllGather:", dia4.AllGather()) ##### dia5 = ctx.Distribute([2, 3, 5, 7, 11, 13, 17, 19]) print("dia5.AllGather:", dia5.AllGather()) def notest_operations(self): run_thrill_threads(4, self.my_thread) if __name__ == '__main__': unittest.main() ##########################################################################
bsd-2-clause
lkeijser/func
test/unittest/test_func_arg.py
8
4973
## ## Copyright 2007, Red Hat, Inc ## see AUTHORS ## ## This software may be freely redistributed under the terms of the GNU ## general public license. ## ## You should have received a copy of the GNU General Public License ## along with this program; if not, write to the Free Software ## Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. ## #tester module for ArgCompatibility from func.minion.func_arg import ArgCompatibility class TestArgCompatibility: def setUp(self): #create the simple object self.ac = ArgCompatibility(self.dummy_arg_getter()) def test_arg_compatibility(self): """ Testing the method argument compatiblity """ result = self.ac.validate_all() assert result == True self.ac = ArgCompatibility(self.dummy_no_getter()) result = self.ac.validate_all() assert result == True self.ac = ArgCompatibility(self.dummy_empty_args()) result = self.ac.validate_all() assert result == True def test_is_all_arguments_registered(self): #create the dummy class tc = FooClass() arguments = tc.register_method() assert self.ac.is_all_arguments_registered(tc,'foomethod',arguments['foomethod']['args'])==True print arguments assert self.ac.validate_all()==True def dummy_no_getter(self): return {} def dummy_empty_args(self): return{ 'myfunc':{ 'args':{}, 'description':'Cool methods here' } } def dummy_arg_getter(self): """ A simple method to test the stuff we have written for arg compatiblity. I just return a dict with proper stuff Should more an more tests here to see if didnt miss something """ return { 'hifunc':{ 'args':{ 'app':{ 'type':'int', 'range':[0,100], 'optional':False, 'default' : 12 }, 'platform':{ 'type':'string', 'options':["fedora","redhat","ubuntu"], 'description':"Hey im a fedora fan", 'default':'fedora8', }, 'platform2':{ 'type':'string', 'min_length':4, 'max_length':33, 'description':"Hey im a fedora fan", 'default':'fedora8', }, 'is_independent':{ 'type':'boolean', 'default' :False, 'description':'Are you independent ?', 'optional':False }, 'some_string':{ 'type':'string', 'validator': "^[a-zA-Z]$", 'description':'String to be validated', 'default':'makkalot', 'optional':False}, # validator is a re string for those whoo need better validation,so when we have options there is no need to use validator and reverse is True #to define also a float we dont need it actually but maybe useful for the UI stuff. 'some_float':{ 'type':'float', 'description':'The float point value', 'default':33.44, 'optional':False }, 'some_iterable':{ 'type':'list', 'description':'The value and description for *arg', 'optional':True, #that is where it makes sense 'validator':'^[0-9]+$',#maybe useful to say it is to be a number for example }, 'some_hash':{ 'type':'hash', 'description':"Dummy desc here", 'optional':True, #of course it is, 'validator':"^[a-z]*$",#only for values not keys } }, 'description':"The dummy method description", } } class FooClass(object): """ Sample class for testing the is_all_arguments_registered method functionality ... """ def foomethod(self,arg1,arg5,arg4,*arg,**kw): pass def register_method(self): return{ 'foomethod':{ 'args':{ 'arg1':{}, 'arg4':{}, 'arg5':{}, 'arg':{}, 'kw':{}, } } }
gpl-2.0
mujiansu/arangodb
3rdParty/V8-4.3.61/third_party/python_26/Lib/distutils/command/bdist_dumb.py
53
4901
"""distutils.command.bdist_dumb Implements the Distutils 'bdist_dumb' command (create a "dumb" built distribution -- i.e., just an archive to be unpacked under $prefix or $exec_prefix).""" # This module should be kept compatible with Python 2.1. __revision__ = "$Id: bdist_dumb.py 61000 2008-02-23 17:40:11Z christian.heimes $" import os from distutils.core import Command from distutils.util import get_platform from distutils.dir_util import remove_tree, ensure_relative from distutils.errors import * from distutils.sysconfig import get_python_version from distutils import log class bdist_dumb (Command): description = "create a \"dumb\" built distribution" user_options = [('bdist-dir=', 'd', "temporary directory for creating the distribution"), ('plat-name=', 'p', "platform name to embed in generated filenames " "(default: %s)" % get_platform()), ('format=', 'f', "archive format to create (tar, ztar, gztar, zip)"), ('keep-temp', 'k', "keep the pseudo-installation tree around after " + "creating the distribution archive"), ('dist-dir=', 'd', "directory to put final built distributions in"), ('skip-build', None, "skip rebuilding everything (for testing/debugging)"), ('relative', None, "build the archive using relative paths" "(default: false)"), ] boolean_options = ['keep-temp', 'skip-build', 'relative'] default_format = { 'posix': 'gztar', 'nt': 'zip', 'os2': 'zip' } def initialize_options (self): self.bdist_dir = None self.plat_name = None self.format = None self.keep_temp = 0 self.dist_dir = None self.skip_build = 0 self.relative = 0 # initialize_options() def finalize_options (self): if self.bdist_dir is None: bdist_base = self.get_finalized_command('bdist').bdist_base self.bdist_dir = os.path.join(bdist_base, 'dumb') if self.format is None: try: self.format = self.default_format[os.name] except KeyError: raise DistutilsPlatformError, \ ("don't know how to create dumb built distributions " + "on platform %s") % os.name self.set_undefined_options('bdist', ('dist_dir', 'dist_dir'), ('plat_name', 'plat_name')) # finalize_options() def run (self): if not self.skip_build: self.run_command('build') install = self.reinitialize_command('install', reinit_subcommands=1) install.root = self.bdist_dir install.skip_build = self.skip_build install.warn_dir = 0 log.info("installing to %s" % self.bdist_dir) self.run_command('install') # And make an archive relative to the root of the # pseudo-installation tree. archive_basename = "%s.%s" % (self.distribution.get_fullname(), self.plat_name) # OS/2 objects to any ":" characters in a filename (such as when # a timestamp is used in a version) so change them to hyphens. if os.name == "os2": archive_basename = archive_basename.replace(":", "-") pseudoinstall_root = os.path.join(self.dist_dir, archive_basename) if not self.relative: archive_root = self.bdist_dir else: if (self.distribution.has_ext_modules() and (install.install_base != install.install_platbase)): raise DistutilsPlatformError, \ ("can't make a dumb built distribution where " "base and platbase are different (%s, %s)" % (repr(install.install_base), repr(install.install_platbase))) else: archive_root = os.path.join(self.bdist_dir, ensure_relative(install.install_base)) # Make the archive filename = self.make_archive(pseudoinstall_root, self.format, root_dir=archive_root) if self.distribution.has_ext_modules(): pyversion = get_python_version() else: pyversion = 'any' self.distribution.dist_files.append(('bdist_dumb', pyversion, filename)) if not self.keep_temp: remove_tree(self.bdist_dir, dry_run=self.dry_run) # run() # class bdist_dumb
apache-2.0
shujaatak/UAV_MissionPlanner
Lib/site-packages/numpy/lib/tests/test__datasource.py
54
10225
import os import sys from tempfile import mkdtemp, mkstemp, NamedTemporaryFile from shutil import rmtree from urlparse import urlparse from urllib2 import URLError import urllib2 from numpy.testing import * from numpy.compat import asbytes import numpy.lib._datasource as datasource def urlopen_stub(url, data=None): '''Stub to replace urlopen for testing.''' if url == valid_httpurl(): tmpfile = NamedTemporaryFile(prefix='urltmp_') return tmpfile else: raise URLError('Name or service not known') old_urlopen = None def setup(): global old_urlopen old_urlopen = urllib2.urlopen urllib2.urlopen = urlopen_stub def teardown(): urllib2.urlopen = old_urlopen # A valid website for more robust testing http_path = 'http://www.google.com/' http_file = 'index.html' http_fakepath = 'http://fake.abc.web/site/' http_fakefile = 'fake.txt' malicious_files = ['/etc/shadow', '../../shadow', '..\\system.dat', 'c:\\windows\\system.dat'] magic_line = asbytes('three is the magic number') # Utility functions used by many TestCases def valid_textfile(filedir): # Generate and return a valid temporary file. fd, path = mkstemp(suffix='.txt', prefix='dstmp_', dir=filedir, text=True) os.close(fd) return path def invalid_textfile(filedir): # Generate and return an invalid filename. fd, path = mkstemp(suffix='.txt', prefix='dstmp_', dir=filedir) os.close(fd) os.remove(path) return path def valid_httpurl(): return http_path+http_file def invalid_httpurl(): return http_fakepath+http_fakefile def valid_baseurl(): return http_path def invalid_baseurl(): return http_fakepath def valid_httpfile(): return http_file def invalid_httpfile(): return http_fakefile class TestDataSourceOpen(TestCase): def setUp(self): self.tmpdir = mkdtemp() self.ds = datasource.DataSource(self.tmpdir) def tearDown(self): rmtree(self.tmpdir) del self.ds def test_ValidHTTP(self): assert self.ds.open(valid_httpurl()) def test_InvalidHTTP(self): url = invalid_httpurl() self.assertRaises(IOError, self.ds.open, url) try: self.ds.open(url) except IOError, e: # Regression test for bug fixed in r4342. assert e.errno is None def test_InvalidHTTPCacheURLError(self): self.assertRaises(URLError, self.ds._cache, invalid_httpurl()) def test_ValidFile(self): local_file = valid_textfile(self.tmpdir) assert self.ds.open(local_file) def test_InvalidFile(self): invalid_file = invalid_textfile(self.tmpdir) self.assertRaises(IOError, self.ds.open, invalid_file) def test_ValidGzipFile(self): try: import gzip except ImportError: # We don't have the gzip capabilities to test. import nose raise nose.SkipTest # Test datasource's internal file_opener for Gzip files. filepath = os.path.join(self.tmpdir, 'foobar.txt.gz') fp = gzip.open(filepath, 'w') fp.write(magic_line) fp.close() fp = self.ds.open(filepath) result = fp.readline() fp.close() self.assertEqual(magic_line, result) def test_ValidBz2File(self): try: import bz2 except ImportError: # We don't have the bz2 capabilities to test. import nose raise nose.SkipTest # Test datasource's internal file_opener for BZip2 files. filepath = os.path.join(self.tmpdir, 'foobar.txt.bz2') fp = bz2.BZ2File(filepath, 'w') fp.write(magic_line) fp.close() fp = self.ds.open(filepath) result = fp.readline() fp.close() self.assertEqual(magic_line, result) class TestDataSourceExists(TestCase): def setUp(self): self.tmpdir = mkdtemp() self.ds = datasource.DataSource(self.tmpdir) def tearDown(self): rmtree(self.tmpdir) del self.ds def test_ValidHTTP(self): assert self.ds.exists(valid_httpurl()) def test_InvalidHTTP(self): self.assertEqual(self.ds.exists(invalid_httpurl()), False) def test_ValidFile(self): # Test valid file in destpath tmpfile = valid_textfile(self.tmpdir) assert self.ds.exists(tmpfile) # Test valid local file not in destpath localdir = mkdtemp() tmpfile = valid_textfile(localdir) assert self.ds.exists(tmpfile) rmtree(localdir) def test_InvalidFile(self): tmpfile = invalid_textfile(self.tmpdir) self.assertEqual(self.ds.exists(tmpfile), False) class TestDataSourceAbspath(TestCase): def setUp(self): self.tmpdir = os.path.abspath(mkdtemp()) self.ds = datasource.DataSource(self.tmpdir) def tearDown(self): rmtree(self.tmpdir) del self.ds def test_ValidHTTP(self): scheme, netloc, upath, pms, qry, frg = urlparse(valid_httpurl()) local_path = os.path.join(self.tmpdir, netloc, upath.strip(os.sep).strip('/')) self.assertEqual(local_path, self.ds.abspath(valid_httpurl())) def test_ValidFile(self): tmpfile = valid_textfile(self.tmpdir) tmpfilename = os.path.split(tmpfile)[-1] # Test with filename only self.assertEqual(tmpfile, self.ds.abspath(os.path.split(tmpfile)[-1])) # Test filename with complete path self.assertEqual(tmpfile, self.ds.abspath(tmpfile)) def test_InvalidHTTP(self): scheme, netloc, upath, pms, qry, frg = urlparse(invalid_httpurl()) invalidhttp = os.path.join(self.tmpdir, netloc, upath.strip(os.sep).strip('/')) self.assertNotEqual(invalidhttp, self.ds.abspath(valid_httpurl())) def test_InvalidFile(self): invalidfile = valid_textfile(self.tmpdir) tmpfile = valid_textfile(self.tmpdir) tmpfilename = os.path.split(tmpfile)[-1] # Test with filename only self.assertNotEqual(invalidfile, self.ds.abspath(tmpfilename)) # Test filename with complete path self.assertNotEqual(invalidfile, self.ds.abspath(tmpfile)) def test_sandboxing(self): tmpfile = valid_textfile(self.tmpdir) tmpfilename = os.path.split(tmpfile)[-1] tmp_path = lambda x: os.path.abspath(self.ds.abspath(x)) assert tmp_path(valid_httpurl()).startswith(self.tmpdir) assert tmp_path(invalid_httpurl()).startswith(self.tmpdir) assert tmp_path(tmpfile).startswith(self.tmpdir) assert tmp_path(tmpfilename).startswith(self.tmpdir) for fn in malicious_files: assert tmp_path(http_path+fn).startswith(self.tmpdir) assert tmp_path(fn).startswith(self.tmpdir) def test_windows_os_sep(self): orig_os_sep = os.sep try: os.sep = '\\' self.test_ValidHTTP() self.test_ValidFile() self.test_InvalidHTTP() self.test_InvalidFile() self.test_sandboxing() finally: os.sep = orig_os_sep class TestRepositoryAbspath(TestCase): def setUp(self): self.tmpdir = os.path.abspath(mkdtemp()) self.repos = datasource.Repository(valid_baseurl(), self.tmpdir) def tearDown(self): rmtree(self.tmpdir) del self.repos def test_ValidHTTP(self): scheme, netloc, upath, pms, qry, frg = urlparse(valid_httpurl()) local_path = os.path.join(self.repos._destpath, netloc, \ upath.strip(os.sep).strip('/')) filepath = self.repos.abspath(valid_httpfile()) self.assertEqual(local_path, filepath) def test_sandboxing(self): tmp_path = lambda x: os.path.abspath(self.repos.abspath(x)) assert tmp_path(valid_httpfile()).startswith(self.tmpdir) for fn in malicious_files: assert tmp_path(http_path+fn).startswith(self.tmpdir) assert tmp_path(fn).startswith(self.tmpdir) def test_windows_os_sep(self): orig_os_sep = os.sep try: os.sep = '\\' self.test_ValidHTTP() self.test_sandboxing() finally: os.sep = orig_os_sep class TestRepositoryExists(TestCase): def setUp(self): self.tmpdir = mkdtemp() self.repos = datasource.Repository(valid_baseurl(), self.tmpdir) def tearDown(self): rmtree(self.tmpdir) del self.repos def test_ValidFile(self): # Create local temp file tmpfile = valid_textfile(self.tmpdir) assert self.repos.exists(tmpfile) def test_InvalidFile(self): tmpfile = invalid_textfile(self.tmpdir) self.assertEqual(self.repos.exists(tmpfile), False) def test_RemoveHTTPFile(self): assert self.repos.exists(valid_httpurl()) def test_CachedHTTPFile(self): localfile = valid_httpurl() # Create a locally cached temp file with an URL based # directory structure. This is similar to what Repository.open # would do. scheme, netloc, upath, pms, qry, frg = urlparse(localfile) local_path = os.path.join(self.repos._destpath, netloc) os.mkdir(local_path, 0700) tmpfile = valid_textfile(local_path) assert self.repos.exists(tmpfile) class TestOpenFunc(TestCase): def setUp(self): self.tmpdir = mkdtemp() def tearDown(self): rmtree(self.tmpdir) def test_DataSourceOpen(self): local_file = valid_textfile(self.tmpdir) # Test case where destpath is passed in assert datasource.open(local_file, destpath=self.tmpdir) # Test case where default destpath is used assert datasource.open(local_file) if hasattr(sys, 'gettotalrefcount'): # skip these, when Python was compiled using the --with-pydebug option del TestDataSourceOpen del TestDataSourceExists del TestDataSourceAbspath del TestRepositoryExists del TestOpenFunc if __name__ == "__main__": run_module_suite()
gpl-2.0
omarocegueda/dipy
dipy/segment/tissue.py
6
6207
import numpy as np from dipy.sims.voxel import add_noise from dipy.segment.mrf import (ConstantObservationModel, IteratedConditionalModes) class TissueClassifierHMRF(object): r""" This class contains the methods for tissue classification using the Markov Random Fields modeling approach """ def __init__(self, save_history=False, verbose=True): self.save_history = save_history self.segmentations = [] self.pves = [] self.energies = [] self.energies_sum = [] self.verbose = verbose def classify(self, image, nclasses, beta, tolerance=None, max_iter=None): r""" This method uses the Maximum a posteriori - Markov Random Field approach for segmentation by using the Iterative Conditional Modes and Expectation Maximization to estimate the parameters. Parameters ---------- image : ndarray, 3D structural image. nclasses : int, number of desired classes. beta : float, smoothing parameter, the higher this number the smoother the output will be. tolerance: float, value that defines the percentage of change tolerated to prevent the ICM loop to stop. Default is 1e-05. max_iter : float, fixed number of desired iterations. Default is 100. If the user only specifies this parameter, the tolerance value will not be considered. If none of these two parameters Returns ------- initial_segmentation : ndarray, 3D segmented image with all tissue types specified in nclasses. final_segmentation : ndarray, 3D final refined segmentation containing all tissue types. PVE : ndarray, 3D probability map of each tissue type. """ nclasses = nclasses + 1 # One extra class for the background energy_sum = [1e-05] com = ConstantObservationModel() icm = IteratedConditionalModes() if image.max() > 1: image = np.interp(image, [0, image.max()], [0.0, 1.0]) mu, sigma = com.initialize_param_uniform(image, nclasses) p = np.argsort(mu) mu = mu[p] sigma = sigma[p] sigmasq = sigma ** 2 neglogl = com.negloglikelihood(image, mu, sigmasq, nclasses) seg_init = icm.initialize_maximum_likelihood(neglogl) mu, sigma = com.seg_stats(image, seg_init, nclasses) sigmasq = sigma ** 2 zero = np.zeros_like(image) + 0.001 zero_noise = add_noise(zero, 10000, 1, noise_type='gaussian') image_gauss = np.where(image == 0, zero_noise, image) final_segmentation = np.empty_like(image) initial_segmentation = seg_init.copy() if max_iter is not None and tolerance is None: for i in range(max_iter): if self.verbose: print('>> Iteration: ' + str(i)) PLN = icm.prob_neighborhood(seg_init, beta, nclasses) PVE = com.prob_image(image_gauss, nclasses, mu, sigmasq, PLN) mu_upd, sigmasq_upd = com.update_param(image_gauss, PVE, mu, nclasses) ind = np.argsort(mu_upd) mu_upd = mu_upd[ind] sigmasq_upd = sigmasq_upd[ind] negll = com.negloglikelihood(image_gauss, mu_upd, sigmasq_upd, nclasses) final_segmentation, energy = icm.icm_ising(negll, beta, seg_init) if self.save_history: self.segmentations.append(final_segmentation) self.pves.append(PVE) self.energies.append(energy) self.energies_sum.append(energy[energy > -np.inf].sum()) seg_init = final_segmentation.copy() mu = mu_upd.copy() sigmasq = sigmasq_upd.copy() else: max_iter = 100 for i in range(max_iter): if self.verbose: print('>> Iteration: ' + str(i)) PLN = icm.prob_neighborhood(seg_init, beta, nclasses) PVE = com.prob_image(image_gauss, nclasses, mu, sigmasq, PLN) mu_upd, sigmasq_upd = com.update_param(image_gauss, PVE, mu, nclasses) ind = np.argsort(mu_upd) mu_upd = mu_upd[ind] sigmasq_upd = sigmasq_upd[ind] negll = com.negloglikelihood(image_gauss, mu_upd, sigmasq_upd, nclasses) final_segmentation, energy = icm.icm_ising(negll, beta, seg_init) energy_sum.append(energy[energy > -np.inf].sum()) if self.save_history: self.segmentations.append(final_segmentation) self.pves.append(PVE) self.energies.append(energy) self.energies_sum.append(energy[energy > -np.inf].sum()) if tolerance is None: tolerance = 1e-05 if i % 10 == 0 and i != 0: tol = tolerance * (np.amax(energy_sum) - np.amin(energy_sum)) test_dist = np.absolute(np.amax( energy_sum[np.size(energy_sum) - 5: i]) - np.amin(energy_sum[np.size(energy_sum) - 5: i]) ) if test_dist < tol: break seg_init = final_segmentation.copy() mu = mu_upd.copy() sigmasq = sigmasq_upd.copy() PVE = PVE[..., 1:] return initial_segmentation, final_segmentation, PVE
bsd-3-clause
davidharrigan/django
tests/csrf_tests/tests.py
78
23643
# -*- coding: utf-8 -*- from __future__ import unicode_literals import logging from django.conf import settings from django.http import HttpRequest, HttpResponse from django.middleware.csrf import ( CSRF_KEY_LENGTH, CsrfViewMiddleware, get_token, ) from django.template import RequestContext, Template from django.template.context_processors import csrf from django.test import SimpleTestCase, override_settings from django.views.decorators.csrf import ( csrf_exempt, ensure_csrf_cookie, requires_csrf_token, ) # Response/views used for CsrfResponseMiddleware and CsrfViewMiddleware tests def post_form_response(): resp = HttpResponse(content=""" <html><body><h1>\u00a1Unicode!<form method="post"><input type="text" /></form></body></html> """, mimetype="text/html") return resp def post_form_view(request): """A view that returns a POST form (without a token)""" return post_form_response() # Response/views used for template tag tests def token_view(request): """A view that uses {% csrf_token %}""" context = RequestContext(request, processors=[csrf]) template = Template("{% csrf_token %}") return HttpResponse(template.render(context)) def non_token_view_using_request_processor(request): """ A view that doesn't use the token, but does use the csrf view processor. """ context = RequestContext(request, processors=[csrf]) template = Template("") return HttpResponse(template.render(context)) class TestingHttpRequest(HttpRequest): """ A version of HttpRequest that allows us to change some things more easily """ def is_secure(self): return getattr(self, '_is_secure_override', False) class CsrfViewMiddlewareTest(SimpleTestCase): # The csrf token is potentially from an untrusted source, so could have # characters that need dealing with. _csrf_id_cookie = b"<1>\xc2\xa1" _csrf_id = "1" def _get_GET_no_csrf_cookie_request(self): return TestingHttpRequest() def _get_GET_csrf_cookie_request(self): req = TestingHttpRequest() req.COOKIES[settings.CSRF_COOKIE_NAME] = self._csrf_id_cookie return req def _get_POST_csrf_cookie_request(self): req = self._get_GET_csrf_cookie_request() req.method = "POST" return req def _get_POST_no_csrf_cookie_request(self): req = self._get_GET_no_csrf_cookie_request() req.method = "POST" return req def _get_POST_request_with_token(self): req = self._get_POST_csrf_cookie_request() req.POST['csrfmiddlewaretoken'] = self._csrf_id return req def _check_token_present(self, response, csrf_id=None): self.assertContains(response, "name='csrfmiddlewaretoken' value='%s'" % (csrf_id or self._csrf_id)) def test_process_view_token_too_long(self): """ If the token is longer than expected, it is ignored and a new token is created. """ req = self._get_GET_no_csrf_cookie_request() req.COOKIES[settings.CSRF_COOKIE_NAME] = 'x' * 10000000 CsrfViewMiddleware().process_view(req, token_view, (), {}) resp = token_view(req) resp2 = CsrfViewMiddleware().process_response(req, resp) csrf_cookie = resp2.cookies.get(settings.CSRF_COOKIE_NAME, False) self.assertEqual(len(csrf_cookie.value), CSRF_KEY_LENGTH) def test_process_response_get_token_used(self): """ When get_token is used, check that the cookie is created and headers patched. """ req = self._get_GET_no_csrf_cookie_request() # Put tests for CSRF_COOKIE_* settings here with self.settings(CSRF_COOKIE_NAME='myname', CSRF_COOKIE_DOMAIN='.example.com', CSRF_COOKIE_PATH='/test/', CSRF_COOKIE_SECURE=True, CSRF_COOKIE_HTTPONLY=True): # token_view calls get_token() indirectly CsrfViewMiddleware().process_view(req, token_view, (), {}) resp = token_view(req) resp2 = CsrfViewMiddleware().process_response(req, resp) csrf_cookie = resp2.cookies.get('myname', False) self.assertNotEqual(csrf_cookie, False) self.assertEqual(csrf_cookie['domain'], '.example.com') self.assertEqual(csrf_cookie['secure'], True) self.assertEqual(csrf_cookie['httponly'], True) self.assertEqual(csrf_cookie['path'], '/test/') self.assertIn('Cookie', resp2.get('Vary', '')) def test_process_response_get_token_not_used(self): """ Check that if get_token() is not called, the view middleware does not add a cookie. """ # This is important to make pages cacheable. Pages which do call # get_token(), assuming they use the token, are not cacheable because # the token is specific to the user req = self._get_GET_no_csrf_cookie_request() # non_token_view_using_request_processor does not call get_token(), but # does use the csrf request processor. By using this, we are testing # that the view processor is properly lazy and doesn't call get_token() # until needed. CsrfViewMiddleware().process_view(req, non_token_view_using_request_processor, (), {}) resp = non_token_view_using_request_processor(req) resp2 = CsrfViewMiddleware().process_response(req, resp) csrf_cookie = resp2.cookies.get(settings.CSRF_COOKIE_NAME, False) self.assertEqual(csrf_cookie, False) # Check the request processing def test_process_request_no_csrf_cookie(self): """ Check that if no CSRF cookies is present, the middleware rejects the incoming request. This will stop login CSRF. """ req = self._get_POST_no_csrf_cookie_request() req2 = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertEqual(403, req2.status_code) def test_process_request_csrf_cookie_no_token(self): """ Check that if a CSRF cookie is present but no token, the middleware rejects the incoming request. """ req = self._get_POST_csrf_cookie_request() req2 = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertEqual(403, req2.status_code) def test_process_request_csrf_cookie_and_token(self): """ Check that if both a cookie and a token is present, the middleware lets it through. """ req = self._get_POST_request_with_token() req2 = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertIsNone(req2) def test_process_request_csrf_cookie_no_token_exempt_view(self): """ Check that if a CSRF cookie is present and no token, but the csrf_exempt decorator has been applied to the view, the middleware lets it through """ req = self._get_POST_csrf_cookie_request() req2 = CsrfViewMiddleware().process_view(req, csrf_exempt(post_form_view), (), {}) self.assertIsNone(req2) def test_csrf_token_in_header(self): """ Check that we can pass in the token in a header instead of in the form """ req = self._get_POST_csrf_cookie_request() req.META['HTTP_X_CSRFTOKEN'] = self._csrf_id req2 = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertIsNone(req2) @override_settings(CSRF_HEADER_NAME='HTTP_X_CSRFTOKEN_CUSTOMIZED') def test_csrf_token_in_header_with_customized_name(self): """ settings.CSRF_HEADER_NAME can be used to customize the CSRF header name """ req = self._get_POST_csrf_cookie_request() req.META['HTTP_X_CSRFTOKEN_CUSTOMIZED'] = self._csrf_id req2 = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertIsNone(req2) def test_put_and_delete_rejected(self): """ Tests that HTTP PUT and DELETE methods have protection """ req = TestingHttpRequest() req.method = 'PUT' req2 = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertEqual(403, req2.status_code) req = TestingHttpRequest() req.method = 'DELETE' req2 = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertEqual(403, req2.status_code) def test_put_and_delete_allowed(self): """ Tests that HTTP PUT and DELETE methods can get through with X-CSRFToken and a cookie """ req = self._get_GET_csrf_cookie_request() req.method = 'PUT' req.META['HTTP_X_CSRFTOKEN'] = self._csrf_id req2 = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertIsNone(req2) req = self._get_GET_csrf_cookie_request() req.method = 'DELETE' req.META['HTTP_X_CSRFTOKEN'] = self._csrf_id req2 = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertIsNone(req2) # Tests for the template tag method def test_token_node_no_csrf_cookie(self): """ Check that CsrfTokenNode works when no CSRF cookie is set """ req = self._get_GET_no_csrf_cookie_request() resp = token_view(req) token = get_token(req) self.assertIsNotNone(token) self._check_token_present(resp, token) def test_token_node_empty_csrf_cookie(self): """ Check that we get a new token if the csrf_cookie is the empty string """ req = self._get_GET_no_csrf_cookie_request() req.COOKIES[settings.CSRF_COOKIE_NAME] = b"" CsrfViewMiddleware().process_view(req, token_view, (), {}) resp = token_view(req) token = get_token(req) self.assertIsNotNone(token) self._check_token_present(resp, token) def test_token_node_with_csrf_cookie(self): """ Check that CsrfTokenNode works when a CSRF cookie is set """ req = self._get_GET_csrf_cookie_request() CsrfViewMiddleware().process_view(req, token_view, (), {}) resp = token_view(req) self._check_token_present(resp) def test_get_token_for_exempt_view(self): """ Check that get_token still works for a view decorated with 'csrf_exempt'. """ req = self._get_GET_csrf_cookie_request() CsrfViewMiddleware().process_view(req, csrf_exempt(token_view), (), {}) resp = token_view(req) self._check_token_present(resp) def test_get_token_for_requires_csrf_token_view(self): """ Check that get_token works for a view decorated solely with requires_csrf_token """ req = self._get_GET_csrf_cookie_request() resp = requires_csrf_token(token_view)(req) self._check_token_present(resp) def test_token_node_with_new_csrf_cookie(self): """ Check that CsrfTokenNode works when a CSRF cookie is created by the middleware (when one was not already present) """ req = self._get_GET_no_csrf_cookie_request() CsrfViewMiddleware().process_view(req, token_view, (), {}) resp = token_view(req) resp2 = CsrfViewMiddleware().process_response(req, resp) csrf_cookie = resp2.cookies[settings.CSRF_COOKIE_NAME] self._check_token_present(resp, csrf_id=csrf_cookie.value) @override_settings(DEBUG=True) def test_https_bad_referer(self): """ Test that a POST HTTPS request with a bad referer is rejected """ req = self._get_POST_request_with_token() req._is_secure_override = True req.META['HTTP_HOST'] = 'www.example.com' req.META['HTTP_REFERER'] = 'https://www.evil.org/somepage' req.META['SERVER_PORT'] = '443' response = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertContains( response, 'Referer checking failed - https://www.evil.org/somepage does not ' 'match any trusted origins.', status_code=403, ) @override_settings(DEBUG=True) def test_https_malformed_referer(self): """ A POST HTTPS request with a bad referer is rejected. """ malformed_referer_msg = 'Referer checking failed - Referer is malformed.' req = self._get_POST_request_with_token() req._is_secure_override = True req.META['HTTP_REFERER'] = 'http://http://www.example.com/' response = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertContains( response, 'Referer checking failed - Referer is insecure while host is secure.', status_code=403, ) # Empty req.META['HTTP_REFERER'] = '' response = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertContains(response, malformed_referer_msg, status_code=403) # Non-ASCII req.META['HTTP_REFERER'] = b'\xd8B\xf6I\xdf' response = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertContains(response, malformed_referer_msg, status_code=403) # missing scheme # >>> urlparse('//example.com/') # ParseResult(scheme='', netloc='example.com', path='/', params='', query='', fragment='') req.META['HTTP_REFERER'] = '//example.com/' response = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertContains(response, malformed_referer_msg, status_code=403) # missing netloc # >>> urlparse('https://') # ParseResult(scheme='https', netloc='', path='', params='', query='', fragment='') req.META['HTTP_REFERER'] = 'https://' response = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertContains(response, malformed_referer_msg, status_code=403) @override_settings(ALLOWED_HOSTS=['www.example.com']) def test_https_good_referer(self): """ A POST HTTPS request with a good referer is accepted. """ req = self._get_POST_request_with_token() req._is_secure_override = True req.META['HTTP_HOST'] = 'www.example.com' req.META['HTTP_REFERER'] = 'https://www.example.com/somepage' req2 = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertIsNone(req2) @override_settings(ALLOWED_HOSTS=['www.example.com']) def test_https_good_referer_2(self): """ A POST HTTPS request with a good referer is accepted where the referer contains no trailing slash. """ # See ticket #15617 req = self._get_POST_request_with_token() req._is_secure_override = True req.META['HTTP_HOST'] = 'www.example.com' req.META['HTTP_REFERER'] = 'https://www.example.com' req2 = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertIsNone(req2) @override_settings(ALLOWED_HOSTS=['www.example.com'], CSRF_TRUSTED_ORIGINS=['dashboard.example.com']) def test_https_csrf_trusted_origin_allowed(self): """ A POST HTTPS request with a referer added to the CSRF_TRUSTED_ORIGINS setting is accepted. """ req = self._get_POST_request_with_token() req._is_secure_override = True req.META['HTTP_HOST'] = 'www.example.com' req.META['HTTP_REFERER'] = 'https://dashboard.example.com' req2 = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertIsNone(req2) @override_settings(ALLOWED_HOSTS=['www.example.com'], CSRF_TRUSTED_ORIGINS=['.example.com']) def test_https_csrf_wildcard_trusted_origin_allowed(self): """ A POST HTTPS request with a referer that matches a CSRF_TRUSTED_ORIGINS wilcard is accepted. """ req = self._get_POST_request_with_token() req._is_secure_override = True req.META['HTTP_HOST'] = 'www.example.com' req.META['HTTP_REFERER'] = 'https://dashboard.example.com' response = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertIsNone(response) @override_settings(ALLOWED_HOSTS=['www.example.com'], CSRF_COOKIE_DOMAIN='.example.com') def test_https_good_referer_matches_cookie_domain(self): """ A POST HTTPS request with a good referer should be accepted from a subdomain that's allowed by CSRF_COOKIE_DOMAIN. """ req = self._get_POST_request_with_token() req._is_secure_override = True req.META['HTTP_REFERER'] = 'https://foo.example.com/' req.META['SERVER_PORT'] = '443' response = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertIsNone(response) @override_settings(ALLOWED_HOSTS=['www.example.com'], CSRF_COOKIE_DOMAIN='.example.com') def test_https_good_referer_matches_cookie_domain_with_different_port(self): """ A POST HTTPS request with a good referer should be accepted from a subdomain that's allowed by CSRF_COOKIE_DOMAIN and a non-443 port. """ req = self._get_POST_request_with_token() req._is_secure_override = True req.META['HTTP_HOST'] = 'www.example.com' req.META['HTTP_REFERER'] = 'https://foo.example.com:4443/' req.META['SERVER_PORT'] = '4443' response = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertIsNone(response) @override_settings(CSRF_COOKIE_DOMAIN='.example.com', DEBUG=True) def test_https_reject_insecure_referer(self): """ A POST HTTPS request from an insecure referer should be rejected. """ req = self._get_POST_request_with_token() req._is_secure_override = True req.META['HTTP_REFERER'] = 'http://example.com/' req.META['SERVER_PORT'] = '443' response = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertContains( response, 'Referer checking failed - Referer is insecure while host is secure.', status_code=403, ) def test_ensures_csrf_cookie_no_middleware(self): """ The ensure_csrf_cookie() decorator works without middleware. """ @ensure_csrf_cookie def view(request): # Doesn't insert a token or anything return HttpResponse(content="") req = self._get_GET_no_csrf_cookie_request() resp = view(req) self.assertTrue(resp.cookies.get(settings.CSRF_COOKIE_NAME, False)) self.assertIn('Cookie', resp.get('Vary', '')) def test_ensures_csrf_cookie_with_middleware(self): """ The ensure_csrf_cookie() decorator works with the CsrfViewMiddleware enabled. """ @ensure_csrf_cookie def view(request): # Doesn't insert a token or anything return HttpResponse(content="") req = self._get_GET_no_csrf_cookie_request() CsrfViewMiddleware().process_view(req, view, (), {}) resp = view(req) resp2 = CsrfViewMiddleware().process_response(req, resp) self.assertTrue(resp2.cookies.get(settings.CSRF_COOKIE_NAME, False)) self.assertIn('Cookie', resp2.get('Vary', '')) def test_ensures_csrf_cookie_no_logging(self): """ ensure_csrf_cookie() doesn't log warnings (#19436). """ @ensure_csrf_cookie def view(request): # Doesn't insert a token or anything return HttpResponse(content="") class TestHandler(logging.Handler): def emit(self, record): raise Exception("This shouldn't have happened!") logger = logging.getLogger('django.request') test_handler = TestHandler() old_log_level = logger.level try: logger.addHandler(test_handler) logger.setLevel(logging.WARNING) req = self._get_GET_no_csrf_cookie_request() view(req) finally: logger.removeHandler(test_handler) logger.setLevel(old_log_level) def test_csrf_cookie_age(self): """ CSRF cookie age can be set using settings.CSRF_COOKIE_AGE. """ req = self._get_GET_no_csrf_cookie_request() MAX_AGE = 123 with self.settings(CSRF_COOKIE_NAME='csrfcookie', CSRF_COOKIE_DOMAIN='.example.com', CSRF_COOKIE_AGE=MAX_AGE, CSRF_COOKIE_PATH='/test/', CSRF_COOKIE_SECURE=True, CSRF_COOKIE_HTTPONLY=True): # token_view calls get_token() indirectly CsrfViewMiddleware().process_view(req, token_view, (), {}) resp = token_view(req) resp2 = CsrfViewMiddleware().process_response(req, resp) max_age = resp2.cookies.get('csrfcookie').get('max-age') self.assertEqual(max_age, MAX_AGE) def test_csrf_cookie_age_none(self): """ CSRF cookie age does not have max age set and therefore uses session-based cookies. """ req = self._get_GET_no_csrf_cookie_request() MAX_AGE = None with self.settings(CSRF_COOKIE_NAME='csrfcookie', CSRF_COOKIE_DOMAIN='.example.com', CSRF_COOKIE_AGE=MAX_AGE, CSRF_COOKIE_PATH='/test/', CSRF_COOKIE_SECURE=True, CSRF_COOKIE_HTTPONLY=True): # token_view calls get_token() indirectly CsrfViewMiddleware().process_view(req, token_view, (), {}) resp = token_view(req) resp2 = CsrfViewMiddleware().process_response(req, resp) max_age = resp2.cookies.get('csrfcookie').get('max-age') self.assertEqual(max_age, '') def test_post_data_read_failure(self): """ #20128 -- IOErrors during POST data reading should be caught and treated as if the POST data wasn't there. """ class CsrfPostRequest(HttpRequest): """ HttpRequest that can raise an IOError when accessing POST data """ def __init__(self, token, raise_error): super(CsrfPostRequest, self).__init__() self.method = 'POST' self.raise_error = False self.COOKIES[settings.CSRF_COOKIE_NAME] = token self.POST['csrfmiddlewaretoken'] = token self.raise_error = raise_error def _load_post_and_files(self): raise IOError('error reading input data') def _get_post(self): if self.raise_error: self._load_post_and_files() return self._post def _set_post(self, post): self._post = post POST = property(_get_post, _set_post) token = 'ABC' req = CsrfPostRequest(token, raise_error=False) resp = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertIsNone(resp) req = CsrfPostRequest(token, raise_error=True) resp = CsrfViewMiddleware().process_view(req, post_form_view, (), {}) self.assertEqual(resp.status_code, 403)
bsd-3-clause
wizyoung/workflows.kyoyue
PIL/ImageWin.py
9
7167
# # The Python Imaging Library. # $Id$ # # a Windows DIB display interface # # History: # 1996-05-20 fl Created # 1996-09-20 fl Fixed subregion exposure # 1997-09-21 fl Added draw primitive (for tzPrint) # 2003-05-21 fl Added experimental Window/ImageWindow classes # 2003-09-05 fl Added fromstring/tostring methods # # Copyright (c) Secret Labs AB 1997-2003. # Copyright (c) Fredrik Lundh 1996-2003. # # See the README file for information on usage and redistribution. # from . import Image class HDC(object): """ Wraps an HDC integer. The resulting object can be passed to the :py:meth:`~PIL.ImageWin.Dib.draw` and :py:meth:`~PIL.ImageWin.Dib.expose` methods. """ def __init__(self, dc): self.dc = dc def __int__(self): return self.dc class HWND(object): """ Wraps an HWND integer. The resulting object can be passed to the :py:meth:`~PIL.ImageWin.Dib.draw` and :py:meth:`~PIL.ImageWin.Dib.expose` methods, instead of a DC. """ def __init__(self, wnd): self.wnd = wnd def __int__(self): return self.wnd class Dib(object): """ A Windows bitmap with the given mode and size. The mode can be one of "1", "L", "P", or "RGB". If the display requires a palette, this constructor creates a suitable palette and associates it with the image. For an "L" image, 128 greylevels are allocated. For an "RGB" image, a 6x6x6 colour cube is used, together with 20 greylevels. To make sure that palettes work properly under Windows, you must call the **palette** method upon certain events from Windows. :param image: Either a PIL image, or a mode string. If a mode string is used, a size must also be given. The mode can be one of "1", "L", "P", or "RGB". :param size: If the first argument is a mode string, this defines the size of the image. """ def __init__(self, image, size=None): if hasattr(image, "mode") and hasattr(image, "size"): mode = image.mode size = image.size else: mode = image image = None if mode not in ["1", "L", "P", "RGB"]: mode = Image.getmodebase(mode) self.image = Image.core.display(mode, size) self.mode = mode self.size = size if image: self.paste(image) def expose(self, handle): """ Copy the bitmap contents to a device context. :param handle: Device context (HDC), cast to a Python integer, or an HDC or HWND instance. In PythonWin, you can use the :py:meth:`CDC.GetHandleAttrib` to get a suitable handle. """ if isinstance(handle, HWND): dc = self.image.getdc(handle) try: result = self.image.expose(dc) finally: self.image.releasedc(handle, dc) else: result = self.image.expose(handle) return result def draw(self, handle, dst, src=None): """ Same as expose, but allows you to specify where to draw the image, and what part of it to draw. The destination and source areas are given as 4-tuple rectangles. If the source is omitted, the entire image is copied. If the source and the destination have different sizes, the image is resized as necessary. """ if not src: src = (0, 0) + self.size if isinstance(handle, HWND): dc = self.image.getdc(handle) try: result = self.image.draw(dc, dst, src) finally: self.image.releasedc(handle, dc) else: result = self.image.draw(handle, dst, src) return result def query_palette(self, handle): """ Installs the palette associated with the image in the given device context. This method should be called upon **QUERYNEWPALETTE** and **PALETTECHANGED** events from Windows. If this method returns a non-zero value, one or more display palette entries were changed, and the image should be redrawn. :param handle: Device context (HDC), cast to a Python integer, or an HDC or HWND instance. :return: A true value if one or more entries were changed (this indicates that the image should be redrawn). """ if isinstance(handle, HWND): handle = self.image.getdc(handle) try: result = self.image.query_palette(handle) finally: self.image.releasedc(handle, handle) else: result = self.image.query_palette(handle) return result def paste(self, im, box=None): """ Paste a PIL image into the bitmap image. :param im: A PIL image. The size must match the target region. If the mode does not match, the image is converted to the mode of the bitmap image. :param box: A 4-tuple defining the left, upper, right, and lower pixel coordinate. If None is given instead of a tuple, all of the image is assumed. """ im.load() if self.mode != im.mode: im = im.convert(self.mode) if box: self.image.paste(im.im, box) else: self.image.paste(im.im) def frombytes(self, buffer): """ Load display memory contents from byte data. :param buffer: A buffer containing display data (usually data returned from <b>tobytes</b>) """ return self.image.frombytes(buffer) def tobytes(self): """ Copy display memory contents to bytes object. :return: A bytes object containing display data. """ return self.image.tobytes() class Window(object): """Create a Window with the given title size.""" def __init__(self, title="PIL", width=None, height=None): self.hwnd = Image.core.createwindow( title, self.__dispatcher, width or 0, height or 0 ) def __dispatcher(self, action, *args): return getattr(self, "ui_handle_" + action)(*args) def ui_handle_clear(self, dc, x0, y0, x1, y1): pass def ui_handle_damage(self, x0, y0, x1, y1): pass def ui_handle_destroy(self): pass def ui_handle_repair(self, dc, x0, y0, x1, y1): pass def ui_handle_resize(self, width, height): pass def mainloop(self): Image.core.eventloop() class ImageWindow(Window): """Create an image window which displays the given image.""" def __init__(self, image, title="PIL"): if not isinstance(image, Dib): image = Dib(image) self.image = image width, height = image.size Window.__init__(self, title, width=width, height=height) def ui_handle_repair(self, dc, x0, y0, x1, y1): self.image.draw(dc, (x0, y0, x1, y1))
mit
detiber/openshift-ansible-contrib
reference-architecture/aws-ansible/add-cns-storage.py
1
13272
#!/usr/bin/env python # vim: sw=2 ts=2 import click import os import sys @click.command() ### Cluster options @click.option('--console-port', default='443', type=click.IntRange(1,65535), help='OpenShift web console port', show_default=True) @click.option('--deployment-type', default='openshift-enterprise', help='OpenShift deployment type', show_default=True) @click.option('--openshift-sdn', default='openshift-ovs-subnet', type=click.Choice(['openshift-ovs-subnet', 'openshift-ovs-multitenant']), help='OpenShift SDN', show_default=True) ### AWS/EC2 options @click.option('--gluster-stack', help='Specify a gluster stack name. Making the name unique will allow for multiple deployments', show_default=True) @click.option('--region', default='us-east-1', help='ec2 region', show_default=True) @click.option('--ami', default='ami-10251c7a', help='ec2 ami', show_default=True) @click.option('--node-instance-type', default='m4.2xlarge', help='ec2 instance type', show_default=True) @click.option('--use-cloudformation-facts', is_flag=True, help='Use cloudformation to populate facts. Requires Deployment >= OCP 3.5', show_default=True) @click.option('--keypair', help='ec2 keypair name', show_default=True) @click.option('--private-subnet-id1', help='Specify a Private subnet within the existing VPC', show_default=True) @click.option('--private-subnet-id2', help='Specify a Private subnet within the existing VPC', show_default=True) @click.option('--private-subnet-id3', help='Specify a Private subnet within the existing VPC', show_default=True) @click.option('--gluster-volume-size', default='500', help='Gluster volume size in GB', show_default=True) @click.option('--gluster-volume-type', default='st1', help='Gluster volume type', show_default=True) @click.option('--iops', help='Specfify the IOPS for a volume (used only with IO1)', show_default=True) ### DNS options @click.option('--public-hosted-zone', help='hosted zone for accessing the environment') ### Subscription and Software options @click.option('--rhsm-user', help='Red Hat Subscription Management User') @click.option('--rhsm-password', help='Red Hat Subscription Management Password', hide_input=True,) @click.option('--rhsm-pool', help='Red Hat Subscription Management Pool Name') ### Miscellaneous options @click.option('--containerized', default='False', help='Containerized installation of OpenShift', show_default=True) @click.option('--iam-role', help='Specify the name of the existing IAM Instance profile', show_default=True) @click.option('--node-sg', help='Specify the already existing node security group id', show_default=True) @click.option('--existing-stack', help='Specify the name of the existing CloudFormation stack') @click.option('--no-confirm', is_flag=True, help='Skip confirmation prompt') @click.help_option('--help', '-h') @click.option('-v', '--verbose', count=True) def launch_refarch_env(region=None, ami=None, no_confirm=False, node_instance_type=None, gluster_stack=None, keypair=None, public_hosted_zone=None, deployment_type=None, console_port=443, rhsm_user=None, rhsm_password=None, rhsm_pool=None, containerized=None, node_type=None, private_subnet_id1=None, private_subnet_id2=None, private_subnet_id3=None, gluster_volume_type=None, gluster_volume_size=None, openshift_sdn=None, iops=None, node_sg=None, iam_role=None, existing_stack=None, use_cloudformation_facts=False, verbose=0): # Need to prompt for the R53 zone: if public_hosted_zone is None: public_hosted_zone = click.prompt('Hosted DNS zone for accessing the environment') if existing_stack is None: existing_stack = click.prompt('Specify the name of the existing CloudFormation stack') if gluster_stack is None: gluster_stack = click.prompt('Specify a unique name for the CNS CloudFormation stack') # If no keypair is specified fail: if keypair is None: keypair = click.prompt('A SSH keypair must be specified or created') # If the user already provided values, don't bother asking again if deployment_type in ['openshift-enterprise'] and rhsm_user is None: rhsm_user = click.prompt("RHSM username?") if deployment_type in ['openshift-enterprise'] and rhsm_password is None: rhsm_password = click.prompt("RHSM password?", hide_input=True) if deployment_type in ['openshift-enterprise'] and rhsm_pool is None: rhsm_pool = click.prompt("RHSM Pool ID or Subscription Name for OpenShift?") # Prompt for vars if they are not defined if use_cloudformation_facts and iam_role is None: iam_role = "Computed by Cloudformations" elif iam_role is None: iam_role = click.prompt("Specify the IAM Role of the node?") if use_cloudformation_facts and node_sg is None: node_sg = "Computed by Cloudformations" elif node_sg is None: node_sg = click.prompt("Specify the Security Group for the nodes?") if use_cloudformation_facts and private_subnet_id1 is None: private_subnet_id1 = "Computed by Cloudformations" elif private_subnet_id1 is None: private_subnet_id1 = click.prompt("Specify the first private subnet for the nodes?") if use_cloudformation_facts and private_subnet_id2 is None: private_subnet_id2 = "Computed by Cloudformations" elif private_subnet_id2 is None: private_subnet_id2 = click.prompt("Specify the second private subnet for the nodes?") if use_cloudformation_facts and private_subnet_id3 is None: private_subnet_id3 = "Computed by Cloudformations" elif private_subnet_id3 is None: private_subnet_id3 = click.prompt("Specify the third private subnet for the nodes?") if gluster_volume_type in ['io1']: iops = click.prompt('Specify a numeric value for iops') if iops is None: iops = "NA" # Hidden facts for infrastructure.yaml create_key = "no" create_vpc = "no" add_node = "yes" node_type = "gluster" # Display information to the user about their choices if use_cloudformation_facts: click.echo('Configured values:') click.echo('\tami: %s' % ami) click.echo('\tregion: %s' % region) click.echo('\tgluster_stack: %s' % gluster_stack) click.echo('\tnode_instance_type: %s' % node_instance_type) click.echo('\tgluster_volume_type: %s' % gluster_volume_type) click.echo('\tgluster_volume_size: %s' % gluster_volume_size) click.echo('\tiops: %s' % iops) click.echo('\topenshift_sdn: %s' % openshift_sdn) click.echo('\tkeypair: %s' % keypair) click.echo('\tdeployment_type: %s' % deployment_type) click.echo('\tpublic_hosted_zone: %s' % public_hosted_zone) click.echo('\tconsole port: %s' % console_port) click.echo('\trhsm_user: %s' % rhsm_user) click.echo('\trhsm_password: *******') click.echo('\trhsm_pool: %s' % rhsm_pool) click.echo('\tcontainerized: %s' % containerized) click.echo('\texisting_stack: %s' % existing_stack) click.echo('\tSubnets, Security Groups, and IAM Roles will be gather from the CloudFormation') click.echo("") else: click.echo('Configured values:') click.echo('\tami: %s' % ami) click.echo('\tregion: %s' % region) click.echo('\tgluster_stack: %s' % gluster_stack) click.echo('\tnode_instance_type: %s' % node_instance_type) click.echo('\tprivate_subnet_id1: %s' % private_subnet_id1) click.echo('\tprivate_subnet_id2: %s' % private_subnet_id2) click.echo('\tprivate_subnet_id3: %s' % private_subnet_id3) click.echo('\tgluster_volume_type: %s' % gluster_volume_type) click.echo('\tgluster_volume_size: %s' % gluster_volume_size) click.echo('\tiops: %s' % iops) click.echo('\openshift_sdn: %s' % openshift_sdn) click.echo('\tkeypair: %s' % keypair) click.echo('\tkeypair: %s' % keypair) click.echo('\tnode_sg: %s' % node_sg) click.echo('\tdeployment_type: %s' % deployment_type) click.echo('\tpublic_hosted_zone: %s' % public_hosted_zone) click.echo('\tconsole port: %s' % console_port) click.echo('\trhsm_user: %s' % rhsm_user) click.echo('\trhsm_password: *******') click.echo('\trhsm_pool: %s' % rhsm_pool) click.echo('\tcontainerized: %s' % containerized) click.echo('\tiam_role: %s' % iam_role) click.echo('\texisting_stack: %s' % existing_stack) click.echo("") if not no_confirm: click.confirm('Continue using these values?', abort=True) playbooks = ['playbooks/infrastructure.yaml', 'playbooks/add-node.yaml'] for playbook in playbooks: # hide cache output unless in verbose mode devnull='> /dev/null' if verbose > 0: devnull='' # refresh the inventory cache to prevent stale hosts from # interferring with re-running command='inventory/aws/hosts/ec2.py --refresh-cache %s' % (devnull) os.system(command) # remove any cached facts to prevent stale data during a re-run command='rm -rf .ansible/cached_facts' os.system(command) if use_cloudformation_facts: command='ansible-playbook -i inventory/aws/hosts -e \'region=%s \ ami=%s \ keypair=%s \ gluster_stack=%s \ add_node=yes \ node_instance_type=%s \ public_hosted_zone=%s \ deployment_type=%s \ console_port=%s \ rhsm_user=%s \ rhsm_password=%s \ rhsm_pool="%s" \ containerized=%s \ node_type=gluster \ key_path=/dev/null \ create_key=%s \ create_vpc=%s \ gluster_volume_type=%s \ gluster_volume_size=%s \ iops=%s \ openshift_sdn=%s \ stack_name=%s \' %s' % (region, ami, keypair, gluster_stack, node_instance_type, public_hosted_zone, deployment_type, console_port, rhsm_user, rhsm_password, rhsm_pool, containerized, create_key, create_vpc, gluster_volume_type, gluster_volume_size, iops, openshift_sdn, existing_stack, playbook) else: command='ansible-playbook -i inventory/aws/hosts -e \'region=%s \ ami=%s \ keypair=%s \ gluster_stack=%s \ add_node=yes \ node_sg=%s \ node_instance_type=%s \ private_subnet_id1=%s \ private_subnet_id2=%s \ private_subnet_id3=%s \ public_hosted_zone=%s \ deployment_type=%s \ console_port=%s \ rhsm_user=%s \ rhsm_password=%s \ rhsm_pool="%s" \ containerized=%s \ node_type=gluster \ iam_role=%s \ key_path=/dev/null \ create_key=%s \ create_vpc=%s \ gluster_volume_type=%s \ gluster_volume_size=%s \ iops=%s \ openshift_sdn=%s \ stack_name=%s \' %s' % (region, ami, keypair, gluster_stack, node_sg, node_instance_type, private_subnet_id1, private_subnet_id2, private_subnet_id3, public_hosted_zone, deployment_type, console_port, rhsm_user, rhsm_password, rhsm_pool, containerized, iam_role, create_key, create_vpc, gluster_volume_type, gluster_volume_size, iops, openshift_sdn, existing_stack, playbook) if verbose > 0: command += " -" + "".join(['v']*verbose) click.echo('We are running: %s' % command) status = os.system(command) if os.WIFEXITED(status) and os.WEXITSTATUS(status) != 0: return os.WEXITSTATUS(status) if __name__ == '__main__': # check for AWS access info if os.getenv('AWS_ACCESS_KEY_ID') is None or os.getenv('AWS_SECRET_ACCESS_KEY') is None: print 'AWS_ACCESS_KEY_ID and AWS_SECRET_ACCESS_KEY **MUST** be exported as environment variables.' sys.exit(1) launch_refarch_env(auto_envvar_prefix='OSE_REFArch')
apache-2.0
lmazuel/azure-sdk-for-python
azure-mgmt-eventhub/azure/mgmt/eventhub/models/__init__.py
2
2621
# coding=utf-8 # -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for # license information. # # Code generated by Microsoft (R) AutoRest Code Generator. # Changes may cause incorrect behavior and will be lost if the code is # regenerated. # -------------------------------------------------------------------------- from .tracked_resource import TrackedResource from .resource import Resource from .sku import Sku from .eh_namespace import EHNamespace from .authorization_rule import AuthorizationRule from .access_keys import AccessKeys from .regenerate_access_key_parameters import RegenerateAccessKeyParameters from .destination import Destination from .capture_description import CaptureDescription from .eventhub import Eventhub from .consumer_group import ConsumerGroup from .check_name_availability_parameter import CheckNameAvailabilityParameter from .check_name_availability_result import CheckNameAvailabilityResult from .operation_display import OperationDisplay from .operation import Operation from .error_response import ErrorResponse, ErrorResponseException from .arm_disaster_recovery import ArmDisasterRecovery from .operation_paged import OperationPaged from .eh_namespace_paged import EHNamespacePaged from .authorization_rule_paged import AuthorizationRulePaged from .arm_disaster_recovery_paged import ArmDisasterRecoveryPaged from .eventhub_paged import EventhubPaged from .consumer_group_paged import ConsumerGroupPaged from .event_hub_management_client_enums import ( SkuName, SkuTier, AccessRights, KeyType, EntityStatus, EncodingCaptureDescription, UnavailableReason, ProvisioningStateDR, RoleDisasterRecovery, ) __all__ = [ 'TrackedResource', 'Resource', 'Sku', 'EHNamespace', 'AuthorizationRule', 'AccessKeys', 'RegenerateAccessKeyParameters', 'Destination', 'CaptureDescription', 'Eventhub', 'ConsumerGroup', 'CheckNameAvailabilityParameter', 'CheckNameAvailabilityResult', 'OperationDisplay', 'Operation', 'ErrorResponse', 'ErrorResponseException', 'ArmDisasterRecovery', 'OperationPaged', 'EHNamespacePaged', 'AuthorizationRulePaged', 'ArmDisasterRecoveryPaged', 'EventhubPaged', 'ConsumerGroupPaged', 'SkuName', 'SkuTier', 'AccessRights', 'KeyType', 'EntityStatus', 'EncodingCaptureDescription', 'UnavailableReason', 'ProvisioningStateDR', 'RoleDisasterRecovery', ]
mit
mileswwatkins/pupa
pupa/scrape/schemas/bill.py
2
4736
""" Schema for bill objects. """ from .common import sources, extras, fuzzy_date_blank, fuzzy_date from opencivicdata import common versions_or_documents = { "items": { "properties": { "note": {"type": "string"}, "date": fuzzy_date_blank, "links": { "items": { "properties": { "media_type": {"type": "string", "blank": True }, "url": {"type": "string", "format": "uri"} }, "type": "object" }, "type": "array", }, }, "type": "object" }, "type": "array", } schema = { "type": "object", "properties": { "legislative_session": {"type": "string"}, "identifier": {"type": "string"}, "title": {"type": "string"}, "from_organization": { "type": ["string", "null"] }, "classification": {"items": {"type": "string", "enum": common.BILL_CLASSIFICATIONS}, "type": "array"}, "subject": { "items": {"type": "string"}, "type": "array"}, "abstracts": { "items": { "properties": { "abstract": {"type": "string"}, "note": {"type": "string", "blank": True}, "date": {"type": "string", "blank": True}, }, "type": "object"}, "type": "array", }, "other_titles": { "items": { "properties": { "title": {"type": "string"}, "note": {"type": "string", "blank": True}, }, "type": "object" }, "type": "array", }, "other_identifiers": { "items": { "properties": { "identifier": {"type": "string"}, "note": {"type": "string", "blank": True}, "scheme": {"type": "string", "blank": True}, }, "type": "object" }, "type": "array", }, "actions": { "items": { "properties": { "organization": { "type": ["string", "null"] }, "date": fuzzy_date, "description": { "type": "string" }, "classification": {"items": {"type": "string", "enum": common.BILL_ACTION_CLASSIFICATIONS }, "type": "array", }, "related_entities": { "items": { "properties": { "name": {"type": "string"}, "entity_type": { "enum": ["organization", "person", ""], "type": "string", "blank": True, }, "person_id": {"type": ["string", "null"]}, "organization_id": {"type": ["string", "null"]}, }, "type": "object" }, "type": "array", }, }, "type": "object" }, "type": "array", }, "sponsorships": { "items": { "properties": { "primary": { "type": "boolean" }, "classification": { "type": "string", }, "name": {"type": "string" }, "entity_type": { "enum": ["organization", "person", ""], "type": "string", "blank": True, }, "person_id": {"type": ["string", "null"] }, "organization_id": {"type": ["string", "null"] }, }, "type": "object" }, "type": "array", }, "related_bills": { "items": { "properties": { "identifier": {"type": "string"}, "legislative_session": {"type": "string"}, "relation_type": {"enum": common.BILL_RELATION_TYPES, "type": "string"}, }, "type": "object" }, "type": "array", }, "versions": versions_or_documents, "documents": versions_or_documents, "sources": sources, "extras": extras, } }
bsd-3-clause
EmmanuelJohnson/ssquiz
flask/lib/python2.7/site-packages/whoosh/query/__init__.py
96
1843
# Copyright 2012 Matt Chaput. All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are met: # # 1. Redistributions of source code must retain the above copyright notice, # this list of conditions and the following disclaimer. # # 2. Redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution. # # THIS SOFTWARE IS PROVIDED BY MATT CHAPUT ``AS IS'' AND ANY EXPRESS OR # IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF # MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO # EVENT SHALL MATT CHAPUT OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, # INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, # OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF # LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING # NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, # EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. # # The views and conclusions contained in the software and documentation are # those of the authors and should not be interpreted as representing official # policies, either expressed or implied, of Matt Chaput. from whoosh.query.qcore import * from whoosh.query.terms import * from whoosh.query.compound import * from whoosh.query.positional import * from whoosh.query.ranges import * from whoosh.query.wrappers import * from whoosh.query.nested import * from whoosh.query.qcolumns import * from whoosh.query.spans import *
bsd-3-clause
robhudson/django
tests/template_tests/filter_tests/test_escapejs.py
324
2055
from __future__ import unicode_literals from django.template.defaultfilters import escapejs_filter from django.test import SimpleTestCase from ..utils import setup class EscapejsTests(SimpleTestCase): @setup({'escapejs01': '{{ a|escapejs }}'}) def test_escapejs01(self): output = self.engine.render_to_string('escapejs01', {'a': 'testing\r\njavascript \'string" <b>escaping</b>'}) self.assertEqual(output, 'testing\\u000D\\u000Ajavascript ' '\\u0027string\\u0022 \\u003Cb\\u003E' 'escaping\\u003C/b\\u003E') @setup({'escapejs02': '{% autoescape off %}{{ a|escapejs }}{% endautoescape %}'}) def test_escapejs02(self): output = self.engine.render_to_string('escapejs02', {'a': 'testing\r\njavascript \'string" <b>escaping</b>'}) self.assertEqual(output, 'testing\\u000D\\u000Ajavascript ' '\\u0027string\\u0022 \\u003Cb\\u003E' 'escaping\\u003C/b\\u003E') class FunctionTests(SimpleTestCase): def test_quotes(self): self.assertEqual( escapejs_filter('"double quotes" and \'single quotes\''), '\\u0022double quotes\\u0022 and \\u0027single quotes\\u0027', ) def test_backslashes(self): self.assertEqual(escapejs_filter(r'\ : backslashes, too'), '\\u005C : backslashes, too') def test_whitespace(self): self.assertEqual( escapejs_filter('and lots of whitespace: \r\n\t\v\f\b'), 'and lots of whitespace: \\u000D\\u000A\\u0009\\u000B\\u000C\\u0008', ) def test_script(self): self.assertEqual( escapejs_filter(r'<script>and this</script>'), '\\u003Cscript\\u003Eand this\\u003C/script\\u003E', ) def test_paragraph_separator(self): self.assertEqual( escapejs_filter('paragraph separator:\u2029and line separator:\u2028'), 'paragraph separator:\\u2029and line separator:\\u2028', )
bsd-3-clause
0111001101111010/open-health-inspection-api
venv/lib/python2.7/site-packages/pip/commands/install.py
342
12694
import os import sys import tempfile import shutil from pip.req import InstallRequirement, RequirementSet, parse_requirements from pip.log import logger from pip.locations import (src_prefix, virtualenv_no_global, distutils_scheme, build_prefix) from pip.basecommand import Command from pip.index import PackageFinder from pip.exceptions import InstallationError, CommandError, PreviousBuildDirError from pip import cmdoptions class InstallCommand(Command): """ Install packages from: - PyPI (and other indexes) using requirement specifiers. - VCS project urls. - Local project directories. - Local or remote source archives. pip also supports installing from "requirements files", which provide an easy way to specify a whole environment to be installed. """ name = 'install' usage = """ %prog [options] <requirement specifier> ... %prog [options] -r <requirements file> ... %prog [options] [-e] <vcs project url> ... %prog [options] [-e] <local project path> ... %prog [options] <archive url/path> ...""" summary = 'Install packages.' bundle = False def __init__(self, *args, **kw): super(InstallCommand, self).__init__(*args, **kw) cmd_opts = self.cmd_opts cmd_opts.add_option( '-e', '--editable', dest='editables', action='append', default=[], metavar='path/url', help='Install a project in editable mode (i.e. setuptools "develop mode") from a local project path or a VCS url.') cmd_opts.add_option(cmdoptions.requirements.make()) cmd_opts.add_option(cmdoptions.build_dir.make()) cmd_opts.add_option( '-t', '--target', dest='target_dir', metavar='dir', default=None, help='Install packages into <dir>.') cmd_opts.add_option( '-d', '--download', '--download-dir', '--download-directory', dest='download_dir', metavar='dir', default=None, help="Download packages into <dir> instead of installing them, regardless of what's already installed.") cmd_opts.add_option(cmdoptions.download_cache.make()) cmd_opts.add_option( '--src', '--source', '--source-dir', '--source-directory', dest='src_dir', metavar='dir', default=src_prefix, help='Directory to check out editable projects into. ' 'The default in a virtualenv is "<venv path>/src". ' 'The default for global installs is "<current dir>/src".') cmd_opts.add_option( '-U', '--upgrade', dest='upgrade', action='store_true', help='Upgrade all packages to the newest available version. ' 'This process is recursive regardless of whether a dependency is already satisfied.') cmd_opts.add_option( '--force-reinstall', dest='force_reinstall', action='store_true', help='When upgrading, reinstall all packages even if they are ' 'already up-to-date.') cmd_opts.add_option( '-I', '--ignore-installed', dest='ignore_installed', action='store_true', help='Ignore the installed packages (reinstalling instead).') cmd_opts.add_option(cmdoptions.no_deps.make()) cmd_opts.add_option( '--no-install', dest='no_install', action='store_true', help="DEPRECATED. Download and unpack all packages, but don't actually install them.") cmd_opts.add_option( '--no-download', dest='no_download', action="store_true", help="DEPRECATED. Don't download any packages, just install the ones already downloaded " "(completes an install run with --no-install).") cmd_opts.add_option(cmdoptions.install_options.make()) cmd_opts.add_option(cmdoptions.global_options.make()) cmd_opts.add_option( '--user', dest='use_user_site', action='store_true', help='Install using the user scheme.') cmd_opts.add_option( '--egg', dest='as_egg', action='store_true', help="Install packages as eggs, not 'flat', like pip normally does. This option is not about installing *from* eggs. (WARNING: Because this option overrides pip's normal install logic, requirements files may not behave as expected.)") cmd_opts.add_option( '--root', dest='root_path', metavar='dir', default=None, help="Install everything relative to this alternate root directory.") cmd_opts.add_option( "--compile", action="store_true", dest="compile", default=True, help="Compile py files to pyc", ) cmd_opts.add_option( "--no-compile", action="store_false", dest="compile", help="Do not compile py files to pyc", ) cmd_opts.add_option(cmdoptions.use_wheel.make()) cmd_opts.add_option(cmdoptions.no_use_wheel.make()) cmd_opts.add_option( '--pre', action='store_true', default=False, help="Include pre-release and development versions. By default, pip only finds stable versions.") cmd_opts.add_option(cmdoptions.no_clean.make()) index_opts = cmdoptions.make_option_group(cmdoptions.index_group, self.parser) self.parser.insert_option_group(0, index_opts) self.parser.insert_option_group(0, cmd_opts) def _build_package_finder(self, options, index_urls, session): """ Create a package finder appropriate to this install command. This method is meant to be overridden by subclasses, not called directly. """ return PackageFinder(find_links=options.find_links, index_urls=index_urls, use_wheel=options.use_wheel, allow_external=options.allow_external, allow_unverified=options.allow_unverified, allow_all_external=options.allow_all_external, allow_all_prereleases=options.pre, process_dependency_links= options.process_dependency_links, session=session, ) def run(self, options, args): if ( options.no_install or options.no_download or (options.build_dir != build_prefix) or options.no_clean ): logger.deprecated('1.7', 'DEPRECATION: --no-install, --no-download, --build, ' 'and --no-clean are deprecated. See https://github.com/pypa/pip/issues/906.') if options.download_dir: options.no_install = True options.ignore_installed = True options.build_dir = os.path.abspath(options.build_dir) options.src_dir = os.path.abspath(options.src_dir) install_options = options.install_options or [] if options.use_user_site: if virtualenv_no_global(): raise InstallationError("Can not perform a '--user' install. User site-packages are not visible in this virtualenv.") install_options.append('--user') temp_target_dir = None if options.target_dir: options.ignore_installed = True temp_target_dir = tempfile.mkdtemp() options.target_dir = os.path.abspath(options.target_dir) if os.path.exists(options.target_dir) and not os.path.isdir(options.target_dir): raise CommandError("Target path exists but is not a directory, will not continue.") install_options.append('--home=' + temp_target_dir) global_options = options.global_options or [] index_urls = [options.index_url] + options.extra_index_urls if options.no_index: logger.notify('Ignoring indexes: %s' % ','.join(index_urls)) index_urls = [] if options.use_mirrors: logger.deprecated("1.7", "--use-mirrors has been deprecated and will be removed" " in the future. Explicit uses of --index-url and/or " "--extra-index-url is suggested.") if options.mirrors: logger.deprecated("1.7", "--mirrors has been deprecated and will be removed in " " the future. Explicit uses of --index-url and/or " "--extra-index-url is suggested.") index_urls += options.mirrors session = self._build_session(options) finder = self._build_package_finder(options, index_urls, session) requirement_set = RequirementSet( build_dir=options.build_dir, src_dir=options.src_dir, download_dir=options.download_dir, download_cache=options.download_cache, upgrade=options.upgrade, as_egg=options.as_egg, ignore_installed=options.ignore_installed, ignore_dependencies=options.ignore_dependencies, force_reinstall=options.force_reinstall, use_user_site=options.use_user_site, target_dir=temp_target_dir, session=session, pycompile=options.compile, ) for name in args: requirement_set.add_requirement( InstallRequirement.from_line(name, None)) for name in options.editables: requirement_set.add_requirement( InstallRequirement.from_editable(name, default_vcs=options.default_vcs)) for filename in options.requirements: for req in parse_requirements(filename, finder=finder, options=options, session=session): requirement_set.add_requirement(req) if not requirement_set.has_requirements: opts = {'name': self.name} if options.find_links: msg = ('You must give at least one requirement to %(name)s ' '(maybe you meant "pip %(name)s %(links)s"?)' % dict(opts, links=' '.join(options.find_links))) else: msg = ('You must give at least one requirement ' 'to %(name)s (see "pip help %(name)s")' % opts) logger.warn(msg) return try: if not options.no_download: requirement_set.prepare_files(finder, force_root_egg_info=self.bundle, bundle=self.bundle) else: requirement_set.locate_files() if not options.no_install and not self.bundle: requirement_set.install(install_options, global_options, root=options.root_path) installed = ' '.join([req.name for req in requirement_set.successfully_installed]) if installed: logger.notify('Successfully installed %s' % installed) elif not self.bundle: downloaded = ' '.join([req.name for req in requirement_set.successfully_downloaded]) if downloaded: logger.notify('Successfully downloaded %s' % downloaded) elif self.bundle: requirement_set.create_bundle(self.bundle_filename) logger.notify('Created bundle in %s' % self.bundle_filename) except PreviousBuildDirError: options.no_clean = True raise finally: # Clean up if (not options.no_clean) and ((not options.no_install) or options.download_dir): requirement_set.cleanup_files(bundle=self.bundle) if options.target_dir: if not os.path.exists(options.target_dir): os.makedirs(options.target_dir) lib_dir = distutils_scheme('', home=temp_target_dir)['purelib'] for item in os.listdir(lib_dir): shutil.move( os.path.join(lib_dir, item), os.path.join(options.target_dir, item) ) shutil.rmtree(temp_target_dir) return requirement_set
gpl-2.0
glwu/python-for-android
python3-alpha/python3-src/Lib/test/test_posixpath.py
49
21964
import unittest from test import support, test_genericpath import posixpath import os import sys from posixpath import realpath, abspath, dirname, basename try: import posix except ImportError: posix = None # An absolute path to a temporary filename for testing. We can't rely on TESTFN # being an absolute path, so we need this. ABSTFN = abspath(support.TESTFN) def skip_if_ABSTFN_contains_backslash(test): """ On Windows, posixpath.abspath still returns paths with backslashes instead of posix forward slashes. If this is the case, several tests fail, so skip them. """ found_backslash = '\\' in ABSTFN msg = "ABSTFN is not a posix path - tests fail" return [test, unittest.skip(msg)(test)][found_backslash] def safe_rmdir(dirname): try: os.rmdir(dirname) except OSError: pass class PosixPathTest(unittest.TestCase): def setUp(self): self.tearDown() def tearDown(self): for suffix in ["", "1", "2"]: support.unlink(support.TESTFN + suffix) safe_rmdir(support.TESTFN + suffix) def test_join(self): self.assertEqual(posixpath.join("/foo", "bar", "/bar", "baz"), "/bar/baz") self.assertEqual(posixpath.join("/foo", "bar", "baz"), "/foo/bar/baz") self.assertEqual(posixpath.join("/foo/", "bar/", "baz/"), "/foo/bar/baz/") self.assertEqual(posixpath.join(b"/foo", b"bar", b"/bar", b"baz"), b"/bar/baz") self.assertEqual(posixpath.join(b"/foo", b"bar", b"baz"), b"/foo/bar/baz") self.assertEqual(posixpath.join(b"/foo/", b"bar/", b"baz/"), b"/foo/bar/baz/") self.assertRaises(TypeError, posixpath.join, b"bytes", "str") self.assertRaises(TypeError, posixpath.join, "str", b"bytes") def test_split(self): self.assertEqual(posixpath.split("/foo/bar"), ("/foo", "bar")) self.assertEqual(posixpath.split("/"), ("/", "")) self.assertEqual(posixpath.split("foo"), ("", "foo")) self.assertEqual(posixpath.split("////foo"), ("////", "foo")) self.assertEqual(posixpath.split("//foo//bar"), ("//foo", "bar")) self.assertEqual(posixpath.split(b"/foo/bar"), (b"/foo", b"bar")) self.assertEqual(posixpath.split(b"/"), (b"/", b"")) self.assertEqual(posixpath.split(b"foo"), (b"", b"foo")) self.assertEqual(posixpath.split(b"////foo"), (b"////", b"foo")) self.assertEqual(posixpath.split(b"//foo//bar"), (b"//foo", b"bar")) def splitextTest(self, path, filename, ext): self.assertEqual(posixpath.splitext(path), (filename, ext)) self.assertEqual(posixpath.splitext("/" + path), ("/" + filename, ext)) self.assertEqual(posixpath.splitext("abc/" + path), ("abc/" + filename, ext)) self.assertEqual(posixpath.splitext("abc.def/" + path), ("abc.def/" + filename, ext)) self.assertEqual(posixpath.splitext("/abc.def/" + path), ("/abc.def/" + filename, ext)) self.assertEqual(posixpath.splitext(path + "/"), (filename + ext + "/", "")) path = bytes(path, "ASCII") filename = bytes(filename, "ASCII") ext = bytes(ext, "ASCII") self.assertEqual(posixpath.splitext(path), (filename, ext)) self.assertEqual(posixpath.splitext(b"/" + path), (b"/" + filename, ext)) self.assertEqual(posixpath.splitext(b"abc/" + path), (b"abc/" + filename, ext)) self.assertEqual(posixpath.splitext(b"abc.def/" + path), (b"abc.def/" + filename, ext)) self.assertEqual(posixpath.splitext(b"/abc.def/" + path), (b"/abc.def/" + filename, ext)) self.assertEqual(posixpath.splitext(path + b"/"), (filename + ext + b"/", b"")) def test_splitext(self): self.splitextTest("foo.bar", "foo", ".bar") self.splitextTest("foo.boo.bar", "foo.boo", ".bar") self.splitextTest("foo.boo.biff.bar", "foo.boo.biff", ".bar") self.splitextTest(".csh.rc", ".csh", ".rc") self.splitextTest("nodots", "nodots", "") self.splitextTest(".cshrc", ".cshrc", "") self.splitextTest("...manydots", "...manydots", "") self.splitextTest("...manydots.ext", "...manydots", ".ext") self.splitextTest(".", ".", "") self.splitextTest("..", "..", "") self.splitextTest("........", "........", "") self.splitextTest("", "", "") def test_isabs(self): self.assertIs(posixpath.isabs(""), False) self.assertIs(posixpath.isabs("/"), True) self.assertIs(posixpath.isabs("/foo"), True) self.assertIs(posixpath.isabs("/foo/bar"), True) self.assertIs(posixpath.isabs("foo/bar"), False) self.assertIs(posixpath.isabs(b""), False) self.assertIs(posixpath.isabs(b"/"), True) self.assertIs(posixpath.isabs(b"/foo"), True) self.assertIs(posixpath.isabs(b"/foo/bar"), True) self.assertIs(posixpath.isabs(b"foo/bar"), False) def test_basename(self): self.assertEqual(posixpath.basename("/foo/bar"), "bar") self.assertEqual(posixpath.basename("/"), "") self.assertEqual(posixpath.basename("foo"), "foo") self.assertEqual(posixpath.basename("////foo"), "foo") self.assertEqual(posixpath.basename("//foo//bar"), "bar") self.assertEqual(posixpath.basename(b"/foo/bar"), b"bar") self.assertEqual(posixpath.basename(b"/"), b"") self.assertEqual(posixpath.basename(b"foo"), b"foo") self.assertEqual(posixpath.basename(b"////foo"), b"foo") self.assertEqual(posixpath.basename(b"//foo//bar"), b"bar") def test_dirname(self): self.assertEqual(posixpath.dirname("/foo/bar"), "/foo") self.assertEqual(posixpath.dirname("/"), "/") self.assertEqual(posixpath.dirname("foo"), "") self.assertEqual(posixpath.dirname("////foo"), "////") self.assertEqual(posixpath.dirname("//foo//bar"), "//foo") self.assertEqual(posixpath.dirname(b"/foo/bar"), b"/foo") self.assertEqual(posixpath.dirname(b"/"), b"/") self.assertEqual(posixpath.dirname(b"foo"), b"") self.assertEqual(posixpath.dirname(b"////foo"), b"////") self.assertEqual(posixpath.dirname(b"//foo//bar"), b"//foo") def test_islink(self): self.assertIs(posixpath.islink(support.TESTFN + "1"), False) self.assertIs(posixpath.lexists(support.TESTFN + "2"), False) f = open(support.TESTFN + "1", "wb") try: f.write(b"foo") f.close() self.assertIs(posixpath.islink(support.TESTFN + "1"), False) if support.can_symlink(): os.symlink(support.TESTFN + "1", support.TESTFN + "2") self.assertIs(posixpath.islink(support.TESTFN + "2"), True) os.remove(support.TESTFN + "1") self.assertIs(posixpath.islink(support.TESTFN + "2"), True) self.assertIs(posixpath.exists(support.TESTFN + "2"), False) self.assertIs(posixpath.lexists(support.TESTFN + "2"), True) finally: if not f.close(): f.close() @staticmethod def _create_file(filename): with open(filename, 'wb') as f: f.write(b'foo') def test_samefile(self): test_fn = support.TESTFN + "1" self._create_file(test_fn) self.assertTrue(posixpath.samefile(test_fn, test_fn)) self.assertRaises(TypeError, posixpath.samefile) @unittest.skipIf( sys.platform.startswith('win'), "posixpath.samefile does not work on links in Windows") @unittest.skipUnless(hasattr(os, "symlink"), "Missing symlink implementation") def test_samefile_on_links(self): test_fn1 = support.TESTFN + "1" test_fn2 = support.TESTFN + "2" self._create_file(test_fn1) os.symlink(test_fn1, test_fn2) self.assertTrue(posixpath.samefile(test_fn1, test_fn2)) os.remove(test_fn2) self._create_file(test_fn2) self.assertFalse(posixpath.samefile(test_fn1, test_fn2)) def test_samestat(self): test_fn = support.TESTFN + "1" self._create_file(test_fn) test_fns = [test_fn]*2 stats = map(os.stat, test_fns) self.assertTrue(posixpath.samestat(*stats)) @unittest.skipIf( sys.platform.startswith('win'), "posixpath.samestat does not work on links in Windows") @unittest.skipUnless(hasattr(os, "symlink"), "Missing symlink implementation") def test_samestat_on_links(self): test_fn1 = support.TESTFN + "1" test_fn2 = support.TESTFN + "2" self._create_file(test_fn1) test_fns = (test_fn1, test_fn2) os.symlink(*test_fns) stats = map(os.stat, test_fns) self.assertTrue(posixpath.samestat(*stats)) os.remove(test_fn2) self._create_file(test_fn2) stats = map(os.stat, test_fns) self.assertFalse(posixpath.samestat(*stats)) self.assertRaises(TypeError, posixpath.samestat) def test_ismount(self): self.assertIs(posixpath.ismount("/"), True) self.assertIs(posixpath.ismount(b"/"), True) def test_ismount_non_existent(self): # Non-existent mountpoint. self.assertIs(posixpath.ismount(ABSTFN), False) try: os.mkdir(ABSTFN) self.assertIs(posixpath.ismount(ABSTFN), False) finally: safe_rmdir(ABSTFN) @unittest.skipUnless(support.can_symlink(), "Test requires symlink support") def test_ismount_symlinks(self): # Symlinks are never mountpoints. try: os.symlink("/", ABSTFN) self.assertIs(posixpath.ismount(ABSTFN), False) finally: os.unlink(ABSTFN) @unittest.skipIf(posix is None, "Test requires posix module") def test_ismount_different_device(self): # Simulate the path being on a different device from its parent by # mocking out st_dev. save_lstat = os.lstat def fake_lstat(path): st_ino = 0 st_dev = 0 if path == ABSTFN: st_dev = 1 st_ino = 1 return posix.stat_result((0, st_ino, st_dev, 0, 0, 0, 0, 0, 0, 0)) try: os.lstat = fake_lstat self.assertIs(posixpath.ismount(ABSTFN), True) finally: os.lstat = save_lstat def test_expanduser(self): self.assertEqual(posixpath.expanduser("foo"), "foo") self.assertEqual(posixpath.expanduser(b"foo"), b"foo") try: import pwd except ImportError: pass else: self.assertIsInstance(posixpath.expanduser("~/"), str) self.assertIsInstance(posixpath.expanduser(b"~/"), bytes) # if home directory == root directory, this test makes no sense if posixpath.expanduser("~") != '/': self.assertEqual( posixpath.expanduser("~") + "/", posixpath.expanduser("~/") ) self.assertEqual( posixpath.expanduser(b"~") + b"/", posixpath.expanduser(b"~/") ) self.assertIsInstance(posixpath.expanduser("~root/"), str) self.assertIsInstance(posixpath.expanduser("~foo/"), str) self.assertIsInstance(posixpath.expanduser(b"~root/"), bytes) self.assertIsInstance(posixpath.expanduser(b"~foo/"), bytes) with support.EnvironmentVarGuard() as env: env['HOME'] = '/' self.assertEqual(posixpath.expanduser("~"), "/") # expanduser should fall back to using the password database del env['HOME'] home = pwd.getpwuid(os.getuid()).pw_dir self.assertEqual(posixpath.expanduser("~"), home) def test_normpath(self): self.assertEqual(posixpath.normpath(""), ".") self.assertEqual(posixpath.normpath("/"), "/") self.assertEqual(posixpath.normpath("//"), "//") self.assertEqual(posixpath.normpath("///"), "/") self.assertEqual(posixpath.normpath("///foo/.//bar//"), "/foo/bar") self.assertEqual(posixpath.normpath("///foo/.//bar//.//..//.//baz"), "/foo/baz") self.assertEqual(posixpath.normpath("///..//./foo/.//bar"), "/foo/bar") self.assertEqual(posixpath.normpath(b""), b".") self.assertEqual(posixpath.normpath(b"/"), b"/") self.assertEqual(posixpath.normpath(b"//"), b"//") self.assertEqual(posixpath.normpath(b"///"), b"/") self.assertEqual(posixpath.normpath(b"///foo/.//bar//"), b"/foo/bar") self.assertEqual(posixpath.normpath(b"///foo/.//bar//.//..//.//baz"), b"/foo/baz") self.assertEqual(posixpath.normpath(b"///..//./foo/.//bar"), b"/foo/bar") @unittest.skipUnless(hasattr(os, "symlink"), "Missing symlink implementation") @skip_if_ABSTFN_contains_backslash def test_realpath_basic(self): # Basic operation. try: os.symlink(ABSTFN+"1", ABSTFN) self.assertEqual(realpath(ABSTFN), ABSTFN+"1") finally: support.unlink(ABSTFN) @unittest.skipUnless(hasattr(os, "symlink"), "Missing symlink implementation") @skip_if_ABSTFN_contains_backslash def test_realpath_relative(self): try: os.symlink(posixpath.relpath(ABSTFN+"1"), ABSTFN) self.assertEqual(realpath(ABSTFN), ABSTFN+"1") finally: support.unlink(ABSTFN) @unittest.skipUnless(hasattr(os, "symlink"), "Missing symlink implementation") @skip_if_ABSTFN_contains_backslash def test_realpath_symlink_loops(self): # Bug #930024, return the path unchanged if we get into an infinite # symlink loop. try: old_path = abspath('.') os.symlink(ABSTFN, ABSTFN) self.assertEqual(realpath(ABSTFN), ABSTFN) os.symlink(ABSTFN+"1", ABSTFN+"2") os.symlink(ABSTFN+"2", ABSTFN+"1") self.assertEqual(realpath(ABSTFN+"1"), ABSTFN+"1") self.assertEqual(realpath(ABSTFN+"2"), ABSTFN+"2") # Test using relative path as well. os.chdir(dirname(ABSTFN)) self.assertEqual(realpath(basename(ABSTFN)), ABSTFN) finally: os.chdir(old_path) support.unlink(ABSTFN) support.unlink(ABSTFN+"1") support.unlink(ABSTFN+"2") @unittest.skipUnless(hasattr(os, "symlink"), "Missing symlink implementation") @skip_if_ABSTFN_contains_backslash def test_realpath_resolve_parents(self): # We also need to resolve any symlinks in the parents of a relative # path passed to realpath. E.g.: current working directory is # /usr/doc with 'doc' being a symlink to /usr/share/doc. We call # realpath("a"). This should return /usr/share/doc/a/. try: old_path = abspath('.') os.mkdir(ABSTFN) os.mkdir(ABSTFN + "/y") os.symlink(ABSTFN + "/y", ABSTFN + "/k") os.chdir(ABSTFN + "/k") self.assertEqual(realpath("a"), ABSTFN + "/y/a") finally: os.chdir(old_path) support.unlink(ABSTFN + "/k") safe_rmdir(ABSTFN + "/y") safe_rmdir(ABSTFN) @unittest.skipUnless(hasattr(os, "symlink"), "Missing symlink implementation") @skip_if_ABSTFN_contains_backslash def test_realpath_resolve_before_normalizing(self): # Bug #990669: Symbolic links should be resolved before we # normalize the path. E.g.: if we have directories 'a', 'k' and 'y' # in the following hierarchy: # a/k/y # # and a symbolic link 'link-y' pointing to 'y' in directory 'a', # then realpath("link-y/..") should return 'k', not 'a'. try: old_path = abspath('.') os.mkdir(ABSTFN) os.mkdir(ABSTFN + "/k") os.mkdir(ABSTFN + "/k/y") os.symlink(ABSTFN + "/k/y", ABSTFN + "/link-y") # Absolute path. self.assertEqual(realpath(ABSTFN + "/link-y/.."), ABSTFN + "/k") # Relative path. os.chdir(dirname(ABSTFN)) self.assertEqual(realpath(basename(ABSTFN) + "/link-y/.."), ABSTFN + "/k") finally: os.chdir(old_path) support.unlink(ABSTFN + "/link-y") safe_rmdir(ABSTFN + "/k/y") safe_rmdir(ABSTFN + "/k") safe_rmdir(ABSTFN) @unittest.skipUnless(hasattr(os, "symlink"), "Missing symlink implementation") @skip_if_ABSTFN_contains_backslash def test_realpath_resolve_first(self): # Bug #1213894: The first component of the path, if not absolute, # must be resolved too. try: old_path = abspath('.') os.mkdir(ABSTFN) os.mkdir(ABSTFN + "/k") os.symlink(ABSTFN, ABSTFN + "link") os.chdir(dirname(ABSTFN)) base = basename(ABSTFN) self.assertEqual(realpath(base + "link"), ABSTFN) self.assertEqual(realpath(base + "link/k"), ABSTFN + "/k") finally: os.chdir(old_path) support.unlink(ABSTFN + "link") safe_rmdir(ABSTFN + "/k") safe_rmdir(ABSTFN) def test_relpath(self): (real_getcwd, os.getcwd) = (os.getcwd, lambda: r"/home/user/bar") try: curdir = os.path.split(os.getcwd())[-1] self.assertRaises(ValueError, posixpath.relpath, "") self.assertEqual(posixpath.relpath("a"), "a") self.assertEqual(posixpath.relpath(posixpath.abspath("a")), "a") self.assertEqual(posixpath.relpath("a/b"), "a/b") self.assertEqual(posixpath.relpath("../a/b"), "../a/b") self.assertEqual(posixpath.relpath("a", "../b"), "../"+curdir+"/a") self.assertEqual(posixpath.relpath("a/b", "../c"), "../"+curdir+"/a/b") self.assertEqual(posixpath.relpath("a", "b/c"), "../../a") self.assertEqual(posixpath.relpath("a", "a"), ".") self.assertEqual(posixpath.relpath("/foo/bar/bat", "/x/y/z"), '../../../foo/bar/bat') self.assertEqual(posixpath.relpath("/foo/bar/bat", "/foo/bar"), 'bat') self.assertEqual(posixpath.relpath("/foo/bar/bat", "/"), 'foo/bar/bat') self.assertEqual(posixpath.relpath("/", "/foo/bar/bat"), '../../..') self.assertEqual(posixpath.relpath("/foo/bar/bat", "/x"), '../foo/bar/bat') self.assertEqual(posixpath.relpath("/x", "/foo/bar/bat"), '../../../x') self.assertEqual(posixpath.relpath("/", "/"), '.') self.assertEqual(posixpath.relpath("/a", "/a"), '.') self.assertEqual(posixpath.relpath("/a/b", "/a/b"), '.') finally: os.getcwd = real_getcwd def test_relpath_bytes(self): (real_getcwdb, os.getcwdb) = (os.getcwdb, lambda: br"/home/user/bar") try: curdir = os.path.split(os.getcwdb())[-1] self.assertRaises(ValueError, posixpath.relpath, b"") self.assertEqual(posixpath.relpath(b"a"), b"a") self.assertEqual(posixpath.relpath(posixpath.abspath(b"a")), b"a") self.assertEqual(posixpath.relpath(b"a/b"), b"a/b") self.assertEqual(posixpath.relpath(b"../a/b"), b"../a/b") self.assertEqual(posixpath.relpath(b"a", b"../b"), b"../"+curdir+b"/a") self.assertEqual(posixpath.relpath(b"a/b", b"../c"), b"../"+curdir+b"/a/b") self.assertEqual(posixpath.relpath(b"a", b"b/c"), b"../../a") self.assertEqual(posixpath.relpath(b"a", b"a"), b".") self.assertEqual(posixpath.relpath(b"/foo/bar/bat", b"/x/y/z"), b'../../../foo/bar/bat') self.assertEqual(posixpath.relpath(b"/foo/bar/bat", b"/foo/bar"), b'bat') self.assertEqual(posixpath.relpath(b"/foo/bar/bat", b"/"), b'foo/bar/bat') self.assertEqual(posixpath.relpath(b"/", b"/foo/bar/bat"), b'../../..') self.assertEqual(posixpath.relpath(b"/foo/bar/bat", b"/x"), b'../foo/bar/bat') self.assertEqual(posixpath.relpath(b"/x", b"/foo/bar/bat"), b'../../../x') self.assertEqual(posixpath.relpath(b"/", b"/"), b'.') self.assertEqual(posixpath.relpath(b"/a", b"/a"), b'.') self.assertEqual(posixpath.relpath(b"/a/b", b"/a/b"), b'.') self.assertRaises(TypeError, posixpath.relpath, b"bytes", "str") self.assertRaises(TypeError, posixpath.relpath, "str", b"bytes") finally: os.getcwdb = real_getcwdb def test_sameopenfile(self): fname = support.TESTFN + "1" with open(fname, "wb") as a, open(fname, "wb") as b: self.assertTrue(posixpath.sameopenfile(a.fileno(), b.fileno())) class PosixCommonTest(test_genericpath.CommonTest): pathmodule = posixpath attributes = ['relpath', 'samefile', 'sameopenfile', 'samestat'] def test_main(): support.run_unittest(PosixPathTest, PosixCommonTest) if __name__=="__main__": test_main()
apache-2.0
tysonclugg/django
django/contrib/gis/gdal/srs.py
72
11540
""" The Spatial Reference class, represents OGR Spatial Reference objects. Example: >>> from django.contrib.gis.gdal import SpatialReference >>> srs = SpatialReference('WGS84') >>> print(srs) GEOGCS["WGS 84", DATUM["WGS_1984", SPHEROID["WGS 84",6378137,298.257223563, AUTHORITY["EPSG","7030"]], TOWGS84[0,0,0,0,0,0,0], AUTHORITY["EPSG","6326"]], PRIMEM["Greenwich",0, AUTHORITY["EPSG","8901"]], UNIT["degree",0.01745329251994328, AUTHORITY["EPSG","9122"]], AUTHORITY["EPSG","4326"]] >>> print(srs.proj) +proj=longlat +ellps=WGS84 +datum=WGS84 +no_defs >>> print(srs.ellipsoid) (6378137.0, 6356752.3142451793, 298.25722356300003) >>> print(srs.projected, srs.geographic) False True >>> srs.import_epsg(32140) >>> print(srs.name) NAD83 / Texas South Central """ from ctypes import byref, c_char_p, c_int from django.contrib.gis.gdal.base import GDALBase from django.contrib.gis.gdal.error import SRSException from django.contrib.gis.gdal.prototypes import srs as capi from django.utils.encoding import force_bytes, force_text class SpatialReference(GDALBase): """ A wrapper for the OGRSpatialReference object. According to the GDAL Web site, the SpatialReference object "provide[s] services to represent coordinate systems (projections and datums) and to transform between them." """ destructor = capi.release_srs def __init__(self, srs_input='', srs_type='user'): """ Create a GDAL OSR Spatial Reference object from the given input. The input may be string of OGC Well Known Text (WKT), an integer EPSG code, a PROJ.4 string, and/or a projection "well known" shorthand string (one of 'WGS84', 'WGS72', 'NAD27', 'NAD83'). """ if srs_type == 'wkt': self.ptr = capi.new_srs(c_char_p(b'')) self.import_wkt(srs_input) return elif isinstance(srs_input, str): try: # If SRID is a string, e.g., '4326', then make acceptable # as user input. srid = int(srs_input) srs_input = 'EPSG:%d' % srid except ValueError: pass elif isinstance(srs_input, int): # EPSG integer code was input. srs_type = 'epsg' elif isinstance(srs_input, self.ptr_type): srs = srs_input srs_type = 'ogr' else: raise TypeError('Invalid SRS type "%s"' % srs_type) if srs_type == 'ogr': # Input is already an SRS pointer. srs = srs_input else: # Creating a new SRS pointer, using the string buffer. buf = c_char_p(b'') srs = capi.new_srs(buf) # If the pointer is NULL, throw an exception. if not srs: raise SRSException('Could not create spatial reference from: %s' % srs_input) else: self.ptr = srs # Importing from either the user input string or an integer SRID. if srs_type == 'user': self.import_user_input(srs_input) elif srs_type == 'epsg': self.import_epsg(srs_input) def __getitem__(self, target): """ Return the value of the given string attribute node, None if the node doesn't exist. Can also take a tuple as a parameter, (target, child), where child is the index of the attribute in the WKT. For example: >>> wkt = 'GEOGCS["WGS 84", DATUM["WGS_1984, ... AUTHORITY["EPSG","4326"]]' >>> srs = SpatialReference(wkt) # could also use 'WGS84', or 4326 >>> print(srs['GEOGCS']) WGS 84 >>> print(srs['DATUM']) WGS_1984 >>> print(srs['AUTHORITY']) EPSG >>> print(srs['AUTHORITY', 1]) # The authority value 4326 >>> print(srs['TOWGS84', 4]) # the fourth value in this wkt 0 >>> print(srs['UNIT|AUTHORITY']) # For the units authority, have to use the pipe symbole. EPSG >>> print(srs['UNIT|AUTHORITY', 1]) # The authority value for the units 9122 """ if isinstance(target, tuple): return self.attr_value(*target) else: return self.attr_value(target) def __str__(self): "Use 'pretty' WKT." return self.pretty_wkt # #### SpatialReference Methods #### def attr_value(self, target, index=0): """ The attribute value for the given target node (e.g. 'PROJCS'). The index keyword specifies an index of the child node to return. """ if not isinstance(target, str) or not isinstance(index, int): raise TypeError return capi.get_attr_value(self.ptr, force_bytes(target), index) def auth_name(self, target): "Return the authority name for the given string target node." return capi.get_auth_name(self.ptr, force_bytes(target)) def auth_code(self, target): "Return the authority code for the given string target node." return capi.get_auth_code(self.ptr, force_bytes(target)) def clone(self): "Return a clone of this SpatialReference object." return SpatialReference(capi.clone_srs(self.ptr)) def from_esri(self): "Morph this SpatialReference from ESRI's format to EPSG." capi.morph_from_esri(self.ptr) def identify_epsg(self): """ This method inspects the WKT of this SpatialReference, and will add EPSG authority nodes where an EPSG identifier is applicable. """ capi.identify_epsg(self.ptr) def to_esri(self): "Morph this SpatialReference to ESRI's format." capi.morph_to_esri(self.ptr) def validate(self): "Check to see if the given spatial reference is valid." capi.srs_validate(self.ptr) # #### Name & SRID properties #### @property def name(self): "Return the name of this Spatial Reference." if self.projected: return self.attr_value('PROJCS') elif self.geographic: return self.attr_value('GEOGCS') elif self.local: return self.attr_value('LOCAL_CS') else: return None @property def srid(self): "Return the SRID of top-level authority, or None if undefined." try: return int(self.attr_value('AUTHORITY', 1)) except (TypeError, ValueError): return None # #### Unit Properties #### @property def linear_name(self): "Return the name of the linear units." units, name = capi.linear_units(self.ptr, byref(c_char_p())) return name @property def linear_units(self): "Return the value of the linear units." units, name = capi.linear_units(self.ptr, byref(c_char_p())) return units @property def angular_name(self): "Return the name of the angular units." units, name = capi.angular_units(self.ptr, byref(c_char_p())) return name @property def angular_units(self): "Return the value of the angular units." units, name = capi.angular_units(self.ptr, byref(c_char_p())) return units @property def units(self): """ Return a 2-tuple of the units value and the units name. Automatically determine whether to return the linear or angular units. """ units, name = None, None if self.projected or self.local: units, name = capi.linear_units(self.ptr, byref(c_char_p())) elif self.geographic: units, name = capi.angular_units(self.ptr, byref(c_char_p())) if name is not None: name = force_text(name) return (units, name) # #### Spheroid/Ellipsoid Properties #### @property def ellipsoid(self): """ Return a tuple of the ellipsoid parameters: (semimajor axis, semiminor axis, and inverse flattening) """ return (self.semi_major, self.semi_minor, self.inverse_flattening) @property def semi_major(self): "Return the Semi Major Axis for this Spatial Reference." return capi.semi_major(self.ptr, byref(c_int())) @property def semi_minor(self): "Return the Semi Minor Axis for this Spatial Reference." return capi.semi_minor(self.ptr, byref(c_int())) @property def inverse_flattening(self): "Return the Inverse Flattening for this Spatial Reference." return capi.invflattening(self.ptr, byref(c_int())) # #### Boolean Properties #### @property def geographic(self): """ Return True if this SpatialReference is geographic (root node is GEOGCS). """ return bool(capi.isgeographic(self.ptr)) @property def local(self): "Return True if this SpatialReference is local (root node is LOCAL_CS)." return bool(capi.islocal(self.ptr)) @property def projected(self): """ Return True if this SpatialReference is a projected coordinate system (root node is PROJCS). """ return bool(capi.isprojected(self.ptr)) # #### Import Routines ##### def import_epsg(self, epsg): "Import the Spatial Reference from the EPSG code (an integer)." capi.from_epsg(self.ptr, epsg) def import_proj(self, proj): "Import the Spatial Reference from a PROJ.4 string." capi.from_proj(self.ptr, proj) def import_user_input(self, user_input): "Import the Spatial Reference from the given user input string." capi.from_user_input(self.ptr, force_bytes(user_input)) def import_wkt(self, wkt): "Import the Spatial Reference from OGC WKT (string)" capi.from_wkt(self.ptr, byref(c_char_p(force_bytes(wkt)))) def import_xml(self, xml): "Import the Spatial Reference from an XML string." capi.from_xml(self.ptr, xml) # #### Export Properties #### @property def wkt(self): "Return the WKT representation of this Spatial Reference." return capi.to_wkt(self.ptr, byref(c_char_p())) @property def pretty_wkt(self, simplify=0): "Return the 'pretty' representation of the WKT." return capi.to_pretty_wkt(self.ptr, byref(c_char_p()), simplify) @property def proj(self): "Return the PROJ.4 representation for this Spatial Reference." return capi.to_proj(self.ptr, byref(c_char_p())) @property def proj4(self): "Alias for proj()." return self.proj @property def xml(self, dialect=''): "Return the XML representation of this Spatial Reference." return capi.to_xml(self.ptr, byref(c_char_p()), force_bytes(dialect)) class CoordTransform(GDALBase): "The coordinate system transformation object." destructor = capi.destroy_ct def __init__(self, source, target): "Initialize on a source and target SpatialReference objects." if not isinstance(source, SpatialReference) or not isinstance(target, SpatialReference): raise TypeError('source and target must be of type SpatialReference') self.ptr = capi.new_ct(source._ptr, target._ptr) self._srs1_name = source.name self._srs2_name = target.name def __str__(self): return 'Transform from "%s" to "%s"' % (self._srs1_name, self._srs2_name)
bsd-3-clause
arjclark/cylc
lib/jinja2/__init__.py
71
2614
# -*- coding: utf-8 -*- """ jinja2 ~~~~~~ Jinja2 is a template engine written in pure Python. It provides a Django inspired non-XML syntax but supports inline expressions and an optional sandboxed environment. Nutshell -------- Here a small example of a Jinja2 template:: {% extends 'base.html' %} {% block title %}Memberlist{% endblock %} {% block content %} <ul> {% for user in users %} <li><a href="{{ user.url }}">{{ user.username }}</a></li> {% endfor %} </ul> {% endblock %} :copyright: (c) 2017 by the Jinja Team. :license: BSD, see LICENSE for more details. """ __docformat__ = 'restructuredtext en' __version__ = '2.10' # high level interface from jinja2.environment import Environment, Template # loaders from jinja2.loaders import BaseLoader, FileSystemLoader, PackageLoader, \ DictLoader, FunctionLoader, PrefixLoader, ChoiceLoader, \ ModuleLoader # bytecode caches from jinja2.bccache import BytecodeCache, FileSystemBytecodeCache, \ MemcachedBytecodeCache # undefined types from jinja2.runtime import Undefined, DebugUndefined, StrictUndefined, \ make_logging_undefined # exceptions from jinja2.exceptions import TemplateError, UndefinedError, \ TemplateNotFound, TemplatesNotFound, TemplateSyntaxError, \ TemplateAssertionError, TemplateRuntimeError # decorators and public utilities from jinja2.filters import environmentfilter, contextfilter, \ evalcontextfilter from jinja2.utils import Markup, escape, clear_caches, \ environmentfunction, evalcontextfunction, contextfunction, \ is_undefined, select_autoescape __all__ = [ 'Environment', 'Template', 'BaseLoader', 'FileSystemLoader', 'PackageLoader', 'DictLoader', 'FunctionLoader', 'PrefixLoader', 'ChoiceLoader', 'BytecodeCache', 'FileSystemBytecodeCache', 'MemcachedBytecodeCache', 'Undefined', 'DebugUndefined', 'StrictUndefined', 'TemplateError', 'UndefinedError', 'TemplateNotFound', 'TemplatesNotFound', 'TemplateSyntaxError', 'TemplateAssertionError', 'TemplateRuntimeError', 'ModuleLoader', 'environmentfilter', 'contextfilter', 'Markup', 'escape', 'environmentfunction', 'contextfunction', 'clear_caches', 'is_undefined', 'evalcontextfilter', 'evalcontextfunction', 'make_logging_undefined', 'select_autoescape', ] def _patch_async(): from jinja2.utils import have_async_gen if have_async_gen: from jinja2.asyncsupport import patch_all patch_all() _patch_async() del _patch_async
gpl-3.0
JudoWill/ResearchNotebooks
DownloadMicroData.py
1
1738
# -*- coding: utf-8 -*- # <nbformat>3.0</nbformat> # <codecell> import os, os.path import concurrent.futures import csv import urllib.request import shutil import gzip os.chdir('/home/will/AutoMicroAnal/') # <codecell> with open('MicroarraySamples.tsv') as handle: microdata = list(csv.DictReader(handle, delimiter = '\t')) # <codecell> def get_fileurl(supurl): #print(supurl) resp = urllib.request.urlopen(supurl) for line in resp: fname = str(line.split()[-1]) if fname.lower().endswith(".cel.gz'"): #print('returning') return supurl + fname[2:-1] return None def process_row(row): supurl = row['URL'] + 'suppl/' tmpfile = '/tmp/' + row['Sample Accession'] + '.CEL.gz' finalfile = '/home/will/AutoMicroAnal/microadata/' + row['Sample Accession'] + '.CEL' if os.path.exists(finalfile): return None fileurl = get_fileurl(supurl) #print(fileurl) if fileurl is None: return fileurl try: resp = urllib.request.urlopen(fileurl) with open(tmpfile, 'wb') as handle: handle.write(resp.read()) except urllib.request.URLError: return fileurl with gzip.open(tmpfile) as zhandle: with open(finalfile, 'wb') as handle: handle.write(zhandle.read()) os.remove(tmpfile) return None # <codecell> gp133As = [row for row in microdata if row['Platform'] == 'GPL96'] # <codecell> for num, row in enumerate(gp133As): try: res = process_row(row) except: print('skipping') continue if (num == 0) | (num == 5) | (num == 20) | (num % 500 == 0): print(num) if res: print(res) # <codecell> # <codecell>
mit
collex100/odoo
addons/account_check_writing/account.py
379
2032
# -*- coding: utf-8 -*- ############################################################################## # # OpenERP, Open Source Management Solution # Copyright (C) 2004-2010 Tiny SPRL (<http://tiny.be>). # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## from openerp.osv import osv,fields class account_journal(osv.osv): _inherit = "account.journal" _columns = { 'allow_check_writing': fields.boolean('Allow Check writing', help='Check this if the journal is to be used for writing checks.'), 'use_preprint_check': fields.boolean('Use Preprinted Check', help='Check if you use a preformated sheet for check'), } class res_company(osv.osv): _inherit = "res.company" _columns = { 'check_layout': fields.selection([ ('top', 'Check on Top'), ('middle', 'Check in middle'), ('bottom', 'Check on bottom'), ],"Check Layout", help="Check on top is compatible with Quicken, QuickBooks and Microsoft Money. Check in middle is compatible with Peachtree, ACCPAC and DacEasy. Check on bottom is compatible with Peachtree, ACCPAC and DacEasy only" ), } _defaults = { 'check_layout' : lambda *a: 'top', } # vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:
agpl-3.0
iemejia/incubator-beam
sdks/python/apache_beam/runners/portability/flink_uber_jar_job_server.py
1
8979
# # Licensed to the Apache Software Foundation (ASF) under one or more # contributor license agreements. See the NOTICE file distributed with # this work for additional information regarding copyright ownership. # The ASF licenses this file to You under the Apache License, Version 2.0 # (the "License"); you may not use this file except in compliance with # the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # """A job server submitting portable pipelines as uber jars to Flink.""" # pytype: skip-file from __future__ import absolute_import from __future__ import print_function import logging import os import tempfile import time import urllib import requests from google.protobuf import json_format from apache_beam.options import pipeline_options from apache_beam.portability.api import beam_job_api_pb2 from apache_beam.runners.portability import abstract_job_service from apache_beam.runners.portability import job_server _LOGGER = logging.getLogger(__name__) class FlinkUberJarJobServer(abstract_job_service.AbstractJobServiceServicer): """A Job server which submits a self-contained Jar to a Flink cluster. The jar contains the Beam pipeline definition, dependencies, and the pipeline artifacts. """ def __init__(self, master_url, options): super(FlinkUberJarJobServer, self).__init__() self._master_url = master_url self._executable_jar = ( options.view_as( pipeline_options.FlinkRunnerOptions).flink_job_server_jar) self._artifact_port = ( options.view_as(pipeline_options.JobServerOptions).artifact_port) self._temp_dir = tempfile.mkdtemp(prefix='apache-beam-flink') def start(self): return self def stop(self): pass def executable_jar(self): if self._executable_jar: if not os.path.exists(self._executable_jar): parsed = urllib.parse.urlparse(self._executable_jar) if not parsed.scheme: raise ValueError( 'Unable to parse jar URL "%s". If using a full URL, make sure ' 'the scheme is specified. If using a local file path, make sure ' 'the file exists; you may have to first build the job server ' 'using `./gradlew runners:flink:%s:job-server:shadowJar`.' % (self._executable_jar, self._flink_version)) url = self._executable_jar else: url = job_server.JavaJarJobServer.path_to_beam_jar( 'runners:flink:%s:job-server:shadowJar' % self.flink_version()) return job_server.JavaJarJobServer.local_jar(url) def flink_version(self): full_version = requests.get('%s/v1/config' % self._master_url).json()['flink-version'] # Only return up to minor version. return '.'.join(full_version.split('.')[:2]) def create_beam_job(self, job_id, job_name, pipeline, options): return FlinkBeamJob( self._master_url, self.executable_jar(), job_id, job_name, pipeline, options, artifact_port=self._artifact_port) def GetJobMetrics(self, request, context=None): if request.job_id not in self._jobs: raise LookupError("Job {} does not exist".format(request.job_id)) metrics_text = self._jobs[request.job_id].get_metrics() response = beam_job_api_pb2.GetJobMetricsResponse() json_format.Parse(metrics_text, response) return response class FlinkBeamJob(abstract_job_service.UberJarBeamJob): """Runs a single Beam job on Flink by staging all contents into a Jar and uploading it via the Flink Rest API.""" def __init__( self, master_url, executable_jar, job_id, job_name, pipeline, options, artifact_port=0): super(FlinkBeamJob, self).__init__( executable_jar, job_id, job_name, pipeline, options, artifact_port=artifact_port) self._master_url = master_url def request(self, method, path, expected_status=200, **kwargs): url = '%s/%s' % (self._master_url, path) response = method(url, **kwargs) if response.status_code != expected_status: raise RuntimeError( "Request to %s failed with status %d: %s" % (url, response.status_code, response.text)) if response.text: return response.json() def get(self, path, **kwargs): return self.request(requests.get, path, **kwargs) def post(self, path, **kwargs): return self.request(requests.post, path, **kwargs) def delete(self, path, **kwargs): return self.request(requests.delete, path, **kwargs) def run(self): self._stop_artifact_service() # Upload the jar and start the job. with open(self._jar, 'rb') as jar_file: self._flink_jar_id = self.post( 'v1/jars/upload', files={'jarfile': ('beam.jar', jar_file)})['filename'].split('/')[-1] self._jar_uploaded = True self._flink_job_id = self.post( 'v1/jars/%s/run' % self._flink_jar_id, json={ 'entryClass': 'org.apache.beam.runners.flink.FlinkPipelineRunner' })['jobid'] os.unlink(self._jar) _LOGGER.info('Started Flink job as %s' % self._flink_job_id) def cancel(self): self.post('v1/%s/stop' % self._flink_job_id, expected_status=202) self.delete_jar() def delete_jar(self): if self._jar_uploaded: self._jar_uploaded = False try: self.delete('v1/jars/%s' % self._flink_jar_id) except Exception: _LOGGER.info( 'Error deleting jar %s' % self._flink_jar_id, exc_info=True) def _get_state(self): """Query flink to get the current state. :return: tuple of int and Timestamp or None timestamp will be None if the state has not changed since the last query. """ # For just getting the status, execution-result seems cheaper. flink_status = self.get('v1/jobs/%s/execution-result' % self._flink_job_id)['status']['id'] if flink_status == 'COMPLETED': flink_status = self.get('v1/jobs/%s' % self._flink_job_id)['state'] beam_state = { 'CREATED': beam_job_api_pb2.JobState.STARTING, 'RUNNING': beam_job_api_pb2.JobState.RUNNING, 'FAILING': beam_job_api_pb2.JobState.RUNNING, 'FAILED': beam_job_api_pb2.JobState.FAILED, 'CANCELLING': beam_job_api_pb2.JobState.CANCELLING, 'CANCELED': beam_job_api_pb2.JobState.CANCELLED, 'FINISHED': beam_job_api_pb2.JobState.DONE, 'RESTARTING': beam_job_api_pb2.JobState.RUNNING, 'SUSPENDED': beam_job_api_pb2.JobState.RUNNING, 'RECONCILING': beam_job_api_pb2.JobState.RUNNING, 'IN_PROGRESS': beam_job_api_pb2.JobState.RUNNING, 'COMPLETED': beam_job_api_pb2.JobState.DONE, }.get(flink_status, beam_job_api_pb2.JobState.UNSPECIFIED) if self.is_terminal_state(beam_state): self.delete_jar() # update the state history if it has changed return beam_state, self.set_state(beam_state) def get_state(self): state, timestamp = self._get_state() if timestamp is None: # state has not changed since it was last checked: use previous timestamp return super(FlinkBeamJob, self).get_state() else: return state, timestamp def get_state_stream(self): def _state_iter(): sleep_secs = 1.0 while True: yield self.get_state() sleep_secs = min(60, sleep_secs * 1.2) time.sleep(sleep_secs) for state, timestamp in self.with_state_history(_state_iter()): yield state, timestamp if self.is_terminal_state(state): break def get_message_stream(self): for state, timestamp in self.get_state_stream(): if self.is_terminal_state(state): response = self.get('v1/jobs/%s/exceptions' % self._flink_job_id) for ix, exc in enumerate(response['all-exceptions']): yield beam_job_api_pb2.JobMessage( message_id='message%d' % ix, time=str(exc['timestamp']), importance=beam_job_api_pb2.JobMessage.MessageImportance. JOB_MESSAGE_ERROR, message_text=exc['exception']) yield state, timestamp break else: yield state, timestamp def get_metrics(self): accumulators = self.get('v1/jobs/%s/accumulators' % self._flink_job_id)['user-task-accumulators'] for accumulator in accumulators: if accumulator['name'] == '__metricscontainers': return accumulator['value'] raise LookupError( "Found no metrics container for job {}".format(self._flink_job_id))
apache-2.0
roxyboy/scikit-learn
sklearn/mixture/tests/test_dpgmm.py
261
4490
import unittest import sys import numpy as np from sklearn.mixture import DPGMM, VBGMM from sklearn.mixture.dpgmm import log_normalize from sklearn.datasets import make_blobs from sklearn.utils.testing import assert_array_less, assert_equal from sklearn.mixture.tests.test_gmm import GMMTester from sklearn.externals.six.moves import cStringIO as StringIO np.seterr(all='warn') def test_class_weights(): # check that the class weights are updated # simple 3 cluster dataset X, y = make_blobs(random_state=1) for Model in [DPGMM, VBGMM]: dpgmm = Model(n_components=10, random_state=1, alpha=20, n_iter=50) dpgmm.fit(X) # get indices of components that are used: indices = np.unique(dpgmm.predict(X)) active = np.zeros(10, dtype=np.bool) active[indices] = True # used components are important assert_array_less(.1, dpgmm.weights_[active]) # others are not assert_array_less(dpgmm.weights_[~active], .05) def test_verbose_boolean(): # checks that the output for the verbose output is the same # for the flag values '1' and 'True' # simple 3 cluster dataset X, y = make_blobs(random_state=1) for Model in [DPGMM, VBGMM]: dpgmm_bool = Model(n_components=10, random_state=1, alpha=20, n_iter=50, verbose=True) dpgmm_int = Model(n_components=10, random_state=1, alpha=20, n_iter=50, verbose=1) old_stdout = sys.stdout sys.stdout = StringIO() try: # generate output with the boolean flag dpgmm_bool.fit(X) verbose_output = sys.stdout verbose_output.seek(0) bool_output = verbose_output.readline() # generate output with the int flag dpgmm_int.fit(X) verbose_output = sys.stdout verbose_output.seek(0) int_output = verbose_output.readline() assert_equal(bool_output, int_output) finally: sys.stdout = old_stdout def test_verbose_first_level(): # simple 3 cluster dataset X, y = make_blobs(random_state=1) for Model in [DPGMM, VBGMM]: dpgmm = Model(n_components=10, random_state=1, alpha=20, n_iter=50, verbose=1) old_stdout = sys.stdout sys.stdout = StringIO() try: dpgmm.fit(X) finally: sys.stdout = old_stdout def test_verbose_second_level(): # simple 3 cluster dataset X, y = make_blobs(random_state=1) for Model in [DPGMM, VBGMM]: dpgmm = Model(n_components=10, random_state=1, alpha=20, n_iter=50, verbose=2) old_stdout = sys.stdout sys.stdout = StringIO() try: dpgmm.fit(X) finally: sys.stdout = old_stdout def test_log_normalize(): v = np.array([0.1, 0.8, 0.01, 0.09]) a = np.log(2 * v) assert np.allclose(v, log_normalize(a), rtol=0.01) def do_model(self, **kwds): return VBGMM(verbose=False, **kwds) class DPGMMTester(GMMTester): model = DPGMM do_test_eval = False def score(self, g, train_obs): _, z = g.score_samples(train_obs) return g.lower_bound(train_obs, z) class TestDPGMMWithSphericalCovars(unittest.TestCase, DPGMMTester): covariance_type = 'spherical' setUp = GMMTester._setUp class TestDPGMMWithDiagCovars(unittest.TestCase, DPGMMTester): covariance_type = 'diag' setUp = GMMTester._setUp class TestDPGMMWithTiedCovars(unittest.TestCase, DPGMMTester): covariance_type = 'tied' setUp = GMMTester._setUp class TestDPGMMWithFullCovars(unittest.TestCase, DPGMMTester): covariance_type = 'full' setUp = GMMTester._setUp class VBGMMTester(GMMTester): model = do_model do_test_eval = False def score(self, g, train_obs): _, z = g.score_samples(train_obs) return g.lower_bound(train_obs, z) class TestVBGMMWithSphericalCovars(unittest.TestCase, VBGMMTester): covariance_type = 'spherical' setUp = GMMTester._setUp class TestVBGMMWithDiagCovars(unittest.TestCase, VBGMMTester): covariance_type = 'diag' setUp = GMMTester._setUp class TestVBGMMWithTiedCovars(unittest.TestCase, VBGMMTester): covariance_type = 'tied' setUp = GMMTester._setUp class TestVBGMMWithFullCovars(unittest.TestCase, VBGMMTester): covariance_type = 'full' setUp = GMMTester._setUp
bsd-3-clause
coderfi/ansible-modules-extras
packaging/macports.py
61
6679
#!/usr/bin/python # -*- coding: utf-8 -*- # (c) 2013, Jimmy Tang <jcftang@gmail.com> # Based on okpg (Patrick Pelletier <pp.pelletier@gmail.com>), pacman # (Afterburn) and pkgin (Shaun Zinck) modules # # This module is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # This software is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this software. If not, see <http://www.gnu.org/licenses/>. DOCUMENTATION = ''' --- module: macports author: Jimmy Tang short_description: Package manager for MacPorts description: - Manages MacPorts packages version_added: "1.1" options: name: description: - name of package to install/remove required: true state: description: - state of the package choices: [ 'present', 'absent', 'active', 'inactive' ] required: false default: present update_cache: description: - update the package db first required: false default: "no" choices: [ "yes", "no" ] notes: [] ''' EXAMPLES = ''' - macports: name=foo state=present - macports: name=foo state=present update_cache=yes - macports: name=foo state=absent - macports: name=foo state=active - macports: name=foo state=inactive ''' import pipes def update_package_db(module, port_path): """ Updates packages list. """ rc, out, err = module.run_command("%s sync" % port_path) if rc != 0: module.fail_json(msg="could not update package db") def query_package(module, port_path, name, state="present"): """ Returns whether a package is installed or not. """ if state == "present": rc, out, err = module.run_command("%s installed | grep -q ^.*%s" % (pipes.quote(port_path), pipes.quote(name)), use_unsafe_shell=True) if rc == 0: return True return False elif state == "active": rc, out, err = module.run_command("%s installed %s | grep -q active" % (pipes.quote(port_path), pipes.quote(name)), use_unsafe_shell=True) if rc == 0: return True return False def remove_packages(module, port_path, packages): """ Uninstalls one or more packages if installed. """ remove_c = 0 # Using a for loop incase of error, we can report the package that failed for package in packages: # Query the package first, to see if we even need to remove if not query_package(module, port_path, package): continue rc, out, err = module.run_command("%s uninstall %s" % (port_path, package)) if query_package(module, port_path, package): module.fail_json(msg="failed to remove %s: %s" % (package, out)) remove_c += 1 if remove_c > 0: module.exit_json(changed=True, msg="removed %s package(s)" % remove_c) module.exit_json(changed=False, msg="package(s) already absent") def install_packages(module, port_path, packages): """ Installs one or more packages if not already installed. """ install_c = 0 for package in packages: if query_package(module, port_path, package): continue rc, out, err = module.run_command("%s install %s" % (port_path, package)) if not query_package(module, port_path, package): module.fail_json(msg="failed to install %s: %s" % (package, out)) install_c += 1 if install_c > 0: module.exit_json(changed=True, msg="installed %s package(s)" % (install_c)) module.exit_json(changed=False, msg="package(s) already present") def activate_packages(module, port_path, packages): """ Activate a package if it's inactive. """ activate_c = 0 for package in packages: if not query_package(module, port_path, package): module.fail_json(msg="failed to activate %s, package(s) not present" % (package)) if query_package(module, port_path, package, state="active"): continue rc, out, err = module.run_command("%s activate %s" % (port_path, package)) if not query_package(module, port_path, package, state="active"): module.fail_json(msg="failed to activate %s: %s" % (package, out)) activate_c += 1 if activate_c > 0: module.exit_json(changed=True, msg="activated %s package(s)" % (activate_c)) module.exit_json(changed=False, msg="package(s) already active") def deactivate_packages(module, port_path, packages): """ Deactivate a package if it's active. """ deactivated_c = 0 for package in packages: if not query_package(module, port_path, package): module.fail_json(msg="failed to activate %s, package(s) not present" % (package)) if not query_package(module, port_path, package, state="active"): continue rc, out, err = module.run_command("%s deactivate %s" % (port_path, package)) if query_package(module, port_path, package, state="active"): module.fail_json(msg="failed to deactivated %s: %s" % (package, out)) deactivated_c += 1 if deactivated_c > 0: module.exit_json(changed=True, msg="deactivated %s package(s)" % (deactivated_c)) module.exit_json(changed=False, msg="package(s) already inactive") def main(): module = AnsibleModule( argument_spec = dict( name = dict(aliases=["pkg"], required=True), state = dict(default="present", choices=["present", "installed", "absent", "removed", "active", "inactive"]), update_cache = dict(default="no", aliases=["update-cache"], type='bool') ) ) port_path = module.get_bin_path('port', True, ['/opt/local/bin']) p = module.params if p["update_cache"]: update_package_db(module, port_path) pkgs = p["name"].split(",") if p["state"] in ["present", "installed"]: install_packages(module, port_path, pkgs) elif p["state"] in ["absent", "removed"]: remove_packages(module, port_path, pkgs) elif p["state"] == "active": activate_packages(module, port_path, pkgs) elif p["state"] == "inactive": deactivate_packages(module, port_path, pkgs) # import module snippets from ansible.module_utils.basic import * main()
gpl-3.0
ShawnPengxy/Flask-madeBlog
site-packages/httpie/output.py
5
16098
"""Output streaming, processing and formatting. """ import json import xml.dom.minidom from functools import partial from itertools import chain import pygments from pygments import token, lexer from pygments.styles import get_style_by_name, STYLE_MAP from pygments.lexers import get_lexer_for_mimetype, get_lexer_by_name from pygments.formatters.terminal import TerminalFormatter from pygments.formatters.terminal256 import Terminal256Formatter from pygments.util import ClassNotFound from .compat import is_windows from .solarized import Solarized256Style from .models import HTTPRequest, HTTPResponse, Environment from .input import (OUT_REQ_BODY, OUT_REQ_HEAD, OUT_RESP_HEAD, OUT_RESP_BODY) # The default number of spaces to indent when pretty printing DEFAULT_INDENT = 4 # Colors on Windows via colorama don't look that # great and fruity seems to give the best result there. AVAILABLE_STYLES = set(STYLE_MAP.keys()) AVAILABLE_STYLES.add('solarized') DEFAULT_STYLE = 'solarized' if not is_windows else 'fruity' BINARY_SUPPRESSED_NOTICE = ( b'\n' b'+-----------------------------------------+\n' b'| NOTE: binary data not shown in terminal |\n' b'+-----------------------------------------+' ) class BinarySuppressedError(Exception): """An error indicating that the body is binary and won't be written, e.g., for terminal output).""" message = BINARY_SUPPRESSED_NOTICE ############################################################################### # Output Streams ############################################################################### def write(stream, outfile, flush): """Write the output stream.""" try: # Writing bytes so we use the buffer interface (Python 3). buf = outfile.buffer except AttributeError: buf = outfile for chunk in stream: buf.write(chunk) if flush: outfile.flush() def write_with_colors_win_py3(stream, outfile, flush): """Like `write`, but colorized chunks are written as text directly to `outfile` to ensure it gets processed by colorama. Applies only to Windows with Python 3 and colorized terminal output. """ color = b'\x1b[' encoding = outfile.encoding for chunk in stream: if color in chunk: outfile.write(chunk.decode(encoding)) else: outfile.buffer.write(chunk) if flush: outfile.flush() def build_output_stream(args, env, request, response): """Build and return a chain of iterators over the `request`-`response` exchange each of which yields `bytes` chunks. """ req_h = OUT_REQ_HEAD in args.output_options req_b = OUT_REQ_BODY in args.output_options resp_h = OUT_RESP_HEAD in args.output_options resp_b = OUT_RESP_BODY in args.output_options req = req_h or req_b resp = resp_h or resp_b output = [] Stream = get_stream_type(env, args) if req: output.append(Stream( msg=HTTPRequest(request), with_headers=req_h, with_body=req_b)) if req_b and resp: # Request/Response separator. output.append([b'\n\n']) if resp: output.append(Stream( msg=HTTPResponse(response), with_headers=resp_h, with_body=resp_b)) if env.stdout_isatty and resp_b: # Ensure a blank line after the response body. # For terminal output only. output.append([b'\n\n']) return chain(*output) def get_stream_type(env, args): """Pick the right stream type based on `env` and `args`. Wrap it in a partial with the type-specific args so that we don't need to think what stream we are dealing with. """ if not env.stdout_isatty and not args.prettify: Stream = partial( RawStream, chunk_size=RawStream.CHUNK_SIZE_BY_LINE if args.stream else RawStream.CHUNK_SIZE ) elif args.prettify: Stream = partial( PrettyStream if args.stream else BufferedPrettyStream, env=env, processor=OutputProcessor( env=env, groups=args.prettify, pygments_style=args.style), ) else: Stream = partial(EncodedStream, env=env) return Stream class BaseStream(object): """Base HTTP message output stream class.""" def __init__(self, msg, with_headers=True, with_body=True, on_body_chunk_downloaded=None): """ :param msg: a :class:`models.HTTPMessage` subclass :param with_headers: if `True`, headers will be included :param with_body: if `True`, body will be included """ assert with_headers or with_body self.msg = msg self.with_headers = with_headers self.with_body = with_body self.on_body_chunk_downloaded = on_body_chunk_downloaded def _get_headers(self): """Return the headers' bytes.""" return self.msg.headers.encode('ascii') def _iter_body(self): """Return an iterator over the message body.""" raise NotImplementedError() def __iter__(self): """Return an iterator over `self.msg`.""" if self.with_headers: yield self._get_headers() yield b'\r\n\r\n' if self.with_body: try: for chunk in self._iter_body(): yield chunk if self.on_body_chunk_downloaded: self.on_body_chunk_downloaded(chunk) except BinarySuppressedError as e: if self.with_headers: yield b'\n' yield e.message class RawStream(BaseStream): """The message is streamed in chunks with no processing.""" CHUNK_SIZE = 1024 * 100 CHUNK_SIZE_BY_LINE = 1 def __init__(self, chunk_size=CHUNK_SIZE, **kwargs): super(RawStream, self).__init__(**kwargs) self.chunk_size = chunk_size def _iter_body(self): return self.msg.iter_body(self.chunk_size) class EncodedStream(BaseStream): """Encoded HTTP message stream. The message bytes are converted to an encoding suitable for `self.env.stdout`. Unicode errors are replaced and binary data is suppressed. The body is always streamed by line. """ CHUNK_SIZE = 1 def __init__(self, env=Environment(), **kwargs): super(EncodedStream, self).__init__(**kwargs) if env.stdout_isatty: # Use the encoding supported by the terminal. output_encoding = getattr(env.stdout, 'encoding', None) else: # Preserve the message encoding. output_encoding = self.msg.encoding # Default to utf8 when unsure. self.output_encoding = output_encoding or 'utf8' def _iter_body(self): for line, lf in self.msg.iter_lines(self.CHUNK_SIZE): if b'\0' in line: raise BinarySuppressedError() yield line.decode(self.msg.encoding)\ .encode(self.output_encoding, 'replace') + lf class PrettyStream(EncodedStream): """In addition to :class:`EncodedStream` behaviour, this stream applies content processing. Useful for long-lived HTTP responses that stream by lines such as the Twitter streaming API. """ CHUNK_SIZE = 1 def __init__(self, processor, **kwargs): super(PrettyStream, self).__init__(**kwargs) self.processor = processor def _get_headers(self): return self.processor.process_headers( self.msg.headers).encode(self.output_encoding) def _iter_body(self): for line, lf in self.msg.iter_lines(self.CHUNK_SIZE): if b'\0' in line: raise BinarySuppressedError() yield self._process_body(line) + lf def _process_body(self, chunk): return (self.processor .process_body( content=chunk.decode(self.msg.encoding, 'replace'), content_type=self.msg.content_type, encoding=self.msg.encoding) .encode(self.output_encoding, 'replace')) class BufferedPrettyStream(PrettyStream): """The same as :class:`PrettyStream` except that the body is fully fetched before it's processed. Suitable regular HTTP responses. """ CHUNK_SIZE = 1024 * 10 def _iter_body(self): # Read the whole body before prettifying it, # but bail out immediately if the body is binary. body = bytearray() for chunk in self.msg.iter_body(self.CHUNK_SIZE): if b'\0' in chunk: raise BinarySuppressedError() body.extend(chunk) yield self._process_body(body) ############################################################################### # Processing ############################################################################### class HTTPLexer(lexer.RegexLexer): """Simplified HTTP lexer for Pygments. It only operates on headers and provides a stronger contrast between their names and values than the original one bundled with Pygments (:class:`pygments.lexers.text import HttpLexer`), especially when Solarized color scheme is used. """ name = 'HTTP' aliases = ['http'] filenames = ['*.http'] tokens = { 'root': [ # Request-Line (r'([A-Z]+)( +)([^ ]+)( +)(HTTP)(/)(\d+\.\d+)', lexer.bygroups( token.Name.Function, token.Text, token.Name.Namespace, token.Text, token.Keyword.Reserved, token.Operator, token.Number )), # Response Status-Line (r'(HTTP)(/)(\d+\.\d+)( +)(\d{3})( +)(.+)', lexer.bygroups( token.Keyword.Reserved, # 'HTTP' token.Operator, # '/' token.Number, # Version token.Text, token.Number, # Status code token.Text, token.Name.Exception, # Reason )), # Header (r'(.*?)( *)(:)( *)(.+)', lexer.bygroups( token.Name.Attribute, # Name token.Text, token.Operator, # Colon token.Text, token.String # Value )) ] } class BaseProcessor(object): """Base, noop output processor class.""" enabled = True def __init__(self, env=Environment(), **kwargs): """ :param env: an class:`Environment` instance :param kwargs: additional keyword argument that some processor might require. """ self.env = env self.kwargs = kwargs def process_headers(self, headers): """Return processed `headers` :param headers: The headers as text. """ return headers def process_body(self, content, content_type, subtype, encoding): """Return processed `content`. :param content: The body content as text :param content_type: Full content type, e.g., 'application/atom+xml'. :param subtype: E.g. 'xml'. :param encoding: The original content encoding. """ return content class JSONProcessor(BaseProcessor): """JSON body processor.""" def process_body(self, content, content_type, subtype, encoding): if subtype == 'json': try: # Indent the JSON data, sort keys by name, and # avoid unicode escapes to improve readability. content = json.dumps(json.loads(content), sort_keys=True, ensure_ascii=False, indent=DEFAULT_INDENT) except ValueError: # Invalid JSON but we don't care. pass return content class XMLProcessor(BaseProcessor): """XML body processor.""" # TODO: tests def process_body(self, content, content_type, subtype, encoding): if subtype == 'xml': try: # Pretty print the XML doc = xml.dom.minidom.parseString(content.encode(encoding)) content = doc.toprettyxml(indent=' ' * DEFAULT_INDENT) except xml.parsers.expat.ExpatError: # Ignore invalid XML errors (skips attempting to pretty print) pass return content class PygmentsProcessor(BaseProcessor): """A processor that applies syntax-highlighting using Pygments to the headers, and to the body as well if its content type is recognized. """ def __init__(self, *args, **kwargs): super(PygmentsProcessor, self).__init__(*args, **kwargs) # Cache that speeds up when we process streamed body by line. self.lexers_by_type = {} if not self.env.colors: self.enabled = False return try: style = get_style_by_name( self.kwargs.get('pygments_style', DEFAULT_STYLE)) except ClassNotFound: style = Solarized256Style if self.env.is_windows or self.env.colors == 256: fmt_class = Terminal256Formatter else: fmt_class = TerminalFormatter self.formatter = fmt_class(style=style) def process_headers(self, headers): return pygments.highlight( headers, HTTPLexer(), self.formatter).strip() def process_body(self, content, content_type, subtype, encoding): try: lexer = self.lexers_by_type.get(content_type) if not lexer: try: lexer = get_lexer_for_mimetype(content_type) except ClassNotFound: lexer = get_lexer_by_name(subtype) self.lexers_by_type[content_type] = lexer except ClassNotFound: pass else: content = pygments.highlight(content, lexer, self.formatter) return content.strip() class HeadersProcessor(BaseProcessor): """Sorts headers by name retaining relative order of multiple headers with the same name. """ def process_headers(self, headers): lines = headers.splitlines() headers = sorted(lines[1:], key=lambda h: h.split(':')[0]) return '\r\n'.join(lines[:1] + headers) class OutputProcessor(object): """A delegate class that invokes the actual processors.""" installed_processors = { 'format': [ HeadersProcessor, JSONProcessor, XMLProcessor ], 'colors': [ PygmentsProcessor ] } def __init__(self, groups, env=Environment(), **kwargs): """ :param env: a :class:`models.Environment` instance :param groups: the groups of processors to be applied :param kwargs: additional keyword arguments for processors """ self.processors = [] for group in groups: for cls in self.installed_processors[group]: processor = cls(env, **kwargs) if processor.enabled: self.processors.append(processor) def process_headers(self, headers): for processor in self.processors: headers = processor.process_headers(headers) return headers def process_body(self, content, content_type, encoding): # e.g., 'application/atom+xml' content_type = content_type.split(';')[0] # e.g., 'xml' subtype = content_type.split('/')[-1].split('+')[-1] for processor in self.processors: content = processor.process_body( content, content_type, subtype, encoding ) return content
mit
EttusResearch/gnuradio
gr-channels/python/channels/qa_channel_model.py
47
1900
#!/usr/bin/env python # # Copyright 2012,2013 Free Software Foundation, Inc. # # This file is part of GNU Radio # # GNU Radio is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 3, or (at your option) # any later version. # # GNU Radio is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with GNU Radio; see the file COPYING. If not, write to # the Free Software Foundation, Inc., 51 Franklin Street, # Boston, MA 02110-1301, USA. # from gnuradio import gr, gr_unittest, analog, blocks, channels import math class test_channel_model(gr_unittest.TestCase): def setUp(self): self.tb = gr.top_block() def tearDown(self): self.tb = None def test_000(self): N = 1000 # number of samples to use fs = 1000 # baseband sampling rate freq = 100 signal = analog.sig_source_c(fs, analog.GR_SIN_WAVE, freq, 1) head = blocks.head(gr.sizeof_gr_complex, N) op = channels.channel_model(0.0, 0.0, 1.0, [1,], 0) snk = blocks.vector_sink_c() snk1 = blocks.vector_sink_c() op.set_noise_voltage(0.0) op.set_frequency_offset(0.0) op.set_taps([1,]) op.set_timing_offset(1.0) self.tb.connect(signal, head, op, snk) self.tb.connect(op, snk1) self.tb.run() dst_data = snk.data() exp_data = snk1.data() self.assertComplexTuplesAlmostEqual(exp_data, dst_data, 5) if __name__ == '__main__': gr_unittest.run(test_channel_model, "test_channel_model.xml")
gpl-3.0
wwright2/dcim3-angstrom1
sources/openembedded-core/meta/lib/oeqa/utils/commands.py
2
4475
# Copyright (c) 2013-2014 Intel Corporation # # Released under the MIT license (see COPYING.MIT) # DESCRIPTION # This module is mainly used by scripts/oe-selftest and modules under meta/oeqa/selftest # It provides a class and methods for running commands on the host in a convienent way for tests. import os import sys import signal import subprocess import threading import logging from oeqa.utils import CommandError from oeqa.utils import ftools class Command(object): def __init__(self, command, bg=False, timeout=None, data=None, **options): self.defaultopts = { "stdout": subprocess.PIPE, "stderr": subprocess.STDOUT, "stdin": None, "shell": False, "bufsize": -1, } self.cmd = command self.bg = bg self.timeout = timeout self.data = data self.options = dict(self.defaultopts) if isinstance(self.cmd, basestring): self.options["shell"] = True if self.data: self.options['stdin'] = subprocess.PIPE self.options.update(options) self.status = None self.output = None self.error = None self.thread = None self.log = logging.getLogger("utils.commands") def run(self): self.process = subprocess.Popen(self.cmd, **self.options) def commThread(): self.output, self.error = self.process.communicate(self.data) self.thread = threading.Thread(target=commThread) self.thread.start() self.log.debug("Running command '%s'" % self.cmd) if not self.bg: self.thread.join(self.timeout) self.stop() def stop(self): if self.thread.isAlive(): self.process.terminate() # let's give it more time to terminate gracefully before killing it self.thread.join(5) if self.thread.isAlive(): self.process.kill() self.thread.join() self.output = self.output.rstrip() self.status = self.process.poll() self.log.debug("Command '%s' returned %d as exit code." % (self.cmd, self.status)) # logging the complete output is insane # bitbake -e output is really big # and makes the log file useless if self.status: lout = "\n".join(self.output.splitlines()[-20:]) self.log.debug("Last 20 lines:\n%s" % lout) class Result(object): pass def runCmd(command, ignore_status=False, timeout=None, assert_error=True, **options): result = Result() cmd = Command(command, timeout=timeout, **options) cmd.run() result.command = command result.status = cmd.status result.output = cmd.output result.pid = cmd.process.pid if result.status and not ignore_status: if assert_error: raise AssertionError("Command '%s' returned non-zero exit status %d:\n%s" % (command, result.status, result.output)) else: raise CommandError(result.status, command, result.output) return result def bitbake(command, ignore_status=False, timeout=None, postconfig=None, **options): if postconfig: postconfig_file = os.path.join(os.environ.get('BUILDDIR'), 'oeqa-post.conf') ftools.write_file(postconfig_file, postconfig) extra_args = "-R %s" % postconfig_file else: extra_args = "" if isinstance(command, basestring): cmd = "bitbake " + extra_args + " " + command else: cmd = [ "bitbake" ] + [a for a in (command + extra_args.split(" ")) if a not in [""]] try: return runCmd(cmd, ignore_status, timeout, **options) finally: if postconfig: os.remove(postconfig_file) def get_bb_env(target=None, postconfig=None): if target: return bitbake("-e %s" % target, postconfig=postconfig).output else: return bitbake("-e", postconfig=postconfig).output def get_bb_var(var, target=None, postconfig=None): val = None bbenv = get_bb_env(target, postconfig=postconfig) for line in bbenv.splitlines(): if line.startswith(var + "="): val = line.split('=')[1] val = val.replace('\"','') break return val def get_test_layer(): layers = get_bb_var("BBLAYERS").split() testlayer = None for l in layers: if "/meta-selftest" in l and os.path.isdir(l): testlayer = l break return testlayer
mit
technic-tec/onedrive-d-old
onedrive_d/od_onedrive_api.py
2
23966
#!/usr/bin/python3 """ OneDrive REST API for onedrive_d. Refer to http://msdn.microsoft.com/en-us/library/dn659752.aspx Notes: * The API object can be called by any arbitrary thread in the program. * Call get_instance() will realize a API singleton object. * When there is network issue at an API call, the calling thread is put to sleep and thread manager will wake it up when the network seems fine. When the caller is waken up, it will retry the function that failed before. * When refresh_token is set, API will try to get new access_token automatically and retry the function call later. Bullets 3 and 4 are like interrupt handling. """ import os import json import urllib import functools import fcntl # import imghdr import requests # for debugging from time import sleep from . import od_glob from . import od_thread_manager api_instance = None def get_instance(): global api_instance if api_instance is None: api_instance = OneDriveAPI(od_glob.APP_CLIENT_ID, od_glob.APP_CLIENT_SECRET) return api_instance class OneDriveAPIException(Exception): def __init__(self, args=None): super().__init__() if args is None: pass elif 'error_description' in args: self.errno = args['error'] self.message = args['error_description'] elif 'error' in args and 'code' in args['error']: args = args['error'] self.errno = args['code'] self.message = args['message'] else: self.errno = 0 self.message = '' def __str__(self): return self.message + ' (' + self.errno + ')' class OneDriveAuthError(OneDriveAPIException): """ Raised when authentication fails. """ pass class OneDriveServerInternalError(OneDriveAPIException): pass class OneDriveValueError(OneDriveAPIException): """ Raised when input to OneDriveAPI is invalid. """ pass class OneDriveAPI: CLIENT_SCOPE = ['wl.skydrive', 'wl.skydrive_update', 'wl.offline_access'] REDIRECT_URI = 'https://login.live.com/oauth20_desktop.srf' OAUTH_AUTHORIZE_URI = 'https://login.live.com/oauth20_authorize.srf?' OAUTH_TOKEN_URI = 'https://login.live.com/oauth20_token.srf' OAUTH_SIGNOUT_URI = 'https://login.live.com/oauth20_logout.srf' API_URI = 'https://apis.live.net/v5.0/' FOLDER_TYPES = ['folder', 'album'] UNSUPPORTED_TYPES = ['notebook'] ROOT_ENTRY_ID = 'me/skydrive' logger = od_glob.get_logger() threadman = od_thread_manager.get_instance() def __init__(self, client_id, client_secret, client_scope=CLIENT_SCOPE, redirect_uri=REDIRECT_URI): self.client_access_token = None self.client_refresh_token = None self.client_id = client_id self.client_secret = client_secret self.client_scope = client_scope self.client_redirect_uri = redirect_uri self.http_client = requests.Session() def parse_response(self, request, error, ok_status=requests.codes.ok): ret = request.json() if request.status_code != ok_status: if 'code' in ret['error']: if ret['error']['code'] == 'request_token_expired': raise OneDriveAuthError(ret) elif ret['error']['code'] == 'server_internal_error': raise OneDriveServerInternalError(ret) raise error(ret) return ret def auto_recover_auth_error(self): """ Note that this function still throws exceptions. """ if self.client_refresh_token is None: raise OneDriveAuthError() refreshed_token_set = self.refresh_token(self.client_refresh_token) od_glob.get_config_instance().set_access_token(refreshed_token_set) self.logger.info('auto refreshed API token in face of auth error.') def get_auth_uri(self, display='touch', locale='en', state=''): """ Use the code returned in the final redirect URL to exchange for an access token http://msdn.microsoft.com/en-us/library/dn659750.aspx """ params = { 'client_id': self.client_id, 'scope': ' '.join(self.client_scope), 'response_type': 'code', 'redirect_uri': self.client_redirect_uri, 'display': display, 'locale': locale } if state != '': params['state'] = state return OneDriveAPI.OAUTH_AUTHORIZE_URI + urllib.parse.urlencode(params) def is_signed_in(self): return self.access_token is not None def set_user_id(self, id): self.user_id = id def set_access_token(self, token): self.client_access_token = token self.http_client.headers.update({'Authorization': 'Bearer ' + token}) def set_refresh_token(self, token): self.client_refresh_token = token def get_access_token(self, code=None, uri=None): """ http://msdn.microsoft.com/en-us/library/dn659750.aspx return a dict with keys token_type, expires_in, scope, access_token, refresh_token, authentication_token """ if uri is not None and '?' in uri: qs_dict = urllib.parse.parse_qs(uri.split('?')[1]) if 'code' in qs_dict: code = qs_dict['code'] if code is None: raise OneDriveValueError( {'error': 'access_code_not_found', 'error_description': 'The access code is not specified.'}) params = { "client_id": self.client_id, "client_secret": self.client_secret, "redirect_uri": self.client_redirect_uri, "code": code, "grant_type": "authorization_code" } try: request = requests.post( OneDriveAPI.OAUTH_TOKEN_URI, data=params, verify=False) response = self.parse_response(request, OneDriveAPIException) self.set_access_token(response['access_token']) self.set_refresh_token(response['refresh_token']) self.set_user_id(response['user_id']) return response except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() return self.get_access_token(code, uri) def refresh_token(self, token): params = { "client_id": self.client_id, "client_secret": self.client_secret, "redirect_uri": self.client_redirect_uri, "refresh_token": token, "grant_type": 'refresh_token' } while True: try: request = requests.post(OneDriveAPI.OAUTH_TOKEN_URI, data=params) response = self.parse_response(request, OneDriveAPIException) self.set_access_token(response['access_token']) self.set_refresh_token(response['refresh_token']) self.set_user_id(response['user_id']) return response except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() def sign_out(self): while True: try: r = self.http_client.get(OneDriveAPI.OAUTH_SIGNOUT_URI + '?client_id=' + self.client_id + '&redirect_uri=' + self.client_redirect_uri) return self.parse_response(r, OneDriveAuthError) except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() def get_recent_docs(self): raise NotImplementedError('get_recent_docs is not implemented.') def get_quota(self, user_id='me'): while True: try: r = self.http_client.get(OneDriveAPI.API_URI + user_id + '/skydrive/quota') return self.parse_response(r, OneDriveAPIException) except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() def get_root_entry_name(self): return self.ROOT_ENTRY_ID def get_property(self, entry_id='me/skydrive'): try: r = self.http_client.get(OneDriveAPI.API_URI + entry_id) return self.parse_response(r, OneDriveAPIException) except OneDriveAuthError: self.auto_recover_auth_error() return self.get_property(entry_id) except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() return self.get_property(entry_id) def set_property(self, entry_id, **kwargs): """ Different types of files have different RW fields. Refer to http://msdn.microsoft.com/en-us/library/dn631831.aspx. Example: self.set_property(your_id, name = 'new name', description = 'new desc') """ headers = { 'Content-Type': 'application/json', } while True: try: r = self.http_client.put( OneDriveAPI.API_URI + entry_id, data=json.dumps(kwargs), headers=headers) return self.parse_response(r, OneDriveAPIException) except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() def get_link(self, entry_id, type='r'): """ Return a link to share the entry. @param type: one of 'r' (default), 'rw', 'e' (short for 'embed'). """ if type == 'r': type = 'shared_read_link' elif type == 'rw': type = 'shared_edit_link' else: type = 'embed' while True: try: r = self.http_client.get(OneDriveAPI.API_URI + entry_id + '/' + type) return self.parse_response(r, OneDriveAPIException)['source'] except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() def list_entries(self, folder_id='me/skydrive', type='files'): """ @param type: 'files' (default) for all files. 'shared' for shared files (used internally). """ while True: try: r = self.http_client.get(OneDriveAPI.API_URI + folder_id + '/' + type) return self.parse_response(r, OneDriveAPIException)['data'] except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() except OneDriveServerInternalError as e: self.logger.error(e) self.threadman.hang_caller() def list_shared_entries(self, user_id='me'): return self.list_entries(user_id + '/skydrive', 'shared') def mkdir(self, folder_name, parent_id='me/skydrive'): if parent_id == '/': parent_id = 'me/skydrive' # fix parent_id alias data = {'name': folder_name} headers = {'Content-Type': 'application/json'} uri = OneDriveAPI.API_URI + parent_id while True: try: r = self.http_client.post(uri, data=json.dumps(data), headers=headers) return self.parse_response(r, OneDriveAPIException, requests.codes.created) except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() def cp(self, target_id, dest_folder_id, overwrite=True, type='COPY'): """ Return an entry dict if opeation succeeds. @param overwrite: whether or not to overwrite an existing entry. True, False, None (ChooseNewName). """ if overwrite is None: overwrite = 'ChooseNewName' data = {'destination': dest_folder_id} headers = { 'Content-Type': 'application/json', 'Authorization': 'Bearer ' + self.client_access_token } uri = OneDriveAPI.API_URI + target_id + '?overwrite=' + str(overwrite) req = requests.Request( type, uri, data=json.dumps(data), headers=headers).prepare() while True: try: r = self.http_client.send(req) return self.parse_response(r, OneDriveAPIException, requests.codes.created) except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() except OneDriveServerInternalError as e: self.logger.error(e) self.threadman.hang_caller() def mv(self, target_id, dest_folder_id, overwrite=True): return self.cp(target_id, dest_folder_id, overwrite, 'MOVE') def bits_put(self, name, folder_id, local_path=None, block_size=1048576): """ Upload a large file with Microsoft BITS API. A detailed document: https://gist.github.com/rgregg/37ba8929768a62131e85 Official document: https://msdn.microsoft.com/en-us/library/aa362821%28v=vs.85%29.aspx @param name: remote file name @param folder_id: the folder_id returned by Live API @param local_path: the local path of the file to upload @param remote_path (X): the remote path to put the file. @return None if an unrecoverable error occurs; or a file property dict. """ # get file size try: source_size = os.path.getsize(local_path) except: self.logger.error("cannot get file size of \"" + local_path + "\"") return None # produce request url if '!' in folder_id: # subfolder bits_folder_id = folder_id.split('.')[-1] url = "https://cid-" + self.user_id + \ ".users.storage.live.com/items/" + bits_folder_id + "/" + name elif folder_id != '': # root folder user_id = folder_id.split('.')[-1] url = "https://cid-" + user_id + \ ".users.storage.live.com/users/0x" + user_id + "/LiveFolders/" + name # elif remote_path is not None: # url = "https://cid-" + user_id + ".users.storage.live.com/users/0x" + user_id + "/LiveFolders/" + remote_path else: self.logger.error("cannot request BITS. folder_id is invalid.") return None # force refresh access token to get largest expiration time try: self.auto_recover_auth_error() except Exception as e: self.logger.error(e) return None # BITS: Create-Session headers = { 'X-Http-Method-Override': 'BITS_POST', 'Content-Length': 0, 'BITS-Packet-Type': 'Create-Session', 'BITS-Supported-Protocols': '{7df0354d-249b-430f-820d-3d2a9bef4931}' } self.logger.debug('getting session token for BITS upload...') while True: try: response = self.http_client.request('post', url, headers=headers) if response.status_code != 201: if 'www-authenticate' in response.headers and 'invalid_token' in response.headers['www-authenticate']: response.close() raise OneDriveAuthError() else: # unknown error should be further analyzed self.logger.debug("failed BITS Create-Session request to upload \"%s\". HTTP %d.", local_path, response.status_code) self.logger.debug(response.headers) response.close() return None session_id = response.headers['bits-session-id'] response.close() break except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() del headers # BITS: upload file by blocks # The autnentication of this part relies on session_id, not access_token. self.logger.debug('uploading file "%s".', local_path) source_file = open(local_path, 'rb') fcntl.lockf(source_file, fcntl.LOCK_SH) source_cursor = 0 while source_cursor < source_size: try: target_cursor = min(source_cursor + block_size, source_size) - 1 source_file.seek(source_cursor) data = source_file.read(target_cursor - source_cursor + 1) self.logger.debug("uploading block %d - %d (total: %d B)", source_cursor, target_cursor, source_size) response = self.http_client.request('post', url, data=data, headers={ 'X-Http-Method-Override': 'BITS_POST', 'BITS-Packet-Type': 'Fragment', 'BITS-Session-Id': session_id, 'Content-Range': 'bytes {}-{}/{}'.format(source_cursor, target_cursor, source_size) }) if response.status_code != requests.codes.ok: # unknown error. better log it for future analysis self.logger.debug('an error occurred uploading the block. HTTP %d.', response.status_code) self.logger.debug(response.headers) response.close() fcntl.lockf(source_file, fcntl.LOCK_UN) source_file.close() # should I cancel session? https://msdn.microsoft.com/en-us/library/aa362829%28v=vs.85%29.aspx return None else: source_cursor = int(response.headers['bits-received-content-range']) response.close() del data # sleep(1) except requests.exceptions.ConnectionError: self.logger.info('network connection error.') del data self.threadman.hang_caller() fcntl.lockf(source_file, fcntl.LOCK_UN) source_file.close() # refresh token if expired if od_glob.get_config_instance().is_token_expired(): try: self.auto_recover_auth_error() except Exception as e: # this branch is horrible self.logger.error(e) return None # BITS: close session self.logger.debug('BITS upload completed. Closing session...') headers = { 'X-Http-Method-Override': 'BITS_POST', 'BITS-Packet-Type': 'Close-Session', 'BITS-Session-Id': session_id, 'Content-Length': 0 } while True: try: response = self.http_client.request('post', url, headers=headers) if response.status_code != requests.codes.ok and response.status_code != requests.codes.created: # when token expires, server return HTTP 500 # www-authenticate: 'Bearer realm="OneDriveAPI", error="expired_token", error_description="Auth token expired. Try refreshing."' if 'www-authenticate' in response.headers and 'expired_token' in response.headers['www-authenticate']: # 'invalid_token' in response.headers['www-authenticate']: response.close() raise OneDriveAuthError() else: # however, when the token is changed, # we will get HTTP 500 with 'x-clienterrorcode': 'UploadSessionNotFound' self.logger.debug('An error occurred when closing BITS session. HTTP %d', response.status_code) self.logger.debug(response.headers) response.close() return None res_id = response.headers['x-resource-id'] response.close() self.logger.debug('BITS session successfully closed.') return self.get_property('file.' + res_id[:res_id.index('!')] + '.' + res_id) except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() def put(self, name, folder_id='me/skydrive', upload_location=None, local_path=None, data=None, overwrite=True): """ Upload the file or data to a path. Returns a dict with keys 'source', 'name', and 'id' @param name: the new name used for the uploaded FILE. Assuming the name is NTFS-compatible. @param folder_id: the parent folder of the entry to upload. Default: root folder. @param upload_location: OneDrive upload_location URL. If given, folder_id is ignored. @param local_path: the local path of the FILE. @param data: the data of the entry. If given, local_path is ignored. @param overwrite: whether or not to overwrite existing files, if any. To put an empty file, either local_path points to an empty file or data is set ''. To upload a dir, check if it exists, and then send recursive puts to upload its files. Another issue is timestamp correction. """ uri = OneDriveAPI.API_URI if upload_location is not None: uri += upload_location # already ends with '/' else: uri += folder_id + '/files/' if name == '': raise OneDriveValueError( {'error': 'empty_name', 'error_description': 'The file name cannot be empty.'}) uri += name d = { 'downsize_photo_uploads': False, 'overwrite': overwrite } uri += '?' + urllib.parse.urlencode(d) if data is not None: pass elif local_path is not None: if not os.path.isfile(local_path): raise OneDriveValueError( {'error': 'wrong_file_type', 'error_description': 'The local path "' + local_path + '" is not a file.'}) else: data = open(local_path, 'rb') else: raise OneDriveValueError( {'error': 'upload_null_content', 'error_description': 'local_path and data cannot both be null.'}) while True: try: r = self.http_client.put(uri, data=data) ret = r.json() if r.status_code != requests.codes.ok and r.status_code != requests.codes.created: # TODO: try testing this if 'error' in ret and 'code' in ret['error'] and ret['error']['code'] == 'request_token_expired': raise OneDriveAuthError(ret) else: raise OneDriveAPIException(ret) return self.get_property(ret['id']) except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() except OneDriveServerInternalError as e: self.logger.error(e) self.threadman.hang_caller() def get_by_blocks(self, entry_id, local_path, file_size, block_size): try: f = open(local_path, 'wb') except OSError as e: self.logger.error(e) return False self.logger.debug('download file to "' + local_path + '"...') # fcntl.lockf(f, fcntl.LOCK_SH) cursor = 0 while cursor < file_size: self.logger.debug('current cursor: ' + str(cursor)) try: target = min(cursor + block_size, file_size) - 1 r = self.http_client.get(OneDriveAPI.API_URI + entry_id + '/content', headers={ 'Range': 'bytes={0}-{1}'.format(cursor, target) }) if r.status_code == requests.codes.ok or r.status_code == requests.codes.partial: # sample data: 'bytes 12582912-12927920/12927921' range_unit, range_str = r.headers['content-range'].split(' ') range_range, range_total = range_str.split('/') range_from, range_to = range_range.split('-') f.write(r.content) cursor = int(range_to) + 1 r.close() else: if 'www-authenticate' in r.headers and 'invalid_token' in r.headers['www-authenticate']: raise OneDriveAuthError() else: self.logger.debug('failed downloading block. HTTP %d.', r.status_code) self.logger.debug(r.headers) self.logger.debug(r.content) return False # return False except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() f.close() self.logger.debug('file saved.') # fcntl.lockf(f, fcntl.LOCK_UN) return True def get(self, entry_id, local_path=None): """ Fetching content of OneNote files will raise OneDriveAPIException: Resource type 'notebook' doesn't support the path 'content'. (request_url_invalid) """ while True: try: r = self.http_client.get(OneDriveAPI.API_URI + entry_id + '/content') if r.status_code != requests.codes.ok: ret = r.json() # TODO: try testing this if 'error' in ret and 'code' in ret['error'] and ret['error']['code'] == 'request_token_expired': raise OneDriveAuthError(ret) else: raise OneDriveAPIException(ret) if local_path is not None: with open(local_path, 'wb') as f: f.write(r.content) return True else: return r.content except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() except OneDriveServerInternalError as e: self.logger.error(e) self.threadman.hang_caller() def rm(self, entry_id): """ OneDrive API always returns HTTP 204. """ while True: try: self.http_client.delete(OneDriveAPI.API_URI + entry_id) return except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() except OneDriveServerInternalError as e: self.logger.error(e) self.threadman.hang_caller() def get_user_info(self, user_id='me'): while True: try: r = self.http_client.get(OneDriveAPI.API_URI + user_id) return self.parse_response(r, OneDriveAPIException, requests.codes.ok) except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller() def get_contact_list(self, user_id='me'): while True: try: r = self.http_client.get(OneDriveAPI.API_URI + user_id + '/friends') return self.parse_response(r, OneDriveAPIException, requests.codes.ok) except OneDriveAuthError: self.auto_recover_auth_error() except requests.exceptions.ConnectionError: self.logger.info('network connection error.') self.threadman.hang_caller()
lgpl-3.0
scieloorg/wayta
setup.py
1
1219
import os from setuptools import setup, find_packages here = os.path.abspath(os.path.dirname(__file__)) with open(os.path.join(here, 'README.txt')) as f: README = f.read() with open(os.path.join(here, 'CHANGES.txt')) as f: CHANGES = f.read() requires = [ 'elasticsearch>=1.1.1', 'pyramid>=1.5.2', 'pyramid_chameleon>=0.3', 'pyramid_debugtoolbar>=2.1' ] setup(name='wayta', version='1.3.1', description='A tool to suggest the name of an institution or country in the original form and language.', long_description=README + '\n\n' + CHANGES, classifiers=[ "Programming Language :: Python", "Framework :: Pyramid", "Topic :: Internet :: WWW/HTTP", "Topic :: Internet :: WWW/HTTP :: WSGI :: Application", ], author='SciELO', author_email='tecnologia@scielo.org', url='http://docs.scielo.org', keywords='web pyramid pylons', packages=find_packages(), include_package_data=True, zip_safe=False, install_requires=requires, entry_points="""\ [paste.app_factory] main = wayta:main [console_scripts] wayta_loaddata=processing.loaddata:main """, )
bsd-2-clause
zorroz/microblog
flask/lib/python2.7/site-packages/setuptools/sandbox.py
221
9994
import os import sys import tempfile import operator import functools import itertools import re import pkg_resources if os.name == "java": import org.python.modules.posix.PosixModule as _os else: _os = sys.modules[os.name] try: _file = file except NameError: _file = None _open = open from distutils.errors import DistutilsError from pkg_resources import working_set from setuptools.compat import builtins, execfile __all__ = [ "AbstractSandbox", "DirectorySandbox", "SandboxViolation", "run_setup", ] def run_setup(setup_script, args): """Run a distutils setup script, sandboxed in its directory""" old_dir = os.getcwd() save_argv = sys.argv[:] save_path = sys.path[:] setup_dir = os.path.abspath(os.path.dirname(setup_script)) temp_dir = os.path.join(setup_dir,'temp') if not os.path.isdir(temp_dir): os.makedirs(temp_dir) save_tmp = tempfile.tempdir save_modules = sys.modules.copy() pr_state = pkg_resources.__getstate__() try: tempfile.tempdir = temp_dir os.chdir(setup_dir) try: sys.argv[:] = [setup_script]+list(args) sys.path.insert(0, setup_dir) # reset to include setup dir, w/clean callback list working_set.__init__() working_set.callbacks.append(lambda dist:dist.activate()) DirectorySandbox(setup_dir).run( lambda: execfile( "setup.py", {'__file__':setup_script, '__name__':'__main__'} ) ) except SystemExit: v = sys.exc_info()[1] if v.args and v.args[0]: raise # Normal exit, just return finally: pkg_resources.__setstate__(pr_state) sys.modules.update(save_modules) # remove any modules imported within the sandbox del_modules = [ mod_name for mod_name in sys.modules if mod_name not in save_modules # exclude any encodings modules. See #285 and not mod_name.startswith('encodings.') ] list(map(sys.modules.__delitem__, del_modules)) os.chdir(old_dir) sys.path[:] = save_path sys.argv[:] = save_argv tempfile.tempdir = save_tmp class AbstractSandbox: """Wrap 'os' module and 'open()' builtin for virtualizing setup scripts""" _active = False def __init__(self): self._attrs = [ name for name in dir(_os) if not name.startswith('_') and hasattr(self,name) ] def _copy(self, source): for name in self._attrs: setattr(os, name, getattr(source,name)) def run(self, func): """Run 'func' under os sandboxing""" try: self._copy(self) if _file: builtins.file = self._file builtins.open = self._open self._active = True return func() finally: self._active = False if _file: builtins.file = _file builtins.open = _open self._copy(_os) def _mk_dual_path_wrapper(name): original = getattr(_os,name) def wrap(self,src,dst,*args,**kw): if self._active: src,dst = self._remap_pair(name,src,dst,*args,**kw) return original(src,dst,*args,**kw) return wrap for name in ["rename", "link", "symlink"]: if hasattr(_os,name): locals()[name] = _mk_dual_path_wrapper(name) def _mk_single_path_wrapper(name, original=None): original = original or getattr(_os,name) def wrap(self,path,*args,**kw): if self._active: path = self._remap_input(name,path,*args,**kw) return original(path,*args,**kw) return wrap if _file: _file = _mk_single_path_wrapper('file', _file) _open = _mk_single_path_wrapper('open', _open) for name in [ "stat", "listdir", "chdir", "open", "chmod", "chown", "mkdir", "remove", "unlink", "rmdir", "utime", "lchown", "chroot", "lstat", "startfile", "mkfifo", "mknod", "pathconf", "access" ]: if hasattr(_os,name): locals()[name] = _mk_single_path_wrapper(name) def _mk_single_with_return(name): original = getattr(_os,name) def wrap(self,path,*args,**kw): if self._active: path = self._remap_input(name,path,*args,**kw) return self._remap_output(name, original(path,*args,**kw)) return original(path,*args,**kw) return wrap for name in ['readlink', 'tempnam']: if hasattr(_os,name): locals()[name] = _mk_single_with_return(name) def _mk_query(name): original = getattr(_os,name) def wrap(self,*args,**kw): retval = original(*args,**kw) if self._active: return self._remap_output(name, retval) return retval return wrap for name in ['getcwd', 'tmpnam']: if hasattr(_os,name): locals()[name] = _mk_query(name) def _validate_path(self,path): """Called to remap or validate any path, whether input or output""" return path def _remap_input(self,operation,path,*args,**kw): """Called for path inputs""" return self._validate_path(path) def _remap_output(self,operation,path): """Called for path outputs""" return self._validate_path(path) def _remap_pair(self,operation,src,dst,*args,**kw): """Called for path pairs like rename, link, and symlink operations""" return ( self._remap_input(operation+'-from',src,*args,**kw), self._remap_input(operation+'-to',dst,*args,**kw) ) if hasattr(os, 'devnull'): _EXCEPTIONS = [os.devnull,] else: _EXCEPTIONS = [] try: from win32com.client.gencache import GetGeneratePath _EXCEPTIONS.append(GetGeneratePath()) del GetGeneratePath except ImportError: # it appears pywin32 is not installed, so no need to exclude. pass class DirectorySandbox(AbstractSandbox): """Restrict operations to a single subdirectory - pseudo-chroot""" write_ops = dict.fromkeys([ "open", "chmod", "chown", "mkdir", "remove", "unlink", "rmdir", "utime", "lchown", "chroot", "mkfifo", "mknod", "tempnam", ]) _exception_patterns = [ # Allow lib2to3 to attempt to save a pickled grammar object (#121) '.*lib2to3.*\.pickle$', ] "exempt writing to paths that match the pattern" def __init__(self, sandbox, exceptions=_EXCEPTIONS): self._sandbox = os.path.normcase(os.path.realpath(sandbox)) self._prefix = os.path.join(self._sandbox,'') self._exceptions = [ os.path.normcase(os.path.realpath(path)) for path in exceptions ] AbstractSandbox.__init__(self) def _violation(self, operation, *args, **kw): raise SandboxViolation(operation, args, kw) if _file: def _file(self, path, mode='r', *args, **kw): if mode not in ('r', 'rt', 'rb', 'rU', 'U') and not self._ok(path): self._violation("file", path, mode, *args, **kw) return _file(path,mode,*args,**kw) def _open(self, path, mode='r', *args, **kw): if mode not in ('r', 'rt', 'rb', 'rU', 'U') and not self._ok(path): self._violation("open", path, mode, *args, **kw) return _open(path,mode,*args,**kw) def tmpnam(self): self._violation("tmpnam") def _ok(self, path): active = self._active try: self._active = False realpath = os.path.normcase(os.path.realpath(path)) return ( self._exempted(realpath) or realpath == self._sandbox or realpath.startswith(self._prefix) ) finally: self._active = active def _exempted(self, filepath): start_matches = ( filepath.startswith(exception) for exception in self._exceptions ) pattern_matches = ( re.match(pattern, filepath) for pattern in self._exception_patterns ) candidates = itertools.chain(start_matches, pattern_matches) return any(candidates) def _remap_input(self, operation, path, *args, **kw): """Called for path inputs""" if operation in self.write_ops and not self._ok(path): self._violation(operation, os.path.realpath(path), *args, **kw) return path def _remap_pair(self, operation, src, dst, *args, **kw): """Called for path pairs like rename, link, and symlink operations""" if not self._ok(src) or not self._ok(dst): self._violation(operation, src, dst, *args, **kw) return (src,dst) def open(self, file, flags, mode=0x1FF, *args, **kw): # 0777 """Called for low-level os.open()""" if flags & WRITE_FLAGS and not self._ok(file): self._violation("os.open", file, flags, mode, *args, **kw) return _os.open(file,flags,mode, *args, **kw) WRITE_FLAGS = functools.reduce( operator.or_, [getattr(_os, a, 0) for a in "O_WRONLY O_RDWR O_APPEND O_CREAT O_TRUNC O_TEMPORARY".split()] ) class SandboxViolation(DistutilsError): """A setup script attempted to modify the filesystem outside the sandbox""" def __str__(self): return """SandboxViolation: %s%r %s The package setup script has attempted to modify files on your system that are not within the EasyInstall build area, and has been aborted. This package cannot be safely installed by EasyInstall, and may not support alternate installation locations even if you run its setup script by hand. Please inform the package's author and the EasyInstall maintainers to find out if a fix or workaround is available.""" % self.args #
bsd-3-clause
uglyboxer/linear_neuron
net-p3/lib/python3.5/site-packages/setuptools/compat.py
456
2094
import sys import itertools PY3 = sys.version_info >= (3,) PY2 = not PY3 if PY2: basestring = basestring import __builtin__ as builtins import ConfigParser from StringIO import StringIO BytesIO = StringIO func_code = lambda o: o.func_code func_globals = lambda o: o.func_globals im_func = lambda o: o.im_func from htmlentitydefs import name2codepoint import httplib from BaseHTTPServer import HTTPServer from SimpleHTTPServer import SimpleHTTPRequestHandler from BaseHTTPServer import BaseHTTPRequestHandler iteritems = lambda o: o.iteritems() long_type = long maxsize = sys.maxint unichr = unichr unicode = unicode bytes = str from urllib import url2pathname, splittag, pathname2url import urllib2 from urllib2 import urlopen, HTTPError, URLError, unquote, splituser from urlparse import urlparse, urlunparse, urljoin, urlsplit, urlunsplit filterfalse = itertools.ifilterfalse exec("""def reraise(tp, value, tb=None): raise tp, value, tb""") if PY3: basestring = str import builtins import configparser as ConfigParser from io import StringIO, BytesIO func_code = lambda o: o.__code__ func_globals = lambda o: o.__globals__ im_func = lambda o: o.__func__ from html.entities import name2codepoint import http.client as httplib from http.server import HTTPServer, SimpleHTTPRequestHandler from http.server import BaseHTTPRequestHandler iteritems = lambda o: o.items() long_type = int maxsize = sys.maxsize unichr = chr unicode = str bytes = bytes from urllib.error import HTTPError, URLError import urllib.request as urllib2 from urllib.request import urlopen, url2pathname, pathname2url from urllib.parse import ( urlparse, urlunparse, unquote, splituser, urljoin, urlsplit, urlunsplit, splittag, ) filterfalse = itertools.filterfalse def reraise(tp, value, tb=None): if value.__traceback__ is not tb: raise value.with_traceback(tb) raise value
mit
guewen/OpenUpgrade
addons/account_payment/wizard/__init__.py
436
1144
# -*- coding: utf-8 -*- ############################################################################## # # OpenERP, Open Source Management Solution # Copyright (C) 2004-2010 Tiny SPRL (<http://tiny.be>). # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## import account_payment_order import account_payment_populate_statement import account_payment_pay # vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:
agpl-3.0
zhuwenping/python-for-android
python-build/python-libs/gdata/build/lib/gdata/health/service.py
263
10007
#!/usr/bin/python # # Copyright 2009 Google Inc. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """HealthService extends GDataService to streamline Google Health API access. HealthService: Provides methods to interact with the profile, profile list, and register/notices feeds. Extends GDataService. HealthProfileQuery: Queries the Google Health Profile feed. HealthProfileListQuery: Queries the Google Health Profile list feed. """ __author__ = 'api.eric@google.com (Eric Bidelman)' import atom import gdata.health import gdata.service class HealthService(gdata.service.GDataService): """Client extension for the Google Health service Document List feed.""" def __init__(self, email=None, password=None, source=None, use_h9_sandbox=False, server='www.google.com', additional_headers=None, **kwargs): """Creates a client for the Google Health service. Args: email: string (optional) The user's email address, used for authentication. password: string (optional) The user's password. source: string (optional) The name of the user's application. use_h9_sandbox: boolean (optional) True to issue requests against the /h9 developer's sandbox. server: string (optional) The name of the server to which a connection will be opened. additional_headers: dictionary (optional) Any additional headers which should be included with CRUD operations. kwargs: The other parameters to pass to gdata.service.GDataService constructor. """ service = use_h9_sandbox and 'weaver' or 'health' gdata.service.GDataService.__init__( self, email=email, password=password, service=service, source=source, server=server, additional_headers=additional_headers, **kwargs) self.ssl = True self.use_h9_sandbox = use_h9_sandbox def __get_service(self): return self.use_h9_sandbox and 'h9' or 'health' def GetProfileFeed(self, query=None, profile_id=None): """Fetches the users Google Health profile feed. Args: query: HealthProfileQuery or string (optional) A query to use on the profile feed. If None, a HealthProfileQuery is constructed. profile_id: string (optional) The profile id to query the profile feed with when using ClientLogin. Note: this parameter is ignored if query is set. Returns: A gdata.health.ProfileFeed object containing the user's Health profile. """ if query is None: projection = profile_id and 'ui' or 'default' uri = HealthProfileQuery( service=self.__get_service(), projection=projection, profile_id=profile_id).ToUri() elif isinstance(query, HealthProfileQuery): uri = query.ToUri() else: uri = query return self.GetFeed(uri, converter=gdata.health.ProfileFeedFromString) def GetProfileListFeed(self, query=None): """Fetches the users Google Health profile feed. Args: query: HealthProfileListQuery or string (optional) A query to use on the profile list feed. If None, a HealthProfileListQuery is constructed to /health/feeds/profile/list or /h9/feeds/profile/list. Returns: A gdata.health.ProfileListFeed object containing the user's list of profiles. """ if not query: uri = HealthProfileListQuery(service=self.__get_service()).ToUri() elif isinstance(query, HealthProfileListQuery): uri = query.ToUri() else: uri = query return self.GetFeed(uri, converter=gdata.health.ProfileListFeedFromString) def SendNotice(self, subject, body=None, content_type='html', ccr=None, profile_id=None): """Sends (posts) a notice to the user's Google Health profile. Args: subject: A string representing the message's subject line. body: string (optional) The message body. content_type: string (optional) The content type of the notice message body. This parameter is only honored when a message body is specified. ccr: string (optional) The CCR XML document to reconcile into the user's profile. profile_id: string (optional) The profile id to work with when using ClientLogin. Note: this parameter is ignored if query is set. Returns: A gdata.health.ProfileEntry object of the posted entry. """ if body: content = atom.Content(content_type=content_type, text=body) else: content = body entry = gdata.GDataEntry( title=atom.Title(text=subject), content=content, extension_elements=[atom.ExtensionElementFromString(ccr)]) projection = profile_id and 'ui' or 'default' query = HealthRegisterQuery(service=self.__get_service(), projection=projection, profile_id=profile_id) return self.Post(entry, query.ToUri(), converter=gdata.health.ProfileEntryFromString) class HealthProfileQuery(gdata.service.Query): """Object used to construct a URI to query the Google Health profile feed.""" def __init__(self, service='health', feed='feeds/profile', projection='default', profile_id=None, text_query=None, params=None, categories=None): """Constructor for Health profile feed query. Args: service: string (optional) The service to query. Either 'health' or 'h9'. feed: string (optional) The path for the feed. The default value is 'feeds/profile'. projection: string (optional) The visibility of the data. Possible values are 'default' for AuthSub and 'ui' for ClientLogin. If this value is set to 'ui', the profile_id parameter should also be set. profile_id: string (optional) The profile id to query. This should only be used when using ClientLogin. text_query: str (optional) The contents of the q query parameter. The contents of the text_query are URL escaped upon conversion to a URI. Note: this parameter can only be used on the register feed using ClientLogin. params: dict (optional) Parameter value string pairs which become URL params when translated to a URI. These parameters are added to the query's items. categories: list (optional) List of category strings which should be included as query categories. See gdata.service.Query for additional documentation. """ self.service = service self.profile_id = profile_id self.projection = projection gdata.service.Query.__init__(self, feed=feed, text_query=text_query, params=params, categories=categories) def ToUri(self): """Generates a URI from the query parameters set in the object. Returns: A string containing the URI used to retrieve entries from the Health profile feed. """ old_feed = self.feed self.feed = '/'.join([self.service, old_feed, self.projection]) if self.profile_id: self.feed += '/' + self.profile_id self.feed = '/%s' % (self.feed,) new_feed = gdata.service.Query.ToUri(self) self.feed = old_feed return new_feed class HealthProfileListQuery(gdata.service.Query): """Object used to construct a URI to query a Health profile list feed.""" def __init__(self, service='health', feed='feeds/profile/list'): """Constructor for Health profile list feed query. Args: service: string (optional) The service to query. Either 'health' or 'h9'. feed: string (optional) The path for the feed. The default value is 'feeds/profile/list'. """ gdata.service.Query.__init__(self, feed) self.service = service def ToUri(self): """Generates a URI from the query parameters set in the object. Returns: A string containing the URI used to retrieve entries from the profile list feed. """ return '/%s' % ('/'.join([self.service, self.feed]),) class HealthRegisterQuery(gdata.service.Query): """Object used to construct a URI to query a Health register/notice feed.""" def __init__(self, service='health', feed='feeds/register', projection='default', profile_id=None): """Constructor for Health profile list feed query. Args: service: string (optional) The service to query. Either 'health' or 'h9'. feed: string (optional) The path for the feed. The default value is 'feeds/register'. projection: string (optional) The visibility of the data. Possible values are 'default' for AuthSub and 'ui' for ClientLogin. If this value is set to 'ui', the profile_id parameter should also be set. profile_id: string (optional) The profile id to query. This should only be used when using ClientLogin. """ gdata.service.Query.__init__(self, feed) self.service = service self.projection = projection self.profile_id = profile_id def ToUri(self): """Generates a URI from the query parameters set in the object. Returns: A string containing the URI needed to interact with the register feed. """ old_feed = self.feed self.feed = '/'.join([self.service, old_feed, self.projection]) new_feed = gdata.service.Query.ToUri(self) self.feed = old_feed if self.profile_id: new_feed += '/' + self.profile_id return '/%s' % (new_feed,)
apache-2.0
pp-mo/iris
lib/iris/quickplot.py
2
9074
# Copyright Iris contributors # # This file is part of Iris and is released under the LGPL license. # See COPYING and COPYING.LESSER in the root of the repository for full # licensing details. """ High-level plotting extensions to :mod:`iris.plot`. These routines work much like their :mod:`iris.plot` counterparts, but they automatically add a plot title, axis titles, and a colour bar when appropriate. See also: :ref:`matplotlib <matplotlib:users-guide-index>`. """ import cf_units import matplotlib.pyplot as plt import iris.config import iris.coords import iris.plot as iplt def _use_symbol(units): # For non-time units use the shortest unit representation. # E.g. prefer 'K' over 'kelvin', but not '0.0174532925199433 rad' # over 'degrees' return ( not units.is_time() and not units.is_time_reference() and len(units.symbol) < len(str(units)) ) def _title(cube_or_coord, with_units): if cube_or_coord is None or isinstance(cube_or_coord, int): title = "" else: title = cube_or_coord.name().replace("_", " ").capitalize() units = cube_or_coord.units if with_units and not ( units.is_unknown() or units.is_no_unit() or units == cf_units.Unit("1") ): if _use_symbol(units): units = units.symbol title += " / {}".format(units) return title def _label(cube, mode, result=None, ndims=2, coords=None, axes=None): """Puts labels on the current plot using the given cube.""" if axes is None: axes = plt.gca() axes.set_title(_title(cube, with_units=False)) if result is not None: draw_edges = mode == iris.coords.POINT_MODE bar = plt.colorbar( result, orientation="horizontal", drawedges=draw_edges ) has_known_units = not ( cube.units.is_unknown() or cube.units.is_no_unit() ) if has_known_units and cube.units != cf_units.Unit("1"): # Use shortest unit representation for anything other than time if _use_symbol(cube.units): bar.set_label(cube.units.symbol) else: bar.set_label(cube.units) # Remove the tick which is put on the colorbar by default. bar.ax.tick_params(length=0) if coords is None: plot_defn = iplt._get_plot_defn(cube, mode, ndims) else: plot_defn = iplt._get_plot_defn_custom_coords_picked( cube, coords, mode, ndims=ndims ) if ndims == 2: if not iplt._can_draw_map(plot_defn.coords): axes.set_ylabel(_title(plot_defn.coords[0], with_units=True)) axes.set_xlabel(_title(plot_defn.coords[1], with_units=True)) elif ndims == 1: axes.set_xlabel(_title(plot_defn.coords[0], with_units=True)) axes.set_ylabel(_title(cube, with_units=True)) else: msg = ( "Unexpected number of dimensions ({}) given to " "_label.".format(ndims) ) raise ValueError(msg) def _label_with_bounds(cube, result=None, ndims=2, coords=None, axes=None): _label(cube, iris.coords.BOUND_MODE, result, ndims, coords, axes) def _label_with_points(cube, result=None, ndims=2, coords=None, axes=None): _label(cube, iris.coords.POINT_MODE, result, ndims, coords, axes) def _get_titles(u_object, v_object): if u_object is None: u_object = iplt._u_object_from_v_object(v_object) xunits = u_object is not None and not u_object.units.is_time_reference() yunits = not v_object.units.is_time_reference() xlabel = _title(u_object, with_units=xunits) ylabel = _title(v_object, with_units=yunits) title = "" if u_object is None: title = _title(v_object, with_units=False) elif isinstance(u_object, iris.cube.Cube) and not isinstance( v_object, iris.cube.Cube ): title = _title(u_object, with_units=False) elif isinstance(v_object, iris.cube.Cube) and not isinstance( u_object, iris.cube.Cube ): title = _title(v_object, with_units=False) return xlabel, ylabel, title def _label_1d_plot(*args, **kwargs): if len(args) > 1 and isinstance( args[1], (iris.cube.Cube, iris.coords.Coord) ): xlabel, ylabel, title = _get_titles(*args[:2]) else: xlabel, ylabel, title = _get_titles(None, args[0]) axes = kwargs.pop("axes", None) if len(kwargs) != 0: msg = "Unexpected kwargs {} given to _label_1d_plot".format( kwargs.keys() ) raise ValueError(msg) if axes is None: axes = plt.gca() axes.set_title(title) axes.set_xlabel(xlabel) axes.set_ylabel(ylabel) def contour(cube, *args, **kwargs): """ Draws contour lines on a labelled plot based on the given Cube. With the basic call signature, contour "level" values are chosen automatically:: contour(cube) Supply a number to use *N* automatically chosen levels:: contour(cube, N) Supply a sequence *V* to use explicitly defined levels:: contour(cube, V) See :func:`iris.plot.contour` for details of valid keyword arguments. """ coords = kwargs.get("coords") axes = kwargs.get("axes") result = iplt.contour(cube, *args, **kwargs) _label_with_points(cube, coords=coords, axes=axes) return result def contourf(cube, *args, **kwargs): """ Draws filled contours on a labelled plot based on the given Cube. With the basic call signature, contour "level" values are chosen automatically:: contour(cube) Supply a number to use *N* automatically chosen levels:: contour(cube, N) Supply a sequence *V* to use explicitly defined levels:: contour(cube, V) See :func:`iris.plot.contourf` for details of valid keyword arguments. """ coords = kwargs.get("coords") axes = kwargs.get("axes") result = iplt.contourf(cube, *args, **kwargs) _label_with_points(cube, result, coords=coords, axes=axes) return result def outline(cube, coords=None, color="k", linewidth=None, axes=None): """ Draws cell outlines on a labelled plot based on the given Cube. Kwargs: * coords: list of :class:`~iris.coords.Coord` objects or coordinate names Use the given coordinates as the axes for the plot. The order of the given coordinates indicates which axis to use for each, where the first element is the horizontal axis of the plot and the second element is the vertical axis of the plot. * color: None or mpl color The color of the cell outlines. If None, the matplotlibrc setting patch.edgecolor is used by default. * linewidth: None or number The width of the lines showing the cell outlines. If None, the default width in patch.linewidth in matplotlibrc is used. """ result = iplt.outline( cube, color=color, linewidth=linewidth, coords=coords, axes=axes ) _label_with_bounds(cube, coords=coords, axes=axes) return result def pcolor(cube, *args, **kwargs): """ Draws a labelled pseudocolor plot based on the given Cube. See :func:`iris.plot.pcolor` for details of valid keyword arguments. """ coords = kwargs.get("coords") axes = kwargs.get("axes") result = iplt.pcolor(cube, *args, **kwargs) _label_with_bounds(cube, result, coords=coords, axes=axes) return result def pcolormesh(cube, *args, **kwargs): """ Draws a labelled pseudocolour plot based on the given Cube. See :func:`iris.plot.pcolormesh` for details of valid keyword arguments. """ coords = kwargs.get("coords") axes = kwargs.get("axes") result = iplt.pcolormesh(cube, *args, **kwargs) _label_with_bounds(cube, result, coords=coords, axes=axes) return result def points(cube, *args, **kwargs): """ Draws sample point positions on a labelled plot based on the given Cube. See :func:`iris.plot.points` for details of valid keyword arguments. """ coords = kwargs.get("coords") axes = kwargs.get("axes") result = iplt.points(cube, *args, **kwargs) _label_with_points(cube, coords=coords, axes=axes) return result def plot(*args, **kwargs): """ Draws a labelled line plot based on the given cube(s) or coordinate(s). See :func:`iris.plot.plot` for details of valid arguments and keyword arguments. """ axes = kwargs.get("axes") result = iplt.plot(*args, **kwargs) _label_1d_plot(*args, axes=axes) return result def scatter(x, y, *args, **kwargs): """ Draws a labelled scatter plot based on the given cubes or coordinates. See :func:`iris.plot.scatter` for details of valid arguments and keyword arguments. """ axes = kwargs.get("axes") result = iplt.scatter(x, y, *args, **kwargs) _label_1d_plot(x, y, axes=axes) return result # Provide a convenience show method from pyplot. show = plt.show
lgpl-3.0
suizokukan/urwid
urwid/tests/test_str_util.py
20
1258
import unittest from urwid.compat import B from urwid.escape import str_util class DecodeOneTest(unittest.TestCase): def gwt(self, ch, exp_ord, exp_pos): ch = B(ch) o, pos = str_util.decode_one(ch,0) assert o==exp_ord, " got:%r expected:%r" % (o, exp_ord) assert pos==exp_pos, " got:%r expected:%r" % (pos, exp_pos) def test1byte(self): self.gwt("ab", ord("a"), 1) self.gwt("\xc0a", ord("?"), 1) # error def test2byte(self): self.gwt("\xc2", ord("?"), 1) # error self.gwt("\xc0\x80", ord("?"), 1) # error self.gwt("\xc2\x80", 0x80, 2) self.gwt("\xdf\xbf", 0x7ff, 2) def test3byte(self): self.gwt("\xe0", ord("?"), 1) # error self.gwt("\xe0\xa0", ord("?"), 1) # error self.gwt("\xe0\x90\x80", ord("?"), 1) # error self.gwt("\xe0\xa0\x80", 0x800, 3) self.gwt("\xef\xbf\xbf", 0xffff, 3) def test4byte(self): self.gwt("\xf0", ord("?"), 1) # error self.gwt("\xf0\x90", ord("?"), 1) # error self.gwt("\xf0\x90\x80", ord("?"), 1) # error self.gwt("\xf0\x80\x80\x80", ord("?"), 1) # error self.gwt("\xf0\x90\x80\x80", 0x10000, 4) self.gwt("\xf3\xbf\xbf\xbf", 0xfffff, 4)
lgpl-2.1
igabriel85/dmon-adp
misc/keras_test.py
1
1530
import numpy import pandas as pd from keras.models import Sequential from keras.layers import Dense from keras.wrappers.scikit_learn import KerasClassifier from keras.utils import np_utils from sklearn.model_selection import cross_val_score from sklearn.model_selection import KFold from sklearn.preprocessing import LabelEncoder from sklearn.pipeline import Pipeline import os, sys # fix random seed for reproducibility seed = 7 numpy.random.seed(seed) dataDir = os.path.join(os.path.dirname(os.path.abspath('')), 'data') # load dataset dataframe = pd.read_csv(os.path.join(dataDir, 'iris.csv')) dataset = dataframe.values X = dataset[:,0:4].astype(float) Y = dataset[:,4] # print Y # encode class values as integers encoder = LabelEncoder() encoder.fit(Y) encoded_Y = encoder.transform(Y) # convert integers to dummy variables (i.e. one hot encoded) dummy_y = np_utils.to_categorical(encoded_Y) # print dummy_y # define baseline model def baseline_model(): # create model model = Sequential() model.add(Dense(8, input_dim=4, activation='relu')) model.add(Dense(3, activation='softmax')) # Compile model model.compile(loss='categorical_crossentropy', optimizer='adam', metrics=['accuracy']) return model estimator = KerasClassifier(build_fn=baseline_model, epochs=200, batch_size=20, verbose=1) kfold = KFold(n_splits=10, shuffle=True, random_state=seed) results = cross_val_score(estimator, X, dummy_y, cv=kfold) print("Baseline: %.2f%% (%.2f%%)" % (results.mean()*100, results.std()*100))
apache-2.0
dreadworks/college-cg
t2-objv/parser.py
1
10996
#!/usr/bin/env python # -*- coding: utf-8 -*- import re import numpy as np from util import LOG log = LOG.out.info """ Parser Library. Every class gets instantiated with the name of the file that should be parsed. Every instance of a parser is bound to a file and thus maintains the files data. The classes should handle their parsing internally without the need to invoke an extra method that handles that actual parsing. Even though this makes error handling of the parsing more complicated (from the users perspective), it enables the possibility to work on very large data without the need to store everything in memory at once. """ class ParserException(Exception): def __str__(self): return self.msg def __init__(self, msg): self.msg = msg # # # # class ObjParser(object): """ Parses wavefront obj files. Currently supported: v, vn, f, s, o Ignored: usemtl """ class Obj(object): """ Parser for obj entity definitions. This is the whole obj file with zero or one "o" directives or the part of the obj file denoted by "o <name>". """ def _parse(self, line): """ Takes a line and saves the data found into the internal data structures. :param line: One line of the obj file :returns: None :rtype: None """ dtype, data = re.split(r' ', line, maxsplit=1) data = data.strip() # # VERTICES # if dtype == 'v': data = map(float, data.split()) self._vertices.append(np.array(data, 'f')) return # # NORMALS # if dtype == 'vn': data = map(float, data.split()) self._normals.append(np.array(data, 'f')) return # # FACES # # save indices of vertices and normals # in self._vertices & self._normals # and map the vertex to a set of points # in self._v2vn if dtype == 'f': data = map(lambda s: s.split('/'), data.split()) vertices = map(lambda l: int(l[0]), data) normals = [] normal = None # cache for i, pair in enumerate(data): # 'f v/vt/vn' case if len(pair) == 3: index = int(pair[2]) # # calculate new surface normal # else: if normal is not None: index = len(self._normals) - 1 else: self.stats['calculated normals'] += 1 # retrieve point coordinates v = map(lambda j: self._vertices[j], vertices) # create normalized vectors spanning a plane vectors = (v[0] - v[1]), (v[0] - v[2]) # the surface normal is the cross product # of the two vectors spanning the plane normal = np.cross(*vectors) normal = normal / np.linalg.norm(normal) index = len(self._normals) self._normals.append(normal) # save normals index normals.append(index) vnstore = self._v2vn.setdefault(vertices[i], []) vnstore.append(index) self._faces += zip(vertices, normals) return # # SMOOTHING GROUPS # if dtype == 's': g = self._smoothing[-1] facecount = len(self._faces) if data == 'off': if len(g) == 1: self._smoothing[-1] += (facecount,) return if data == 'on': if len(g) == 2: self._smoothing.append((facecount,)) return # # IGNORE # if dtype == 'usemtl': fmt = dtype, data log('ignoring directive %s with data %s' % fmt) return # # NOT FOUND # msg = 'Could not map directive "%s"' raise ParserException(msg % dtype) def _smooth(self, group): """ Calculates a new normal for a vertex based on all the surface normals on that particular point. The provided group determines the range of faces where the smoothing has to be applied. :param group: Tuple denoting the smoothing range :returns: None :rtype: None """ log('smoothing normals between %d and %d' % group) for i in range(*group): v = self._faces[i][0] # cache miss if not type(self._v2vn[v]) is int: # obtain normals normals = self._v2vn[v] normals = map(lambda i: self._normals[i], normals) # calculate average normal smoothed = sum(normals) / len(normals) smoothed = smoothed / np.linalg.norm(smoothed) # save smoothed normal self._normals.append(smoothed) self._v2vn[v] = len(self._normals) - 1 self.stats['smoothed normals'] += 1 # save new vn to the faces (v, vn) tuple self._faces[i] = self._faces[i][0], self._v2vn[v] def __init__(self, name, data): """ Initialize the object parser and parse the file provided. :param name: Name of the object :param data: List of strings with obj definitions :returns: self :rtype: parser.ObjParser.Obj """ self._name = name # used for an efficient calculation # of smoothed surfaces and to retrieve # normals per vertex when serving faces self._v2vn = {} # just for statistics self.stats = { 'calculated normals': 0, 'smoothed normals': 0} # enumerations in obj's begin # with value 1 (for whatever reason...) # hence the None element. self._vertices = [None] # [None, (x, y, z)₀, ...] ()₀ is np.array self._normals = [None] # [None, (x, y, z)₀, ...] ()₀ is np.array self._smoothing = [(0,)] # Ranges of faces where # smoothing is activated self._faces = [] # [(v₀, vn₀), (v₁, vn₁), ...], # v and vn as indices of elements in # self._vertices and self._normals # split data line-wise and remove # empty lines and comments sanitize = lambda s: s and not s.startswith('#') data = filter(sanitize, data.split('\n')) log('analyzing %d lines of raw data' % len(data)) # analyze data line by line # note: len is an O(1) operation for line in data: try: self._parse(line) except Exception as e: msg = 'Could not parse line "%s"\nbecause of %s: %s' fmt = (line, type(e), str(e)) raise ParserException(msg % fmt) # if smoothing never got # explicitly turned off if len(self._smoothing[-1]) == 1: self._smoothing[-1] += (len(self._faces),) # smooth if necessary for group in self._smoothing: self._smooth(group) # for -verbose fmt = [len(self._vertices), len(self._normals)] fmt = tuple(map(lambda x: x - 1, fmt)) log('got %d vertices and %d normals' % fmt) fmt = len(self._faces) log('got %d vertex/vertex normal pairs for faces' % fmt) fmt = self.stats['calculated normals'] log('calculated %d normals' % fmt) fmt = self.stats['smoothed normals'] fmt = fmt, sum([y - x for x, y in self._smoothing]) log('calculated %d smoothed normals of %d definitions' % fmt) # # PROPERTIES # # @property def name(self): """ Returns the objects name :returns: The name :rtype: string """ return self._name @property def vertices(self): """ Returns a numpy array of vertex coordinates. :returns: Vertex coordinates :rtype: numpy.Array """ return np.array(self._vertices[1:], 'f') @property def faces(self): """ Returns the faces as a numpy array consisting of v, vn pairs, where v are vertex coordinates and vn surface normal coordinates. :returns: Geometrical description of faces :rtype: numpy.Array """ v, vn = zip(*self._faces) v = map(lambda i: self._vertices[i], v) vn = map(lambda i: self._normals[i], vn) return np.array(zip(v, vn), 'f') # # # # # def __init__(self, fname): """ Parses an wavefront obj file. For every defined object an ObjParser.Obj object is created. :param fname: File name :returns: self :rtype: parser.ObjParser """ log('parsing %s' % fname) with open(fname) as f: data = f.read() self._objects = [] add = self._objects.append log('parsing data of size %d' % len(data)) objs = re.split(r'^o (.*)', data) # no 'o'-directive found if len(objs) == 1: add(ObjParser.Obj(fname.rstrip('.obj'), objs[0])) # multiple objects per obj for name, data in zip(objs[1::2], objs[2::2]): add(ObjParser.Obj(name, data)) return raise ParserException("Could not open file") @property def objects(self): """ Return all parsed objects :returns: Parsed objects :rtype: List of parse.ObjParser.Obj objects """ return self._objects
mit
fujunwei/chromium-crosswalk
tools/telemetry/telemetry/core/platform/power_monitor/power_monitor_controller.py
69
1214
# Copyright 2014 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. import telemetry.core.platform.power_monitor as power_monitor class PowerMonitorController(power_monitor.PowerMonitor): """ PowerMonitor that acts as facade for a list of PowerMonitor objects and uses the first available one. """ def __init__(self, power_monitors): super(PowerMonitorController, self).__init__() self._cascading_power_monitors = power_monitors self._active_monitor = None def _AsyncPowerMonitor(self): return next( (x for x in self._cascading_power_monitors if x.CanMonitorPower()), None) def CanMonitorPower(self): return bool(self._AsyncPowerMonitor()) def StartMonitoringPower(self, browser): self._active_monitor = self._AsyncPowerMonitor() assert self._active_monitor, 'No available monitor.' self._active_monitor.StartMonitoringPower(browser) def StopMonitoringPower(self): assert self._active_monitor, 'StartMonitoringPower() not called.' try: return self._active_monitor.StopMonitoringPower() finally: self._active_monitor = None
bsd-3-clause
globocom/oauth2u
tests/helpers.py
1
2130
import sys import urllib import cgi import base64 import json from functools import partial import requests __all__ = ('TEST_SERVER_HOST', 'build_root_url', 'build_basic_authorization_header', 'build_access_token_url', 'parse_json_response', 'parse_query_string', 'get_code_from_url', 'request_authorization_code') TEST_SERVER_HOST = 'http://localhost:8888' def build_url(host, path, query=None): query = query or {} return u'{0}/{1}?{2}'.format(host.rstrip('/'), path.lstrip('/'), urllib.urlencode(query)) build_root_url = partial(build_url, TEST_SERVER_HOST) build_authorize_url = partial(build_url, TEST_SERVER_HOST, '/authorize') build_access_token_url = partial(build_url, TEST_SERVER_HOST, '/access-token') def parse_json_response(response): assert 'application/json; charset=UTF-8' == response.headers['content-type'] return json.loads(response.content) def parse_query_string(url): url, query_string = url.split('?') query = dict(cgi.parse_qsl(query_string)) return url, query def get_code_from_url(url): ''' Given an url returns the 'code' GET parameter ''' query = dict(cgi.parse_qsl(url.split('?')[1])) return query['code'] def request_authorization_code(client_id='123', redirect_uri='http://callback'): ''' Performs a GET on the authorization request url, waits for the redirect and return the code provided ''' url = build_authorize_url({'client_id': client_id, 'response_type': 'code', 'redirect_uri': redirect_uri}) resp = requests.get(url, allow_redirects=False) assert 302 == resp.status_code code = get_code_from_url(resp.headers['Location']) return code def build_basic_authorization_header(client_id, code): ''' Build the value for a Basic ``Authorization`` HTTP header ''' digest = base64.b64encode('{0}:{1}'.format(client_id, code)) return 'Basic {0}'.format(digest)
mit
Conchylicultor/DeepQA
chatbot/corpus/scotusdata.py
10
1602
# Copyright 2015 Conchylicultor. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== import os """ Load transcripts from the Supreme Court of the USA. Available from here: https://github.com/pender/chatbot-rnn """ class ScotusData: """ """ def __init__(self, dirName): """ Args: dirName (string): directory where to load the corpus """ self.lines = self.loadLines(os.path.join(dirName, "scotus")) self.conversations = [{"lines": self.lines}] def loadLines(self, fileName): """ Args: fileName (str): file to load Return: list<dict<str>>: the extracted fields for each line """ lines = [] with open(fileName, 'r') as f: for line in f: l = line[line.index(":")+1:].strip() # Strip name of speaker. lines.append({"text": l}) return lines def getConversations(self): return self.conversations
apache-2.0
DevMine/devmine-core
devmine/__init__.py
1
1683
__devmine_version__ = '0.1.0' __api_version__ = '1' import logging import bottle from bottle.ext import sqlalchemy from sqlalchemy import create_engine from sqlalchemy.orm import sessionmaker from devmine.app.models import Base from devmine.config import routes from devmine.lib import composition class Devmine: def __init__(self, server='auto', host='0.0.0.0', port=8080, db_url='sqlite:///:memory:', db_echo=False, reloader=False, debug=False): self.server_type = server self.host = host self.port = port self.reloader = reloader self.debug = debug self.api_version = __api_version__ self.devmine_version = __devmine_version__ self.app = bottle.Bottle() routes.setup_routing(self.app) bottle.debug(self.debug) engine = create_engine(db_url, echo=db_echo) sqlalchemy_plugin = sqlalchemy.Plugin( engine, Base.metadata, keyword='db', create=True, commit=True, use_kwargs=False ) self.app.install(sqlalchemy_plugin) create_session = sessionmaker(bind=engine) session = create_session() logging.info('Prefetching the scores matrix...') composition.get_scores_matrix(session) session.close() @staticmethod def get_version(): """Return devmine version.""" return __devmine_version__ @staticmethod def get_api_version(): """Return devmine API version.""" return __api_version__
bsd-3-clause
walterreade/scikit-learn
sklearn/externals/joblib/my_exceptions.py
31
3690
""" Exceptions """ # Author: Gael Varoquaux < gael dot varoquaux at normalesup dot org > # Copyright: 2010, Gael Varoquaux # License: BSD 3 clause import sys from ._compat import PY3_OR_LATER class JoblibException(Exception): """A simple exception with an error message that you can get to.""" def __init__(self, *args): # We need to implement __init__ so that it is picked in the # multiple heritance hierarchy in the class created in # _mk_exception. Note: in Python 2, if you implement __init__ # in your exception class you need to set .args correctly, # otherwise you can dump an exception instance with pickle but # not load it (at load time an empty .args will be passed to # the constructor). Also we want to be explicit and not use # 'super' here. Using 'super' can cause a sibling class method # to be called and we have no control the sibling class method # constructor signature in the exception returned by # _mk_exception. Exception.__init__(self, *args) def __repr__(self): if hasattr(self, 'args') and len(self.args) > 0: message = self.args[0] else: message = '' name = self.__class__.__name__ return '%s\n%s\n%s\n%s' % (name, 75 * '_', message, 75 * '_') __str__ = __repr__ class TransportableException(JoblibException): """An exception containing all the info to wrap an original exception and recreate it. """ def __init__(self, message, etype): # The next line set the .args correctly. This is needed to # make the exception loadable with pickle JoblibException.__init__(self, message, etype) self.message = message self.etype = etype _exception_mapping = dict() def _mk_exception(exception, name=None): # Create an exception inheriting from both JoblibException # and that exception if name is None: name = exception.__name__ this_name = 'Joblib%s' % name if this_name in _exception_mapping: # Avoid creating twice the same exception this_exception = _exception_mapping[this_name] else: if exception is Exception: # JoblibException is already a subclass of Exception. No # need to use multiple inheritance return JoblibException, this_name try: this_exception = type( this_name, (JoblibException, exception), {}) _exception_mapping[this_name] = this_exception except TypeError: # This happens if "Cannot create a consistent method # resolution order", e.g. because 'exception' is a # subclass of JoblibException or 'exception' is not an # acceptable base class this_exception = JoblibException return this_exception, this_name def _mk_common_exceptions(): namespace = dict() if PY3_OR_LATER: import builtins as _builtin_exceptions common_exceptions = filter( lambda x: x.endswith('Error'), dir(_builtin_exceptions)) else: import exceptions as _builtin_exceptions common_exceptions = dir(_builtin_exceptions) for name in common_exceptions: obj = getattr(_builtin_exceptions, name) if isinstance(obj, type) and issubclass(obj, BaseException): this_obj, this_name = _mk_exception(obj, name=name) namespace[this_name] = this_obj return namespace # Updating module locals so that the exceptions pickle right. AFAIK this # works only at module-creation time locals().update(_mk_common_exceptions())
bsd-3-clause
alianmohammad/pd-gem5
src/arch/micro_asm_test.py
86
3195
# Copyright (c) 2007 The Regents of The University of Michigan # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer; # redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution; # neither the name of the copyright holders nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. # # Authors: Gabe Black from micro_asm import MicroAssembler, Combinational_Macroop, Rom_Macroop, Rom class Bah(object): def __init__(self): self.mnemonic = "bah" class Bah_Tweaked(object): def __init__(self): self.mnemonic = "bah_tweaked" class Hoop(object): def __init__(self, first_param, second_param): self.mnemonic = "hoop_%s_%s" % (first_param, second_param) def __str__(self): return "%s" % self.mnemonic class Dah(object): def __init__(self): self.mnemonic = "dah" microops = { "bah": Bah, "hoop": Hoop, "dah": Dah } class TestMacroop(Combinational_Macroop): def tweak(self): microops["bah"] = Bah_Tweaked def untweak(self): microops["bah"] = Bah def print_debug(self, message): print message def __init__(self, name): super(TestMacroop, self).__init__(name) self.directives = { "tweak": self.tweak, "untweak": self.untweak, "print": self.print_debug } assembler = MicroAssembler(TestMacroop, microops, Rom('main ROM'), Rom_Macroop) testAssembly = ''' # Single line comment def rom { goo: bah extern la: hoop 4*8, "a" }; /* multiline comment on one line */ /* multi line comment across lines to make sure they work */ def macroop squishy { .tweak bah .untweak .print "In the midst" bah dah # single line comment after something .tweak }; #Extending the rom... def rom { #Here's more stuff for the rom bah }; def macroop squashy { bah }; def macroop jumper (bar); ''' assembler.assemble(testAssembly)
bsd-3-clause
akash1808/nova_test_latest
nova/tests/unit/scheduler/weights/test_weights_ioopsweight.py
73
2785
# Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """ Tests For Scheduler IoOpsWeigher weights """ from nova.scheduler import weights from nova.scheduler.weights import io_ops from nova import test from nova.tests.unit.scheduler import fakes class IoOpsWeigherTestCase(test.NoDBTestCase): def setUp(self): super(IoOpsWeigherTestCase, self).setUp() self.weight_handler = weights.HostWeightHandler() self.weighers = [io_ops.IoOpsWeigher()] def _get_weighed_host(self, hosts, io_ops_weight_multiplier): if io_ops_weight_multiplier is not None: self.flags(io_ops_weight_multiplier=io_ops_weight_multiplier) return self.weight_handler.get_weighed_objects(self.weighers, hosts, {})[0] def _get_all_hosts(self): host_values = [ ('host1', 'node1', {'num_io_ops': 1}), ('host2', 'node2', {'num_io_ops': 2}), ('host3', 'node3', {'num_io_ops': 0}), ('host4', 'node4', {'num_io_ops': 4}) ] return [fakes.FakeHostState(host, node, values) for host, node, values in host_values] def _do_test(self, io_ops_weight_multiplier, expected_weight, expected_host): hostinfo_list = self._get_all_hosts() weighed_host = self._get_weighed_host(hostinfo_list, io_ops_weight_multiplier) self.assertEqual(weighed_host.weight, expected_weight) if expected_host: self.assertEqual(weighed_host.obj.host, expected_host) def test_io_ops_weight_multiplier_by_default(self): self._do_test(io_ops_weight_multiplier=None, expected_weight=0.0, expected_host='host3') def test_io_ops_weight_multiplier_zero_value(self): # We do not know the host, all have same weight. self._do_test(io_ops_weight_multiplier=0.0, expected_weight=0.0, expected_host=None) def test_io_ops_weight_multiplier_positive_value(self): self._do_test(io_ops_weight_multiplier=2.0, expected_weight=2.0, expected_host='host4')
apache-2.0
jabez1314/shadowsocks
tests/coverage_server.py
1072
1655
#!/usr/bin/env python # # Copyright 2015 clowwindy # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. if __name__ == '__main__': import tornado.ioloop import tornado.web import urllib class MainHandler(tornado.web.RequestHandler): def get(self, project): try: with open('/tmp/%s-coverage' % project, 'rb') as f: coverage = f.read().strip() n = int(coverage.strip('%')) if n >= 80: color = 'brightgreen' else: color = 'yellow' self.redirect(('https://img.shields.io/badge/' 'coverage-%s-%s.svg' '?style=flat') % (urllib.quote(coverage), color)) except IOError: raise tornado.web.HTTPError(404) application = tornado.web.Application([ (r"/([a-zA-Z0-9\-_]+)", MainHandler), ]) if __name__ == "__main__": application.listen(8888, address='127.0.0.1') tornado.ioloop.IOLoop.instance().start()
apache-2.0
BeATz-UnKNoWN/python-for-android
python-build/python-libs/gdata/src/gdata/alt/app_engine.py
136
3386
#!/usr/bin/python # # Copyright (C) 2009 Google Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Provides functions to persist serialized auth tokens in the datastore. The get_token and set_token functions should be used in conjunction with gdata.gauth's token_from_blob and token_to_blob to allow auth token objects to be reused across requests. It is up to your own code to ensure that the token key's are unique. """ __author__ = 'j.s@google.com (Jeff Scudder)' from google.appengine.ext import db from google.appengine.api import memcache class Token(db.Model): """Datastore Model which stores a serialized auth token.""" t = db.BlobProperty() def get_token(unique_key): """Searches for a stored token with the desired key. Checks memcache and then the datastore if required. Args: unique_key: str which uniquely identifies the desired auth token. Returns: A string encoding the auth token data. Use gdata.gauth.token_from_blob to convert back into a usable token object. None if the token was not found in memcache or the datastore. """ token_string = memcache.get(unique_key) if token_string is None: # The token wasn't in memcache, so look in the datastore. token = Token.get_by_key_name(unique_key) if token is None: return None return token.t return token_string def set_token(unique_key, token_str): """Saves the serialized auth token in the datastore. The token is also stored in memcache to speed up retrieval on a cache hit. Args: unique_key: The unique name for this token as a string. It is up to your code to ensure that this token value is unique in your application. Previous values will be silently overwitten. token_str: A serialized auth token as a string. I expect that this string will be generated by gdata.gauth.token_to_blob. Returns: True if the token was stored sucessfully, False if the token could not be safely cached (if an old value could not be cleared). If the token was set in memcache, but not in the datastore, this function will return None. However, in that situation an exception will likely be raised. Raises: Datastore exceptions may be raised from the App Engine SDK in the event of failure. """ # First try to save in memcache. result = memcache.set(unique_key, token_str) # If memcache fails to save the value, clear the cached value. if not result: result = memcache.delete(unique_key) # If we could not clear the cached value for this token, refuse to save. if result == 0: return False # Save to the datastore. if Token(key_name=unique_key, t=token_str).put(): return True return None def delete_token(unique_key): # Clear from memcache. memcache.delete(unique_key) # Clear from the datastore. Token(key_name=unique_key).delete()
apache-2.0
leafclick/intellij-community
python/helpers/py2only/docutils/languages/fr.py
148
1893
# $Id: fr.py 4564 2006-05-21 20:44:42Z wiemann $ # Author: Stefane Fermigier <sf@fermigier.com> # Copyright: This module has been placed in the public domain. # New language mappings are welcome. Before doing a new translation, please # read <http://docutils.sf.net/docs/howto/i18n.html>. Two files must be # translated for each language: one in docutils/languages, the other in # docutils/parsers/rst/languages. """ French-language mappings for language-dependent features of Docutils. """ __docformat__ = 'reStructuredText' labels = { u'author': u'Auteur', u'authors': u'Auteurs', u'organization': u'Organisation', u'address': u'Adresse', u'contact': u'Contact', u'version': u'Version', u'revision': u'R\u00e9vision', u'status': u'Statut', u'date': u'Date', u'copyright': u'Copyright', u'dedication': u'D\u00e9dicace', u'abstract': u'R\u00e9sum\u00e9', u'attention': u'Attention!', u'caution': u'Avertissement!', u'danger': u'!DANGER!', u'error': u'Erreur', u'hint': u'Indication', u'important': u'Important', u'note': u'Note', u'tip': u'Astuce', u'warning': u'Avis', u'contents': u'Sommaire'} """Mapping of node class name to label text.""" bibliographic_fields = { u'auteur': u'author', u'auteurs': u'authors', u'organisation': u'organization', u'adresse': u'address', u'contact': u'contact', u'version': u'version', u'r\u00e9vision': u'revision', u'statut': u'status', u'date': u'date', u'copyright': u'copyright', u'd\u00e9dicace': u'dedication', u'r\u00e9sum\u00e9': u'abstract'} """French (lowcased) to canonical name mapping for bibliographic fields.""" author_separators = [';', ','] """List of separator strings for the 'Authors' bibliographic field. Tried in order."""
apache-2.0
play113/swer
heekscnc-read-only/nc/nc.py
25
20718
################################################################################ # nc.py # # Base class for NC code creation # And global functions for calling current creator # # Hirutso Enni, 2009-01-13 # altered by Dan Falck 2010-08-04 # added tap() arguments Michael Haberler 2010-10-07 ################################################################################ ncOFF = 0 ncLEFT = -1 ncRIGHT = +1 ncCW = -1 ncCCW = +1 ncMIST = 1 ncFLOOD = 2 ################################################################################ class Creator: def __init__(self): pass ############################################################################ ## Internals def file_open(self, name): self.file = open(name, 'w') self.filename = name def file_close(self): self.file.close() def write(self, s): self.file.write(s) ############################################################################ ## Programs def program_begin(self, id, name=''): """Begin a program""" pass def add_stock(self, type_name, params): pass def program_stop(self, optional=False): """Stop the machine""" pass def program_end(self): """End the program""" pass def flush_nc(self): """Flush all pending codes""" pass ############################################################################ ## Subprograms def sub_begin(self, id, name=''): """Begin a subprogram""" pass def sub_call(self, id): """Call a subprogram""" pass def sub_end(self): """Return from a subprogram""" pass ############################################################################ ## Settings def imperial(self): """Set imperial units""" pass def metric(self): """Set metric units""" pass def absolute(self): """Set absolute coordinates""" pass def incremental(self): """Set incremental coordinates""" pass def polar(self, on=True): """Set polar coordinates""" pass def set_plane(self, plane): """Set plane""" pass def set_temporary_origin(self, x=None, y=None, z=None, a=None, b=None, c=None): """Set temporary origin G92""" pass def remove_temporary_origin(self): """Remote temporary origin G92.1""" pass ############################################################################ ## Tools def tool_change(self, id): """Change the tool""" pass def tool_defn(self, id, name='', params=None): """Define a tool""" pass def offset_radius(self, id, radius=None): """Set tool radius offsetting""" pass def offset_length(self, id, length=None): """Set tool length offsetting""" pass def current_tool(self): return None ############################################################################ ## Datums def datum_shift(self, x=None, y=None, z=None, a=None, b=None, c=None): """Shift the datum""" pass def datum_set(self, x=None, y=None, z=None, a=None, b=None, c=None): """Set the datum""" pass def workplane(self, id): """Set the workplane""" pass def clearanceplane(self,z=None): """set clearance plane""" pass ############################################################################ ## APT360 like Transformation Definitions ## These definitions were created while looking at Irvin Kraal's book on APT ## - Numerical Control Progamming in APT - page 211 def matrix(self,a1=None,b1=None,c1=None,a2=None,b2=None,c2=None,a3=None,b3=None,c3=None): """Create a matrix for transformations""" pass def translate(self,x=None,y=None,z=None): """Translate in x,y,z direction""" pass def rotate(self,xyrot=None,yzrot=None,zxrot=None,angle=None): """Rotate about a coordinate axis""" pass def scale(self,k=None): """Scale by factor k""" pass def matrix_product(self,matrix1=None,matrix2=None): """Create matrix that is the product of two other matrices""" pass def mirror_plane(self,plane1=None,plane2=None,plane3=None): """Mirror image about one or more coordinate planes""" pass def mirror_line(self,line=None): """Mirror about a line""" pass ############################################################################ ## Rates + Modes def feedrate(self, f): """Set the feedrate""" pass def feedrate_hv(self, fh, fv): """Set the horizontal and vertical feedrates""" pass def spindle(self, s, clockwise=True): """Set the spindle speed""" pass def coolant(self, mode=0): """Set the coolant mode""" pass def gearrange(self, gear=0): """Set the gear range""" pass ############################################################################ ## Moves def rapid(self, x=None, y=None, z=None, a=None, b=None, c=None): """Rapid move""" pass def feed(self, x=None, y=None, z=None, a = None, b = None, c = None): """Feed move""" pass def arc_cw(self, x=None, y=None, z=None, i=None, j=None, k=None, r=None): """Clockwise arc move""" pass def arc_ccw(self, x=None, y=None, z=None, i=None, j=None, k=None, r=None): """Counterclockwise arc move""" pass def dwell(self, t): """Dwell""" pass def rapid_home(self, x=None, y=None, z=None, a=None, b=None, c=None): """Rapid relative to home position""" pass def rapid_unhome(self): """Return from rapid home""" pass def set_machine_coordinates(self): """Set machine coordinates""" pass ############################################################################ ## Cutter radius compensation def use_CRC(self): """CRC""" return False ############################################################################ ## Cycles def pattern(self): """Simple pattern eg. circle, rect""" pass def pocket(self): """Pocket routine""" pass def profile(self): """Profile routine""" pass def drill(self, x=None, y=None, dwell=None, depthparams = None, retract_mode=None, spindle_mode=None, internal_coolant_on=None, rapid_to_clearance=None): """Drilling routines""" pass # original prototype was: # def tap(self, x=None, y=None, z=None, zretract=None, depth=None, standoff=None, dwell_bottom=None, pitch=None, stoppos=None, spin_in=None, spin_out=None): # # current call is like so: # tap(x=10, y=10, z=0, tap_mode=0, depth=12.7, standoff=6.35, direction=0, pitch=1.25) # just add tap_mode & direction parameters def tap(self, x=None, y=None, z=None, zretract=None, depth=None, standoff=None, dwell_bottom=None, pitch=None, stoppos=None, spin_in=None, spin_out=None, tap_mode=None, direction=None): """Tapping routines""" pass def bore(self, x=None, y=None, z=None, zretract=None, depth=None, standoff=None, dwell_bottom=None, feed_in=None, feed_out=None, stoppos=None, shift_back=None, shift_right=None, backbore=False, stop=False): """Boring routines""" pass def end_canned_cycle(self): pass ############################################################################ ## Misc def comment(self, text): """Insert a comment""" pass def insert(self, text): """APT style INSERT statement""" pass def block_delete(self, on=False): """block to ignore if block delete switch is on""" pass def variable(self, id): """Insert a variable""" pass def variable_set(self, id, value): """Set a variable""" pass def probe_linear_centre_outside(self, x1=None, y1=None, depth=None, x2=None, y2=None ): pass def probe_single_point(self, point_along_edge_x=None, point_along_edge_y=None, depth=None, retracted_point_x=None, retracted_point_y=None, destination_point_x=None, destination_point_y=None, intersection_variable_x=None, intersection_variable_y=None, probe_offset_x_component=None, probe_offset_y_component=None ): pass def probe_downward_point(self, x=None, y=None, depth=None, intersection_variable_z=None): pass def report_probe_results(self, x1=None, y1=None, z1=None, x2=None, y2=None, z2=None, x3=None, y3=None, z3=None, x4=None, y4=None, z4=None, x5=None, y5=None, z5=None, x6=None, y6=None, z6=None, xml_file_name=None ): pass def open_log_file(self, xml_file_name=None ): pass def log_coordinate(self, x=None, y=None, z=None): pass def log_message(self, message=None): pass def close_log_file(self): pass def rapid_to_midpoint(self, x1=None, y1=None, z1=None, x2=None, y2=None, z2=None): pass def rapid_to_intersection(self, x1, y1, x2, y2, x3, y3, x4, y4, intersection_x, intersection_y, ua_numerator, ua_denominator, ua, ub_numerator, ub): pass def rapid_to_rotated_coordinate(self, x1, y1, x2, y2, ref_x, ref_y, x_current, y_current, x_final, y_final): pass def set_path_control_mode(self, mode, motion_blending_tolerance, naive_cam_tolerance ): pass ############################################################################ ## NC code creator for additive machines like RepRap def wipe(self): """wipe routine""" pass def extruder_on(self): """Turn on the extruder""" pass def extruder_off(self): """turn off the extruder""" pass def set_extruder_flowrate(self, flowrate): """Set the flowrate for the extruder""" pass def extruder_temp(self, temp): """Set the extruder temp in celsius""" pass def fan_on(self): """turn on the cooling fan""" pass def fan_off(self): """turn off the cooling fan""" pass def build_bed_temp(self, temp): """Set the bed temp in celsius""" pass def chamber_temp(self, temp): """Set the chamber temp in celsius""" pass def begin_ncblock(self): # if the moves have come from backplotting nc code, then the nc code text can be given with these three functions pass def end_ncblock(self): pass def add_text(self, s, col, cdata): pass ################################################################################ creator = Creator() ############################################################################ ## Internals def write(s): creator.write(s) def output(filename): creator.file_open(filename) ############################################################################ ## Programs def program_begin(id, name=''): creator.program_begin(id, name) def add_stock(type_name, params): creator.add_stock(type_name, params) def program_stop(optional=False): creator.program_stop(optional) def program_end(): creator.program_end() def flush_nc(): creator.flush_nc() ############################################################################ ## Subprograms def sub_begin(id, name=''): creator.sub_begin(id, name) def sub_call(id): creator.sub_call(id) def sub_end(): creator.sub_end() ############################################################################ ## Settings def imperial(): creator.imperial() def metric(): creator.metric() def absolute(): creator.absolute() def incremental(): creator.incremental() def polar(on=True): creator.polar(on) def set_plane(plane): creator.set_plane(plane) def set_temporary_origin(x=None, y=None, z=None, a=None, b=None, c=None): creator.set_temporary_origin(x,y,z,a,b,c) def remove_temporary_origin(): creator.remove_temporary_origin() ############################################################################ ## Tools def tool_change(id): creator.tool_change(id) def tool_defn(id, name='', params=None): creator.tool_defn(id, name, params) def offset_radius(id, radius=None): creator.offset_radius(id, radius) def offset_length(id, length=None): creator.offset_length(id, length) def current_tool(self): return creator.current_tool() ############################################################################ ## Datums def datum_shift(x=None, y=None, z=None, a=None, b=None, c=None): creator.datum_shift(x, y, z, a, b, c) def datum_set(x=None, y=None, z=None, a=None, b=None, c=None): creator.datum_set(x, y, z, a, b, c) def workplane(id): creator.workplane(id) def clearanceplane(z=None): creator.clearanceplane(z) ############################################################################ ## APT360 like Transformation Definitions ## These definitions were created while looking at Irvin Kraal's book on APT ## - Numerical Control Progamming in APT - page 211 def matrix(a1=None,b1=None,c1=None,a2=None,b2=None,c2=None,a3=None,b3=None,c3=None): creator.matrix(a1,b1,c1,a2,b2,c2,a3,b3,c3) def translate(x=None,y=None,z=None): creator.translate(x,y,z) def rotate(xyrot=None,yzrot=None,zxrot=None,angle=None): creator.rotate(xyrot,yzrot,zxrot,angle) def scale(k=None): creator.scale(k) def matrix_product(matrix1=None,matrix2=None): creator.matrix_product(matrix1,matrix2) def mirror_plane(plane1=None,plane2=None,plane3=None): creator.mirror_plane(plane1,plane2,plane3) def mirror_line(line=None): creator.mirror_line(line) ############################################################################ ## Rates + Modes def feedrate(f): creator.feedrate(f) def feedrate_hv(fh, fv): creator.feedrate_hv(fh, fv) def spindle(s, clockwise=True): creator.spindle(s, clockwise) def coolant(mode=0): creator.coolant(mode) def gearrange(gear=0): creator.gearrange(gear) ############################################################################ ## Moves def rapid(x=None, y=None, z=None, a=None, b=None, c=None): creator.rapid(x, y, z, a, b, c) def feed(x=None, y=None, z=None, a = None, b = None, c = None): creator.feed(x, y, z) def arc_cw(x=None, y=None, z=None, i=None, j=None, k=None, r=None): creator.arc_cw(x, y, z, i, j, k, r) def arc_ccw(x=None, y=None, z=None, i=None, j=None, k=None, r=None): creator.arc_ccw(x, y, z, i, j, k, r) def dwell(t): creator.dwell(t) def rapid_home(x=None, y=None, z=None, a=None, b=None, c=None): creator.rapid_home(x, y, z, a, b, c) def rapid_unhome(): creator.rapid_unhome() def set_machine_coordinates(): creator.set_machine_coordinates() ############################################################################ ## Cutter radius compensation def use_CRC(): return creator.use_CRC() def CRC_nominal_path(): return creator.CRC_nominal_path() def start_CRC(left = True, radius = 0.0): creator.start_CRC(left, radius) def end_CRC(): creator.end_CRC() ############################################################################ ## Cycles def pattern(): creator.pattern() def pocket(): creator.pocket() def profile(): creator.profile() def drill(x=None, y=None, dwell=None, depthparams = None, retract_mode=None, spindle_mode=None, internal_coolant_on=None, rapid_to_clearance=None): creator.drill(x, y, dwell, depthparams, retract_mode, spindle_mode, internal_coolant_on, rapid_to_clearance) def tap(x=None, y=None, z=None, zretract=None, depth=None, standoff=None, dwell_bottom=None, pitch=None, stoppos=None, spin_in=None, spin_out=None, tap_mode=None, direction=None): creator.tap(x, y, z, zretract, depth, standoff, dwell_bottom, pitch, stoppos, spin_in, spin_out, tap_mode, direction) def bore(x=None, y=None, z=None, zretract=None, depth=None, standoff=None, dwell_bottom=None, feed_in=None, feed_out=None, stoppos=None, shift_back=None, shift_right=None, backbore=False, stop=False): creator.bore(x, y, z, zretract, depth, standoff, dwell_Bottom, feed_in, feed_out, stoppos, shift_back, shift_right, backbore, stop) def end_canned_cycle(): creator.end_canned_cycle() def peck(count, first, last=None, step=0.0): pecks = [] peck = first if (last == None) : last = first for i in range(0,count): pecks.append(peck) if (peck - step > last) : peck -= step return pecks ############################################################################ ## Misc def comment(text): creator.comment(text) def insert(text): creator.insert(text) def block_delete(on=False): creator.block_delete(on) def variable(id): creator.variable(id) def variable_set(id, value): creator.variable_set(id, value) def probe_single_point(point_along_edge_x=None, point_along_edge_y=None, depth=None, retracted_point_x=None, retracted_point_y=None, destination_point_x=None, destination_point_y=None, intersection_variable_x=None, intersection_variable_y=None, probe_offset_x_component=None, probe_offset_y_component=None ): creator.probe_single_point(point_along_edge_x, point_along_edge_y, depth, retracted_point_x, retracted_point_y, destination_point_x, destination_point_y, intersection_variable_x, intersection_variable_y, probe_offset_x_component, probe_offset_y_component ) def probe_downward_point(x=None, y=None, depth=None, intersection_variable_z=None): creator.probe_downward_point(x, y, depth, intersection_variable_z) def report_probe_results(x1=None, y1=None, z1=None, x2=None, y2=None, z2=None, x3=None, y3=None, z3=None, x4=None, y4=None, z4=None, x5=None, y5=None, z5=None, x6=None, y6=None, z6=None, xml_file_name=None ): creator.report_probe_results(x1, y1, z1, x2, y2, z2, x3, y3, z3, x4, y4, z4, x5, y5, z5, x6, y6, z6, xml_file_name) def open_log_file(xml_file_name=None ): creator.open_log_file(xml_file_name) def log_coordinate(x=None, y=None, z=None): creator.log_coordinate(x, y, z) def log_message(message=None): creator.log_message(message) def close_log_file(): creator.close_log_file() def rapid_to_midpoint(x1=None, y1=None, z1=None, x2=None, y2=None, z2=None): creator.rapid_to_midpoint(x1, y1, z1, x2, y2, z2) def rapid_to_intersection(x1, y1, x2, y2, x3, y3, x4, y4, intersection_x, intersection_y, ua_numerator, ua_denominator, ua, ub_numerator, ub): creator.rapid_to_intersection(x1, y1, x2, y2, x3, y3, x4, y4, intersection_x, intersection_y, ua_numerator, ua_denominator, ua, ub_numerator, ub) def rapid_to_rotated_coordinate(x1, y1, x2, y2, ref_x, ref_y, x_current, y_current, x_final, y_final): creator.rapid_to_rotated_coordinate(x1, y1, x2, y2, ref_x, ref_y, x_current, y_current, x_final, y_final) def set_path_control_mode(mode, motion_blending_tolerance, naive_cam_tolerance ): creator.set_path_control_mode(mode, motion_blending_tolerance, naive_cam_tolerance ) ############################################################################ ## NC code creator for additive machines like RepRap def wipe(): creator.wipe() def extruder_on(): creator.extruder_on() def extruder_off(): creator.extruder_off() def set_extruder_flowrate(flowrate): creator.set_extruder_flowrate(flowrate) def extruder_temp(temp=None): creator.extruder_temp(temp) def fan_on(): creator.fan_on() def fan_off(): creator.fan_off() def build_bed_temp(temp=None): creator.build_bed_temp(temp) def chamber_temp(temp=None): creator.chamber_temp(temp)
mit
ParticulateSolutions/django-paydirekt
django_paydirekt/migrations/0001_initial.py
1
4278
# -*- coding: utf-8 -*- from __future__ import unicode_literals from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ] operations = [ migrations.CreateModel( name='PaydirektCapture', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('amount', models.DecimalField(verbose_name='amount', max_digits=9, decimal_places=2)), ('transaction_id', models.CharField(unique=True, max_length=255, verbose_name='transaction id')), ('final', models.BooleanField(default=False, verbose_name='final')), ('link', models.URLField(verbose_name='link')), ('status', models.CharField(max_length=255, verbose_name='status', blank=True)), ('capture_type', models.CharField(max_length=255, verbose_name='capture type', blank=True)), ('created_at', models.DateTimeField(auto_now_add=True, verbose_name='created at')), ('last_modified', models.DateTimeField(auto_now=True, verbose_name='last modified')), ], options={ 'verbose_name': 'Paydirekt Capture', 'verbose_name_plural': 'Paydirekt Captures', }, ), migrations.CreateModel( name='PaydirektCheckout', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('checkout_id', models.CharField(unique=True, max_length=255, verbose_name='checkout id')), ('payment_type', models.CharField(max_length=255, verbose_name='payment type')), ('total_amount', models.DecimalField(verbose_name='total amount', max_digits=9, decimal_places=2)), ('status', models.CharField(max_length=255, verbose_name='status', blank=True)), ('link', models.URLField(verbose_name='link')), ('approve_link', models.URLField(verbose_name='approve link')), ('close_link', models.URLField(verbose_name='close link', blank=True)), ('captures_link', models.URLField(verbose_name='captures link', blank=True)), ('refunds_link', models.URLField(verbose_name='refunds link', blank=True)), ('created_at', models.DateTimeField(auto_now_add=True, verbose_name='created at')), ('last_modified', models.DateTimeField(auto_now=True, verbose_name='last modified')), ], options={ 'verbose_name': 'Paydirekt Checkout', 'verbose_name_plural': 'Paydirekt Checkouts', }, ), migrations.CreateModel( name='PaydirektRefund', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('amount', models.DecimalField(verbose_name='amount', max_digits=9, decimal_places=2)), ('transaction_id', models.CharField(unique=True, max_length=255, verbose_name='transaction id')), ('link', models.URLField(verbose_name='link')), ('status', models.CharField(max_length=255, verbose_name='status', blank=True)), ('refund_type', models.CharField(max_length=255, verbose_name='refund type', blank=True)), ('created_at', models.DateTimeField(auto_now_add=True, verbose_name='created at')), ('last_modified', models.DateTimeField(auto_now=True, verbose_name='last modified')), ('checkout', models.ForeignKey(related_name='refunds', verbose_name='checkout', to='django_paydirekt.PaydirektCheckout', on_delete=models.CASCADE)), ], options={ 'verbose_name': 'Paydirekt Refund', 'verbose_name_plural': 'Paydirekt Refund', }, ), migrations.AddField( model_name='paydirektcapture', name='checkout', field=models.ForeignKey(related_name='captures', verbose_name='checkout', to='django_paydirekt.PaydirektCheckout', on_delete=models.CASCADE), ), ]
mit
MrLoick/python-for-android
python-modules/twisted/twisted/test/test_stringtransport.py
56
9941
# Copyright (c) 2009-2010 Twisted Matrix Laboratories. # See LICENSE for details. """ Tests for L{twisted.test.proto_helpers}. """ from zope.interface.verify import verifyObject from twisted.internet.interfaces import (ITransport, IPushProducer, IConsumer, IReactorTCP, IReactorSSL, IReactorUNIX, IAddress, IListeningPort, IConnector) from twisted.internet.address import IPv4Address from twisted.trial.unittest import TestCase from twisted.test.proto_helpers import (StringTransport, MemoryReactor, RaisingMemoryReactor) from twisted.internet.protocol import ClientFactory, Factory class StringTransportTests(TestCase): """ Tests for L{twisted.test.proto_helpers.StringTransport}. """ def setUp(self): self.transport = StringTransport() def test_interfaces(self): """ L{StringTransport} instances provide L{ITransport}, L{IPushProducer}, and L{IConsumer}. """ self.assertTrue(verifyObject(ITransport, self.transport)) self.assertTrue(verifyObject(IPushProducer, self.transport)) self.assertTrue(verifyObject(IConsumer, self.transport)) def test_registerProducer(self): """ L{StringTransport.registerProducer} records the arguments supplied to it as instance attributes. """ producer = object() streaming = object() self.transport.registerProducer(producer, streaming) self.assertIdentical(self.transport.producer, producer) self.assertIdentical(self.transport.streaming, streaming) def test_disallowedRegisterProducer(self): """ L{StringTransport.registerProducer} raises L{RuntimeError} if a producer is already registered. """ producer = object() self.transport.registerProducer(producer, True) self.assertRaises( RuntimeError, self.transport.registerProducer, object(), False) self.assertIdentical(self.transport.producer, producer) self.assertTrue(self.transport.streaming) def test_unregisterProducer(self): """ L{StringTransport.unregisterProducer} causes the transport to forget about the registered producer and makes it possible to register a new one. """ oldProducer = object() newProducer = object() self.transport.registerProducer(oldProducer, False) self.transport.unregisterProducer() self.assertIdentical(self.transport.producer, None) self.transport.registerProducer(newProducer, True) self.assertIdentical(self.transport.producer, newProducer) self.assertTrue(self.transport.streaming) def test_invalidUnregisterProducer(self): """ L{StringTransport.unregisterProducer} raises L{RuntimeError} if called when no producer is registered. """ self.assertRaises(RuntimeError, self.transport.unregisterProducer) def test_initialProducerState(self): """ L{StringTransport.producerState} is initially C{'producing'}. """ self.assertEqual(self.transport.producerState, 'producing') def test_pauseProducing(self): """ L{StringTransport.pauseProducing} changes the C{producerState} of the transport to C{'paused'}. """ self.transport.pauseProducing() self.assertEqual(self.transport.producerState, 'paused') def test_resumeProducing(self): """ L{StringTransport.resumeProducing} changes the C{producerState} of the transport to C{'producing'}. """ self.transport.pauseProducing() self.transport.resumeProducing() self.assertEqual(self.transport.producerState, 'producing') def test_stopProducing(self): """ L{StringTransport.stopProducing} changes the C{'producerState'} of the transport to C{'stopped'}. """ self.transport.stopProducing() self.assertEqual(self.transport.producerState, 'stopped') def test_stoppedTransportCannotPause(self): """ L{StringTransport.pauseProducing} raises L{RuntimeError} if the transport has been stopped. """ self.transport.stopProducing() self.assertRaises(RuntimeError, self.transport.pauseProducing) def test_stoppedTransportCannotResume(self): """ L{StringTransport.resumeProducing} raises L{RuntimeError} if the transport has been stopped. """ self.transport.stopProducing() self.assertRaises(RuntimeError, self.transport.resumeProducing) def test_disconnectingTransportCannotPause(self): """ L{StringTransport.pauseProducing} raises L{RuntimeError} if the transport is being disconnected. """ self.transport.loseConnection() self.assertRaises(RuntimeError, self.transport.pauseProducing) def test_disconnectingTransportCannotResume(self): """ L{StringTransport.resumeProducing} raises L{RuntimeError} if the transport is being disconnected. """ self.transport.loseConnection() self.assertRaises(RuntimeError, self.transport.resumeProducing) def test_loseConnectionSetsDisconnecting(self): """ L{StringTransport.loseConnection} toggles the C{disconnecting} instance variable to C{True}. """ self.assertFalse(self.transport.disconnecting) self.transport.loseConnection() self.assertTrue(self.transport.disconnecting) def test_specifiedHostAddress(self): """ If a host address is passed to L{StringTransport.__init__}, that value is returned from L{StringTransport.getHost}. """ address = object() self.assertIdentical(StringTransport(address).getHost(), address) def test_specifiedPeerAddress(self): """ If a peer address is passed to L{StringTransport.__init__}, that value is returned from L{StringTransport.getPeer}. """ address = object() self.assertIdentical( StringTransport(peerAddress=address).getPeer(), address) def test_defaultHostAddress(self): """ If no host address is passed to L{StringTransport.__init__}, an L{IPv4Address} is returned from L{StringTransport.getHost}. """ address = StringTransport().getHost() self.assertIsInstance(address, IPv4Address) def test_defaultPeerAddress(self): """ If no peer address is passed to L{StringTransport.__init__}, an L{IPv4Address} is returned from L{StringTransport.getPeer}. """ address = StringTransport().getPeer() self.assertIsInstance(address, IPv4Address) class ReactorTests(TestCase): """ Tests for L{MemoryReactor} and L{RaisingMemoryReactor}. """ def test_memoryReactorProvides(self): """ L{MemoryReactor} provides all of the attributes described by the interfaces it advertises. """ memoryReactor = MemoryReactor() verifyObject(IReactorTCP, memoryReactor) verifyObject(IReactorSSL, memoryReactor) verifyObject(IReactorUNIX, memoryReactor) def test_raisingReactorProvides(self): """ L{RaisingMemoryReactor} provides all of the attributes described by the interfaces it advertises. """ raisingReactor = RaisingMemoryReactor() verifyObject(IReactorTCP, raisingReactor) verifyObject(IReactorSSL, raisingReactor) verifyObject(IReactorUNIX, raisingReactor) def test_connectDestination(self): """ L{MemoryReactor.connectTCP}, L{MemoryReactor.connectSSL}, and L{MemoryReactor.connectUNIX} will return an L{IConnector} whose C{getDestination} method returns an L{IAddress} with attributes which reflect the values passed. """ memoryReactor = MemoryReactor() for connector in [memoryReactor.connectTCP( "test.example.com", 8321, ClientFactory()), memoryReactor.connectSSL( "test.example.com", 8321, ClientFactory(), None)]: verifyObject(IConnector, connector) address = connector.getDestination() verifyObject(IAddress, address) self.assertEquals(address.host, "test.example.com") self.assertEquals(address.port, 8321) connector = memoryReactor.connectUNIX("/fake/path", ClientFactory()) verifyObject(IConnector, connector) address = connector.getDestination() verifyObject(IAddress, address) self.assertEquals(address.name, "/fake/path") def test_listenDefaultHost(self): """ L{MemoryReactor.listenTCP}, L{MemoryReactor.listenSSL} and L{MemoryReactor.listenUNIX} will return an L{IListeningPort} whose C{getHost} method returns an L{IAddress}; C{listenTCP} and C{listenSSL} will have a default host of C{'0.0.0.0'}, and a port that reflects the value passed, and C{listenUNIX} will have a name that reflects the path passed. """ memoryReactor = MemoryReactor() for port in [memoryReactor.listenTCP(8242, Factory()), memoryReactor.listenSSL(8242, Factory(), None)]: verifyObject(IListeningPort, port) address = port.getHost() verifyObject(IAddress, address) self.assertEquals(address.host, '0.0.0.0') self.assertEquals(address.port, 8242) port = memoryReactor.listenUNIX("/path/to/socket", Factory()) verifyObject(IListeningPort, port) address = port.getHost() verifyObject(IAddress, address) self.assertEquals(address.name, "/path/to/socket")
apache-2.0
jagg81/translate-toolkit
translate/lang/si.py
4
1048
#!/usr/bin/env python # -*- coding: utf-8 -*- # # Copyright 2010 Zuza Software Foundation # # This file is part of the Translate Toolkit. # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program; if not, see <http://www.gnu.org/licenses/>. """This module represents Sinhala language. For more information, see U{http://en.wikipedia.org/wiki/Sinhala_language} """ from translate.lang import common class si(common.Common): """This class represents Sinhala.""" ignoretests = ["startcaps", "simplecaps"]
gpl-2.0
geodrinx/gearthview
ext-libs/twisted/internet/_posixserialport.py
42
2068
# Copyright (c) Twisted Matrix Laboratories. # See LICENSE for details. """ Serial Port Protocol """ # system imports import os, errno # dependent on pyserial ( http://pyserial.sf.net/ ) # only tested w/ 1.18 (5 Dec 2002) import serial from serial import PARITY_NONE, PARITY_EVEN, PARITY_ODD from serial import STOPBITS_ONE, STOPBITS_TWO from serial import FIVEBITS, SIXBITS, SEVENBITS, EIGHTBITS from serialport import BaseSerialPort # twisted imports from twisted.internet import abstract, fdesc, main class SerialPort(BaseSerialPort, abstract.FileDescriptor): """ A select()able serial device, acting as a transport. """ connected = 1 def __init__(self, protocol, deviceNameOrPortNumber, reactor, baudrate = 9600, bytesize = EIGHTBITS, parity = PARITY_NONE, stopbits = STOPBITS_ONE, timeout = 0, xonxoff = 0, rtscts = 0): abstract.FileDescriptor.__init__(self, reactor) self._serial = self._serialFactory( deviceNameOrPortNumber, baudrate=baudrate, bytesize=bytesize, parity=parity, stopbits=stopbits, timeout=timeout, xonxoff=xonxoff, rtscts=rtscts) self.reactor = reactor self.flushInput() self.flushOutput() self.protocol = protocol self.protocol.makeConnection(self) self.startReading() def fileno(self): return self._serial.fd def writeSomeData(self, data): """ Write some data to the serial device. """ return fdesc.writeToFD(self.fileno(), data) def doRead(self): """ Some data's readable from serial device. """ return fdesc.readFromFD(self.fileno(), self.protocol.dataReceived) def connectionLost(self, reason): """ Called when the serial port disconnects. Will call C{connectionLost} on the protocol that is handling the serial data. """ abstract.FileDescriptor.connectionLost(self, reason) self._serial.close() self.protocol.connectionLost(reason)
gpl-3.0
GeoNode/geonode
geonode/monitoring/views.py
4
27048
# -*- coding: utf-8 -*- ######################################################################### # # Copyright (C) 2017 OSGeo # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ######################################################################### import json import pytz from datetime import datetime, timedelta from django.shortcuts import render from django import forms from django.contrib import auth from django.conf import settings from django.views.generic.base import View from django.urls import reverse from django.core.management import call_command from django.views.decorators.csrf import csrf_exempt from geonode.decorators import view_decorator, superuser_protected from geonode.utils import json_response from geonode.monitoring.collector import CollectorAPI from geonode.monitoring.models import ( Service, Host, Metric, ServiceTypeMetric, MetricLabel, MonitoredResource, ExceptionEvent, EventType, NotificationCheck, MetricNotificationCheck, ) from geonode.monitoring.models import do_autoconfigure from geonode.monitoring.utils import TypeChecks, dump, extend_datetime_input_formats from geonode.monitoring.service_handlers import exposes # Create your views here. capi = CollectorAPI() class MetricsList(View): def get(self, *args, **kwargs): _metrics = capi.get_metric_names() out = [] for srv, mlist in _metrics: out.append({'service': srv.name, 'metrics': [{'name': m.name, 'unit': m.unit, 'type': m.type} for m in mlist]}) return json_response({'metrics': out}) class ServicesList(View): def get_queryset(self): return Service.objects.filter(active=True).select_related() def get(self, *args, **kwargs): q = self.get_queryset() out = [] for item in q: out.append({'name': item.name, 'host': item.host.name, 'id': item.id, 'type': item.service_type.name, 'check_interval': item.check_interval.total_seconds(), 'last_check': item.last_check}) return json_response({'services': out}) class HostsList(View): def get_queryset(self): return Host.objects.filter(active=True).select_related() def get(self, *args, **kwargs): q = self.get_queryset() out = [] for item in q: out.append({'name': item.name, 'ip': item.ip}) return json_response({'hosts': out}) class _ValidFromToLastForm(forms.Form): valid_from = forms.DateTimeField( required=False, input_formats=extend_datetime_input_formats(['%Y-%m-%dT%H:%M:%S.%fZ']) ) valid_to = forms.DateTimeField( required=False, input_formats=extend_datetime_input_formats(['%Y-%m-%dT%H:%M:%S.%fZ']) ) interval = forms.IntegerField(min_value=60, required=False) last = forms.IntegerField(min_value=60, required=False) def _check_timestamps(self): last = self.cleaned_data.get('last') vf = self.cleaned_data.get('valid_from') vt = self.cleaned_data.get('valid_to') if last and (vf or vt): raise forms.ValidationError( 'Cannot use last and valid_from/valid_to at the same time') def clean(self): super(_ValidFromToLastForm, self).clean() self._check_timestamps() class CheckTypeForm(_ValidFromToLastForm): """ Special form class to validate values from specific db dictionaries (services, resources, ows services etc) """ def _check_type(self, tname): """ Returns tname-specific object instance from db. Internally it uses geonode.monotoring.utils.TypeChecks to resolve field's value to object. """ d = self.cleaned_data if not d: return val = d[tname] if not val: return tcheck = getattr(TypeChecks, f'{tname}_type', None) if not tcheck: raise forms.ValidationError(f"No type check for {tname}") try: return tcheck(val) except (Exception,) as err: raise forms.ValidationError(err) class MetricsFilters(CheckTypeForm): GROUP_BY_RESOURCE = 'resource' GROUP_BY_RESOURCE_ON_LABEL = 'resource_on_label' GROUP_BY_RESOURCE_ON_USER = 'resource_on_user' GROUP_BY_COUNT_ON_RESOURCE = 'count_on_resource' GROUP_BY_LABEL = 'label' GROUP_BY_USER = 'user' GROUP_BY_USER_ON_LABEL = 'user_on_label' GROUP_BY_EVENT_TYPE = 'event_type' GROUP_BY_EVENT_TYPE_ON_LABEL = 'event_type_on_label' GROUP_BY_EVENT_TYPE_ON_USER = 'event_type_on_user' GROUP_BY_CHOICES = ((GROUP_BY_RESOURCE, "By resource",), (GROUP_BY_RESOURCE_ON_LABEL, "By resource on label",), (GROUP_BY_RESOURCE_ON_USER, "By resource on user",), (GROUP_BY_COUNT_ON_RESOURCE, "By resource with count",), (GROUP_BY_LABEL, "By label",), (GROUP_BY_USER, "By user",), (GROUP_BY_USER_ON_LABEL, "By user on label",), (GROUP_BY_EVENT_TYPE, "By event type",), (GROUP_BY_EVENT_TYPE_ON_LABEL, "By event type on label",), (GROUP_BY_EVENT_TYPE_ON_USER, "By event type on user",),) service = forms.CharField(required=False) label = forms.CharField(required=False) user = forms.CharField(required=False) resource = forms.CharField(required=False) resource_type = forms.ChoiceField( choices=MonitoredResource.TYPES, required=False) event_type = forms.CharField(required=False) service_type = forms.CharField(required=False) group_by = forms.ChoiceField(choices=GROUP_BY_CHOICES, required=False) def clean_resource(self): return self._check_type('resource') def clean_service(self): return self._check_type('service') def clean_label(self): return self._check_type('label') def clean_user(self): return self._check_type('user') def clean_event_type(self): return self._check_type('event_type') def clean_service_type(self): return self._check_type('service_type') def _check_services(self): s = self.cleaned_data.get('service') st = self.cleaned_data.get('service_type') if st and s: raise forms.ValidationError( "Cannot use service and service type at the same time") def clean(self): super(MetricsFilters, self).clean() self._check_services() class LabelsFilterForm(CheckTypeForm): metric_name = forms.CharField(required=False) def clean_metric(self): return self._check_type('metric_name') class ResourcesFilterForm(LabelsFilterForm): resource_type = forms.CharField(required=False) def clean_resource_type(self): return self._check_type('resource_type') class EventTypesFilterForm(CheckTypeForm): ows_service = forms.CharField(required=False) def clean_ows_service(self): return self._check_type('ows_service') class FilteredView(View): # form which validates request.GET for get_queryset() filter_form = None # iterable of pairs (from model field, to key name) to map # fields from model to elements of output data fields_map = tuple() # key name for output ({output_name: data}) output_name = None def get_filter_args(self, request): self.errors = None if not self.filter_form: return {} f = self.filter_form(data=request.GET) if not f.is_valid(): self.errors = f.errors return f.cleaned_data def get(self, request, *args, **kwargs): qargs = self.get_filter_args(request) if self.errors: return json_response({'success': False, 'status': 'errors', 'errors': self.errors}, status=400) q = self.get_queryset(**qargs) from_fields = [f[0] for f in self.fields_map] to_fields = [f[1] for f in self.fields_map] out = [dict(zip(to_fields, (getattr(item, f) for f in from_fields))) for item in q] data = {self.output_name: out, 'success': True, 'errors': {}, 'status': 'ok'} if self.output_name != 'data': data['data'] = {'key': self.output_name} return json_response(data) @view_decorator(superuser_protected, subclass=True) class ResourcesList(FilteredView): filter_form = ResourcesFilterForm fields_map = (('id', 'id',), ('type', 'type',), ('name', 'name',),) output_name = 'resources' def get_queryset(self, metric_name=None, resource_type=None, valid_from=None, valid_to=None, last=None, interval=None): q = MonitoredResource.objects.all().distinct() qparams = {} if resource_type: qparams['type'] = resource_type if metric_name: sm = ServiceTypeMetric.objects.filter(metric__name=metric_name) qparams['metric_values__service_metric__in'] = sm if last: _from = datetime.utcnow().replace(tzinfo=pytz.utc) - timedelta(seconds=last) if interval is None: interval = 60 if not isinstance(interval, timedelta): interval = timedelta(seconds=interval) valid_from = _from if valid_from: qparams['metric_values__valid_from__gte'] = valid_from if valid_to: qparams['metric_values__valid_to__lte'] = valid_to if qparams: q = q.filter(**qparams) return q @view_decorator(superuser_protected, subclass=True) class ResourceTypesList(FilteredView): output_name = 'resource_types' def get(self, request, *args, **kwargs): if self.filter_form: f = self.filter_form(data=request.GET) if not f.is_valid(): return json_response({'success': False, 'status': 'errors', 'errors': f.errors}, status=400) out = [{"name": mrt[0], "type_label": mrt[1]} for mrt in MonitoredResource.TYPES] data = {self.output_name: out, 'success': True, 'errors': {}, 'status': 'ok'} if self.output_name != 'data': data['data'] = {'key': self.output_name} return json_response(data) @view_decorator(superuser_protected, subclass=True) class LabelsList(FilteredView): filter_form = LabelsFilterForm fields_map = (('id', 'id',), ('name', 'name',),) output_name = 'labels' def get_queryset(self, metric_name, valid_from, valid_to, interval=None, last=None): q = MetricLabel.objects.all().distinct() qparams = {} if metric_name: sm = ServiceTypeMetric.objects.filter(metric__name=metric_name) qparams['metric_values__service_metric__in'] = sm if last: _from = datetime.utcnow().replace(tzinfo=pytz.utc) - timedelta(seconds=last) if interval is None: interval = 60 if not isinstance(interval, timedelta): interval = timedelta(seconds=interval) valid_from = _from if valid_from: qparams['metric_values__valid_from__gte'] = valid_from if valid_to: qparams['metric_values__valid_to__lte'] = valid_to if qparams: q = q.filter(**qparams) return q @view_decorator(superuser_protected, subclass=True) class EventTypeList(FilteredView): filter_form = EventTypesFilterForm fields_map = (('name', 'name',), ('type_label', 'type_label',),) output_name = 'event_types' def get_queryset(self, **kwargs): if "ows_service" in kwargs and kwargs["ows_service"] is not None: if kwargs["ows_service"]: return EventType.objects.filter(name__icontains="OWS") else: return EventType.objects.exclude(name__icontains="OWS") return EventType.objects.all() def get(self, request, *args, **kwargs): qargs = self.get_filter_args(request) if self.errors: return json_response({'success': False, 'status': 'errors', 'errors': self.errors}, status=400) q = self.get_queryset(**qargs) from_fields = [f[0] for f in self.fields_map] to_fields = [f[1] for f in self.fields_map] labels = dict(EventType.EVENT_TYPES) out = [dict(zip( to_fields, (getattr(item, f) if f != 'type_label' else labels[getattr(item, 'name')] for f in from_fields) )) for item in q] data = {self.output_name: out, 'success': True, 'errors': {}, 'status': 'ok'} if self.output_name != 'data': data['data'] = {'key': self.output_name} return json_response(data) @view_decorator(superuser_protected, subclass=True) class MetricDataView(View): def get_filters(self, **kwargs): out = {} self.errors = None f = MetricsFilters(data=self.request.GET) if not f.is_valid(): self.errors = f.errors else: out.update(f.cleaned_data) return out def get(self, request, *args, **kwargs): filters = self.get_filters(**kwargs) if self.errors: return json_response({'status': 'error', 'success': False, 'errors': self.errors}, status=400) metric_name = kwargs['metric_name'] last = filters.pop('last', None) if last: td = timedelta(seconds=last) now = datetime.utcnow().replace(tzinfo=pytz.utc) filters['valid_from'] = now - td filters['valid_to'] = now out = capi.get_metrics_for(metric_name, **filters) return json_response({'data': out}) class ExceptionsListForm(CheckTypeForm): error_type = forms.CharField(required=False) service_name = forms.CharField(required=False) service_type = forms.CharField(required=False) resource = forms.CharField(required=False) def clean_resource(self): return self._check_type('resource') def clean_service(self): return self._check_type('service') class ExceptionsListView(FilteredView): filter_form = ExceptionsListForm fields_map = (('id', 'id',), ('created', 'created',), ('url', 'url',), ('service_data', 'service',), ('error_type', 'error_type',),) output_name = 'exceptions' def get_queryset(self, error_type=None, valid_from=None, valid_to=None, interval=None, last=None, service_name=None, service_type=None, resource=None): q = ExceptionEvent.objects.all().select_related() if error_type: q = q.filter(error_type=error_type) if last: _from = datetime.utcnow().replace(tzinfo=pytz.utc) - timedelta(seconds=last) if interval is None: interval = 60 if not isinstance(interval, timedelta): interval = timedelta(seconds=interval) valid_from = _from if valid_from: q = q.filter(created__gte=valid_from) if valid_to: q = q.filter(created__lte=valid_to) if service_name: q = q.filter(service__name=service_name) if service_type: q = q.filter(service__service_type__name=service_type) if resource: q = q.filter(request__resources__in=(resource,)) return q class ExceptionDataView(View): def get_object(self, exception_id): try: return ExceptionEvent.objects.get(id=exception_id) except ExceptionEvent.DoesNotExist: return def get(self, request, exception_id, *args, **kwargs): e = self.get_object(exception_id) if not e: return json_response( errors={'exception_id': "Object not found"}, status=404) data = e.expose() return json_response(data) class BeaconView(View): def get(self, request, *args, **kwargs): service = kwargs.get('exposed') if not service: data = [{'name': s, 'url': reverse( 'monitoring:api_beacon_exposed', args=(s,))} for s in exposes.keys()] return json_response({'exposed': data}) try: ex = exposes[service]() except KeyError: return json_response( errors={'exposed': f'No service for {service}'}, status=404) out = {'data': ex.expose(), 'timestamp': datetime.utcnow().replace(tzinfo=pytz.utc)} return json_response(out) def index(request): if auth.get_user(request).is_superuser: return render(request, 'monitoring/index.html') return render(request, 'monitoring/non_superuser.html') class NotificaitonCheckForm(forms.ModelForm): class Meta: model = NotificationCheck fields = ('name', 'description', 'severity', 'user_threshold',) class MetricNotificationCheckForm(forms.ModelForm): metric = forms.CharField(required=True) service = forms.CharField(required=False) resource = forms.CharField(required=False) label = forms.CharField(required=False) event_type = forms.CharField(required=False) class Meta: model = MetricNotificationCheck fields = ( 'notification_check', 'min_value', 'max_value', 'max_timeout', ) def _get_clean_model(self, cls, name): val = self.cleaned_data.get(name) if not self.fields[name].required: if not val: return try: return cls.objects.get(name=val) except cls.DoesNotExist: raise forms.ValidationError(f"Invalid {name}: {val}") def clean_metric(self): return self._get_clean_model(Metric, 'metric') def clean_service(self): return self._get_clean_model(Service, 'service') def clean_label(self): return self._get_clean_model(MetricLabel, 'label') def clean_event_type(self): return self._get_clean_model(EventType, 'event_type') def clean_resource(self): val = self.cleaned_data.get('resource') if not val: return try: vtype, vname = val.split('=') except IndexError: raise forms.ValidationError( f"Invalid resource name: {val}") try: return MonitoredResource.objects.get(name=vname, type=vtype) except MonitoredResource.DoesNotExist: raise forms.ValidationError(f"Invalid resource: {val}") class UserNotificationConfigView(View): def get_object(self): pk = self.kwargs['pk'] return NotificationCheck.objects.get(pk=pk) def get(self, request, *args, **kwargs): out = {'success': False, 'status': 'error', 'data': [], 'errors': {}} fields = ('field_name', 'steps', 'current_value', 'steps_calculated', 'unit', 'is_enabled',) if auth.get_user(request).is_authenticated: obj = self.get_object() out['success'] = True out['status'] = 'ok' form = obj.get_user_form() fields = [dump(r, fields) for r in obj.definitions.all()] out['data'] = {'form': form.as_table(), 'fields': fields, 'emails': obj.emails, 'notification': dump(obj)} status = 200 else: out['errors']['user'] = ['User is not authenticated'] status = 401 return json_response(out, status=status) def post(self, request, *args, **kwargs): out = {'success': False, 'status': 'error', 'data': [], 'errors': {}} if auth.get_user(request).is_authenticated: obj = self.get_object() try: is_json = True data = json.loads(request.body) except (TypeError, ValueError,): is_json = False data = request.POST.copy() try: configs = obj.process_user_form(data, is_json=is_json) out['success'] = True out['status'] = 'ok' out['data'] = [dump(c) for c in configs] status = 200 except forms.ValidationError as err: out['errors'] = err.errors status = 400 else: out['errors']['user'] = ['User is not authenticated'] status = 401 return json_response(out, status=status) if settings.MONITORING_DISABLE_CSRF: post = csrf_exempt(post) class NotificationsList(FilteredView): filter_form = None fields_map = (('id', 'id',), ('url', 'url',), ('name', 'name',), ('active', 'active',), ('severity', 'severity',), ('description', 'description',), ) output_name = 'data' def get_filter_args(self, *args, **kwargs): self.errors = {} if not auth.get_user(self.request).is_authenticated: self.errors = {'user': ['User is not authenticated']} return {} def get_queryset(self, *args, **kwargs): return NotificationCheck.objects.all() def create(self, request, *args, **kwargs): f = NotificaitonCheckForm(data=request.POST) if f.is_valid(): d = f.cleaned_data return NotificationCheck.create(**d) self.errors = f.errors def post(self, request, *args, **kwargs): out = {'success': False, 'status': 'error', 'data': [], 'errors': {}} d = self.create(request, *args, **kwargs) if d is None: out['errors'] = self.errors status = 400 else: out['data'] = dump(d) out['success'] = True out['status'] = 'ok' status = 200 return json_response(out, status=status) class StatusCheckView(View): fields = ('name', 'severity', 'offending_value', 'threshold_value', 'spotted_at', 'valid_from', 'valid_to', 'check_url', 'check_id', 'description', 'message',) def get(self, request, *args, **kwargs): capi = CollectorAPI() checks = capi.get_notifications() data = {'status': 'ok', 'success': True, 'data': {}} d = data['data'] d['problems'] = problems = [] d['health_level'] = 'ok' _levels = ('fatal', 'error', 'warning',) levels = set([]) for nc, ncdata in checks: for ncd in ncdata: levels.add(ncd.severity) problems.append(dump(ncd, self.fields)) if levels: for lyr in _levels: if lyr in levels: d['health_level'] = lyr break return json_response(data) class AutoconfigureView(View): def post(self, request, *args, **kwargs): if not auth.get_user(request).is_authenticated: out = {'success': False, 'status': 'error', 'errors': {'user': ['User is not authenticated']} } return json_response(out, status=401) if not (auth.get_user(request).is_superuser or auth.get_user(request).is_staff): out = {'success': False, 'status': 'error', 'errors': {'user': ['User is not permitted']} } return json_response(out, status=401) do_autoconfigure() out = {'success': True, 'status': 'ok', 'errors': {} } return json_response(out) class CollectMetricsView(View): """ - Run command "collect_metrics -n -t xml" via web """ authkey = 'OzhVMECJUn9vDu2oLv1HjGPKByuTBwF8' def get(self, request, *args, **kwargs): authkey = kwargs.get('authkey') if not authkey or authkey != self.authkey: out = {'success': False, 'status': 'error', 'errors': {'denied': ['Call is not permitted']} } return json_response(out, status=401) else: call_command( 'collect_metrics', '-n', '-t', 'xml') out = {'success': True, 'status': 'ok', 'errors': {} } return json_response(out) api_metrics = MetricsList.as_view() api_services = ServicesList.as_view() api_hosts = HostsList.as_view() api_labels = LabelsList.as_view() api_resources = ResourcesList.as_view() api_resource_types = ResourceTypesList.as_view() api_event_types = EventTypeList.as_view() api_metric_data = MetricDataView.as_view() api_metric_collect = CollectMetricsView.as_view() api_exceptions = ExceptionsListView.as_view() api_exception = ExceptionDataView.as_view() api_beacon = BeaconView.as_view() api_user_notification_config = UserNotificationConfigView.as_view() api_user_notifications = NotificationsList.as_view() api_status = StatusCheckView.as_view() api_autoconfigure = AutoconfigureView.as_view()
gpl-3.0
rackerlabs/ironic
ironic/drivers/modules/deploy_utils.py
1
17645
# Copyright (c) 2012 NTT DOCOMO, INC. # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import os import re import socket import stat import time from oslo.config import cfg from oslo.utils import excutils from oslo_concurrency import processutils from ironic.common import disk_partitioner from ironic.common import exception from ironic.common.i18n import _ from ironic.common.i18n import _LE from ironic.common import images from ironic.common import states from ironic.common import utils from ironic.conductor import utils as manager_utils from ironic.drivers.modules import image_cache from ironic.openstack.common import log as logging LOG = logging.getLogger(__name__) CONF = cfg.CONF # All functions are called from deploy() directly or indirectly. # They are split for stub-out. def discovery(portal_address, portal_port): """Do iSCSI discovery on portal.""" utils.execute('iscsiadm', '-m', 'discovery', '-t', 'st', '-p', '%s:%s' % (portal_address, portal_port), run_as_root=True, check_exit_code=[0], attempts=5, delay_on_retry=True) def login_iscsi(portal_address, portal_port, target_iqn): """Login to an iSCSI target.""" utils.execute('iscsiadm', '-m', 'node', '-p', '%s:%s' % (portal_address, portal_port), '-T', target_iqn, '--login', run_as_root=True, check_exit_code=[0], attempts=5, delay_on_retry=True) # Ensure the login complete time.sleep(3) def logout_iscsi(portal_address, portal_port, target_iqn): """Logout from an iSCSI target.""" utils.execute('iscsiadm', '-m', 'node', '-p', '%s:%s' % (portal_address, portal_port), '-T', target_iqn, '--logout', run_as_root=True, check_exit_code=[0], attempts=5, delay_on_retry=True) def delete_iscsi(portal_address, portal_port, target_iqn): """Delete the iSCSI target.""" # Retry delete until it succeeds (exit code 0) or until there is # no longer a target to delete (exit code 21). utils.execute('iscsiadm', '-m', 'node', '-p', '%s:%s' % (portal_address, portal_port), '-T', target_iqn, '-o', 'delete', run_as_root=True, check_exit_code=[0, 21], attempts=5, delay_on_retry=True) def make_partitions(dev, root_mb, swap_mb, ephemeral_mb, commit=True): """Create partitions for root, swap and ephemeral on a disk device. :param root_mb: Size of the root partition in mebibytes (MiB). :param swap_mb: Size of the swap partition in mebibytes (MiB). If 0, no swap partition will be created. :param ephemeral_mb: Size of the ephemeral partition in mebibytes (MiB). If 0, no ephemeral partition will be created. :param commit: True/False. Default for this setting is True. If False partitions will not be written to disk. :returns: A dictionary containing the partition type as Key and partition path as Value for the partitions created by this method. """ part_template = dev + '-part%d' part_dict = {} dp = disk_partitioner.DiskPartitioner(dev) if ephemeral_mb: part_num = dp.add_partition(ephemeral_mb) part_dict['ephemeral'] = part_template % part_num if swap_mb: part_num = dp.add_partition(swap_mb, fs_type='linux-swap') part_dict['swap'] = part_template % part_num # NOTE(lucasagomes): Make the root partition the last partition. This # enables tools like cloud-init's growroot utility to expand the root # partition until the end of the disk. part_num = dp.add_partition(root_mb) part_dict['root'] = part_template % part_num if commit: # write to the disk dp.commit() return part_dict def is_block_device(dev): """Check whether a device is block or not.""" s = os.stat(dev) return stat.S_ISBLK(s.st_mode) def dd(src, dst): """Execute dd from src to dst.""" utils.dd(src, dst, 'bs=1M', 'oflag=direct') def populate_image(src, dst): data = images.qemu_img_info(src) if data.file_format == 'raw': dd(src, dst) else: images.convert_image(src, dst, 'raw', True) def mkswap(dev, label='swap1'): """Execute mkswap on a device.""" utils.mkfs('swap', dev, label) def mkfs_ephemeral(dev, ephemeral_format, label="ephemeral0"): utils.mkfs(ephemeral_format, dev, label) def block_uuid(dev): """Get UUID of a block device.""" out, _err = utils.execute('blkid', '-s', 'UUID', '-o', 'value', dev, run_as_root=True, check_exit_code=[0]) return out.strip() def switch_pxe_config(path, root_uuid, boot_mode): """Switch a pxe config from deployment mode to service mode.""" with open(path) as f: lines = f.readlines() root = 'UUID=%s' % root_uuid rre = re.compile(r'\{\{ ROOT \}\}') if boot_mode == 'uefi': dre = re.compile('^default=.*$') boot_line = 'default=boot' else: pxe_cmd = 'goto' if CONF.pxe.ipxe_enabled else 'default' dre = re.compile('^%s .*$' % pxe_cmd) boot_line = '%s boot' % pxe_cmd with open(path, 'w') as f: for line in lines: line = rre.sub(root, line) line = dre.sub(boot_line, line) f.write(line) def notify(address, port): """Notify a node that it becomes ready to reboot.""" s = socket.socket(socket.AF_INET, socket.SOCK_STREAM) try: s.connect((address, port)) s.send('done') finally: s.close() def get_dev(address, port, iqn, lun): """Returns a device path for given parameters.""" dev = ("/dev/disk/by-path/ip-%s:%s-iscsi-%s-lun-%s" % (address, port, iqn, lun)) return dev def get_image_mb(image_path, virtual_size=True): """Get size of an image in Megabyte.""" mb = 1024 * 1024 if not virtual_size: image_byte = os.path.getsize(image_path) else: image_byte = images.converted_size(image_path) # round up size to MB image_mb = int((image_byte + mb - 1) / mb) return image_mb def get_dev_block_size(dev): """Get the device size in 512 byte sectors.""" block_sz, cmderr = utils.execute('blockdev', '--getsz', dev, run_as_root=True, check_exit_code=[0]) return int(block_sz) def destroy_disk_metadata(dev, node_uuid): """Destroy metadata structures on node's disk. Ensure that node's disk appears to be blank without zeroing the entire drive. To do this we will zero: - the first 18KiB to clear MBR / GPT data - the last 18KiB to clear GPT and other metadata like: LVM, veritas, MDADM, DMRAID, ... """ # NOTE(NobodyCam): This is needed to work around bug: # https://bugs.launchpad.net/ironic/+bug/1317647 try: utils.execute('dd', 'if=/dev/zero', 'of=%s' % dev, 'bs=512', 'count=36', run_as_root=True, check_exit_code=[0]) except processutils.ProcessExecutionError as err: with excutils.save_and_reraise_exception(): LOG.error(_LE("Failed to erase beginning of disk for node " "%(node)s. Command: %(command)s. Error: %(error)s."), {'node': node_uuid, 'command': err.cmd, 'error': err.stderr}) # now wipe the end of the disk. # get end of disk seek value try: block_sz = get_dev_block_size(dev) except processutils.ProcessExecutionError as err: with excutils.save_and_reraise_exception(): LOG.error(_LE("Failed to get disk block count for node %(node)s. " "Command: %(command)s. Error: %(error)s."), {'node': node_uuid, 'command': err.cmd, 'error': err.stderr}) else: seek_value = block_sz - 36 try: utils.execute('dd', 'if=/dev/zero', 'of=%s' % dev, 'bs=512', 'count=36', 'seek=%d' % seek_value, run_as_root=True, check_exit_code=[0]) except processutils.ProcessExecutionError as err: with excutils.save_and_reraise_exception(): LOG.error(_LE("Failed to erase the end of the disk on node " "%(node)s. Command: %(command)s. " "Error: %(error)s."), {'node': node_uuid, 'command': err.cmd, 'error': err.stderr}) def work_on_disk(dev, root_mb, swap_mb, ephemeral_mb, ephemeral_format, image_path, node_uuid, preserve_ephemeral=False): """Create partitions and copy an image to the root partition. :param dev: Path for the device to work on. :param root_mb: Size of the root partition in megabytes. :param swap_mb: Size of the swap partition in megabytes. :param ephemeral_mb: Size of the ephemeral partition in megabytes. If 0, no ephemeral partition will be created. :param ephemeral_format: The type of file system to format the ephemeral partition. :param image_path: Path for the instance's disk image. :param node_uuid: node's uuid. Used for logging. :param preserve_ephemeral: If True, no filesystem is written to the ephemeral block device, preserving whatever content it had (if the partition table has not changed). :returns: the UUID of the root partition. """ if not is_block_device(dev): raise exception.InstanceDeployFailure(_("Parent device '%s' not found") % dev) # the only way for preserve_ephemeral to be set to true is if we are # rebuilding an instance with --preserve_ephemeral. commit = not preserve_ephemeral # now if we are committing the changes to disk clean first. if commit: destroy_disk_metadata(dev, node_uuid) part_dict = make_partitions(dev, root_mb, swap_mb, ephemeral_mb, commit=commit) ephemeral_part = part_dict.get('ephemeral') swap_part = part_dict.get('swap') root_part = part_dict.get('root') if not is_block_device(root_part): raise exception.InstanceDeployFailure(_("Root device '%s' not found") % root_part) if swap_part and not is_block_device(swap_part): raise exception.InstanceDeployFailure(_("Swap device '%s' not found") % swap_part) if ephemeral_part and not is_block_device(ephemeral_part): raise exception.InstanceDeployFailure( _("Ephemeral device '%s' not found") % ephemeral_part) populate_image(image_path, root_part) if swap_part: mkswap(swap_part) if ephemeral_part and not preserve_ephemeral: mkfs_ephemeral(ephemeral_part, ephemeral_format) try: root_uuid = block_uuid(root_part) except processutils.ProcessExecutionError: with excutils.save_and_reraise_exception(): LOG.error(_LE("Failed to detect root device UUID.")) return root_uuid def deploy(address, port, iqn, lun, image_path, root_mb, swap_mb, ephemeral_mb, ephemeral_format, node_uuid, preserve_ephemeral=False): """All-in-one function to deploy a node. :param address: The iSCSI IP address. :param port: The iSCSI port number. :param iqn: The iSCSI qualified name. :param lun: The iSCSI logical unit number. :param image_path: Path for the instance's disk image. :param root_mb: Size of the root partition in megabytes. :param swap_mb: Size of the swap partition in megabytes. :param ephemeral_mb: Size of the ephemeral partition in megabytes. If 0, no ephemeral partition will be created. :param ephemeral_format: The type of file system to format the ephemeral partition. :param node_uuid: node's uuid. Used for logging. :param preserve_ephemeral: If True, no filesystem is written to the ephemeral block device, preserving whatever content it had (if the partition table has not changed). :returns: the UUID of the root partition. """ dev = get_dev(address, port, iqn, lun) image_mb = get_image_mb(image_path) if image_mb > root_mb: root_mb = image_mb discovery(address, port) login_iscsi(address, port, iqn) try: root_uuid = work_on_disk(dev, root_mb, swap_mb, ephemeral_mb, ephemeral_format, image_path, node_uuid, preserve_ephemeral) except processutils.ProcessExecutionError as err: with excutils.save_and_reraise_exception(): LOG.error(_LE("Deploy to address %s failed."), address) LOG.error(_LE("Command: %s"), err.cmd) LOG.error(_LE("StdOut: %r"), err.stdout) LOG.error(_LE("StdErr: %r"), err.stderr) except exception.InstanceDeployFailure as e: with excutils.save_and_reraise_exception(): LOG.error(_LE("Deploy to address %s failed."), address) LOG.error(e) finally: logout_iscsi(address, port, iqn) delete_iscsi(address, port, iqn) return root_uuid def notify_deploy_complete(address): """Notifies the completion of deployment to the baremetal node. :param address: The IP address of the node. """ # Ensure the node started netcat on the port after POST the request. time.sleep(3) notify(address, 10000) def check_for_missing_params(info_dict, error_msg, param_prefix=''): """Check for empty params in the provided dictionary. :param info_dict: The dictionary to inspect. :param error_msg: The error message to prefix before printing the information about missing parameters. :param param_prefix: Add this prefix to each parameter for error messages :raises: MissingParameterValue, if one or more parameters are empty in the provided dictionary. """ missing_info = [] for label, value in info_dict.items(): if not value: missing_info.append(param_prefix + label) if missing_info: exc_msg = _("%(error_msg)s. Missing are: %(missing_info)s") raise exception.MissingParameterValue(exc_msg % {'error_msg': error_msg, 'missing_info': missing_info}) def fetch_images(ctx, cache, images_info, force_raw=True): """Check for available disk space and fetch images using ImageCache. :param ctx: context :param cache: ImageCache instance to use for fetching :param images_info: list of tuples (image href, destination path) :param force_raw: boolean value, whether to convert the image to raw format :raises: InstanceDeployFailure if unable to find enough disk space """ try: image_cache.clean_up_caches(ctx, cache.master_dir, images_info) except exception.InsufficientDiskSpace as e: raise exception.InstanceDeployFailure(reason=e) # NOTE(dtantsur): This code can suffer from race condition, # if disk space is used between the check and actual download. # This is probably unavoidable, as we can't control other # (probably unrelated) processes for href, path in images_info: cache.fetch_image(href, path, ctx=ctx, force_raw=force_raw) def set_failed_state(task, msg): """Sets the deploy status as failed with relevant messages. This method sets the deployment as fail with the given message. It sets node's provision_state to DEPLOYFAIL and updates last_error with the given error message. It also powers off the baremetal node. :param task: a TaskManager instance containing the node to act on. :param msg: the message to set in last_error of the node. """ node = task.node node.provision_state = states.DEPLOYFAIL node.target_provision_state = states.NOSTATE node.save() try: manager_utils.node_power_action(task, states.POWER_OFF) except Exception: msg2 = (_LE('Node %s failed to power off while handling deploy ' 'failure. This may be a serious condition. Node ' 'should be removed from Ironic or put in maintenance ' 'mode until the problem is resolved.') % node.uuid) LOG.exception(msg2) finally: # NOTE(deva): node_power_action() erases node.last_error # so we need to set it again here. node.last_error = msg node.save()
apache-2.0
xzturn/tensorflow
tensorflow/tools/docs/generate_lib.py
4
22402
# Lint as: python2, python3 # Copyright 2015 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Generate docs for the TensorFlow Python API.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import argparse import fnmatch import os import shutil import tempfile import six from tensorflow.python.util import tf_inspect from tensorflow.tools.common import public_api from tensorflow.tools.common import traverse from tensorflow.tools.docs import doc_controls from tensorflow.tools.docs import doc_generator_visitor from tensorflow.tools.docs import parser from tensorflow.tools.docs import pretty_docs from tensorflow.tools.docs import py_guide_parser def write_docs(output_dir, parser_config, yaml_toc, root_title='TensorFlow', search_hints=True, site_api_path='api_docs/python'): """Write previously extracted docs to disk. Write a docs page for each symbol included in the indices of parser_config to a tree of docs at `output_dir`. Symbols with multiple aliases will have only one page written about them, which is referenced for all aliases. Args: output_dir: Directory to write documentation markdown files to. Will be created if it doesn't exist. parser_config: A `parser.ParserConfig` object, containing all the necessary indices. yaml_toc: Set to `True` to generate a "_toc.yaml" file. root_title: The title name for the root level index.md. search_hints: (bool) include meta-data search hints at the top of each output file. site_api_path: The output path relative to the site root. Used in the `_toc.yaml` and `_redirects.yaml` files. Raises: ValueError: if `output_dir` is not an absolute path """ # Make output_dir. if not os.path.isabs(output_dir): raise ValueError("'output_dir' must be an absolute path.\n" " output_dir='%s'" % output_dir) if not os.path.exists(output_dir): os.makedirs(output_dir) # These dictionaries are used for table-of-contents generation below # They will contain, after the for-loop below:: # - module name(string):classes and functions the module contains(list) module_children = {} # - symbol name(string):pathname (string) symbol_to_file = {} # Collect redirects for an api _redirects.yaml file. redirects = [] # Parse and write Markdown pages, resolving cross-links (@{symbol}). for full_name, py_object in six.iteritems(parser_config.index): parser_config.reference_resolver.current_doc_full_name = full_name if full_name in parser_config.duplicate_of: continue # Methods and some routines are documented only as part of their class. if not (tf_inspect.ismodule(py_object) or tf_inspect.isclass(py_object) or parser.is_free_function(py_object, full_name, parser_config.index)): continue sitepath = os.path.join(parser.documentation_path(full_name)[:-3]) # For TOC, we need to store a mapping from full_name to the file # we're generating symbol_to_file[full_name] = sitepath # For a module, remember the module for the table-of-contents if tf_inspect.ismodule(py_object): if full_name in parser_config.tree: module_children.setdefault(full_name, []) # For something else that's documented, # figure out what module it lives in else: subname = str(full_name) while True: subname = subname[:subname.rindex('.')] if tf_inspect.ismodule(parser_config.index[subname]): module_children.setdefault(subname, []).append(full_name) break # Generate docs for `py_object`, resolving references. page_info = parser.docs_for_object(full_name, py_object, parser_config) path = os.path.join(output_dir, parser.documentation_path(full_name)) directory = os.path.dirname(path) try: if not os.path.exists(directory): os.makedirs(directory) # This function returns raw bytes in PY2 or unicode in PY3. if search_hints: content = [page_info.get_metadata_html()] else: content = [''] content.append(pretty_docs.build_md_page(page_info)) text = '\n'.join(content) if six.PY3: text = text.encode('utf-8') with open(path, 'wb') as f: f.write(text) except OSError: raise OSError( 'Cannot write documentation for %s to %s' % (full_name, directory)) duplicates = parser_config.duplicates.get(full_name, []) if not duplicates: continue duplicates = [item for item in duplicates if item != full_name] for dup in duplicates: from_path = os.path.join(site_api_path, six.ensure_str(dup).replace('.', '/')) to_path = os.path.join(site_api_path, six.ensure_str(full_name).replace('.', '/')) redirects.append(( os.path.join('/', from_path), os.path.join('/', to_path))) if redirects: redirects = sorted(redirects) template = ('- from: {}\n' ' to: {}\n') redirects = [template.format(f, t) for f, t in redirects] api_redirects_path = os.path.join(output_dir, '_redirects.yaml') with open(api_redirects_path, 'w') as redirect_file: redirect_file.write('redirects:\n') redirect_file.write(''.join(redirects)) if yaml_toc: # Generate table of contents # Put modules in alphabetical order, case-insensitive modules = sorted(list(module_children.keys()), key=lambda a: a.upper()) leftnav_path = os.path.join(output_dir, '_toc.yaml') with open(leftnav_path, 'w') as f: # Generate header f.write('# Automatically generated file; please do not edit\ntoc:\n') for module in modules: indent_num = module.count('.') # Don't list `tf.submodule` inside `tf` indent_num = max(indent_num, 1) indent = ' '*indent_num if indent_num > 1: # tf.contrib.baysflow.entropy will be under # tf.contrib->baysflow->entropy title = six.ensure_str(module).split('.')[-1] else: title = module header = [ '- title: ' + six.ensure_str(title), ' section:', ' - title: Overview', ' path: ' + os.path.join('/', site_api_path, symbol_to_file[module]) ] header = ''.join([indent+line+'\n' for line in header]) f.write(header) symbols_in_module = module_children.get(module, []) # Sort case-insensitive, if equal sort case sensitive (upper first) symbols_in_module.sort(key=lambda a: (a.upper(), a)) for full_name in symbols_in_module: item = [ ' - title: ' + full_name[len(module) + 1:], ' path: ' + os.path.join('/', site_api_path, symbol_to_file[full_name])] item = ''.join([indent+line+'\n' for line in item]) f.write(item) # Write a global index containing all full names with links. with open(os.path.join(output_dir, 'index.md'), 'w') as f: f.write( six.ensure_str( parser.generate_global_index(root_title, parser_config.index, parser_config.reference_resolver))) def add_dict_to_dict(add_from, add_to): for key in add_from: if key in add_to: add_to[key].extend(add_from[key]) else: add_to[key] = add_from[key] # Exclude some libraries in contrib from the documentation altogether. def _get_default_private_map(): return { 'tf.test': ['mock'], 'tf': ['contrib'], 'tf.compat': ['v1', 'v2'], } # Exclude members of some libraries. def _get_default_do_not_descend_map(): # TODO(markdaoust): Use docs_controls decorators, locally, instead. return { 'tf': ['cli', 'lib', 'wrappers'], } class DocControlsAwareCrawler(public_api.PublicAPIVisitor): """A `docs_controls` aware API-crawler.""" def _is_private(self, path, name, obj): if doc_controls.should_skip(obj): return True return super(DocControlsAwareCrawler, self)._is_private(path, name, obj) def extract(py_modules, private_map, do_not_descend_map, visitor_cls=doc_generator_visitor.DocGeneratorVisitor): """Extract docs from tf namespace and write them to disk.""" # Traverse the first module. visitor = visitor_cls(py_modules[0][0]) api_visitor = DocControlsAwareCrawler(visitor) api_visitor.set_root_name(py_modules[0][0]) add_dict_to_dict(private_map, api_visitor.private_map) add_dict_to_dict(do_not_descend_map, api_visitor.do_not_descend_map) traverse.traverse(py_modules[0][1], api_visitor) # Traverse all py_modules after the first: for module_name, module in py_modules[1:]: visitor.set_root_name(module_name) api_visitor.set_root_name(module_name) traverse.traverse(module, api_visitor) return visitor class _GetMarkdownTitle(py_guide_parser.PyGuideParser): """Extract the title from a .md file.""" def __init__(self): self.title = None py_guide_parser.PyGuideParser.__init__(self) def process_title(self, _, title): if self.title is None: # only use the first title self.title = title class _DocInfo(object): """A simple struct for holding a doc's url and title.""" def __init__(self, url, title): self.url = url self.title = title def build_doc_index(src_dir): """Build an index from a keyword designating a doc to _DocInfo objects.""" doc_index = {} if not os.path.isabs(src_dir): raise ValueError("'src_dir' must be an absolute path.\n" " src_dir='%s'" % src_dir) if not os.path.exists(src_dir): raise ValueError("'src_dir' path must exist.\n" " src_dir='%s'" % src_dir) for dirpath, _, filenames in os.walk(src_dir): suffix = os.path.relpath(path=dirpath, start=src_dir) for base_name in filenames: if not six.ensure_str(base_name).endswith('.md'): continue title_parser = _GetMarkdownTitle() title_parser.process(os.path.join(dirpath, base_name)) if title_parser.title is None: msg = ('`{}` has no markdown title (# title)'.format( os.path.join(dirpath, base_name))) raise ValueError(msg) key_parts = six.ensure_str(os.path.join(suffix, base_name[:-3])).split('/') if key_parts[-1] == 'index': key_parts = key_parts[:-1] doc_info = _DocInfo(os.path.join(suffix, base_name), title_parser.title) doc_index[key_parts[-1]] = doc_info if len(key_parts) > 1: doc_index['/'.join(key_parts[-2:])] = doc_info return doc_index class _GuideRef(object): def __init__(self, base_name, title, section_title, section_tag): self.url = 'api_guides/python/' + six.ensure_str( (('%s#%s' % (base_name, section_tag)) if section_tag else base_name)) self.link_text = (('%s > %s' % (title, section_title)) if section_title else title) def make_md_link(self, url_prefix): return '[%s](%s%s)' % (self.link_text, url_prefix, self.url) class _GenerateGuideIndex(py_guide_parser.PyGuideParser): """Turn guide files into an index from symbol name to a list of _GuideRefs.""" def __init__(self): self.index = {} py_guide_parser.PyGuideParser.__init__(self) def process(self, full_path, base_name): """Index a file, reading from `full_path`, with `base_name` as the link.""" self.full_path = full_path self.base_name = base_name self.title = None self.section_title = None self.section_tag = None py_guide_parser.PyGuideParser.process(self, full_path) def process_title(self, _, title): if self.title is None: # only use the first title self.title = title def process_section(self, _, section_title, tag): self.section_title = section_title self.section_tag = tag def process_line(self, _, line): """Index the file and section of each `symbol` reference.""" for match in parser.AUTO_REFERENCE_RE.finditer(line): val = self.index.get(match.group(1), []) val.append( _GuideRef(self.base_name, self.title, self.section_title, self.section_tag)) self.index[match.group(1)] = val def _build_guide_index(guide_src_dir): """Return dict: symbol name -> _GuideRef from the files in `guide_src_dir`.""" index_generator = _GenerateGuideIndex() if os.path.exists(guide_src_dir): for full_path, base_name in py_guide_parser.md_files_in_dir(guide_src_dir): index_generator.process(full_path, base_name) return index_generator.index class _UpdateTags(py_guide_parser.PyGuideParser): """Rewrites a Python guide so that each section has an explicit id tag. "section" here refers to blocks delimited by second level headings. """ def process_section(self, line_number, section_title, tag): self.replace_line(line_number, '<h2 id="%s">%s</h2>' % (tag, section_title)) def update_id_tags_inplace(src_dir): """Set explicit ids on all second-level headings to ensure back-links work. Args: src_dir: The directory of md-files to convert (inplace). """ tag_updater = _UpdateTags() for dirpath, _, filenames in os.walk(src_dir): for base_name in filenames: if not base_name.endswith('.md'): continue full_path = os.path.join(src_dir, dirpath, base_name) # Tag updater loads the file, makes the replacements, and returns the # modified file contents content = tag_updater.process(full_path) with open(full_path, 'w') as f: f.write(six.ensure_str(content)) EXCLUDED = set(['__init__.py', 'OWNERS', 'README.txt']) def replace_refs(src_dir, output_dir, reference_resolver, file_pattern='*.md', api_docs_relpath='api_docs'): """Fix @{} references in all files under `src_dir` matching `file_pattern`. A matching directory structure, with the modified files is written to `output_dir`. `{"__init__.py","OWNERS","README.txt"}` are skipped. Files not matching `file_pattern` (using `fnmatch`) are copied with no change. Also, files in the `api_guides/python` directory get explicit ids set on all heading-2s to ensure back-links work. Args: src_dir: The directory to convert files from. output_dir: The root directory to write the resulting files to. reference_resolver: A `parser.ReferenceResolver` to make the replacements. file_pattern: Only replace references in files matching file_patters, using fnmatch. Non-matching files are copied unchanged. api_docs_relpath: Relative-path string to the api_docs, from the src_dir. """ # Iterate through all the source files and process them. for dirpath, _, filenames in os.walk(src_dir): depth = os.path.relpath(src_dir, start=dirpath) # How to get from `dirpath` to api_docs/python/ relative_path_to_root = os.path.join(depth, api_docs_relpath, 'python') # Make the directory under output_dir. new_dir = os.path.join(output_dir, os.path.relpath(path=dirpath, start=src_dir)) if not os.path.exists(new_dir): os.makedirs(new_dir) for base_name in filenames: if base_name in EXCLUDED: continue full_in_path = os.path.join(dirpath, base_name) # Set the `current_doc_full_name` so bad files can be reported on errors. reference_resolver.current_doc_full_name = full_in_path suffix = os.path.relpath(path=full_in_path, start=src_dir) full_out_path = os.path.join(output_dir, suffix) # Copy files that do not match the file_pattern, unmodified. if not fnmatch.fnmatch(base_name, file_pattern): if full_in_path != full_out_path: shutil.copyfile(full_in_path, full_out_path) continue with open(full_in_path, 'rb') as f: content = f.read().decode('utf-8') content = reference_resolver.replace_references(content, relative_path_to_root) with open(full_out_path, 'wb') as f: f.write(six.ensure_binary(content, 'utf-8')) class DocGenerator(object): """Main entry point for generating docs.""" def __init__(self): self.argument_parser = argparse.ArgumentParser() self._py_modules = None self._private_map = _get_default_private_map() self._do_not_descend_map = _get_default_do_not_descend_map() self.yaml_toc = True self.argument_parser.add_argument( '--no_search_hints', dest='search_hints', action='store_false', default=True) self.argument_parser.add_argument( '--site_api_path', type=str, default='api_docs/python', help='The path from the site-root to api_docs' 'directory for this project') self.argument_parser.add_argument( '--api_cache_out_path', type=str, default=None, help='Path to store a json-serialized api-index, so links can be ' 'inserted into docs without rebuilding the api_docs') def add_output_dir_argument(self): self.argument_parser.add_argument( '--output_dir', type=str, default=None, required=True, help='Directory to write docs to.') def add_src_dir_argument(self): self.argument_parser.add_argument( '--src_dir', type=str, default=tempfile.mkdtemp(), required=False, help='Optional directory of source docs to add api_docs links to') def add_base_dir_argument(self, default_base_dir): self.argument_parser.add_argument( '--base_dir', type=str, default=default_base_dir, help='Base directory to strip from file names referenced in docs.') def parse_known_args(self): flags, _ = self.argument_parser.parse_known_args() return flags def add_to_private_map(self, d): add_dict_to_dict(d, self._private_map) def add_to_do_not_descend_map(self, d): add_dict_to_dict(d, self._do_not_descend_map) def set_private_map(self, d): self._private_map = d def set_do_not_descend_map(self, d): self._do_not_descend_map = d def set_py_modules(self, py_modules): self._py_modules = py_modules def py_module_names(self): if self._py_modules is None: raise RuntimeError( 'Must call set_py_modules() before running py_module_names().') return [name for (name, _) in self._py_modules] def make_reference_resolver(self, visitor, doc_index): return parser.ReferenceResolver.from_visitor( visitor, doc_index, py_module_names=self.py_module_names()) def make_parser_config(self, visitor, reference_resolver, guide_index, base_dir): return parser.ParserConfig( reference_resolver=reference_resolver, duplicates=visitor.duplicates, duplicate_of=visitor.duplicate_of, tree=visitor.tree, index=visitor.index, reverse_index=visitor.reverse_index, guide_index=guide_index, base_dir=base_dir) def run_extraction(self): return extract(self._py_modules, self._private_map, self._do_not_descend_map) def build(self, flags): """Build all the docs. This produces two outputs python api docs: * generated from modules set with `set_py_modules`. * written to '{FLAGS.output_dir}/api_docs/python/' non-api docs: * Everything in '{FLAGS.src_dir}' is copied to '{FLAGS.output_dir}'. * '@{}' references in '.md' files are replaced with links. * '.md' files under 'api_guides/python' have explicit ids set for their second level headings. Args: flags: * src_dir: Where to fetch the non-api-docs. * base_dir: Base of the docs directory (Used to build correct relative links). * output_dir: Where to write the resulting docs. Returns: The number of errors encountered while processing. """ # Extract the python api from the _py_modules doc_index = build_doc_index(flags.src_dir) visitor = self.run_extraction() reference_resolver = self.make_reference_resolver(visitor, doc_index) if getattr(flags, 'api_cache_out_path', None): reference_resolver.to_json_file(flags.api_cache_out_path) # Build the guide_index for the api_docs back links. root_title = getattr(flags, 'root_title', 'TensorFlow') guide_index = _build_guide_index( os.path.join(flags.src_dir, 'api_guides/python')) # Write the api docs. parser_config = self.make_parser_config(visitor, reference_resolver, guide_index, flags.base_dir) output_dir = os.path.join(flags.output_dir, 'api_docs/python') write_docs( output_dir, parser_config, yaml_toc=self.yaml_toc, root_title=root_title, search_hints=getattr(flags, 'search_hints', True), site_api_path=getattr(flags, 'site_api_path', '')) # Replace all the @{} references in files under `FLAGS.src_dir` replace_refs(flags.src_dir, flags.output_dir, reference_resolver, '*.md') # Fix the tags in the guide dir. guide_dir = os.path.join(flags.output_dir, 'api_guides/python') if os.path.exists(guide_dir): update_id_tags_inplace(guide_dir) # Report all errors found by the reference resolver, and return the error # code. parser_config.reference_resolver.log_errors() return parser_config.reference_resolver.num_errors()
apache-2.0
Mevlock/xbmc
lib/gtest/test/gtest_env_var_test.py
184
3546
#!/usr/bin/env python # # Copyright 2008, Google Inc. # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: # # * Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the above # copyright notice, this list of conditions and the following disclaimer # in the documentation and/or other materials provided with the # distribution. # * Neither the name of Google Inc. nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. """Verifies that Google Test correctly parses environment variables.""" __author__ = 'wan@google.com (Zhanyong Wan)' import os import gtest_test_utils IS_WINDOWS = os.name == 'nt' IS_LINUX = os.name == 'posix' and os.uname()[0] == 'Linux' COMMAND = gtest_test_utils.GetTestExecutablePath('gtest_env_var_test_') environ = os.environ.copy() def AssertEq(expected, actual): if expected != actual: print 'Expected: %s' % (expected,) print ' Actual: %s' % (actual,) raise AssertionError def SetEnvVar(env_var, value): """Sets the env variable to 'value'; unsets it when 'value' is None.""" if value is not None: environ[env_var] = value elif env_var in environ: del environ[env_var] def GetFlag(flag): """Runs gtest_env_var_test_ and returns its output.""" args = [COMMAND] if flag is not None: args += [flag] return gtest_test_utils.Subprocess(args, env=environ, capture_stderr=False).output def TestFlag(flag, test_val, default_val): """Verifies that the given flag is affected by the corresponding env var.""" env_var = 'GTEST_' + flag.upper() SetEnvVar(env_var, test_val) AssertEq(test_val, GetFlag(flag)) SetEnvVar(env_var, None) AssertEq(default_val, GetFlag(flag)) class GTestEnvVarTest(gtest_test_utils.TestCase): def testEnvVarAffectsFlag(self): """Tests that environment variable should affect the corresponding flag.""" TestFlag('break_on_failure', '1', '0') TestFlag('color', 'yes', 'auto') TestFlag('filter', 'FooTest.Bar', '*') TestFlag('output', 'xml:tmp/foo.xml', '') TestFlag('print_time', '0', '1') TestFlag('repeat', '999', '1') TestFlag('throw_on_failure', '1', '0') TestFlag('death_test_style', 'threadsafe', 'fast') TestFlag('catch_exceptions', '0', '1') if IS_LINUX: TestFlag('death_test_use_fork', '1', '0') TestFlag('stack_trace_depth', '0', '100') if __name__ == '__main__': gtest_test_utils.Main()
gpl-2.0
sudiptpa/google-diff-match-patch
python2/diff_match_patch_test.py
319
41744
#!/usr/bin/python2.4 """Test harness for diff_match_patch.py Copyright 2006 Google Inc. http://code.google.com/p/google-diff-match-patch/ Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ import sys import time import unittest import diff_match_patch as dmp_module # Force a module reload. Allows one to edit the DMP module and rerun the tests # without leaving the Python interpreter. reload(dmp_module) class DiffMatchPatchTest(unittest.TestCase): def setUp(self): "Test harness for dmp_module." self.dmp = dmp_module.diff_match_patch() def diff_rebuildtexts(self, diffs): # Construct the two texts which made up the diff originally. text1 = "" text2 = "" for x in range(0, len(diffs)): if diffs[x][0] != dmp_module.diff_match_patch.DIFF_INSERT: text1 += diffs[x][1] if diffs[x][0] != dmp_module.diff_match_patch.DIFF_DELETE: text2 += diffs[x][1] return (text1, text2) class DiffTest(DiffMatchPatchTest): """DIFF TEST FUNCTIONS""" def testDiffCommonPrefix(self): # Detect any common prefix. # Null case. self.assertEquals(0, self.dmp.diff_commonPrefix("abc", "xyz")) # Non-null case. self.assertEquals(4, self.dmp.diff_commonPrefix("1234abcdef", "1234xyz")) # Whole case. self.assertEquals(4, self.dmp.diff_commonPrefix("1234", "1234xyz")) def testDiffCommonSuffix(self): # Detect any common suffix. # Null case. self.assertEquals(0, self.dmp.diff_commonSuffix("abc", "xyz")) # Non-null case. self.assertEquals(4, self.dmp.diff_commonSuffix("abcdef1234", "xyz1234")) # Whole case. self.assertEquals(4, self.dmp.diff_commonSuffix("1234", "xyz1234")) def testDiffCommonOverlap(self): # Null case. self.assertEquals(0, self.dmp.diff_commonOverlap("", "abcd")) # Whole case. self.assertEquals(3, self.dmp.diff_commonOverlap("abc", "abcd")) # No overlap. self.assertEquals(0, self.dmp.diff_commonOverlap("123456", "abcd")) # Overlap. self.assertEquals(3, self.dmp.diff_commonOverlap("123456xxx", "xxxabcd")) # Unicode. # Some overly clever languages (C#) may treat ligatures as equal to their # component letters. E.g. U+FB01 == 'fi' self.assertEquals(0, self.dmp.diff_commonOverlap("fi", u"\ufb01i")) def testDiffHalfMatch(self): # Detect a halfmatch. self.dmp.Diff_Timeout = 1 # No match. self.assertEquals(None, self.dmp.diff_halfMatch("1234567890", "abcdef")) self.assertEquals(None, self.dmp.diff_halfMatch("12345", "23")) # Single Match. self.assertEquals(("12", "90", "a", "z", "345678"), self.dmp.diff_halfMatch("1234567890", "a345678z")) self.assertEquals(("a", "z", "12", "90", "345678"), self.dmp.diff_halfMatch("a345678z", "1234567890")) self.assertEquals(("abc", "z", "1234", "0", "56789"), self.dmp.diff_halfMatch("abc56789z", "1234567890")) self.assertEquals(("a", "xyz", "1", "7890", "23456"), self.dmp.diff_halfMatch("a23456xyz", "1234567890")) # Multiple Matches. self.assertEquals(("12123", "123121", "a", "z", "1234123451234"), self.dmp.diff_halfMatch("121231234123451234123121", "a1234123451234z")) self.assertEquals(("", "-=-=-=-=-=", "x", "", "x-=-=-=-=-=-=-="), self.dmp.diff_halfMatch("x-=-=-=-=-=-=-=-=-=-=-=-=", "xx-=-=-=-=-=-=-=")) self.assertEquals(("-=-=-=-=-=", "", "", "y", "-=-=-=-=-=-=-=y"), self.dmp.diff_halfMatch("-=-=-=-=-=-=-=-=-=-=-=-=y", "-=-=-=-=-=-=-=yy")) # Non-optimal halfmatch. # Optimal diff would be -q+x=H-i+e=lloHe+Hu=llo-Hew+y not -qHillo+x=HelloHe-w+Hulloy self.assertEquals(("qHillo", "w", "x", "Hulloy", "HelloHe"), self.dmp.diff_halfMatch("qHilloHelloHew", "xHelloHeHulloy")) # Optimal no halfmatch. self.dmp.Diff_Timeout = 0 self.assertEquals(None, self.dmp.diff_halfMatch("qHilloHelloHew", "xHelloHeHulloy")) def testDiffLinesToChars(self): # Convert lines down to characters. self.assertEquals(("\x01\x02\x01", "\x02\x01\x02", ["", "alpha\n", "beta\n"]), self.dmp.diff_linesToChars("alpha\nbeta\nalpha\n", "beta\nalpha\nbeta\n")) self.assertEquals(("", "\x01\x02\x03\x03", ["", "alpha\r\n", "beta\r\n", "\r\n"]), self.dmp.diff_linesToChars("", "alpha\r\nbeta\r\n\r\n\r\n")) self.assertEquals(("\x01", "\x02", ["", "a", "b"]), self.dmp.diff_linesToChars("a", "b")) # More than 256 to reveal any 8-bit limitations. n = 300 lineList = [] charList = [] for x in range(1, n + 1): lineList.append(str(x) + "\n") charList.append(unichr(x)) self.assertEquals(n, len(lineList)) lines = "".join(lineList) chars = "".join(charList) self.assertEquals(n, len(chars)) lineList.insert(0, "") self.assertEquals((chars, "", lineList), self.dmp.diff_linesToChars(lines, "")) def testDiffCharsToLines(self): # Convert chars up to lines. diffs = [(self.dmp.DIFF_EQUAL, "\x01\x02\x01"), (self.dmp.DIFF_INSERT, "\x02\x01\x02")] self.dmp.diff_charsToLines(diffs, ["", "alpha\n", "beta\n"]) self.assertEquals([(self.dmp.DIFF_EQUAL, "alpha\nbeta\nalpha\n"), (self.dmp.DIFF_INSERT, "beta\nalpha\nbeta\n")], diffs) # More than 256 to reveal any 8-bit limitations. n = 300 lineList = [] charList = [] for x in range(1, n + 1): lineList.append(str(x) + "\n") charList.append(unichr(x)) self.assertEquals(n, len(lineList)) lines = "".join(lineList) chars = "".join(charList) self.assertEquals(n, len(chars)) lineList.insert(0, "") diffs = [(self.dmp.DIFF_DELETE, chars)] self.dmp.diff_charsToLines(diffs, lineList) self.assertEquals([(self.dmp.DIFF_DELETE, lines)], diffs) def testDiffCleanupMerge(self): # Cleanup a messy diff. # Null case. diffs = [] self.dmp.diff_cleanupMerge(diffs) self.assertEquals([], diffs) # No change case. diffs = [(self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_DELETE, "b"), (self.dmp.DIFF_INSERT, "c")] self.dmp.diff_cleanupMerge(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_DELETE, "b"), (self.dmp.DIFF_INSERT, "c")], diffs) # Merge equalities. diffs = [(self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_EQUAL, "b"), (self.dmp.DIFF_EQUAL, "c")] self.dmp.diff_cleanupMerge(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "abc")], diffs) # Merge deletions. diffs = [(self.dmp.DIFF_DELETE, "a"), (self.dmp.DIFF_DELETE, "b"), (self.dmp.DIFF_DELETE, "c")] self.dmp.diff_cleanupMerge(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "abc")], diffs) # Merge insertions. diffs = [(self.dmp.DIFF_INSERT, "a"), (self.dmp.DIFF_INSERT, "b"), (self.dmp.DIFF_INSERT, "c")] self.dmp.diff_cleanupMerge(diffs) self.assertEquals([(self.dmp.DIFF_INSERT, "abc")], diffs) # Merge interweave. diffs = [(self.dmp.DIFF_DELETE, "a"), (self.dmp.DIFF_INSERT, "b"), (self.dmp.DIFF_DELETE, "c"), (self.dmp.DIFF_INSERT, "d"), (self.dmp.DIFF_EQUAL, "e"), (self.dmp.DIFF_EQUAL, "f")] self.dmp.diff_cleanupMerge(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "ac"), (self.dmp.DIFF_INSERT, "bd"), (self.dmp.DIFF_EQUAL, "ef")], diffs) # Prefix and suffix detection. diffs = [(self.dmp.DIFF_DELETE, "a"), (self.dmp.DIFF_INSERT, "abc"), (self.dmp.DIFF_DELETE, "dc")] self.dmp.diff_cleanupMerge(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_DELETE, "d"), (self.dmp.DIFF_INSERT, "b"), (self.dmp.DIFF_EQUAL, "c")], diffs) # Prefix and suffix detection with equalities. diffs = [(self.dmp.DIFF_EQUAL, "x"), (self.dmp.DIFF_DELETE, "a"), (self.dmp.DIFF_INSERT, "abc"), (self.dmp.DIFF_DELETE, "dc"), (self.dmp.DIFF_EQUAL, "y")] self.dmp.diff_cleanupMerge(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "xa"), (self.dmp.DIFF_DELETE, "d"), (self.dmp.DIFF_INSERT, "b"), (self.dmp.DIFF_EQUAL, "cy")], diffs) # Slide edit left. diffs = [(self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_INSERT, "ba"), (self.dmp.DIFF_EQUAL, "c")] self.dmp.diff_cleanupMerge(diffs) self.assertEquals([(self.dmp.DIFF_INSERT, "ab"), (self.dmp.DIFF_EQUAL, "ac")], diffs) # Slide edit right. diffs = [(self.dmp.DIFF_EQUAL, "c"), (self.dmp.DIFF_INSERT, "ab"), (self.dmp.DIFF_EQUAL, "a")] self.dmp.diff_cleanupMerge(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "ca"), (self.dmp.DIFF_INSERT, "ba")], diffs) # Slide edit left recursive. diffs = [(self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_DELETE, "b"), (self.dmp.DIFF_EQUAL, "c"), (self.dmp.DIFF_DELETE, "ac"), (self.dmp.DIFF_EQUAL, "x")] self.dmp.diff_cleanupMerge(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "abc"), (self.dmp.DIFF_EQUAL, "acx")], diffs) # Slide edit right recursive. diffs = [(self.dmp.DIFF_EQUAL, "x"), (self.dmp.DIFF_DELETE, "ca"), (self.dmp.DIFF_EQUAL, "c"), (self.dmp.DIFF_DELETE, "b"), (self.dmp.DIFF_EQUAL, "a")] self.dmp.diff_cleanupMerge(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "xca"), (self.dmp.DIFF_DELETE, "cba")], diffs) def testDiffCleanupSemanticLossless(self): # Slide diffs to match logical boundaries. # Null case. diffs = [] self.dmp.diff_cleanupSemanticLossless(diffs) self.assertEquals([], diffs) # Blank lines. diffs = [(self.dmp.DIFF_EQUAL, "AAA\r\n\r\nBBB"), (self.dmp.DIFF_INSERT, "\r\nDDD\r\n\r\nBBB"), (self.dmp.DIFF_EQUAL, "\r\nEEE")] self.dmp.diff_cleanupSemanticLossless(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "AAA\r\n\r\n"), (self.dmp.DIFF_INSERT, "BBB\r\nDDD\r\n\r\n"), (self.dmp.DIFF_EQUAL, "BBB\r\nEEE")], diffs) # Line boundaries. diffs = [(self.dmp.DIFF_EQUAL, "AAA\r\nBBB"), (self.dmp.DIFF_INSERT, " DDD\r\nBBB"), (self.dmp.DIFF_EQUAL, " EEE")] self.dmp.diff_cleanupSemanticLossless(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "AAA\r\n"), (self.dmp.DIFF_INSERT, "BBB DDD\r\n"), (self.dmp.DIFF_EQUAL, "BBB EEE")], diffs) # Word boundaries. diffs = [(self.dmp.DIFF_EQUAL, "The c"), (self.dmp.DIFF_INSERT, "ow and the c"), (self.dmp.DIFF_EQUAL, "at.")] self.dmp.diff_cleanupSemanticLossless(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "The "), (self.dmp.DIFF_INSERT, "cow and the "), (self.dmp.DIFF_EQUAL, "cat.")], diffs) # Alphanumeric boundaries. diffs = [(self.dmp.DIFF_EQUAL, "The-c"), (self.dmp.DIFF_INSERT, "ow-and-the-c"), (self.dmp.DIFF_EQUAL, "at.")] self.dmp.diff_cleanupSemanticLossless(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "The-"), (self.dmp.DIFF_INSERT, "cow-and-the-"), (self.dmp.DIFF_EQUAL, "cat.")], diffs) # Hitting the start. diffs = [(self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_DELETE, "a"), (self.dmp.DIFF_EQUAL, "ax")] self.dmp.diff_cleanupSemanticLossless(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "a"), (self.dmp.DIFF_EQUAL, "aax")], diffs) # Hitting the end. diffs = [(self.dmp.DIFF_EQUAL, "xa"), (self.dmp.DIFF_DELETE, "a"), (self.dmp.DIFF_EQUAL, "a")] self.dmp.diff_cleanupSemanticLossless(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "xaa"), (self.dmp.DIFF_DELETE, "a")], diffs) # Sentence boundaries. diffs = [(self.dmp.DIFF_EQUAL, "The xxx. The "), (self.dmp.DIFF_INSERT, "zzz. The "), (self.dmp.DIFF_EQUAL, "yyy.")] self.dmp.diff_cleanupSemanticLossless(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "The xxx."), (self.dmp.DIFF_INSERT, " The zzz."), (self.dmp.DIFF_EQUAL, " The yyy.")], diffs) def testDiffCleanupSemantic(self): # Cleanup semantically trivial equalities. # Null case. diffs = [] self.dmp.diff_cleanupSemantic(diffs) self.assertEquals([], diffs) # No elimination #1. diffs = [(self.dmp.DIFF_DELETE, "ab"), (self.dmp.DIFF_INSERT, "cd"), (self.dmp.DIFF_EQUAL, "12"), (self.dmp.DIFF_DELETE, "e")] self.dmp.diff_cleanupSemantic(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "ab"), (self.dmp.DIFF_INSERT, "cd"), (self.dmp.DIFF_EQUAL, "12"), (self.dmp.DIFF_DELETE, "e")], diffs) # No elimination #2. diffs = [(self.dmp.DIFF_DELETE, "abc"), (self.dmp.DIFF_INSERT, "ABC"), (self.dmp.DIFF_EQUAL, "1234"), (self.dmp.DIFF_DELETE, "wxyz")] self.dmp.diff_cleanupSemantic(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "abc"), (self.dmp.DIFF_INSERT, "ABC"), (self.dmp.DIFF_EQUAL, "1234"), (self.dmp.DIFF_DELETE, "wxyz")], diffs) # Simple elimination. diffs = [(self.dmp.DIFF_DELETE, "a"), (self.dmp.DIFF_EQUAL, "b"), (self.dmp.DIFF_DELETE, "c")] self.dmp.diff_cleanupSemantic(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "abc"), (self.dmp.DIFF_INSERT, "b")], diffs) # Backpass elimination. diffs = [(self.dmp.DIFF_DELETE, "ab"), (self.dmp.DIFF_EQUAL, "cd"), (self.dmp.DIFF_DELETE, "e"), (self.dmp.DIFF_EQUAL, "f"), (self.dmp.DIFF_INSERT, "g")] self.dmp.diff_cleanupSemantic(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "abcdef"), (self.dmp.DIFF_INSERT, "cdfg")], diffs) # Multiple eliminations. diffs = [(self.dmp.DIFF_INSERT, "1"), (self.dmp.DIFF_EQUAL, "A"), (self.dmp.DIFF_DELETE, "B"), (self.dmp.DIFF_INSERT, "2"), (self.dmp.DIFF_EQUAL, "_"), (self.dmp.DIFF_INSERT, "1"), (self.dmp.DIFF_EQUAL, "A"), (self.dmp.DIFF_DELETE, "B"), (self.dmp.DIFF_INSERT, "2")] self.dmp.diff_cleanupSemantic(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "AB_AB"), (self.dmp.DIFF_INSERT, "1A2_1A2")], diffs) # Word boundaries. diffs = [(self.dmp.DIFF_EQUAL, "The c"), (self.dmp.DIFF_DELETE, "ow and the c"), (self.dmp.DIFF_EQUAL, "at.")] self.dmp.diff_cleanupSemantic(diffs) self.assertEquals([(self.dmp.DIFF_EQUAL, "The "), (self.dmp.DIFF_DELETE, "cow and the "), (self.dmp.DIFF_EQUAL, "cat.")], diffs) # No overlap elimination. diffs = [(self.dmp.DIFF_DELETE, "abcxx"), (self.dmp.DIFF_INSERT, "xxdef")] self.dmp.diff_cleanupSemantic(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "abcxx"), (self.dmp.DIFF_INSERT, "xxdef")], diffs) # Overlap elimination. diffs = [(self.dmp.DIFF_DELETE, "abcxxx"), (self.dmp.DIFF_INSERT, "xxxdef")] self.dmp.diff_cleanupSemantic(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "abc"), (self.dmp.DIFF_EQUAL, "xxx"), (self.dmp.DIFF_INSERT, "def")], diffs) # Reverse overlap elimination. diffs = [(self.dmp.DIFF_DELETE, "xxxabc"), (self.dmp.DIFF_INSERT, "defxxx")] self.dmp.diff_cleanupSemantic(diffs) self.assertEquals([(self.dmp.DIFF_INSERT, "def"), (self.dmp.DIFF_EQUAL, "xxx"), (self.dmp.DIFF_DELETE, "abc")], diffs) # Two overlap eliminations. diffs = [(self.dmp.DIFF_DELETE, "abcd1212"), (self.dmp.DIFF_INSERT, "1212efghi"), (self.dmp.DIFF_EQUAL, "----"), (self.dmp.DIFF_DELETE, "A3"), (self.dmp.DIFF_INSERT, "3BC")] self.dmp.diff_cleanupSemantic(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "abcd"), (self.dmp.DIFF_EQUAL, "1212"), (self.dmp.DIFF_INSERT, "efghi"), (self.dmp.DIFF_EQUAL, "----"), (self.dmp.DIFF_DELETE, "A"), (self.dmp.DIFF_EQUAL, "3"), (self.dmp.DIFF_INSERT, "BC")], diffs) def testDiffCleanupEfficiency(self): # Cleanup operationally trivial equalities. self.dmp.Diff_EditCost = 4 # Null case. diffs = [] self.dmp.diff_cleanupEfficiency(diffs) self.assertEquals([], diffs) # No elimination. diffs = [(self.dmp.DIFF_DELETE, "ab"), (self.dmp.DIFF_INSERT, "12"), (self.dmp.DIFF_EQUAL, "wxyz"), (self.dmp.DIFF_DELETE, "cd"), (self.dmp.DIFF_INSERT, "34")] self.dmp.diff_cleanupEfficiency(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "ab"), (self.dmp.DIFF_INSERT, "12"), (self.dmp.DIFF_EQUAL, "wxyz"), (self.dmp.DIFF_DELETE, "cd"), (self.dmp.DIFF_INSERT, "34")], diffs) # Four-edit elimination. diffs = [(self.dmp.DIFF_DELETE, "ab"), (self.dmp.DIFF_INSERT, "12"), (self.dmp.DIFF_EQUAL, "xyz"), (self.dmp.DIFF_DELETE, "cd"), (self.dmp.DIFF_INSERT, "34")] self.dmp.diff_cleanupEfficiency(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "abxyzcd"), (self.dmp.DIFF_INSERT, "12xyz34")], diffs) # Three-edit elimination. diffs = [(self.dmp.DIFF_INSERT, "12"), (self.dmp.DIFF_EQUAL, "x"), (self.dmp.DIFF_DELETE, "cd"), (self.dmp.DIFF_INSERT, "34")] self.dmp.diff_cleanupEfficiency(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "xcd"), (self.dmp.DIFF_INSERT, "12x34")], diffs) # Backpass elimination. diffs = [(self.dmp.DIFF_DELETE, "ab"), (self.dmp.DIFF_INSERT, "12"), (self.dmp.DIFF_EQUAL, "xy"), (self.dmp.DIFF_INSERT, "34"), (self.dmp.DIFF_EQUAL, "z"), (self.dmp.DIFF_DELETE, "cd"), (self.dmp.DIFF_INSERT, "56")] self.dmp.diff_cleanupEfficiency(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "abxyzcd"), (self.dmp.DIFF_INSERT, "12xy34z56")], diffs) # High cost elimination. self.dmp.Diff_EditCost = 5 diffs = [(self.dmp.DIFF_DELETE, "ab"), (self.dmp.DIFF_INSERT, "12"), (self.dmp.DIFF_EQUAL, "wxyz"), (self.dmp.DIFF_DELETE, "cd"), (self.dmp.DIFF_INSERT, "34")] self.dmp.diff_cleanupEfficiency(diffs) self.assertEquals([(self.dmp.DIFF_DELETE, "abwxyzcd"), (self.dmp.DIFF_INSERT, "12wxyz34")], diffs) self.dmp.Diff_EditCost = 4 def testDiffPrettyHtml(self): # Pretty print. diffs = [(self.dmp.DIFF_EQUAL, "a\n"), (self.dmp.DIFF_DELETE, "<B>b</B>"), (self.dmp.DIFF_INSERT, "c&d")] self.assertEquals("<span>a&para;<br></span><del style=\"background:#ffe6e6;\">&lt;B&gt;b&lt;/B&gt;</del><ins style=\"background:#e6ffe6;\">c&amp;d</ins>", self.dmp.diff_prettyHtml(diffs)) def testDiffText(self): # Compute the source and destination texts. diffs = [(self.dmp.DIFF_EQUAL, "jump"), (self.dmp.DIFF_DELETE, "s"), (self.dmp.DIFF_INSERT, "ed"), (self.dmp.DIFF_EQUAL, " over "), (self.dmp.DIFF_DELETE, "the"), (self.dmp.DIFF_INSERT, "a"), (self.dmp.DIFF_EQUAL, " lazy")] self.assertEquals("jumps over the lazy", self.dmp.diff_text1(diffs)) self.assertEquals("jumped over a lazy", self.dmp.diff_text2(diffs)) def testDiffDelta(self): # Convert a diff into delta string. diffs = [(self.dmp.DIFF_EQUAL, "jump"), (self.dmp.DIFF_DELETE, "s"), (self.dmp.DIFF_INSERT, "ed"), (self.dmp.DIFF_EQUAL, " over "), (self.dmp.DIFF_DELETE, "the"), (self.dmp.DIFF_INSERT, "a"), (self.dmp.DIFF_EQUAL, " lazy"), (self.dmp.DIFF_INSERT, "old dog")] text1 = self.dmp.diff_text1(diffs) self.assertEquals("jumps over the lazy", text1) delta = self.dmp.diff_toDelta(diffs) self.assertEquals("=4\t-1\t+ed\t=6\t-3\t+a\t=5\t+old dog", delta) # Convert delta string into a diff. self.assertEquals(diffs, self.dmp.diff_fromDelta(text1, delta)) # Generates error (19 != 20). try: self.dmp.diff_fromDelta(text1 + "x", delta) self.assertFalse(True) except ValueError: # Exception expected. pass # Generates error (19 != 18). try: self.dmp.diff_fromDelta(text1[1:], delta) self.assertFalse(True) except ValueError: # Exception expected. pass # Generates error (%c3%xy invalid Unicode). try: self.dmp.diff_fromDelta("", "+%c3xy") self.assertFalse(True) except ValueError: # Exception expected. pass # Test deltas with special characters. diffs = [(self.dmp.DIFF_EQUAL, u"\u0680 \x00 \t %"), (self.dmp.DIFF_DELETE, u"\u0681 \x01 \n ^"), (self.dmp.DIFF_INSERT, u"\u0682 \x02 \\ |")] text1 = self.dmp.diff_text1(diffs) self.assertEquals(u"\u0680 \x00 \t %\u0681 \x01 \n ^", text1) delta = self.dmp.diff_toDelta(diffs) self.assertEquals("=7\t-7\t+%DA%82 %02 %5C %7C", delta) # Convert delta string into a diff. self.assertEquals(diffs, self.dmp.diff_fromDelta(text1, delta)) # Verify pool of unchanged characters. diffs = [(self.dmp.DIFF_INSERT, "A-Z a-z 0-9 - _ . ! ~ * ' ( ) ; / ? : @ & = + $ , # ")] text2 = self.dmp.diff_text2(diffs) self.assertEquals("A-Z a-z 0-9 - _ . ! ~ * \' ( ) ; / ? : @ & = + $ , # ", text2) delta = self.dmp.diff_toDelta(diffs) self.assertEquals("+A-Z a-z 0-9 - _ . ! ~ * \' ( ) ; / ? : @ & = + $ , # ", delta) # Convert delta string into a diff. self.assertEquals(diffs, self.dmp.diff_fromDelta("", delta)) def testDiffXIndex(self): # Translate a location in text1 to text2. self.assertEquals(5, self.dmp.diff_xIndex([(self.dmp.DIFF_DELETE, "a"), (self.dmp.DIFF_INSERT, "1234"), (self.dmp.DIFF_EQUAL, "xyz")], 2)) # Translation on deletion. self.assertEquals(1, self.dmp.diff_xIndex([(self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_DELETE, "1234"), (self.dmp.DIFF_EQUAL, "xyz")], 3)) def testDiffLevenshtein(self): # Levenshtein with trailing equality. self.assertEquals(4, self.dmp.diff_levenshtein([(self.dmp.DIFF_DELETE, "abc"), (self.dmp.DIFF_INSERT, "1234"), (self.dmp.DIFF_EQUAL, "xyz")])) # Levenshtein with leading equality. self.assertEquals(4, self.dmp.diff_levenshtein([(self.dmp.DIFF_EQUAL, "xyz"), (self.dmp.DIFF_DELETE, "abc"), (self.dmp.DIFF_INSERT, "1234")])) # Levenshtein with middle equality. self.assertEquals(7, self.dmp.diff_levenshtein([(self.dmp.DIFF_DELETE, "abc"), (self.dmp.DIFF_EQUAL, "xyz"), (self.dmp.DIFF_INSERT, "1234")])) def testDiffBisect(self): # Normal. a = "cat" b = "map" # Since the resulting diff hasn't been normalized, it would be ok if # the insertion and deletion pairs are swapped. # If the order changes, tweak this test as required. self.assertEquals([(self.dmp.DIFF_DELETE, "c"), (self.dmp.DIFF_INSERT, "m"), (self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_DELETE, "t"), (self.dmp.DIFF_INSERT, "p")], self.dmp.diff_bisect(a, b, sys.maxint)) # Timeout. self.assertEquals([(self.dmp.DIFF_DELETE, "cat"), (self.dmp.DIFF_INSERT, "map")], self.dmp.diff_bisect(a, b, 0)) def testDiffMain(self): # Perform a trivial diff. # Null case. self.assertEquals([], self.dmp.diff_main("", "", False)) # Equality. self.assertEquals([(self.dmp.DIFF_EQUAL, "abc")], self.dmp.diff_main("abc", "abc", False)) # Simple insertion. self.assertEquals([(self.dmp.DIFF_EQUAL, "ab"), (self.dmp.DIFF_INSERT, "123"), (self.dmp.DIFF_EQUAL, "c")], self.dmp.diff_main("abc", "ab123c", False)) # Simple deletion. self.assertEquals([(self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_DELETE, "123"), (self.dmp.DIFF_EQUAL, "bc")], self.dmp.diff_main("a123bc", "abc", False)) # Two insertions. self.assertEquals([(self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_INSERT, "123"), (self.dmp.DIFF_EQUAL, "b"), (self.dmp.DIFF_INSERT, "456"), (self.dmp.DIFF_EQUAL, "c")], self.dmp.diff_main("abc", "a123b456c", False)) # Two deletions. self.assertEquals([(self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_DELETE, "123"), (self.dmp.DIFF_EQUAL, "b"), (self.dmp.DIFF_DELETE, "456"), (self.dmp.DIFF_EQUAL, "c")], self.dmp.diff_main("a123b456c", "abc", False)) # Perform a real diff. # Switch off the timeout. self.dmp.Diff_Timeout = 0 # Simple cases. self.assertEquals([(self.dmp.DIFF_DELETE, "a"), (self.dmp.DIFF_INSERT, "b")], self.dmp.diff_main("a", "b", False)) self.assertEquals([(self.dmp.DIFF_DELETE, "Apple"), (self.dmp.DIFF_INSERT, "Banana"), (self.dmp.DIFF_EQUAL, "s are a"), (self.dmp.DIFF_INSERT, "lso"), (self.dmp.DIFF_EQUAL, " fruit.")], self.dmp.diff_main("Apples are a fruit.", "Bananas are also fruit.", False)) self.assertEquals([(self.dmp.DIFF_DELETE, "a"), (self.dmp.DIFF_INSERT, u"\u0680"), (self.dmp.DIFF_EQUAL, "x"), (self.dmp.DIFF_DELETE, "\t"), (self.dmp.DIFF_INSERT, "\x00")], self.dmp.diff_main("ax\t", u"\u0680x\x00", False)) # Overlaps. self.assertEquals([(self.dmp.DIFF_DELETE, "1"), (self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_DELETE, "y"), (self.dmp.DIFF_EQUAL, "b"), (self.dmp.DIFF_DELETE, "2"), (self.dmp.DIFF_INSERT, "xab")], self.dmp.diff_main("1ayb2", "abxab", False)) self.assertEquals([(self.dmp.DIFF_INSERT, "xaxcx"), (self.dmp.DIFF_EQUAL, "abc"), (self.dmp.DIFF_DELETE, "y")], self.dmp.diff_main("abcy", "xaxcxabc", False)) self.assertEquals([(self.dmp.DIFF_DELETE, "ABCD"), (self.dmp.DIFF_EQUAL, "a"), (self.dmp.DIFF_DELETE, "="), (self.dmp.DIFF_INSERT, "-"), (self.dmp.DIFF_EQUAL, "bcd"), (self.dmp.DIFF_DELETE, "="), (self.dmp.DIFF_INSERT, "-"), (self.dmp.DIFF_EQUAL, "efghijklmnopqrs"), (self.dmp.DIFF_DELETE, "EFGHIJKLMNOefg")], self.dmp.diff_main("ABCDa=bcd=efghijklmnopqrsEFGHIJKLMNOefg", "a-bcd-efghijklmnopqrs", False)) # Large equality. self.assertEquals([(self.dmp.DIFF_INSERT, " "), (self.dmp.DIFF_EQUAL,"a"), (self.dmp.DIFF_INSERT,"nd"), (self.dmp.DIFF_EQUAL," [[Pennsylvania]]"), (self.dmp.DIFF_DELETE," and [[New")], self.dmp.diff_main("a [[Pennsylvania]] and [[New", " and [[Pennsylvania]]", False)) # Timeout. self.dmp.Diff_Timeout = 0.1 # 100ms a = "`Twas brillig, and the slithy toves\nDid gyre and gimble in the wabe:\nAll mimsy were the borogoves,\nAnd the mome raths outgrabe.\n" b = "I am the very model of a modern major general,\nI've information vegetable, animal, and mineral,\nI know the kings of England, and I quote the fights historical,\nFrom Marathon to Waterloo, in order categorical.\n" # Increase the text lengths by 1024 times to ensure a timeout. for x in range(10): a = a + a b = b + b startTime = time.time() self.dmp.diff_main(a, b) endTime = time.time() # Test that we took at least the timeout period. self.assertTrue(self.dmp.Diff_Timeout <= endTime - startTime) # Test that we didn't take forever (be forgiving). # Theoretically this test could fail very occasionally if the # OS task swaps or locks up for a second at the wrong moment. self.assertTrue(self.dmp.Diff_Timeout * 2 > endTime - startTime) self.dmp.Diff_Timeout = 0 # Test the linemode speedup. # Must be long to pass the 100 char cutoff. # Simple line-mode. a = "1234567890\n" * 13 b = "abcdefghij\n" * 13 self.assertEquals(self.dmp.diff_main(a, b, False), self.dmp.diff_main(a, b, True)) # Single line-mode. a = "1234567890" * 13 b = "abcdefghij" * 13 self.assertEquals(self.dmp.diff_main(a, b, False), self.dmp.diff_main(a, b, True)) # Overlap line-mode. a = "1234567890\n" * 13 b = "abcdefghij\n1234567890\n1234567890\n1234567890\nabcdefghij\n1234567890\n1234567890\n1234567890\nabcdefghij\n1234567890\n1234567890\n1234567890\nabcdefghij\n" texts_linemode = self.diff_rebuildtexts(self.dmp.diff_main(a, b, True)) texts_textmode = self.diff_rebuildtexts(self.dmp.diff_main(a, b, False)) self.assertEquals(texts_textmode, texts_linemode) # Test null inputs. try: self.dmp.diff_main(None, None) self.assertFalse(True) except ValueError: # Exception expected. pass class MatchTest(DiffMatchPatchTest): """MATCH TEST FUNCTIONS""" def testMatchAlphabet(self): # Initialise the bitmasks for Bitap. self.assertEquals({"a":4, "b":2, "c":1}, self.dmp.match_alphabet("abc")) self.assertEquals({"a":37, "b":18, "c":8}, self.dmp.match_alphabet("abcaba")) def testMatchBitap(self): self.dmp.Match_Distance = 100 self.dmp.Match_Threshold = 0.5 # Exact matches. self.assertEquals(5, self.dmp.match_bitap("abcdefghijk", "fgh", 5)) self.assertEquals(5, self.dmp.match_bitap("abcdefghijk", "fgh", 0)) # Fuzzy matches. self.assertEquals(4, self.dmp.match_bitap("abcdefghijk", "efxhi", 0)) self.assertEquals(2, self.dmp.match_bitap("abcdefghijk", "cdefxyhijk", 5)) self.assertEquals(-1, self.dmp.match_bitap("abcdefghijk", "bxy", 1)) # Overflow. self.assertEquals(2, self.dmp.match_bitap("123456789xx0", "3456789x0", 2)) self.assertEquals(0, self.dmp.match_bitap("abcdef", "xxabc", 4)) self.assertEquals(3, self.dmp.match_bitap("abcdef", "defyy", 4)) self.assertEquals(0, self.dmp.match_bitap("abcdef", "xabcdefy", 0)) # Threshold test. self.dmp.Match_Threshold = 0.4 self.assertEquals(4, self.dmp.match_bitap("abcdefghijk", "efxyhi", 1)) self.dmp.Match_Threshold = 0.3 self.assertEquals(-1, self.dmp.match_bitap("abcdefghijk", "efxyhi", 1)) self.dmp.Match_Threshold = 0.0 self.assertEquals(1, self.dmp.match_bitap("abcdefghijk", "bcdef", 1)) self.dmp.Match_Threshold = 0.5 # Multiple select. self.assertEquals(0, self.dmp.match_bitap("abcdexyzabcde", "abccde", 3)) self.assertEquals(8, self.dmp.match_bitap("abcdexyzabcde", "abccde", 5)) # Distance test. self.dmp.Match_Distance = 10 # Strict location. self.assertEquals(-1, self.dmp.match_bitap("abcdefghijklmnopqrstuvwxyz", "abcdefg", 24)) self.assertEquals(0, self.dmp.match_bitap("abcdefghijklmnopqrstuvwxyz", "abcdxxefg", 1)) self.dmp.Match_Distance = 1000 # Loose location. self.assertEquals(0, self.dmp.match_bitap("abcdefghijklmnopqrstuvwxyz", "abcdefg", 24)) def testMatchMain(self): # Full match. # Shortcut matches. self.assertEquals(0, self.dmp.match_main("abcdef", "abcdef", 1000)) self.assertEquals(-1, self.dmp.match_main("", "abcdef", 1)) self.assertEquals(3, self.dmp.match_main("abcdef", "", 3)) self.assertEquals(3, self.dmp.match_main("abcdef", "de", 3)) self.assertEquals(3, self.dmp.match_main("abcdef", "defy", 4)) self.assertEquals(0, self.dmp.match_main("abcdef", "abcdefy", 0)) # Complex match. self.dmp.Match_Threshold = 0.7 self.assertEquals(4, self.dmp.match_main("I am the very model of a modern major general.", " that berry ", 5)) self.dmp.Match_Threshold = 0.5 # Test null inputs. try: self.dmp.match_main(None, None, 0) self.assertFalse(True) except ValueError: # Exception expected. pass class PatchTest(DiffMatchPatchTest): """PATCH TEST FUNCTIONS""" def testPatchObj(self): # Patch Object. p = dmp_module.patch_obj() p.start1 = 20 p.start2 = 21 p.length1 = 18 p.length2 = 17 p.diffs = [(self.dmp.DIFF_EQUAL, "jump"), (self.dmp.DIFF_DELETE, "s"), (self.dmp.DIFF_INSERT, "ed"), (self.dmp.DIFF_EQUAL, " over "), (self.dmp.DIFF_DELETE, "the"), (self.dmp.DIFF_INSERT, "a"), (self.dmp.DIFF_EQUAL, "\nlaz")] strp = str(p) self.assertEquals("@@ -21,18 +22,17 @@\n jump\n-s\n+ed\n over \n-the\n+a\n %0Alaz\n", strp) def testPatchFromText(self): self.assertEquals([], self.dmp.patch_fromText("")) strp = "@@ -21,18 +22,17 @@\n jump\n-s\n+ed\n over \n-the\n+a\n %0Alaz\n" self.assertEquals(strp, str(self.dmp.patch_fromText(strp)[0])) self.assertEquals("@@ -1 +1 @@\n-a\n+b\n", str(self.dmp.patch_fromText("@@ -1 +1 @@\n-a\n+b\n")[0])) self.assertEquals("@@ -1,3 +0,0 @@\n-abc\n", str(self.dmp.patch_fromText("@@ -1,3 +0,0 @@\n-abc\n")[0])) self.assertEquals("@@ -0,0 +1,3 @@\n+abc\n", str(self.dmp.patch_fromText("@@ -0,0 +1,3 @@\n+abc\n")[0])) # Generates error. try: self.dmp.patch_fromText("Bad\nPatch\n") self.assertFalse(True) except ValueError: # Exception expected. pass def testPatchToText(self): strp = "@@ -21,18 +22,17 @@\n jump\n-s\n+ed\n over \n-the\n+a\n laz\n" p = self.dmp.patch_fromText(strp) self.assertEquals(strp, self.dmp.patch_toText(p)) strp = "@@ -1,9 +1,9 @@\n-f\n+F\n oo+fooba\n@@ -7,9 +7,9 @@\n obar\n-,\n+.\n tes\n" p = self.dmp.patch_fromText(strp) self.assertEquals(strp, self.dmp.patch_toText(p)) def testPatchAddContext(self): self.dmp.Patch_Margin = 4 p = self.dmp.patch_fromText("@@ -21,4 +21,10 @@\n-jump\n+somersault\n")[0] self.dmp.patch_addContext(p, "The quick brown fox jumps over the lazy dog.") self.assertEquals("@@ -17,12 +17,18 @@\n fox \n-jump\n+somersault\n s ov\n", str(p)) # Same, but not enough trailing context. p = self.dmp.patch_fromText("@@ -21,4 +21,10 @@\n-jump\n+somersault\n")[0] self.dmp.patch_addContext(p, "The quick brown fox jumps.") self.assertEquals("@@ -17,10 +17,16 @@\n fox \n-jump\n+somersault\n s.\n", str(p)) # Same, but not enough leading context. p = self.dmp.patch_fromText("@@ -3 +3,2 @@\n-e\n+at\n")[0] self.dmp.patch_addContext(p, "The quick brown fox jumps.") self.assertEquals("@@ -1,7 +1,8 @@\n Th\n-e\n+at\n qui\n", str(p)) # Same, but with ambiguity. p = self.dmp.patch_fromText("@@ -3 +3,2 @@\n-e\n+at\n")[0] self.dmp.patch_addContext(p, "The quick brown fox jumps. The quick brown fox crashes.") self.assertEquals("@@ -1,27 +1,28 @@\n Th\n-e\n+at\n quick brown fox jumps. \n", str(p)) def testPatchMake(self): # Null case. patches = self.dmp.patch_make("", "") self.assertEquals("", self.dmp.patch_toText(patches)) text1 = "The quick brown fox jumps over the lazy dog." text2 = "That quick brown fox jumped over a lazy dog." # Text2+Text1 inputs. expectedPatch = "@@ -1,8 +1,7 @@\n Th\n-at\n+e\n qui\n@@ -21,17 +21,18 @@\n jump\n-ed\n+s\n over \n-a\n+the\n laz\n" # The second patch must be "-21,17 +21,18", not "-22,17 +21,18" due to rolling context. patches = self.dmp.patch_make(text2, text1) self.assertEquals(expectedPatch, self.dmp.patch_toText(patches)) # Text1+Text2 inputs. expectedPatch = "@@ -1,11 +1,12 @@\n Th\n-e\n+at\n quick b\n@@ -22,18 +22,17 @@\n jump\n-s\n+ed\n over \n-the\n+a\n laz\n" patches = self.dmp.patch_make(text1, text2) self.assertEquals(expectedPatch, self.dmp.patch_toText(patches)) # Diff input. diffs = self.dmp.diff_main(text1, text2, False) patches = self.dmp.patch_make(diffs) self.assertEquals(expectedPatch, self.dmp.patch_toText(patches)) # Text1+Diff inputs. patches = self.dmp.patch_make(text1, diffs) self.assertEquals(expectedPatch, self.dmp.patch_toText(patches)) # Text1+Text2+Diff inputs (deprecated). patches = self.dmp.patch_make(text1, text2, diffs) self.assertEquals(expectedPatch, self.dmp.patch_toText(patches)) # Character encoding. patches = self.dmp.patch_make("`1234567890-=[]\\;',./", "~!@#$%^&*()_+{}|:\"<>?") self.assertEquals("@@ -1,21 +1,21 @@\n-%601234567890-=%5B%5D%5C;',./\n+~!@#$%25%5E&*()_+%7B%7D%7C:%22%3C%3E?\n", self.dmp.patch_toText(patches)) # Character decoding. diffs = [(self.dmp.DIFF_DELETE, "`1234567890-=[]\\;',./"), (self.dmp.DIFF_INSERT, "~!@#$%^&*()_+{}|:\"<>?")] self.assertEquals(diffs, self.dmp.patch_fromText("@@ -1,21 +1,21 @@\n-%601234567890-=%5B%5D%5C;',./\n+~!@#$%25%5E&*()_+%7B%7D%7C:%22%3C%3E?\n")[0].diffs) # Long string with repeats. text1 = "" for x in range(100): text1 += "abcdef" text2 = text1 + "123" expectedPatch = "@@ -573,28 +573,31 @@\n cdefabcdefabcdefabcdefabcdef\n+123\n" patches = self.dmp.patch_make(text1, text2) self.assertEquals(expectedPatch, self.dmp.patch_toText(patches)) # Test null inputs. try: self.dmp.patch_make(None, None) self.assertFalse(True) except ValueError: # Exception expected. pass def testPatchSplitMax(self): # Assumes that Match_MaxBits is 32. patches = self.dmp.patch_make("abcdefghijklmnopqrstuvwxyz01234567890", "XabXcdXefXghXijXklXmnXopXqrXstXuvXwxXyzX01X23X45X67X89X0") self.dmp.patch_splitMax(patches) self.assertEquals("@@ -1,32 +1,46 @@\n+X\n ab\n+X\n cd\n+X\n ef\n+X\n gh\n+X\n ij\n+X\n kl\n+X\n mn\n+X\n op\n+X\n qr\n+X\n st\n+X\n uv\n+X\n wx\n+X\n yz\n+X\n 012345\n@@ -25,13 +39,18 @@\n zX01\n+X\n 23\n+X\n 45\n+X\n 67\n+X\n 89\n+X\n 0\n", self.dmp.patch_toText(patches)) patches = self.dmp.patch_make("abcdef1234567890123456789012345678901234567890123456789012345678901234567890uvwxyz", "abcdefuvwxyz") oldToText = self.dmp.patch_toText(patches) self.dmp.patch_splitMax(patches) self.assertEquals(oldToText, self.dmp.patch_toText(patches)) patches = self.dmp.patch_make("1234567890123456789012345678901234567890123456789012345678901234567890", "abc") self.dmp.patch_splitMax(patches) self.assertEquals("@@ -1,32 +1,4 @@\n-1234567890123456789012345678\n 9012\n@@ -29,32 +1,4 @@\n-9012345678901234567890123456\n 7890\n@@ -57,14 +1,3 @@\n-78901234567890\n+abc\n", self.dmp.patch_toText(patches)) patches = self.dmp.patch_make("abcdefghij , h : 0 , t : 1 abcdefghij , h : 0 , t : 1 abcdefghij , h : 0 , t : 1", "abcdefghij , h : 1 , t : 1 abcdefghij , h : 1 , t : 1 abcdefghij , h : 0 , t : 1") self.dmp.patch_splitMax(patches) self.assertEquals("@@ -2,32 +2,32 @@\n bcdefghij , h : \n-0\n+1\n , t : 1 abcdef\n@@ -29,32 +29,32 @@\n bcdefghij , h : \n-0\n+1\n , t : 1 abcdef\n", self.dmp.patch_toText(patches)) def testPatchAddPadding(self): # Both edges full. patches = self.dmp.patch_make("", "test") self.assertEquals("@@ -0,0 +1,4 @@\n+test\n", self.dmp.patch_toText(patches)) self.dmp.patch_addPadding(patches) self.assertEquals("@@ -1,8 +1,12 @@\n %01%02%03%04\n+test\n %01%02%03%04\n", self.dmp.patch_toText(patches)) # Both edges partial. patches = self.dmp.patch_make("XY", "XtestY") self.assertEquals("@@ -1,2 +1,6 @@\n X\n+test\n Y\n", self.dmp.patch_toText(patches)) self.dmp.patch_addPadding(patches) self.assertEquals("@@ -2,8 +2,12 @@\n %02%03%04X\n+test\n Y%01%02%03\n", self.dmp.patch_toText(patches)) # Both edges none. patches = self.dmp.patch_make("XXXXYYYY", "XXXXtestYYYY") self.assertEquals("@@ -1,8 +1,12 @@\n XXXX\n+test\n YYYY\n", self.dmp.patch_toText(patches)) self.dmp.patch_addPadding(patches) self.assertEquals("@@ -5,8 +5,12 @@\n XXXX\n+test\n YYYY\n", self.dmp.patch_toText(patches)) def testPatchApply(self): self.dmp.Match_Distance = 1000 self.dmp.Match_Threshold = 0.5 self.dmp.Patch_DeleteThreshold = 0.5 # Null case. patches = self.dmp.patch_make("", "") results = self.dmp.patch_apply(patches, "Hello world.") self.assertEquals(("Hello world.", []), results) # Exact match. patches = self.dmp.patch_make("The quick brown fox jumps over the lazy dog.", "That quick brown fox jumped over a lazy dog.") results = self.dmp.patch_apply(patches, "The quick brown fox jumps over the lazy dog.") self.assertEquals(("That quick brown fox jumped over a lazy dog.", [True, True]), results) # Partial match. results = self.dmp.patch_apply(patches, "The quick red rabbit jumps over the tired tiger.") self.assertEquals(("That quick red rabbit jumped over a tired tiger.", [True, True]), results) # Failed match. results = self.dmp.patch_apply(patches, "I am the very model of a modern major general.") self.assertEquals(("I am the very model of a modern major general.", [False, False]), results) # Big delete, small change. patches = self.dmp.patch_make("x1234567890123456789012345678901234567890123456789012345678901234567890y", "xabcy") results = self.dmp.patch_apply(patches, "x123456789012345678901234567890-----++++++++++-----123456789012345678901234567890y") self.assertEquals(("xabcy", [True, True]), results) # Big delete, big change 1. patches = self.dmp.patch_make("x1234567890123456789012345678901234567890123456789012345678901234567890y", "xabcy") results = self.dmp.patch_apply(patches, "x12345678901234567890---------------++++++++++---------------12345678901234567890y") self.assertEquals(("xabc12345678901234567890---------------++++++++++---------------12345678901234567890y", [False, True]), results) # Big delete, big change 2. self.dmp.Patch_DeleteThreshold = 0.6 patches = self.dmp.patch_make("x1234567890123456789012345678901234567890123456789012345678901234567890y", "xabcy") results = self.dmp.patch_apply(patches, "x12345678901234567890---------------++++++++++---------------12345678901234567890y") self.assertEquals(("xabcy", [True, True]), results) self.dmp.Patch_DeleteThreshold = 0.5 # Compensate for failed patch. self.dmp.Match_Threshold = 0.0 self.dmp.Match_Distance = 0 patches = self.dmp.patch_make("abcdefghijklmnopqrstuvwxyz--------------------1234567890", "abcXXXXXXXXXXdefghijklmnopqrstuvwxyz--------------------1234567YYYYYYYYYY890") results = self.dmp.patch_apply(patches, "ABCDEFGHIJKLMNOPQRSTUVWXYZ--------------------1234567890") self.assertEquals(("ABCDEFGHIJKLMNOPQRSTUVWXYZ--------------------1234567YYYYYYYYYY890", [False, True]), results) self.dmp.Match_Threshold = 0.5 self.dmp.Match_Distance = 1000 # No side effects. patches = self.dmp.patch_make("", "test") patchstr = self.dmp.patch_toText(patches) results = self.dmp.patch_apply(patches, "") self.assertEquals(patchstr, self.dmp.patch_toText(patches)) # No side effects with major delete. patches = self.dmp.patch_make("The quick brown fox jumps over the lazy dog.", "Woof") patchstr = self.dmp.patch_toText(patches) self.dmp.patch_apply(patches, "The quick brown fox jumps over the lazy dog.") self.assertEquals(patchstr, self.dmp.patch_toText(patches)) # Edge exact match. patches = self.dmp.patch_make("", "test") self.dmp.patch_apply(patches, "") self.assertEquals(("test", [True]), results) # Near edge exact match. patches = self.dmp.patch_make("XY", "XtestY") results = self.dmp.patch_apply(patches, "XY") self.assertEquals(("XtestY", [True]), results) # Edge partial match. patches = self.dmp.patch_make("y", "y123") results = self.dmp.patch_apply(patches, "x") self.assertEquals(("x123", [True]), results) if __name__ == "__main__": unittest.main()
apache-2.0
chaluemwut/fbserver
venv/lib/python2.7/site-packages/scipy/io/matlab/tests/test_mio_funcs.py
17
1816
#!/usr/bin/env python ''' Jottings to work out format for __function_workspace__ matrix at end of mat file. ''' from __future__ import division, print_function, absolute_import from os.path import join as pjoin, dirname import sys from io import BytesIO from numpy.testing import \ assert_array_equal, \ assert_array_almost_equal, \ assert_equal, \ assert_raises, run_module_suite from nose.tools import assert_true import numpy as np from numpy.compat import asstr from scipy.io.matlab.mio5 import MatlabObject, MatFile5Writer, \ MatFile5Reader, MatlabFunction test_data_path = pjoin(dirname(__file__), 'data') def read_minimat_vars(rdr): rdr.initialize_read() mdict = {'__globals__': []} i = 0 while not rdr.end_of_stream(): hdr, next_position = rdr.read_var_header() name = asstr(hdr.name) if name == '': name = 'var_%d' % i i += 1 res = rdr.read_var_array(hdr, process=False) rdr.mat_stream.seek(next_position) mdict[name] = res if hdr.is_global: mdict['__globals__'].append(name) return mdict def read_workspace_vars(fname): fp = open(fname, 'rb') rdr = MatFile5Reader(fp, struct_as_record=True) vars = rdr.get_variables() fws = vars['__function_workspace__'] ws_bs = BytesIO(fws.tostring()) ws_bs.seek(2) rdr.mat_stream = ws_bs # Guess byte order. mi = rdr.mat_stream.read(2) rdr.byte_order = mi == b'IM' and '<' or '>' rdr.mat_stream.read(4) # presumably byte padding mdict = read_minimat_vars(rdr) fp.close() return mdict def test_jottings(): # example fname = pjoin(test_data_path, 'parabola.mat') ws_vars = read_workspace_vars(fname) if __name__ == "__main__": run_module_suite()
apache-2.0
uclaros/QGIS
tests/src/python/test_qgsoptional.py
74
2145
# -*- coding: utf-8 -*- ''' test_qgsoptional.py -------------------------------------- Date : September 2016 Copyright : (C) 2016 Matthias Kuhn email : matthias@opengis.ch *************************************************************************** * * * This program is free software; you can redistribute it and/or modify * * it under the terms of the GNU General Public License as published by * * the Free Software Foundation; either version 2 of the License, or * * (at your option) any later version. * * * ***************************************************************************/ ''' import qgis # NOQA from qgis.testing import unittest from qgis.core import QgsOptionalExpression, QgsExpression class TestQgsOptional(unittest.TestCase): def setUp(self): """Run before each test.""" pass def tearDown(self): """Run after each test.""" pass def testQgsOptionalExpression(self): opt = QgsOptionalExpression() self.assertFalse(opt.enabled()) opt = QgsOptionalExpression(QgsExpression('true')) self.assertTrue(opt.enabled()) self.assertEqual(opt.data().expression(), 'true') opt.setEnabled(False) self.assertFalse(opt.enabled()) # boolean operator not yet working in python # self.assertFalse(opt) self.assertEqual(opt.data().expression(), 'true') opt.setEnabled(True) self.assertTrue(opt.enabled()) # self.assertTrue(opt) self.assertEqual(opt.data().expression(), 'true') opt.setData(QgsExpression('xyz')) self.assertTrue(opt.enabled()) self.assertEqual(opt.data().expression(), 'xyz') opt = QgsOptionalExpression(QgsExpression('true'), False) self.assertFalse(opt.enabled()) if __name__ == '__main__': unittest.main()
gpl-2.0
JingZhou0404/phantomjs
src/qt/qtwebkit/Tools/Scripts/webkitpy/tool/steps/build.py
119
2636
# Copyright (C) 2010 Google Inc. All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: # # * Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the above # copyright notice, this list of conditions and the following disclaimer # in the documentation and/or other materials provided with the # distribution. # * Neither the name of Google Inc. nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. import logging from webkitpy.tool.steps.abstractstep import AbstractStep from webkitpy.tool.steps.options import Options _log = logging.getLogger(__name__) class Build(AbstractStep): @classmethod def options(cls): return AbstractStep.options() + [ Options.build, Options.quiet, Options.build_style, ] def build(self, build_style): environment = self._tool.copy_current_environment() environment.disable_gcc_smartquotes() env = environment.to_dictionary() build_webkit_command = self._tool.deprecated_port().build_webkit_command(build_style=build_style) self._tool.executive.run_and_throw_if_fail(build_webkit_command, self._options.quiet, cwd=self._tool.scm().checkout_root, env=env) def run(self, state): if not self._options.build: return _log.info("Building WebKit") if self._options.build_style == "both": self.build("debug") self.build("release") else: self.build(self._options.build_style)
bsd-3-clause
simartin/servo
python/servo/build_commands.py
2
45345
# Copyright 2013 The Servo Project Developers. See the COPYRIGHT # file at the top-level directory of this distribution. # # Licensed under the Apache License, Version 2.0 <LICENSE-APACHE or # http://www.apache.org/licenses/LICENSE-2.0> or the MIT license # <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your # option. This file may not be copied, modified, or distributed # except according to those terms. from __future__ import print_function, unicode_literals import datetime import locale import os import os.path as path import platform import shutil import subprocess import sys import six.moves.urllib as urllib import zipfile import stat from time import time from mach.decorators import ( CommandArgument, CommandProvider, Command, ) from mach.registrar import Registrar from mach_bootstrap import _get_exec_path from servo.command_base import CommandBase, cd, call, check_call, append_to_path_env, gstreamer_root from servo.gstreamer import windows_dlls, windows_plugins, macos_dylibs, macos_plugins from servo.util import host_triple def format_duration(seconds): return str(datetime.timedelta(seconds=int(seconds))) def notify_linux(title, text): try: import dbus bus = dbus.SessionBus() notify_obj = bus.get_object("org.freedesktop.Notifications", "/org/freedesktop/Notifications") method = notify_obj.get_dbus_method("Notify", "org.freedesktop.Notifications") method(title, 0, "", text, "", [], {"transient": True}, -1) except ImportError: raise Exception("Optional Python module 'dbus' is not installed.") def notify_win(title, text): try: from servo.win32_toast import WindowsToast w = WindowsToast() w.balloon_tip(title, text) except WindowsError: from ctypes import Structure, windll, POINTER, sizeof from ctypes.wintypes import DWORD, HANDLE, WINFUNCTYPE, BOOL, UINT class FLASHWINDOW(Structure): _fields_ = [("cbSize", UINT), ("hwnd", HANDLE), ("dwFlags", DWORD), ("uCount", UINT), ("dwTimeout", DWORD)] FlashWindowExProto = WINFUNCTYPE(BOOL, POINTER(FLASHWINDOW)) FlashWindowEx = FlashWindowExProto(("FlashWindowEx", windll.user32)) FLASHW_CAPTION = 0x01 FLASHW_TRAY = 0x02 FLASHW_TIMERNOFG = 0x0C params = FLASHWINDOW(sizeof(FLASHWINDOW), windll.kernel32.GetConsoleWindow(), FLASHW_CAPTION | FLASHW_TRAY | FLASHW_TIMERNOFG, 3, 0) FlashWindowEx(params) def notify_darwin(title, text): try: import Foundation bundleDict = Foundation.NSBundle.mainBundle().infoDictionary() bundleIdentifier = 'CFBundleIdentifier' if bundleIdentifier not in bundleDict: bundleDict[bundleIdentifier] = 'mach' note = Foundation.NSUserNotification.alloc().init() note.setTitle_(title) note.setInformativeText_(text) now = Foundation.NSDate.dateWithTimeInterval_sinceDate_(0, Foundation.NSDate.date()) note.setDeliveryDate_(now) centre = Foundation.NSUserNotificationCenter.defaultUserNotificationCenter() centre.scheduleNotification_(note) except ImportError: raise Exception("Optional Python module 'pyobjc' is not installed.") def notify_with_command(command): def notify(title, text): if call([command, title, text]) != 0: raise Exception("Could not run '%s'." % command) return notify def notify_build_done(config, elapsed, success=True): """Generate desktop notification when build is complete and the elapsed build time was longer than 30 seconds.""" if elapsed > 30: notify(config, "Servo build", "%s in %s" % ("Completed" if success else "FAILED", format_duration(elapsed))) def notify(config, title, text): """Generate a desktop notification using appropriate means on supported platforms Linux, Windows, and Mac OS. On unsupported platforms, this function acts as a no-op. If notify-command is set in the [tools] section of the configuration, that is used instead.""" notify_command = config["tools"].get("notify-command") if notify_command: func = notify_with_command(notify_command) else: platforms = { "linux": notify_linux, "linux2": notify_linux, "win32": notify_win, "darwin": notify_darwin } func = platforms.get(sys.platform) if func is not None: try: func(title, text) except Exception as e: extra = getattr(e, "message", "") print("[Warning] Could not generate notification! %s" % extra, file=sys.stderr) @CommandProvider class MachCommands(CommandBase): @Command('build', description='Build Servo', category='build') @CommandArgument('--release', '-r', action='store_true', help='Build in release mode') @CommandArgument('--dev', '-d', action='store_true', help='Build in development mode') @CommandArgument('--jobs', '-j', default=None, help='Number of jobs to run in parallel') @CommandArgument('--no-package', action='store_true', help='For Android, disable packaging into a .apk after building') @CommandArgument('--verbose', '-v', action='store_true', help='Print verbose output') @CommandArgument('--very-verbose', '-vv', action='store_true', help='Print very verbose output') @CommandArgument('--uwp', action='store_true', help='Build for HoloLens (x64)') @CommandArgument('--win-arm64', action='store_true', help="Use arm64 Windows target") @CommandArgument('params', nargs='...', help="Command-line arguments to be passed through to Cargo") @CommandBase.build_like_command_arguments def build(self, release=False, dev=False, jobs=None, params=None, media_stack=None, no_package=False, verbose=False, very_verbose=False, target=None, android=False, magicleap=False, libsimpleservo=False, features=None, uwp=False, win_arm64=False, **kwargs): # Force the UWP-enabled target if the convenience UWP flags are passed. if uwp and not target: if win_arm64: target = 'aarch64-uwp-windows-msvc' else: target = 'x86_64-uwp-windows-msvc' opts = params or [] features = features or [] target, android = self.pick_target_triple(target, android, magicleap) # Infer UWP build if only provided a target. if not uwp: uwp = target and 'uwp' in target features += self.pick_media_stack(media_stack, target) target_path = base_path = self.get_target_dir() if android: target_path = path.join(target_path, "android") base_path = path.join(target_path, target) elif magicleap: target_path = path.join(target_path, "magicleap") base_path = path.join(target_path, target) release_path = path.join(base_path, "release", "servo") dev_path = path.join(base_path, "debug", "servo") release_exists = path.exists(release_path) dev_exists = path.exists(dev_path) if not (release or dev): if self.config["build"]["mode"] == "dev": dev = True elif self.config["build"]["mode"] == "release": release = True elif release_exists and not dev_exists: release = True elif dev_exists and not release_exists: dev = True else: print("Please specify either --dev (-d) for a development") print(" build, or --release (-r) for an optimized build.") sys.exit(1) if release and dev: print("Please specify either --dev or --release.") sys.exit(1) if release: opts += ["--release"] servo_path = release_path else: servo_path = dev_path if jobs is not None: opts += ["-j", jobs] if verbose: opts += ["-v"] if very_verbose: opts += ["-vv"] env = self.build_env(target=target, is_build=True, uwp=uwp, features=features) self.ensure_bootstrapped(target=target) self.ensure_clobbered() build_start = time() env["CARGO_TARGET_DIR"] = target_path host = host_triple() target_triple = target or host_triple() if 'apple-darwin' in host and target_triple == host: if 'CXXFLAGS' not in env: env['CXXFLAGS'] = '' env["CXXFLAGS"] += "-mmacosx-version-min=10.10" if 'windows' in host: vs_dirs = self.vs_dirs() if host != target_triple and 'windows' in target_triple: if os.environ.get('VisualStudioVersion') or os.environ.get('VCINSTALLDIR'): print("Can't cross-compile for Windows inside of a Visual Studio shell.\n" "Please run `python mach build [arguments]` to bypass automatic " "Visual Studio shell, and make sure the VisualStudioVersion and " "VCINSTALLDIR environment variables are not set.") sys.exit(1) vcinstalldir = vs_dirs['vcdir'] if not os.path.exists(vcinstalldir): print("Can't find Visual C++ %s installation at %s." % (vs_dirs['vs_version'], vcinstalldir)) sys.exit(1) env['PKG_CONFIG_ALLOW_CROSS'] = "1" if uwp: # Ensure libstd is ready for the new UWP target. check_call(["rustup", "component", "add", "rust-src"]) env['RUST_SYSROOT'] = path.expanduser('~\\.xargo') # Don't try and build a desktop port. libsimpleservo = True arches = { "aarch64": { "angle": "arm64", "gst": "ARM64", "gst_root": "arm64", }, "x86_64": { "angle": "x64", "gst": "X86_64", "gst_root": "x64", }, } arch = arches.get(target_triple.split('-')[0]) if not arch: print("Unsupported UWP target.") sys.exit(1) # Ensure that the NuGet ANGLE package containing libEGL is accessible # to the Rust linker. append_to_path_env(angle_root(target_triple, env), env, "LIB") # Don't want to mix non-UWP libraries with vendored UWP libraries. if "gstreamer" in env['LIB']: print("Found existing GStreamer library path in LIB. Please remove it.") sys.exit(1) # Override any existing GStreamer installation with the vendored libraries. env["GSTREAMER_1_0_ROOT_" + arch['gst']] = path.join( self.msvc_package_dir("gstreamer-uwp"), arch['gst_root'] ) env["PKG_CONFIG_PATH"] = path.join( self.msvc_package_dir("gstreamer-uwp"), arch['gst_root'], "lib", "pkgconfig" ) if 'windows' in host: process = subprocess.Popen('("%s" %s > nul) && "python" -c "import os; print(repr(os.environ))"' % (os.path.join(vs_dirs['vcdir'], "Auxiliary", "Build", "vcvarsall.bat"), "x64"), stdout=subprocess.PIPE, shell=True) stdout, stderr = process.communicate() exitcode = process.wait() encoding = locale.getpreferredencoding() # See https://stackoverflow.com/a/9228117 if exitcode == 0: decoded = stdout.decode(encoding) if decoded.startswith("environ("): decoded = decoded.strip()[8:-1] os.environ.update(eval(decoded)) else: print("Failed to run vcvarsall. stderr:") print(stderr.decode(encoding)) exit(1) # Ensure that GStreamer libraries are accessible when linking. if 'windows' in target_triple: gst_root = gstreamer_root(target_triple, env) if gst_root: append_to_path_env(os.path.join(gst_root, "lib"), env, "LIB") if android: if "ANDROID_NDK" not in env: print("Please set the ANDROID_NDK environment variable.") sys.exit(1) if "ANDROID_SDK" not in env: print("Please set the ANDROID_SDK environment variable.") sys.exit(1) android_platform = self.config["android"]["platform"] android_toolchain_name = self.config["android"]["toolchain_name"] android_toolchain_prefix = self.config["android"]["toolchain_prefix"] android_lib = self.config["android"]["lib"] android_arch = self.config["android"]["arch"] # Build OpenSSL for android env["OPENSSL_VERSION"] = "1.1.1d" make_cmd = ["make"] if jobs is not None: make_cmd += ["-j" + jobs] openssl_dir = path.join(target_path, target, "native", "openssl") if not path.exists(openssl_dir): os.makedirs(openssl_dir) shutil.copy(path.join(self.android_support_dir(), "openssl.makefile"), openssl_dir) shutil.copy(path.join(self.android_support_dir(), "openssl.sh"), openssl_dir) # Check if the NDK version is 15 if not os.path.isfile(path.join(env["ANDROID_NDK"], 'source.properties')): print("ANDROID_NDK should have file `source.properties`.") print("The environment variable ANDROID_NDK may be set at a wrong path.") sys.exit(1) with open(path.join(env["ANDROID_NDK"], 'source.properties')) as ndk_properties: lines = ndk_properties.readlines() if lines[1].split(' = ')[1].split('.')[0] != '15': print("Currently only support NDK 15. Please re-run `./mach bootstrap-android`.") sys.exit(1) env["RUST_TARGET"] = target with cd(openssl_dir): status = call( make_cmd + ["-f", "openssl.makefile"], env=env, verbose=verbose) if status: return status openssl_dir = path.join(openssl_dir, "openssl-{}".format(env["OPENSSL_VERSION"])) env['OPENSSL_LIB_DIR'] = openssl_dir env['OPENSSL_INCLUDE_DIR'] = path.join(openssl_dir, "include") env['OPENSSL_STATIC'] = 'TRUE' # Android builds also require having the gcc bits on the PATH and various INCLUDE # path munging if you do not want to install a standalone NDK. See: # https://dxr.mozilla.org/mozilla-central/source/build/autoconf/android.m4#139-161 os_type = platform.system().lower() if os_type not in ["linux", "darwin"]: raise Exception("Android cross builds are only supported on Linux and macOS.") cpu_type = platform.machine().lower() host_suffix = "unknown" if cpu_type in ["i386", "i486", "i686", "i768", "x86"]: host_suffix = "x86" elif cpu_type in ["x86_64", "x86-64", "x64", "amd64"]: host_suffix = "x86_64" host = os_type + "-" + host_suffix host_cc = env.get('HOST_CC') or _get_exec_path(["clang"]) or _get_exec_path(["gcc"]) host_cxx = env.get('HOST_CXX') or _get_exec_path(["clang++"]) or _get_exec_path(["g++"]) llvm_toolchain = path.join(env['ANDROID_NDK'], "toolchains", "llvm", "prebuilt", host) gcc_toolchain = path.join(env['ANDROID_NDK'], "toolchains", android_toolchain_prefix + "-4.9", "prebuilt", host) gcc_libs = path.join(gcc_toolchain, "lib", "gcc", android_toolchain_name, "4.9.x") env['PATH'] = (path.join(llvm_toolchain, "bin") + ':' + env['PATH']) env['ANDROID_SYSROOT'] = path.join(env['ANDROID_NDK'], "sysroot") support_include = path.join(env['ANDROID_NDK'], "sources", "android", "support", "include") cpufeatures_include = path.join(env['ANDROID_NDK'], "sources", "android", "cpufeatures") cxx_include = path.join(env['ANDROID_NDK'], "sources", "cxx-stl", "llvm-libc++", "include") clang_include = path.join(llvm_toolchain, "lib64", "clang", "3.8", "include") cxxabi_include = path.join(env['ANDROID_NDK'], "sources", "cxx-stl", "llvm-libc++abi", "include") sysroot_include = path.join(env['ANDROID_SYSROOT'], "usr", "include") arch_include = path.join(sysroot_include, android_toolchain_name) android_platform_dir = path.join(env['ANDROID_NDK'], "platforms", android_platform, "arch-" + android_arch) arch_libs = path.join(android_platform_dir, "usr", "lib") clang_include = path.join(llvm_toolchain, "lib64", "clang", "5.0", "include") android_api = android_platform.replace('android-', '') env['HOST_CC'] = host_cc env['HOST_CXX'] = host_cxx env['HOST_CFLAGS'] = '' env['HOST_CXXFLAGS'] = '' env['CC'] = path.join(llvm_toolchain, "bin", "clang") env['CPP'] = path.join(llvm_toolchain, "bin", "clang") + " -E" env['CXX'] = path.join(llvm_toolchain, "bin", "clang++") env['ANDROID_TOOLCHAIN'] = gcc_toolchain env['ANDROID_TOOLCHAIN_DIR'] = gcc_toolchain env['ANDROID_VERSION'] = android_api env['ANDROID_PLATFORM_DIR'] = android_platform_dir env['GCC_TOOLCHAIN'] = gcc_toolchain gcc_toolchain_bin = path.join(gcc_toolchain, android_toolchain_name, "bin") env['AR'] = path.join(gcc_toolchain_bin, "ar") env['RANLIB'] = path.join(gcc_toolchain_bin, "ranlib") env['OBJCOPY'] = path.join(gcc_toolchain_bin, "objcopy") env['YASM'] = path.join(env['ANDROID_NDK'], 'prebuilt', host, 'bin', 'yasm') # A cheat-sheet for some of the build errors caused by getting the search path wrong... # # fatal error: 'limits' file not found # -- add -I cxx_include # unknown type name '__locale_t' (when running bindgen in mozjs_sys) # -- add -isystem sysroot_include # error: use of undeclared identifier 'UINTMAX_C' # -- add -D__STDC_CONSTANT_MACROS # # Also worth remembering: autoconf uses C for its configuration, # even for C++ builds, so the C flags need to line up with the C++ flags. env['CFLAGS'] = ' '.join([ "--target=" + target, "--sysroot=" + env['ANDROID_SYSROOT'], "--gcc-toolchain=" + gcc_toolchain, "-isystem", sysroot_include, "-I" + arch_include, "-B" + arch_libs, "-L" + arch_libs, "-D__ANDROID_API__=" + android_api, ]) env['CXXFLAGS'] = ' '.join([ "--target=" + target, "--sysroot=" + env['ANDROID_SYSROOT'], "--gcc-toolchain=" + gcc_toolchain, "-I" + cpufeatures_include, "-I" + cxx_include, "-I" + clang_include, "-isystem", sysroot_include, "-I" + cxxabi_include, "-I" + clang_include, "-I" + arch_include, "-I" + support_include, "-L" + gcc_libs, "-B" + arch_libs, "-L" + arch_libs, "-D__ANDROID_API__=" + android_api, "-D__STDC_CONSTANT_MACROS", "-D__NDK_FPABI__=", ]) env['CPPFLAGS'] = ' '.join([ "--target=" + target, "--sysroot=" + env['ANDROID_SYSROOT'], "-I" + arch_include, ]) env["NDK_ANDROID_VERSION"] = android_api env["ANDROID_ABI"] = android_lib env["ANDROID_PLATFORM"] = android_platform env["NDK_CMAKE_TOOLCHAIN_FILE"] = path.join(env['ANDROID_NDK'], "build", "cmake", "android.toolchain.cmake") env["CMAKE_TOOLCHAIN_FILE"] = path.join(self.android_support_dir(), "toolchain.cmake") # Set output dir for gradle aar files aar_out_dir = self.android_aar_dir() if not os.path.exists(aar_out_dir): os.makedirs(aar_out_dir) env["AAR_OUT_DIR"] = aar_out_dir # GStreamer and its dependencies use pkg-config and this flag is required # to make it work in a cross-compilation context. env["PKG_CONFIG_ALLOW_CROSS"] = '1' # Build the name of the package containing all GStreamer dependencies # according to the build target. gst_lib = "gst-build-{}".format(self.config["android"]["lib"]) gst_lib_zip = "gstreamer-{}-1.16.0-20190517-095630.zip".format(self.config["android"]["lib"]) gst_dir = os.path.join(target_path, "gstreamer") gst_lib_path = os.path.join(gst_dir, gst_lib) pkg_config_path = os.path.join(gst_lib_path, "pkgconfig") env["PKG_CONFIG_PATH"] = pkg_config_path if not os.path.exists(gst_lib_path): # Download GStreamer dependencies if they have not already been downloaded # This bundle is generated with `libgstreamer_android_gen` # Follow these instructions to build and deploy new binaries # https://github.com/servo/libgstreamer_android_gen#build print("Downloading GStreamer dependencies") gst_url = "https://servo-deps-2.s3.amazonaws.com/gstreamer/%s" % gst_lib_zip print(gst_url) urllib.request.urlretrieve(gst_url, gst_lib_zip) zip_ref = zipfile.ZipFile(gst_lib_zip, "r") zip_ref.extractall(gst_dir) os.remove(gst_lib_zip) # Change pkgconfig info to make all GStreamer dependencies point # to the libgstreamer_android.so bundle. for each in os.listdir(pkg_config_path): if each.endswith('.pc'): print("Setting pkgconfig info for %s" % each) pc = os.path.join(pkg_config_path, each) expr = "s#libdir=.*#libdir=%s#g" % gst_lib_path subprocess.call(["perl", "-i", "-pe", expr, pc]) if magicleap: if platform.system() not in ["Darwin"]: raise Exception("Magic Leap builds are only supported on macOS. " "If you only wish to test if your code builds, " "run ./mach build -p libmlservo.") ml_sdk = env.get("MAGICLEAP_SDK") if not ml_sdk: raise Exception("Magic Leap builds need the MAGICLEAP_SDK environment variable") if not os.path.exists(ml_sdk): raise Exception("Path specified by MAGICLEAP_SDK does not exist.") ml_support = path.join(self.get_top_dir(), "support", "magicleap") # We pretend to be an Android build env.setdefault("ANDROID_VERSION", "21") env.setdefault("ANDROID_NDK", env["MAGICLEAP_SDK"]) env.setdefault("ANDROID_NDK_VERSION", "16.0.0") env.setdefault("ANDROID_PLATFORM_DIR", path.join(env["MAGICLEAP_SDK"], "lumin")) env.setdefault("ANDROID_TOOLCHAIN_DIR", path.join(env["MAGICLEAP_SDK"], "tools", "toolchains")) env.setdefault("ANDROID_CLANG", path.join(env["ANDROID_TOOLCHAIN_DIR"], "bin", "clang")) # A random collection of search paths env.setdefault("STLPORT_LIBS", " ".join([ "-L" + path.join(env["MAGICLEAP_SDK"], "lumin", "stl", "libc++-lumin", "lib"), "-lc++" ])) env.setdefault("STLPORT_CPPFLAGS", " ".join([ "-I" + path.join(env["MAGICLEAP_SDK"], "lumin", "stl", "libc++-lumin", "include") ])) env.setdefault("CPPFLAGS", " ".join([ "--no-standard-includes", "--sysroot=" + env["ANDROID_PLATFORM_DIR"], "-I" + path.join(env["ANDROID_PLATFORM_DIR"], "usr", "include"), "-isystem" + path.join(env["ANDROID_TOOLCHAIN_DIR"], "lib64", "clang", "3.8", "include"), ])) env.setdefault("CFLAGS", " ".join([ env["CPPFLAGS"], "-L" + path.join(env["ANDROID_TOOLCHAIN_DIR"], "lib", "gcc", target, "4.9.x"), ])) env.setdefault("CXXFLAGS", " ".join([ # Sigh, Angle gets confused if there's another EGL around "-I./gfx/angle/checkout/include", env["STLPORT_CPPFLAGS"], env["CFLAGS"] ])) # The toolchain commands env.setdefault("AR", path.join(env["ANDROID_TOOLCHAIN_DIR"], "bin", "aarch64-linux-android-ar")) env.setdefault("AS", path.join(env["ANDROID_TOOLCHAIN_DIR"], "bin", "aarch64-linux-android-clang")) env.setdefault("CC", path.join(env["ANDROID_TOOLCHAIN_DIR"], "bin", "aarch64-linux-android-clang")) env.setdefault("CPP", path.join(env["ANDROID_TOOLCHAIN_DIR"], "bin", "aarch64-linux-android-clang -E")) env.setdefault("CXX", path.join(env["ANDROID_TOOLCHAIN_DIR"], "bin", "aarch64-linux-android-clang++")) env.setdefault("LD", path.join(env["ANDROID_TOOLCHAIN_DIR"], "bin", "aarch64-linux-android-ld")) env.setdefault("OBJCOPY", path.join(env["ANDROID_TOOLCHAIN_DIR"], "bin", "aarch64-linux-android-objcopy")) env.setdefault("OBJDUMP", path.join(env["ANDROID_TOOLCHAIN_DIR"], "bin", "aarch64-linux-android-objdump")) env.setdefault("RANLIB", path.join(env["ANDROID_TOOLCHAIN_DIR"], "bin", "aarch64-linux-android-ranlib")) env.setdefault("STRIP", path.join(env["ANDROID_TOOLCHAIN_DIR"], "bin", "aarch64-linux-android-strip")) # Undo all of that when compiling build tools for the host env.setdefault("HOST_CFLAGS", "") env.setdefault("HOST_CXXFLAGS", "") env.setdefault("HOST_CC", "/usr/local/opt/llvm/bin/clang") env.setdefault("HOST_CXX", "/usr/local/opt/llvm/bin/clang++") env.setdefault("HOST_LD", "ld") # Some random build configurations env.setdefault("HARFBUZZ_SYS_NO_PKG_CONFIG", "1") env.setdefault("PKG_CONFIG_ALLOW_CROSS", "1") env.setdefault("CMAKE_TOOLCHAIN_FILE", path.join(ml_support, "toolchain.cmake")) env.setdefault("_LIBCPP_INLINE_VISIBILITY", "__attribute__((__always_inline__))") # The Open SSL configuration env.setdefault("OPENSSL_DIR", path.join(target_path, target, "native", "openssl")) env.setdefault("OPENSSL_VERSION", "1.1.1d") env.setdefault("OPENSSL_STATIC", "1") # GStreamer configuration env.setdefault("GSTREAMER_DIR", path.join(target_path, target, "native", "gstreamer-1.16.0")) env.setdefault("GSTREAMER_URL", "https://servo-deps-2.s3.amazonaws.com/gstreamer/gstreamer-magicleap-1.16.0-20190823-104505.tgz") env.setdefault("PKG_CONFIG_PATH", path.join(env["GSTREAMER_DIR"], "system", "lib64", "pkgconfig")) # Override the linker set in .cargo/config env.setdefault("CARGO_TARGET_AARCH64_LINUX_ANDROID_LINKER", path.join(ml_support, "fake-ld.sh")) # Only build libmlservo opts += ["--package", "libmlservo"] # Download and build OpenSSL if necessary status = call(path.join(ml_support, "openssl.sh"), env=env, verbose=verbose) if status: return status # Download prebuilt Gstreamer if necessary if not os.path.exists(path.join(env["GSTREAMER_DIR"], "system")): if not os.path.exists(env["GSTREAMER_DIR"] + ".tgz"): check_call([ 'curl', '-L', '-f', '-o', env["GSTREAMER_DIR"] + ".tgz", env["GSTREAMER_URL"], ]) check_call([ 'mkdir', '-p', env["GSTREAMER_DIR"], ]) check_call([ 'tar', 'xzf', env["GSTREAMER_DIR"] + ".tgz", '-C', env["GSTREAMER_DIR"], ]) # https://internals.rust-lang.org/t/exploring-crate-graph-build-times-with-cargo-build-ztimings/10975 # Prepend so that e.g. `-Ztimings` (which means `-Ztimings=info,html`) # given on the command line can override it opts = ["-Ztimings=info"] + opts if very_verbose: print(["Calling", "cargo", "build"] + opts) for key in env: print((key, env[key])) if sys.platform == "win32": env.setdefault("CC", "clang-cl.exe") env.setdefault("CXX", "clang-cl.exe") if uwp: env.setdefault("TARGET_CFLAGS", "") env.setdefault("TARGET_CXXFLAGS", "") env["TARGET_CFLAGS"] += " -DWINAPI_FAMILY=WINAPI_FAMILY_APP" env["TARGET_CXXFLAGS"] += " -DWINAPI_FAMILY=WINAPI_FAMILY_APP" else: env.setdefault("CC", "clang") env.setdefault("CXX", "clang++") status = self.run_cargo_build_like_command( "build", opts, env=env, verbose=verbose, target=target, android=android, magicleap=magicleap, libsimpleservo=libsimpleservo, uwp=uwp, features=features, **kwargs ) elapsed = time() - build_start # Do some additional things if the build succeeded if status == 0: if android and not no_package: flavor = None if "googlevr" in features: flavor = "googlevr" elif "oculusvr" in features: flavor = "oculusvr" rv = Registrar.dispatch("package", context=self.context, release=release, dev=dev, target=target, flavor=flavor) if rv: return rv if sys.platform == "win32": servo_exe_dir = os.path.dirname( self.get_binary_path(release, dev, target=target, simpleservo=libsimpleservo) ) assert os.path.exists(servo_exe_dir) # on msvc builds, use editbin to change the subsystem to windows, but only # on release builds -- on debug builds, it hides log output if not dev and not libsimpleservo: call(["editbin", "/nologo", "/subsystem:windows", path.join(servo_exe_dir, "servo.exe")], verbose=verbose) # on msvc, we need to copy in some DLLs in to the servo.exe dir and the directory for unit tests. for ssl_lib in ["libssl.dll", "libcrypto.dll"]: ssl_path = path.join(env['OPENSSL_LIB_DIR'], "../bin", ssl_lib) shutil.copy(ssl_path, servo_exe_dir) shutil.copy(ssl_path, path.join(servo_exe_dir, "deps")) build_path = path.join(servo_exe_dir, "build") assert os.path.exists(build_path) def package_generated_shared_libraries(libs, build_path, servo_exe_dir): for root, dirs, files in os.walk(build_path): remaining_libs = list(libs) for lib in libs: if lib in files: shutil.copy(path.join(root, lib), servo_exe_dir) remaining_libs.remove(lib) continue libs = remaining_libs if not libs: return True for lib in libs: print("WARNING: could not find " + lib) # UWP build has its own ANGLE library that it packages. if not uwp: print("Packaging EGL DLLs") egl_libs = ["libEGL.dll", "libGLESv2.dll"] if not package_generated_shared_libraries(egl_libs, build_path, servo_exe_dir): status = 1 # copy needed gstreamer DLLs in to servo.exe dir print("Packaging gstreamer DLLs") if not package_gstreamer_dlls(env, servo_exe_dir, target_triple, uwp): status = 1 # UWP app packaging already bundles all required DLLs for us. print("Packaging MSVC DLLs") if not package_msvc_dlls(servo_exe_dir, target_triple, vs_dirs['vcdir'], vs_dirs['vs_version']): status = 1 elif sys.platform == "darwin": servo_exe_dir = os.path.dirname( self.get_binary_path(release, dev, target=target, simpleservo=libsimpleservo) ) assert os.path.exists(servo_exe_dir) if not package_gstreamer_dylibs(servo_exe_dir): return 1 # On the Mac, set a lovely icon. This makes it easier to pick out the Servo binary in tools # like Instruments.app. try: import Cocoa icon_path = path.join(self.get_top_dir(), "resources", "servo_1024.png") icon = Cocoa.NSImage.alloc().initWithContentsOfFile_(icon_path) if icon is not None: Cocoa.NSWorkspace.sharedWorkspace().setIcon_forFile_options_(icon, servo_path, 0) except ImportError: pass # Generate Desktop Notification if elapsed-time > some threshold value notify_build_done(self.config, elapsed, status == 0) print("Build %s in %s" % ("Completed" if status == 0 else "FAILED", format_duration(elapsed))) return status @Command('clean', description='Clean the build directory.', category='build') @CommandArgument('--manifest-path', default=None, help='Path to the manifest to the package to clean') @CommandArgument('--verbose', '-v', action='store_true', help='Print verbose output') @CommandArgument('params', nargs='...', help="Command-line arguments to be passed through to Cargo") def clean(self, manifest_path=None, params=[], verbose=False): self.ensure_bootstrapped() virtualenv_fname = '_virtualenv%d.%d' % (sys.version_info[0], sys.version_info[1]) virtualenv_path = path.join(self.get_top_dir(), 'python', virtualenv_fname) if path.exists(virtualenv_path): print('Removing virtualenv directory: %s' % virtualenv_path) shutil.rmtree(virtualenv_path) self.clean_uwp() opts = ["--manifest-path", manifest_path or path.join(self.context.topdir, "Cargo.toml")] if verbose: opts += ["-v"] opts += params return check_call(["cargo", "clean"] + opts, env=self.build_env(), verbose=verbose) @Command('clean-uwp', description='Clean the support/hololens/ directory.', category='build') def clean_uwp(self): uwp_artifacts = [ "support/hololens/x64/", "support/hololens/ARM/", "support/hololens/ARM64/", "support/hololens/ServoApp/x64/", "support/hololens/ServoApp/ARM/", "support/hololens/ServoApp/ARM64/", "support/hololens/ServoApp/Generated Files/", "support/hololens/ServoApp/BundleArtifacts/", "support/hololens/ServoApp/support/", "support/hololens/ServoApp/Debug/", "support/hololens/ServoApp/Release/", "support/hololens/packages/", "support/hololens/AppPackages/", "support/hololens/ServoApp/ServoApp.vcxproj.user", ] for uwp_artifact in uwp_artifacts: artifact = path.join(self.get_top_dir(), uwp_artifact) if path.exists(artifact): if path.isdir(artifact): shutil.rmtree(artifact) else: os.remove(artifact) def angle_root(target, nuget_env): arch = { "aarch64": "arm64", "x86_64": "x64", } angle_arch = arch[target.split('-')[0]] package_name = "ANGLE.WindowsStore.Servo" import xml.etree.ElementTree as ET tree = ET.parse(os.path.join('support', 'hololens', 'ServoApp', 'packages.config')) root = tree.getroot() for package in root.iter('package'): if package.get('id') == package_name: package_version = package.get('version') break else: raise Exception("Couldn't locate ANGLE package") angle_default_path = path.join(os.getcwd(), "support", "hololens", "packages", package_name + "." + package_version, "bin", "UAP", angle_arch) # Nuget executable command nuget_app = path.join(os.getcwd(), "support", "hololens", "ServoApp.sln") if not os.path.exists(angle_default_path): check_call(['nuget.exe', 'restore', nuget_app], env=nuget_env) return angle_default_path def package_gstreamer_dylibs(servo_exe_dir): missing = [] gst_dylibs = macos_dylibs() + macos_plugins() for gst_lib in gst_dylibs: try: dest_path = os.path.join(servo_exe_dir, os.path.basename(gst_lib)) if os.path.isfile(dest_path): os.remove(dest_path) shutil.copy(gst_lib, servo_exe_dir) except Exception as e: print(e) missing += [str(gst_lib)] for gst_lib in missing: print("ERROR: could not find required GStreamer DLL: " + gst_lib) return not missing def package_gstreamer_dlls(env, servo_exe_dir, target, uwp): gst_root = gstreamer_root(target, env) if not gst_root: print("Could not find GStreamer installation directory.") return False # All the shared libraries required for starting up and loading plugins. gst_dlls = [ "avcodec-58.dll", "avfilter-7.dll", "avformat-58.dll", "avutil-56.dll", "bz2.dll", "ffi-7.dll", "gio-2.0-0.dll", "glib-2.0-0.dll", "gmodule-2.0-0.dll", "gobject-2.0-0.dll", "intl-8.dll", "orc-0.4-0.dll", "swresample-3.dll", "z-1.dll", ] gst_dlls += windows_dlls(uwp) if uwp: # These come from a more recent version of ffmpeg and # aren't present in the official GStreamer 1.16 release. gst_dlls += [ "avresample-4.dll", "postproc-55.dll", "swscale-5.dll", "x264-157.dll", ] else: # These are built with MinGW and are not yet compatible # with UWP's restrictions. gst_dlls += [ "graphene-1.0-0.dll", "libcrypto-1_1-x64.dll", "libgmp-10.dll", "libgnutls-30.dll", "libhogweed-4.dll", "libjpeg-8.dll", "libnettle-6.dll.", "libogg-0.dll", "libopus-0.dll", "libpng16-16.dll", "libssl-1_1-x64.dll", "libtasn1-6.dll", "libtheora-0.dll", "libtheoradec-1.dll", "libtheoraenc-1.dll", "libusrsctp-1.dll", "libvorbis-0.dll", "libvorbisenc-2.dll", "libwinpthread-1.dll", "nice-10.dll", ] missing = [] for gst_lib in gst_dlls: try: shutil.copy(path.join(gst_root, "bin", gst_lib), servo_exe_dir) except Exception: missing += [str(gst_lib)] for gst_lib in missing: print("ERROR: could not find required GStreamer DLL: " + gst_lib) if missing: return False # Only copy a subset of the available plugins. gst_dlls = windows_plugins(uwp) gst_plugin_path_root = os.environ.get("GSTREAMER_PACKAGE_PLUGIN_PATH") or gst_root gst_plugin_path = path.join(gst_plugin_path_root, "lib", "gstreamer-1.0") if not os.path.exists(gst_plugin_path): print("ERROR: couldn't find gstreamer plugins at " + gst_plugin_path) return False missing = [] for gst_lib in gst_dlls: try: shutil.copy(path.join(gst_plugin_path, gst_lib), servo_exe_dir) except Exception: missing += [str(gst_lib)] for gst_lib in missing: print("ERROR: could not find required GStreamer DLL: " + gst_lib) return not missing def package_msvc_dlls(servo_exe_dir, target, vcinstalldir, vs_version): # copy some MSVC DLLs to servo.exe dir msvc_redist_dir = None vs_platforms = { "x86_64": "x64", "i686": "x86", "aarch64": "arm64", } target_arch = target.split('-')[0] vs_platform = vs_platforms[target_arch] vc_dir = vcinstalldir or os.environ.get("VCINSTALLDIR", "") if not vs_version: vs_version = os.environ.get("VisualStudioVersion", "") msvc_deps = [ "msvcp140.dll", "vcruntime140.dll", ] if target_arch != "aarch64" and "uwp" not in target and vs_version in ("14.0", "15.0", "16.0"): msvc_deps += ["api-ms-win-crt-runtime-l1-1-0.dll"] # Check if it's Visual C++ Build Tools or Visual Studio 2015 vs14_vcvars = path.join(vc_dir, "vcvarsall.bat") is_vs14 = True if os.path.isfile(vs14_vcvars) or vs_version == "14.0" else False if is_vs14: msvc_redist_dir = path.join(vc_dir, "redist", vs_platform, "Microsoft.VC140.CRT") elif vs_version in ("15.0", "16.0"): redist_dir = path.join(vc_dir, "Redist", "MSVC") if os.path.isdir(redist_dir): for p in os.listdir(redist_dir)[::-1]: redist_path = path.join(redist_dir, p) for v in ["VC141", "VC142", "VC150", "VC160"]: # there are two possible paths # `x64\Microsoft.VC*.CRT` or `onecore\x64\Microsoft.VC*.CRT` redist1 = path.join(redist_path, vs_platform, "Microsoft.{}.CRT".format(v)) redist2 = path.join(redist_path, "onecore", vs_platform, "Microsoft.{}.CRT".format(v)) if os.path.isdir(redist1): msvc_redist_dir = redist1 break elif os.path.isdir(redist2): msvc_redist_dir = redist2 break if msvc_redist_dir: break if not msvc_redist_dir: print("Couldn't locate MSVC redistributable directory") return False redist_dirs = [ msvc_redist_dir, ] if "WindowsSdkDir" in os.environ: redist_dirs += [path.join(os.environ["WindowsSdkDir"], "Redist", "ucrt", "DLLs", vs_platform)] missing = [] for msvc_dll in msvc_deps: for dll_dir in redist_dirs: dll = path.join(dll_dir, msvc_dll) servo_dir_dll = path.join(servo_exe_dir, msvc_dll) if os.path.isfile(dll): if os.path.isfile(servo_dir_dll): # avoid permission denied error when overwrite dll in servo build directory os.chmod(servo_dir_dll, stat.S_IWUSR) shutil.copy(dll, servo_exe_dir) break else: missing += [msvc_dll] for msvc_dll in missing: print("DLL file `{}` not found!".format(msvc_dll)) return not missing
mpl-2.0
MalkIPP/ipp_work
ipp_work/simulations/ir_marg_rate.py
1
8481
# -*- coding: utf-8 -*- # OpenFisca -- A versatile microsimulation software # By: OpenFisca Team <contact@openfisca.fr> # # Copyright (C) 2011, 2012, 2013, 2014, 2015 OpenFisca Team # https://github.com/openfisca # # This file is part of OpenFisca. # # OpenFisca is free software; you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # OpenFisca is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. import pandas import logging import openfisca_france_data from openfisca_france_data.input_data_builders import get_input_data_frame from openfisca_france_data.surveys import SurveyScenario from openfisca_core.rates import average_rate from ipp_work.utils import from_simulation_to_data_frame_by_entity_key_plural log = logging.getLogger(__name__) def from_input_df_to_entity_key_plural_df(input_data_frame, tax_benefit_system, simulation, used_as_input_variables = None): ''' En entrée il faut: une input_data_frame une liste des variables nécessaires et leurs entités => il faut le tax_benefit_system Objectif: créer une input_data_frame_by_entity_key_plural Il faut ensuite créer une 2e fonction qui transforme cette df en Array ''' assert input_data_frame is not None assert tax_benefit_system is not None id_variables = [ entity.index_for_person_variable_name for entity in simulation.entity_by_key_singular.values() if not entity.is_persons_entity] role_variables = [ entity.role_for_person_variable_name for entity in simulation.entity_by_key_singular.values() if not entity.is_persons_entity] column_by_name = tax_benefit_system.column_by_name # Check 1 (ici ou dans la méthode de classe ?) for column_name in input_data_frame: if column_name not in column_by_name: log.info('Unknown column "{}" in survey, dropped from input table'.format(column_name)) # waiting for the new pandas version to hit Travis repo input_data_frame = input_data_frame.drop(column_name, axis = 1) # , inplace = True) # TODO: effet de bords ? # Check 2 (ici ou dans la méthode de classe ?) for column_name in input_data_frame: if column_name in id_variables + role_variables: continue #TODO: make that work ? (MG, may 15) # if column_by_name[column_name].formula_class.function is not None: # if column_name in column_by_name.used_as_input_variables: # log.info( # 'Column "{}" not dropped because present in used_as_input_variabels'.format(column_name)) # continue # # log.info('Column "{}" in survey set to be calculated, dropped from input table'.format(column_name)) # input_data_frame = input_data_frame.drop(column_name, axis = 1) # , inplace = True) # TODO: effet de bords ? # Work on entities for entity in simulation.entity_by_key_singular.values(): if entity.is_persons_entity: entity.count = entity.step_size = len(input_data_frame) else: entity.count = entity.step_size = (input_data_frame[entity.role_for_person_variable_name] == 0).sum() entity.roles_count = input_data_frame[entity.role_for_person_variable_name].max() + 1 # Classify column by entity: columns_by_entity = {} columns_by_entity['individu'] = [] columns_by_entity['quifam'] = [] columns_by_entity['quifoy'] = [] columns_by_entity['quimen'] = [] for column_name, column_serie in input_data_frame.iteritems(): holder = simulation.get_or_new_holder(column_name) entity = holder.entity if entity.is_persons_entity: columns_by_entity['individu'].append(column_name) else: columns_by_entity[entity.role_for_person_variable_name].append(column_name) input_data_frame_by_entity_key_plural = {} for entity in simulation.entity_by_key_singular.values(): if entity.is_persons_entity: input_data_frame_by_entity_key_plural['individus'] = \ input_data_frame[columns_by_entity['individu']] entity.count = entity.step_size = len(input_data_frame) else: input_data_frame_by_entity_key_plural[entity.index_for_person_variable_name] = \ input_data_frame[columns_by_entity[entity.role_for_person_variable_name]][input_data_frame[entity.role_for_person_variable_name] == 0] return input_data_frame_by_entity_key_plural def marginal_rate_survey(df, target = None, target_2 = None, varying = None, varying_2 = None): # target: numerator, varying: denominator return 1 - (df[target] - df[target_2]) / (df[varying] - df[varying_2]) def varying_survey_simulation(year = 2009, increment = 10, target = 'irpp', varying = 'rni', used_as_input_variables = None): TaxBenefitSystem = openfisca_france_data.init_country() tax_benefit_system = TaxBenefitSystem() input_data_frame = get_input_data_frame(year) # Simulation 1 : get varying and target survey_scenario = SurveyScenario().init_from_data_frame( input_data_frame = input_data_frame, used_as_input_variables = used_as_input_variables, year = year, tax_benefit_system = tax_benefit_system ) simulation = survey_scenario.new_simulation(debug = False) output_data_frame = pandas.DataFrame( dict([(name, simulation.calculate_add(name)) for name in [ target, varying, 'idfoy_original' ]])) # Make input_data_frame_by_entity_key_plural from the previous input_data_frame and simulation input_data_frames_by_entity_key_plural = \ from_input_df_to_entity_key_plural_df(input_data_frame, tax_benefit_system, simulation) foyers = input_data_frames_by_entity_key_plural['idfoy'] foyers = pandas.merge(foyers, output_data_frame, on = 'idfoy_original') # Incrementation of varying: foyers[varying] = foyers[varying] + increment # On remplace la nouvelle base dans le dictionnaire input_data_frames_by_entity_key_plural['idfoy'] = foyers # 2e simulation à partir de input_data_frame_by_entity_key_plural: # TODO: fix used_as_input_variabels in the from_input_df_to_entity_key_plural_df() function used_as_input_variables = used_as_input_variables + [varying] TaxBenefitSystem = openfisca_france_data.init_country() tax_benefit_system = TaxBenefitSystem() survey_scenario = SurveyScenario().init_from_data_frame( input_data_frame = None, input_data_frames_by_entity_key_plural = input_data_frames_by_entity_key_plural, used_as_input_variables = used_as_input_variables, year = year, tax_benefit_system = tax_benefit_system, ) simulation = survey_scenario.new_simulation(debug = False) output_data_frame2 = pandas.DataFrame( dict([(name, simulation.calculate_add(name)) for name in [ target, varying, 'idfoy_original' ]])) output_data_frame2.rename(columns = {varying: '{}_2'.format(varying), target: '{}_2'.format(target)}, inplace = True) merged = pandas.merge(output_data_frame, output_data_frame2, on = 'idfoy_original') merged['marginal_rate'] = marginal_rate_survey(merged, '{}'.format(target), '{}_2'.format(target), 'rni', 'rni_2') merged['average_rate'] = average_rate(target = merged[target], varying = merged[varying]) return merged if __name__ == '__main__': import logging import time log = logging.getLogger(__name__) import sys logging.basicConfig(level = logging.INFO, stream = sys.stdout) start = time.time() used_as_input_variables = ['salaire_imposable', 'cho', 'rst', 'age_en_mois', 'smic55'] merged = varying_survey_simulation(year = 2009, increment = 10, target = 'irpp', varying = 'rni', used_as_input_variables = used_as_input_variables)
agpl-3.0
agx/git-buildpackage
gbp/scripts/import_ref.py
1
8733
# vim: set fileencoding=utf-8 : # # (C) 2018 Michael Stapelberg <stapelberg@debian.org> # 2018 Guido Günther <agx@sigxcpu.org> # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program; if not, please see # <http://www.gnu.org/licenses/> # """Import a new upstream version from a git branch onto the Debian branch""" import os import sys import gbp.command_wrappers as gbpc from gbp.deb.git import GitRepositoryError from gbp.config import GbpOptionParserDebian, GbpOptionGroup from gbp.errors import GbpError import gbp.log from gbp.scripts.common import ExitCodes from gbp.deb.rollbackgit import RollbackDebianGitRepository from gbp.scripts.import_orig import (debian_branch_merge, postimport_hook, set_bare_repo_options, rollback) def get_commit_and_version_to_merge(repo, options): """ Get the commit and version we want to merge based on the --upstream-tag setting """ version = options.version if options.upstream_tree.upper() == 'VERSION': # Determine tag name from given version if not options.version: raise GbpError("No upstream version given, try -u<version>") commit = repo.version_to_tag(options.upstream_tag, options.version) elif options.upstream_tree.upper() == 'BRANCH': # Use head of upstrem branch if not repo.has_branch(options.upstream_branch): raise GbpError("%s is not a valid branch" % options.upstream_branch) commit = options.upstream_branch else: # Use whatever is passed in as commitish commit = "%s^{commit}" % options.upstream_tree return commit, version def build_parser(name): try: parser = GbpOptionParserDebian(command=os.path.basename(name), prefix='', usage='%prog [options] -u<upstream-version>') except GbpError as err: gbp.log.err(err) return None import_group = GbpOptionGroup(parser, "import options", "import related options") tag_group = GbpOptionGroup(parser, "tag options", "tag related options ") branch_group = GbpOptionGroup(parser, "version and branch naming options", "version number and branch layout options") cmd_group = GbpOptionGroup(parser, "external command options", "how and when to invoke external commands and hooks") for group in [import_group, branch_group, tag_group, cmd_group]: parser.add_option_group(group) branch_group.add_option("-u", "--upstream-version", dest="version", help="The version number to use for the new version, " "default is ''", default='') branch_group.add_config_file_option(option_name="debian-branch", dest="debian_branch") branch_group.add_config_file_option(option_name="upstream-branch", dest="upstream_branch") branch_group.add_config_file_option(option_name="upstream-tree", dest="upstream_tree", help="Where to merge the upstream changes from.", default="VERSION") branch_group.add_config_file_option(option_name="merge-mode", dest="merge_mode") tag_group.add_boolean_config_file_option(option_name="sign-tags", dest="sign_tags") tag_group.add_config_file_option(option_name="keyid", dest="keyid") tag_group.add_config_file_option(option_name="upstream-tag", dest="upstream_tag") import_group.add_config_file_option(option_name="import-msg", dest="import_msg") cmd_group.add_config_file_option(option_name="postimport", dest="postimport") parser.add_boolean_config_file_option(option_name="rollback", dest="rollback") parser.add_option("-v", "--verbose", action="store_true", dest="verbose", default=False, help="verbose command execution") parser.add_config_file_option(option_name="color", dest="color", type='tristate') parser.add_config_file_option(option_name="color-scheme", dest="color_scheme") return parser def parse_args(argv): """Parse the command line arguments @return: options and arguments """ parser = build_parser(argv[0]) if not parser: return None, None (options, args) = parser.parse_args(argv[1:]) gbp.log.setup(options.color, options.verbose, options.color_scheme) return options, args def main(argv): ret = 0 repo = None (options, args) = parse_args(argv) if not options: return ExitCodes.parse_error # TODO: honor --filter option # TODO: add --filter-with-copyright which takes d/copyright into account # TODO: handle automatic versions based on timestamp + sha1 # TODO: handle updating of upstream branch from remote gbp.log.warn("This script is experimental, it might change incompatibly between versions.") try: try: repo = RollbackDebianGitRepository('.') except GitRepositoryError: raise GbpError("%s is not a git repository" % (os.path.abspath('.'))) commit, version = get_commit_and_version_to_merge(repo, options) is_empty = repo.is_empty() (clean, out) = repo.is_clean() if not clean and not is_empty: gbp.log.err("Repository has uncommitted changes, commit these first: ") raise GbpError(out) if repo.bare: set_bare_repo_options(options) try: tag = repo.version_to_tag(options.upstream_tag, version) if not repo.has_tag(tag): gbp.log.info("Upstream tag '%s' not found. Creating it for you." % tag) repo.create_tag(name=tag, msg="Upstream version %s" % version, commit="%s^0" % commit, sign=options.sign_tags, keyid=options.keyid) if is_empty: repo.create_branch(branch=options.debian_branch, rev=commit) repo.force_head(options.debian_branch, hard=True) # In an empty repo avoid master branch defaulted to by # git and check out debian branch instead. if not repo.bare: cur = repo.branch if cur != options.debian_branch: repo.set_branch(options.debian_branch) repo.delete_branch(cur) else: repo.rrr_branch(options.debian_branch) debian_branch_merge(repo, tag, version, options) # Update working copy and index if we've possibly updated the # checked out branch current_branch = repo.get_branch() if current_branch in [options.upstream_branch, repo.pristine_tar_branch]: repo.force_head(current_branch, hard=True) postimport_hook(repo, tag, version, options) except (gbpc.CommandExecFailed, GitRepositoryError) as err: msg = str(err) or 'Unknown error, please report a bug' raise GbpError("Import of %s failed: %s" % (commit, msg)) except KeyboardInterrupt: raise GbpError("Import of %s failed: aborted by user" % (options.git_ref)) except GbpError as err: if str(err): gbp.log.err(err) ret = 1 rollback(repo, options) if not ret: gbp.log.info("Successfully imported version %s" % (version)) return ret if __name__ == "__main__": sys.exit(main(sys.argv)) # vim:et:ts=4:sw=4:et:sts=4:ai:set list listchars=tab\:»·,trail\:·:
gpl-2.0
yodalee/servo
tests/wpt/web-platform-tests/tools/py/testing/log/test_warning.py
161
2253
import pytest import py mypath = py.path.local(__file__).new(ext=".py") @pytest.mark.xfail def test_forwarding_to_warnings_module(): pytest.deprecated_call(py.log._apiwarn, "1.3", "..") def test_apiwarn_functional(recwarn): capture = py.io.StdCapture() py.log._apiwarn("x.y.z", "something", stacklevel=1) out, err = capture.reset() py.builtin.print_("out", out) py.builtin.print_("err", err) assert err.find("x.y.z") != -1 lno = py.code.getrawcode(test_apiwarn_functional).co_firstlineno + 2 exp = "%s:%s" % (mypath, lno) assert err.find(exp) != -1 def test_stacklevel(recwarn): def f(): py.log._apiwarn("x", "some", stacklevel=2) # 3 # 4 capture = py.io.StdCapture() f() out, err = capture.reset() lno = py.code.getrawcode(test_stacklevel).co_firstlineno + 6 warning = str(err) assert warning.find(":%s" % lno) != -1 def test_stacklevel_initpkg_with_resolve(testdir, recwarn): testdir.makepyfile(modabc=""" import py def f(): py.log._apiwarn("x", "some", stacklevel="apipkg123") """) testdir.makepyfile(apipkg123=""" def __getattr__(): import modabc modabc.f() """) p = testdir.makepyfile(""" import apipkg123 apipkg123.__getattr__() """) capture = py.io.StdCapture() p.pyimport() out, err = capture.reset() warning = str(err) loc = 'test_stacklevel_initpkg_with_resolve.py:2' assert warning.find(loc) != -1 def test_stacklevel_initpkg_no_resolve(recwarn): def f(): py.log._apiwarn("x", "some", stacklevel="apipkg") capture = py.io.StdCapture() f() out, err = capture.reset() lno = py.code.getrawcode(test_stacklevel_initpkg_no_resolve).co_firstlineno + 2 warning = str(err) assert warning.find(":%s" % lno) != -1 def test_function(recwarn): capture = py.io.StdCapture() py.log._apiwarn("x.y.z", "something", function=test_function) out, err = capture.reset() py.builtin.print_("out", out) py.builtin.print_("err", err) assert err.find("x.y.z") != -1 lno = py.code.getrawcode(test_function).co_firstlineno exp = "%s:%s" % (mypath, lno) assert err.find(exp) != -1
mpl-2.0
quasiben/bokeh
examples/plotting/server/selection_histogram.py
4
3752
# You must first run "bokeh serve" to view this example import numpy as np from bokeh.client import push_session from bokeh.models import BoxSelectTool, LassoSelectTool, Paragraph from bokeh.plotting import curdoc, figure, hplot, vplot # create three normal population samples with different parameters x1 = np.random.normal(loc=5.0, size=400) * 100 y1 = np.random.normal(loc=10.0, size=400) * 10 x2 = np.random.normal(loc=5.0, size=800) * 50 y2 = np.random.normal(loc=5.0, size=800) * 10 x3 = np.random.normal(loc=55.0, size=200) * 10 y3 = np.random.normal(loc=4.0, size=200) * 10 x = np.concatenate((x1, x2, x3)) y = np.concatenate((y1, y2, y3)) TOOLS="pan,wheel_zoom,box_select,lasso_select" # create the scatter plot p = figure(tools=TOOLS, plot_width=600, plot_height=600, title=None, min_border=10, min_border_left=50) r = p.scatter(x, y, size=3, color="#3A5785", alpha=0.6) p.select(BoxSelectTool).select_every_mousemove = False p.select(LassoSelectTool).select_every_mousemove = False # create the horizontal histogram hhist, hedges = np.histogram(x, bins=20) hzeros = np.zeros(len(hedges)-1) hmax = max(hhist)*1.1 LINE_ARGS = dict(color="#3A5785", line_color=None) ph = figure(toolbar_location=None, plot_width=p.plot_width, plot_height=200, x_range=p.x_range, y_range=(-hmax, hmax), title=None, min_border=10, min_border_left=50) ph.xgrid.grid_line_color = None ph.quad(bottom=0, left=hedges[:-1], right=hedges[1:], top=hhist, color="white", line_color="#3A5785") hh1 = ph.quad(bottom=0, left=hedges[:-1], right=hedges[1:], top=hzeros, alpha=0.5, **LINE_ARGS) hh2 = ph.quad(bottom=0, left=hedges[:-1], right=hedges[1:], top=hzeros, alpha=0.1, **LINE_ARGS) # create the vertical histogram vhist, vedges = np.histogram(y, bins=20) vzeros = np.zeros(len(vedges)-1) vmax = max(vhist)*1.1 th = 42 # need to adjust for toolbar height, unfortunately pv = figure(toolbar_location=None, plot_width=200, plot_height=p.plot_height+th-10, x_range=(-vmax, vmax), y_range=p.y_range, title=None, min_border=10, min_border_top=th) pv.ygrid.grid_line_color = None pv.xaxis.major_label_orientation = -3.14/2 pv.quad(left=0, bottom=vedges[:-1], top=vedges[1:], right=vhist, color="white", line_color="#3A5785") vh1 = pv.quad(left=0, bottom=vedges[:-1], top=vedges[1:], right=vzeros, alpha=0.5, **LINE_ARGS) vh2 = pv.quad(left=0, bottom=vedges[:-1], top=vedges[1:], right=vzeros, alpha=0.1, **LINE_ARGS) # NOTE: Version 0.11 has introduced auto spacing by default on VBox/HBox/vplot/hplot # so for now we must tweak some spacing and borders to have it closely # aligned. pv.min_border_top = 80 pv.min_border_left = 0 ph.min_border_top = 10 ph.min_border_right = 10 p.min_border_right = 10 layout = vplot(hplot(p, pv), hplot(ph, Paragraph(width=200)), width=800, height=800) # open a session to keep our local document in sync with server session = push_session(curdoc()) def update(attr, old, new): inds = np.array(new['1d']['indices']) if len(inds) == 0 or len(inds) == len(x): hhist1, hhist2 = hzeros, hzeros vhist1, vhist2 = vzeros, vzeros else: neg_inds = np.ones_like(x, dtype=np.bool) neg_inds[inds] = False hhist1, _ = np.histogram(x[inds], bins=hedges) vhist1, _ = np.histogram(y[inds], bins=vedges) hhist2, _ = np.histogram(x[neg_inds], bins=hedges) vhist2, _ = np.histogram(y[neg_inds], bins=vedges) hh1.data_source.data["top"] = hhist1 hh2.data_source.data["top"] = -hhist2 vh1.data_source.data["right"] = vhist1 vh2.data_source.data["right"] = -vhist2 r.data_source.on_change('selected', update) session.show(layout) # open the document in a browser session.loop_until_closed() # run forever
bsd-3-clause
shownomercy/django
django/conf/locale/lt/formats.py
504
1830
# -*- encoding: utf-8 -*- # This file is distributed under the same license as the Django package. # from __future__ import unicode_literals # The *_FORMAT strings use the Django date format syntax, # see http://docs.djangoproject.com/en/dev/ref/templates/builtins/#date DATE_FORMAT = r'Y \m. E j \d.' TIME_FORMAT = 'H:i' DATETIME_FORMAT = r'Y \m. E j \d., H:i' YEAR_MONTH_FORMAT = r'Y \m. F' MONTH_DAY_FORMAT = r'E j \d.' SHORT_DATE_FORMAT = 'Y-m-d' SHORT_DATETIME_FORMAT = 'Y-m-d H:i' FIRST_DAY_OF_WEEK = 1 # Monday # The *_INPUT_FORMATS strings use the Python strftime format syntax, # see http://docs.python.org/library/datetime.html#strftime-strptime-behavior DATE_INPUT_FORMATS = [ '%Y-%m-%d', '%d.%m.%Y', '%d.%m.%y', # '2006-10-25', '25.10.2006', '25.10.06' ] TIME_INPUT_FORMATS = [ '%H:%M:%S', # '14:30:59' '%H:%M:%S.%f', # '14:30:59.000200' '%H:%M', # '14:30' '%H.%M.%S', # '14.30.59' '%H.%M.%S.%f', # '14.30.59.000200' '%H.%M', # '14.30' ] DATETIME_INPUT_FORMATS = [ '%Y-%m-%d %H:%M:%S', # '2006-10-25 14:30:59' '%Y-%m-%d %H:%M:%S.%f', # '2006-10-25 14:30:59.000200' '%Y-%m-%d %H:%M', # '2006-10-25 14:30' '%d.%m.%Y %H:%M:%S', # '25.10.2006 14:30:59' '%d.%m.%Y %H:%M:%S.%f', # '25.10.2006 14:30:59.000200' '%d.%m.%Y %H:%M', # '25.10.2006 14:30' '%d.%m.%Y', # '25.10.2006' '%d.%m.%y %H:%M:%S', # '25.10.06 14:30:59' '%d.%m.%y %H:%M:%S.%f', # '25.10.06 14:30:59.000200' '%d.%m.%y %H:%M', # '25.10.06 14:30' '%d.%m.%y %H.%M.%S', # '25.10.06 14.30.59' '%d.%m.%y %H.%M.%S.%f', # '25.10.06 14.30.59.000200' '%d.%m.%y %H.%M', # '25.10.06 14.30' '%d.%m.%y', # '25.10.06' ] DECIMAL_SEPARATOR = ',' THOUSAND_SEPARATOR = '.' NUMBER_GROUPING = 3
bsd-3-clause
uwcirg/true_nth_usa_portal
tests/test_portal.py
1
11562
"""Unit test module for portal views""" from datetime import datetime import tempfile import urllib from flask_swagger import swagger from flask_webtest import SessionScope from swagger_spec_validator import validate_spec_url from portal.config.config import TestConfig from portal.extensions import db from portal.factories.app import create_app from portal.models.intervention import INTERVENTION, UserIntervention from portal.models.message import EmailMessage from portal.models.organization import Organization from portal.models.role import ROLE from portal.models.user import User, get_user from tests import OAUTH_INFO_PROVIDER_LOGIN, TEST_USER_ID, TestCase class TestPortal(TestCase): """Portal view tests""" def test_card_html(self): """Interventions can customize the button text """ client = self.add_client() intervention = INTERVENTION.DECISION_SUPPORT_P3P intervention.public_access = True # make the card avail for the test client.intervention = intervention intervention.card_html = "Custom Label" self.login() self.add_required_clinical_data() self.bless_with_basics(make_patient=False) response = self.client.get('/home') assert response.status_code == 200 assert 'Custom Label' in response.get_data(as_text=True) intervention = db.session.merge(intervention) assert intervention.card_html in response.get_data(as_text=True) def test_user_card_html(self): """Interventions can further customize per user""" client = self.add_client() intervention = INTERVENTION.DECISION_SUPPORT_P3P intervention.public_access = True # make the card avail for the test client.intervention = intervention ui = UserIntervention( user_id=TEST_USER_ID, intervention_id=intervention.id) ui.card_html = "<b>Bold Card Text</b>" ui.link_label = "Custom User Label" ui.link_url = 'http://example.com/?test=param1' with SessionScope(db): db.session.add(ui) db.session.commit() self.login() self.add_required_clinical_data() self.bless_with_basics(make_patient=False) user = db.session.merge(self.test_user) response = self.client.get('/home') assert response.status_code == 200 ui = db.session.merge(ui) assert ui.card_html in response.get_data(as_text=True) assert ui.link_label in response.get_data(as_text=True) assert ui.link_url in response.get_data(as_text=True) intervention = db.session.merge(intervention) assert ( intervention.display_for_user(user).link_label in response.get_data(as_text=True)) def test_staff_html(self): """Interventions can customize the staff text """ client = self.add_client() intervention = INTERVENTION.sexual_recovery client.intervention = intervention ui = UserIntervention( user_id=TEST_USER_ID, intervention_id=intervention.id) ui.staff_html = "Custom text for <i>staff</i>" with SessionScope(db): db.session.add(ui) db.session.commit() self.bless_with_basics() self.login() self.promote_user(role_name=ROLE.INTERVENTION_STAFF.value) # This test requires PATIENT_LIST_ADDL_FIELDS includes the # 'reports' field self.app.config['PATIENT_LIST_ADDL_FIELDS'] = ['reports'] response = self.client.get('/patients/') ui = db.session.merge(ui) results = response.get_data(as_text=True) assert ui.staff_html in results def test_public_access(self): """Interventions w/o public access should be hidden""" client = self.add_client() intervention = INTERVENTION.sexual_recovery client.intervention = intervention intervention.public_access = False self.login() self.add_required_clinical_data() self.bless_with_basics() response = self.client.get('/home') assert 'Sexual Recovery' not in response.get_data(as_text=True) # now give just the test user access intervention = db.session.merge(intervention) ui = UserIntervention( user_id=TEST_USER_ID, intervention_id=intervention.id, access="granted") with SessionScope(db): db.session.add(ui) db.session.commit() response = self.client.get('/home') assert 'Sexual Recovery' in response.get_data(as_text=True) def test_admin_list(self): """Test admin view lists all users""" # Generate a few users with a smattering of roles u1 = self.add_user(username='u1@foo.bar') u2 = self.add_user(username='u2@bar.foo') self.promote_user(u1, role_name=ROLE.ADMIN.value) self.promote_user(u2, role_name=ROLE.APPLICATION_DEVELOPER.value) # Test user needs admin role to view list self.promote_user(role_name=ROLE.ADMIN.value) self.login() response = self.client.get('/admin') # Should at least see an entry per user in system assert (response.get_data(as_text=True).count('/profile') >= User.query.count()) def test_invite(self): """Test email invite form""" test_user = User.query.get(TEST_USER_ID) test_user.email = 'test_user@uw.edu' db.session.add(test_user) db.session.commit() self.login() postdata = { 'subject': 'unittest subject', 'recipients': 'test_user@yahoo.com test_user@uw.edu', 'body': "Ode to joy"} response = self.client.post('/invite', data=postdata, follow_redirects=True) assert "Email Invite Sent" in response.get_data(as_text=True) def test_message_sent(self): """Email invites - test view for sent messages""" sent_at = datetime.strptime( "2000/01/01 12:31:00", "%Y/%m/%d %H:%M:%S") message = EmailMessage( subject='a subject', user_id=TEST_USER_ID, sender="testuser@email.com", body='Welcome to testing \u2713', sent_at=sent_at, recipients="one@ex1.com two@two.org") db.session.add(message) db.session.commit() # confirm styling unicode functions body = message.style_message(message.body) assert 'DOCTYPE' in body assert 'style' in body assert isinstance(body, str) self.login() response = self.client.get('/invite/{0}'.format(message.id)) assert (response.get_data(as_text=True).find( sent_at.strftime('%m/%d/%Y %H:%M:%S')) > 0) assert (response.get_data(as_text=True).find('one@ex1.com two@two.org') > 0) def test_missing_message(self): """Request to view non existant message should 404""" self.login() response = self.client.get('/invite/404') assert response.status_code == 404 def test_swagger_docgen(self): """Build swagger docs for entire project""" expected_keys = ( 'info', 'paths', 'swagger', 'definitions', ) swag = swagger(self.client.application) for key in expected_keys: assert key in swag def test_swagger_validation(self): """Ensure our swagger spec matches swagger schema""" with tempfile.NamedTemporaryFile( prefix='swagger_test_', suffix='.json', delete=True, ) as temp_spec: temp_spec.write(self.client.get('/spec').data) temp_spec.seek(0) validate_spec_url("file:%s" % temp_spec.name) def test_report_error(self): self.login() params = { 'subject_id': 112, 'page_url': '/not/real', 'message': 'creative test string' } response = self.client.get('/report-error?{}'.format( urllib.parse.urlencode(params))) assert response.status_code == 200 def test_configuration_settings(self): self.login() lr_group = self.app.config['LR_GROUP'] response = self.client.get('/api/settings/lr_group') assert response.status_code == 200 assert response.json.get('LR_GROUP') == lr_group response2 = self.client.get('/api/settings/bad_value') assert response2.status_code == 400 def test_configuration_secrets(self): """Ensure config keys containing secrets are not exposed""" blacklist = ( 'SECRET', 'URI', 'SQL', ) response = self.client.get('/api/settings') assert response.status_code == 200 assert not any( any(k in config_key for k in blacklist) for config_key in response.json ) class TestPortalEproms(TestCase): """Portal views depending on eproms blueprint""" def create_app(self): """ Overload base version to hide the GIL (allows registration of ePROMs) """ tc = TestConfig() setattr(tc, 'HIDE_GIL', True) self._app = create_app(tc) return self._app def test_redirect_validation(self): self.promote_user(role_name=ROLE.ADMIN.value) self.promote_user(role_name=ROLE.STAFF.value) org = Organization(name='test org') user = get_user(TEST_USER_ID) with SessionScope(db): db.session.add(org) user.organizations.append(org) db.session.commit() self.login() client = self.add_client() client_url = client._redirect_uris local_url = "http://{}/home?test".format( self.app.config.get('SERVER_NAME')) invalid_url = 'http://invalid.org' # validate redirect of /website-consent-script GET response = self.client.get( '/website-consent-script/{}'.format(TEST_USER_ID), query_string={'redirect_url': local_url} ) assert response.status_code == 200 response2 = self.client.get( '/website-consent-script/{}'.format(TEST_USER_ID), query_string={'redirect_url': invalid_url} ) assert response2.status_code == 401 # validate session login redirect with valid url oauth_info = { 'user_id': TEST_USER_ID, 'next': client_url, } response3 = self.login(oauth_info=oauth_info) assert response3.status_code == 200 # validate session login redirect with invalid url oauth_info['next'] = invalid_url response4 = self.login(oauth_info=oauth_info) assert response4.status_code == 401 # validate provider login redirect with invalid url oauth_info = dict(OAUTH_INFO_PROVIDER_LOGIN) oauth_info['next'] = invalid_url response5 = self.login(oauth_info=oauth_info) assert response5.status_code == 401 # validate redirect of /challenge POST formdata = {'user_id': TEST_USER_ID, 'next_url': local_url} response6 = self.client.post('/challenge', data=formdata) assert response6.status_code == 200 formdata['next_url'] = invalid_url response7 = self.client.post('/challenge', data=formdata) assert response7.status_code == 401
bsd-3-clause
andersinno/foosball
config/settings/production.py
1
4603
# -*- coding: utf-8 -*- """ Production Configurations """ from __future__ import absolute_import, unicode_literals from django.utils import six from .common import * # noqa # Enable social integration plugins SOCIAL_ACCOUNTS = ( 'allauth.socialaccount.providers.google', 'allauth.socialaccount.providers.facebook', ) INSTALLED_APPS += SOCIAL_ACCOUNTS # SECRET CONFIGURATION # ------------------------------------------------------------------------------ # See: https://docs.djangoproject.com/en/dev/ref/settings/#secret-key # Raises ImproperlyConfigured exception if DJANGO_SECRET_KEY not in os.environ SECRET_KEY = env("DJANGO_SECRET_KEY") # This ensures that Django will be able to detect a secure connection SECURE_PROXY_SSL_HEADER = ('HTTP_X_FORWARDED_PROTO', 'https') SECURITY_MIDDLEWARE = ( 'django.middleware.security.SecurityMiddleware', ) # Make sure SecurityMiddleware is listed first MIDDLEWARE_CLASSES = SECURITY_MIDDLEWARE + MIDDLEWARE_CLASSES SESSION_COOKIE_SECURE = True SESSION_COOKIE_HTTPONLY = True SECURE_SSL_REDIRECT = True ACCOUNT_DEFAULT_HTTP_PROTOCOL = "https" # SITE CONFIGURATION # ------------------------------------------------------------------------------ # Hosts/domain names that are valid for this site # See https://docs.djangoproject.com/en/1.6/ref/settings/#allowed-hosts ALLOWED_HOSTS = env.list('DJANGO_ALLOWED_HOSTS', default=['foosball.anders.fi']) # END SITE CONFIGURATION # EMAIL # ------------------------------------------------------------------------------ DEFAULT_FROM_EMAIL = env('DJANGO_DEFAULT_FROM_EMAIL', default='foosball <noreply@foosball.anders.fi>') EMAIL_SUBJECT_PREFIX = env("DJANGO_EMAIL_SUBJECT_PREFIX", default='[foosball] ') SERVER_EMAIL = env('DJANGO_SERVER_EMAIL', default=DEFAULT_FROM_EMAIL) # TEMPLATE CONFIGURATION # ------------------------------------------------------------------------------ # See: # https://docs.djangoproject.com/en/dev/ref/templates/api/#django.template.loaders.cached.Loader TEMPLATES[1]['OPTIONS']['loaders'] = [ ('django.template.loaders.cached.Loader', [ 'django.template.loaders.filesystem.Loader', 'django.template.loaders.app_directories.Loader', ]), ] # DATABASE CONFIGURATION # ------------------------------------------------------------------------------ # Raises ImproperlyConfigured exception if DATABASE_URL not in os.environ DATABASES['default'] = env.db("DATABASE_URL") # CACHING # ------------------------------------------------------------------------------ CACHES = { "default": { "BACKEND": "django_redis.cache.RedisCache", "LOCATION": "{0}/{1}".format(env('REDIS_URL', default="redis://127.0.0.1:6379"), 0), "OPTIONS": { "CLIENT_CLASS": "django_redis.client.DefaultClient", "IGNORE_EXCEPTIONS": True, # mimics memcache behavior. # http://niwinz.github.io/django-redis/latest/#_memcached_exceptions_behavior } } } # LOGGING CONFIGURATION # ------------------------------------------------------------------------------ # See: https://docs.djangoproject.com/en/dev/ref/settings/#logging # A sample logging configuration. The only tangible logging # performed by this configuration is to send an email to # the site admins on every HTTP 500 error when DEBUG=False. # See http://docs.djangoproject.com/en/dev/topics/logging for # more details on how to customize your logging configuration. LOGGING = { 'version': 1, 'disable_existing_loggers': False, 'filters': { 'require_debug_false': { '()': 'django.utils.log.RequireDebugFalse' } }, 'formatters': { 'verbose': { 'format': '%(levelname)s %(asctime)s %(module)s ' '%(process)d %(thread)d %(message)s' }, }, 'handlers': { 'mail_admins': { 'level': 'ERROR', 'filters': ['require_debug_false'], 'class': 'django.utils.log.AdminEmailHandler' }, 'console': { 'level': 'DEBUG', 'class': 'logging.StreamHandler', 'formatter': 'verbose', }, }, 'loggers': { 'django.request': { 'handlers': ['mail_admins'], 'level': 'ERROR', 'propagate': True }, 'django.security.DisallowedHost': { 'level': 'ERROR', 'handlers': ['console', 'mail_admins'], 'propagate': True } } } # Custom Admin URL, use {% url 'admin:index' %} ADMIN_URL = env('DJANGO_ADMIN_URL')
mit
ducthien1490/youtube-dl
youtube_dl/extractor/instagram.py
93
4498
from __future__ import unicode_literals import re from .common import InfoExtractor from ..utils import ( int_or_none, limit_length, ) class InstagramIE(InfoExtractor): _VALID_URL = r'https://instagram\.com/p/(?P<id>[\da-zA-Z]+)' _TEST = { 'url': 'https://instagram.com/p/aye83DjauH/?foo=bar#abc', 'md5': '0d2da106a9d2631273e192b372806516', 'info_dict': { 'id': 'aye83DjauH', 'ext': 'mp4', 'uploader_id': 'naomipq', 'title': 'Video by naomipq', 'description': 'md5:1f17f0ab29bd6fe2bfad705f58de3cb8', } } def _real_extract(self, url): video_id = self._match_id(url) webpage = self._download_webpage(url, video_id) uploader_id = self._search_regex(r'"owner":{"username":"(.+?)"', webpage, 'uploader id', fatal=False) desc = self._search_regex(r'"caption":"(.*?)"', webpage, 'description', fatal=False) return { 'id': video_id, 'url': self._og_search_video_url(webpage, secure=False), 'ext': 'mp4', 'title': 'Video by %s' % uploader_id, 'thumbnail': self._og_search_thumbnail(webpage), 'uploader_id': uploader_id, 'description': desc, } class InstagramUserIE(InfoExtractor): _VALID_URL = r'https://instagram\.com/(?P<username>[^/]{2,})/?(?:$|[?#])' IE_DESC = 'Instagram user profile' IE_NAME = 'instagram:user' _TEST = { 'url': 'https://instagram.com/porsche', 'info_dict': { 'id': 'porsche', 'title': 'porsche', }, 'playlist_mincount': 2, 'playlist': [{ 'info_dict': { 'id': '614605558512799803_462752227', 'ext': 'mp4', 'title': '#Porsche Intelligent Performance.', 'thumbnail': 're:^https?://.*\.jpg', 'uploader': 'Porsche', 'uploader_id': 'porsche', 'timestamp': 1387486713, 'upload_date': '20131219', }, }], 'params': { 'extract_flat': True, 'skip_download': True, } } def _real_extract(self, url): mobj = re.match(self._VALID_URL, url) uploader_id = mobj.group('username') entries = [] page_count = 0 media_url = 'http://instagram.com/%s/media' % uploader_id while True: page = self._download_json( media_url, uploader_id, note='Downloading page %d ' % (page_count + 1), ) page_count += 1 for it in page['items']: if it.get('type') != 'video': continue like_count = int_or_none(it.get('likes', {}).get('count')) user = it.get('user', {}) formats = [{ 'format_id': k, 'height': v.get('height'), 'width': v.get('width'), 'url': v['url'], } for k, v in it['videos'].items()] self._sort_formats(formats) thumbnails_el = it.get('images', {}) thumbnail = thumbnails_el.get('thumbnail', {}).get('url') # In some cases caption is null, which corresponds to None # in python. As a result, it.get('caption', {}) gives None title = (it.get('caption') or {}).get('text', it['id']) entries.append({ 'id': it['id'], 'title': limit_length(title, 80), 'formats': formats, 'thumbnail': thumbnail, 'webpage_url': it.get('link'), 'uploader': user.get('full_name'), 'uploader_id': user.get('username'), 'like_count': like_count, 'timestamp': int_or_none(it.get('created_time')), }) if not page['items']: break max_id = page['items'][-1]['id'] media_url = ( 'http://instagram.com/%s/media?max_id=%s' % ( uploader_id, max_id)) return { '_type': 'playlist', 'entries': entries, 'id': uploader_id, 'title': uploader_id, }
unlicense
bloopletech/Comix
src/preferences.py
6
22727
"""preferences.py - Preference handler.""" import os import cPickle import gtk import pango import constants import labels ZOOM_MODE_BEST = 0 ZOOM_MODE_WIDTH = 1 ZOOM_MODE_HEIGHT = 2 ZOOM_MODE_MANUAL = 3 # All the preferences are stored here. prefs = { 'comment extensions': ['txt', 'nfo'], 'auto load last file': False, 'page of last file': 1, 'path to last file': '', 'auto open next archive': True, 'bg colour': (5000, 5000, 5000), 'checkered bg for transparent images': True, 'cache': True, 'stretch': False, 'default double page': False, 'default fullscreen': False, 'default zoom mode': ZOOM_MODE_BEST, 'default manga mode': False, 'lens magnification': 2, 'lens size': 200, 'no double page for wide images': False, 'double step in double page mode': True, 'show page numbers on thumbnails': True, 'thumbnail size': 80, 'create thumbnails': True, 'slideshow delay': 3000, 'smart space scroll': True, 'flip with wheel': False, 'smart bg': False, 'store recent file info': True, 'hide all': False, 'hide all in fullscreen': True, 'stored hide all values': (True, True, True, True, True), 'path of last browsed in filechooser': constants.HOME_DIR, 'last filter in main filechooser': 0, 'last filter in library filechooser': 1, 'show menubar': True, 'show scrollbar': True, 'show statusbar': True, 'show toolbar': True, 'show thumbnails': True, 'rotation': 0, 'auto rotate from exif': True, 'vertical flip': False, 'horizontal flip': False, 'keep transformation': False, 'window height': gtk.gdk.screen_get_default().get_height() * 3 // 4, 'window width': min(gtk.gdk.screen_get_default().get_width() * 3 // 4, gtk.gdk.screen_get_default().get_height() * 5 // 8), 'library cover size': 128, 'auto add books into collections': True, 'last library collection': None, 'lib window height': gtk.gdk.screen_get_default().get_height() * 3 // 4, 'lib window width': gtk.gdk.screen_get_default().get_width() * 3 // 4 } _config_path = os.path.join(constants.CONFIG_DIR, 'preferences.pickle') _dialog = None class _PreferencesDialog(gtk.Dialog): """The preferences dialog where most (but not all) settings that are saved between sessions are presented to the user. """ def __init__(self, window): self._window = window gtk.Dialog.__init__(self, _('Preferences'), window, 0, (gtk.STOCK_CLOSE, gtk.RESPONSE_CLOSE)) self.connect('response', self._response) self.set_has_separator(False) self.set_resizable(True) self.set_default_response(gtk.RESPONSE_CLOSE) notebook = gtk.Notebook() self.vbox.pack_start(notebook) self.set_border_width(4) notebook.set_border_width(6) # ---------------------------------------------------------------- # The "Appearance" tab. # ---------------------------------------------------------------- page = _PreferencePage(80) page.new_section(_('Background')) fixed_bg_button = gtk.RadioButton(None, '%s:' % _('Use this colour as background')) fixed_bg_button.set_tooltip_text( _('Always use this selected colour as the background colour.')) color_button = gtk.ColorButton(gtk.gdk.Color(*prefs['bg colour'])) color_button.connect('color_set', self._color_button_cb) page.add_row(fixed_bg_button, color_button) dynamic_bg_button = gtk.RadioButton(fixed_bg_button, _('Use dynamic background colour.')) dynamic_bg_button.set_active(prefs['smart bg']) dynamic_bg_button.connect('toggled', self._check_button_cb, 'smart bg') dynamic_bg_button.set_tooltip_text( _('Automatically pick a background colour that fits the viewed image.')) page.add_row(dynamic_bg_button) page.new_section(_('Thumbnails')) label = gtk.Label('%s:' % _('Thumbnail size (in pixels)')) adjustment = gtk.Adjustment(prefs['thumbnail size'], 20, 128, 1, 10) thumb_size_spinner = gtk.SpinButton(adjustment) thumb_size_spinner.connect('value_changed', self._spinner_cb, 'thumbnail size') page.add_row(label, thumb_size_spinner) thumb_number_button = gtk.CheckButton( _('Show page numbers on thumbnails.')) thumb_number_button.set_active( prefs['show page numbers on thumbnails']) thumb_number_button.connect('toggled', self._check_button_cb, 'show page numbers on thumbnails') page.add_row(thumb_number_button) page.new_section(_('Magnifying Glass')) label = gtk.Label('%s:' % _('Magnifying glass size (in pixels)')) adjustment = gtk.Adjustment(prefs['lens size'], 50, 400, 1, 10) glass_size_spinner = gtk.SpinButton(adjustment) glass_size_spinner.connect('value_changed', self._spinner_cb, 'lens size') glass_size_spinner.set_tooltip_text( _('Set the size of the magnifying glass. It is a square with a side of this many pixels.')) page.add_row(label, glass_size_spinner) label = gtk.Label('%s:' % _('Magnification factor')) adjustment = gtk.Adjustment(prefs['lens magnification'], 1.1, 10.0, 0.1, 1.0) glass_magnification_spinner = gtk.SpinButton(adjustment, digits=1) glass_magnification_spinner.connect('value_changed', self._spinner_cb, 'lens magnification') glass_magnification_spinner.set_tooltip_text( _('Set the magnification factor of the magnifying glass.')) page.add_row(label, glass_magnification_spinner) page.new_section(_('Image scaling')) stretch_button = gtk.CheckButton(_('Stretch small images.')) stretch_button.set_active(prefs['stretch']) stretch_button.connect('toggled', self._check_button_cb, 'stretch') stretch_button.set_tooltip_text( _('Stretch images to a size that is larger than their original size if the current zoom mode requests it. If this preference is unset, images are never scaled to be larger than their original size.')) page.add_row(stretch_button) page.new_section(_('Transparency')) checkered_bg_button = gtk.CheckButton( _('Use checkered background for transparent images.')) checkered_bg_button.set_active( prefs['checkered bg for transparent images']) checkered_bg_button.connect('toggled', self._check_button_cb, 'checkered bg for transparent images') checkered_bg_button.set_tooltip_text( _('Use a grey checkered background for transparent images. If this preference is unset, the background is plain white instead.')) page.add_row(checkered_bg_button) notebook.append_page(page, gtk.Label(_('Appearance'))) # ---------------------------------------------------------------- # The "Behaviour" tab. # ---------------------------------------------------------------- page = _PreferencePage(150) page.new_section(_('Scroll')) smart_space_button = gtk.CheckButton( _('Use smart space key scrolling.')) smart_space_button.set_active(prefs['smart space scroll']) smart_space_button.connect('toggled', self._check_button_cb, 'smart space scroll') smart_space_button.set_tooltip_text( _('Use smart scrolling with the space key. Normally the space key scrolls only right down (or up when shift is pressed), but with this preference set it also scrolls sideways and so tries to follow the natural reading order of the comic book.')) page.add_row(smart_space_button) flip_with_wheel_button = gtk.CheckButton( _('Flip pages when scrolling off the edges of the page.')) flip_with_wheel_button.set_active(prefs['flip with wheel']) flip_with_wheel_button.connect('toggled', self._check_button_cb, 'flip with wheel') flip_with_wheel_button.set_tooltip_text( _('Flip pages when scrolling "off the page" with the scroll wheel or with the arrow keys. It takes three consecutive "steps" with the scroll wheel or the arrow keys for the pages to be flipped.')) page.add_row(flip_with_wheel_button) page.new_section(_('Double page mode')) step_length_button = gtk.CheckButton( _('Flip two pages in double page mode.')) step_length_button.set_active(prefs['double step in double page mode']) step_length_button.connect('toggled', self._check_button_cb, 'double step in double page mode') step_length_button.set_tooltip_text( _('Flip two pages, instead of one, each time we flip pages in double page mode.')) page.add_row(step_length_button) virtual_double_button = gtk.CheckButton( _('Show only one wide image in double page mode.')) virtual_double_button.set_active( prefs['no double page for wide images']) virtual_double_button.connect('toggled', self._check_button_cb, 'no double page for wide images') virtual_double_button.set_tooltip_text( _("Display only one image in double page mode, if the image's width exceeds its height. The result of this is that scans that span two pages are displayed properly (i.e. alone) also in double page mode.")) page.add_row(virtual_double_button) page.new_section(_('Files')) auto_open_next_button = gtk.CheckButton( _('Automatically open the next archive.')) auto_open_next_button.set_active(prefs['auto open next archive']) auto_open_next_button.connect('toggled', self._check_button_cb, 'auto open next archive') auto_open_next_button.set_tooltip_text( _('Automatically open the next archive in the directory when flipping past the last page, or the previous archive when flipping past the first page.')) page.add_row(auto_open_next_button) auto_open_last_button = gtk.CheckButton( _('Automatically open the last viewed file on startup.')) auto_open_last_button.set_active(prefs['auto load last file']) auto_open_last_button.connect('toggled', self._check_button_cb, 'auto load last file') auto_open_last_button.set_tooltip_text( _('Automatically open, on startup, the file that was open when Comix was last closed.')) page.add_row(auto_open_last_button) store_recent_button = gtk.CheckButton( _('Store information about recently opened files.')) store_recent_button.set_active(prefs['store recent file info']) store_recent_button.connect('toggled', self._check_button_cb, 'store recent file info') store_recent_button.set_tooltip_text( _('Add information about all files opened from within Comix to the shared recent files list.')) page.add_row(store_recent_button) create_thumbs_button = gtk.CheckButton( _('Store thumbnails for opened files.')) create_thumbs_button.set_active(prefs['create thumbnails']) create_thumbs_button.connect('toggled', self._check_button_cb, 'create thumbnails') create_thumbs_button.set_tooltip_text( _('Store thumbnails for opened files according to the freedesktop.org specification. These thumbnails are shared by many other applications, such as most file managers.')) page.add_row(create_thumbs_button) page.new_section(_('Cache')) cache_button = gtk.CheckButton(_('Use a cache to speed up browsing.')) cache_button.set_active(prefs['cache']) cache_button.connect('toggled', self._check_button_cb, 'cache') cache_button.set_tooltip_text( _('Cache the images that are next to the currently viewed image in order to speed up browsing. Since the speed improvements are quite big, it is recommended that you have this preference set, unless you are running short on free RAM.')) page.add_row(cache_button) notebook.append_page(page, gtk.Label(_('Behaviour'))) # ---------------------------------------------------------------- # The "Display" tab. # ---------------------------------------------------------------- page = _PreferencePage(180) page.new_section(_('Default modes')) double_page_button = gtk.CheckButton( _('Use double page mode by default.')) double_page_button.set_active(prefs['default double page']) double_page_button.connect('toggled', self._check_button_cb, 'default double page') page.add_row(double_page_button) fullscreen_button = gtk.CheckButton(_('Use fullscreen by default.')) fullscreen_button.set_active(prefs['default fullscreen']) fullscreen_button.connect('toggled', self._check_button_cb, 'default fullscreen') page.add_row(fullscreen_button) manga_button = gtk.CheckButton(_('Use manga mode by default.')) manga_button.set_active(prefs['default manga mode']) manga_button.connect('toggled', self._check_button_cb, 'default manga mode') page.add_row(manga_button) label = gtk.Label('%s:' % _('Default zoom mode')) zoom_combo = gtk.combo_box_new_text() zoom_combo.append_text(_('Best fit mode')) zoom_combo.append_text(_('Fit width mode')) zoom_combo.append_text(_('Fit height mode')) zoom_combo.append_text(_('Manual zoom mode')) # Change this if the combobox entries are reordered. zoom_combo.set_active(prefs['default zoom mode']) zoom_combo.connect('changed', self._combo_box_cb) page.add_row(label, zoom_combo) page.new_section(_('Fullscreen')) hide_in_fullscreen_button = gtk.CheckButton( _('Automatically hide all toolbars in fullscreen.')) hide_in_fullscreen_button.set_active(prefs['hide all in fullscreen']) hide_in_fullscreen_button.connect('toggled', self._check_button_cb, 'hide all in fullscreen') page.add_row(hide_in_fullscreen_button) page.new_section(_('Slideshow')) label = gtk.Label('%s:' % _('Slideshow delay (in seconds)')) adjustment = gtk.Adjustment(prefs['slideshow delay'] / 1000.0, 0.5, 3600.0, 0.1, 1) delay_spinner = gtk.SpinButton(adjustment, digits=1) delay_spinner.connect('value_changed', self._spinner_cb, 'slideshow delay') page.add_row(label, delay_spinner) page.new_section(_('Comments')) label = gtk.Label('%s:' % _('Comment extensions')) extensions_entry = gtk.Entry() extensions_entry.set_text(', '.join(prefs['comment extensions'])) extensions_entry.connect('activate', self._entry_cb) extensions_entry.connect('focus_out_event', self._entry_cb) extensions_entry.set_tooltip_text( _('Treat all files found within archives, that have one of these file endings, as comments.')) page.add_row(label, extensions_entry) page.new_section(_('Rotation')) auto_rotate_button = gtk.CheckButton( _('Automatically rotate images according to their metadata.')) auto_rotate_button.set_active(prefs['auto rotate from exif']) auto_rotate_button.connect('toggled', self._check_button_cb, 'auto rotate from exif') auto_rotate_button.set_tooltip_text( _('Automatically rotate images when an orientation is specified in the image metadata, such as in an Exif tag.')) page.add_row(auto_rotate_button) notebook.append_page(page, gtk.Label(_('Display'))) self.show_all() def _check_button_cb(self, button, preference): """Callback for all checkbutton-type preferences.""" prefs[preference] = button.get_active() if preference == 'smart bg': if not prefs[preference]: self._window.set_bg_colour(prefs['bg colour']) else: self._window.draw_image(scroll=False) elif preference in ('stretch', 'checkered bg for transparent images', 'no double page for wide images', 'auto rotate from exif'): self._window.draw_image(scroll=False) elif (preference == 'hide all in fullscreen' and self._window.is_fullscreen): self._window.draw_image(scroll=False) elif preference == 'show page numbers on thumbnails': self._window.thumbnailsidebar.clear() self._window.thumbnailsidebar.load_thumbnails() def _color_button_cb(self, colorbutton): """Callback for the background colour selection button.""" colour = colorbutton.get_color() prefs['bg colour'] = colour.red, colour.green, colour.blue if not prefs['smart bg'] or not self._window.file_handler.file_loaded: self._window.set_bg_colour(prefs['bg colour']) def _spinner_cb(self, spinbutton, preference): """Callback for spinner-type preferences.""" value = spinbutton.get_value() if preference == 'lens size': prefs[preference] = int(value) elif preference == 'lens magnification': prefs[preference] = value elif preference == 'slideshow delay': prefs[preference] = int(value * 1000) self._window.slideshow.update_delay() elif preference == 'thumbnail size': prefs[preference] = int(value) self._window.thumbnailsidebar.resize() self._window.draw_image(scroll=False) def _combo_box_cb(self, combobox): """Callback for combobox-type preferences.""" zoom_mode = combobox.get_active() prefs['default zoom mode'] = zoom_mode def _entry_cb(self, entry, event=None): """Callback for entry-type preferences.""" text = entry.get_text() extensions = [e.strip() for e in text.split(',')] prefs['comment extensions'] = [e for e in extensions if e] self._window.file_handler.update_comment_extensions() def _response(self, dialog, response): _close_dialog() class _PreferencePage(gtk.VBox): """The _PreferencePage is a conveniece class for making one "page" in a preferences-style dialog that contains one or more _PreferenceSections. """ def __init__(self, right_column_width): """Create a new page where any possible right columns have the width request <right_column_width>. """ gtk.VBox.__init__(self, False, 12) self.set_border_width(12) self._right_column_width = right_column_width self._section = None def new_section(self, header): """Start a new section in the page, with the header text from <header>. """ self._section = _PreferenceSection(header, self._right_column_width) self.pack_start(self._section, False, False) def add_row(self, left_item, right_item=None): """Add a row to the page (in the latest section), containing one or two items. If the left item is a label it is automatically aligned properly. """ if isinstance(left_item, gtk.Label): left_item.set_alignment(0, 0.5) if right_item is None: self._section.contentbox.pack_start(left_item) else: left_box, right_box = self._section.new_split_vboxes() left_box.pack_start(left_item) right_box.pack_start(right_item) class _PreferenceSection(gtk.VBox): """The _PreferenceSection is a convenience class for making one "section" of a preference-style dialog, e.g. it has a bold header and a number of rows which are indented with respect to that header. """ def __init__(self, header, right_column_width=150): """Contruct a new section with the header set to the text in <header>, and the width request of the (possible) right columns set to that of <right_column_width>. """ gtk.VBox.__init__(self, False, 0) self._right_column_width = right_column_width self.contentbox = gtk.VBox(False, 6) label = labels.BoldLabel(header) label.set_alignment(0, 0.5) hbox = gtk.HBox(False, 0) hbox.pack_start(gtk.HBox(), False, False, 6) hbox.pack_start(self.contentbox) self.pack_start(label, False, False) self.pack_start(hbox, False, False, 6) def new_split_vboxes(self): """Return two new VBoxes that are automatically put in the section after the previously added items. The right one has a width request equal to the right_column_width value passed to the class contructor, in order to make it easy for all "right column items" in a page to line up nicely. """ left_box = gtk.VBox(False, 6) right_box = gtk.VBox(False, 6) right_box.set_size_request(self._right_column_width, -1) hbox = gtk.HBox(False, 12) hbox.pack_start(left_box) hbox.pack_start(right_box, False, False) self.contentbox.pack_start(hbox) return left_box, right_box def open_dialog(action, window): global _dialog if _dialog is None: _dialog = _PreferencesDialog(window) else: _dialog.present() def _close_dialog(*args): global _dialog if _dialog is not None: _dialog.destroy() _dialog = None def read_preferences_file(): """Read preferences data from disk.""" if os.path.isfile(_config_path): config = None try: config = open(_config_path, 'rb') version = cPickle.load(config) old_prefs = cPickle.load(config) config.close() except Exception: print '! Corrupt preferences file "%s", deleting...' % _config_path if config is not None: config.close() os.remove(_config_path) else: for key in old_prefs: if key in prefs: prefs[key] = old_prefs[key] def write_preferences_file(): """Write preference data to disk.""" config = open(_config_path, 'wb') cPickle.dump(constants.VERSION, config, cPickle.HIGHEST_PROTOCOL) cPickle.dump(prefs, config, cPickle.HIGHEST_PROTOCOL) config.close()
gpl-2.0
ghxandsky/zstack-utility
kvmagent/kvmagent/plugins/network_plugin.py
1
7289
''' @author: frank ''' from kvmagent import kvmagent from zstacklib.utils import jsonobject from zstacklib.utils import http from zstacklib.utils import log from zstacklib.utils import lock from zstacklib.utils import shell from zstacklib.utils import linux import os import traceback CHECK_PHYSICAL_NETWORK_INTERFACE_PATH = '/network/checkphysicalnetworkinterface' KVM_REALIZE_L2NOVLAN_NETWORK_PATH = "/network/l2novlan/createbridge" KVM_REALIZE_L2VLAN_NETWORK_PATH = "/network/l2vlan/createbridge" KVM_CHECK_L2NOVLAN_NETWORK_PATH = "/network/l2novlan/checkbridge" KVM_CHECK_L2VLAN_NETWORK_PATH = "/network/l2vlan/checkbridge" logger = log.get_logger(__name__) class CheckPhysicalNetworkInterfaceCmd(kvmagent.AgentCommand): def __init__(self): super(CheckPhysicalNetworkInterfaceCmd, self).__init__() self.interfaceNames = None class CheckPhysicalNetworkInterfaceResponse(kvmagent.AgentResponse): def __init__(self): super(CheckPhysicalNetworkInterfaceResponse, self).__init__() self.failedInterfaceNames = None class CreateBridgeCmd(kvmagent.AgentCommand): def __init__(self): super(CreateBridgeCmd, self).__init__() self.physicalInterfaceName = None self.bridgeName = None class CreateBridgeResponse(kvmagent.AgentResponse): def __init__(self): super(CreateBridgeResponse, self).__init__() class CreateVlanBridgeCmd(kvmagent.AgentCommand): def __init__(self): super(CreateVlanBridgeCmd, self).__init__() self.vlan = None class CreateVlanBridgeResponse(kvmagent.AgentResponse): def __init__(self): super(CreateVlanBridgeResponse, self).__init__() class CheckBridgeResponse(kvmagent.AgentResponse): def __init__(self): super(CheckBridgeResponse, self).__init__() class CheckVlanBridgeResponse(kvmagent.AgentResponse): def __init__(self): super(CheckVlanBridgeResponse, self).__init__() class NetworkPlugin(kvmagent.KvmAgent): ''' classdocs ''' def _ifup_device_if_down(self, device_name): state_path = '/sys/class/net/%s/operstate' % device_name if not os.path.exists(state_path): raise Exception('cannot find %s' % state_path) with open(state_path, 'r') as fd: state = fd.read() if 'up' in state: return shell.call('ip link set %s up' % device_name) def _configure_bridge(self): shell.call('echo 1 > /proc/sys/net/bridge/bridge-nf-call-iptables') shell.call('echo 1 > /proc/sys/net/ipv4/conf/default/forwarding') @kvmagent.replyerror def check_physical_network_interface(self, req): cmd = jsonobject.loads(req[http.REQUEST_BODY]) rsp = CheckPhysicalNetworkInterfaceResponse() for i in cmd.interfaceNames: shell_cmd = shell.ShellCmd("ip link | grep '%s'" % i) shell_cmd(False) if shell_cmd.return_code != 0: rsp.failedInterfaceNames = [i] rsp.success = False return jsonobject.dumps(rsp) for i in cmd.interfaceNames: self._ifup_device_if_down(i) logger.debug(http.path_msg(CHECK_PHYSICAL_NETWORK_INTERFACE_PATH, 'checked physical interfaces: %s' % cmd.interfaceNames)) return jsonobject.dumps(rsp) @lock.lock('create_bridge') @kvmagent.replyerror def create_bridge(self, req): cmd = jsonobject.loads(req[http.REQUEST_BODY]) rsp = CreateBridgeResponse() self._ifup_device_if_down(cmd.physicalInterfaceName) if linux.is_vif_on_bridge(cmd.bridgeName, cmd.physicalInterfaceName): logger.debug('%s is a bridge device. Interface %s is attached to bridge. No need to create bridge or attach device interface' % (cmd.bridgeName, cmd.physicalInterfaceName)) self._configure_bridge() return jsonobject.dumps(rsp) try: linux.create_bridge(cmd.bridgeName, cmd.physicalInterfaceName) self._configure_bridge() logger.debug('successfully realize bridge[%s] from device[%s]' % (cmd.bridgeName, cmd.physicalInterfaceName)) except Exception as e: logger.warning(traceback.format_exc()) rsp.error = 'unable to create bridge[%s] from device[%s], because %s' % (cmd.bridgeName, cmd.physicalInterfaceName, str(e)) rsp.success = False return jsonobject.dumps(rsp) @lock.lock('create_bridge') @kvmagent.replyerror def create_vlan_bridge(self, req): cmd = jsonobject.loads(req[http.REQUEST_BODY]) rsp = CreateVlanBridgeResponse() if linux.is_bridge(cmd.bridgeName): logger.debug('%s is a bridge device, no need to create bridge' % cmd.bridgeName) self._ifup_device_if_down('%s.%s' % (cmd.physicalInterfaceName, cmd.vlan)) self._configure_bridge() return jsonobject.dumps(rsp) try: linux.create_vlan_bridge(cmd.bridgeName, cmd.physicalInterfaceName, cmd.vlan) self._configure_bridge() logger.debug('successfully realize vlan bridge[name:%s, vlan:%s] from device[%s]' % (cmd.bridgeName, cmd.vlan, cmd.physicalInterfaceName)) except Exception as e: logger.warning(traceback.format_exc()) rsp.error = 'unable to create vlan bridge[name:%s, vlan:%s] from device[%s], because %s' % (cmd.bridgeName, cmd.vlan, cmd.physicalInterfaceName, str(e)) rsp.success = False return jsonobject.dumps(rsp) @lock.lock('create_bridge') @kvmagent.replyerror def check_bridge(self, req): cmd = jsonobject.loads(req[http.REQUEST_BODY]) rsp = CheckBridgeResponse() if not linux.is_bridge(cmd.bridgeName): rsp.error = "can not find bridge[%s]" % cmd.bridgeName rsp.success = False else: self._ifup_device_if_down(cmd.physicalInterfaceName) return jsonobject.dumps(rsp) @lock.lock('create_bridge') @kvmagent.replyerror def check_vlan_bridge(self, req): cmd = jsonobject.loads(req[http.REQUEST_BODY]) rsp = CheckVlanBridgeResponse() if not linux.is_bridge(cmd.bridgeName): rsp.error = "can not find vlan bridge[%s]" % cmd.bridgeName rsp.success = False else: self._ifup_device_if_down(cmd.physicalInterfaceName) return jsonobject.dumps(rsp) def start(self): http_server = kvmagent.get_http_server() http_server.register_sync_uri(CHECK_PHYSICAL_NETWORK_INTERFACE_PATH, self.check_physical_network_interface) http_server.register_async_uri(KVM_REALIZE_L2NOVLAN_NETWORK_PATH, self.create_bridge) http_server.register_async_uri(KVM_REALIZE_L2VLAN_NETWORK_PATH, self.create_vlan_bridge) http_server.register_async_uri(KVM_CHECK_L2NOVLAN_NETWORK_PATH, self.check_bridge) http_server.register_async_uri(KVM_CHECK_L2VLAN_NETWORK_PATH, self.check_vlan_bridge) def stop(self): pass
apache-2.0
KanoComputing/nush
cherrypy/test/test_auth_basic.py
54
2853
# This file is part of CherryPy <http://www.cherrypy.org/> # -*- coding: utf-8 -*- # vim:ts=4:sw=4:expandtab:fileencoding=utf-8 import cherrypy from cherrypy._cpcompat import md5, ntob from cherrypy.lib import auth_basic from cherrypy.test import helper class BasicAuthTest(helper.CPWebCase): def setup_server(): class Root: def index(self): return "This is public." index.exposed = True class BasicProtected: def index(self): return "Hello %s, you've been authorized." % cherrypy.request.login index.exposed = True class BasicProtected2: def index(self): return "Hello %s, you've been authorized." % cherrypy.request.login index.exposed = True userpassdict = {'xuser' : 'xpassword'} userhashdict = {'xuser' : md5(ntob('xpassword')).hexdigest()} def checkpasshash(realm, user, password): p = userhashdict.get(user) return p and p == md5(ntob(password)).hexdigest() or False conf = {'/basic': {'tools.auth_basic.on': True, 'tools.auth_basic.realm': 'wonderland', 'tools.auth_basic.checkpassword': auth_basic.checkpassword_dict(userpassdict)}, '/basic2': {'tools.auth_basic.on': True, 'tools.auth_basic.realm': 'wonderland', 'tools.auth_basic.checkpassword': checkpasshash}, } root = Root() root.basic = BasicProtected() root.basic2 = BasicProtected2() cherrypy.tree.mount(root, config=conf) setup_server = staticmethod(setup_server) def testPublic(self): self.getPage("/") self.assertStatus('200 OK') self.assertHeader('Content-Type', 'text/html;charset=utf-8') self.assertBody('This is public.') def testBasic(self): self.getPage("/basic/") self.assertStatus(401) self.assertHeader('WWW-Authenticate', 'Basic realm="wonderland"') self.getPage('/basic/', [('Authorization', 'Basic eHVzZXI6eHBhc3N3b3JX')]) self.assertStatus(401) self.getPage('/basic/', [('Authorization', 'Basic eHVzZXI6eHBhc3N3b3Jk')]) self.assertStatus('200 OK') self.assertBody("Hello xuser, you've been authorized.") def testBasic2(self): self.getPage("/basic2/") self.assertStatus(401) self.assertHeader('WWW-Authenticate', 'Basic realm="wonderland"') self.getPage('/basic2/', [('Authorization', 'Basic eHVzZXI6eHBhc3N3b3JX')]) self.assertStatus(401) self.getPage('/basic2/', [('Authorization', 'Basic eHVzZXI6eHBhc3N3b3Jk')]) self.assertStatus('200 OK') self.assertBody("Hello xuser, you've been authorized.")
gpl-3.0
ghickman/tvrenamr
tvrenamr/logs.py
2
2377
import logging import logging.handlers import os def convert_log_level(level=26): """ Get a numeric log level from a string. The default 26 is for SHORT logs. :param level :return level """ # annoying but the level can be passed in as None if not level: level = 26 levels = {'notset': 0, 'debug': 10, 'info': 20, 'minimal': 22, 'short': 26, 'warning': 30, 'error': 40, 'critical': 50} if isinstance(level, str): level = levels.get(level) return level def get_log_file(filename=None): # make sure the log directory exists and place the log file there if filename is None: filename = os.path.join( os.path.expanduser('~'), '.tvrenamr', 'tvrenamr.log' ) filename = filename.replace('~', os.path.expanduser('~')) try: os.makedirs(os.path.split(filename)[0]) except OSError: pass return filename def start_logging(filename, log_level, quiet=False): """ Setup the file logging and start the root logger """ filename = get_log_file(filename) log_level = convert_log_level(log_level) # add the custom levels logging.addLevelName(22, 'MINIMAL') logging.addLevelName(26, 'SHORT') # setup log file file_format = '%(asctime)-15s %(levelname)-8s %(name)-11s %(message)s' handler = logging.handlers.RotatingFileHandler(filename, maxBytes=1048576, backupCount=10) handler.setFormatter(logging.Formatter(file_format, '%Y-%m-%dT%H:%M')) logging.getLogger().addHandler(handler) logging.getLogger().setLevel(logging.DEBUG) if not quiet: # setup the console logs to debug # debug if log_level is 10: console_format = '%(asctime)-15s %(levelname)-8s %(name)-11s %(message)s' console_datefmt = '%Y-%m-%d %H:%M' else: console_format = '%(message)s' console_datefmt = '' console_formatter = logging.Formatter(console_format, console_datefmt) # define a Handler with the given level and outputs to the console console = logging.StreamHandler() console.setLevel(log_level) # set the console format & attach the handler to the root logger with it. console.setFormatter(console_formatter) logging.getLogger().addHandler(console)
mit
simleo/openmicroscopy
components/tools/OmeroPy/test/integration/test_chgrp.py
2
46241
#!/usr/bin/env python # -*- coding: utf-8 -*- # # Copyright (C) 2012-2015 University of Dundee & Open Microscopy Environment. # All rights reserved. Use is subject to license terms supplied in LICENSE.txt # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License along # with this program; if not, write to the Free Software Foundation, Inc., # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. """ Integration test for moving objects between groups. """ import omero import omero.gateway from omero.testlib import ITest import pytest from omero.cmd import Chgrp2 from omero.cmd.graphs import ChildOption from omero.model import DatasetI, DatasetImageLinkI, ExperimenterGroupI, ImageI from omero.model import TagAnnotationI from omero.model import ProjectDatasetLinkI, ProjectI, PlateI, ScreenI from omero.model import ExperimenterI from omero.rtypes import rstring, unwrap from omero.api import Save PRIVATE = 'rw----' READONLY = 'rwr---' READANNOTATE = 'rwra--' COLLAB = 'rwrw--' class TestChgrp(ITest): def testChgrpImportedImage(self): """ Tests chgrp for an imported image, moving to a collaborative group """ # One user in two groups client, exp = self.new_client_and_user() grp = self.new_group(experimenters=[exp], perms=COLLAB) gid = grp.id.val client.sf.getAdminService().getEventContext() # Reset session # Import an image into the client context images = self.import_fake_file(name="testChgrpImportedImage", client=client) image = images[0] # Chgrp chgrp = Chgrp2(targetObjects={'Image': [image.id.val]}, groupId=gid) self.do_submit(chgrp, client) # Change our context to new group... admin = client.sf.getAdminService() admin.setDefaultGroup(exp, ExperimenterGroupI(gid, False)) self.set_context(client, gid) # ...check image img = client.sf.getQueryService().get("Image", image.id.val) assert img.details.group.id.val == gid def testChgrpImage(self): """ Tests chgrp for a dummny image object (no Pixels) """ # One user in two groups client, exp = self.new_client_and_user() grp = self.new_group([exp]) gid = grp.id.val client.sf.getAdminService().getEventContext() # Reset session update = client.sf.getUpdateService() query = client.sf.getQueryService() admin = client.sf.getAdminService() first_gid = admin.getEventContext().groupId # Create a dataset in the 'first group' ds = self.make_dataset(name="testChgrpImage_target", client=client) ds_id = ds.id.val # Change our context to new group and create image admin.setDefaultGroup(exp, ExperimenterGroupI(gid, False)) self.set_context(client, gid) update = client.sf.getUpdateService() # do we need to get this again? img = self.new_image() img = update.saveAndReturnObject(img) # Move image to new group chgrp = Chgrp2( targetObjects={'Image': [img.id.val]}, groupId=first_gid) # Link to Save link = DatasetImageLinkI() link.child = ImageI(img.id.val, False) link.parent = DatasetI(ds_id, False) save = Save() save.obj = link requests = [chgrp, save] # we're going to chgrp THEN save DIlink # Change our context to original group... admin.setDefaultGroup(exp, ExperimenterGroupI(first_gid, False)) self.set_context(client, first_gid) # We have to be in destination group for link Save to work self.do_submit(requests, client) # ...check image img = client.sf.getQueryService().get("Image", img.id.val) assert img.details.group.id.val == first_gid # check Dataset query = "select link from DatasetImageLink link\ where link.child.id=%s" % img.id.val l = client.sf.getQueryService().findByQuery(query, None) assert l is not None, "New DatasetImageLink on image not found" assert l.details.group.id.val == first_gid,\ "Link Created in same group as Image target" def testChgrpPDI(self): """ Tests chgrp for a Project, Dataset, Image hierarchy """ # One user in two groups client, exp = self.new_client_and_user() grp = self.new_group([exp]) gid = grp.id.val client.sf.getAdminService().getEventContext() # Reset session # Data Setup (image in the P/D hierarchy) img = self.make_image(client=client) project = self.make_project(name="chgrp-test", client=client) dataset = self.make_dataset(name="chgrp-test", client=client) self.link(dataset, img, client=client) self.link(project, dataset, client=client) # Move Project to new group chgrp = Chgrp2( targetObjects={'Project': [project.id.val]}, groupId=gid) self.do_submit(chgrp, client) # Change our context to new group... admin = client.sf.getAdminService() admin.setDefaultGroup(exp, ExperimenterGroupI(gid, False)) self.set_context(client, gid) # ...check image img = client.sf.getQueryService().get("Image", img.id.val) assert img.details.group.id.val == gid # check Project prj = client.sf.getQueryService().get("Project", project.id.val) assert prj.details.group.id.val == gid def testChgrpRdef7825(self): # One user in two groups owner, owner_obj = self.new_client_and_user(perms="rwrw--") admin = owner.sf.getAdminService() ec = admin.getEventContext() source_grp = admin.getGroup(ec.groupId) target_grp = self.new_group([owner]) target_gid = target_grp.id.val ec = admin.getEventContext() # Refresh # Add another user to the source group member = self.new_client(group=source_grp) # Create an image as the owner images = self.import_fake_file(name="testChgrpRdef7825", client=owner) image = images[0] # Render as both users owner_g = omero.gateway.BlitzGateway(client_obj=owner) member_g = omero.gateway.BlitzGateway(client_obj=member) def render(g): g.getObject("Image", image.id.val).getThumbnail() render(owner_g) render(member_g) # Now chgrp and try to delete chgrp = Chgrp2( targetObjects={'Image': [image.id.val]}, groupId=target_gid) self.do_submit(chgrp, owner) # Shouldn't be necessary to change group, but we're gonna owner_g.SERVICE_OPTS.setOmeroGroup("-1") handle = owner_g.deleteObjects("Image", [image.id.val]) self.wait_on_cmd(owner_g.c, handle) def testChgrpOneImageFilesetErr(self): """ Simple example of the MIF chgrp bad case: A single fileset containing 2 images - we try to chgrp ONE image. Each sibling CANNOT be moved independently of the other. """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val # 2 images sharing a fileset images = self.import_fake_file(2, client=client) # Now chgrp chgrp = Chgrp2( targetObjects={'Image': [images[0].id.val]}, groupId=target_gid) self.do_submit(chgrp, client, test_should_pass=False) def testChgrpAllImagesFilesetOK(self): """ Simple example of the MIF chgrp bad case: A single fileset containing 2 images can be moved to the same group together. """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val images = self.import_fake_file(2, client=client) # chgrp should succeed ids = [images[0].id.val, images[1].id.val] chgrp = Chgrp2(targetObjects={'Image': ids}, groupId=target_gid) self.do_submit(chgrp, client) # Check both Images moved query_service = client.sf.getQueryService() ctx = {'omero.group': '-1'} # query across groups for i in images: image = query_service.get('Image', i.id.val, ctx) img_gid = image.details.group.id.val assert target_gid == img_gid,\ "Image should be in group: %s, NOT %s" % (target_gid, img_gid) def testChgrpAllImagesFilesetTwoCommandsErr(self): """ Simple example of the MIF chgrp bad case with Chgrp2: A single fileset containing 2 images cannot be moved to the same group together using two commands See testChgrpAllImagesFilesetOK for the good. """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val images = self.import_fake_file(2, client=client) # chgrp should succeed chgrp1 = Chgrp2( targetObjects={'Image': [images[0].id.val]}, groupId=target_gid) chgrp2 = Chgrp2( targetObjects={'Image': [images[1].id.val]}, groupId=target_gid) self.do_submit([chgrp1, chgrp2], client, test_should_pass=False) def testChgrpOneDatasetFilesetErr(self): """ Simple example of the MIF chgrp bad case: A single fileset containing 2 images is split among 2 datasets. We try to chgrp ONE Dataset. Each dataset CANNOT be moved independently of the other. """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val datasets = self.create_datasets( 2, "testChgrpOneDatasetFilesetErr", client=client) images = self.import_fake_file(2, client=client) for i in range(2): self.link(datasets[i], images[i], client=client) # chgrp should succeed with the first Dataset only chgrp = Chgrp2( targetObjects={"Dataset": [datasets[0].id.val]}, groupId=target_gid) self.do_submit(chgrp, client) query_service = client.sf.getQueryService() # Check Images not moved for i in range(2): image = query_service.get('Image', images[i].id.val) assert target_gid != image.details.group.id.val,\ "Image should not be in group: %s" % target_gid # Check second Dataset not moved dataset = query_service.get('Dataset', datasets[1].id.val) assert target_gid != dataset.details.group.id.val,\ "Dataset should not be in group: %s" % target_gid ctx = {'omero.group': str(target_gid)} # query in the target group # Check first Dataset moved dataset = query_service.get('Dataset', datasets[0].id.val, ctx) assert target_gid == dataset.details.group.id.val,\ "Dataset should be in group: %s" % target_gid def testChgrpAllDatasetsFilesetOK(self): """ Simple example of the MIF chgrp bad case: a single fileset containing 2 images is split among 2 datasets. Datasets can be moved to the same group together. """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val datasets = self.create_datasets( 2, "testChgrpAllDatasetsFilesetOK", client=client) images = self.import_fake_file(2, client=client) for i in range(2): self.link(datasets[i], images[i], client=client) # Now chgrp, should succeed ids = [datasets[0].id.val, datasets[1].id.val] chgrp = Chgrp2(targetObjects={"Dataset": ids}, groupId=target_gid) self.do_submit(chgrp, client) # Check both Datasets and Images moved query_service = client.sf.getQueryService() ctx = {'omero.group': str(target_gid)} # query in the target group for i in range(2): dataset = query_service.get('Dataset', datasets[i].id.val, ctx) image = query_service.get('Image', images[i].id.val, ctx) assert target_gid == dataset.details.group.id.val,\ "Dataset should be in group: %s" % target_gid assert target_gid == image.details.group.id.val,\ "Image should be in group: %s" % target_gid def testChgrpOneDatasetFilesetOK(self): """ Simple example of the MIF chgrp good case: a single fileset containing 2 images in one dataset. The dataset can be moved. """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val ds = self.make_dataset(name="testChgrpOneDatasetFilesetOK", client=client) images = self.import_fake_file(2, client=client) for i in range(2): self.link(ds, images[i], client=client) # Now chgrp, should succeed chgrp = Chgrp2( targetObjects={"Dataset": [ds.id.val]}, groupId=target_gid) self.do_submit(chgrp, client) # Check Dataset and both Images moved query_service = client.sf.getQueryService() ctx = {'omero.group': '-1'} # query across groups dataset = query_service.get('Dataset', ds.id.val, ctx) assert target_gid == dataset.details.group.id.val,\ "Dataset should be in group: %s" % target_gid for i in range(2): image = query_service.get('Image', images[i].id.val, ctx) img_gid = image.details.group.id.val assert target_gid == img_gid,\ "Image should be in group: %s, NOT %s" % (target_gid, img_gid) def testChgrpImagesTwoFilesetsErr(self): """ If we try to 'split' 2 Filesets, both should be returned by the chgrp error """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val images_fs_one = self.import_fake_file(2, client=client) images_fs_two = self.import_fake_file(2, client=client) # chgrp should fail... ids = [images_fs_one[0].id.val, images_fs_two[0].id.val] chgrp = Chgrp2(targetObjects={"Image": ids}, groupId=target_gid) self.do_submit(chgrp, client, test_should_pass=False) def testChgrpDatasetTwoFilesetsErr(self): """ If we try to 'split' 2 Filesets, both should be returned by the chgrp error """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val images_fs_one = self.import_fake_file(2, client=client) images_fs_two = self.import_fake_file(2, client=client) ds = self.make_dataset(name="testChgrpDatasetTwoFilesetsErr", client=client) self.import_fake_file(2, client=client) for i in (images_fs_one, images_fs_two): self.link(ds, i[0], client=client) # chgrp should succeed with the Dataset only chgrp = Chgrp2( targetObjects={"Dataset": [ds.id.val]}, groupId=target_gid) self.do_submit(chgrp, client) query_service = client.sf.getQueryService() # Check Images not moved for i in (images_fs_one[0], images_fs_two[0]): image = query_service.get('Image', i.id.val) assert target_gid != image.details.group.id.val,\ "Image should not be in group: %s" % target_gid ctx = {'omero.group': str(target_gid)} # query in the target group # Check Dataset moved dataset = query_service.get('Dataset', ds.id.val, ctx) assert target_gid == dataset.details.group.id.val,\ "Dataset should be in group: %s" % target_gid def testChgrpDatasetCheckFsGroup(self): """ Move a Dataset of MIF images into a new group, then check that the Fileset group is the same as the target group. From 'Security Violation' Bug https://github.com/openmicroscopy/openmicroscopy/pull/1139 """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val ds = self.make_dataset(name="testChgrpDatasetCheckFsGroup", client=client) images = self.import_fake_file(2, client=client) for i in range(2): self.link(ds, images[i], client=client) # Now chgrp, should succeed chgrp = Chgrp2( targetObjects={"Dataset": [ds.id.val]}, groupId=target_gid) self.do_submit(chgrp, client) # Check the group of the fileset is in sync with image. ctx = {'omero.group': '-1'} qs = client.sf.getQueryService() image1 = qs.get("Image", images[0].id.val, ctx) fs_id = image1.fileset.id.val image_gid = image1.details.group.id.val fileset_gid = qs.get("Fileset", fs_id, ctx).details.group.id.val assert image_gid == fileset_gid,\ "Image group: %s and Fileset group: %s don't match" %\ (image_gid, fileset_gid) def testChgrpFilesetOK(self): """ Move a Fileset of MIF images into a new group, then check that the Fileset group is the same as the target group. """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) query = client.sf.getQueryService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val images = self.import_fake_file(2, client=client) fs_id = query.get("Image", images[0].id.val).fileset.id.val # Now chgrp, should succeed chgrp = Chgrp2(targetObjects={"Fileset": [fs_id]}, groupId=target_gid) self.do_submit(chgrp, client) # Check Fileset and both Images moved and # thus the Fileset is in sync with Images. ctx = {'omero.group': '-1'} # query across groups fileset = query.get('Fileset', fs_id, ctx) assert target_gid == fileset.details.group.id.val,\ "Fileset should be in group: %s" % target_gid for i in range(2): image = query.get('Image', images[i].id.val, ctx) img_gid = image.details.group.id.val assert target_gid == img_gid,\ "Image should be in group: %s, NOT %s" % (target_gid, img_gid) def testChgrp11000(self): """ Move a Dataset of MIF images *with a companion file* into a new group. Note: once FakeReader supports companion files this logic can be simplified. """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) ds = self.make_dataset(name="testChgrp11000", client=client) images = self.import_fake_file(2, client=client) for i in range(2): self.link(ds, images[i], client=client) # Perform the extra companion file logic fs = client.sf.getQueryService().findByQuery(""" select fs from Image i join i.fileset fs join fetch fs.usedFiles as uf join fetch uf.originalFile where i.id = %s """ % images[0].id.val, None) entry1 = fs.getFilesetEntry(0) ofile = entry1.getOriginalFile() for i in range(2): ann = omero.model.FileAnnotationI() ann.file = ofile.proxy() self.link(images[i], ann, client=client) def testChgrp11109(self): """ Place a plate in a single screen and attempt to move it. """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh update = client.sf.getUpdateService() plate = PlateI() plate.name = rstring("testChgrp11109") screen = ScreenI() screen.name = rstring("testChgrp11109") link = screen.linkPlate(plate) link = update.saveAndReturnObject(link) # Now chgrp, should succeed chgrp = Chgrp2( targetObjects={"Plate": [link.child.id.val]}, groupId=target_gid) self.do_submit(chgrp, client) # Check that the links have been destroyed query = client.sf.getQueryService() with pytest.raises(omero.ValidationException): query.get("ScreenPlateLink", link.id.val, {"omero.group": "-1"}) def testChgrpDatasetWithImage(self): """ D->I ChGrp D See https://trac.openmicroscopy.org.uk/ome/ticket/12452 """ client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh query = client.sf.getQueryService() d = self.make_dataset(client=client) i = self.make_image(client=client) self.link(d, i, client=client) self.change_group([d], target_gid, client) ctx = {'omero.group': '-1'} assert target_gid == query.get("Image", i.id.val, ctx).details.group.id.val assert target_gid == query.get("Dataset", d.id.val, ctx).details.group.id.val def testChgrpPDIReverseLinkOrder(self): """ P->D->I ChGrp P See https://trac.openmicroscopy.org.uk/ome/ticket/12452 """ client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh query = client.sf.getQueryService() p = self.make_project(client=client) d = self.make_dataset(client=client) i = self.make_image(client=client) self.link(p, d, client=client) self.link(d, i, client=client) self.change_group([p], target_gid, client=client) ctx = {'omero.group': '-1'} assert target_gid == query.get("Project", p.id.val, ctx).details.group.id.val assert target_gid == query.get("Dataset", d.id.val, ctx).details.group.id.val assert target_gid == query.get("Image", i.id.val, ctx).details.group.id.val def testChgrpTwoDatasetsLinkedToSingleImageDefault(self): """ D1->I D2->I ChGrp D1 See https://trac.openmicroscopy.org.uk/ome/ticket/12452 """ client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh query = client.sf.getQueryService() d1 = self.make_dataset(client=client) d2 = self.make_dataset(client=client) i = self.make_image(client=client) self.link(d1, i, client=client) self.link(d2, i, client=client) self.change_group([d1], target_gid, client=client) ctx = {'omero.group': '-1'} assert target_gid == query.get("Dataset", d1.id.val, ctx).details.group.id.val assert target_gid != query.get("Dataset", d2.id.val, ctx).details.group.id.val assert target_gid != query.get("Image", i.id.val, ctx).details.group.id.val def testChgrpTwoDatasetsLinkedToSingleImageHard(self): """ D1->I D2->I ChGrp D1 See https://trac.openmicroscopy.org.uk/ome/ticket/12452 """ client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh query = client.sf.getQueryService() d1 = self.make_dataset(client=client) d2 = self.make_dataset(client=client) i = self.make_image(client=client) self.link(d1, i, client=client) self.link(d2, i, client=client) hard = ChildOption(includeType=["Image"]) chgrp = Chgrp2( targetObjects={"Dataset": [d1.id.val]}, childOptions=[hard], groupId=target_gid) self.do_submit(chgrp, client) ctx = {'omero.group': '-1'} assert target_gid == query.get("Dataset", d1.id.val, ctx).details.group.id.val assert target_gid != query.get("Dataset", d2.id.val, ctx).details.group.id.val assert target_gid == query.get("Image", i.id.val, ctx).details.group.id.val def testChgrpProjectWithDatasetLinkedToImageWithOtherDatasetDefault(self): """ P->D1->I D2->I ChGrp P See https://trac.openmicroscopy.org.uk/ome/ticket/12452 """ client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh query = client.sf.getQueryService() p = self.make_project(client=client) d1 = self.make_dataset(client=client) d2 = self.make_dataset(client=client) i = self.make_image(client=client) self.link(d1, i, client=client) self.link(d2, i, client=client) self.link(p, d1, client=client) self.change_group([p], target_gid, client) ctx = {'omero.group': '-1'} assert target_gid == query.get("Project", p.id.val, ctx).details.group.id.val assert target_gid == query.get("Dataset", d1.id.val, ctx).details.group.id.val assert target_gid != query.get("Image", i.id.val, ctx).details.group.id.val def testChgrpProjectWithDatasetLinkedToImageWithOtherDatasetHard(self): """ P->D1->I D2->I ChGrp P See https://trac.openmicroscopy.org.uk/ome/ticket/12452 """ client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh query = client.sf.getQueryService() p = self.make_project(client=client) d1 = self.make_dataset(client=client) d2 = self.make_dataset(client=client) i = self.make_image(client=client) self.link(d1, i, client=client) self.link(d2, i, client=client) self.link(p, d1, client=client) hard = ChildOption(includeType=["Image"]) chgrp = Chgrp2( targetObjects={"Project": [p.id.val]}, childOptions=[hard], groupId=target_gid) self.do_submit(chgrp, client) ctx = {'omero.group': '-1'} assert target_gid == query.get("Project", p.id.val, ctx).details.group.id.val assert target_gid == query.get("Dataset", d1.id.val, ctx).details.group.id.val assert target_gid != query.get("Dataset", d2.id.val, ctx).details.group.id.val assert target_gid == query.get("Image", i.id.val, ctx).details.group.id.val def testChgrpDatasetWithImageLinkedToTwoProjects(self): """ P1->D->I P2->D->I ChGrp D See https://trac.openmicroscopy.org.uk/ome/ticket/12452 """ client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh query = client.sf.getQueryService() p1 = self.make_project(client=client) p2 = self.make_project(client=client) d = self.make_dataset(client=client) i = self.make_image(client=client) self.link(p1, d, client=client) self.link(p2, d, client=client) self.link(d, i, client=client) self.change_group([d], target_gid, client) ctx = {'omero.group': '-1'} assert not target_gid == query.get("Project", p1.id.val, ctx).details.group.id.val assert not target_gid == query.get("Project", p2.id.val, ctx).details.group.id.val assert target_gid == query.get("Dataset", d.id.val, ctx).details.group.id.val assert target_gid == query.get("Image", i.id.val, ctx).details.group.id.val def testChgrpProjectLinkedToDatasetAndImageDefault(self): """ P1->D->I P2->D->I ChGrp P1 See https://trac.openmicroscopy.org.uk/ome/ticket/12452 """ client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh query = client.sf.getQueryService() p1 = self.make_project(client=client) p2 = self.make_project(client=client) d = self.make_dataset(client=client) i = self.make_image(client=client) self.link(p1, d, client=client) self.link(p2, d, client=client) self.link(d, i, client=client) self.change_group([p1], target_gid, client) ctx = {'omero.group': '-1'} assert target_gid == query.get("Project", p1.id.val, ctx).details.group.id.val assert target_gid != query.get("Dataset", d.id.val, ctx).details.group.id.val assert target_gid != query.get("Image", i.id.val, ctx).details.group.id.val def testChgrpProjectLinkedToDatasetAndImageHard(self): """ P1->D->I P2->D->I ChGrp P1 See https://trac.openmicroscopy.org.uk/ome/ticket/12452 """ client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh query = client.sf.getQueryService() p1 = self.make_project(client=client) p2 = self.make_project(client=client) d = self.make_dataset(client=client) i = self.make_image(client=client) self.link(p1, d, client=client) self.link(p2, d, client=client) self.link(d, i, client=client) hard = ChildOption(includeType=["Dataset"]) chgrp = Chgrp2( targetObjects={"Project": [p1.id.val]}, childOptions=[hard], groupId=target_gid) self.do_submit(chgrp, client) ctx = {'omero.group': '-1'} assert target_gid == query.get("Project", p1.id.val, ctx).details.group.id.val assert target_gid != query.get("Project", p2.id.val, ctx).details.group.id.val assert target_gid == query.get("Dataset", d.id.val, ctx).details.group.id.val assert target_gid == query.get("Image", i.id.val, ctx).details.group.id.val def testChgrpProjectLinkedToDatasetDefault(self): """ P1->D P2->D ChGrp P1 See https://trac.openmicroscopy.org.uk/ome/ticket/12452 """ client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh query = client.sf.getQueryService() p1 = self.make_project(client=client) p2 = self.make_project(client=client) d = self.make_dataset(client=client) self.link(p1, d, client=client) self.link(p2, d, client=client) self.change_group([p1], target_gid, client) ctx = {'omero.group': '-1'} assert target_gid == query.get("Project", p1.id.val, ctx).details.group.id.val assert target_gid != query.get("Dataset", d.id.val, ctx).details.group.id.val def testChgrpProjectLinkedToDatasetHard(self): """ P1->D P2->D ChGrp P1 See https://trac.openmicroscopy.org.uk/ome/ticket/12452 """ client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh query = client.sf.getQueryService() p1 = self.make_project(client=client) p2 = self.make_project(client=client) d = self.make_dataset(client=client) self.link(p1, d, client=client) self.link(p2, d, client=client) hard = ChildOption(includeType=["Dataset"]) chgrp = Chgrp2( targetObjects={"Project": [p1.id.val]}, childOptions=[hard], groupId=target_gid) self.do_submit(chgrp, client) ctx = {'omero.group': '-1'} assert target_gid == query.get("Project", p1.id.val, ctx).details.group.id.val assert target_gid != query.get("Project", p2.id.val, ctx).details.group.id.val assert target_gid == query.get("Dataset", d.id.val, ctx).details.group.id.val def testChgrpProjectLinkedToTwoDatasetsAndImage(self): """ P->D1->I P->D2->I ChGrp P See https://trac.openmicroscopy.org.uk/ome/ticket/12452 """ client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val admin.getEventContext() # Refresh query = client.sf.getQueryService() p = self.make_project(client=client) d1 = self.make_dataset(client=client) d2 = self.make_dataset(client=client) i = self.make_image(client=client) self.link(p, d1, client=client) self.link(p, d2, client=client) self.link(d1, i, client=client) self.link(d2, i, client=client) self.change_group([p], target_gid, client) ctx = {'omero.group': '-1'} assert target_gid == query.get("Project", p.id.val, ctx).details.group.id.val assert target_gid == query.get("Dataset", d1.id.val, ctx).details.group.id.val assert target_gid == query.get("Dataset", d2.id.val, ctx).details.group.id.val assert target_gid == query.get("Image", i.id.val, ctx).details.group.id.val def testIntergroupLinks(self): # create read-annotate group 'read-annotate' with implicit owner ra_group = self.new_group(perms=READANNOTATE) self.new_user(group=ra_group, owner=True) # create private group 'private' with implicit owner p_group = self.new_group(perms=PRIVATE) self.new_user(group=p_group, owner=True) # create new user 'image-owner' who is a member of both 'read-annotate' # and 'private' io_client, image_owner = self.new_client_and_user(group=ra_group) self.add_groups(image_owner, [p_group]) # create new user 'tag-owner' who is a member of both 'read-annotate' # and 'private' to_client, tag_owner = self.new_client_and_user(group=ra_group) self.add_groups(tag_owner, [p_group]) # switch user to 'image-owner' # import two images into 'read-annotate' images = [] for x in range(0, 2): values = self.import_fake_file(client=io_client) images.append(values[0]) image = io_client.sf.getQueryService().get("Image", images[x].id.val) assert ra_group.id.val == image.details.group.id.val # switch user to tag-owner # tag both image-owner's images with the same new tag tag = self.new_object( TagAnnotationI, name="tag from user %s" % tag_owner.omeName.val) tag = to_client.sf.getUpdateService().saveAndReturnObject(tag) assert tag_owner.id.val == tag.details.owner.id.val links = [] for image in images: links.append(self.link(image, tag, client=to_client)) # (shell) as root # run bin/omero hql --all 'select parent.details.group.id, # child.details.group.id from ImageIink' # and observe that for each row # the group ID in Col1 matches that in Col2 for link in links: assert link.parent.details.group.id == link.child.details.group.id # switch user to image-owner # right-click one of the images and move it to private self.change_group([images[0]], p_group.id.val, io_client) # (shell) as root # run bin/omero hql --all 'select parent.details.group.id, # child.details.group.id from ImageAnnotationLink' and recoil in horror params = omero.sys.ParametersI() params.addId(tag.id.val) ctx = {"omero.group": "-1"} query = "select parent.details.group.id," query += " child.details.group.id from ImageAnnotationLink" query += " where child.id = :id" links = unwrap(self.root.sf.getQueryService().projection(query, params, ctx)) assert links is not None for link in links: assert link[0] == link[1] class TestChgrpTarget(ITest): def createDSInGroup(self, gid, name=None, client=None): if name is None: name = self.uuid() if client is None: client = self.client ctx = {'omero.group': str(gid)} update = client.sf.getUpdateService() ds = self.new_dataset(name) return update.saveAndReturnObject(ds, ctx) def chgrpImagesToTargetDataset(self, img_count): """ Helper method to test chgrp of image(s) to target Dataset """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) admin = client.sf.getAdminService() target_grp = self.new_group([user], perms=PRIVATE) target_gid = target_grp.id.val images = self.import_fake_file(img_count, client=client) ds = self.createDSInGroup(target_gid, client=client) # each chgrp includes a 'save' link to target dataset saves = [] ids = [] for i in images: ids.append(i.id.val) link = DatasetImageLinkI() link.child = ImageI(i.id.val, False) link.parent = DatasetI(ds.id.val, False) save = Save() save.obj = link saves.append(save) chgrp = Chgrp2( targetObjects={"Image": ids}, groupId=target_gid) requests = [chgrp] requests.extend(saves) self.do_submit(requests, client, omero_group=target_gid) # Check Images moved to correct group query_service = client.sf.getQueryService() ctx = {'omero.group': '-1'} # query across groups for i in images: image = query_service.get('Image', i.id.val, ctx) img_gid = image.details.group.id.val assert target_gid == img_gid,\ "Image should be in group: %s, NOT %s" % (target_gid, img_gid) # Check Dataset has images linked ds_imgs = client.sf.getContainerService().getImages( 'Dataset', [ds.id.val], None, ctx) assert len(ds_imgs) == len(images),\ "All Images should be in target Dataset" previous_gid = admin.getEventContext().groupId return (ds, images, client, user, previous_gid, target_gid) def testChgrpImageToTargetDataset(self): """ Chgrp a single Image to target Dataset """ self.chgrpImagesToTargetDataset(1) def testChgrpMifImagesToTargetDataset(self): """ Chgrp 2 images in a MIF to target Dataset """ self.chgrpImagesToTargetDataset(2) def testChgrpImageToTargetDatasetAndBackNoDS(self): """ Chgrp a single Image to target Dataset and then back No target is provided on the way back. see ticket:11118 """ ds, images, client, user, old_gid, new_gid =\ self.chgrpImagesToTargetDataset(1) chgrp = Chgrp2( targetObjects={"Image": [images[0].id.val]}, groupId=old_gid) self.do_submit(chgrp, client, omero_group=old_gid) def testChgrpImageToTargetDatasetAndBackDS(self): """ Chgrp a single Image to target Dataset and then back see ticket:11118 """ new_ds, images, client, user, old_gid, new_gid =\ self.chgrpImagesToTargetDataset(1) # create Dataset in original group old_ds = self.createDSInGroup(old_gid, client=client) link = DatasetImageLinkI() link.parent = old_ds.proxy() link.child = images[0].proxy() chgrp = Chgrp2( targetObjects={"Image": [images[0].id.val]}, groupId=old_gid) save = Save(link) self.do_submit([chgrp, save], client, omero_group=old_gid) dils = client.sf.getQueryService().findAllByQuery( "select dil from DatasetImageLink dil where dil.child.id = :id", omero.sys.ParametersI().addId(images[0].id.val), {"omero.group": "-1"}) assert 1 == len(dils) @pytest.mark.parametrize("credentials", ["user", "admin"]) def testChgrpDatasetToTargetProject(self, credentials): """ Tests that an Admin can move a user's Dataset to a private group and link it to an existing user's Project there. Also tests that the user can do the same chgrp themselves. """ # One user in two groups client, user = self.new_client_and_user(perms=PRIVATE) target_grp = self.new_group([user], perms=PRIVATE) e_ctx = client.sf.getAdminService().getEventContext() # Reset session user_id = e_ctx.userId target_gid = target_grp.id.val # User creates Dataset in current group... update = client.sf.getUpdateService() ds = self.make_dataset(client=client) # ...and Project in target group ctx = {'omero.group': str(target_gid)} pr = self.new_project() pr = update.saveAndReturnObject(pr, ctx) requests = [] saves = [] chgrp = Chgrp2( targetObjects={"Dataset": [ds.id.val]}, groupId=target_gid) requests.append(chgrp) link = ProjectDatasetLinkI() link.details.owner = ExperimenterI(user_id, False) link.child = DatasetI(ds.id.val, False) link.parent = ProjectI(pr.id.val, False) save = Save() save.obj = link saves.append(save) requests.extend(saves) if credentials == "user": c = client else: c = self.root self.do_submit(requests, c, omero_group=target_gid) query_service = client.sf.getQueryService() ctx = {'omero.group': '-1'} # query across groups dataset = query_service.get('Dataset', ds.id.val, ctx) ds_gid = dataset.details.group.id.val assert target_gid == ds_gid,\ "Dataset should be in group: %s, NOT %s" % (target_gid, ds_gid)
gpl-2.0
MarcosCommunity/odoo
addons/base_report_designer/plugin/openerp_report_designer/bin/script/Repeatln.py
293
13228
######################################################################### # # Copyright (c) 2003-2004 Danny Brewer d29583@groovegarden.com # Copyright (C) 2004-2010 OpenERP SA (<http://openerp.com>). # # This library is free software; you can redistribute it and/or # modify it under the terms of the GNU Lesser General Public # License as published by the Free Software Foundation; either # version 2.1 of the License, or (at your option) any later version. # # This library is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public # License along with this library; if not, write to the Free Software # Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA # # See: http://www.gnu.org/licenses/lgpl.html # ############################################################################# import uno import string import unohelper import xmlrpclib from com.sun.star.task import XJobExecutor if __name__<>"package": from lib.gui import * from lib.error import ErrorDialog from lib.functions import * from ServerParameter import * from lib.logreport import * from lib.rpc import * from LoginTest import * database="test_db1" uid = 3 #class RepeatIn: class RepeatIn( unohelper.Base, XJobExecutor ): def __init__(self, sObject="", sVariable="", sFields="", sDisplayName="", bFromModify=False): # Interface Design LoginTest() self.logobj=Logger() if not loginstatus and __name__=="package": exit(1) self.win = DBModalDialog(60, 50, 180, 250, "RepeatIn Builder") self.win.addFixedText("lblVariable", 2, 12, 60, 15, "Objects to loop on :") self.win.addComboBox("cmbVariable", 180-120-2, 10, 120, 15,True, itemListenerProc=self.cmbVariable_selected) self.insVariable = self.win.getControl( "cmbVariable" ) self.win.addFixedText("lblFields", 10, 32, 60, 15, "Field to loop on :") self.win.addComboListBox("lstFields", 180-120-2, 30, 120, 150, False,itemListenerProc=self.lstbox_selected) self.insField = self.win.getControl( "lstFields" ) self.win.addFixedText("lblName", 12, 187, 60, 15, "Variable name :") self.win.addEdit("txtName", 180-120-2, 185, 120, 15,) self.win.addFixedText("lblUName", 8, 207, 60, 15, "Displayed name :") self.win.addEdit("txtUName", 180-120-2, 205, 120, 15,) self.win.addButton('btnOK',-2 ,-10,45,15,'Ok', actionListenerProc = self.btnOk_clicked ) self.win.addButton('btnCancel',-2 - 45 - 5 ,-10,45,15,'Cancel', actionListenerProc = self.btnCancel_clicked ) global passwd self.password = passwd global url self.sock=RPCSession(url) # Variable Declaration self.sValue=None self.sObj=None self.aSectionList=[] self.sGVariable=sVariable self.sGDisplayName=sDisplayName self.aItemList=[] self.aComponentAdd=[] self.aObjectList=[] self.aListRepeatIn=[] self.aVariableList=[] # Call method to perform Enumration on Report Document EnumDocument(self.aItemList,self.aComponentAdd) # Perform checking that Field-1 and Field - 4 is available or not alos get Combobox # filled if condition is true desktop = getDesktop() doc = desktop.getCurrentComponent() docinfo = doc.getDocumentInfo() # Check weather Field-1 is available if not then exit from application self.sMyHost= "" if not docinfo.getUserFieldValue(3) == "" and not docinfo.getUserFieldValue(0)=="": self.sMyHost= docinfo.getUserFieldValue(0) self.count=0 oParEnum = doc.getTextFields().createEnumeration() while oParEnum.hasMoreElements(): oPar = oParEnum.nextElement() if oPar.supportsService("com.sun.star.text.TextField.DropDown"): self.count += 1 getList(self.aObjectList, self.sMyHost,self.count) cursor = doc.getCurrentController().getViewCursor() text = cursor.getText() tcur = text.createTextCursorByRange(cursor) self.aVariableList.extend( filter( lambda obj: obj[:obj.find(" ")] == "List", self.aObjectList ) ) for i in range(len(self.aItemList)): try: anItem = self.aItemList[i][1] component = self.aComponentAdd[i] if component == "Document": sLVal = anItem[anItem.find(",'") + 2:anItem.find("')")] self.aVariableList.extend( filter( lambda obj: obj[:obj.find("(")] == sLVal, self.aObjectList ) ) if tcur.TextSection: getRecersiveSection(tcur.TextSection,self.aSectionList) if component in self.aSectionList: sLVal = anItem[anItem.find(",'") + 2:anItem.find("')")] self.aVariableList.extend( filter( lambda obj: obj[:obj.find("(")] == sLVal, self.aObjectList ) ) if tcur.TextTable: if not component == "Document" and component[component.rfind(".") + 1:] == tcur.TextTable.Name: VariableScope( tcur, self.aVariableList, self.aObjectList, self.aComponentAdd, self.aItemList, component ) except : import traceback,sys info = reduce(lambda x, y: x+y, traceback.format_exception(sys.exc_type, sys.exc_value, sys.exc_traceback)) self.logobj.log_write('RepeatIn', LOG_ERROR, info) self.bModify=bFromModify if self.bModify==True: if sObject=="": self.insVariable.setText("List of "+docinfo.getUserFieldValue(3)) self.insField.addItem("objects",self.win.getListBoxItemCount("lstFields")) self.win.setEditText("txtName", sVariable) self.win.setEditText("txtUName",sDisplayName) self.sValue= "objects" else: sItem="" for anObject in self.aObjectList: if anObject[:anObject.find("(")] == sObject: sItem = anObject self.insVariable.setText( sItem ) genTree( sItem[sItem.find("(")+1:sItem.find(")")], self.aListRepeatIn, self.insField, self.sMyHost, 2, ending=['one2many','many2many'], recur=['one2many','many2many'] ) self.sValue= self.win.getListBoxItem("lstFields",self.aListRepeatIn.index(sFields)) for var in self.aVariableList: if var[:8] <> 'List of ': self.model_ids = self.sock.execute(database, uid, self.password, 'ir.model' , 'search', [('model','=',var[var.find("(")+1:var.find(")")])]) else: self.model_ids = self.sock.execute(database, uid, self.password, 'ir.model' , 'search', [('model','=',var[8:])]) fields=['name','model'] self.model_res = self.sock.execute(database, uid, self.password, 'ir.model', 'read', self.model_ids,fields) if self.model_res <> []: if var[:8]<>'List of ': self.insVariable.addItem(var[:var.find("(")+1] + self.model_res[0]['name'] + ")" ,self.insVariable.getItemCount()) else: self.insVariable.addItem('List of ' + self.model_res[0]['name'] ,self.insVariable.getItemCount()) else: self.insVariable.addItem(var ,self.insVariable.getItemCount()) self.win.doModalDialog("lstFields",self.sValue) else: ErrorDialog("Please Select Appropriate module" ,"Create new report from: \nOdoo -> Open a New Report") self.win.endExecute() def lstbox_selected(self, oItemEvent): sItem=self.win.getListBoxSelectedItem("lstFields") sMain=self.aListRepeatIn[self.win.getListBoxSelectedItemPos("lstFields")] if self.bModify==True: self.win.setEditText("txtName", self.sGVariable) self.win.setEditText("txtUName",self.sGDisplayName) else: self.win.setEditText("txtName",sMain[sMain.rfind("/")+1:]) self.win.setEditText("txtUName","|-."+sItem[sItem.rfind("/")+1:]+".-|") def cmbVariable_selected(self, oItemEvent): if self.count > 0 : desktop=getDesktop() doc =desktop.getCurrentComponent() docinfo=doc.getDocumentInfo() self.win.removeListBoxItems("lstFields", 0, self.win.getListBoxItemCount("lstFields")) sItem=self.win.getComboBoxText("cmbVariable") for var in self.aVariableList: if var[:8]=='List of ': if var[:8]==sItem[:8]: sItem = var elif var[:var.find("(")+1] == sItem[:sItem.find("(")+1]: sItem = var self.aListRepeatIn=[] data = ( sItem[sItem.rfind(" ") + 1:] == docinfo.getUserFieldValue(3) ) and docinfo.getUserFieldValue(3) or sItem[sItem.find("(")+1:sItem.find(")")] genTree( data, self.aListRepeatIn, self.insField, self.sMyHost, 2, ending=['one2many','many2many'], recur=['one2many','many2many'] ) self.win.selectListBoxItemPos("lstFields", 0, True ) else: sItem=self.win.getComboBoxText("cmbVariable") for var in self.aVariableList: if var[:8]=='List of ' and var[:8] == sItem[:8]: sItem = var if sItem.find(".")==-1: temp=sItem[sItem.rfind("x_"):] else: temp=sItem[sItem.rfind(".")+1:] self.win.setEditText("txtName",temp) self.win.setEditText("txtUName","|-."+temp+".-|") self.insField.addItem("objects",self.win.getListBoxItemCount("lstFields")) self.win.selectListBoxItemPos("lstFields", 0, True ) def btnOk_clicked(self, oActionEvent): desktop=getDesktop() doc = desktop.getCurrentComponent() cursor = doc.getCurrentController().getViewCursor() selectedItem = self.win.getListBoxSelectedItem( "lstFields" ) selectedItemPos = self.win.getListBoxSelectedItemPos( "lstFields" ) txtName = self.win.getEditText( "txtName" ) txtUName = self.win.getEditText( "txtUName" ) if selectedItem != "" and txtName != "" and txtUName != "": sKey=u""+ txtUName if selectedItem == "objects": sValue=u"[[ repeatIn(" + selectedItem + ",'" + txtName + "') ]]" else: sObjName=self.win.getComboBoxText("cmbVariable") sObjName=sObjName[:sObjName.find("(")] sValue=u"[[ repeatIn(" + sObjName + self.aListRepeatIn[selectedItemPos].replace("/",".") + ",'" + txtName +"') ]]" if self.bModify == True: oCurObj = cursor.TextField oCurObj.Items = (sKey,sValue) oCurObj.update() else: oInputList = doc.createInstance("com.sun.star.text.TextField.DropDown") if self.win.getListBoxSelectedItem("lstFields") == "objects": oInputList.Items = (sKey,sValue) doc.Text.insertTextContent(cursor,oInputList,False) else: sValue=u"[[ repeatIn(" + sObjName + self.aListRepeatIn[selectedItemPos].replace("/",".") + ",'" + txtName +"') ]]" if cursor.TextTable==None: oInputList.Items = (sKey,sValue) doc.Text.insertTextContent(cursor,oInputList,False) else: oInputList.Items = (sKey,sValue) widget = ( cursor.TextTable or selectedItem <> 'objects' ) and cursor.TextTable.getCellByName( cursor.Cell.CellName ) or doc.Text widget.insertTextContent(cursor,oInputList,False) self.win.endExecute() else: ErrorDialog("Please fill appropriate data in Object Field or Name field \nor select particular value from the list of fields.") def btnCancel_clicked(self, oActionEvent): self.win.endExecute() if __name__<>"package" and __name__=="__main__": RepeatIn() elif __name__=="package": g_ImplementationHelper = unohelper.ImplementationHelper() g_ImplementationHelper.addImplementation( RepeatIn, "org.openoffice.openerp.report.repeatln", ("com.sun.star.task.Job",),) # vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:
agpl-3.0
NitroKK/kernel_lge_iproj
tools/perf/scripts/python/sched-migration.py
11215
11670
#!/usr/bin/python # # Cpu task migration overview toy # # Copyright (C) 2010 Frederic Weisbecker <fweisbec@gmail.com> # # perf script event handlers have been generated by perf script -g python # # This software is distributed under the terms of the GNU General # Public License ("GPL") version 2 as published by the Free Software # Foundation. import os import sys from collections import defaultdict from UserList import UserList sys.path.append(os.environ['PERF_EXEC_PATH'] + \ '/scripts/python/Perf-Trace-Util/lib/Perf/Trace') sys.path.append('scripts/python/Perf-Trace-Util/lib/Perf/Trace') from perf_trace_context import * from Core import * from SchedGui import * threads = { 0 : "idle"} def thread_name(pid): return "%s:%d" % (threads[pid], pid) class RunqueueEventUnknown: @staticmethod def color(): return None def __repr__(self): return "unknown" class RunqueueEventSleep: @staticmethod def color(): return (0, 0, 0xff) def __init__(self, sleeper): self.sleeper = sleeper def __repr__(self): return "%s gone to sleep" % thread_name(self.sleeper) class RunqueueEventWakeup: @staticmethod def color(): return (0xff, 0xff, 0) def __init__(self, wakee): self.wakee = wakee def __repr__(self): return "%s woke up" % thread_name(self.wakee) class RunqueueEventFork: @staticmethod def color(): return (0, 0xff, 0) def __init__(self, child): self.child = child def __repr__(self): return "new forked task %s" % thread_name(self.child) class RunqueueMigrateIn: @staticmethod def color(): return (0, 0xf0, 0xff) def __init__(self, new): self.new = new def __repr__(self): return "task migrated in %s" % thread_name(self.new) class RunqueueMigrateOut: @staticmethod def color(): return (0xff, 0, 0xff) def __init__(self, old): self.old = old def __repr__(self): return "task migrated out %s" % thread_name(self.old) class RunqueueSnapshot: def __init__(self, tasks = [0], event = RunqueueEventUnknown()): self.tasks = tuple(tasks) self.event = event def sched_switch(self, prev, prev_state, next): event = RunqueueEventUnknown() if taskState(prev_state) == "R" and next in self.tasks \ and prev in self.tasks: return self if taskState(prev_state) != "R": event = RunqueueEventSleep(prev) next_tasks = list(self.tasks[:]) if prev in self.tasks: if taskState(prev_state) != "R": next_tasks.remove(prev) elif taskState(prev_state) == "R": next_tasks.append(prev) if next not in next_tasks: next_tasks.append(next) return RunqueueSnapshot(next_tasks, event) def migrate_out(self, old): if old not in self.tasks: return self next_tasks = [task for task in self.tasks if task != old] return RunqueueSnapshot(next_tasks, RunqueueMigrateOut(old)) def __migrate_in(self, new, event): if new in self.tasks: self.event = event return self next_tasks = self.tasks[:] + tuple([new]) return RunqueueSnapshot(next_tasks, event) def migrate_in(self, new): return self.__migrate_in(new, RunqueueMigrateIn(new)) def wake_up(self, new): return self.__migrate_in(new, RunqueueEventWakeup(new)) def wake_up_new(self, new): return self.__migrate_in(new, RunqueueEventFork(new)) def load(self): """ Provide the number of tasks on the runqueue. Don't count idle""" return len(self.tasks) - 1 def __repr__(self): ret = self.tasks.__repr__() ret += self.origin_tostring() return ret class TimeSlice: def __init__(self, start, prev): self.start = start self.prev = prev self.end = start # cpus that triggered the event self.event_cpus = [] if prev is not None: self.total_load = prev.total_load self.rqs = prev.rqs.copy() else: self.rqs = defaultdict(RunqueueSnapshot) self.total_load = 0 def __update_total_load(self, old_rq, new_rq): diff = new_rq.load() - old_rq.load() self.total_load += diff def sched_switch(self, ts_list, prev, prev_state, next, cpu): old_rq = self.prev.rqs[cpu] new_rq = old_rq.sched_switch(prev, prev_state, next) if old_rq is new_rq: return self.rqs[cpu] = new_rq self.__update_total_load(old_rq, new_rq) ts_list.append(self) self.event_cpus = [cpu] def migrate(self, ts_list, new, old_cpu, new_cpu): if old_cpu == new_cpu: return old_rq = self.prev.rqs[old_cpu] out_rq = old_rq.migrate_out(new) self.rqs[old_cpu] = out_rq self.__update_total_load(old_rq, out_rq) new_rq = self.prev.rqs[new_cpu] in_rq = new_rq.migrate_in(new) self.rqs[new_cpu] = in_rq self.__update_total_load(new_rq, in_rq) ts_list.append(self) if old_rq is not out_rq: self.event_cpus.append(old_cpu) self.event_cpus.append(new_cpu) def wake_up(self, ts_list, pid, cpu, fork): old_rq = self.prev.rqs[cpu] if fork: new_rq = old_rq.wake_up_new(pid) else: new_rq = old_rq.wake_up(pid) if new_rq is old_rq: return self.rqs[cpu] = new_rq self.__update_total_load(old_rq, new_rq) ts_list.append(self) self.event_cpus = [cpu] def next(self, t): self.end = t return TimeSlice(t, self) class TimeSliceList(UserList): def __init__(self, arg = []): self.data = arg def get_time_slice(self, ts): if len(self.data) == 0: slice = TimeSlice(ts, TimeSlice(-1, None)) else: slice = self.data[-1].next(ts) return slice def find_time_slice(self, ts): start = 0 end = len(self.data) found = -1 searching = True while searching: if start == end or start == end - 1: searching = False i = (end + start) / 2 if self.data[i].start <= ts and self.data[i].end >= ts: found = i end = i continue if self.data[i].end < ts: start = i elif self.data[i].start > ts: end = i return found def set_root_win(self, win): self.root_win = win def mouse_down(self, cpu, t): idx = self.find_time_slice(t) if idx == -1: return ts = self[idx] rq = ts.rqs[cpu] raw = "CPU: %d\n" % cpu raw += "Last event : %s\n" % rq.event.__repr__() raw += "Timestamp : %d.%06d\n" % (ts.start / (10 ** 9), (ts.start % (10 ** 9)) / 1000) raw += "Duration : %6d us\n" % ((ts.end - ts.start) / (10 ** 6)) raw += "Load = %d\n" % rq.load() for t in rq.tasks: raw += "%s \n" % thread_name(t) self.root_win.update_summary(raw) def update_rectangle_cpu(self, slice, cpu): rq = slice.rqs[cpu] if slice.total_load != 0: load_rate = rq.load() / float(slice.total_load) else: load_rate = 0 red_power = int(0xff - (0xff * load_rate)) color = (0xff, red_power, red_power) top_color = None if cpu in slice.event_cpus: top_color = rq.event.color() self.root_win.paint_rectangle_zone(cpu, color, top_color, slice.start, slice.end) def fill_zone(self, start, end): i = self.find_time_slice(start) if i == -1: return for i in xrange(i, len(self.data)): timeslice = self.data[i] if timeslice.start > end: return for cpu in timeslice.rqs: self.update_rectangle_cpu(timeslice, cpu) def interval(self): if len(self.data) == 0: return (0, 0) return (self.data[0].start, self.data[-1].end) def nr_rectangles(self): last_ts = self.data[-1] max_cpu = 0 for cpu in last_ts.rqs: if cpu > max_cpu: max_cpu = cpu return max_cpu class SchedEventProxy: def __init__(self): self.current_tsk = defaultdict(lambda : -1) self.timeslices = TimeSliceList() def sched_switch(self, headers, prev_comm, prev_pid, prev_prio, prev_state, next_comm, next_pid, next_prio): """ Ensure the task we sched out this cpu is really the one we logged. Otherwise we may have missed traces """ on_cpu_task = self.current_tsk[headers.cpu] if on_cpu_task != -1 and on_cpu_task != prev_pid: print "Sched switch event rejected ts: %s cpu: %d prev: %s(%d) next: %s(%d)" % \ (headers.ts_format(), headers.cpu, prev_comm, prev_pid, next_comm, next_pid) threads[prev_pid] = prev_comm threads[next_pid] = next_comm self.current_tsk[headers.cpu] = next_pid ts = self.timeslices.get_time_slice(headers.ts()) ts.sched_switch(self.timeslices, prev_pid, prev_state, next_pid, headers.cpu) def migrate(self, headers, pid, prio, orig_cpu, dest_cpu): ts = self.timeslices.get_time_slice(headers.ts()) ts.migrate(self.timeslices, pid, orig_cpu, dest_cpu) def wake_up(self, headers, comm, pid, success, target_cpu, fork): if success == 0: return ts = self.timeslices.get_time_slice(headers.ts()) ts.wake_up(self.timeslices, pid, target_cpu, fork) def trace_begin(): global parser parser = SchedEventProxy() def trace_end(): app = wx.App(False) timeslices = parser.timeslices frame = RootFrame(timeslices, "Migration") app.MainLoop() def sched__sched_stat_runtime(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, comm, pid, runtime, vruntime): pass def sched__sched_stat_iowait(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, comm, pid, delay): pass def sched__sched_stat_sleep(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, comm, pid, delay): pass def sched__sched_stat_wait(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, comm, pid, delay): pass def sched__sched_process_fork(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, parent_comm, parent_pid, child_comm, child_pid): pass def sched__sched_process_wait(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, comm, pid, prio): pass def sched__sched_process_exit(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, comm, pid, prio): pass def sched__sched_process_free(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, comm, pid, prio): pass def sched__sched_migrate_task(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, comm, pid, prio, orig_cpu, dest_cpu): headers = EventHeaders(common_cpu, common_secs, common_nsecs, common_pid, common_comm) parser.migrate(headers, pid, prio, orig_cpu, dest_cpu) def sched__sched_switch(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, prev_comm, prev_pid, prev_prio, prev_state, next_comm, next_pid, next_prio): headers = EventHeaders(common_cpu, common_secs, common_nsecs, common_pid, common_comm) parser.sched_switch(headers, prev_comm, prev_pid, prev_prio, prev_state, next_comm, next_pid, next_prio) def sched__sched_wakeup_new(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, comm, pid, prio, success, target_cpu): headers = EventHeaders(common_cpu, common_secs, common_nsecs, common_pid, common_comm) parser.wake_up(headers, comm, pid, success, target_cpu, 1) def sched__sched_wakeup(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, comm, pid, prio, success, target_cpu): headers = EventHeaders(common_cpu, common_secs, common_nsecs, common_pid, common_comm) parser.wake_up(headers, comm, pid, success, target_cpu, 0) def sched__sched_wait_task(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, comm, pid, prio): pass def sched__sched_kthread_stop_ret(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, ret): pass def sched__sched_kthread_stop(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm, comm, pid): pass def trace_unhandled(event_name, context, common_cpu, common_secs, common_nsecs, common_pid, common_comm): pass
gpl-2.0
CLVsol/oehealth
oehealth_pharmacy/oehealth_annotation.py
1
1638
# -*- encoding: utf-8 -*- ################################################################################ # # # Copyright (C) 2013-Today Carlos Eduardo Vercelino - CLVsol # # # # This program is free software: you can redistribute it and/or modify # # it under the terms of the GNU Affero General Public License as published by # # the Free Software Foundation, either version 3 of the License, or # # (at your option) any later version. # # # # This program is distributed in the hope that it will be useful, # # but WITHOUT ANY WARRANTY; without even the implied warranty of # # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # # GNU Affero General Public License for more details. # # # # You should have received a copy of the GNU Affero General Public License # # along with this program. If not, see <http://www.gnu.org/licenses/>. # ################################################################################ from openerp.osv import orm, fields class oehealth_annotation(orm.Model): _inherit = 'oehealth.annotation' _columns = { 'pharmacy_id' : fields.many2one ('oehealth.pharmacy', 'Pharmacy'), } oehealth_annotation()
agpl-3.0
SrNetoChan/Quantum-GIS
python/plugins/processing/algs/qgis/Heatmap.py
15
11238
# -*- coding: utf-8 -*- """ *************************************************************************** Heatmap.py --------------------- Date : November 2016 Copyright : (C) 2016 by Nyall Dawson Email : nyall dot dawson at gmail dot com *************************************************************************** * * * This program is free software; you can redistribute it and/or modify * * it under the terms of the GNU General Public License as published by * * the Free Software Foundation; either version 2 of the License, or * * (at your option) any later version. * * * *************************************************************************** """ __author__ = 'Nyall Dawson' __date__ = 'November 2016' __copyright__ = '(C) 2016, Nyall Dawson' import os from collections import OrderedDict from qgis.PyQt.QtGui import QIcon from qgis.core import (QgsApplication, QgsFeatureRequest, QgsRasterFileWriter, QgsProcessing, QgsProcessingException, QgsProcessingParameterFeatureSource, QgsProcessingParameterNumber, QgsProcessingParameterDistance, QgsProcessingParameterField, QgsProcessingParameterEnum, QgsProcessingParameterDefinition, QgsProcessingParameterRasterDestination) from qgis.analysis import QgsKernelDensityEstimation from processing.algs.qgis.QgisAlgorithm import QgisAlgorithm pluginPath = os.path.split(os.path.split(os.path.dirname(__file__))[0])[0] class Heatmap(QgisAlgorithm): INPUT = 'INPUT' RADIUS = 'RADIUS' RADIUS_FIELD = 'RADIUS_FIELD' WEIGHT_FIELD = 'WEIGHT_FIELD' PIXEL_SIZE = 'PIXEL_SIZE' KERNEL = 'KERNEL' DECAY = 'DECAY' OUTPUT_VALUE = 'OUTPUT_VALUE' OUTPUT = 'OUTPUT' def icon(self): return QgsApplication.getThemeIcon("/heatmap.svg") def tags(self): return self.tr('heatmap,kde,hotspot').split(',') def group(self): return self.tr('Interpolation') def groupId(self): return 'interpolation' def name(self): return 'heatmapkerneldensityestimation' def displayName(self): return self.tr('Heatmap (Kernel Density Estimation)') def __init__(self): super().__init__() def initAlgorithm(self, config=None): self.KERNELS = OrderedDict([(self.tr('Quartic'), QgsKernelDensityEstimation.KernelQuartic), (self.tr('Triangular'), QgsKernelDensityEstimation.KernelTriangular), (self.tr('Uniform'), QgsKernelDensityEstimation.KernelUniform), (self.tr('Triweight'), QgsKernelDensityEstimation.KernelTriweight), (self.tr('Epanechnikov'), QgsKernelDensityEstimation.KernelEpanechnikov)]) self.OUTPUT_VALUES = OrderedDict([(self.tr('Raw'), QgsKernelDensityEstimation.OutputRaw), (self.tr('Scaled'), QgsKernelDensityEstimation.OutputScaled)]) self.addParameter(QgsProcessingParameterFeatureSource(self.INPUT, self.tr('Point layer'), [QgsProcessing.TypeVectorPoint])) self.addParameter(QgsProcessingParameterDistance(self.RADIUS, self.tr('Radius'), 100.0, self.INPUT, False, 0.0)) radius_field_param = QgsProcessingParameterField(self.RADIUS_FIELD, self.tr('Radius from field'), None, self.INPUT, QgsProcessingParameterField.Numeric, optional=True ) radius_field_param.setFlags(radius_field_param.flags() | QgsProcessingParameterDefinition.FlagAdvanced) self.addParameter(radius_field_param) class ParameterHeatmapPixelSize(QgsProcessingParameterNumber): def __init__(self, name='', description='', parent_layer=None, radius_param=None, radius_field_param=None, minValue=None, default=None, optional=False): QgsProcessingParameterNumber.__init__(self, name, description, QgsProcessingParameterNumber.Double, default, optional, minValue) self.parent_layer = parent_layer self.radius_param = radius_param self.radius_field_param = radius_field_param def clone(self): copy = ParameterHeatmapPixelSize(self.name(), self.description(), self.parent_layer, self.radius_param, self.radius_field_param, self.minimum(), self.maximum(), self.defaultValue((), self.flags() & QgsProcessingParameterDefinition.FlagOptional)) return copy pixel_size_param = ParameterHeatmapPixelSize(self.PIXEL_SIZE, self.tr('Output raster size'), parent_layer=self.INPUT, radius_param=self.RADIUS, radius_field_param=self.RADIUS_FIELD, minValue=0.0, default=0.1) pixel_size_param.setMetadata({ 'widget_wrapper': { 'class': 'processing.algs.qgis.ui.HeatmapWidgets.HeatmapPixelSizeWidgetWrapper'}}) self.addParameter(pixel_size_param) weight_field_param = QgsProcessingParameterField(self.WEIGHT_FIELD, self.tr('Weight from field'), None, self.INPUT, QgsProcessingParameterField.Numeric, optional=True ) weight_field_param.setFlags(weight_field_param.flags() | QgsProcessingParameterDefinition.FlagAdvanced) self.addParameter(weight_field_param) keys = list(self.KERNELS.keys()) kernel_shape_param = QgsProcessingParameterEnum(self.KERNEL, self.tr('Kernel shape'), keys, allowMultiple=False, defaultValue=0) kernel_shape_param.setFlags(kernel_shape_param.flags() | QgsProcessingParameterDefinition.FlagAdvanced) self.addParameter(kernel_shape_param) decay_ratio = QgsProcessingParameterNumber(self.DECAY, self.tr('Decay ratio (Triangular kernels only)'), QgsProcessingParameterNumber.Double, 0.0, True, -100.0, 100.0) decay_ratio.setFlags(decay_ratio.flags() | QgsProcessingParameterDefinition.FlagAdvanced) self.addParameter(decay_ratio) keys = list(self.OUTPUT_VALUES.keys()) output_scaling = QgsProcessingParameterEnum(self.OUTPUT_VALUE, self.tr('Output value scaling'), keys, allowMultiple=False, defaultValue=0) output_scaling.setFlags(output_scaling.flags() | QgsProcessingParameterDefinition.FlagAdvanced) self.addParameter(output_scaling) self.addParameter(QgsProcessingParameterRasterDestination(self.OUTPUT, self.tr('Heatmap'))) def processAlgorithm(self, parameters, context, feedback): source = self.parameterAsSource(parameters, self.INPUT, context) if source is None: raise QgsProcessingException(self.invalidSourceError(parameters, self.INPUT)) radius = self.parameterAsDouble(parameters, self.RADIUS, context) kernel_shape = self.parameterAsEnum(parameters, self.KERNEL, context) pixel_size = self.parameterAsDouble(parameters, self.PIXEL_SIZE, context) decay = self.parameterAsDouble(parameters, self.DECAY, context) output_values = self.parameterAsEnum(parameters, self.OUTPUT_VALUE, context) outputFile = self.parameterAsOutputLayer(parameters, self.OUTPUT, context) output_format = QgsRasterFileWriter.driverForExtension(os.path.splitext(outputFile)[1]) weight_field = self.parameterAsString(parameters, self.WEIGHT_FIELD, context) radius_field = self.parameterAsString(parameters, self.RADIUS_FIELD, context) attrs = [] kde_params = QgsKernelDensityEstimation.Parameters() kde_params.source = source kde_params.radius = radius kde_params.pixelSize = pixel_size # radius field if radius_field: kde_params.radiusField = radius_field attrs.append(source.fields().lookupField(radius_field)) # weight field if weight_field: kde_params.weightField = weight_field attrs.append(source.fields().lookupField(weight_field)) kde_params.shape = kernel_shape kde_params.decayRatio = decay kde_params.outputValues = output_values kde = QgsKernelDensityEstimation(kde_params, outputFile, output_format) if kde.prepare() != QgsKernelDensityEstimation.Success: raise QgsProcessingException( self.tr('Could not create destination layer')) request = QgsFeatureRequest() request.setSubsetOfAttributes(attrs) features = source.getFeatures(request) total = 100.0 / source.featureCount() if source.featureCount() else 0 for current, f in enumerate(features): if feedback.isCanceled(): break if kde.addFeature(f) != QgsKernelDensityEstimation.Success: feedback.reportError(self.tr('Error adding feature with ID {} to heatmap').format(f.id())) feedback.setProgress(int(current * total)) if kde.finalise() != QgsKernelDensityEstimation.Success: raise QgsProcessingException( self.tr('Could not save destination layer')) return {self.OUTPUT: outputFile}
gpl-2.0
SnabbCo/neutron
neutron/tests/unit/services/firewall/agents/l3reference/test_firewall_l3_agent.py
3
16283
# vim: tabstop=4 shiftwidth=4 softtabstop=4 # # Copyright (c) 2013 OpenStack Foundation # All Rights Reserved. # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. # # @author: Sumit Naiksatam, sumitnaiksatam@gmail.com, Big Switch Networks, Inc. # @author: Sridar Kandaswamy, skandasw@cisco.com, Cisco Systems, Inc. # @author: Dan Florea, dflorea@cisco.com, Cisco Systems, Inc. import contextlib import uuid import mock from oslo.config import cfg from neutron.agent.common import config as agent_config from neutron.agent import l3_agent from neutron.agent.linux import ip_lib from neutron.common import config as base_config from neutron import context from neutron.plugins.common import constants from neutron.services.firewall.agents.l3reference import firewall_l3_agent from neutron.tests import base from neutron.tests.unit.services.firewall.agents import test_firewall_agent_api class FWaasHelper(object): def __init__(self, host): pass class FWaasAgent(firewall_l3_agent.FWaaSL3AgentRpcCallback, FWaasHelper): def __init__(self, conf=None): super(FWaasAgent, self).__init__(conf) class TestFwaasL3AgentRpcCallback(base.BaseTestCase): def setUp(self): super(TestFwaasL3AgentRpcCallback, self).setUp() self.conf = cfg.ConfigOpts() self.conf.register_opts(base_config.core_opts) self.conf.register_opts(l3_agent.L3NATAgent.OPTS) agent_config.register_use_namespaces_opts_helper(self.conf) agent_config.register_root_helper(self.conf) self.conf.root_helper = 'sudo' self.api = FWaasAgent(self.conf) self.api.fwaas_driver = test_firewall_agent_api.NoopFwaasDriver() def test_create_firewall(self): fake_firewall = {'id': 0} with mock.patch.object( self.api, '_invoke_driver_for_plugin_api' ) as mock_driver: self.assertEqual( self.api.create_firewall( mock.sentinel.context, fake_firewall, 'host'), mock_driver.return_value) def test_update_firewall(self): fake_firewall = {'id': 0} with mock.patch.object( self.api, '_invoke_driver_for_plugin_api' ) as mock_driver: self.assertEqual( self.api.update_firewall( mock.sentinel.context, fake_firewall, 'host'), mock_driver.return_value) def test_delete_firewall(self): fake_firewall = {'id': 0} with mock.patch.object( self.api, '_invoke_driver_for_plugin_api' ) as mock_driver: self.assertEqual( self.api.delete_firewall( mock.sentinel.context, fake_firewall, 'host'), mock_driver.return_value) def test_invoke_driver_for_plugin_api(self): fake_firewall = {'id': 0, 'tenant_id': 1, 'admin_state_up': True} self.api.plugin_rpc = mock.Mock() with contextlib.nested( mock.patch.object(self.api.plugin_rpc, 'get_routers'), mock.patch.object(self.api, '_get_router_info_list_for_tenant'), mock.patch.object(self.api.fwaas_driver, 'create_firewall'), mock.patch.object(self.api.fwplugin_rpc, 'set_firewall_status') ) as ( mock_get_routers, mock_get_router_info_list_for_tenant, mock_driver_create_firewall, mock_set_firewall_status): mock_driver_create_firewall.return_value = True self.api.create_firewall( context=mock.sentinel.context, firewall=fake_firewall, host='host') mock_get_routers.assert_called_once_with( mock.sentinel.context) mock_get_router_info_list_for_tenant.assert_called_once_with( mock_get_routers.return_value, fake_firewall['tenant_id']) mock_set_firewall_status.assert_called_once_with( mock.sentinel.context, fake_firewall['id'], 'ACTIVE') def test_invoke_driver_for_plugin_api_admin_state_down(self): fake_firewall = {'id': 0, 'tenant_id': 1, 'admin_state_up': False} self.api.plugin_rpc = mock.Mock() with contextlib.nested( mock.patch.object(self.api.plugin_rpc, 'get_routers'), mock.patch.object(self.api, '_get_router_info_list_for_tenant'), mock.patch.object(self.api.fwaas_driver, 'update_firewall'), mock.patch.object(self.api.fwplugin_rpc, 'get_firewalls_for_tenant'), mock.patch.object(self.api.fwplugin_rpc, 'set_firewall_status') ) as ( mock_get_routers, mock_get_router_info_list_for_tenant, mock_driver_update_firewall, mock_get_firewalls_for_tenant, mock_set_firewall_status): mock_driver_update_firewall.return_value = True self.api.update_firewall( context=mock.sentinel.context, firewall=fake_firewall, host='host') mock_get_routers.assert_called_once_with( mock.sentinel.context) mock_get_router_info_list_for_tenant.assert_called_once_with( mock_get_routers.return_value, fake_firewall['tenant_id']) mock_set_firewall_status.assert_called_once_with( mock.sentinel.context, fake_firewall['id'], 'DOWN') def test_invoke_driver_for_plugin_api_delete(self): fake_firewall = {'id': 0, 'tenant_id': 1, 'admin_state_up': True} self.api.plugin_rpc = mock.Mock() with contextlib.nested( mock.patch.object(self.api.plugin_rpc, 'get_routers'), mock.patch.object(self.api, '_get_router_info_list_for_tenant'), mock.patch.object(self.api.fwaas_driver, 'delete_firewall'), mock.patch.object(self.api.fwplugin_rpc, 'firewall_deleted') ) as ( mock_get_routers, mock_get_router_info_list_for_tenant, mock_driver_delete_firewall, mock_firewall_deleted): mock_driver_delete_firewall.return_value = True self.api.delete_firewall( context=mock.sentinel.context, firewall=fake_firewall, host='host') mock_get_routers.assert_called_once_with( mock.sentinel.context) mock_get_router_info_list_for_tenant.assert_called_once_with( mock_get_routers.return_value, fake_firewall['tenant_id']) mock_firewall_deleted.assert_called_once_with( mock.sentinel.context, fake_firewall['id']) def test_delete_firewall_no_router(self): fake_firewall = {'id': 0, 'tenant_id': 1} self.api.plugin_rpc = mock.Mock() with contextlib.nested( mock.patch.object(self.api.plugin_rpc, 'get_routers'), mock.patch.object(self.api, '_get_router_info_list_for_tenant'), mock.patch.object(self.api.fwplugin_rpc, 'firewall_deleted') ) as ( mock_get_routers, mock_get_router_info_list_for_tenant, mock_firewall_deleted): mock_get_router_info_list_for_tenant.return_value = [] self.api.delete_firewall( context=mock.sentinel.context, firewall=fake_firewall, host='host') mock_get_routers.assert_called_once_with( mock.sentinel.context) mock_get_router_info_list_for_tenant.assert_called_once_with( mock_get_routers.return_value, fake_firewall['tenant_id']) mock_firewall_deleted.assert_called_once_with( mock.sentinel.context, fake_firewall['id']) def test_process_router_add_fw_update(self): fake_firewall_list = [{'id': 0, 'tenant_id': 1, 'status': constants.PENDING_UPDATE, 'admin_state_up': True}] fake_router = {'id': 1111, 'tenant_id': 2} self.api.plugin_rpc = mock.Mock() ri = mock.Mock() ri.router = fake_router routers = [ri.router] with contextlib.nested( mock.patch.object(self.api.plugin_rpc, 'get_routers'), mock.patch.object(self.api, '_get_router_info_list_for_tenant'), mock.patch.object(self.api.fwaas_driver, 'update_firewall'), mock.patch.object(self.api.fwplugin_rpc, 'set_firewall_status'), mock.patch.object(self.api.fwplugin_rpc, 'get_firewalls_for_tenant'), mock.patch.object(context, 'Context') ) as ( mock_get_routers, mock_get_router_info_list_for_tenant, mock_driver_update_firewall, mock_set_firewall_status, mock_get_firewalls_for_tenant, mock_Context): mock_driver_update_firewall.return_value = True ctx = mock.sentinel.context mock_Context.return_value = ctx mock_get_router_info_list_for_tenant.return_value = routers mock_get_firewalls_for_tenant.return_value = fake_firewall_list self.api._process_router_add(ri) mock_get_router_info_list_for_tenant.assert_called_with( routers, ri.router['tenant_id']) mock_get_firewalls_for_tenant.assert_called_once_with(ctx) mock_driver_update_firewall.assert_called_once_with( routers, fake_firewall_list[0]) mock_set_firewall_status.assert_called_once_with( ctx, fake_firewall_list[0]['id'], constants.ACTIVE) def test_process_router_add_fw_delete(self): fake_firewall_list = [{'id': 0, 'tenant_id': 1, 'status': constants.PENDING_DELETE}] fake_router = {'id': 1111, 'tenant_id': 2} self.api.plugin_rpc = mock.Mock() ri = mock.Mock() ri.router = fake_router routers = [ri.router] with contextlib.nested( mock.patch.object(self.api.plugin_rpc, 'get_routers'), mock.patch.object(self.api, '_get_router_info_list_for_tenant'), mock.patch.object(self.api.fwaas_driver, 'delete_firewall'), mock.patch.object(self.api.fwplugin_rpc, 'firewall_deleted'), mock.patch.object(self.api.fwplugin_rpc, 'get_firewalls_for_tenant'), mock.patch.object(context, 'Context') ) as ( mock_get_routers, mock_get_router_info_list_for_tenant, mock_driver_delete_firewall, mock_firewall_deleted, mock_get_firewalls_for_tenant, mock_Context): mock_driver_delete_firewall.return_value = True ctx = mock.sentinel.context mock_Context.return_value = ctx mock_get_router_info_list_for_tenant.return_value = routers mock_get_firewalls_for_tenant.return_value = fake_firewall_list self.api._process_router_add(ri) mock_get_router_info_list_for_tenant.assert_called_with( routers, ri.router['tenant_id']) mock_get_firewalls_for_tenant.assert_called_once_with(ctx) mock_driver_delete_firewall.assert_called_once_with( routers, fake_firewall_list[0]) mock_firewall_deleted.assert_called_once_with( ctx, fake_firewall_list[0]['id']) def _prepare_router_data(self, use_namespaces): router = {'id': str(uuid.uuid4()), 'tenant_id': str(uuid.uuid4())} return l3_agent.RouterInfo(router['id'], self.conf.root_helper, use_namespaces, router=router) def _get_router_info_list_with_namespace_helper(self, router_use_namespaces): self.conf.set_override('use_namespaces', True) ri = self._prepare_router_data( use_namespaces=router_use_namespaces) routers = [ri.router] self.api.router_info = {ri.router_id: ri} with mock.patch.object(ip_lib.IPWrapper, 'get_namespaces') as mock_get_namespaces: mock_get_namespaces.return_value = ri.ns_name router_info_list = self.api._get_router_info_list_for_tenant( routers, ri.router['tenant_id']) self.assertEqual([ri], router_info_list) mock_get_namespaces.assert_called_once_with( self.conf.root_helper) def _get_router_info_list_without_namespace_helper(self, router_use_namespaces): self.conf.set_override('use_namespaces', False) ri = self._prepare_router_data( use_namespaces=router_use_namespaces) routers = [ri.router] self.api.router_info = {ri.router_id: ri} router_info_list = self.api._get_router_info_list_for_tenant( routers, ri.router['tenant_id']) if router_use_namespaces: self.assertFalse(router_info_list) else: self.assertEqual([ri], router_info_list) def test_get_router_info_list_for_tenant_for_namespaces_enabled(self): self._get_router_info_list_with_namespace_helper( router_use_namespaces=True) def test_get_router_info_list_for_tenant_for_namespaces_disabled(self): self._get_router_info_list_without_namespace_helper( router_use_namespaces=False) def test_get_router_info_list_tenant_with_namespace_router_without(self): self._get_router_info_list_with_namespace_helper( router_use_namespaces=False) def test_get_router_info_list_tenant_without_namespace_router_with(self): self._get_router_info_list_without_namespace_helper( router_use_namespaces=True) def _get_router_info_list_router_without_router_info_helper(self, rtr_with_ri): self.conf.set_override('use_namespaces', True) # ri.router with associated router_info (ri) # rtr2 has no router_info ri = self._prepare_router_data(use_namespaces=True) rtr2 = {'id': str(uuid.uuid4()), 'tenant_id': ri.router['tenant_id']} routers = [rtr2] self.api.router_info = {} ri_expected = [] if rtr_with_ri: self.api.router_info[ri.router_id] = ri routers.append(ri.router) ri_expected.append(ri) with mock.patch.object(ip_lib.IPWrapper, 'get_namespaces') as mock_get_namespaces: mock_get_namespaces.return_value = ri.ns_name router_info_list = self.api._get_router_info_list_for_tenant( routers, ri.router['tenant_id']) self.assertEqual(ri_expected, router_info_list) def test_get_router_info_list_router_without_router_info(self): self._get_router_info_list_router_without_router_info_helper( rtr_with_ri=False) def test_get_router_info_list_two_routers_one_without_router_info(self): self._get_router_info_list_router_without_router_info_helper( rtr_with_ri=True)
apache-2.0