gt
stringclasses
1 value
context
stringlengths
2.49k
119k
# Copyright 2016 Cloudbase Solutions Srl # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """Config options available all across the project.""" from oslo_config import cfg from cloudbaseinit.conf import base as conf_base from cloudbaseinit import constant class GlobalOptions(conf_base.Options): """Config options available all across the project.""" def __init__(self, config): super(GlobalOptions, self).__init__(config, group="DEFAULT") self._options = [ cfg.BoolOpt( 'allow_reboot', default=True, help='Allows OS reboots requested by plugins'), cfg.BoolOpt( 'stop_service_on_exit', default=True, help='In case of execution as a service, specifies if the ' 'service must be gracefully stopped before exiting'), cfg.BoolOpt( 'check_latest_version', default=False, help='Check if there is a newer version of cloudbase-init ' 'available. If this option is activated, a log ' 'message will be emitted if there is a newer version ' 'available.'), cfg.IntOpt( 'retry_count', default=5, help='Max. number of attempts for fetching metadata in ' 'case of transient errors'), cfg.FloatOpt( 'retry_count_interval', default=4, help='Interval between attempts in case of transient errors, ' 'expressed in seconds'), cfg.StrOpt( 'mtools_path', default=None, help='Path to "mtools" program suite, used for interacting ' 'with VFAT filesystems'), cfg.StrOpt( 'bsdtar_path', default='bsdtar.exe', help='Path to "bsdtar", used to extract ISO ConfigDrive ' 'files'), cfg.BoolOpt( 'netbios_host_name_compatibility', default=True, help='Truncates the hostname to 15 characters for Netbios ' 'compatibility'), cfg.StrOpt( 'logging_serial_port_settings', default=None, help='Serial port logging settings. Format: ' '"port,baudrate,parity,bytesize", e.g.: ' '"COM1,115200,N,8". Set to None (default) to disable.'), cfg.BoolOpt( 'activate_windows', default=False, help='Activates Windows automatically'), cfg.BoolOpt( 'set_kms_product_key', default=False, help='Sets the KMS product key for this operating system'), cfg.BoolOpt( 'set_avma_product_key', default=False, help='Sets the AVMA product key for this operating system'), cfg.StrOpt( 'kms_host', default=None, help='The KMS host address in form <host>[:<port>], ' 'e.g: "kmshost:1688"'), cfg.BoolOpt( 'log_licensing_info', default=True, help='Logs the operating system licensing information'), cfg.BoolOpt( 'winrm_enable_basic_auth', default=True, help='Enables basic authentication for the WinRM ' 'HTTPS listener'), cfg.BoolOpt( 'winrm_configure_http_listener', default=False, help='Configures the WinRM HTTP listener'), cfg.BoolOpt( 'winrm_configure_https_listener', default=True, help='Configures the WinRM HTTPS listener'), cfg.ListOpt( 'volumes_to_extend', default=None, help='List of volumes that need to be extended ' 'if contiguous space is available on the disk. ' 'By default all the available volumes can be extended. ' 'Volumes must be specified using a comma separated list ' 'of volume indexes, e.g.: "1,2"'), cfg.StrOpt( 'san_policy', default=None, choices=[constant.SAN_POLICY_ONLINE_STR, constant.SAN_POLICY_OFFLINE_STR, constant.SAN_POLICY_OFFLINE_SHARED_STR], help='If not None, the SAN policy is set to the given value'), cfg.StrOpt( 'local_scripts_path', default=None, help='Path location containing scripts to be executed when ' 'the plugin runs'), cfg.BoolOpt( 'mtu_use_dhcp_config', default=True, help='Configures the network interfaces MTU based on the ' 'values provided via DHCP'), cfg.StrOpt( 'username', default='Admin', help='User to be added to the ' 'system or updated if already existing'), cfg.ListOpt( 'groups', default=['Administrators'], help='List of local groups to which the user specified in ' '"username" will be added'), cfg.BoolOpt( 'rename_admin_user', default=False, help='Renames the builtin admin user instead of creating a ' 'new user'), cfg.StrOpt( 'heat_config_dir', default='C:\\cfn', help='The directory where the Heat configuration files must ' 'be saved'), cfg.BoolOpt( 'ntp_enable_service', default=True, help='Enables the NTP client service'), cfg.BoolOpt( 'ntp_use_dhcp_config', default=False, help='Configures NTP client time synchronization using ' 'the NTP servers provided via DHCP'), cfg.BoolOpt( 'real_time_clock_utc', default=False, help='Sets the real time clock to use universal time (True) ' 'or local time (False)'), cfg.BoolOpt( 'inject_user_password', default=True, help='Set the password provided in the configuration. ' 'If False or no password is provided, a random one ' 'will be set'), cfg.StrOpt( 'first_logon_behaviour', default=constant.CLEAR_TEXT_INJECTED_ONLY, choices=constant.LOGON_PASSWORD_CHANGE_OPTIONS, help='Control the behaviour of what happens at ' 'next logon. If this option is set to `always`, ' 'then the user will be forced to change the password ' 'at next logon. If it is set to ' '`clear_text_injected_only`, ' 'then the user will have to change the password only if ' 'the password is a clear text password, coming from the ' 'metadata. The last option is `no`, when the user is ' 'never forced to change the password.'), cfg.ListOpt( 'metadata_services', default=[ 'cloudbaseinit.metadata.services.httpservice.HttpService', 'cloudbaseinit.metadata.services' '.configdrive.ConfigDriveService', 'cloudbaseinit.metadata.services.ec2service.EC2Service', 'cloudbaseinit.metadata.services' '.maasservice.MaaSHttpService', 'cloudbaseinit.metadata.services.cloudstack.CloudStack', 'cloudbaseinit.metadata.services' '.opennebulaservice.OpenNebulaService', ], help='List of enabled metadata service classes, ' 'to be tested for availability in the provided order. ' 'The first available service will be used to retrieve ' 'metadata'), cfg.ListOpt( 'plugins', default=[ 'cloudbaseinit.plugins.common.mtu.MTUPlugin', 'cloudbaseinit.plugins.windows.ntpclient' '.NTPClientPlugin', 'cloudbaseinit.plugins.common.sethostname' '.SetHostNamePlugin', 'cloudbaseinit.plugins.windows.createuser' '.CreateUserPlugin', 'cloudbaseinit.plugins.common.networkconfig' '.NetworkConfigPlugin', 'cloudbaseinit.plugins.windows.licensing' '.WindowsLicensingPlugin', 'cloudbaseinit.plugins.common.sshpublickeys' '.SetUserSSHPublicKeysPlugin', 'cloudbaseinit.plugins.windows.extendvolumes' '.ExtendVolumesPlugin', 'cloudbaseinit.plugins.common.userdata.UserDataPlugin', 'cloudbaseinit.plugins.common.setuserpassword.' 'SetUserPasswordPlugin', 'cloudbaseinit.plugins.windows.winrmlistener.' 'ConfigWinRMListenerPlugin', 'cloudbaseinit.plugins.windows.winrmcertificateauth.' 'ConfigWinRMCertificateAuthPlugin', 'cloudbaseinit.plugins.common.localscripts' '.LocalScriptsPlugin', ], help='List of enabled plugin classes, ' 'to be executed in the provided order'), cfg.ListOpt( 'user_data_plugins', default=[ 'cloudbaseinit.plugins.common.userdataplugins.parthandler.' 'PartHandlerPlugin', 'cloudbaseinit.plugins.common.userdataplugins.cloudconfig.' 'CloudConfigPlugin', 'cloudbaseinit.plugins.common.userdataplugins' '.cloudboothook.CloudBootHookPlugin', 'cloudbaseinit.plugins.common.userdataplugins.shellscript.' 'ShellScriptPlugin', 'cloudbaseinit.plugins.common.userdataplugins' '.multipartmixed.MultipartMixedPlugin', 'cloudbaseinit.plugins.common.userdataplugins.heat.' 'HeatPlugin', ], help='List of enabled userdata content plugins'), cfg.ListOpt( 'cloud_config_plugins', default=[], help='List which contains the name of the cloud config ' 'plugins ordered by priority.'), cfg.BoolOpt( 'rdp_set_keepalive', default=True, help='Sets the RDP KeepAlive policy'), cfg.StrOpt( 'bcd_boot_status_policy', default=None, choices=[constant.POLICY_IGNORE_ALL_FAILURES], help='Sets the Windows BCD boot status policy'), cfg.BoolOpt( 'bcd_enable_auto_recovery', default=False, help='Enables or disables the BCD auto recovery'), cfg.BoolOpt( 'set_unique_boot_disk_id', default=True, help='Sets a new random unique id on the boot disk to avoid ' 'collisions'), cfg.IntOpt( 'display_idle_timeout', default=0, help='The idle timeout, in seconds, before powering off ' 'the display. Set 0 to leave the display always on'), cfg.ListOpt( 'page_file_volume_labels', default=[], help='Labels of volumes on which a Windows page file needs to ' 'be created. E.g.: "Temporary Storage"'), cfg.ListOpt( 'page_file_volume_mount_points', default=[], help='Volume mount points on which a Windows page file needs ' 'to be created. E.g.: ' '"\\\\?\\GLOBALROOT\\device\\Harddisk1\\Partition1\\"'), cfg.BoolOpt( 'trim_enabled', default=False, help='Enables or disables TRIM delete notifications for ' 'the underlying storage device.'), cfg.BoolOpt( 'process_userdata', default=True, help='Processes the userdata content based on the type, e.g. ' 'executing a PowerShell script'), cfg.StrOpt( 'userdata_save_path', default=None, help='Copies the userdata to the given file path. The path ' 'can include environment variables that will be expanded,' ' e.g. "%%SYSTEMDRIVE%%\\CloudbaseInit\\UserData.bin"'), cfg.BoolOpt( 'enable_automatic_updates', default=None, help='If set, enables or disables automatic operating ' 'system updates.'), cfg.BoolOpt( 'metadata_report_provisioning_started', default=False, help='Reports to the metadata service that provisioning has ' 'started'), cfg.BoolOpt( 'metadata_report_provisioning_completed', default=False, help='Reports to the metadata service that provisioning ' 'completed successfully or failed'), cfg.StrOpt( 'ephemeral_disk_volume_label', default=None, help='Ephemeral disk volume label, e.g.: "Temporary Storage"'), cfg.StrOpt( 'ephemeral_disk_volume_mount_point', default=None, help='Ephemeral disk volume mount point, e.g.:' '"\\\\?\\GLOBALROOT\\device\\Harddisk1\\Partition1\\"'), cfg.StrOpt( 'ephemeral_disk_data_loss_warning_path', default=None, help='Ephemeral disk data loss warning path, relative to the ' 'ephemeral disk volume path. E.g.: ' 'DATALOSS_WARNING_README.txt'), cfg.IntOpt( 'user_password_length', default=20, help='The length of the generated password for the user ' 'defined by the `username` config option.'), ] self._cli_options = [ cfg.BoolOpt( 'reset_service_password', default=True, help='If set to True, the service user password will be ' 'reset at each execution with a new random value of ' 'appropriate length and complexity, unless the user is ' 'a built-in or domain account.' 'This is needed to avoid "pass the hash" attacks on ' 'Windows cloned instances.'), ] def register(self): """Register the current options to the global ConfigOpts object.""" self._config.register_cli_opts(self._cli_options) self._config.register_opts(self._options + self._cli_options) def list(self): """Return a list which contains all the available options.""" return self._options
from sys import exit from click import BOOL, argument, option, prompt from flask.cli import AppGroup from sqlalchemy.orm.exc import NoResultFound from sqlalchemy.exc import IntegrityError from redash import models from redash.handlers.users import invite_user manager = AppGroup(help="Users management commands.") def build_groups(org, groups, is_admin): if isinstance(groups, basestring): groups = groups.split(',') if "" in groups: groups.remove('') # in case it was empty string groups = [int(g) for g in groups] if groups is None: groups = [org.default_group.id] if is_admin: groups += [org.admin_group.id] return groups @manager.command() @argument('email') @option('--org', 'organization', default='default', help="the organization the user belongs to, (leave blank for " "'default').") def grant_admin(email, organization='default'): """ Grant admin access to user EMAIL. """ try: org = models.Organization.get_by_slug(organization) admin_group = org.admin_group user = models.User.get_by_email_and_org(email, org) if admin_group.id in user.group_ids: print "User is already an admin." else: user.group_ids = user.group_ids + [org.admin_group.id] models.db.session.add(user) models.db.session.commit() print "User updated." except NoResultFound: print "User [%s] not found." % email def create_user_logic(email, name, groups, is_admin=False, google_auth=False, password=None, organization='default', dashgroups=None): """ Create user EMAIL with display name NAME. The dashgroups argument is a comma separated list of dashgroups names. """ print "Creating user (%s, %s) in organization %s..." % (email, name, organization) print "Admin: %r" % is_admin print "Login with Google Auth: %r\n" % google_auth org = models.Organization.get_by_slug(organization) groups = build_groups(org, groups, is_admin) user = models.User(org=org, email=email, name=name, group_ids=groups) if not password and not google_auth: password = prompt("Password", hide_input=True, confirmation_prompt=True) if not google_auth: user.hash_password(password) try: models.db.session.add(user) models.db.session.commit() # Creates a UserDashgroup for every passed dashgroup. if dashgroups is not None: for dg in dashgroups.split(','): dashgroup = models.Dashgroup.get_by_name(dg) user_dg = models.UserDashgroup(dashgroup_id=dashgroup.id, user_id=user.id) models.db.session.add(user_dg) models.db.session.commit() except Exception, e: print "Failed creating user: %s" % e.message exit(1) @manager.command("create") @argument('email') @argument('name') @option('--org', 'organization', default='default', help="The organization the user belongs to (leave blank for " "'default').") @option('--admin', 'is_admin', is_flag=True, default=False, help="set user as admin") @option('--google', 'google_auth', is_flag=True, default=False, help="user uses Google Auth to login") @option('--password', 'password', default=None, help="Password for users who don't use Google Auth " "(leave blank for prompt).") @option('--groups', 'groups', default=None, help="Comma separated list of groups (leave blank for " "default).") @option('--dashgroups', 'dashgroups', default=None, help="Comma separated list of dashgroups.") def create(email, name, groups, is_admin=False, google_auth=False,password=None, organization='default', dashgroups=None): create_user_logic(email, name, groups, is_admin, google_auth, dashgroups) @manager.command() @argument('email') @option('--org', 'organization', default=None, help="The organization the user belongs to (leave blank for all" " organizations).") def delete(email, organization=None): """ Delete user EMAIL. """ if organization: org = models.Organization.get_by_slug(organization) deleted_count = models.User.query.filter( models.User.email == email, models.User.org == org.id, ).delete() else: deleted_count = models.User.query.filter(models.User.email == email).delete() models.db.session.commit() print "Deleted %d users." % deleted_count @manager.command() @argument('email') @argument('password') @option('--org', 'organization', default=None, help="The organization the user belongs to (leave blank for all " "organizations).") def password(email, password, organization=None): """ Resets password for EMAIL to PASSWORD. """ if organization: org = models.Organization.get_by_slug(organization) user = models.User.query.filter( models.User.email == email, models.User.org == org, ).first() else: user = models.User.query.filter(models.User.email == email).first() if user is not None: user.hash_password(password) models.db.session.add(user) models.db.session.commit() print "User updated." else: print "User [%s] not found." % email exit(1) @manager.command() @argument('email') @argument('name') @argument('inviter_email') @option('--org', 'organization', default='default', help="The organization the user belongs to (leave blank for 'default')") @option('--admin', 'is_admin', type=BOOL, default=False, help="set user as admin") @option('--groups', 'groups', default=None, help="Comma seperated list of groups (leave blank for default).") def invite(email, name, inviter_email, groups, is_admin=False, organization='default'): """ Sends an invitation to the given NAME and EMAIL from INVITER_EMAIL. """ org = models.Organization.get_by_slug(organization) groups = build_groups(org, groups, is_admin) try: user_from = models.User.get_by_email_and_org(inviter_email, org) user = models.User(org=org, name=name, email=email, group_ids=groups) models.db.session.add(user) try: models.db.session.commit() invite_user(org, user_from, user) print "An invitation was sent to [%s] at [%s]." % (name, email) except IntegrityError as e: if "email" in e.message: print "Cannot invite. User already exists [%s]" % email else: print e except NoResultFound: print "The inviter [%s] was not found." % inviter_email @manager.command() @option('--org', 'organization', default=None, help="The organization the user belongs to (leave blank for all" " organizations)") def list(organization=None): """List all users""" if organization: org = models.Organization.get_by_slug(organization) users = models.User.query.filter(models.User.org == org) else: users = models.User.query for i, user in enumerate(users): if i > 0: print "-" * 20 print "Id: {}\nName: {}\nEmail: {}\nOrganization: {}".format( user.id, user.name.encode('utf-8'), user.email, user.org.name)
#!/usr/bin/env python from __future__ import absolute_import, division, print_function import base64 import binascii from contextlib import closing import copy import functools import sys import threading import datetime from io import BytesIO from tornado.escape import utf8, native_str from tornado import gen from tornado.httpclient import HTTPRequest, HTTPResponse, _RequestProxy, HTTPError, HTTPClient from tornado.httpserver import HTTPServer from tornado.ioloop import IOLoop from tornado.iostream import IOStream from tornado.log import gen_log from tornado import netutil from tornado.stack_context import ExceptionStackContext, NullContext from tornado.testing import AsyncHTTPTestCase, bind_unused_port, gen_test, ExpectLog from tornado.test.util import unittest, skipOnTravis from tornado.web import Application, RequestHandler, url from tornado.httputil import format_timestamp, HTTPHeaders class HelloWorldHandler(RequestHandler): def get(self): name = self.get_argument("name", "world") self.set_header("Content-Type", "text/plain") self.finish("Hello %s!" % name) class PostHandler(RequestHandler): def post(self): self.finish("Post arg1: %s, arg2: %s" % ( self.get_argument("arg1"), self.get_argument("arg2"))) class PutHandler(RequestHandler): def put(self): self.write("Put body: ") self.write(self.request.body) class RedirectHandler(RequestHandler): def prepare(self): self.write('redirects can have bodies too') self.redirect(self.get_argument("url"), status=int(self.get_argument("status", "302"))) class ChunkHandler(RequestHandler): @gen.coroutine def get(self): self.write("asdf") self.flush() # Wait a bit to ensure the chunks are sent and received separately. yield gen.sleep(0.01) self.write("qwer") class AuthHandler(RequestHandler): def get(self): self.finish(self.request.headers["Authorization"]) class CountdownHandler(RequestHandler): def get(self, count): count = int(count) if count > 0: self.redirect(self.reverse_url("countdown", count - 1)) else: self.write("Zero") class EchoPostHandler(RequestHandler): def post(self): self.write(self.request.body) class UserAgentHandler(RequestHandler): def get(self): self.write(self.request.headers.get('User-Agent', 'User agent not set')) class ContentLength304Handler(RequestHandler): def get(self): self.set_status(304) self.set_header('Content-Length', 42) def _clear_headers_for_304(self): # Tornado strips content-length from 304 responses, but here we # want to simulate servers that include the headers anyway. pass class PatchHandler(RequestHandler): def patch(self): "Return the request payload - so we can check it is being kept" self.write(self.request.body) class AllMethodsHandler(RequestHandler): SUPPORTED_METHODS = RequestHandler.SUPPORTED_METHODS + ('OTHER',) def method(self): self.write(self.request.method) get = post = put = delete = options = patch = other = method class SetHeaderHandler(RequestHandler): def get(self): # Use get_arguments for keys to get strings, but # request.arguments for values to get bytes. for k, v in zip(self.get_arguments('k'), self.request.arguments['v']): self.set_header(k, v) # These tests end up getting run redundantly: once here with the default # HTTPClient implementation, and then again in each implementation's own # test suite. class HTTPClientCommonTestCase(AsyncHTTPTestCase): def get_app(self): return Application([ url("/hello", HelloWorldHandler), url("/post", PostHandler), url("/put", PutHandler), url("/redirect", RedirectHandler), url("/chunk", ChunkHandler), url("/auth", AuthHandler), url("/countdown/([0-9]+)", CountdownHandler, name="countdown"), url("/echopost", EchoPostHandler), url("/user_agent", UserAgentHandler), url("/304_with_content_length", ContentLength304Handler), url("/all_methods", AllMethodsHandler), url('/patch', PatchHandler), url('/set_header', SetHeaderHandler), ], gzip=True) def test_patch_receives_payload(self): body = b"some patch data" response = self.fetch("/patch", method='PATCH', body=body) self.assertEqual(response.code, 200) self.assertEqual(response.body, body) @skipOnTravis def test_hello_world(self): response = self.fetch("/hello") self.assertEqual(response.code, 200) self.assertEqual(response.headers["Content-Type"], "text/plain") self.assertEqual(response.body, b"Hello world!") self.assertEqual(int(response.request_time), 0) response = self.fetch("/hello?name=Ben") self.assertEqual(response.body, b"Hello Ben!") def test_streaming_callback(self): # streaming_callback is also tested in test_chunked chunks = [] response = self.fetch("/hello", streaming_callback=chunks.append) # with streaming_callback, data goes to the callback and not response.body self.assertEqual(chunks, [b"Hello world!"]) self.assertFalse(response.body) def test_post(self): response = self.fetch("/post", method="POST", body="arg1=foo&arg2=bar") self.assertEqual(response.code, 200) self.assertEqual(response.body, b"Post arg1: foo, arg2: bar") def test_chunked(self): response = self.fetch("/chunk") self.assertEqual(response.body, b"asdfqwer") chunks = [] response = self.fetch("/chunk", streaming_callback=chunks.append) self.assertEqual(chunks, [b"asdf", b"qwer"]) self.assertFalse(response.body) def test_chunked_close(self): # test case in which chunks spread read-callback processing # over several ioloop iterations, but the connection is already closed. sock, port = bind_unused_port() with closing(sock): def write_response(stream, request_data): if b"HTTP/1." not in request_data: self.skipTest("requires HTTP/1.x") stream.write(b"""\ HTTP/1.1 200 OK Transfer-Encoding: chunked 1 1 1 2 0 """.replace(b"\n", b"\r\n"), callback=stream.close) def accept_callback(conn, address): # fake an HTTP server using chunked encoding where the final chunks # and connection close all happen at once stream = IOStream(conn) stream.read_until(b"\r\n\r\n", functools.partial(write_response, stream)) netutil.add_accept_handler(sock, accept_callback) self.http_client.fetch("http://127.0.0.1:%d/" % port, self.stop) resp = self.wait() resp.rethrow() self.assertEqual(resp.body, b"12") self.io_loop.remove_handler(sock.fileno()) def test_streaming_stack_context(self): chunks = [] exc_info = [] def error_handler(typ, value, tb): exc_info.append((typ, value, tb)) return True def streaming_cb(chunk): chunks.append(chunk) if chunk == b'qwer': 1 / 0 with ExceptionStackContext(error_handler): self.fetch('/chunk', streaming_callback=streaming_cb) self.assertEqual(chunks, [b'asdf', b'qwer']) self.assertEqual(1, len(exc_info)) self.assertIs(exc_info[0][0], ZeroDivisionError) def test_basic_auth(self): self.assertEqual(self.fetch("/auth", auth_username="Aladdin", auth_password="open sesame").body, b"Basic QWxhZGRpbjpvcGVuIHNlc2FtZQ==") def test_basic_auth_explicit_mode(self): self.assertEqual(self.fetch("/auth", auth_username="Aladdin", auth_password="open sesame", auth_mode="basic").body, b"Basic QWxhZGRpbjpvcGVuIHNlc2FtZQ==") def test_unsupported_auth_mode(self): # curl and simple clients handle errors a bit differently; the # important thing is that they don't fall back to basic auth # on an unknown mode. with ExpectLog(gen_log, "uncaught exception", required=False): with self.assertRaises((ValueError, HTTPError)): response = self.fetch("/auth", auth_username="Aladdin", auth_password="open sesame", auth_mode="asdf") response.rethrow() def test_follow_redirect(self): response = self.fetch("/countdown/2", follow_redirects=False) self.assertEqual(302, response.code) self.assertTrue(response.headers["Location"].endswith("/countdown/1")) response = self.fetch("/countdown/2") self.assertEqual(200, response.code) self.assertTrue(response.effective_url.endswith("/countdown/0")) self.assertEqual(b"Zero", response.body) def test_credentials_in_url(self): url = self.get_url("/auth").replace("http://", "http://me:secret@") self.http_client.fetch(url, self.stop) response = self.wait() self.assertEqual(b"Basic " + base64.b64encode(b"me:secret"), response.body) def test_body_encoding(self): unicode_body = u"\xe9" byte_body = binascii.a2b_hex(b"e9") # unicode string in body gets converted to utf8 response = self.fetch("/echopost", method="POST", body=unicode_body, headers={"Content-Type": "application/blah"}) self.assertEqual(response.headers["Content-Length"], "2") self.assertEqual(response.body, utf8(unicode_body)) # byte strings pass through directly response = self.fetch("/echopost", method="POST", body=byte_body, headers={"Content-Type": "application/blah"}) self.assertEqual(response.headers["Content-Length"], "1") self.assertEqual(response.body, byte_body) # Mixing unicode in headers and byte string bodies shouldn't # break anything response = self.fetch("/echopost", method="POST", body=byte_body, headers={"Content-Type": "application/blah"}, user_agent=u"foo") self.assertEqual(response.headers["Content-Length"], "1") self.assertEqual(response.body, byte_body) def test_types(self): response = self.fetch("/hello") self.assertEqual(type(response.body), bytes) self.assertEqual(type(response.headers["Content-Type"]), str) self.assertEqual(type(response.code), int) self.assertEqual(type(response.effective_url), str) def test_header_callback(self): first_line = [] headers = {} chunks = [] def header_callback(header_line): if header_line.startswith('HTTP/1.1 101'): # Upgrading to HTTP/2 pass elif header_line.startswith('HTTP/'): first_line.append(header_line) elif header_line != '\r\n': k, v = header_line.split(':', 1) headers[k.lower()] = v.strip() def streaming_callback(chunk): # All header callbacks are run before any streaming callbacks, # so the header data is available to process the data as it # comes in. self.assertEqual(headers['content-type'], 'text/html; charset=UTF-8') chunks.append(chunk) self.fetch('/chunk', header_callback=header_callback, streaming_callback=streaming_callback) self.assertEqual(len(first_line), 1, first_line) self.assertRegexpMatches(first_line[0], 'HTTP/[0-9]\\.[0-9] 200.*\r\n') self.assertEqual(chunks, [b'asdf', b'qwer']) def test_header_callback_stack_context(self): exc_info = [] def error_handler(typ, value, tb): exc_info.append((typ, value, tb)) return True def header_callback(header_line): if header_line.lower().startswith('content-type:'): 1 / 0 with ExceptionStackContext(error_handler): self.fetch('/chunk', header_callback=header_callback) self.assertEqual(len(exc_info), 1) self.assertIs(exc_info[0][0], ZeroDivisionError) def test_configure_defaults(self): defaults = dict(user_agent='TestDefaultUserAgent', allow_ipv6=False) # Construct a new instance of the configured client class client = self.http_client.__class__(force_instance=True, defaults=defaults) try: client.fetch(self.get_url('/user_agent'), callback=self.stop) response = self.wait() self.assertEqual(response.body, b'TestDefaultUserAgent') finally: client.close() def test_header_types(self): # Header values may be passed as character or utf8 byte strings, # in a plain dictionary or an HTTPHeaders object. # Keys must always be the native str type. # All combinations should have the same results on the wire. for value in [u"MyUserAgent", b"MyUserAgent"]: for container in [dict, HTTPHeaders]: headers = container() headers['User-Agent'] = value resp = self.fetch('/user_agent', headers=headers) self.assertEqual( resp.body, b"MyUserAgent", "response=%r, value=%r, container=%r" % (resp.body, value, container)) def test_multi_line_headers(self): # Multi-line http headers are rare but rfc-allowed # http://www.w3.org/Protocols/rfc2616/rfc2616-sec4.html#sec4.2 sock, port = bind_unused_port() with closing(sock): def write_response(stream, request_data): if b"HTTP/1." not in request_data: self.skipTest("requires HTTP/1.x") stream.write(b"""\ HTTP/1.1 200 OK X-XSS-Protection: 1; \tmode=block """.replace(b"\n", b"\r\n"), callback=stream.close) def accept_callback(conn, address): stream = IOStream(conn) stream.read_until(b"\r\n\r\n", functools.partial(write_response, stream)) netutil.add_accept_handler(sock, accept_callback) self.http_client.fetch("http://127.0.0.1:%d/" % port, self.stop) resp = self.wait() resp.rethrow() self.assertEqual(resp.headers['X-XSS-Protection'], "1; mode=block") self.io_loop.remove_handler(sock.fileno()) def test_304_with_content_length(self): # According to the spec 304 responses SHOULD NOT include # Content-Length or other entity headers, but some servers do it # anyway. # http://www.w3.org/Protocols/rfc2616/rfc2616-sec10.html#sec10.3.5 response = self.fetch('/304_with_content_length') self.assertEqual(response.code, 304) self.assertEqual(response.headers['Content-Length'], '42') def test_final_callback_stack_context(self): # The final callback should be run outside of the httpclient's # stack_context. We want to ensure that there is not stack_context # between the user's callback and the IOLoop, so monkey-patch # IOLoop.handle_callback_exception and disable the test harness's # context with a NullContext. # Note that this does not apply to secondary callbacks (header # and streaming_callback), as errors there must be seen as errors # by the http client so it can clean up the connection. exc_info = [] def handle_callback_exception(callback): exc_info.append(sys.exc_info()) self.stop() self.io_loop.handle_callback_exception = handle_callback_exception with NullContext(): self.http_client.fetch(self.get_url('/hello'), lambda response: 1 / 0) self.wait() self.assertEqual(exc_info[0][0], ZeroDivisionError) @gen_test def test_future_interface(self): response = yield self.http_client.fetch(self.get_url('/hello')) self.assertEqual(response.body, b'Hello world!') @gen_test def test_future_http_error(self): with self.assertRaises(HTTPError) as context: yield self.http_client.fetch(self.get_url('/notfound')) self.assertEqual(context.exception.code, 404) self.assertEqual(context.exception.response.code, 404) @gen_test def test_future_http_error_no_raise(self): response = yield self.http_client.fetch(self.get_url('/notfound'), raise_error=False) self.assertEqual(response.code, 404) @gen_test def test_reuse_request_from_response(self): # The response.request attribute should be an HTTPRequest, not # a _RequestProxy. # This test uses self.http_client.fetch because self.fetch calls # self.get_url on the input unconditionally. url = self.get_url('/hello') response = yield self.http_client.fetch(url) self.assertEqual(response.request.url, url) self.assertTrue(isinstance(response.request, HTTPRequest)) response2 = yield self.http_client.fetch(response.request) self.assertEqual(response2.body, b'Hello world!') def test_all_methods(self): for method in ['GET', 'DELETE', 'OPTIONS']: response = self.fetch('/all_methods', method=method) self.assertEqual(response.body, utf8(method)) for method in ['POST', 'PUT', 'PATCH']: response = self.fetch('/all_methods', method=method, body=b'') self.assertEqual(response.body, utf8(method)) response = self.fetch('/all_methods', method='HEAD') self.assertEqual(response.body, b'') response = self.fetch('/all_methods', method='OTHER', allow_nonstandard_methods=True) self.assertEqual(response.body, b'OTHER') def test_body_sanity_checks(self): # These methods require a body. for method in ('POST', 'PUT', 'PATCH'): with self.assertRaises(ValueError) as context: resp = self.fetch('/all_methods', method=method) resp.rethrow() self.assertIn('must not be None', str(context.exception)) resp = self.fetch('/all_methods', method=method, allow_nonstandard_methods=True) self.assertEqual(resp.code, 200) # These methods don't allow a body. for method in ('GET', 'DELETE', 'OPTIONS'): with self.assertRaises(ValueError) as context: resp = self.fetch('/all_methods', method=method, body=b'asdf') resp.rethrow() self.assertIn('must be None', str(context.exception)) # In most cases this can be overridden, but curl_httpclient # does not allow body with a GET at all. if method != 'GET': resp = self.fetch('/all_methods', method=method, body=b'asdf', allow_nonstandard_methods=True) resp.rethrow() self.assertEqual(resp.code, 200) # This test causes odd failures with the combination of # curl_httpclient (at least with the version of libcurl available # on ubuntu 12.04), TwistedIOLoop, and epoll. For POST (but not PUT), # curl decides the response came back too soon and closes the connection # to start again. It does this *before* telling the socket callback to # unregister the FD. Some IOLoop implementations have special kernel # integration to discover this immediately. Tornado's IOLoops # ignore errors on remove_handler to accommodate this behavior, but # Twisted's reactor does not. The removeReader call fails and so # do all future removeAll calls (which our tests do at cleanup). # # def test_post_307(self): # response = self.fetch("/redirect?status=307&url=/post", # method="POST", body=b"arg1=foo&arg2=bar") # self.assertEqual(response.body, b"Post arg1: foo, arg2: bar") def test_put_307(self): response = self.fetch("/redirect?status=307&url=/put", method="PUT", body=b"hello") response.rethrow() self.assertEqual(response.body, b"Put body: hello") def test_non_ascii_header(self): # Non-ascii headers are sent as latin1. response = self.fetch("/set_header?k=foo&v=%E9") response.rethrow() self.assertEqual(response.headers["Foo"], native_str(u"\u00e9")) class RequestProxyTest(unittest.TestCase): def test_request_set(self): proxy = _RequestProxy(HTTPRequest('http://example.com/', user_agent='foo'), dict()) self.assertEqual(proxy.user_agent, 'foo') def test_default_set(self): proxy = _RequestProxy(HTTPRequest('http://example.com/'), dict(network_interface='foo')) self.assertEqual(proxy.network_interface, 'foo') def test_both_set(self): proxy = _RequestProxy(HTTPRequest('http://example.com/', proxy_host='foo'), dict(proxy_host='bar')) self.assertEqual(proxy.proxy_host, 'foo') def test_neither_set(self): proxy = _RequestProxy(HTTPRequest('http://example.com/'), dict()) self.assertIs(proxy.auth_username, None) def test_bad_attribute(self): proxy = _RequestProxy(HTTPRequest('http://example.com/'), dict()) with self.assertRaises(AttributeError): proxy.foo def test_defaults_none(self): proxy = _RequestProxy(HTTPRequest('http://example.com/'), None) self.assertIs(proxy.auth_username, None) class HTTPResponseTestCase(unittest.TestCase): def test_str(self): response = HTTPResponse(HTTPRequest('http://example.com'), 200, headers={}, buffer=BytesIO()) s = str(response) self.assertTrue(s.startswith('HTTPResponse(')) self.assertIn('code=200', s) class SyncHTTPClientTest(unittest.TestCase): def setUp(self): if IOLoop.configured_class().__name__ == 'TwistedIOLoop': # TwistedIOLoop only supports the global reactor, so we can't have # separate IOLoops for client and server threads. raise unittest.SkipTest( 'Sync HTTPClient not compatible with TwistedIOLoop') self.server_ioloop = IOLoop() @gen.coroutine def init_server(): sock, self.port = bind_unused_port() app = Application([('/', HelloWorldHandler)]) self.server = HTTPServer(app) self.server.add_socket(sock) self.server_ioloop.run_sync(init_server) self.server_thread = threading.Thread(target=self.server_ioloop.start) self.server_thread.start() self.http_client = HTTPClient() def tearDown(self): def stop_server(): self.server.stop() # Delay the shutdown of the IOLoop by one iteration because # the server may still have some cleanup work left when # the client finishes with the response (this is noticeable # with http/2, which leaves a Future with an unexamined # StreamClosedError on the loop). self.server_ioloop.add_callback(self.server_ioloop.stop) self.server_ioloop.add_callback(stop_server) self.server_thread.join() self.http_client.close() self.server_ioloop.close(all_fds=True) def get_url(self, path): return 'http://127.0.0.1:%d%s' % (self.port, path) def test_sync_client(self): response = self.http_client.fetch(self.get_url('/')) self.assertEqual(b'Hello world!', response.body) def test_sync_client_error(self): # Synchronous HTTPClient raises errors directly; no need for # response.rethrow() with self.assertRaises(HTTPError) as assertion: self.http_client.fetch(self.get_url('/notfound')) self.assertEqual(assertion.exception.code, 404) class HTTPRequestTestCase(unittest.TestCase): def test_headers(self): request = HTTPRequest('http://example.com', headers={'foo': 'bar'}) self.assertEqual(request.headers, {'foo': 'bar'}) def test_headers_setter(self): request = HTTPRequest('http://example.com') request.headers = {'bar': 'baz'} self.assertEqual(request.headers, {'bar': 'baz'}) def test_null_headers_setter(self): request = HTTPRequest('http://example.com') request.headers = None self.assertEqual(request.headers, {}) def test_body(self): request = HTTPRequest('http://example.com', body='foo') self.assertEqual(request.body, utf8('foo')) def test_body_setter(self): request = HTTPRequest('http://example.com') request.body = 'foo' self.assertEqual(request.body, utf8('foo')) def test_if_modified_since(self): http_date = datetime.datetime.utcnow() request = HTTPRequest('http://example.com', if_modified_since=http_date) self.assertEqual(request.headers, {'If-Modified-Since': format_timestamp(http_date)}) class HTTPErrorTestCase(unittest.TestCase): def test_copy(self): e = HTTPError(403) e2 = copy.copy(e) self.assertIsNot(e, e2) self.assertEqual(e.code, e2.code) def test_plain_error(self): e = HTTPError(403) self.assertEqual(str(e), "HTTP 403: Forbidden") self.assertEqual(repr(e), "HTTP 403: Forbidden") def test_error_with_response(self): resp = HTTPResponse(HTTPRequest('http://example.com/'), 403) with self.assertRaises(HTTPError) as cm: resp.rethrow() e = cm.exception self.assertEqual(str(e), "HTTP 403: Forbidden") self.assertEqual(repr(e), "HTTP 403: Forbidden")
# Copyright 2017 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Training functions for Gradient boosted decision trees.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import collections import copy from tensorflow.contrib import learn from tensorflow.contrib.boosted_trees.lib.learner.batch import categorical_split_handler from tensorflow.contrib.boosted_trees.lib.learner.batch import ordinal_split_handler from tensorflow.contrib.boosted_trees.proto import learner_pb2 from tensorflow.contrib.boosted_trees.python.ops import batch_ops_utils from tensorflow.contrib.boosted_trees.python.ops import gen_model_ops from tensorflow.contrib.boosted_trees.python.ops import model_ops from tensorflow.contrib.boosted_trees.python.ops import prediction_ops from tensorflow.contrib.boosted_trees.python.ops import stats_accumulator_ops from tensorflow.contrib.boosted_trees.python.ops import training_ops from tensorflow.contrib.layers.python.layers import feature_column as feature_column_lib from tensorflow.contrib.layers.python.layers import feature_column_ops from tensorflow.python.feature_column import feature_column as fc_core from tensorflow.python.framework import constant_op from tensorflow.python.framework import dtypes from tensorflow.python.framework import ops from tensorflow.python.framework import sparse_tensor from tensorflow.python.framework import tensor_shape from tensorflow.python.ops import array_ops from tensorflow.python.ops import control_flow_ops from tensorflow.python.ops import gradients_impl from tensorflow.python.ops import math_ops from tensorflow.python.ops import stateless_random_ops as stateless from tensorflow.python.ops import variable_scope from tensorflow.python.ops import variables from tensorflow.python.ops.losses import losses from tensorflow.python.platform import tf_logging as logging from tensorflow.python.summary import summary from tensorflow.python.training import device_setter # Key names for prediction dict. ENSEMBLE_STAMP = "ensemble_stamp" PREDICTIONS = "predictions" PARTITION_IDS = "partition_ids" NUM_LAYERS_ATTEMPTED = "num_layers" NUM_TREES_ATTEMPTED = "num_trees" NUM_USED_HANDLERS = "num_used_handlers" USED_HANDLERS_MASK = "used_handlers_mask" LEAF_INDEX = "leaf_index" _FEATURE_NAME_TEMPLATE = "%s_%d" # Keys in Training state. GBDTTrainingState = collections.namedtuple("GBDTTrainingState", [ "num_layer_examples", "num_layer_steps", "num_layers", "active_tree", "active_layer", "continue_centering", "bias_stats_accumulator", "steps_accumulator", "handlers" ]) def _get_column_by_index(tensor, indices): """Returns columns from a 2-D tensor by index.""" shape = array_ops.shape(tensor) p_flat = array_ops.reshape(tensor, [-1]) i_flat = array_ops.reshape( array_ops.reshape(math_ops.range(0, shape[0]) * shape[1], [-1, 1]) + indices, [-1]) return array_ops.reshape(array_ops.gather(p_flat, i_flat), [shape[0], -1]) def _make_predictions_dict(stamp, logits, partition_ids, ensemble_stats, used_handlers, leaf_index=None): """Returns predictions for the given logits and n_classes. Args: stamp: The ensemble stamp. logits: A rank 2 `Tensor` with shape [batch_size, n_classes - 1]. that contains predictions when no dropout was applied. partition_ids: A rank 1 `Tensor` with shape [batch_size]. ensemble_stats: A TreeEnsembleStatsOp result tuple. used_handlers: A TreeEnsembleUsedHandlerOp result tuple of an int and a boolean mask. leaf_index: A rank 2 `Tensor` with shape [batch_size, number of trees]. that contains leaf id for each example prediction. Returns: A dict of predictions. """ result = {} result[ENSEMBLE_STAMP] = stamp result[PREDICTIONS] = logits result[PARTITION_IDS] = partition_ids result[NUM_LAYERS_ATTEMPTED] = ensemble_stats.attempted_layers result[NUM_TREES_ATTEMPTED] = ensemble_stats.attempted_trees result[NUM_USED_HANDLERS] = used_handlers.num_used_handlers result[USED_HANDLERS_MASK] = used_handlers.used_handlers_mask if leaf_index is not None: result[LEAF_INDEX] = leaf_index return result class _OpRoundRobinStrategy(object): """Returns the next ps task index for placement via per-Op round-robin order. This strategy works slightly better for the GBDT graph because of using custom resources which vary significantly in compute cost. """ def __init__(self, ps_ops, num_tasks): """Create a new `_RoundRobinStrategy`. Args: ps_ops: List of Op types to place on PS. num_tasks: Number of ps tasks to cycle among. """ next_task = 0 self._next_task_per_op = {} for op in ps_ops: self._next_task_per_op[op] = next_task next_task = (next_task + 1) % num_tasks if num_tasks else 0 self._num_tasks = num_tasks def __call__(self, op): """Choose a ps task index for the given `Operation`. Args: op: An `Operation` to be placed on ps. Returns: The next ps task index to use for the `Operation`. Returns the next index, in the range `[offset, offset + num_tasks)`. Raises: ValueError: If attempting to place non-PS Op. """ if op.type not in self._next_task_per_op: raise ValueError("Unknown op type '%s' for placement:" % op.type) task = self._next_task_per_op[op.type] self._next_task_per_op[op.type] = ((task + 1) % self._num_tasks if self._num_tasks else 0) return task def extract_features(features, feature_columns, use_core_columns): """Extracts columns from a dictionary of features. Args: features: `dict` of `Tensor` objects. feature_columns: A list of feature_columns. Returns: Seven values: - A list of all feature column names. - A list of dense floats. - A list of sparse float feature indices. - A list of sparse float feature values. - A list of sparse float feature shapes. - A list of sparse int feature indices. - A list of sparse int feature values. - A list of sparse int feature shapes. Raises: ValueError: if features is not valid. """ if not features: raise ValueError("Features dictionary must be specified.") # Make a shallow copy of features to ensure downstream usage # is unaffected by modifications in the model function. features = copy.copy(features) if feature_columns: scope = "gbdt" with variable_scope.variable_scope(scope): feature_columns = list(feature_columns) transformed_features = collections.OrderedDict() for fc in feature_columns: # pylint: disable=protected-access if use_core_columns: # pylint: disable=protected-access tensor = fc_core._transform_features(features, [fc])[fc] transformed_features[fc.name] = tensor elif isinstance(fc, feature_column_lib._EmbeddingColumn): # pylint: enable=protected-access transformed_features[fc.name] = fc_core.input_layer( features, [fc], weight_collections=[scope]) else: result = feature_column_ops.transform_features(features, [fc]) if len(result) > 1: raise ValueError("Unexpected number of output features") transformed_features[fc.name] = result[list(result.keys())[0]] features = transformed_features dense_float_names = [] dense_floats = [] sparse_float_names = [] sparse_float_indices = [] sparse_float_values = [] sparse_float_shapes = [] sparse_int_names = [] sparse_int_indices = [] sparse_int_values = [] sparse_int_shapes = [] for key in sorted(features.keys()): tensor = features[key] # TODO(nponomareva): consider iterating over feature columns instead. if isinstance(tensor, tuple): # Weighted categorical feature. categorical_tensor = tensor[0] weight_tensor = tensor[1] shape = categorical_tensor.dense_shape indices = array_ops.concat([ array_ops.slice(categorical_tensor.indices, [0, 0], [-1, 1]), array_ops.expand_dims( math_ops.cast(categorical_tensor.values, dtypes.int64), -1) ], 1) tensor = sparse_tensor.SparseTensor( indices=indices, values=weight_tensor.values, dense_shape=shape) if isinstance(tensor, sparse_tensor.SparseTensor): if tensor.values.dtype == dtypes.float32: sparse_float_names.append(key) sparse_float_indices.append(tensor.indices) sparse_float_values.append(tensor.values) sparse_float_shapes.append(tensor.dense_shape) elif tensor.values.dtype == dtypes.int64: sparse_int_names.append(key) sparse_int_indices.append(tensor.indices) sparse_int_values.append(tensor.values) sparse_int_shapes.append(tensor.dense_shape) else: raise ValueError("Unsupported sparse feature %s with dtype %s." % (tensor.indices.name, tensor.dtype)) else: if tensor.dtype == dtypes.float32: if len(tensor.shape) > 1 and tensor.shape[1] > 1: unstacked = array_ops.unstack(tensor, axis=1) for i in range(len(unstacked)): dense_float_names.append(_FEATURE_NAME_TEMPLATE % (key, i)) dense_floats.append(array_ops.reshape(unstacked[i], [-1, 1])) else: dense_float_names.append(key) dense_floats.append(tensor) else: raise ValueError("Unsupported dense feature %s with dtype %s." % (tensor.name, tensor.dtype)) # Feature columns are logically organized into incrementing slots starting # from dense floats, then sparse floats then sparse ints. fc_names = (dense_float_names + sparse_float_names + sparse_int_names) return (fc_names, dense_floats, sparse_float_indices, sparse_float_values, sparse_float_shapes, sparse_int_indices, sparse_int_values, sparse_int_shapes) def _dropout_params(mode, ensemble_stats): """Returns parameters relevant for dropout. Args: mode: Train/Eval/Infer ensemble_stats: A TreeEnsembleStatsOp result tuple. Returns: Whether to apply dropout and a dropout seed. """ if mode == learn.ModeKeys.TRAIN: # Do dropout only during training. apply_dropout = True seed = ensemble_stats.attempted_trees else: seed = -1 apply_dropout = False return apply_dropout, seed class GradientBoostedDecisionTreeModel(object): """A GBDT model function.""" def __init__(self, is_chief, num_ps_replicas, ensemble_handle, center_bias, examples_per_layer, learner_config, features, logits_dimension, loss_reduction=losses.Reduction.SUM_OVER_NONZERO_WEIGHTS, feature_columns=None, use_core_columns=False, output_leaf_index=False, output_leaf_index_modes=None, num_quantiles=100): """Construct a new GradientBoostedDecisionTreeModel function. Args: is_chief: Whether to build the chief graph. num_ps_replicas: Number of parameter server replicas, can be 0. ensemble_handle: A handle to the ensemble variable. center_bias: Whether to center the bias before growing trees. examples_per_layer: Number of examples to accumulate before growing a tree layer. It can also be a function that computes the number of examples based on the depth of the layer that's being built. learner_config: A learner config. features: `dict` of `Tensor` objects. logits_dimension: An int, the dimension of logits. loss_reduction: Either `SUM_OVER_NONZERO_WEIGHTS` (mean) or `SUM`. feature_columns: A list of feature columns. use_core_columns: A boolean specifying whether core feature columns are used. output_leaf_index: A boolean variable indicating whether to output leaf index into predictions dictionary. output_leaf_index_modes: A list of modes from (TRAIN, EVAL, INFER) which dictates when leaf indices will be outputted. By default, leaf indices are only outputted in INFER mode. num_quantiles: Number of quantiles to build for numeric feature values. Raises: ValueError: if inputs are not valid. """ if ensemble_handle is None: raise ValueError("ensemble_handle must be specified.") if learner_config is None: raise ValueError("learner_config must be specified.") if learner_config.num_classes < 2: raise ValueError("Number of classes must be >=2") self._logits_dimension = logits_dimension self._is_chief = is_chief self._num_ps_replicas = num_ps_replicas self._ensemble_handle = ensemble_handle self._center_bias = center_bias self._examples_per_layer = examples_per_layer # Check loss reduction value. if (loss_reduction != losses.Reduction.SUM and loss_reduction != losses.Reduction.SUM_OVER_NONZERO_WEIGHTS): raise ValueError( "Invalid loss reduction is provided: %s." % loss_reduction) self._loss_reduction = loss_reduction # Fill in the defaults. if (learner_config.multi_class_strategy == learner_pb2.LearnerConfig.MULTI_CLASS_STRATEGY_UNSPECIFIED): if logits_dimension == 1: learner_config.multi_class_strategy = ( learner_pb2.LearnerConfig.TREE_PER_CLASS) else: learner_config.multi_class_strategy = ( learner_pb2.LearnerConfig.DIAGONAL_HESSIAN) if logits_dimension == 1 or learner_config.multi_class_strategy == ( learner_pb2.LearnerConfig.TREE_PER_CLASS): self._gradient_shape = tensor_shape.scalar() self._hessian_shape = tensor_shape.scalar() else: if center_bias: raise ValueError("Center bias should be False for multiclass.") self._gradient_shape = tensor_shape.TensorShape([logits_dimension]) if (learner_config.multi_class_strategy == learner_pb2.LearnerConfig.FULL_HESSIAN): self._hessian_shape = tensor_shape.TensorShape( ([logits_dimension, logits_dimension])) else: # Diagonal hessian strategy. self._hessian_shape = tensor_shape.TensorShape(([logits_dimension])) if (learner_config.growing_mode == learner_pb2.LearnerConfig.GROWING_MODE_UNSPECIFIED): learner_config.growing_mode = learner_pb2.LearnerConfig.LAYER_BY_LAYER if (learner_config.weak_learner_type == learner_pb2.LearnerConfig .OBLIVIOUS_DECISION_TREE and learner_config.pruning_mode == learner_pb2 .LearnerConfig.PRUNING_MODE_UNSPECIFIED): learner_config.pruning_mode = learner_pb2.LearnerConfig.PRE_PRUNE if (learner_config.pruning_mode == learner_pb2.LearnerConfig.PRUNING_MODE_UNSPECIFIED): learner_config.pruning_mode = learner_pb2.LearnerConfig.POST_PRUNE if (learner_config.weak_learner_type == learner_pb2.LearnerConfig .OBLIVIOUS_DECISION_TREE and learner_config.pruning_mode == learner_pb2.LearnerConfig.POST_PRUNE): raise ValueError( "Post pruning is not implmented for oblivious decision trees.") if learner_config.constraints.max_tree_depth == 0: # Use 6 as the default maximum depth. learner_config.constraints.max_tree_depth = 6 tuner = learner_config.learning_rate_tuner.WhichOneof("tuner") if not tuner: learner_config.learning_rate_tuner.fixed.learning_rate = 0.1 self._learner_config = learner_config self._feature_columns = feature_columns self._learner_config_serialized = learner_config.SerializeToString() self._num_quantiles = num_quantiles self._max_tree_depth = variables.VariableV1( initial_value=self._learner_config.constraints.max_tree_depth) self._attempted_trees = variables.VariableV1( initial_value=array_ops.zeros([], dtypes.int64), trainable=False, name="attempted_trees") self._finalized_trees = variables.VariableV1( initial_value=array_ops.zeros([], dtypes.int64), trainable=False, name="finalized_trees") if not features: raise ValueError("Features dictionary must be specified.") (fc_names, dense_floats, sparse_float_indices, sparse_float_values, sparse_float_shapes, sparse_int_indices, sparse_int_values, sparse_int_shapes) = extract_features( features, self._feature_columns, use_core_columns) if (learner_config.weak_learner_type == learner_pb2.LearnerConfig .OBLIVIOUS_DECISION_TREE and sparse_float_indices): raise ValueError("Oblivious trees don't handle sparse float features yet." ) logging.info("Active Feature Columns: " + str(fc_names)) logging.info("Learner config: " + str(learner_config)) self._fc_names = fc_names self._dense_floats = dense_floats self._sparse_float_indices = sparse_float_indices self._sparse_float_values = sparse_float_values self._sparse_float_shapes = sparse_float_shapes self._sparse_int_indices = sparse_int_indices self._sparse_int_values = sparse_int_values self._sparse_int_shapes = sparse_int_shapes self._reduce_dim = ( self._learner_config.multi_class_strategy == learner_pb2.LearnerConfig.TREE_PER_CLASS and learner_config.num_classes == 2) if output_leaf_index_modes is None: output_leaf_index_modes = [learn.ModeKeys.INFER] elif not all( mode in (learn.ModeKeys.TRAIN, learn.ModeKeys.EVAL, learn.ModeKeys.INFER) for mode in output_leaf_index_modes): raise ValueError("output_leaf_index_modes should only contain ModeKeys.") self._output_leaf_index = output_leaf_index self._output_leaf_index_modes = output_leaf_index_modes def _predict_and_return_dict(self, ensemble_handle, ensemble_stamp, mode): """Runs prediction and returns a dictionary of the prediction results. Args: ensemble_handle: ensemble resource handle. ensemble_stamp: stamp of ensemble resource. mode: learn.ModeKeys.TRAIN or EVAL or INFER. Returns: a dictionary of prediction results - ENSEMBLE_STAMP, PREDICTION, PARTITION_IDS, NUM_LAYER_ATTEMPTED, NUM_TREES_ATTEMPTED. """ ensemble_stats = training_ops.tree_ensemble_stats(ensemble_handle, ensemble_stamp) num_handlers = ( len(self._dense_floats) + len(self._sparse_float_shapes) + len( self._sparse_int_shapes)) # Used during feature selection. used_handlers = model_ops.tree_ensemble_used_handlers( ensemble_handle, ensemble_stamp, num_all_handlers=num_handlers) # We don't need dropout info - we can always restore it based on the # seed. apply_dropout, seed = _dropout_params(mode, ensemble_stats) # Make sure ensemble stats run. This will check that the ensemble has # the right stamp. with ops.control_dependencies(ensemble_stats): leaf_index = None if self._output_leaf_index and mode in self._output_leaf_index_modes: predictions, _, leaf_index = ( prediction_ops).gradient_trees_prediction_verbose( ensemble_handle, seed, self._dense_floats, self._sparse_float_indices, self._sparse_float_values, self._sparse_float_shapes, self._sparse_int_indices, self._sparse_int_values, self._sparse_int_shapes, learner_config=self._learner_config_serialized, apply_dropout=apply_dropout, apply_averaging=mode != learn.ModeKeys.TRAIN, use_locking=True, center_bias=self._center_bias, reduce_dim=self._reduce_dim) else: leaf_index = None predictions, _ = prediction_ops.gradient_trees_prediction( ensemble_handle, seed, self._dense_floats, self._sparse_float_indices, self._sparse_float_values, self._sparse_float_shapes, self._sparse_int_indices, self._sparse_int_values, self._sparse_int_shapes, learner_config=self._learner_config_serialized, apply_dropout=apply_dropout, apply_averaging=mode != learn.ModeKeys.TRAIN, use_locking=True, center_bias=self._center_bias, reduce_dim=self._reduce_dim) partition_ids = prediction_ops.gradient_trees_partition_examples( ensemble_handle, self._dense_floats, self._sparse_float_indices, self._sparse_float_values, self._sparse_float_shapes, self._sparse_int_indices, self._sparse_int_values, self._sparse_int_shapes, use_locking=True) return _make_predictions_dict(ensemble_stamp, predictions, partition_ids, ensemble_stats, used_handlers, leaf_index) def predict(self, mode): """Returns predictions given the features and mode. Args: mode: Mode the graph is running in (train|predict|eval). Returns: A dict of predictions tensors. Raises: ValueError: if features is not valid. """ # Use the current ensemble to predict on the current batch of input. # For faster prediction we check if the inputs are on the same device # as the model. If not, we create a copy of the model on the worker. input_deps = ( self._dense_floats + self._sparse_float_indices + self._sparse_int_indices) if not input_deps: raise ValueError("No input tensors for prediction.") # Get most current model stamp. ensemble_stamp = model_ops.tree_ensemble_stamp_token(self._ensemble_handle) # Determine if ensemble is colocated with the inputs. if self._ensemble_handle.device != input_deps[0].device: # Create a local ensemble and get its local stamp. with ops.name_scope("local_ensemble", "TreeEnsembleVariable"): local_ensemble_handle = ( gen_model_ops.decision_tree_ensemble_resource_handle_op( self._ensemble_handle.op.name + "/local_ensemble")) create_op = gen_model_ops.create_tree_ensemble_variable( local_ensemble_handle, stamp_token=-1, tree_ensemble_config="") with ops.control_dependencies([create_op]): local_stamp = model_ops.tree_ensemble_stamp_token( local_ensemble_handle) # Determine whether the local ensemble is stale and update it if needed. def _refresh_local_ensemble_fn(): # Serialize the model from parameter server after reading the inputs. with ops.control_dependencies([input_deps[0]]): (ensemble_stamp, serialized_model) = ( model_ops.tree_ensemble_serialize(self._ensemble_handle)) # Update local ensemble with the serialized model from parameter server. with ops.control_dependencies([create_op]): return model_ops.tree_ensemble_deserialize( local_ensemble_handle, stamp_token=ensemble_stamp, tree_ensemble_config=serialized_model), ensemble_stamp with ops.device(local_ensemble_handle.device): # Need to colocate stamps for cond. colocated_ensemble_stamp = array_ops.identity(ensemble_stamp) refresh_local_ensemble, ensemble_stamp = control_flow_ops.cond( math_ops.not_equal(colocated_ensemble_stamp, local_stamp), _refresh_local_ensemble_fn, lambda: (control_flow_ops.no_op(), colocated_ensemble_stamp)) # Once updated, use the local model for prediction. with ops.control_dependencies([refresh_local_ensemble]): return self._predict_and_return_dict(local_ensemble_handle, ensemble_stamp, mode) else: # Use ensemble_handle directly, if colocated. with ops.device(self._ensemble_handle.device): return self._predict_and_return_dict(self._ensemble_handle, ensemble_stamp, mode) def _get_class_id(self, predictions_dict): # Handle different multiclass strategies. if (self._learner_config.multi_class_strategy == learner_pb2.LearnerConfig.TREE_PER_CLASS and self._logits_dimension != 1): # Choose the class for which the tree is built (one vs rest). return math_ops.cast( predictions_dict[NUM_TREES_ATTEMPTED] % self._logits_dimension, dtypes.int32) return constant_op.constant(-1, dtype=dtypes.int32) def update_stats(self, loss, predictions_dict, gradients=None, hessians=None): """Update the accumulators with stats from this batch. Args: loss: A scalar tensor representing average loss of examples. predictions_dict: Dictionary of Rank 2 `Tensor` representing information about predictions per example. gradients: A tensor with the gradients with the respect to logits from predictions_dict. If not provided, tensorflow will do autodifferentiation. hessians: A tensor with the hessians with the respect to logits from predictions_dict. If not provided, tensorflow will do autodifferentiation. Returns: Three values: - An op that adds a new tree to the ensemble, and - An op that increments the stamp but removes all the trees and resets the handlers. This can be used to reset the state of the ensemble. - A dict containing the training state. Raises: ValueError: if inputs are not valid. """ # Get the worker device from input dependencies. input_deps = ( self._dense_floats + self._sparse_float_indices + self._sparse_int_indices) worker_device = input_deps[0].device # Get tensors relevant for training and form the loss. predictions = predictions_dict[PREDICTIONS] partition_ids = predictions_dict[PARTITION_IDS] ensemble_stamp = predictions_dict[ENSEMBLE_STAMP] if gradients is None: gradients = gradients_impl.gradients( loss, predictions, name="Gradients", colocate_gradients_with_ops=False, gate_gradients=0, aggregation_method=None)[0] strategy = self._learner_config.multi_class_strategy class_id = self._get_class_id(predictions_dict) # Handle different multiclass strategies. if strategy == learner_pb2.LearnerConfig.TREE_PER_CLASS: # We build one vs rest trees. if self._logits_dimension == 1: # We have only 1 score, gradients is of shape [batch, 1]. if hessians is None: hessians = gradients_impl.gradients( gradients, predictions, name="Hessian", colocate_gradients_with_ops=False, gate_gradients=0, aggregation_method=None)[0] squeezed_gradients = array_ops.squeeze(gradients, axis=[1]) squeezed_hessians = array_ops.squeeze(hessians, axis=[1]) else: if hessians is not None: raise ValueError("Providing hessians is not yet supported here.") hessian_list = self._diagonal_hessian(gradients, predictions) # Assemble hessian list into a tensor. hessians = array_ops.stack(hessian_list, axis=1) # Use class id tensor to get the column with that index from gradients # and hessians. squeezed_gradients = array_ops.squeeze( _get_column_by_index(gradients, class_id)) squeezed_hessians = array_ops.squeeze( _get_column_by_index(hessians, class_id)) else: if hessians is not None: raise ValueError("Providing hessians is not yet supported here.") # Other multiclass strategies. if strategy == learner_pb2.LearnerConfig.FULL_HESSIAN: hessian_list = self._full_hessian(gradients, predictions) else: # Diagonal hessian strategy. hessian_list = self._diagonal_hessian(gradients, predictions) squeezed_gradients = gradients hessians = array_ops.stack(hessian_list, axis=1) squeezed_hessians = hessians # Get the weights for each example for quantiles calculation, weights = self._get_weights(self._hessian_shape, squeezed_hessians) # Create all handlers ensuring resources are evenly allocated across PS. fc_name_idx = 0 handlers = [] init_stamp_token = constant_op.constant(0, dtype=dtypes.int64) l1_regularization = constant_op.constant( self._learner_config.regularization.l1, dtypes.float32) l2_regularization = constant_op.constant( self._learner_config.regularization.l2, dtypes.float32) tree_complexity_regularization = constant_op.constant( self._learner_config.regularization.tree_complexity, dtypes.float32) min_node_weight = constant_op.constant( self._learner_config.constraints.min_node_weight, dtypes.float32) loss_uses_sum_reduction = self._loss_reduction == losses.Reduction.SUM loss_uses_sum_reduction = constant_op.constant(loss_uses_sum_reduction) weak_learner_type = constant_op.constant( self._learner_config.weak_learner_type) num_quantiles = self._num_quantiles epsilon = 1.0 / num_quantiles strategy_tensor = constant_op.constant(strategy) with ops.device(self._get_replica_device_setter(worker_device)): # Create handlers for dense float columns for dense_float_column_idx in range(len(self._dense_floats)): fc_name = self._fc_names[fc_name_idx] handlers.append( ordinal_split_handler.DenseSplitHandler( l1_regularization=l1_regularization, l2_regularization=l2_regularization, tree_complexity_regularization=tree_complexity_regularization, min_node_weight=min_node_weight, feature_column_group_id=constant_op.constant( dense_float_column_idx), epsilon=epsilon, num_quantiles=num_quantiles, dense_float_column=self._dense_floats[dense_float_column_idx], name=fc_name, gradient_shape=self._gradient_shape, hessian_shape=self._hessian_shape, multiclass_strategy=strategy_tensor, init_stamp_token=init_stamp_token, loss_uses_sum_reduction=loss_uses_sum_reduction, weak_learner_type=weak_learner_type, )) fc_name_idx += 1 # Create handlers for sparse float columns. for sparse_float_column_idx in range(len(self._sparse_float_indices)): fc_name = self._fc_names[fc_name_idx] handlers.append( ordinal_split_handler.SparseSplitHandler( l1_regularization=l1_regularization, l2_regularization=l2_regularization, tree_complexity_regularization=tree_complexity_regularization, min_node_weight=min_node_weight, feature_column_group_id=constant_op.constant( sparse_float_column_idx), epsilon=epsilon, num_quantiles=num_quantiles, sparse_float_column=sparse_tensor.SparseTensor( self._sparse_float_indices[sparse_float_column_idx], self._sparse_float_values[sparse_float_column_idx], self._sparse_float_shapes[sparse_float_column_idx]), name=fc_name, gradient_shape=self._gradient_shape, hessian_shape=self._hessian_shape, multiclass_strategy=strategy_tensor, init_stamp_token=init_stamp_token, loss_uses_sum_reduction=loss_uses_sum_reduction)) fc_name_idx += 1 # Create handlers for sparse int columns. for sparse_int_column_idx in range(len(self._sparse_int_indices)): fc_name = self._fc_names[fc_name_idx] handlers.append( categorical_split_handler.EqualitySplitHandler( l1_regularization=l1_regularization, l2_regularization=l2_regularization, tree_complexity_regularization=tree_complexity_regularization, min_node_weight=min_node_weight, feature_column_group_id=constant_op.constant( sparse_int_column_idx), sparse_int_column=sparse_tensor.SparseTensor( self._sparse_int_indices[sparse_int_column_idx], self._sparse_int_values[sparse_int_column_idx], self._sparse_int_shapes[sparse_int_column_idx]), name=fc_name, gradient_shape=self._gradient_shape, hessian_shape=self._hessian_shape, multiclass_strategy=strategy_tensor, init_stamp_token=init_stamp_token, loss_uses_sum_reduction=loss_uses_sum_reduction, weak_learner_type=weak_learner_type)) fc_name_idx += 1 # Create ensemble stats variables. num_layer_examples = variables.VariableV1( initial_value=array_ops.zeros([], dtypes.int64), name="num_layer_examples", trainable=False) num_layer_steps = variables.VariableV1( initial_value=array_ops.zeros([], dtypes.int64), name="num_layer_steps", trainable=False) num_layers = variables.VariableV1( initial_value=array_ops.zeros([], dtypes.int64), name="num_layers", trainable=False) active_tree = variables.VariableV1( initial_value=array_ops.zeros([], dtypes.int64), name="active_tree", trainable=False) active_layer = variables.VariableV1( initial_value=array_ops.zeros([], dtypes.int64), name="active_layer", trainable=False) # Variable that becomes false once bias centering is done. continue_centering = variables.VariableV1( initial_value=self._center_bias, name="continue_centering", trainable=False) # Create bias stats accumulator. bias_stats_accumulator = stats_accumulator_ops.StatsAccumulator( stamp_token=0, gradient_shape=self._gradient_shape, hessian_shape=self._hessian_shape, name="BiasAccumulator") # Create steps accumulator. steps_accumulator = stats_accumulator_ops.StatsAccumulator( stamp_token=0, gradient_shape=tensor_shape.scalar(), hessian_shape=tensor_shape.scalar(), name="StepsAccumulator") # Create ensemble stats summaries. summary.scalar("layer_stats/num_examples", num_layer_examples) summary.scalar("layer_stats/num_steps", num_layer_steps) summary.scalar("ensemble_stats/active_tree", active_tree) summary.scalar("ensemble_stats/active_layer", active_layer) # Update bias stats. stats_update_ops = [] stats_update_ops.append( control_flow_ops.cond( continue_centering, self._make_update_bias_stats_fn(ensemble_stamp, predictions, gradients, bias_stats_accumulator, hessians), control_flow_ops.no_op)) # Update handler stats. handler_reads = collections.OrderedDict() for handler in handlers: handler_reads[handler] = handler.scheduled_reads() handler_results = batch_ops_utils.run_handler_scheduled_ops( handler_reads, ensemble_stamp, worker_device) per_handler_updates = collections.OrderedDict() # Two values per handler. First one is if the handler is active for the # current layer. The second one is if the handler is going to be active # for the next layer. subsampling_type = self._learner_config.WhichOneof("feature_fraction") if subsampling_type == "feature_fraction_per_level": seed = predictions_dict[NUM_LAYERS_ATTEMPTED] active_handlers_current_layer = stateless.stateless_random_uniform( shape=[len(handlers)], seed=[seed, 1]) active_handlers_next_layer = stateless.stateless_random_uniform( shape=[len(handlers)], seed=[seed + 1, 1]) active_handlers = array_ops.stack( [active_handlers_current_layer, active_handlers_next_layer], axis=1) active_handlers = ( active_handlers < self._learner_config.feature_fraction_per_level) elif subsampling_type == "feature_fraction_per_tree": seed = predictions_dict[NUM_TREES_ATTEMPTED] active_handlers_current_layer = stateless.stateless_random_uniform( shape=[len(handlers)], seed=[seed, 2]) active_handlers_current_layer = ( active_handlers_current_layer < self._learner_config.feature_fraction_per_tree) active_handlers = array_ops.stack( [ active_handlers_current_layer, array_ops.ones([len(handlers)], dtype=dtypes.bool) ], axis=1) else: active_handlers = array_ops.ones([len(handlers), 2], dtype=dtypes.bool) if self._learner_config.constraints.max_number_of_unique_feature_columns: target = ( self._learner_config.constraints.max_number_of_unique_feature_columns) def _feature_selection_active_handlers(): # The active list for current and the next iteration. used_handlers = array_ops.reshape(predictions_dict[USED_HANDLERS_MASK], [-1, 1]) used_handlers = array_ops.concat([used_handlers, used_handlers], axis=1) return math_ops.logical_and(used_handlers, active_handlers) active_handlers = ( control_flow_ops.cond(predictions_dict[NUM_USED_HANDLERS] >= target, _feature_selection_active_handlers, lambda: active_handlers)) # Prepare empty gradients and hessians when handlers are not ready. empty_hess_shape = [1] + self._hessian_shape.as_list() empty_grad_shape = [1] + self._gradient_shape.as_list() empty_gradients = constant_op.constant_v1( [], dtype=dtypes.float32, shape=empty_grad_shape) empty_hessians = constant_op.constant_v1( [], dtype=dtypes.float32, shape=empty_hess_shape) active_handlers = array_ops.unstack(active_handlers, axis=0) for handler_idx in range(len(handlers)): handler = handlers[handler_idx] is_active = active_handlers[handler_idx] updates, scheduled_updates = handler.update_stats( ensemble_stamp, partition_ids, squeezed_gradients, squeezed_hessians, empty_gradients, empty_hessians, weights, is_active, handler_results[handler]) stats_update_ops.append(updates) per_handler_updates[handler] = scheduled_updates update_results = batch_ops_utils.run_handler_scheduled_ops( per_handler_updates, ensemble_stamp, worker_device) for update in update_results.values(): stats_update_ops += update training_state = GBDTTrainingState( num_layer_examples=num_layer_examples, num_layer_steps=num_layer_steps, num_layers=num_layers, active_tree=active_tree, active_layer=active_layer, continue_centering=continue_centering, bias_stats_accumulator=bias_stats_accumulator, steps_accumulator=steps_accumulator, handlers=handlers) reset_op = control_flow_ops.no_op() if self._is_chief: # Advance the ensemble stamp to throw away staggered workers. stamp_token, _ = model_ops.tree_ensemble_serialize(self._ensemble_handle) next_stamp_token = stamp_token + 1 reset_ops = [] for handler in handlers: reset_ops.append(handler.reset(stamp_token, next_stamp_token)) if self._center_bias: reset_ops.append( bias_stats_accumulator.flush(stamp_token, next_stamp_token)) reset_ops.append(steps_accumulator.flush(stamp_token, next_stamp_token)) reset_ops.append(self._finalized_trees.assign(0).op) reset_ops.append(self._attempted_trees.assign(0).op) reset_ops.append( model_ops.tree_ensemble_deserialize( self._ensemble_handle, stamp_token=next_stamp_token, tree_ensemble_config="", name="reset_gbdt")) reset_op = control_flow_ops.group([reset_ops]) return stats_update_ops, reset_op, training_state def increment_step_counter_and_maybe_update_ensemble(self, predictions_dict, training_state): """Increments number of visited examples and grows the ensemble. If the number of visited examples reaches the target examples_per_layer, ensemble is updated. Args: predictions_dict: Dictionary of Rank 2 `Tensor` representing information about predictions per example. training_state: `dict` returned by update_stats. Returns: An op that updates the counters and potientially grows the ensemble. """ batch_size = math_ops.cast( array_ops.shape(predictions_dict[PREDICTIONS])[0], dtypes.float32) ensemble_stamp = predictions_dict[ENSEMBLE_STAMP] # Accumulate a step after updating stats. steps_accumulator = training_state.steps_accumulator num_layer_examples = training_state.num_layer_examples num_layer_steps = training_state.num_layer_steps active_layer = training_state.active_layer add_step_op = steps_accumulator.add( ensemble_stamp, [0], [[0, 0]], [batch_size], [1.0]) # After adding the step, decide if further processing is needed. ensemble_update_ops = [add_step_op] class_id = self._get_class_id(predictions_dict) with ops.control_dependencies([add_step_op]): if self._is_chief: dropout_seed = predictions_dict[NUM_TREES_ATTEMPTED] # Get accumulated steps and examples for the current layer. _, _, _, _, acc_examples, acc_steps = ( steps_accumulator.saveable.serialize()) acc_examples = math_ops.cast(acc_examples[0], dtypes.int64) acc_steps = math_ops.cast(acc_steps[0], dtypes.int64) ensemble_update_ops.append( num_layer_examples.assign(acc_examples)) ensemble_update_ops.append(num_layer_steps.assign(acc_steps)) # Determine whether we need to update tree ensemble. examples_per_layer = self._examples_per_layer if callable(examples_per_layer): examples_per_layer = examples_per_layer(active_layer) ensemble_update_ops.append( control_flow_ops.cond( acc_examples >= examples_per_layer, self.make_update_ensemble_fn(ensemble_stamp, training_state, dropout_seed, class_id), control_flow_ops.no_op)) # Note, the loss is calculated from the prediction considering dropouts, so # that the value might look staggering over steps when the dropout ratio is # high. eval_loss might be referred instead in the aspect of convergence. return control_flow_ops.group(*ensemble_update_ops) def make_update_ensemble_fn(self, ensemble_stamp, training_state, dropout_seed, class_id): """A method to create the function which updates the tree ensemble.""" # Determine learning rate. learning_rate_tuner = self._learner_config.learning_rate_tuner.WhichOneof( "tuner") if learning_rate_tuner == "fixed" or learning_rate_tuner == "dropout": tuner = getattr(self._learner_config.learning_rate_tuner, learning_rate_tuner) learning_rate = tuner.learning_rate else: # TODO(nponomareva, soroush) do the line search. raise ValueError("Line search learning rate is not yet supported.") def _update_ensemble(): """A method to update the tree ensemble.""" # Get next stamp token. next_ensemble_stamp = ensemble_stamp + 1 # Finalize bias stats. _, _, _, bias_grads, bias_hess = ( training_state.bias_stats_accumulator.flush(ensemble_stamp, next_ensemble_stamp)) # Finalize handler splits. are_splits_ready_list = [] partition_ids_list = [] gains_list = [] split_info_list = [] for handler in training_state.handlers: (are_splits_ready, partition_ids, gains, split_info) = handler.make_splits( ensemble_stamp, next_ensemble_stamp, class_id) are_splits_ready_list.append(are_splits_ready) partition_ids_list.append(partition_ids) gains_list.append(gains) split_info_list.append(split_info) # Stack all the inputs to one tensor per type. # This is a workaround for the slowness of graph building in tf.cond. # See (b/36554864). split_sizes = array_ops.reshape( array_ops.shape_n(partition_ids_list), [len(partition_ids_list)]) partition_ids = array_ops.concat(partition_ids_list, axis=0) gains = array_ops.concat(gains_list, axis=0) split_infos = array_ops.concat(split_info_list, axis=0) # Determine if all splits are ready. are_all_splits_ready = math_ops.reduce_all( array_ops.stack( are_splits_ready_list, axis=0, name="stack_handler_readiness")) # Define bias centering update operation. def _center_bias_fn(): # Center tree ensemble bias. delta_updates = array_ops.where(bias_hess > 0, -bias_grads / bias_hess, array_ops.zeros_like(bias_grads)) center_bias = training_ops.center_tree_ensemble_bias( tree_ensemble_handle=self._ensemble_handle, stamp_token=ensemble_stamp, next_stamp_token=next_ensemble_stamp, delta_updates=delta_updates, learner_config=self._learner_config_serialized) return training_state.continue_centering.assign(center_bias) # Define ensemble growing operations. def _grow_ensemble_ready_fn(): # Grow the ensemble given the current candidates. sizes = array_ops.unstack(split_sizes) partition_ids_list = list(array_ops.split(partition_ids, sizes, axis=0)) # When using the oblivious decision tree as weak learner, it produces # one gain and one split per handler and not number of partitions. if self._learner_config.weak_learner_type == ( learner_pb2.LearnerConfig.OBLIVIOUS_DECISION_TREE): sizes = len(training_state.handlers) gains_list = list(array_ops.split(gains, sizes, axis=0)) split_info_list = list(array_ops.split(split_infos, sizes, axis=0)) return training_ops.grow_tree_ensemble( tree_ensemble_handle=self._ensemble_handle, stamp_token=ensemble_stamp, next_stamp_token=next_ensemble_stamp, learning_rate=learning_rate, partition_ids=partition_ids_list, gains=gains_list, splits=split_info_list, learner_config=self._learner_config_serialized, dropout_seed=dropout_seed, center_bias=self._center_bias, max_tree_depth=self._max_tree_depth, weak_learner_type=self._learner_config.weak_learner_type) def _grow_ensemble_not_ready_fn(): # Don't grow the ensemble, just update the stamp. return training_ops.grow_tree_ensemble( tree_ensemble_handle=self._ensemble_handle, stamp_token=ensemble_stamp, next_stamp_token=next_ensemble_stamp, learning_rate=0, partition_ids=[], gains=[], splits=[], learner_config=self._learner_config_serialized, dropout_seed=dropout_seed, center_bias=self._center_bias, max_tree_depth=self._max_tree_depth, weak_learner_type=self._learner_config.weak_learner_type) def _grow_ensemble_fn(): # Conditionally grow an ensemble depending on whether the splits # from all the handlers are ready. return control_flow_ops.cond(are_all_splits_ready, _grow_ensemble_ready_fn, _grow_ensemble_not_ready_fn) # Update ensemble. update_ops = [are_all_splits_ready] if self._center_bias: update_model = control_flow_ops.cond(training_state.continue_centering, _center_bias_fn, _grow_ensemble_fn) else: update_model = _grow_ensemble_fn() update_ops.append(update_model) # Update ensemble stats. with ops.control_dependencies([update_model]): stats = training_ops.tree_ensemble_stats( self._ensemble_handle, stamp_token=next_ensemble_stamp) update_ops.append(self._finalized_trees.assign(stats.num_trees)) update_ops.append(self._attempted_trees.assign(stats.attempted_trees)) update_ops.append(training_state.num_layers.assign(stats.num_layers)) update_ops.append(training_state.active_tree.assign(stats.active_tree)) update_ops.append( training_state.active_layer.assign(stats.active_layer)) # Flush step stats. update_ops.extend( training_state.steps_accumulator.flush(ensemble_stamp, next_ensemble_stamp)) return control_flow_ops.group(*update_ops, name="update_ensemble") return _update_ensemble def get_number_of_trees_tensor(self): return self._finalized_trees, self._attempted_trees def get_max_tree_depth(self): return self._max_tree_depth def train(self, loss, predictions_dict, labels, gradients=None, hessians=None): """Updates the accumalator stats and grows the ensemble. Args: loss: A scalar tensor representing average loss of examples. predictions_dict: Dictionary of Rank 2 `Tensor` representing information about predictions per example. labels: Rank 2 `Tensor` representing labels per example. Has no effect on the training and is only kept for backward compatibility. gradients: A tensor with the gradients with the respect to logits from predictions_dict. If not provided, tensorflow will do autodifferentiation. hessians: A tensor with the hessians with the respect to logits from predictions_dict. If not provided, tensorflow will do autodifferentiation. Returns: An op that adds a new tree to the ensemble. Raises: ValueError: if inputs are not valid. """ del labels # unused; kept for backward compatibility. update_op, _, training_state = self.update_stats(loss, predictions_dict, gradients, hessians) with ops.control_dependencies(update_op): return self.increment_step_counter_and_maybe_update_ensemble( predictions_dict, training_state) def _get_weights(self, hessian_shape, hessians): """Derives weights to be used based on hessians and multiclass strategy.""" if hessian_shape == tensor_shape.scalar(): # This is tree per class. weights = hessians elif len(hessian_shape.dims) == 1: # This is diagonal hessian. weights = math_ops.reduce_sum(hessians, axis=1) else: # This is full hessian. weights = math_ops.trace(hessians) return weights def _full_hessian(self, grads, predictions): """Prepares hessians for full-hessian multiclass strategy.""" # Because of # https://github.com/tensorflow/tensorflow/issues/675, we can't just # compute the full hessian with a single call to gradients, but instead # must compute it row-by-row. gradients_list = array_ops.unstack( grads, num=self._logits_dimension, axis=1) hessian_rows = [] for row in range(self._logits_dimension): # If current row is i, K is number of classes,each row returns a tensor of # size batch_size x K representing for each example dx_i dx_1, dx_i dx_2 # etc dx_i dx_K hessian_row = gradients_impl.gradients( gradients_list[row], predictions, name="Hessian_%d" % row, colocate_gradients_with_ops=False, gate_gradients=0, aggregation_method=None) # hessian_row is of dimension 1, batch_size, K, => trim first dimension # to get batch_size x K hessian_row = array_ops.squeeze(array_ops.unstack(hessian_row), [0]) hessian_rows.append(hessian_row) return hessian_rows def _diagonal_hessian(self, grads, predictions): """Prepares hessians for diagonal-hessian multiclass mode.""" diag_hessian_list = [] gradients_list = array_ops.unstack( grads, num=self._logits_dimension, axis=1) for row, row_grads in enumerate(gradients_list): # If current row is i, K is number of classes,each row returns a tensor of # size batch_size x K representing for each example dx_i dx_1, dx_1 dx_2 # etc dx_i dx_K hessian_row = gradients_impl.gradients( row_grads, predictions, name="Hessian_%d" % row, colocate_gradients_with_ops=False, gate_gradients=0, aggregation_method=None) # hessian_row is of dimension 1, batch_size, K, => trim first dimension # to get batch_size x K hessian_row = array_ops.squeeze(array_ops.unstack(hessian_row), [0]) # Get dx_i^2 for the whole batch. elem = array_ops.transpose(hessian_row)[row] diag_hessian_list.append(elem) return diag_hessian_list def _get_replica_device_setter(self, worker_device): """Creates a replica device setter.""" ps_tasks = self._num_ps_replicas ps_ops = list(device_setter.STANDARD_PS_OPS) ps_ops.extend([ "DecisionTreeEnsembleResourceHandleOp", "StatsAccumulatorScalarResourceHandleOp", "StatsAccumulatorTensorResourceHandleOp", ]) ps_strategy = _OpRoundRobinStrategy(ps_ops, ps_tasks) return device_setter.replica_device_setter( worker_device=worker_device, ps_tasks=ps_tasks, merge_devices=True, ps_ops=ps_ops, ps_strategy=ps_strategy) def _make_update_bias_stats_fn(self, ensemble_stamp, predictions, gradients, bias_stats_accumulator, hessians=None): """A method to create the function which updates the bias stats.""" def _update_bias_stats(): """A method to update the bias stats.""" # Get reduced gradients and hessians. grads_sum = math_ops.reduce_sum(gradients, 0) if hessians is not None: hess = hessians else: hess = gradients_impl.gradients( grads_sum, predictions, name="Hessians", colocate_gradients_with_ops=False, gate_gradients=0, aggregation_method=None)[0] hess_sum = math_ops.reduce_sum(hess, 0) # Accumulate gradients and hessians. partition_ids = math_ops.range(self._logits_dimension) feature_ids = array_ops.zeros( [self._logits_dimension, 2], dtype=dtypes.int64) add_stats_op = bias_stats_accumulator.add( ensemble_stamp, partition_ids, feature_ids, grads_sum, hess_sum) return control_flow_ops.group(*[add_stats_op], name="update_bias_stats") return _update_bias_stats
import json import logging from django.http import ( HttpResponse, HttpResponseBadRequest, HttpResponseForbidden, HttpResponseNotAllowed, HttpResponseServerError, ) from django.utils.encoding import force_str from django.utils.text import slugify from django.views.decorators.csrf import csrf_exempt from django.views.generic import View from .models import SystemToken from standup.status.models import Project, Status, StandupUser logger = logging.getLogger(__name__) def convert_to_json(resp, cors=False): """Converts responses into JSON responses""" # If the response is already json-ified, then we skip it. if getattr(resp, 'is_json', False): return resp resp['content_type'] = 'application/json' if cors: resp['Access-Control-Allow-Origin'] = '*' content = resp.content if isinstance(resp, ( HttpResponseBadRequest, HttpResponseForbidden, HttpResponseServerError )): # Errors are in the form {'error': 'error string...'} content = {'error': content.decode('utf-8')} elif isinstance(resp, HttpResponseNotAllowed): content = {'error': 'Method not allowed'} elif isinstance(resp, HttpResponseJSON): return resp resp.content = json.dumps(content) resp.is_json = True return resp class AuthException(Exception): """Authentication exception""" pass class HttpResponseJSON(HttpResponse): is_json = True def __init__(self, content, status=None, cors=False): super(HttpResponseJSON, self).__init__( content=json.dumps(content), content_type='application/json', status=status ) if cors: self['Access-Control-Allow-Origin'] = '*' class APIView(View): """API view that looks at the world in JSON""" @classmethod def as_view(cls, *args, **kwargs): # API calls use token authentication and don't need csrf bits return csrf_exempt(super(APIView, cls).as_view(*args, **kwargs)) def authenticate(self, request): """Authenticates the request which pulls out the auth token and validates it Adds "auth_token" attribute to the request with the token instance. :raises AuthError: for authentication errors """ pass def dispatch(self, request, *args, **kwargs): """Dispatches like View, except always returns JSON responses""" try: if request.body: # FIXME(willkg): This assumes the body is utf-8. request.json_body = json.loads(force_str(request.body)) if not isinstance(request.json_body, dict): raise Exception('Unrecognized JSON payload.') else: request.json_body = None self.authenticate(request) resp = super(APIView, self).dispatch(request, *args, **kwargs) except AuthException as exc: resp = HttpResponseForbidden(exc.args[0]) except Exception as exc: resp = HttpResponseServerError('Error occured: %s' % exc) logger.exception('Request kicked up exception') return convert_to_json(resp) class AuthenticatedAPIView(APIView): def authenticate(self, request): # If this request is for a method that's not allowed, we just # skip it and dispatch will deal with it. if getattr(self, request.method.lower(), None) is None: return if not request.json_body: raise AuthException('No api_key provided.') api_key = request.json_body.get('api_key') if not api_key: raise AuthException('No api_key provided.') # Check to see if this is a system token try: token = SystemToken.objects.get(token=api_key) except SystemToken.DoesNotExist: raise AuthException('Api key forbidden.') # Verify the token is enabled if not token.enabled: raise AuthException('Api key forbidden.') # Add token to request object request.auth_token = token class StatusCreate(AuthenticatedAPIView): def post(self, request): # token = request.auth_token # FIXME(willkg): Authorize operation. # FIXME(willkg): This makes the API irc-specific. irc_nick = request.json_body.get('user') project_slug = request.json_body.get('project') content = request.json_body.get('content') reply_to = request.json_body.get('reply_to') project = None replied = None # Validate we have the required fields. if not (irc_nick and content): return HttpResponseBadRequest('Missing required fields.') # If this is a reply make sure that the status being replied to # exists and is not itself a reply if reply_to: replied = Status.objects.filter(id=reply_to).first() if not replied: return HttpResponseBadRequest('Status does not exist.') elif replied.reply_to: return HttpResponseBadRequest('Cannot reply to a reply.') # Get the user user = StandupUser.objects.filter(irc_nick=irc_nick).first() if not user: return HttpResponseBadRequest('User does not exist.') # Get or create the project (but not if this is a reply) if project_slug and not replied: # This forces the slug to be slug-like. project_slug = slugify(project_slug) project = Project.objects.filter(slug=project_slug).first() if not project: project = Project(slug=project_slug, name=project_slug) project.save() # Create the status status = Status(user=user, content=content) if project_slug and project: status.project = project if replied: status.reply_to = replied status.save() return HttpResponseJSON({'id': status.id, 'content': content}) class StatusDelete(AuthenticatedAPIView): def delete(self, request, pk): # token = request.auth_token # FIXME(willkg): Authorize this operation. # FIXME(willkg): This makes the API irc-specific. irc_nick = request.json_body.get('user') if not irc_nick: return HttpResponseBadRequest('Missing required fields.') status = Status.objects.filter(id=pk).first() if not status: return HttpResponseBadRequest('Status does not exist.') if status.user.irc_nick != irc_nick: return HttpResponseForbidden('You cannot delete this status.') status_id = status.id status.delete() return HttpResponseJSON({'id': status_id}) class UpdateUser(AuthenticatedAPIView): def post(self, request, username): # token = request.auth_token # FIXME(willkg): Authorize this operation. # FIXME(willkg): This makes the API irc-specific. user = StandupUser.objects.filter(irc_nick=username).first() if not user: return HttpResponseBadRequest('User does not exist.') if 'name' in request.json_body: user.name = request.json_body['name'] if 'email' in request.json_body: user.user.email = request.json_body['email'] if 'github_handle' in request.json_body: user.github_handle = request.json_body['github_handle'] user.save() user.user.save() return HttpResponseJSON({'id': user.id})
# Copyright 2013-2015 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. import contextlib import imp import inspect import os import sys from .config import ConfigContext from .config_types import Path, ModuleBasePath, RECIPE_MODULE_PREFIX from .recipe_api import RecipeApi, RecipeApiPlain, Property, BoundProperty from .recipe_api import UndefinedPropertyException, PROPERTY_SENTINEL from .recipe_test_api import RecipeTestApi, DisabledTestData from .util import scan_directory class NoSuchRecipe(Exception): """Raised by load_recipe is recipe is not found.""" class RecipeScript(object): """Holds dict of an evaluated recipe script.""" def __init__(self, recipe_dict): # Let each property object know about the property name. recipe_dict['PROPERTIES'] = { name: value.bind(name, BoundProperty.RECIPE_PROPERTY, name) for name, value in recipe_dict.get('PROPERTIES', {}).items()} for k, v in recipe_dict.iteritems(): setattr(self, k, v) @classmethod def from_script_path(cls, script_path, universe): """Evaluates a script and returns RecipeScript instance.""" script_vars = {} script_vars['__file__'] = script_path with _preserve_path(): execfile(script_path, script_vars) script_vars['LOADED_DEPS'] = universe.deps_from_spec( script_vars.get('DEPS', [])) return cls(script_vars) class Dependency(object): def load(self, universe): raise NotImplementedError() @property def local_name(self): raise NotImplementedError() @property def unique_name(self): """A unique identifier for the module that this dependency refers to. This must be generated without loading the module.""" raise NotImplementedError() class PathDependency(Dependency): def __init__(self, path, local_name, universe): assert os.path.isabs(path), ( 'Path dependencies must be absolute, but %s is not' % path) self._path = path self._local_name = local_name # We forbid modules from living outside our main paths to keep clients # from going crazy before we have standardized recipe locations. mod_dir = os.path.dirname(path) assert mod_dir in universe.module_dirs, ( 'Modules living outside of approved directories are forbidden: ' '%s is not in %s' % (mod_dir, universe.module_dirs)) def load(self, universe): return _load_recipe_module_module(self._path, universe) @property def local_name(self): return self._local_name @property def unique_name(self): return self._path class NamedDependency(PathDependency): def __init__(self, name, universe): for path in universe.module_dirs: mod_path = os.path.join(path, name) if _is_recipe_module_dir(mod_path): super(NamedDependency, self).__init__(mod_path, name, universe=universe) return raise NoSuchRecipe('Recipe module named %s does not exist' % name) class PackageDependency(PathDependency): # TODO(luqui): Forbid depending on a module from a (locally) undeclared # dependency. def __init__(self, package, module, local_name, universe): mod_path = ( universe.package_deps.get_package(package).module_path(module)) super(PackageDependency, self).__init__( mod_path, local_name, universe=universe) class RecipeUniverse(object): def __init__(self, package_deps): self._loaded = {} self._package_deps = package_deps @property def module_dirs(self): return self._package_deps.all_module_dirs @property def recipe_dirs(self): return self._package_deps.all_recipe_dirs @property def package_deps(self): return self._package_deps def load(self, dep): """Load a Dependency.""" name = dep.unique_name if name in self._loaded: mod = self._loaded[name] assert mod is not None, ( 'Cyclic dependency when trying to load %s' % name) return mod else: self._loaded[name] = None mod = dep.load(self) self._loaded[name] = mod return mod def _dep_from_name(self, name): if '/' in name: [package,module] = name.split('/') dep = PackageDependency(package, module, module, universe=self) else: # Old style: bare module name, search paths to find it. module = name dep = NamedDependency(name, universe=self) return module, dep def deps_from_spec(self, spec): # Automatic local names. if isinstance(spec, (list, tuple)): deps = {} for item in spec: name, dep = self._dep_from_name(item) deps[name] = self.load(dep) # Explicit local names. elif isinstance(spec, dict): deps = {} for name, item in spec.iteritems(): _, dep = self._dep_from_name(item) deps[name] = self.load(dep) return deps def load_recipe(self, recipe): """Given name of a recipe, loads and returns it as RecipeScript instance. Args: recipe (str): name of a recipe, can be in form '<module>:<recipe>'. Returns: RecipeScript instance. Raises: NoSuchRecipe: recipe is not found. """ # If the recipe is specified as "module:recipe", then it is an recipe # contained in a recipe_module as an example. Look for it in the modules # imported by load_recipe_modules instead of the normal search paths. if ':' in recipe: module_name, example = recipe.split(':') assert example.endswith('example') for module_dir in self.module_dirs: if os.path.isdir(module_dir): for subitem in os.listdir(module_dir): if module_name == subitem: return RecipeScript.from_script_path( os.path.join(module_dir, subitem, 'example.py'), self) raise NoSuchRecipe(recipe, 'Recipe example %s:%s does not exist' % (module_name, example)) else: for recipe_path in (os.path.join(p, recipe) for p in self.recipe_dirs): if os.path.exists(recipe_path + '.py'): return RecipeScript.from_script_path(recipe_path + '.py', self) raise NoSuchRecipe(recipe) def loop_over_recipe_modules(self): for path in self.module_dirs: if os.path.isdir(path): for item in os.listdir(path): subpath = os.path.join(path, item) if _is_recipe_module_dir(subpath): yield subpath def loop_over_recipes(self): """Yields pairs (path to recipe, recipe name). Enumerates real recipes in recipes/* as well as examples in recipe_modules/*. """ for path in self.recipe_dirs: for recipe in scan_directory( path, lambda f: f.endswith('.py') and f[0] != '_'): yield recipe, recipe[len(path)+1:-len('.py')] for path in self.module_dirs: for recipe in scan_directory( path, lambda f: f.endswith('example.py')): module_name = os.path.dirname(recipe)[len(path)+1:] yield recipe, '%s:example' % module_name def _is_recipe_module_dir(path): return (os.path.isdir(path) and os.path.isfile(os.path.join(path, '__init__.py'))) @contextlib.contextmanager def _preserve_path(): old_path = sys.path[:] try: yield finally: sys.path = old_path def _find_and_load_module(fullname, modname, path): imp.acquire_lock() try: if fullname not in sys.modules: fil = None try: fil, pathname, descr = imp.find_module(modname, [os.path.dirname(path)]) imp.load_module(fullname, fil, pathname, descr) finally: if fil: fil.close() return sys.modules[fullname] finally: imp.release_lock() def _load_recipe_module_module(path, universe): modname = os.path.splitext(os.path.basename(path))[0] fullname = '%s.%s' % (RECIPE_MODULE_PREFIX, modname) mod = _find_and_load_module(fullname, modname, path) # This actually loads the dependencies. mod.LOADED_DEPS = universe.deps_from_spec(getattr(mod, 'DEPS', [])) # Prevent any modules that mess with sys.path from leaking. with _preserve_path(): # TODO(luqui): Remove this hack once configs are cleaned. sys.modules['%s.DEPS' % fullname] = mod.LOADED_DEPS _recursive_import(path, RECIPE_MODULE_PREFIX) _patchup_module(modname, mod) return mod def _recursive_import(path, prefix): modname = os.path.splitext(os.path.basename(path))[0] fullname = '%s.%s' % (prefix, modname) mod = _find_and_load_module(fullname, modname, path) if not os.path.isdir(path): return mod for subitem in os.listdir(path): subpath = os.path.join(path, subitem) subname = os.path.splitext(subitem)[0] if os.path.isdir(subpath): if not os.path.exists(os.path.join(subpath, '__init__.py')): continue elif not subpath.endswith('.py') or subitem.startswith('__init__.py'): continue submod = _recursive_import(subpath, fullname) if not hasattr(mod, subname): setattr(mod, subname, submod) else: prev = getattr(mod, subname) assert submod is prev, ( 'Conflicting modules: %s and %s' % (prev, mod)) return mod def _patchup_module(name, submod): """Finds framework related classes and functions in a |submod| and adds them to |submod| as top level constants with well known names such as API, CONFIG_CTX, TEST_API, and PROPERTIES. |submod| is a recipe module (akin to python package) with submodules such as 'api', 'config', 'test_api'. This function scans through dicts of that submodules to find subclasses of RecipeApi, RecipeTestApi, etc. """ submod.NAME = name submod.UNIQUE_NAME = name # TODO(luqui): use a luci-config unique name submod.MODULE_DIRECTORY = Path(ModuleBasePath(submod)) submod.CONFIG_CTX = getattr(submod, 'CONFIG_CTX', None) if hasattr(submod, 'config'): for v in submod.config.__dict__.itervalues(): if isinstance(v, ConfigContext): assert not submod.CONFIG_CTX, ( 'More than one configuration context: %s, %s' % (submod.config, submod.CONFIG_CTX)) submod.CONFIG_CTX = v assert submod.CONFIG_CTX, 'Config file, but no config context?' submod.API = getattr(submod, 'API', None) for v in submod.api.__dict__.itervalues(): if inspect.isclass(v) and issubclass(v, RecipeApiPlain): assert not submod.API, ( '%s has more than one Api subclass: %s, %s' % (name, v, submod.api)) submod.API = v assert submod.API, 'Submodule has no api? %s' % (submod) submod.TEST_API = getattr(submod, 'TEST_API', None) if hasattr(submod, 'test_api'): for v in submod.test_api.__dict__.itervalues(): if inspect.isclass(v) and issubclass(v, RecipeTestApi): assert not submod.TEST_API, ( 'More than one TestApi subclass: %s' % submod.api) submod.TEST_API = v assert submod.API, ( 'Submodule has test_api.py but no TestApi subclass? %s' % (submod) ) # Let each property object know about the property name. submod.PROPERTIES = { prop_name: value.bind(prop_name, BoundProperty.MODULE_PROPERTY, name) for prop_name, value in getattr(submod, 'PROPERTIES', {}).items()} class DependencyMapper(object): """DependencyMapper topologically traverses the dependency DAG beginning at a module, executing a callback ("instantiator") for each module. For example, if the dependency DAG looked like this: A / \ B C \ / D (with D depending on B and C, etc.), DependencyMapper(f).instantiate(D) would construct f_A = f(A, {}) f_B = f(B, { 'A': f_A }) f_C = f(C, { 'A': f_A }) f_D = f(D, { 'B': f_B, 'C': f_C }) finally returning f_D. instantiate can be called multiple times, which reuses already-computed results. """ def __init__(self, instantiator): self._instantiator = instantiator self._instances = {} def instantiate(self, mod): if mod in self._instances: return self._instances[mod] deps_dict = { name: self.instantiate(dep) for name, dep in mod.LOADED_DEPS.iteritems() } self._instances[mod] = self._instantiator(mod, deps_dict) return self._instances[mod] def invoke_with_properties(callable_obj, all_props, prop_defs, **additional_args): """ Invokes callable with filtered, type-checked properties. Args: callable_obj: The function to call, or class to instantiate. This supports passing in either RunSteps, or a recipe module, which is a class. all_props: A dictionary containing all the properties (instances of BoundProperty) currently defined in the system. prop_defs: A dictionary of name to property definitions for this callable. additional_args: kwargs to pass through to the callable. Note that the names of the arguments can correspond to positional arguments as well. Returns: The result of calling callable with the filtered properties and additional arguments. """ # Check that we got passed BoundProperties, and not Properties for name, prop in prop_defs.items(): if not isinstance(prop, BoundProperty): raise ValueError( "You tried to invoke {} with an unbound Property {} named {}".format( callable, prop, name)) # To detect when they didn't specify a property that they have as a # function argument, list the arguments, through inspection, # and then comparing this list to the provided properties. We use a list # instead of a dict because getargspec returns a list which we would have to # convert to a dictionary, and the benefit of the dictionary is pretty small. props = [] if inspect.isclass(callable_obj): arg_names = inspect.getargspec(callable_obj.__init__).args arg_names.pop(0) else: arg_names = inspect.getargspec(callable_obj).args for arg in arg_names: if arg in additional_args: props.append(additional_args.pop(arg)) continue if arg not in prop_defs: raise UndefinedPropertyException( "Missing property definition for '{}'.".format(arg)) prop = prop_defs[arg] props.append(prop.interpret(all_props.get( prop.param_name, PROPERTY_SENTINEL))) return callable_obj(*props, **additional_args) def create_recipe_api(toplevel_deps, engine, test_data=DisabledTestData()): def instantiator(mod, deps): kwargs = { 'module': mod, 'engine': engine, # TODO(luqui): test_data will need to use canonical unique names. 'test_data': test_data.get_module_test_data(mod.NAME) } prop_defs = mod.PROPERTIES mod_api = invoke_with_properties( mod.API, engine.properties, prop_defs, **kwargs) mod_api.test_api = (getattr(mod, 'TEST_API', None) or RecipeTestApi)(module=mod) for k, v in deps.iteritems(): setattr(mod_api.m, k, v) setattr(mod_api.test_api.m, k, v.test_api) return mod_api mapper = DependencyMapper(instantiator) api = RecipeApi(module=None, engine=engine, test_data=test_data.get_module_test_data(None)) for k, v in toplevel_deps.iteritems(): setattr(api, k, mapper.instantiate(v)) return api def create_test_api(toplevel_deps, universe): def instantiator(mod, deps): modapi = (getattr(mod, 'TEST_API', None) or RecipeTestApi)(module=mod) for k,v in deps.iteritems(): setattr(modapi.m, k, v) return modapi mapper = DependencyMapper(instantiator) api = RecipeTestApi(module=None) for k,v in toplevel_deps.iteritems(): setattr(api, k, mapper.instantiate(v)) return api
from nose.tools import * import mock from tests.factories import UserFactory, ProjectFactory from framework.auth.decorators import Auth from website.addons.dataverse.model import ( AddonDataverseUserSettings, AddonDataverseNodeSettings, DataverseFile ) from website.addons.dataverse.tests.utils import DataverseAddonTestCase class TestDataverseFile(DataverseAddonTestCase): def test_constants(self): dvf = DataverseFile() assert_equal('dataverse', dvf.provider) assert_equal('state', dvf.version_identifier) def test_path_doesnt_crash_without_addon(self): dvf = DataverseFile(node=self.project, file_id='12345') self.project.delete_addon('dataverse', Auth(self.user)) assert_is(self.project.get_addon('dataverse'), None) assert_true(dvf.file_id) assert_true(dvf.waterbutler_path) def test_waterbutler_path(self): dvf = DataverseFile(node=self.project, file_id='12345') assert_equals(dvf.file_id, '12345') assert_equals(dvf.waterbutler_path, '/12345') def test_unique_identifier(self): dvf = DataverseFile(node=self.project, file_id='12345') assert_true(dvf.file_id, '12345') assert_equals(dvf.unique_identifier, '12345') def test_node_addon_get_or_create(self): dvf, created = self.node_settings.find_or_create_file_guid('12345') assert_true(created) assert_equal(dvf.file_id, '12345') assert_equal(dvf.waterbutler_path, '/12345') def test_node_addon_get_or_create_finds(self): dvf1, created1 = self.node_settings.find_or_create_file_guid('12345') dvf2, created2 = self.node_settings.find_or_create_file_guid('12345') assert_true(created1) assert_false(created2) assert_equals(dvf1, dvf2) @mock.patch('website.addons.base.requests.get') def test_name(self, mock_get): mock_response = mock.Mock(ok=True, status_code=200) mock_get.return_value = mock_response mock_response.json.return_value = { 'data': { 'name': 'Morty.foo', 'path': '/12345', }, } dvf, created = self.node_settings.find_or_create_file_guid('12345') dvf.enrich() assert_equal(dvf.name, 'Morty.foo') @mock.patch('website.addons.base.requests.get') def test_mfr_temp_path(self, mock_get): mock_response = mock.Mock(ok=True, status_code=200) mock_get.return_value = mock_response mock_response.json.return_value = { 'data': { 'name': 'Morty.foo', 'path': '/12345', }, } dvf, created = self.node_settings.find_or_create_file_guid('12345') dvf.enrich() # Included fields ensure uniqueness assert_in(self.project._id, dvf.mfr_temp_path) assert_in(dvf.provider, dvf.mfr_temp_path) assert_in(dvf.unique_identifier, dvf.mfr_temp_path) class TestDataverseUserSettings(DataverseAddonTestCase): def test_has_auth(self): # Dataverse has no auth by default dataverse = AddonDataverseUserSettings() assert_false(dataverse.has_auth) # With valid credentials, dataverse is authorized dataverse.api_token = 'snowman-frosty' assert_true(dataverse.has_auth) def test_clear(self): self.user_settings.clear() # Fields were cleared, but settings were not deleted assert_false(self.user_settings.api_token) assert_false(self.user_settings.deleted) # Authorized node settings were deauthorized assert_false(self.node_settings.dataverse_alias) assert_false(self.node_settings.dataverse) assert_false(self.node_settings.dataset_doi) assert_false(self.node_settings._dataset_id) # Getter makes request assert_false(self.node_settings.dataset) assert_false(self.node_settings.user_settings) # Authorized node settings were not deleted assert_false(self.node_settings.deleted) @mock.patch('website.addons.dataverse.model.AddonDataverseUserSettings.clear') def test_delete(self, mock_clear): self.user_settings.delete() assert_true(self.user_settings.deleted) mock_clear.assert_called_once_with() class TestDataverseNodeSettings(DataverseAddonTestCase): def test_fields(self): node_settings = AddonDataverseNodeSettings(user_settings=self.user_settings) node_settings.save() assert_true(node_settings.user_settings) assert_equal(node_settings.user_settings.owner, self.user) assert_true(hasattr(node_settings, 'dataverse')) assert_true(hasattr(node_settings, 'dataverse_alias')) assert_true(hasattr(node_settings, 'dataset')) assert_true(hasattr(node_settings, 'dataset_doi')) def test_defaults(self): node_settings = AddonDataverseNodeSettings(user_settings=self.user_settings) node_settings.save() assert_is_none(node_settings.dataverse) assert_is_none(node_settings.dataverse_alias) assert_is_none(node_settings.dataset) assert_is_none(node_settings.dataset_doi) def test_has_auth(self): node_settings = AddonDataverseNodeSettings() node_settings.save() assert_false(node_settings.has_auth) user_settings = AddonDataverseUserSettings() user_settings.save() node_settings.user_settings = user_settings node_settings.save() assert_false(node_settings.has_auth) user_settings.api_token = 'foo-bar' user_settings.save() assert_true(node_settings.has_auth) @mock.patch('website.addons.dataverse.model.AddonDataverseNodeSettings.deauthorize') def test_delete(self, mock_deauth): num_old_logs = len(self.project.logs) self.node_settings.delete() assert_true(self.node_settings.deleted) args, kwargs = mock_deauth.call_args assert_equal(kwargs, {'add_log': False}) # Log was not generated self.project.reload() assert_equal(len(self.project.logs), num_old_logs) def test_set_user_auth(self): project = ProjectFactory() project.add_addon('dataverse', auth=Auth(self.user)) node_settings = project.get_addon('dataverse') num_old_logs = len(project.logs) assert_false(node_settings.user_settings) node_settings.set_user_auth(self.user_settings) node_settings.save() assert_equal(node_settings.user_settings, self.user_settings) # Test log project.reload() assert_equal(len(project.logs), num_old_logs + 1) last_log = project.logs[-1] assert_equal(last_log.action, 'dataverse_node_authorized') assert_equal(last_log.params['node'], project._primary_key) assert_is_none(last_log.params['project']) def test_deauthorize(self): self.node_settings.deauthorize(Auth(self.user)) assert_false(self.node_settings.dataverse_alias) assert_false(self.node_settings.dataverse) assert_false(self.node_settings.dataset_doi) assert_false(self.node_settings.dataset) assert_false(self.node_settings.user_settings) class TestNodeSettingsCallbacks(DataverseAddonTestCase): def test_after_fork_by_authorized_dataverse_user(self): fork = ProjectFactory() clone, message = self.node_settings.after_fork( node=self.project, fork=fork, user=self.user_settings.owner ) assert_equal(clone.user_settings, self.user_settings) def test_after_fork_by_unauthorized_dataverse_user(self): fork = ProjectFactory() user = UserFactory() clone, message = self.node_settings.after_fork( node=self.project, fork=fork, user=user, save=True ) assert_is_none(clone.user_settings) def test_before_fork(self): node = ProjectFactory() message = self.node_settings.before_fork(node, self.user) assert_true(message) def test_before_remove_contributor_message(self): message = self.node_settings.before_remove_contributor( self.project, self.user) assert_true(message) assert_in(self.user.fullname, message) assert_in(self.project.project_or_component, message) def test_after_remove_authorized_dataverse_user_not_self(self): message = self.node_settings.after_remove_contributor( node=self.project, removed=self.user_settings.owner) self.node_settings.save() assert_is_none(self.node_settings.user_settings) assert_true(message) assert_in("You can re-authenticate", message) def test_after_remove_authorized_dataverse_user_self(self): auth = Auth(user=self.user_settings.owner) message = self.node_settings.after_remove_contributor( self.project, self.user_settings.owner, auth) self.node_settings.save() assert_is_none(self.node_settings.user_settings) assert_true(message) assert_not_in("You can re-authenticate", message) def test_after_delete(self): self.project.remove_node(Auth(user=self.project.creator)) # Ensure that changes to node settings have been saved self.node_settings.reload() assert_true(self.node_settings.user_settings is None) assert_true(self.node_settings.dataverse_alias is None) assert_true(self.node_settings.dataverse is None) assert_true(self.node_settings.dataset_doi is None) assert_true(self.node_settings.dataset is None) def test_does_not_get_copied_to_registrations(self): registration = self.project.register_node( schema=None, auth=Auth(user=self.project.creator), template='Template1', data='hodor' ) assert_false(registration.has_addon('dataverse'))
''' Author: Tobi and Gundram ''' from __future__ import print_function import tensorflow as tf from tensorflow.python.ops import ctc_ops as ctc from tensorflow.contrib.layers import batch_norm from tensorflow.python.ops import rnn_cell from tensorflow.python.ops import control_flow_ops from tensorflow.python.ops.rnn import bidirectional_rnn from util.LoaderUtil import read_image_list, get_list_vals from random import shuffle from util.STR2CTC import get_charmap_lp, get_charmap_lp_inv import os import time import numpy as np import matplotlib.pyplot as plt # Goes done to 10% INPUT_PATH_TRAIN = './private/lists/lp_only_shifted_train.lst' INPUT_PATH_VAL = './private/lists/lp_only_val.lst' cm, nClasses = get_charmap_lp() # Additional NaC Channel nClasses += 1 nEpochs = 15 batchSize = 16 # It is assumed that the TextLines are ALL saved with a consistent height of imgH imgH = 48 # Depending on the size the image is cropped or zero padded imgW = 256 channels = 1 nHiddenLSTM1 = 256 os.chdir("../..") trainList = read_image_list(INPUT_PATH_TRAIN) numT = 32998 stepsPerEpocheTrain = numT / batchSize valList = read_image_list(INPUT_PATH_VAL) stepsPerEpocheVal = len(valList) / batchSize def get_saver_dict(prefix): dict = {} if prefix[-1] != '/': prefix = prefix + '/' res = tf.get_collection(tf.GraphKeys.GLOBAL_VARIABLES, scope=prefix) for t in res: key = t.name key = key[len(prefix):] dict[str(key)] = t # print(dict) return dict def inference(images, seqLen, keep_prob, phase_train): with tf.variable_scope('readPart') as scope: with tf.variable_scope('conv1') as scope: kernel = tf.Variable(tf.truncated_normal([6, 5, channels, 32], stddev=5e-2), name='weights') ##Weight Decay? # weight_decay = tf.mul(tf.nn.l2_loss(kernel), 0.002, name='weight_loss') # tf.add_to_collection('losses', weight_decay) conv = tf.nn.conv2d(images, kernel, [1, 4, 3, 1], padding='SAME') biases = tf.Variable(tf.constant(0.1, shape=[32]), name='biases') pre_activation = tf.nn.bias_add(conv, biases) conv1 = tf.nn.relu(pre_activation, name=scope.name) norm1 = tf.nn.local_response_normalization(conv1, name='norm1') # _activation_summary(conv1) # norm1 = tf.nn.local_response_normalization(conv1, 4, bias=1.0, alpha=0.001 / 9.0, beta=0.75,name='norm1') seqFloat = tf.to_float(seqLen) seqL2 = tf.ceil(seqFloat * 0.33) with tf.variable_scope('conv2') as scope: kernel = tf.Variable(tf.truncated_normal([5, 5, 32, 64], stddev=5e-2), name='weights') ##Weight Decay? # weight_decay = tf.mul(tf.nn.l2_loss(kernel), 0.002, name='weight_loss') # tf.add_to_collection('losses', weight_decay) conv = tf.nn.conv2d(norm1, kernel, [1, 1, 1, 1], padding='SAME') biases = tf.Variable(tf.constant(0.1, shape=[64]), name='biases') pre_activation = tf.nn.bias_add(conv, biases) conv2 = tf.nn.relu(pre_activation, name=scope.name) norm2 = tf.nn.local_response_normalization(conv2, name='norm2') # _activation_summary(conv2) # norm2 # norm2 = tf.nn.local_response_normalization(conv2, 4, bias=1.0, alpha=0.001 / 9.0, beta=0.75,name='norm2') pool2 = tf.nn.max_pool(norm2, ksize=[1, 4, 2, 1], strides=[1, 4, 2, 1], padding='SAME', name='pool2') seqL3 = tf.ceil(seqL2 * 0.5) with tf.variable_scope('conv3') as scope: kernel = tf.Variable(tf.truncated_normal([5, 3, 64, 128], stddev=5e-2), name='weights') ##Weight Decay? # weight_decay = tf.mul(tf.nn.l2_loss(kernel), 0.002, name='weight_loss') # tf.add_to_collection('losses', weight_decay) conv = tf.nn.conv2d(pool2, kernel, [1, 1, 1, 1], padding='SAME') biases = tf.Variable(tf.constant(0.1, shape=[128]), name='biases') pre_activation = tf.nn.bias_add(conv, biases) conv3 = tf.nn.relu(pre_activation, name=scope.name) norm3 = tf.nn.local_response_normalization(conv3, name='norm3') pool3 = tf.nn.max_pool(norm3, ksize=[1, 3, 1, 1], strides=[1, 3, 1, 1], padding='SAME', name='pool2') # NO POOLING HERE -> CTC needs an appropriate length. seqLenAfterConv = tf.to_int32(seqL3) with tf.variable_scope('RNN_Prep') as scope: # (#batch Y X Z) --> (X #batch Y Z) rnnIn = tf.transpose(pool3, [2, 0, 1, 3]) # (X #batch Y Z) --> (X #batch Y*Z) shape = rnnIn.get_shape() steps = shape[0] rnnIn = tf.reshape(rnnIn, tf.pack([shape[0], shape[1], -1])) # (X #batch Y*Z) --> (X*#batch Y*Z) shape = rnnIn.get_shape() rnnIn = tf.reshape(rnnIn, tf.pack([-1, shape[2]])) # (X*#batch Y*Z) --> list of X tensors of shape (#batch, Y*Z) rnnIn = tf.split(0, steps, rnnIn) with tf.variable_scope('BLSTM1') as scope: forwardH1 = rnn_cell.LSTMCell(nHiddenLSTM1, use_peepholes=True, state_is_tuple=True) droppedFW = rnn_cell.DropoutWrapper(forwardH1, output_keep_prob=keep_prob) backwardH1 = rnn_cell.LSTMCell(nHiddenLSTM1, use_peepholes=True, state_is_tuple=True) droppedBW = rnn_cell.DropoutWrapper(backwardH1, output_keep_prob=keep_prob) outputs, _, _ = bidirectional_rnn(droppedFW, droppedBW, rnnIn, dtype=tf.float32) fbH1rs = [tf.reshape(t, [batchSize, 2, nHiddenLSTM1]) for t in outputs] # outH1 = [tf.reduce_sum(tf.mul(t, weightsOutH1), reduction_indices=1) + biasesOutH1 for t in fbH1rs] outH1 = [tf.reduce_sum(t, reduction_indices=1) for t in fbH1rs] with tf.variable_scope('LOGIT') as scope: weightsClasses = tf.Variable(tf.truncated_normal([nHiddenLSTM1, nClasses], stddev=np.sqrt(2.0 / nHiddenLSTM1))) biasesClasses = tf.Variable(tf.zeros([nClasses])) logitsFin = [tf.matmul(t, weightsClasses) + biasesClasses for t in outH1] logits3d = tf.pack(logitsFin) return logits3d, seqLenAfterConv def loss(logits3d, tgt, seqLenAfterConv): loss = tf.reduce_sum(ctc.ctc_loss(logits3d, tgt, seqLenAfterConv)) update_ops = tf.get_collection(tf.GraphKeys.UPDATE_OPS) if update_ops: updates = tf.group(*update_ops) loss = control_flow_ops.with_dependencies([updates], loss) return loss print('Defining graph') graph = tf.Graph() with graph.as_default(): ####Graph input inputX = tf.placeholder(tf.float32, shape=(batchSize, imgH, imgW, channels)) targetIxs = tf.placeholder(tf.int64) targetVals = tf.placeholder(tf.int32) targetShape = tf.placeholder(tf.int64) targetY = tf.SparseTensor(targetIxs, targetVals, targetShape) seqLengths = tf.placeholder(tf.int32, shape=(batchSize)) keep_prob = tf.placeholder(tf.float32) trainIN = tf.placeholder_with_default(tf.constant(False), []) logits3d, seqAfterConv = inference(inputX, seqLengths, keep_prob, trainIN) loss = loss(logits3d, targetY, seqAfterConv) dict = get_saver_dict('readPart') saver = tf.train.Saver(dict) # optimizer = tf.train.MomentumOptimizer(learningRate, momentum).minimize(loss) optimizer = tf.train.AdamOptimizer().minimize(loss) # pred = tf.to_int32(ctc.ctc_beam_search_decoder(logits3d, seqAfterConv, merge_repeated=False)[0][0]) pred = tf.to_int32(ctc.ctc_greedy_decoder(logits3d, seqAfterConv)[0][0]) edist = tf.edit_distance(pred, targetY, normalize=False) tgtLens = tf.to_float(tf.size(targetY.values)) err = tf.reduce_sum(edist) / tgtLens with tf.Session(graph=graph) as session: # writer = tf.train.SummaryWriter('./log', session.graph) print('Initializing') tf.global_variables_initializer().run() # ckpt = tf.train.get_checkpoint_state("./private/models/lp2/") # if ckpt and ckpt.model_checkpoint_path: # saver.restore(session, ckpt.model_checkpoint_path) # print(ckpt) # workList = valList[:] # errV = 0 # lossV = 0 # timeVS = time.time() # cmInv = get_charmap_lp_inv() # for bStep in range(stepsPerEpocheVal): # bList, workList = workList[:batchSize], workList[batchSize:] # batchInputs, batchSeqLengths, batchTargetIdxs, batchTargetVals, batchTargetShape = get_list_vals(bList, cm, # imgW, # mvn=True) # feedDict = {inputX: batchInputs, targetIxs: batchTargetIdxs, targetVals: batchTargetVals, # targetShape: batchTargetShape, seqLengths: batchSeqLengths} # lossB, aErr, p = session.run([loss, err, pred], feed_dict=feedDict) # print(aErr) # res = [] # for idx in p.values: # res.append(cmInv[idx]) # print(res) # # print(p) # plt.imshow(batchInputs[0,:,:,0], cmap=plt.cm.gray) # plt.show() # # lossV += lossB # errV += aErr # print('Val: CTC-loss ', lossV) # errVal = errV / stepsPerEpocheVal # print('Val: CER ', errVal) # print('Val time ', time.time() - timeVS) for epoch in range(nEpochs): workList = trainList[:] shuffle(workList) workList = workList[0:32998] print('Epoch', epoch + 1, '...') lossT = 0 errT = 0 timeTS = time.time() for bStep in range(stepsPerEpocheTrain): bList, workList = workList[:batchSize], workList[batchSize:] batchInputs, batchSeqLengths, batchTargetIdxs, batchTargetVals, batchTargetShape = get_list_vals(bList, cm, imgW, mvn=True) feedDict = {inputX: batchInputs, targetIxs: batchTargetIdxs, targetVals: batchTargetVals, targetShape: batchTargetShape, seqLengths: imgW*np.ones([batchSize]), keep_prob: 0.5, trainIN: True} _, lossB, aErr = session.run([optimizer, loss, err], feed_dict=feedDict) # _, lossB, aErr, sET, sLT = session.run([optimizer, loss, err, err_train, loss_train], feed_dict=feedDict) lossT += lossB # writer.add_summary(sET, epoch * stepsPerEpocheTrain + bStep) # writer.add_summary(sLT, epoch * stepsPerEpocheTrain + bStep) errT += aErr print('Train: CTC-loss ', lossT) cerT = errT / stepsPerEpocheTrain print('Train: CER ', cerT) print('Train time ', time.time() - timeTS) workList = valList[:] errV = 0 lossV = 0 timeVS = time.time() for bStep in range(stepsPerEpocheVal): bList, workList = workList[:batchSize], workList[batchSize:] batchInputs, batchSeqLengths, batchTargetIdxs, batchTargetVals, batchTargetShape = get_list_vals(bList, cm, imgW, mvn=True) feedDict = {inputX: batchInputs, targetIxs: batchTargetIdxs, targetVals: batchTargetVals, targetShape: batchTargetShape, seqLengths: imgW*np.ones([batchSize]), keep_prob: 1.0, trainIN: False} lossB, aErr = session.run([loss, err], feed_dict=feedDict) # lossB, aErr, sE, sL = session.run([loss, err, err_val, loss_val], feed_dict=feedDict) # writer.add_summary(sE, epoch*stepsPerEpocheVal + bStep) # writer.add_summary(sL, epoch * stepsPerEpocheVal + bStep) lossV += lossB errV += aErr print('Val: CTC-loss ', lossV) errVal = errV / stepsPerEpocheVal print('Val: CER ', errVal) print('Val time ', time.time() - timeVS) # Write a checkpoint. checkpoint_file = os.path.join('./private/models/lp24/', 'checkpoint') saver.save(session, checkpoint_file, global_step=epoch)
"""Default values and other various configuration for projects, including available theme names and repository types. """ import re from django.utils.translation import ugettext_lazy as _ THEME_DEFAULT = 'default' THEME_SPHINX = 'sphinxdoc' THEME_SCROLLS = 'scrolls' THEME_AGOGO = 'agogo' THEME_TRADITIONAL = 'traditional' THEME_NATURE = 'nature' THEME_HAIKU = 'haiku' DOCUMENTATION_CHOICES = ( ('auto', _('Automatically Choose')), ('sphinx', _('Sphinx Html')), ('mkdocs', _('Mkdocs (Markdown)')), ('sphinx_htmldir', _('Sphinx HtmlDir')), ('sphinx_singlehtml', _('Sphinx Single Page HTML')), #('sphinx_websupport2', _('Sphinx Websupport')), #('rdoc', 'Rdoc'), ) DEFAULT_THEME_CHOICES = ( # Translators: This is a name of a Sphinx theme. (THEME_DEFAULT, _('Default')), # Translators: This is a name of a Sphinx theme. (THEME_SPHINX, _('Sphinx Docs')), #(THEME_SCROLLS, 'Scrolls'), #(THEME_AGOGO, 'Agogo'), # Translators: This is a name of a Sphinx theme. (THEME_TRADITIONAL, _('Traditional')), # Translators: This is a name of a Sphinx theme. (THEME_NATURE, _('Nature')), # Translators: This is a name of a Sphinx theme. (THEME_HAIKU, _('Haiku')), ) SAMPLE_FILES = ( ('Installation', 'projects/samples/installation.rst.html'), ('Getting started', 'projects/samples/getting_started.rst.html'), ) SCRAPE_CONF_SETTINGS = [ 'copyright', 'project', 'version', 'release', 'source_suffix', 'html_theme', 'extensions', ] HEADING_MARKUP = ( (1, '='), (2, '-'), (3, '^'), (4, '"'), ) LIVE_STATUS = 1 DELETED_STATUS = 99 STATUS_CHOICES = ( (LIVE_STATUS, _('Live')), (DELETED_STATUS, _('Deleted')), ) REPO_CHOICES = ( ('git', _('Git')), ('svn', _('Subversion')), ('hg', _('Mercurial')), ('bzr', _('Bazaar')), ) PUBLIC = 'public' PROTECTED = 'protected' PRIVATE = 'private' PRIVACY_CHOICES = ( (PUBLIC, _('Public')), (PROTECTED, _('Protected')), (PRIVATE, _('Private')), ) IMPORTANT_VERSION_FILTERS = { 'slug': 'important' } # in the future this constant can be replaced with a implementation that # detect all available Python interpreters in the fly (Maybe using # update-alternatives linux tool family?). PYTHON_CHOICES = ( ('python', _('CPython 2.x')), ('python3', _('CPython 3.x')), ) # Via http://sphinx-doc.org/latest/config.html#confval-language # Languages supported for the lang_slug in the URL # Translations for builtin Sphinx messages only available for a subset of these LANGUAGES = ( ("aa", "Afar"), ("ab", "Abkhaz"), ("af", "Afrikaans"), ("am", "Amharic"), ("ar", "Arabic"), ("as", "Assamese"), ("ay", "Aymara"), ("az", "Azerbaijani"), ("ba", "Bashkir"), ("be", "Belarusian"), ("bg", "Bulgarian"), ("bh", "Bihari"), ("bi", "Bislama"), ("bn", "Bengali"), ("bo", "Tibetan"), ("br", "Breton"), ("ca", "Catalan"), ("co", "Corsican"), ("cs", "Czech"), ("cy", "Welsh"), ("da", "Danish"), ("de", "German"), ("dz", "Dzongkha"), ("el", "Greek"), ("en", "English"), ("eo", "Esperanto"), ("es", "Spanish"), ("et", "Estonian"), ("eu", "Basque"), ("fa", "Iranian"), ("fi", "Finnish"), ("fj", "Fijian"), ("fo", "Faroese"), ("fr", "French"), ("fy", "Western Frisian"), ("ga", "Irish"), ("gd", "Scottish Gaelic"), ("gl", "Galician"), ("gn", "Guarani"), ("gu", "Gujarati"), ("ha", "Hausa"), ("hi", "Hindi"), ("he", "Hebrew"), ("hr", "Croatian"), ("hu", "Hungarian"), ("hy", "Armenian"), ("ia", "Interlingua"), ("id", "Indonesian"), ("ie", "Interlingue"), ("ik", "Inupiaq"), ("is", "Icelandic"), ("it", "Italian"), ("iu", "Inuktitut"), ("ja", "Japanese"), ("jv", "Javanese"), ("ka", "Georgian"), ("kk", "Kazakh"), ("kl", "Kalaallisut"), ("km", "Khmer"), ("kn", "Kannada"), ("ko", "Korean"), ("ks", "Kashmiri"), ("ku", "Kurdish"), ("ky", "Kyrgyz"), ("la", "Latin"), ("ln", "Lingala"), ("lo", "Lao"), ("lt", "Lithuanian"), ("lv", "Latvian"), ("mg", "Malagasy"), ("mi", "Maori"), ("mk", "Macedonian"), ("ml", "Malayalam"), ("mn", "Mongolian"), ("mr", "Marathi"), ("ms", "Malay"), ("mt", "Maltese"), ("my", "Burmese"), ("na", "Nauru"), ("ne", "Nepali"), ("nl", "Dutch"), ("no", "Norwegian"), ("oc", "Occitan"), ("om", "Oromo"), ("or", "Oriya"), ("pa", "Panjabi"), ("pl", "Polish"), ("ps", "Pashto"), ("pt", "Portuguese"), ("qu", "Quechua"), ("rm", "Romansh"), ("rn", "Kirundi"), ("ro", "Romanian"), ("ru", "Russian"), ("rw", "Kinyarwanda"), ("sa", "Sanskrit"), ("sd", "Sindhi"), ("sg", "Sango"), ("si", "Sinhala"), ("sk", "Slovak"), ("sl", "Slovenian"), ("sm", "Samoan"), ("sn", "Shona"), ("so", "Somali"), ("sq", "Albanian"), ("sr", "Serbian"), ("ss", "Swati"), ("st", "Southern Sotho"), ("su", "Sudanese"), ("sv", "Swedish"), ("sw", "Swahili"), ("ta", "Tamil"), ("te", "Telugu"), ("tg", "Tajik"), ("th", "Thai"), ("ti", "Tigrinya"), ("tk", "Turkmen"), ("tl", "Tagalog"), ("tn", "Tswana"), ("to", "Tonga"), ("tr", "Turkish"), ("ts", "Tsonga"), ("tt", "Tatar"), ("tw", "Twi"), ("ug", "Uyghur"), ("uk", "Ukrainian"), ("ur", "Urdu"), ("uz", "Uzbek"), ("vi", "Vietnamese"), ("vo", "Volapuk"), ("wo", "Wolof"), ("xh", "Xhosa"), ("yi", "Yiddish"), ("yo", "Yoruba"), ("za", "Zhuang"), ("zh", "Chinese"), ("zu", "Zulu"), # Try these to test our non-2 letter language support ("nb_NO", "Norwegian Bokmal"), ("pt_BR", "Brazilian Portuguese"), ("uk_UA", "Ukrainian"), ("zh_CN", "Simplified Chinese"), ("zh_TW", "Traditional Chinese"), ) LANGUAGES_REGEX = "|".join( [re.escape(code[0]) for code in LANGUAGES] ) PROGRAMMING_LANGUAGES = ( ("words", "Only Words"), ("py", "Python"), ("js", "Javascript"), ("php", "PHP"), ("ruby", "Ruby"), ("perl", "Perl"), ("java", "Java"), ("go", "Go"), ("julia", "Julia"), ("c", "C"), ("csharp", "C#"), ("cpp", "C++"), ("objc", "Objective-C"), ("other", "Other"), ) LOG_TEMPLATE = u"(Build) [{project}:{version}] {msg}" PROJECT_PK_REGEX = '(?:[-\w]+)' PROJECT_SLUG_REGEX = '(?:[-\w]+)'
import datetime from django.conf import settings from django.core.exceptions import FieldError from django.db.backends.utils import truncate_name from django.db.models.constants import LOOKUP_SEP from django.db.models.query_utils import select_related_descend, QueryWrapper from django.db.models.sql.constants import (CURSOR, SINGLE, MULTI, NO_RESULTS, ORDER_DIR, GET_ITERATOR_CHUNK_SIZE, SelectInfo) from django.db.models.sql.datastructures import EmptyResultSet from django.db.models.sql.query import get_order_dir, Query from django.db.transaction import TransactionManagementError from django.db.utils import DatabaseError from django.utils import six from django.utils.six.moves import zip from django.utils import timezone class SQLCompiler(object): def __init__(self, query, connection, using): self.query = query self.connection = connection self.using = using self.quote_cache = {'*': '*'} # When ordering a queryset with distinct on a column not part of the # select set, the ordering column needs to be added to the select # clause. This information is needed both in SQL construction and # masking away the ordering selects from the returned row. self.ordering_aliases = [] self.ordering_params = [] def pre_sql_setup(self): """ Does any necessary class setup immediately prior to producing SQL. This is for things that can't necessarily be done in __init__ because we might not have all the pieces in place at that time. # TODO: after the query has been executed, the altered state should be # cleaned. We are not using a clone() of the query here. """ if not self.query.tables: self.query.join((None, self.query.get_meta().db_table, None)) if (not self.query.select and self.query.default_cols and not self.query.included_inherited_models): self.query.setup_inherited_models() if self.query.select_related and not self.query.related_select_cols: self.fill_related_selections() def __call__(self, name): """ A wrapper around connection.ops.quote_name that doesn't quote aliases for table names. This avoids problems with some SQL dialects that treat quoted strings specially (e.g. PostgreSQL). """ if name in self.quote_cache: return self.quote_cache[name] if ((name in self.query.alias_map and name not in self.query.table_map) or name in self.query.extra_select): self.quote_cache[name] = name return name r = self.connection.ops.quote_name(name) self.quote_cache[name] = r return r def quote_name_unless_alias(self, name): """ A wrapper around connection.ops.quote_name that doesn't quote aliases for table names. This avoids problems with some SQL dialects that treat quoted strings specially (e.g. PostgreSQL). """ return self(name) def compile(self, node): vendor_impl = getattr( node, 'as_' + self.connection.vendor, None) if vendor_impl: return vendor_impl(self, self.connection) else: return node.as_sql(self, self.connection) def as_sql(self, with_limits=True, with_col_aliases=False): """ Creates the SQL for this query. Returns the SQL string and list of parameters. If 'with_limits' is False, any limit/offset information is not included in the query. """ if with_limits and self.query.low_mark == self.query.high_mark: return '', () self.pre_sql_setup() # After executing the query, we must get rid of any joins the query # setup created. So, take note of alias counts before the query ran. # However we do not want to get rid of stuff done in pre_sql_setup(), # as the pre_sql_setup will modify query state in a way that forbids # another run of it. refcounts_before = self.query.alias_refcount.copy() out_cols, s_params = self.get_columns(with_col_aliases) ordering, o_params, ordering_group_by = self.get_ordering() distinct_fields = self.get_distinct() # This must come after 'select', 'ordering' and 'distinct' -- see # docstring of get_from_clause() for details. from_, f_params = self.get_from_clause() where, w_params = self.compile(self.query.where) having, h_params = self.compile(self.query.having) having_group_by = self.query.having.get_group_by_cols() params = [] for val in six.itervalues(self.query.extra_select): params.extend(val[1]) result = ['SELECT'] if self.query.distinct: result.append(self.connection.ops.distinct_sql(distinct_fields)) result.append(', '.join(out_cols + self.ordering_aliases)) params.extend(s_params) params.extend(self.ordering_params) result.append('FROM') result.extend(from_) params.extend(f_params) if where: result.append('WHERE %s' % where) params.extend(w_params) grouping, gb_params = self.get_grouping(having_group_by, ordering_group_by) if grouping: if distinct_fields: raise NotImplementedError( "annotate() + distinct(fields) not implemented.") if not ordering: ordering = self.connection.ops.force_no_ordering() result.append('GROUP BY %s' % ', '.join(grouping)) params.extend(gb_params) if having: result.append('HAVING %s' % having) params.extend(h_params) if ordering: result.append('ORDER BY %s' % ', '.join(ordering)) params.extend(o_params) if with_limits: if self.query.high_mark is not None: result.append('LIMIT %d' % (self.query.high_mark - self.query.low_mark)) if self.query.low_mark: if self.query.high_mark is None: val = self.connection.ops.no_limit_value() if val: result.append('LIMIT %d' % val) result.append('OFFSET %d' % self.query.low_mark) if self.query.select_for_update and self.connection.features.has_select_for_update: if self.connection.get_autocommit(): raise TransactionManagementError("select_for_update cannot be used outside of a transaction.") # If we've been asked for a NOWAIT query but the backend does not support it, # raise a DatabaseError otherwise we could get an unexpected deadlock. nowait = self.query.select_for_update_nowait if nowait and not self.connection.features.has_select_for_update_nowait: raise DatabaseError('NOWAIT is not supported on this database backend.') result.append(self.connection.ops.for_update_sql(nowait=nowait)) # Finally do cleanup - get rid of the joins we created above. self.query.reset_refcounts(refcounts_before) return ' '.join(result), tuple(params) def as_nested_sql(self): """ Perform the same functionality as the as_sql() method, returning an SQL string and parameters. However, the alias prefixes are bumped beforehand (in a copy -- the current query isn't changed), and any ordering is removed if the query is unsliced. Used when nesting this query inside another. """ obj = self.query.clone() if obj.low_mark == 0 and obj.high_mark is None and not self.query.distinct_fields: # If there is no slicing in use, then we can safely drop all ordering obj.clear_ordering(True) return obj.get_compiler(connection=self.connection).as_sql() def get_columns(self, with_aliases=False): """ Returns the list of columns to use in the select statement, as well as a list any extra parameters that need to be included. If no columns have been specified, returns all columns relating to fields in the model. If 'with_aliases' is true, any column names that are duplicated (without the table names) are given unique aliases. This is needed in some cases to avoid ambiguity with nested queries. """ qn = self qn2 = self.connection.ops.quote_name result = ['(%s) AS %s' % (col[0], qn2(alias)) for alias, col in six.iteritems(self.query.extra_select)] params = [] aliases = set(self.query.extra_select.keys()) if with_aliases: col_aliases = aliases.copy() else: col_aliases = set() if self.query.select: only_load = self.deferred_to_columns() for col, _ in self.query.select: if isinstance(col, (list, tuple)): alias, column = col table = self.query.alias_map[alias].table_name if table in only_load and column not in only_load[table]: continue r = '%s.%s' % (qn(alias), qn(column)) if with_aliases: if col[1] in col_aliases: c_alias = 'Col%d' % len(col_aliases) result.append('%s AS %s' % (r, c_alias)) aliases.add(c_alias) col_aliases.add(c_alias) else: result.append('%s AS %s' % (r, qn2(col[1]))) aliases.add(r) col_aliases.add(col[1]) else: result.append(r) aliases.add(r) col_aliases.add(col[1]) else: col_sql, col_params = self.compile(col) result.append(col_sql) params.extend(col_params) if hasattr(col, 'alias'): aliases.add(col.alias) col_aliases.add(col.alias) elif self.query.default_cols: cols, new_aliases = self.get_default_columns(with_aliases, col_aliases) result.extend(cols) aliases.update(new_aliases) max_name_length = self.connection.ops.max_name_length() for alias, annotation in self.query.annotation_select.items(): agg_sql, agg_params = self.compile(annotation) if alias is None: result.append(agg_sql) else: result.append('%s AS %s' % (agg_sql, qn(truncate_name(alias, max_name_length)))) params.extend(agg_params) for (table, col), _ in self.query.related_select_cols: r = '%s.%s' % (qn(table), qn(col)) if with_aliases and col in col_aliases: c_alias = 'Col%d' % len(col_aliases) result.append('%s AS %s' % (r, c_alias)) aliases.add(c_alias) col_aliases.add(c_alias) else: result.append(r) aliases.add(r) col_aliases.add(col) self._select_aliases = aliases return result, params def get_default_columns(self, with_aliases=False, col_aliases=None, start_alias=None, opts=None, as_pairs=False, from_parent=None): """ Computes the default columns for selecting every field in the base model. Will sometimes be called to pull in related models (e.g. via select_related), in which case "opts" and "start_alias" will be given to provide a starting point for the traversal. Returns a list of strings, quoted appropriately for use in SQL directly, as well as a set of aliases used in the select statement (if 'as_pairs' is True, returns a list of (alias, col_name) pairs instead of strings as the first component and None as the second component). """ result = [] if opts is None: opts = self.query.get_meta() qn = self qn2 = self.connection.ops.quote_name aliases = set() only_load = self.deferred_to_columns() if not start_alias: start_alias = self.query.get_initial_alias() # The 'seen_models' is used to optimize checking the needed parent # alias for a given field. This also includes None -> start_alias to # be used by local fields. seen_models = {None: start_alias} for field, model in opts.get_concrete_fields_with_model(): if from_parent and model is not None and issubclass(from_parent, model): # Avoid loading data for already loaded parents. continue alias = self.query.join_parent_model(opts, model, start_alias, seen_models) column = field.column for seen_model, seen_alias in seen_models.items(): if seen_model and seen_alias == alias: ancestor_link = seen_model._meta.get_ancestor_link(model) if ancestor_link: column = ancestor_link.column break table = self.query.alias_map[alias].table_name if table in only_load and column not in only_load[table]: continue if as_pairs: result.append((alias, field)) aliases.add(alias) continue if with_aliases and column in col_aliases: c_alias = 'Col%d' % len(col_aliases) result.append('%s.%s AS %s' % (qn(alias), qn2(column), c_alias)) col_aliases.add(c_alias) aliases.add(c_alias) else: r = '%s.%s' % (qn(alias), qn2(column)) result.append(r) aliases.add(r) if with_aliases: col_aliases.add(column) return result, aliases def get_distinct(self): """ Returns a quoted list of fields to use in DISTINCT ON part of the query. Note that this method can alter the tables in the query, and thus it must be called before get_from_clause(). """ qn = self qn2 = self.connection.ops.quote_name result = [] opts = self.query.get_meta() for name in self.query.distinct_fields: parts = name.split(LOOKUP_SEP) _, targets, alias, joins, path, _ = self._setup_joins(parts, opts, None) targets, alias, _ = self.query.trim_joins(targets, joins, path) for target in targets: result.append("%s.%s" % (qn(alias), qn2(target.column))) return result def get_ordering(self): """ Returns a tuple containing a list representing the SQL elements in the "order by" clause, and the list of SQL elements that need to be added to the GROUP BY clause as a result of the ordering. Also sets the ordering_aliases attribute on this instance to a list of extra aliases needed in the select. Determining the ordering SQL can change the tables we need to include, so this should be run *before* get_from_clause(). """ if self.query.extra_order_by: ordering = self.query.extra_order_by elif not self.query.default_ordering: ordering = self.query.order_by else: ordering = (self.query.order_by or self.query.get_meta().ordering or []) qn = self qn2 = self.connection.ops.quote_name distinct = self.query.distinct select_aliases = self._select_aliases result = [] group_by = [] ordering_aliases = [] if self.query.standard_ordering: asc, desc = ORDER_DIR['ASC'] else: asc, desc = ORDER_DIR['DESC'] # It's possible, due to model inheritance, that normal usage might try # to include the same field more than once in the ordering. We track # the table/column pairs we use and discard any after the first use. processed_pairs = set() params = [] ordering_params = [] # For plain DISTINCT queries any ORDER BY clause must appear # in SELECT clause. # http://www.postgresql.org/message-id/27009.1171559417@sss.pgh.pa.us must_append_to_select = distinct and not self.query.distinct_fields for pos, field in enumerate(ordering): if field == '?': result.append(self.connection.ops.random_function_sql()) continue if isinstance(field, int): if field < 0: order = desc field = -field else: order = asc result.append('%s %s' % (field, order)) group_by.append((str(field), [])) continue col, order = get_order_dir(field, asc) if col in self.query.annotation_select: result.append('%s %s' % (qn(col), order)) continue if '.' in field: # This came in through an extra(order_by=...) addition. Pass it # on verbatim. table, col = col.split('.', 1) if (table, col) not in processed_pairs: elt = '%s.%s' % (qn(table), col) processed_pairs.add((table, col)) if not must_append_to_select or elt in select_aliases: result.append('%s %s' % (elt, order)) group_by.append((elt, [])) elif not self.query._extra or get_order_dir(field)[0] not in self.query._extra: # 'col' is of the form 'field' or 'field1__field2' or # '-field1__field2__field', etc. for table, cols, order in self.find_ordering_name(field, self.query.get_meta(), default_order=asc): for col in cols: if (table, col) not in processed_pairs: elt = '%s.%s' % (qn(table), qn2(col)) processed_pairs.add((table, col)) if must_append_to_select and elt not in select_aliases: ordering_aliases.append(elt) result.append('%s %s' % (elt, order)) group_by.append((elt, [])) else: elt = qn2(col) if col not in self.query.extra_select: if must_append_to_select: sql = "(%s) AS %s" % (self.query.extra[col][0], elt) ordering_aliases.append(sql) ordering_params.extend(self.query.extra[col][1]) result.append('%s %s' % (elt, order)) else: result.append("(%s) %s" % (self.query.extra[col][0], order)) params.extend(self.query.extra[col][1]) else: result.append('%s %s' % (elt, order)) group_by.append(self.query.extra[col]) self.ordering_aliases = ordering_aliases self.ordering_params = ordering_params return result, params, group_by def find_ordering_name(self, name, opts, alias=None, default_order='ASC', already_seen=None): """ Returns the table alias (the name might be ambiguous, the alias will not be) and column name for ordering by the given 'name' parameter. The 'name' is of the form 'field1__field2__...__fieldN'. """ name, order = get_order_dir(name, default_order) pieces = name.split(LOOKUP_SEP) field, targets, alias, joins, path, opts = self._setup_joins(pieces, opts, alias) # If we get to this point and the field is a relation to another model, # append the default ordering for that model unless the attribute name # of the field is specified. if field.rel and path and opts.ordering and name != field.attname: # Firstly, avoid infinite loops. if not already_seen: already_seen = set() join_tuple = tuple(self.query.alias_map[j].table_name for j in joins) if join_tuple in already_seen: raise FieldError('Infinite loop caused by ordering.') already_seen.add(join_tuple) results = [] for item in opts.ordering: results.extend(self.find_ordering_name(item, opts, alias, order, already_seen)) return results targets, alias, _ = self.query.trim_joins(targets, joins, path) return [(alias, [t.column for t in targets], order)] def _setup_joins(self, pieces, opts, alias): """ A helper method for get_ordering and get_distinct. Note that get_ordering and get_distinct must produce same target columns on same input, as the prefixes of get_ordering and get_distinct must match. Executing SQL where this is not true is an error. """ if not alias: alias = self.query.get_initial_alias() field, targets, opts, joins, path = self.query.setup_joins( pieces, opts, alias) alias = joins[-1] return field, targets, alias, joins, path, opts def get_from_clause(self): """ Returns a list of strings that are joined together to go after the "FROM" part of the query, as well as a list any extra parameters that need to be included. Sub-classes, can override this to create a from-clause via a "select". This should only be called after any SQL construction methods that might change the tables we need. This means the select columns, ordering and distinct must be done first. """ result = [] qn = self qn2 = self.connection.ops.quote_name first = True from_params = [] for alias in self.query.tables: if not self.query.alias_refcount[alias]: continue try: name, alias, join_type, lhs, join_cols, _, join_field = self.query.alias_map[alias] except KeyError: # Extra tables can end up in self.tables, but not in the # alias_map if they aren't in a join. That's OK. We skip them. continue alias_str = '' if alias == name else (' %s' % alias) if join_type and not first: extra_cond = join_field.get_extra_restriction( self.query.where_class, alias, lhs) if extra_cond: extra_sql, extra_params = self.compile(extra_cond) extra_sql = 'AND (%s)' % extra_sql from_params.extend(extra_params) else: extra_sql = "" result.append('%s %s%s ON (' % (join_type, qn(name), alias_str)) for index, (lhs_col, rhs_col) in enumerate(join_cols): if index != 0: result.append(' AND ') result.append('%s.%s = %s.%s' % (qn(lhs), qn2(lhs_col), qn(alias), qn2(rhs_col))) result.append('%s)' % extra_sql) else: connector = '' if first else ', ' result.append('%s%s%s' % (connector, qn(name), alias_str)) first = False for t in self.query.extra_tables: alias, _ = self.query.table_alias(t) # Only add the alias if it's not already present (the table_alias() # calls increments the refcount, so an alias refcount of one means # this is the only reference. if alias not in self.query.alias_map or self.query.alias_refcount[alias] == 1: connector = '' if first else ', ' result.append('%s%s' % (connector, qn(alias))) first = False return result, from_params def get_grouping(self, having_group_by, ordering_group_by): """ Returns a tuple representing the SQL elements in the "group by" clause. """ qn = self result, params = [], [] if self.query.group_by is not None: select_cols = self.query.select + self.query.related_select_cols # Just the column, not the fields. select_cols = [s[0] for s in select_cols] if (len(self.query.get_meta().concrete_fields) == len(self.query.select) and self.connection.features.allows_group_by_pk): self.query.group_by = [ (self.query.get_initial_alias(), self.query.get_meta().pk.column) ] select_cols = [] seen = set() cols = self.query.group_by + having_group_by + select_cols for col in cols: col_params = () if isinstance(col, (list, tuple)): sql = '%s.%s' % (qn(col[0]), qn(col[1])) elif hasattr(col, 'as_sql'): self.compile(col) else: sql = '(%s)' % str(col) if sql not in seen: result.append(sql) params.extend(col_params) seen.add(sql) # Still, we need to add all stuff in ordering (except if the backend can # group by just by PK). if ordering_group_by and not self.connection.features.allows_group_by_pk: for order, order_params in ordering_group_by: # Even if we have seen the same SQL string, it might have # different params, so, we add same SQL in "has params" case. if order not in seen or order_params: result.append(order) params.extend(order_params) seen.add(order) # Unconditionally add the extra_select items. for extra_select, extra_params in self.query.extra_select.values(): sql = '(%s)' % str(extra_select) result.append(sql) params.extend(extra_params) return result, params def fill_related_selections(self, opts=None, root_alias=None, cur_depth=1, requested=None, restricted=None): """ Fill in the information needed for a select_related query. The current depth is measured as the number of connections away from the root model (for example, cur_depth=1 means we are looking at models with direct connections to the root model). """ if not restricted and self.query.max_depth and cur_depth > self.query.max_depth: # We've recursed far enough; bail out. return if not opts: opts = self.query.get_meta() root_alias = self.query.get_initial_alias() self.query.related_select_cols = [] only_load = self.query.get_loaded_field_names() # Setup for the case when only particular related fields should be # included in the related selection. if requested is None: if isinstance(self.query.select_related, dict): requested = self.query.select_related restricted = True else: restricted = False for f, model in opts.get_fields_with_model(): # The get_fields_with_model() returns None for fields that live # in the field's local model. So, for those fields we want to use # the f.model - that is the field's local model. field_model = model or f.model if not select_related_descend(f, restricted, requested, only_load.get(field_model)): continue _, _, _, joins, _ = self.query.setup_joins( [f.name], opts, root_alias) alias = joins[-1] columns, _ = self.get_default_columns(start_alias=alias, opts=f.rel.to._meta, as_pairs=True) self.query.related_select_cols.extend( SelectInfo((col[0], col[1].column), col[1]) for col in columns) if restricted: next = requested.get(f.name, {}) else: next = False self.fill_related_selections(f.rel.to._meta, alias, cur_depth + 1, next, restricted) if restricted: related_fields = [ (o.field, o.model) for o in opts.get_all_related_objects() if o.field.unique ] for f, model in related_fields: if not select_related_descend(f, restricted, requested, only_load.get(model), reverse=True): continue _, _, _, joins, _ = self.query.setup_joins( [f.related_query_name()], opts, root_alias) alias = joins[-1] from_parent = (opts.model if issubclass(model, opts.model) else None) columns, _ = self.get_default_columns(start_alias=alias, opts=model._meta, as_pairs=True, from_parent=from_parent) self.query.related_select_cols.extend( SelectInfo((col[0], col[1].column), col[1]) for col in columns) next = requested.get(f.related_query_name(), {}) self.fill_related_selections(model._meta, alias, cur_depth + 1, next, restricted) def deferred_to_columns(self): """ Converts the self.deferred_loading data structure to mapping of table names to sets of column names which are to be loaded. Returns the dictionary. """ columns = {} self.query.deferred_to_data(columns, self.query.deferred_to_columns_cb) return columns def get_converters(self, fields): converters = {} index_extra_select = len(self.query.extra_select) for i, field in enumerate(fields): if field: backend_converters = self.connection.ops.get_db_converters(field.get_internal_type()) field_converters = field.get_db_converters(self.connection) if backend_converters or field_converters: converters[index_extra_select + i] = (backend_converters, field_converters, field) return converters def apply_converters(self, row, converters): row = list(row) for pos, (backend_converters, field_converters, field) in converters.items(): value = row[pos] for converter in backend_converters: value = converter(value, field) for converter in field_converters: value = converter(value, self.connection) row[pos] = value return tuple(row) def results_iter(self): """ Returns an iterator over the results from executing this query. """ fields = None converters = None has_annotation_select = bool(self.query.annotation_select) for rows in self.execute_sql(MULTI): for row in rows: if fields is None: # We only set this up here because # related_select_cols isn't populated until # execute_sql() has been called. # If the field was deferred, exclude it from being passed # into `get_converters` because it wasn't selected. only_load = self.deferred_to_columns() # This code duplicates the logic for the order of fields # found in get_columns(). It would be nice to clean this up. if self.query.select: fields = [f.field for f in self.query.select] elif self.query.default_cols: fields = self.query.get_meta().concrete_fields else: fields = [] if only_load: # strip deferred fields fields = [ f for f in fields if f.model._meta.db_table not in only_load or f.column in only_load[f.model._meta.db_table] ] # annotations come before the related cols if has_annotation_select: # extra is always at the start of the field list prepended_cols = len(self.query.extra_select) annotation_start = len(fields) + prepended_cols fields = fields + [ anno.output_field for alias, anno in self.query.annotation_select.items()] annotation_end = len(fields) + prepended_cols # add related fields fields = fields + [ # strip deferred f.field for f in self.query.related_select_cols if f.field.model._meta.db_table not in only_load or f.field.column in only_load[f.field.model._meta.db_table] ] converters = self.get_converters(fields) if has_annotation_select: for (alias, annotation), position in zip( self.query.annotation_select.items(), range(annotation_start, annotation_end + 1)): if position in converters: # annotation conversions always run first converters[position][1].insert(0, annotation.convert_value) else: converters[position] = ([], [annotation.convert_value], annotation.output_field) if converters: row = self.apply_converters(row, converters) yield row def has_results(self): """ Backends (e.g. NoSQL) can override this in order to use optimized versions of "query has any results." """ # This is always executed on a query clone, so we can modify self.query self.query.add_extra({'a': 1}, None, None, None, None, None) self.query.set_extra_mask(['a']) return bool(self.execute_sql(SINGLE)) def execute_sql(self, result_type=MULTI): """ Run the query against the database and returns the result(s). The return value is a single data item if result_type is SINGLE, or an iterator over the results if the result_type is MULTI. result_type is either MULTI (use fetchmany() to retrieve all rows), SINGLE (only retrieve a single row), or None. In this last case, the cursor is returned if any query is executed, since it's used by subclasses such as InsertQuery). It's possible, however, that no query is needed, as the filters describe an empty set. In that case, None is returned, to avoid any unnecessary database interaction. """ if not result_type: result_type = NO_RESULTS try: sql, params = self.as_sql() if not sql: raise EmptyResultSet except EmptyResultSet: if result_type == MULTI: return iter([]) else: return cursor = self.connection.cursor() try: cursor.execute(sql, params) except Exception: cursor.close() raise if result_type == CURSOR: # Caller didn't specify a result_type, so just give them back the # cursor to process (and close). return cursor if result_type == SINGLE: try: if self.ordering_aliases: return cursor.fetchone()[:-len(self.ordering_aliases)] return cursor.fetchone() finally: # done with the cursor cursor.close() if result_type == NO_RESULTS: cursor.close() return # The MULTI case. if self.ordering_aliases: result = order_modified_iter(cursor, len(self.ordering_aliases), self.connection.features.empty_fetchmany_value) else: result = cursor_iter(cursor, self.connection.features.empty_fetchmany_value) if not self.connection.features.can_use_chunked_reads: try: # If we are using non-chunked reads, we return the same data # structure as normally, but ensure it is all read into memory # before going any further. return list(result) finally: # done with the cursor cursor.close() return result def as_subquery_condition(self, alias, columns, qn): inner_qn = self qn2 = self.connection.ops.quote_name if len(columns) == 1: sql, params = self.as_sql() return '%s.%s IN (%s)' % (qn(alias), qn2(columns[0]), sql), params for index, select_col in enumerate(self.query.select): lhs = '%s.%s' % (inner_qn(select_col.col[0]), qn2(select_col.col[1])) rhs = '%s.%s' % (qn(alias), qn2(columns[index])) self.query.where.add( QueryWrapper('%s = %s' % (lhs, rhs), []), 'AND') sql, params = self.as_sql() return 'EXISTS (%s)' % sql, params class SQLInsertCompiler(SQLCompiler): def __init__(self, *args, **kwargs): self.return_id = False super(SQLInsertCompiler, self).__init__(*args, **kwargs) def placeholder(self, field, val): if field is None: # A field value of None means the value is raw. return val elif hasattr(field, 'get_placeholder'): # Some fields (e.g. geo fields) need special munging before # they can be inserted. return field.get_placeholder(val, self, self.connection) else: # Return the common case for the placeholder return '%s' def as_sql(self): # We don't need quote_name_unless_alias() here, since these are all # going to be column names (so we can avoid the extra overhead). qn = self.connection.ops.quote_name opts = self.query.get_meta() result = ['INSERT INTO %s' % qn(opts.db_table)] has_fields = bool(self.query.fields) fields = self.query.fields if has_fields else [opts.pk] result.append('(%s)' % ', '.join(qn(f.column) for f in fields)) if has_fields: params = values = [ [ f.get_db_prep_save( getattr(obj, f.attname) if self.query.raw else f.pre_save(obj, True), connection=self.connection ) for f in fields ] for obj in self.query.objs ] else: values = [[self.connection.ops.pk_default_value()] for obj in self.query.objs] params = [[]] fields = [None] can_bulk = (not any(hasattr(field, "get_placeholder") for field in fields) and not self.return_id and self.connection.features.has_bulk_insert) if can_bulk: placeholders = [["%s"] * len(fields)] else: placeholders = [ [self.placeholder(field, v) for field, v in zip(fields, val)] for val in values ] # Oracle Spatial needs to remove some values due to #10888 params = self.connection.ops.modify_insert_params(placeholders, params) if self.return_id and self.connection.features.can_return_id_from_insert: params = params[0] col = "%s.%s" % (qn(opts.db_table), qn(opts.pk.column)) result.append("VALUES (%s)" % ", ".join(placeholders[0])) r_fmt, r_params = self.connection.ops.return_insert_id() # Skip empty r_fmt to allow subclasses to customize behavior for # 3rd party backends. Refs #19096. if r_fmt: result.append(r_fmt % col) params += r_params return [(" ".join(result), tuple(params))] if can_bulk: result.append(self.connection.ops.bulk_insert_sql(fields, len(values))) return [(" ".join(result), tuple(v for val in values for v in val))] else: return [ (" ".join(result + ["VALUES (%s)" % ", ".join(p)]), vals) for p, vals in zip(placeholders, params) ] def execute_sql(self, return_id=False): assert not (return_id and len(self.query.objs) != 1) self.return_id = return_id with self.connection.cursor() as cursor: for sql, params in self.as_sql(): cursor.execute(sql, params) if not (return_id and cursor): return if self.connection.features.can_return_id_from_insert: return self.connection.ops.fetch_returned_insert_id(cursor) return self.connection.ops.last_insert_id(cursor, self.query.get_meta().db_table, self.query.get_meta().pk.column) class SQLDeleteCompiler(SQLCompiler): def as_sql(self): """ Creates the SQL for this query. Returns the SQL string and list of parameters. """ assert len(self.query.tables) == 1, \ "Can only delete from one table at a time." qn = self result = ['DELETE FROM %s' % qn(self.query.tables[0])] where, params = self.compile(self.query.where) if where: result.append('WHERE %s' % where) return ' '.join(result), tuple(params) class SQLUpdateCompiler(SQLCompiler): def as_sql(self): """ Creates the SQL for this query. Returns the SQL string and list of parameters. """ self.pre_sql_setup() if not self.query.values: return '', () table = self.query.tables[0] qn = self result = ['UPDATE %s' % qn(table)] result.append('SET') values, update_params = [], [] for field, model, val in self.query.values: if hasattr(val, 'resolve_expression'): val = val.resolve_expression(self.query, allow_joins=False) elif hasattr(val, 'prepare_database_save'): if field.rel: val = val.prepare_database_save(field) else: raise TypeError("Database is trying to update a relational field " "of type %s with a value of type %s. Make sure " "you are setting the correct relations" % (field.__class__.__name__, val.__class__.__name__)) else: val = field.get_db_prep_save(val, connection=self.connection) # Getting the placeholder for the field. if hasattr(field, 'get_placeholder'): placeholder = field.get_placeholder(val, self, self.connection) else: placeholder = '%s' name = field.column if hasattr(val, 'as_sql'): sql, params = self.compile(val) values.append('%s = %s' % (qn(name), sql)) update_params.extend(params) elif val is not None: values.append('%s = %s' % (qn(name), placeholder)) update_params.append(val) else: values.append('%s = NULL' % qn(name)) if not values: return '', () result.append(', '.join(values)) where, params = self.compile(self.query.where) if where: result.append('WHERE %s' % where) return ' '.join(result), tuple(update_params + params) def execute_sql(self, result_type): """ Execute the specified update. Returns the number of rows affected by the primary update query. The "primary update query" is the first non-empty query that is executed. Row counts for any subsequent, related queries are not available. """ cursor = super(SQLUpdateCompiler, self).execute_sql(result_type) try: rows = cursor.rowcount if cursor else 0 is_empty = cursor is None finally: if cursor: cursor.close() for query in self.query.get_related_updates(): aux_rows = query.get_compiler(self.using).execute_sql(result_type) if is_empty and aux_rows: rows = aux_rows is_empty = False return rows def pre_sql_setup(self): """ If the update depends on results from other tables, we need to do some munging of the "where" conditions to match the format required for (portable) SQL updates. That is done here. Further, if we are going to be running multiple updates, we pull out the id values to update at this point so that they don't change as a result of the progressive updates. """ self.query.select_related = False self.query.clear_ordering(True) super(SQLUpdateCompiler, self).pre_sql_setup() count = self.query.count_active_tables() if not self.query.related_updates and count == 1: return # We need to use a sub-select in the where clause to filter on things # from other tables. query = self.query.clone(klass=Query) query._extra = {} query.select = [] query.add_fields([query.get_meta().pk.name]) # Recheck the count - it is possible that fiddling with the select # fields above removes tables from the query. Refs #18304. count = query.count_active_tables() if not self.query.related_updates and count == 1: return must_pre_select = count > 1 and not self.connection.features.update_can_self_select # Now we adjust the current query: reset the where clause and get rid # of all the tables we don't need (since they're in the sub-select). self.query.where = self.query.where_class() if self.query.related_updates or must_pre_select: # Either we're using the idents in multiple update queries (so # don't want them to change), or the db backend doesn't support # selecting from the updating table (e.g. MySQL). idents = [] for rows in query.get_compiler(self.using).execute_sql(MULTI): idents.extend(r[0] for r in rows) self.query.add_filter(('pk__in', idents)) self.query.related_ids = idents else: # The fast path. Filters and updates in one query. self.query.add_filter(('pk__in', query)) for alias in self.query.tables[1:]: self.query.alias_refcount[alias] = 0 class SQLAggregateCompiler(SQLCompiler): def as_sql(self, qn=None): """ Creates the SQL for this query. Returns the SQL string and list of parameters. """ if qn is None: qn = self sql, params = [], [] for annotation in self.query.annotation_select.values(): agg_sql, agg_params = self.compile(annotation) sql.append(agg_sql) params.extend(agg_params) sql = ', '.join(sql) params = tuple(params) sql = 'SELECT %s FROM (%s) subquery' % (sql, self.query.subquery) params = params + self.query.sub_params return sql, params class SQLDateCompiler(SQLCompiler): def results_iter(self): """ Returns an iterator over the results from executing this query. """ from django.db.models.fields import DateField converters = self.get_converters([DateField()]) offset = len(self.query.extra_select) for rows in self.execute_sql(MULTI): for row in rows: date = self.apply_converters(row, converters)[offset] if isinstance(date, datetime.datetime): date = date.date() yield date class SQLDateTimeCompiler(SQLCompiler): def results_iter(self): """ Returns an iterator over the results from executing this query. """ from django.db.models.fields import DateTimeField converters = self.get_converters([DateTimeField()]) offset = len(self.query.extra_select) for rows in self.execute_sql(MULTI): for row in rows: datetime = self.apply_converters(row, converters)[offset] # Datetimes are artificially returned in UTC on databases that # don't support time zone. Restore the zone used in the query. if settings.USE_TZ: if datetime is None: raise ValueError("Database returned an invalid value " "in QuerySet.datetimes(). Are time zone " "definitions for your database and pytz installed?") datetime = datetime.replace(tzinfo=None) datetime = timezone.make_aware(datetime, self.query.tzinfo) yield datetime def cursor_iter(cursor, sentinel): """ Yields blocks of rows from a cursor and ensures the cursor is closed when done. """ try: for rows in iter((lambda: cursor.fetchmany(GET_ITERATOR_CHUNK_SIZE)), sentinel): yield rows finally: cursor.close() def order_modified_iter(cursor, trim, sentinel): """ Yields blocks of rows from a cursor. We use this iterator in the special case when extra output columns have been added to support ordering requirements. We must trim those extra columns before anything else can use the results, since they're only needed to make the SQL valid. """ try: for rows in iter((lambda: cursor.fetchmany(GET_ITERATOR_CHUNK_SIZE)), sentinel): yield [r[:-trim] for r in rows] finally: cursor.close()
import subprocess from typing import Any, Dict, List from zulint.printer import ENDC, GREEN from .template_parser import is_django_block_tag, tokenize def pretty_print_html(html: str, num_spaces: int = 4) -> str: # We use 1-based indexing for both rows and columns. tokens = tokenize(html) lines = html.split("\n") # We will keep a stack of "start" tags so that we know # when HTML ranges end. Note that some start tags won't # be blocks from an indentation standpoint. stack: List[Dict[str, Any]] = [] # Seed our stack with a pseudo entry to make depth calculations # easier. info: Dict[str, Any] = dict( block=False, depth=-1, line=-1, token_kind="html_start", tag="html", extra_indent=0, ignore_lines=[], ) stack.append(info) # Our main job is to figure out offsets that we use to nudge lines # over by. offsets: Dict[int, int] = {} # Loop through our start/end tokens, and calculate offsets. As # we proceed, we will push/pop info dictionaries on/off a stack. for token in tokens: if ( token.kind in ( "html_start", "handlebars_start", "handlebars_singleton", "html_singleton", "django_start", "jinja2_whitespace_stripped_type2_start", "jinja2_whitespace_stripped_start", ) and stack[-1]["tag"] != "pre" ): # An HTML start tag should only cause a new indent if we # are on a new line. if token.tag not in ("extends", "include", "else", "elif") and ( is_django_block_tag(token.tag) or token.kind != "django_start" ): is_block = token.line > stack[-1]["line"] if is_block: if ( ( token.kind == "handlebars_start" and stack[-1]["token_kind"] == "handlebars_start" ) or ( token.kind in { "django_start", "jinja2_whitespace_stripped_type2_start", "jinja2_whitespace_stripped_start", } and stack[-1]["token_kind"] in { "django_start", "jinja2_whitespace_stripped_type2_start", "jinja2_whitespace_stripped_start", } ) ) and not stack[-1]["indenting"]: info = stack.pop() info["depth"] = info["depth"] + 1 info["indenting"] = True info["adjust_offset_until"] = token.line stack.append(info) new_depth = stack[-1]["depth"] + 1 extra_indent = stack[-1]["extra_indent"] line = lines[token.line - 1] adjustment = len(line) - len(line.lstrip()) + 1 offset = (1 + extra_indent + new_depth * num_spaces) - adjustment info = dict( block=True, depth=new_depth, actual_depth=new_depth, line=token.line, tag=token.tag, token_kind=token.kind, line_span=token.line_span, offset=offset, extra_indent=token.col - adjustment + extra_indent, extra_indent_prev=extra_indent, adjustment=adjustment, indenting=True, adjust_offset_until=token.line, ignore_lines=[], ) if token.kind in ("handlebars_start", "django_start"): info.update(dict(depth=new_depth - 1, indenting=False)) else: info = dict( block=False, depth=stack[-1]["depth"], actual_depth=stack[-1]["depth"], line=token.line, tag=token.tag, token_kind=token.kind, extra_indent=stack[-1]["extra_indent"], ignore_lines=[], ) stack.append(info) elif ( token.kind in ( "html_end", "handlebars_end", "html_singleton_end", "django_end", "handlebars_singleton_end", "jinja2_whitespace_stripped_end", ) and (stack[-1]["tag"] != "pre" or token.tag == "pre") ): info = stack.pop() if info["block"]: # We are at the end of an indentation block. We # assume the whole block was formatted ok before, just # possibly at an indentation that we don't like, so we # nudge over all lines in the block by the same offset. start_line = info["line"] end_line = token.line if token.tag == "pre": offsets[start_line] = 0 offsets[end_line] = 0 stack[-1]["ignore_lines"].append(start_line) stack[-1]["ignore_lines"].append(end_line) else: offsets[start_line] = info["offset"] line = lines[token.line - 1] adjustment = len(line) - len(line.lstrip()) + 1 if adjustment == token.col and token.kind != "html_singleton_end": offsets[end_line] = ( info["offset"] + info["adjustment"] - adjustment + info["extra_indent"] - info["extra_indent_prev"] ) elif start_line + info["line_span"] - 1 == end_line and info["line_span"] > 1: offsets[end_line] = ( 1 + info["extra_indent"] + (info["depth"] + 1) * num_spaces ) - adjustment # We would like singleton tags and tags which spread over # multiple lines to have 2 space indentation. offsets[end_line] -= 2 elif token.line != info["line"]: offsets[end_line] = info["offset"] if token.tag != "pre" and token.tag != "script": for line_num in range(start_line + 1, end_line): # Be careful not to override offsets that happened # deeper in the HTML within our block. if line_num not in offsets: line = lines[line_num - 1] new_depth = info["depth"] + 1 if ( line.lstrip().startswith("{{else}}") or line.lstrip().startswith("{% else %}") or line.lstrip().startswith("{% elif") ): new_depth = info["actual_depth"] extra_indent = info["extra_indent"] adjustment = len(line) - len(line.lstrip()) + 1 offset = (1 + extra_indent + new_depth * num_spaces) - adjustment if line_num <= start_line + info["line_span"] - 1: # We would like singleton tags and tags which spread over # multiple lines to have 2 space indentation. offset -= 2 offsets[line_num] = offset elif ( token.kind in ("handlebars_end", "django_end") and info["indenting"] and line_num < info["adjust_offset_until"] and line_num not in info["ignore_lines"] ): offsets[line_num] += num_spaces elif token.tag != "pre": for line_num in range(start_line + 1, end_line): if line_num not in offsets: offsets[line_num] = info["offset"] else: for line_num in range(start_line + 1, end_line): if line_num not in offsets: offsets[line_num] = 0 stack[-1]["ignore_lines"].append(line_num) # Now that we have all of our offsets calculated, we can just # join all our lines together, fixing up offsets as needed. formatted_lines = [] for i, line in enumerate(html.split("\n")): row = i + 1 offset = offsets.get(row, 0) pretty_line = line if line.strip() == "": pretty_line = "" else: if offset > 0: pretty_line = (" " * offset) + pretty_line elif offset < 0: pretty_line = pretty_line[-1 * offset :] assert line.strip() == pretty_line.strip() formatted_lines.append(pretty_line) return "\n".join(formatted_lines) def validate_indent_html(fn: str, fix: bool) -> int: with open(fn) as f: html = f.read() phtml = pretty_print_html(html) if not html.split("\n") == phtml.split("\n"): if fix: print(GREEN + "Automatically fixing problems..." + ENDC) with open(fn, "w") as f: f.write(phtml) # Since we successfully fixed the issues, we exit with status 0 return 0 print( "Invalid indentation detected in file: " f"{fn}\nDiff for the file against expected indented file:", flush=True, ) subprocess.run(["diff", fn, "-"], input=phtml, universal_newlines=True) print() print("This problem can be fixed with the `--fix` option.") return 0 return 1
from jsonrpc import ServiceProxy import sys import string # ===== BEGIN USER SETTINGS ===== # if you do not set these you will be prompted for a password for every command rpcuser = "" rpcpass = "" # ====== END USER SETTINGS ====== if rpcpass == "": access = ServiceProxy("http://127.0.0.1:14101") else: access = ServiceProxy("http://"+rpcuser+":"+rpcpass+"@127.0.0.1:14101") cmd = sys.argv[1].lower() if cmd == "backupwallet": try: path = raw_input("Enter destination path/filename: ") print access.backupwallet(path) except: print "\n---An error occurred---\n" elif cmd == "getaccount": try: addr = raw_input("Enter a Slendermancoin address: ") print access.getaccount(addr) except: print "\n---An error occurred---\n" elif cmd == "getaccountaddress": try: acct = raw_input("Enter an account name: ") print access.getaccountaddress(acct) except: print "\n---An error occurred---\n" elif cmd == "getaddressesbyaccount": try: acct = raw_input("Enter an account name: ") print access.getaddressesbyaccount(acct) except: print "\n---An error occurred---\n" elif cmd == "getbalance": try: acct = raw_input("Enter an account (optional): ") mc = raw_input("Minimum confirmations (optional): ") try: print access.getbalance(acct, mc) except: print access.getbalance() except: print "\n---An error occurred---\n" elif cmd == "getblockbycount": try: height = raw_input("Height: ") print access.getblockbycount(height) except: print "\n---An error occurred---\n" elif cmd == "getblockcount": try: print access.getblockcount() except: print "\n---An error occurred---\n" elif cmd == "getblocknumber": try: print access.getblocknumber() except: print "\n---An error occurred---\n" elif cmd == "getconnectioncount": try: print access.getconnectioncount() except: print "\n---An error occurred---\n" elif cmd == "getdifficulty": try: print access.getdifficulty() except: print "\n---An error occurred---\n" elif cmd == "getgenerate": try: print access.getgenerate() except: print "\n---An error occurred---\n" elif cmd == "gethashespersec": try: print access.gethashespersec() except: print "\n---An error occurred---\n" elif cmd == "getinfo": try: print access.getinfo() except: print "\n---An error occurred---\n" elif cmd == "getnewaddress": try: acct = raw_input("Enter an account name: ") try: print access.getnewaddress(acct) except: print access.getnewaddress() except: print "\n---An error occurred---\n" elif cmd == "getreceivedbyaccount": try: acct = raw_input("Enter an account (optional): ") mc = raw_input("Minimum confirmations (optional): ") try: print access.getreceivedbyaccount(acct, mc) except: print access.getreceivedbyaccount() except: print "\n---An error occurred---\n" elif cmd == "getreceivedbyaddress": try: addr = raw_input("Enter a Slendermancoin address (optional): ") mc = raw_input("Minimum confirmations (optional): ") try: print access.getreceivedbyaddress(addr, mc) except: print access.getreceivedbyaddress() except: print "\n---An error occurred---\n" elif cmd == "gettransaction": try: txid = raw_input("Enter a transaction ID: ") print access.gettransaction(txid) except: print "\n---An error occurred---\n" elif cmd == "getwork": try: data = raw_input("Data (optional): ") try: print access.gettransaction(data) except: print access.gettransaction() except: print "\n---An error occurred---\n" elif cmd == "help": try: cmd = raw_input("Command (optional): ") try: print access.help(cmd) except: print access.help() except: print "\n---An error occurred---\n" elif cmd == "listaccounts": try: mc = raw_input("Minimum confirmations (optional): ") try: print access.listaccounts(mc) except: print access.listaccounts() except: print "\n---An error occurred---\n" elif cmd == "listreceivedbyaccount": try: mc = raw_input("Minimum confirmations (optional): ") incemp = raw_input("Include empty? (true/false, optional): ") try: print access.listreceivedbyaccount(mc, incemp) except: print access.listreceivedbyaccount() except: print "\n---An error occurred---\n" elif cmd == "listreceivedbyaddress": try: mc = raw_input("Minimum confirmations (optional): ") incemp = raw_input("Include empty? (true/false, optional): ") try: print access.listreceivedbyaddress(mc, incemp) except: print access.listreceivedbyaddress() except: print "\n---An error occurred---\n" elif cmd == "listtransactions": try: acct = raw_input("Account (optional): ") count = raw_input("Number of transactions (optional): ") frm = raw_input("Skip (optional):") try: print access.listtransactions(acct, count, frm) except: print access.listtransactions() except: print "\n---An error occurred---\n" elif cmd == "move": try: frm = raw_input("From: ") to = raw_input("To: ") amt = raw_input("Amount:") mc = raw_input("Minimum confirmations (optional): ") comment = raw_input("Comment (optional): ") try: print access.move(frm, to, amt, mc, comment) except: print access.move(frm, to, amt) except: print "\n---An error occurred---\n" elif cmd == "sendfrom": try: frm = raw_input("From: ") to = raw_input("To: ") amt = raw_input("Amount:") mc = raw_input("Minimum confirmations (optional): ") comment = raw_input("Comment (optional): ") commentto = raw_input("Comment-to (optional): ") try: print access.sendfrom(frm, to, amt, mc, comment, commentto) except: print access.sendfrom(frm, to, amt) except: print "\n---An error occurred---\n" elif cmd == "sendmany": try: frm = raw_input("From: ") to = raw_input("To (in format address1:amount1,address2:amount2,...): ") mc = raw_input("Minimum confirmations (optional): ") comment = raw_input("Comment (optional): ") try: print access.sendmany(frm,to,mc,comment) except: print access.sendmany(frm,to) except: print "\n---An error occurred---\n" elif cmd == "sendtoaddress": try: to = raw_input("To (in format address1:amount1,address2:amount2,...): ") amt = raw_input("Amount:") comment = raw_input("Comment (optional): ") commentto = raw_input("Comment-to (optional): ") try: print access.sendtoaddress(to,amt,comment,commentto) except: print access.sendtoaddress(to,amt) except: print "\n---An error occurred---\n" elif cmd == "setaccount": try: addr = raw_input("Address: ") acct = raw_input("Account:") print access.setaccount(addr,acct) except: print "\n---An error occurred---\n" elif cmd == "setgenerate": try: gen= raw_input("Generate? (true/false): ") cpus = raw_input("Max processors/cores (-1 for unlimited, optional):") try: print access.setgenerate(gen, cpus) except: print access.setgenerate(gen) except: print "\n---An error occurred---\n" elif cmd == "settxfee": try: amt = raw_input("Amount:") print access.settxfee(amt) except: print "\n---An error occurred---\n" elif cmd == "stop": try: print access.stop() except: print "\n---An error occurred---\n" elif cmd == "validateaddress": try: addr = raw_input("Address: ") print access.validateaddress(addr) except: print "\n---An error occurred---\n" elif cmd == "walletpassphrase": try: pwd = raw_input("Enter wallet passphrase: ") access.walletpassphrase(pwd, 60) print "\n---Wallet unlocked---\n" except: print "\n---An error occurred---\n" elif cmd == "walletpassphrasechange": try: pwd = raw_input("Enter old wallet passphrase: ") pwd2 = raw_input("Enter new wallet passphrase: ") access.walletpassphrasechange(pwd, pwd2) print print "\n---Passphrase changed---\n" except: print print "\n---An error occurred---\n" print else: print "Command not found or not supported"
#!/usr/bin/env python # -*- coding: utf-8 -*- # Copyright 2013 Mirantis, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import __main__ import argparse import code import os import sys def add_config_parameter(parser): parser.add_argument( '-c', '--config', dest='config_file', action='store', type=str, help='custom config file', default=None ) def load_run_parsers(subparsers): run_parser = subparsers.add_parser( 'run', help='run application locally' ) run_parser.add_argument( '-p', '--port', dest='port', action='store', type=str, help='application port', default='8000' ) run_parser.add_argument( '-a', '--address', dest='address', action='store', type=str, help='application address', default='0.0.0.0' ) run_parser.add_argument( '--fake-tasks', action='store_true', help='fake tasks' ) run_parser.add_argument( '--fake-tasks-amqp', action='store_true', help='fake tasks with real AMQP' ) run_parser.add_argument( '--keepalive', action='store_true', help='run keep alive thread' ) add_config_parameter(run_parser) run_parser.add_argument( '--fake-tasks-tick-count', action='store', type=int, help='Fake tasks tick count' ) run_parser.add_argument( '--fake-tasks-tick-interval', action='store', type=int, help='Fake tasks tick interval in seconds' ) run_parser.add_argument( '--authentication-method', action='store', type=str, help='Choose authentication type', choices=['none', 'fake', 'keystone'], ) def load_db_parsers(subparsers): subparsers.add_parser( 'syncdb', help='sync application database' ) subparsers.add_parser( 'dropdb', help='drop application database' ) # fixtures loaddata_parser = subparsers.add_parser( 'loaddata', help='load data from fixture' ) loaddata_parser.add_argument( 'fixture', action='store', help='json fixture to load' ) dumpdata_parser = subparsers.add_parser( 'dumpdata', help='dump models as fixture' ) dumpdata_parser.add_argument( 'model', action='store', help='model name to dump; underscored name' 'should be used, e.g. network_group for NetworkGroup model' ) subparsers.add_parser( 'loaddefault', help='load data from default fixtures ' '(settings.FIXTURES_TO_IPLOAD)' ) def load_alembic_parsers(migrate_parser): alembic_parser = migrate_parser.add_subparsers( dest="alembic_command", help='alembic command' ) for name in ['current', 'history', 'branches']: parser = alembic_parser.add_parser(name) for name in ['upgrade', 'downgrade']: parser = alembic_parser.add_parser(name) parser.add_argument('--delta', type=int) parser.add_argument('--sql', action='store_true') parser.add_argument('revision', nargs='?') parser = alembic_parser.add_parser('stamp') parser.add_argument('--sql', action='store_true') parser.add_argument('revision') parser = alembic_parser.add_parser('revision') parser.add_argument('-m', '--message') parser.add_argument('--autogenerate', action='store_true') parser.add_argument('--sql', action='store_true') def load_db_migrate_parsers(subparsers): migrate_parser = subparsers.add_parser( 'migrate', help='dealing with DB migration' ) load_alembic_parsers(migrate_parser) def load_dbshell_parsers(subparsers): dbshell_parser = subparsers.add_parser( 'dbshell', help='open database shell' ) add_config_parameter(dbshell_parser) def load_test_parsers(subparsers): subparsers.add_parser( 'test', help='run unit tests' ) def load_shell_parsers(subparsers): shell_parser = subparsers.add_parser( 'shell', help='open python REPL' ) add_config_parameter(shell_parser) def load_settings_parsers(subparsers): subparsers.add_parser( 'dump_settings', help='dump current settings to YAML' ) def action_dumpdata(params): import logging logging.disable(logging.WARNING) from nailgun.db.sqlalchemy import fixman fixman.dump_fixture(params.model) sys.exit(0) def action_loaddata(params): from nailgun.db.sqlalchemy import fixman from nailgun.logger import logger logger.info("Uploading fixture...") with open(params.fixture, "r") as fileobj: fixman.upload_fixture(fileobj) logger.info("Done") def action_loaddefault(params): from nailgun.db.sqlalchemy import fixman from nailgun.logger import logger logger.info("Uploading fixture...") fixman.upload_fixtures() logger.info("Done") def action_syncdb(params): from nailgun.db import syncdb from nailgun.logger import logger logger.info("Syncing database...") syncdb() logger.info("Done") def action_dropdb(params): from nailgun.db import dropdb from nailgun.logger import logger logger.info("Dropping database...") dropdb() logger.info("Done") def action_migrate(params): from nailgun.db.migration import action_migrate_alembic action_migrate_alembic(params) def action_test(params): from nailgun.logger import logger from nailgun.unit_test import TestRunner logger.info("Running tests...") TestRunner.run() logger.info("Done") def action_dbshell(params): from nailgun.settings import settings if params.config_file: settings.update_from_file(params.config_file) args = ['psql'] env = {} if settings.DATABASE['passwd']: env['PGPASSWORD'] = settings.DATABASE['passwd'] if settings.DATABASE['user']: args += ["-U", settings.DATABASE['user']] if settings.DATABASE['host']: args.extend(["-h", settings.DATABASE['host']]) if settings.DATABASE['port']: args.extend(["-p", str(settings.DATABASE['port'])]) args += [settings.DATABASE['name']] if os.name == 'nt': sys.exit(os.system(" ".join(args))) else: os.execvpe('psql', args, env) def action_dump_settings(params): from nailgun.settings import settings sys.stdout.write(settings.dump()) def action_shell(params): from nailgun.db import db from nailgun.settings import settings if params.config_file: settings.update_from_file(params.config_file) try: from IPython import embed embed() except ImportError: code.interact(local={'db': db, 'settings': settings}) def action_run(params): from nailgun.settings import settings settings.update({ 'LISTEN_PORT': int(params.port), 'LISTEN_ADDRESS': params.address, }) for attr in ['FAKE_TASKS', 'FAKE_TASKS_TICK_COUNT', 'FAKE_TASKS_TICK_INTERVAL', 'FAKE_TASKS_AMQP']: param = getattr(params, attr.lower()) if param is not None: settings.update({attr: param}) if params.authentication_method: auth_method = params.authentication_method settings.AUTH.update({'AUTHENTICATION_METHOD' : auth_method}) if params.config_file: settings.update_from_file(params.config_file) from nailgun.app import appstart appstart() if __name__ == "__main__": parser = argparse.ArgumentParser() subparsers = parser.add_subparsers( dest="action", help='actions' ) load_run_parsers(subparsers) load_db_parsers(subparsers) load_db_migrate_parsers(subparsers) load_dbshell_parsers(subparsers) load_test_parsers(subparsers) load_shell_parsers(subparsers) load_settings_parsers(subparsers) params, other_params = parser.parse_known_args() sys.argv.pop(1) action = getattr( __main__, "action_{0}".format(params.action) ) action(params) if action else parser.print_help()
# -*- coding: utf-8 -*- import os import sys import types import numpy as np from sklearn.metrics import accuracy_score from sklearn.tree.tree import DecisionTreeClassifier from sklearn.ensemble.weight_boosting import AdaBoostClassifier from sklearn.ensemble.forest import RandomForestClassifier from sklearn.ensemble.forest import ExtraTreesClassifier from sklearn.svm.classes import LinearSVC from sklearn.svm.classes import SVC from sklearn.svm.classes import NuSVC from sklearn.neighbors.classification import KNeighborsClassifier from sklearn.naive_bayes import GaussianNB from sklearn.naive_bayes import BernoulliNB from sklearn_porter.utils.Environment import Environment from sklearn_porter.utils.Shell import Shell # from sklearn_porter.language import * class Porter(object): def __init__(self, estimator, language='java', method='predict', **kwargs): # pylint: disable=unused-argument """ Transpile a trained estimator to the chosen target programming language. Parameters ---------- language : {'c', 'go', 'java', 'js', 'php', 'ruby'}, default: 'java' The required target programming language. method : {'predict', 'predict_proba'}, default: 'predict' The target prediction method. """ # Check language support: language = str(language).strip().lower() if language not in ['c', 'go', 'java', 'js', 'php', 'ruby']: error = "The given language '{}' isn't supported.".format(language) raise AttributeError(error) self.target_language = language # Check method support: method = str(method).strip().lower() if method not in ['predict', 'predict_proba']: error = "The given method '{}' isn't supported.".format(method) raise AttributeError(error) self.target_method = method # Determine the local version of sklearn: from sklearn import __version__ as sklearn_ver sklearn_ver = str(sklearn_ver).split('.') sklearn_ver = [int(v) for v in sklearn_ver] major, minor = sklearn_ver[0], sklearn_ver[1] patch = sklearn_ver[2] if len(sklearn_ver) >= 3 else 0 self.sklearn_ver = (major, minor, patch) # Extract estimator from 'Pipeline': # sklearn version >= 0.15.0 if not hasattr(self, 'estimator') and self.sklearn_ver[:2] >= (0, 15): from sklearn.pipeline import Pipeline if isinstance(estimator, Pipeline): if hasattr(estimator, '_final_estimator') and \ estimator._final_estimator is not None: self.estimator = estimator._final_estimator # Extract estimator from optimizer (GridSearchCV, RandomizedSearchCV): # sklearn version >= 0.19.0 if not hasattr(self, 'estimator') and self.sklearn_ver[:2] >= (0, 19): from sklearn.model_selection._search import GridSearchCV from sklearn.model_selection._search import RandomizedSearchCV optimizers = (GridSearchCV, RandomizedSearchCV) if isinstance(estimator, optimizers): if hasattr(estimator, 'best_estimator_') and \ hasattr(estimator.best_estimator_, '_final_estimator'): self.estimator = estimator.best_estimator_._final_estimator if not hasattr(self, 'estimator'): self.estimator = estimator # Determine the local supported estimators: self.supported_classifiers = self._classifiers self.supported_regressors = self._regressors # Read algorithm name and type: self.estimator_name = str(type(self.estimator).__name__) if isinstance(self.estimator, self.supported_classifiers): self.estimator_type = 'classifier' elif isinstance(self.estimator, self.supported_regressors): self.estimator_type = 'regressor' else: error = "Currently the given estimator '{estimator}' isn't" \ " supported.".format(**self.__dict__) raise ValueError(error) # Import estimator class: if sys.version_info[:2] < (3, 3): pckg = 'estimator.{estimator_type}.{estimator_name}' level = -1 else: pckg = 'sklearn_porter.estimator.{estimator_type}.{estimator_name}' level = 0 pckg = pckg.format(**self.__dict__) try: clazz = __import__(pckg, globals(), locals(), [self.estimator_name], level) clazz = getattr(clazz, self.estimator_name) except ImportError: error = "Currently the given model '{algorithm_name}' " \ "isn't supported.".format(**self.__dict__) raise AttributeError(error) # Set target programming language: pwd = os.path.dirname(__file__) template_dir = os.path.join(pwd, 'estimator', self.estimator_type, self.estimator_name, 'templates', self.target_language) has_template = os.path.isdir(template_dir) if not has_template: error = "Currently the chosen target programming language '{}' " \ "isn't supported for the estimator '{}'." \ "".format(self.estimator_name, self.target_language) raise AttributeError(error) # Set target prediction method: has_method = self.target_method in \ set(getattr(clazz, 'SUPPORTED_METHODS')) if not has_method: error = "Currently the chosen model method" \ " '{}' isn't supported.".format(self.target_method) raise AttributeError(error) self._tested_dependencies = False # Create instance with all parameters: self.template = clazz(**self.__dict__) def export(self, class_name=None, method_name=None, num_format=lambda x: str(x), details=False, **kwargs): # pylint: disable=unused-argument """ Transpile a trained model to the syntax of a chosen programming language. Parameters ---------- :param class_name : string, default: None The name for the ported class. :param method_name : string, default: None The name for the ported method. :param num_format : lambda x, default: lambda x: str(x) The representation of the floating-point values. :param details : bool, default False Return additional data for the compilation and execution. Returns ------- model : {mix} The ported model as string or a dictionary with further information. """ if class_name is None or class_name == '': class_name = self.estimator_name if method_name is None or method_name == '': method_name = self.target_method if isinstance(num_format, types.LambdaType): self.template._num_format = num_format output = self.template.export(class_name=class_name, method_name=method_name, **kwargs) if not details: return output language = self.target_language filename = Porter._get_filename(class_name, language) comp_cmd, exec_cmd = Porter._get_commands(filename, class_name, language) output = { 'estimator': str(output), 'filename': filename, 'class_name': class_name, 'method_name': method_name, 'cmd': { 'compilation': comp_cmd, 'execution': exec_cmd }, 'algorithm': { 'type': self.estimator_type, 'name': self.estimator_name } } return output def port(self, class_name=None, method_name=None, num_format=lambda x: str(x), details=False, **kwargs): # pylint: disable=unused-argument """ Transpile a trained model to the syntax of a chosen programming language. Parameters ---------- :param class_name : string, default: None The name for the ported class. :param method_name : string, default: None The name for the ported method. :param num_format : lambda x, default: lambda x: str(x) The representation of the floating-point values. :param details : bool, default: False Return additional data for the compilation and execution. Returns ------- model : {mix} The ported model as string or a dictionary with further information. """ loc = locals() loc.pop(str('self')) return self.export(**loc) @property def _classifiers(self): """ Get a set of supported classifiers. Returns ------- classifiers : {set} The set of supported classifiers. """ # sklearn version < 0.18.0 classifiers = ( AdaBoostClassifier, BernoulliNB, DecisionTreeClassifier, ExtraTreesClassifier, GaussianNB, KNeighborsClassifier, LinearSVC, NuSVC, RandomForestClassifier, SVC, ) # sklearn version >= 0.18.0 if self.sklearn_ver[:2] >= (0, 18): from sklearn.neural_network.multilayer_perceptron \ import MLPClassifier classifiers += (MLPClassifier, ) return classifiers @property def _regressors(self): """ Get a set of supported regressors. Returns ------- regressors : {set} The set of supported regressors. """ # sklearn version < 0.18.0 regressors = () # sklearn version >= 0.18.0 if self.sklearn_ver[:2] >= (0, 18): from sklearn.neural_network.multilayer_perceptron \ import MLPRegressor regressors += (MLPRegressor, ) return regressors def predict(self, X, class_name=None, method_name=None, tnp_dir='tmp', keep_tmp_dir=False, num_format=lambda x: str(x)): """ Predict using the transpiled model. Parameters ---------- :param X : {array-like}, shape (n_features) or (n_samples, n_features) The input data. :param class_name : string, default: None The name for the ported class. :param method_name : string, default: None The name for the ported method. :param tnp_dir : string, default: 'tmp' The path to the temporary directory for storing the transpiled (and compiled) model. :param keep_tmp_dir : bool, default: False Whether to delete the temporary directory or not. :param num_format : lambda x, default: lambda x: str(x) The representation of the floating-point values. Returns ------- y : int or array-like, shape (n_samples,) The predicted class or classes. """ if class_name is None: class_name = self.estimator_name if method_name is None: method_name = self.target_method # Dependencies: if not self._tested_dependencies: self._test_dependencies() self._tested_dependencies = True # Support: if 'predict' not in set(self.template.SUPPORTED_METHODS): error = "Currently the given model method" \ " '{}' isn't supported.".format('predict') raise AttributeError(error) # Cleanup: Shell.call('rm -rf {}'.format(tnp_dir)) Shell.call('mkdir {}'.format(tnp_dir)) # Transpiled model: details = self.export(class_name=class_name, method_name=method_name, num_format=num_format, details=True) filename = Porter._get_filename(class_name, self.target_language) target_file = os.path.join(tnp_dir, filename) with open(target_file, str('w')) as file_: file_.write(details.get('estimator')) # Compilation command: comp_cmd = details.get('cmd').get('compilation') if comp_cmd is not None: Shell.call(comp_cmd, cwd=tnp_dir) # Execution command: exec_cmd = details.get('cmd').get('execution') exec_cmd = str(exec_cmd).split() pred_y = None # Single feature set: if exec_cmd is not None and len(X.shape) == 1: full_exec_cmd = exec_cmd + [str(sample).strip() for sample in X] pred_y = Shell.check_output(full_exec_cmd, cwd=tnp_dir) pred_y = int(pred_y) # Multiple feature sets: if exec_cmd is not None and len(X.shape) > 1: pred_y = np.empty(X.shape[0], dtype=int) for idx, features in enumerate(X): full_exec_cmd = exec_cmd + [str(f).strip() for f in features] pred = Shell.check_output(full_exec_cmd, cwd=tnp_dir) pred_y[idx] = int(pred) # Cleanup: if not keep_tmp_dir: Shell.call('rm -rf {}'.format(tnp_dir)) return pred_y def integrity_score(self, X, method='predict', normalize=True, num_format=lambda x: str(x)): """ Compute the accuracy of the ported classifier. Parameters ---------- :param X : ndarray, shape (n_samples, n_features) Input data. :param method : string, default: 'predict' The method which should be tested. :param normalize : bool, default: True If ``False``, return the number of correctly classified samples. Otherwise, return the fraction of correctly classified samples. :param num_format : lambda x, default: lambda x: str(x) The representation of the floating-point values. Returns ------- score : float If ``normalize == True``, return the correctly classified samples (float), else it returns the number of correctly classified samples (int). The best performance is 1 with ``normalize == True`` and the number of samples with ``normalize == False``. """ X = np.array(X) if not X.ndim > 1: X = np.array([X]) method = str(method).strip().lower() if method not in ['predict', 'predict_proba']: error = "The given method '{}' isn't supported.".format(method) raise AttributeError(error) if method == 'predict': y_true = self.estimator.predict(X) y_pred = self.predict(X, tnp_dir='tmp_integrity_score', keep_tmp_dir=True, num_format=num_format) return accuracy_score(y_true, y_pred, normalize=normalize) return False def _test_dependencies(self): """ Check all target programming and operating system dependencies. """ lang = self.target_language # Dependencies: deps = { 'c': ['gcc'], 'java': ['java', 'javac'], 'js': ['node'], 'go': ['go'], 'php': ['php'], 'ruby': ['ruby'] } current_deps = deps.get(lang) + ['mkdir', 'rm'] Environment.check_deps(current_deps) @staticmethod def _get_filename(class_name, language): """ Generate the specific filename. Parameters ---------- :param class_name : str The used class name. :param language : {'c', 'go', 'java', 'js', 'php', 'ruby'} The target programming language. Returns ------- filename : str The generated filename. """ name = str(class_name).strip() lang = str(language) # Name: if language in ['java', 'php']: name = "".join([name[0].upper() + name[1:]]) # Suffix: suffix = { 'c': 'c', 'java': 'java', 'js': 'js', 'go': 'go', 'php': 'php', 'ruby': 'rb' } suffix = suffix.get(lang, lang) # Filename: return '{}.{}'.format(name, suffix) @staticmethod def _get_commands(filename, class_name, language): """ Generate the related compilation and execution commands. Parameters ---------- :param filename : str The used filename. :param class_name : str The used class name. :param language : {'c', 'go', 'java', 'js', 'php', 'ruby'} The target programming language. Returns ------- comp_cmd, exec_cmd : (str, str) The compilation and execution command. """ cname = str(class_name) fname = str(filename) lang = str(language) # Compilation variants: comp_vars = { # gcc brain.c -o brain 'c': 'gcc {} -lm -o {}'.format(fname, cname), # javac Brain.java 'java': 'javac {}'.format(fname), # go build -o brain brain.go 'go': 'go build -o {} {}.go'.format(cname, cname) } comp_cmd = comp_vars.get(lang, None) # Execution variants: exec_vars = { # ./brain 'c': os.path.join('.', cname), # java -classpath . Brain 'java': 'java -classpath . {}'.format(cname), # node brain.js 'js': 'node {}'.format(fname), # php -f Brain.php 'php': 'php -f {}'.format(fname), # ruby brain.rb 'ruby': 'ruby {}'.format(fname), # ./brain 'go': os.path.join('.', cname), } exec_cmd = exec_vars.get(lang, None) return comp_cmd, exec_cmd
from io import BytesIO from unittest import TestCase from eve.io.media import MediaStorage from eve.io.mongo import GridFSMediaStorage from eve.tests import TestBase, MONGO_DBNAME from eve import STATUS_OK, ID_FIELD, STATUS, STATUS_ERR, ISSUES, ETAG import base64 from bson import ObjectId class TestMediaStorage(TestCase): def test_base_media_storage(self): a = MediaStorage() self.assertEqual(a.app, None) a = MediaStorage("hello") self.assertEqual(a.app, "hello") self.assertRaises(NotImplementedError, a.get, 1) self.assertRaises(NotImplementedError, a.put, "clean", "filename") self.assertRaises(NotImplementedError, a.delete, 1) self.assertRaises(NotImplementedError, a.exists, 1) class TestGridFSMediaStorage(TestBase): def setUp(self): super(TestGridFSMediaStorage, self).setUp() self.url = self.known_resource_url self.headers = [('Content-Type', 'multipart/form-data')] self.test_field, self.test_value = 'ref', "1234567890123456789054321" # we want an explicit binary as Py3 encodestring() expects binaries. self.clean = b'my file contents' # encodedstring will raise a DeprecationWarning under Python3.3, but # the alternative encodebytes is not available in Python 2. self.encoded = base64.encodestring(self.clean).decode('utf-8') def test_gridfs_media_storage_errors(self): self.assertRaises(TypeError, GridFSMediaStorage) self.assertRaises(TypeError, GridFSMediaStorage, "hello") def test_gridfs_media_storage_post(self): # send something different than a file and get an error back data = {'media': 'not a file'} r, s = self.parse_response( self.test_client.post(self.url, data=data, headers=self.headers)) self.assertEqual(STATUS_ERR, r[STATUS]) # validates media fields self.assertTrue('file was expected' in r[ISSUES]['media']) # also validates ordinary fields self.assertTrue('required' in r[ISSUES][self.test_field]) r, s = self._post() self.assertEqual(STATUS_OK, r[STATUS]) # compare original and returned data _id = r[ID_FIELD] self.assertMediaField(_id, self.encoded, self.clean) # GET the file at the resource endpoint where = 'where={"%s": "%s"}' % (ID_FIELD, _id) r, s = self.parse_response( self.test_client.get('%s?%s' % (self.url, where))) self.assertEqual(len(r['_items']), 1) returned = r['_items'][0]['media'] # returned value is a base64 encoded string self.assertEqual(returned, self.encoded) # which decodes to the original clean self.assertEqual(base64.decodestring(returned.encode()), self.clean) def test_gridfs_media_storage_post_excluded_file_in_result(self): # send something different than a file and get an error back data = {'media': 'not a file'} r, s = self.parse_response( self.test_client.post(self.url, data=data, headers=self.headers)) self.assertEqual(STATUS_ERR, r[STATUS]) # validates media fields self.assertTrue('file was expected' in r[ISSUES]['media']) # also validates ordinary fields self.assertTrue('required' in r[ISSUES][self.test_field]) r, s = self._post() self.assertEqual(STATUS_OK, r[STATUS]) self.app.config['RETURN_MEDIA_AS_BASE64_STRING'] = False # compare original and returned data _id = r[ID_FIELD] # GET the file at the resource endpoint where = 'where={"%s": "%s"}' % (ID_FIELD, _id) r, s = self.parse_response( self.test_client.get('%s?%s' % (self.url, where))) self.assertEqual(len(r['_items']), 1) returned = r['_items'][0]['media'] # returned value is a base64 encoded string self.assertEqual(returned, None) def test_gridfs_media_storage_post_extended(self): r, s = self._post() self.assertEqual(STATUS_OK, r[STATUS]) # request extended format file response self.app.config['EXTENDED_MEDIA_INFO'] = ['content_type', 'length'] # compare original and returned data _id = r[ID_FIELD] self.assertMediaFieldExtended(_id, self.encoded, self.clean) # GET the file at the resource endpoint where = 'where={"%s": "%s"}' % (ID_FIELD, _id) r, s = self.parse_response( self.test_client.get('%s?%s' % (self.url, where))) self.assertEqual(len(r['_items']), 1) returned = r['_items'][0]['media'] # returned value is a base64 encoded string self.assertEqual(returned['file'], self.encoded) # which decodes to the original clean self.assertEqual(base64.decodestring(returned['file'].encode()), self.clean) # also verify our extended fields self.assertEqual(returned['content_type'], 'text/plain') self.assertEqual(returned['length'], 16) def test_gridfs_media_storage_post_extended_excluded_file_in_result(self): r, s = self._post() self.assertEqual(STATUS_OK, r[STATUS]) # request extended format file response self.app.config['EXTENDED_MEDIA_INFO'] = ['content_type', 'length'] self.app.config['RETURN_MEDIA_AS_BASE64_STRING'] = False # compare original and returned data _id = r[ID_FIELD] # GET the file at the resource endpoint where = 'where={"%s": "%s"}' % (ID_FIELD, _id) r, s = self.parse_response( self.test_client.get('%s?%s' % (self.url, where))) self.assertEqual(len(r['_items']), 1) returned = r['_items'][0]['media'] # returned value is None self.assertEqual(returned['file'], None) # also verify our extended fields self.assertEqual(returned['content_type'], 'text/plain') self.assertEqual(returned['length'], 16) def test_gridfs_media_storage_put(self): r, s = self._post() _id = r[ID_FIELD] etag = r[ETAG] # compare original and returned data self.assertMediaField(_id, self.encoded, self.clean) with self.app.test_request_context(): # retrieve media_id media_id = self.assertMediaStored(_id) # PUT replaces the file with new one clean = b'my new file contents' encoded = base64.encodestring(clean).decode() test_field, test_value = 'ref', "9234567890123456789054321" data = {'media': (BytesIO(clean), 'test.txt'), test_field: test_value} headers = [('Content-Type', 'multipart/form-data'), ('If-Match', etag)] r, s = self.parse_response( self.test_client.put(('%s/%s' % (self.url, _id)), data=data, headers=headers)) self.assertEqual(STATUS_OK, r[STATUS]) with self.app.test_request_context(): # media has been properly stored self.assertMediaStored(_id) # compare original and returned data r, s = self.assertMediaField(_id, encoded, clean) # and of course, the ordinary field has been updated too self.assertEqual(r[test_field], test_value) with self.app.test_request_context(): # previous media doesn't exist anymore (it's been deleted) self.assertFalse(self.app.media.exists(media_id)) def test_gridfs_media_storage_patch(self): r, s = self._post() _id = r[ID_FIELD] etag = r[ETAG] # compare original and returned data self.assertMediaField(_id, self.encoded, self.clean) with self.app.test_request_context(): # retrieve media_id media_id = self.assertMediaStored(_id) # PATCH replaces the file with new one clean = b'my new file contents' encoded = base64.encodestring(clean).decode() test_field, test_value = 'ref', "9234567890123456789054321" data = {'media': (BytesIO(clean), 'test.txt'), test_field: test_value} headers = [('Content-Type', 'multipart/form-data'), ('If-Match', etag)] r, s = self.parse_response( self.test_client.patch(('%s/%s' % (self.url, _id)), data=data, headers=headers)) self.assertEqual(STATUS_OK, r[STATUS]) # compare original and returned data r, s = self.assertMediaField(_id, encoded, clean) # and of course, the ordinary field has been updated too self.assertEqual(r[test_field], test_value) with self.app.test_request_context(): # previous media doesn't exist anymore (it's been deleted) self.assertFalse(self.app.media.exists(media_id)) def test_gridfs_media_storage_patch_null(self): # set 'media' field to 'nullable' self.domain[self.known_resource]['schema']['media']['nullable'] = True response, status = self._post() self.assert201(status) _id = response[ID_FIELD] etag = response[ETAG] # test that nullable media field can be set to None data = {'media': None} headers = [('If-Match', etag)] response, status = self.patch(('%s/%s' % (self.url, _id)), data=data, headers=headers) self.assert200(status) response, status = self.get(self.known_resource, item=_id) self.assert200(status) self.assertEqual(response['media'], None) def test_gridfs_media_storage_delete(self): r, s = self._post() _id = r[ID_FIELD] etag = r[ETAG] with self.app.test_request_context(): # retrieve media_id and compare original and returned data self.assertMediaField(_id, self.encoded, self.clean) media_id = self.assertMediaStored(_id) # DELETE deletes both the document and the media file headers = [('If-Match', etag)] r, s = self.parse_response( self.test_client.delete(('%s/%s' % (self.url, _id)), headers=headers)) self.assert204(s) with self.app.test_request_context(): # media doesn't exist anymore (it's been deleted) self.assertFalse(self.app.media.exists(media_id)) # GET returns 404 r, s = self.parse_response(self.test_client.get('%s/%s' % (self.url, _id))) self.assert404(s) def test_gridfs_media_storage_delete_projection(self): """ test that #284 is fixed: If you have a media field, and set datasource projection to 0 for that field, the media will not be deleted """ r, s = self._post() _id = r[ID_FIELD] with self.app.test_request_context(): # retrieve media_id and compare original and returned data media_id = self.assertMediaStored(_id) self.app.config['DOMAIN']['contacts']['datasource']['projection'] = \ {"media": 0} r, s = self.parse_response(self.test_client.get('%s/%s' % (self.url, _id))) etag = r[ETAG] # DELETE deletes both the document and the media file headers = [('If-Match', etag)] r, s = self.parse_response( self.test_client.delete(('%s/%s' % (self.url, _id)), headers=headers)) self.assert204(s) with self.app.test_request_context(): # media doesn't exist anymore (it's been deleted) self.assertFalse(self.app.media.exists(media_id)) # GET returns 404 r, s = self.parse_response(self.test_client.get('%s/%s' % (self.url, _id))) self.assert404(s) def test_gridfs_media_storage_return_url(self): self.app._init_media_endpoint() self.app.config['RETURN_MEDIA_AS_BASE64_STRING'] = False self.app.config['RETURN_MEDIA_AS_URL'] = True r, s = self._post() self.assertEqual(STATUS_OK, r[STATUS]) _id = r[ID_FIELD] # GET the file at the resource endpoint where = 'where={"%s": "%s"}' % (ID_FIELD, _id) r, s = self.parse_response( self.test_client.get('%s?%s' % (self.url, where))) self.assertEqual(len(r['_items']), 1) url = r['_items'][0]['media'] with self.app.test_request_context(): media_id = self.assertMediaStored(_id) self.assertEqual('/media/%s' % media_id, url) response = self.test_client.get(url) self.assertEqual(self.clean, response.get_data()) def assertMediaField(self, _id, encoded, clean): # GET the file at the item endpoint r, s = self.parse_response(self.test_client.get('%s/%s' % (self.url, _id))) returned = r['media'] # returned value is a base64 encoded string self.assertEqual(returned, encoded) # which decodes to the original file clean self.assertEqual(base64.decodestring(returned.encode()), clean) return r, s def assertMediaFieldExtended(self, _id, encoded, clean): # GET the file at the item endpoint r, s = self.parse_response(self.test_client.get('%s/%s' % (self.url, _id))) returned = r['media']['file'] # returned value is a base64 encoded string self.assertEqual(returned, encoded) # which decodes to the original file clean self.assertEqual(base64.decodestring(returned.encode()), clean) return r, s def assertMediaStored(self, _id): _db = self.connection[MONGO_DBNAME] # retrieve media id media_id = _db.contacts.find_one({ID_FIELD: ObjectId(_id)})['media'] # verify it's actually stored in the media storage system self.assertTrue(self.app.media.exists(media_id)) return media_id def _post(self): # send a file and a required, ordinary field with no issues data = {'media': (BytesIO(self.clean), 'test.txt'), self.test_field: self.test_value} return self.parse_response(self.test_client.post( self.url, data=data, headers=self.headers))
"""UI classes like StringWriter and Buttons""" import pygame import sys def update_resolution(settings, player, width, height): pixel_width = ((player.segment_height + player.segment_margin) * width) + player.segment_margin pixel_height = ((player.segment_height + player.segment_margin) * height) + (player.segment_margin + settings.overlay_width) settings.screen_size = [pixel_width, pixel_height] settings.screen_segments[0] = width settings.screen_segments[1] = height class StringWriter: """Class for drawing generic text to the screen""" def __init__(self, screen, string, size, x, y, color=(0, 0, 0), bold=False): self.screen = screen if not bold: self.font = pygame.font.Font("Comfortaa-Regular.ttf", size) # Create font with desired size else: self.font = pygame.font.Font("Comfortaa-Bold.ttf", size) self.text = self.font.render(string, 1, color) # Create a text "sprite" self.text_rect = self.text.get_rect() # get it's background_rect self.text_rect.centerx = x # and set it's location self.text_rect.centery = y def update_text(self, string, color=(0, 0, 0)): try: self.text = self.font.render(string, 1, color) except TypeError: self.text = self.font.render(str(string), 1, color) def reposition(self, x, y): self.text_rect = self.text.get_rect() self.text_rect.centerx = x self.text_rect.centery = y def draw(self): self.screen.blit(self.text, self.text_rect) class StringInputField: """Input field class for capturing input from the keyboard""" def __init__(self, screen, settings, x, y, limit=20, default_text="Click to write...", background_color=(255, 255, 255), width=500, height=50, text_color=(0, 0, 0), border=6, border_color=(0, 0, 0)): self.screen = screen self.settings = settings self.x = x self.y = y self.limit = limit self.default_text = default_text self.keyboard_input = default_text self.text_length = len(self.keyboard_input) self.capturing = False # Grahpics stuff # Text self.text = StringWriter(self.screen, self.keyboard_input, 25, self.x, self.y, color=text_color) # Input box self.image = pygame.Surface([width, height]) self.image.fill(background_color) self.rect = self.image.get_rect() self.rect.centerx = self.x self.rect.centery = self.y # Border self.border = pygame.Surface([width+border, height+border]) self.border.fill(border_color) self.border_rect = self.border.get_rect() self.border_rect.centerx = self.x self.border_rect.centery = self.y def capture(self, event): banned_chars = [pygame.K_BACKSPACE, pygame.K_TAB, pygame.K_KP_ENTER] if self.capturing: if event.type == pygame.KEYDOWN: if event.key == pygame.K_ESCAPE and self.capturing: self.capturing = False elif event.key == pygame.K_BACKSPACE and len(self.keyboard_input) > 0: self.keyboard_input = self.keyboard_input[:-1] elif len(self.keyboard_input) <= self.limit and event.key not in banned_chars: self.keyboard_input += event.unicode def restore_defaults(self): self.keyboard_input = self.default_text self.capturing = False def draw_frame(self): if self.text_length != len(self.keyboard_input): self.text.update_text(self.keyboard_input) self.text.reposition(self.x, self.y) self.text_length = len(self.keyboard_input) self.screen.blit(self.border, self.border_rect) self.screen.blit(self.image, self.rect) self.text.draw() def check_pressed(self, event): if event.type == pygame.MOUSEBUTTONDOWN: if event.pos[0] >= self.rect.left and event.pos[0] <= self.rect.right: if event.pos[1] >= self.rect.top and event.pos[1] <= self.rect.bottom: self.keyboard_input = "" self.capturing = True else: self.restore_defaults() elif event.type == pygame.QUIT: sys.exit() class Button: """Button class for creating buttons""" def __init__(self, x, y, width, height, color, text, screen, border=6, border_color=(0, 0, 0)): self.screen = screen self.text = text self.image = pygame.Surface([width, height]) self.border = pygame.Surface([width+border, height+border]) self.image.fill(color) self.border.fill(border_color) self.rect = self.image.get_rect() self.rect.centerx = x self.rect.centery = y self.border_rect = self.border.get_rect() self.border_rect.centerx = self.rect.centerx self.border_rect.centery = self.rect.centery self.button_text = StringWriter(self.screen, text, 30, self.rect.centerx, self.rect.centery) def draw_button(self): self.screen.blit(self.border, self.border_rect) self.screen.blit(self.image, self.rect) self.button_text.draw() def pressed(self, event): if self.rect.left <= event.pos[0] <= self.rect.right: if self.rect.top <= event.pos[1] <= self.rect.bottom: return True else: return False class IntSelector: def __init__(self, screen, x, y, title, integer, color=(96, 130, 182), min_int=0, max_int=999): self.screen = screen self.title = title self.integer = integer self.x = x self.y = y self.min_int = min_int self.max_int = max_int # Labels self.title_label = StringWriter(self.screen, self.title, 20, x, y-50) self.display = StringWriter(self.screen, str(self.integer), 20, x, y) # Buttons # Plus self.plus_button = Button(x+100, y, 50, 50, color, "+", self.screen) self.plus_five_button = Button(x + 160, y, 50, 50, color, "+5", self.screen) # Minus self.minus_button = Button(x - 100, y, 50, 50, color, "-", self.screen) self.minus_five_button = Button(x - 160, y, 50, 50, color, "-5", self.screen) def get_int(self): return self.integer def draw(self): self.title_label.draw() self.display.draw() self.plus_button.draw_button() self.plus_five_button.draw_button() self.minus_button.draw_button() self.minus_five_button.draw_button() def check_events(self, event): if self.plus_button.pressed(event) and self.integer < self.max_int: self.integer += 1 self.display.update_text(str(self.integer)) elif self.plus_five_button.pressed(event) and self.integer+5 <= self.max_int: self.integer += 5 self.display.update_text(str(self.integer)) elif self.minus_button.pressed(event) and self.integer > self.min_int: self.integer -= 1 self.display.update_text(str(self.integer)) elif self.minus_five_button.pressed(event) and self.integer-5 >= self.min_int: self.integer -= 5 self.display.update_text(str(self.integer)) class GameOverlay: def __init__(self, screen, settings): self.screen = screen self.settings = settings self.previous_score = settings.score self.previous_speed = settings.game_speed self.previous_size = settings.snake_size # Overlay background self.background = pygame.Surface([self.settings.screen_size[0], self.settings.overlay_width]) self.background.fill(self.settings.colors["d-grey"]) self.background_rect = self.background.get_rect() # Divider line self.line = pygame.Surface([self.settings.screen_size[0], 5]) self.line_rect = self.line.get_rect() line_y = self.settings.overlay_width - self.line.get_height() # Positioning self.background_rect.topleft = (0, 0) self.line_rect.topleft = (0, line_y) # Text labels self.score_label = StringWriter(screen, "Score: " + str(settings.score), 25, 100, settings.overlay_width//2 - self.line.get_height(), bold=True) self.speed_label = StringWriter(self.screen, "Speed: " + str(self.settings.game_speed), 25, 250, self.settings.overlay_width//2 - self.line.get_height(), bold=True) self.size_label = StringWriter(self.screen, "Size: " + str(self.previous_size), 25, 400, self.settings.overlay_width // 2 - self.line.get_height(), bold=True) def draw(self, player): self.update_labels(player) self.screen.blit(self.background, self.background_rect) self.screen.blit(self.line, self.line_rect) self.speed_label.draw() self.score_label.draw() self.size_label.draw() def update_labels(self, player): if self.previous_speed != self.settings.game_speed: self.previous_speed = self.settings.game_speed self.speed_label.update_text("Speed: " + str(self.settings.game_speed)) if self.previous_score != self.settings.score: self.previous_score = self.settings.score self.score_label.update_text("Score: " + str(self.settings.score)) if self.previous_size != len(player.snake_segments): self.previous_size = len(player.snake_segments) self.size_label.update_text(("Size: " + str(self.previous_size)))
# Copyright 2012 VMware, Inc. # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. # import collections import time from unittest import mock from neutron_lib import constants as n_const from oslo_config import cfg from oslo_log import log from neutron.agent.common import ip_lib from neutron.agent.common import ovs_lib from neutron.plugins.ml2.drivers.openvswitch.agent.common import constants from neutron.tests.unit.plugins.ml2.drivers.openvswitch.agent \ import ovs_test_base from neutron.tests.unit.plugins.ml2.drivers.openvswitch.agent \ import test_vlanmanager Switch = collections.namedtuple('Switch', ['br_name']) # Useful global dummy variables. NET_UUID = '3faeebfe-5d37-11e1-a64b-000c29d5f0a7' LS_ID = 420 LV_ID = 42 LV_IDS = [42, 43] VIF_ID = '404deaec-5d37-11e1-a64b-000c29d5f0a8' VIF_MAC = '3c:09:24:1e:78:23' OFPORT_NUM = 1 VIF_PORT = ovs_lib.VifPort('port', OFPORT_NUM, VIF_ID, VIF_MAC, Switch(br_name='br_name')) VIF_PORTS = {VIF_ID: VIF_PORT} FIXED_IPS = [{'subnet_id': 'my-subnet-uuid', 'ip_address': '1.1.1.1'}] VM_DEVICE_OWNER = n_const.DEVICE_OWNER_COMPUTE_PREFIX + 'fake' TUN_OFPORTS = {n_const.TYPE_GRE: {'ip1': '11', 'ip2': '12'}} BCAST_MAC = "01:00:00:00:00:00/01:00:00:00:00:00" UCAST_MAC = "00:00:00:00:00:00/01:00:00:00:00:00" class DummyPort(object): def __init__(self, interface_id): self.interface_id = interface_id class DummyVlanBinding(object): def __init__(self, network_id, vlan_id): self.network_id = network_id self.vlan_id = vlan_id class TunnelTest(object): def setUp(self): super(TunnelTest, self).setUp() self.useFixture(test_vlanmanager.LocalVlanManagerFixture()) conn_patcher = mock.patch( 'neutron.agent.ovsdb.impl_idl._connection') conn_patcher.start() mock.patch( 'neutron.api.rpc.handlers.resources_rpc.ResourcesPullRpcApi' ).start() self.addCleanup(conn_patcher.stop) cfg.CONF.set_default('firewall_driver', 'neutron.agent.firewall.NoopFirewallDriver', group='SECURITYGROUP') cfg.CONF.set_override('report_interval', 0, 'AGENT') cfg.CONF.set_override('explicitly_egress_direct', True, 'AGENT') self.INT_BRIDGE = 'integration_bridge' self.TUN_BRIDGE = 'tunnel_bridge' self.MAP_TUN_BRIDGE = 'tun_br_map' self.AUX_BRIDGE = 'ancillary_bridge' self.NET_MAPPING = ['net1:%s' % self.MAP_TUN_BRIDGE] self.INT_OFPORT = 11111 self.TUN_OFPORT = 22222 self.MAP_TUN_INT_OFPORT = 33333 self.MAP_TUN_PHY_OFPORT = 44444 self.LVM_DATA = ( LV_ID, 'gre', None, LS_ID, VIF_PORTS) self.LVM_FLAT_DATA = ( LV_ID, 'flat', 'net1', LS_ID, VIF_PORTS) self.LVM_VLAN_DATA = ( LV_ID, 'vlan', 'net1', LS_ID, VIF_PORTS) self.inta = mock.Mock() self.intb = mock.Mock() mock.patch.object(ovs_lib.BaseOVS, 'config', new_callable=mock.PropertyMock, return_value={}).start() mock.patch('neutron.agent.ovsdb.impl_idl._connection').start() self.ovs_bridges = { self.INT_BRIDGE: mock.create_autospec( self.br_int_cls('br-int')), self.TUN_BRIDGE: mock.create_autospec( self.br_tun_cls('br-tun')), self.MAP_TUN_BRIDGE: mock.create_autospec( self.br_phys_cls('br-phys')), self.AUX_BRIDGE: mock.create_autospec( ovs_lib.OVSBridge('br-aux')), } self.ovs_int_ofports = { 'patch-tun': self.TUN_OFPORT, 'int-%s' % self.MAP_TUN_BRIDGE: self.MAP_TUN_INT_OFPORT } mock.patch('neutron.agent.rpc.PluginReportStateAPI.' 'has_alive_neutron_server').start() def lookup_br(br_name, *args, **kwargs): return self.ovs_bridges[br_name] self.mock_int_bridge_cls = mock.patch(self._BR_INT_CLASS, autospec=True).start() self.mock_int_bridge_cls.side_effect = lookup_br self.mock_phys_bridge_cls = mock.patch(self._BR_PHYS_CLASS, autospec=True).start() self.mock_phys_bridge_cls.side_effect = lookup_br self.mock_tun_bridge_cls = mock.patch(self._BR_TUN_CLASS, autospec=True).start() self.mock_tun_bridge_cls.side_effect = lookup_br self.mock_aux_bridge_cls = mock.patch( 'neutron.agent.common.ovs_lib.OVSBridge', autospec=True).start() self.mock_aux_bridge_cls.side_effect = lookup_br self.mock_int_bridge = self.ovs_bridges[self.INT_BRIDGE] self.mock_int_bridge.add_port.return_value = self.MAP_TUN_INT_OFPORT self.mock_int_bridge.add_patch_port.side_effect = ( lambda tap, peer: self.ovs_int_ofports[tap]) self.mock_int_bridge.port_exists.return_value = False self.mock_int_bridge.get_vif_ports.return_value = [] self.mock_int_bridge.get_ports_attributes.return_value = [] self.mock_int_bridge.db_get_val.return_value = {} self.mock_map_tun_bridge = self.ovs_bridges[self.MAP_TUN_BRIDGE] self.mock_map_tun_bridge.br_name = self.MAP_TUN_BRIDGE self.mock_map_tun_bridge.add_port.return_value = ( self.MAP_TUN_PHY_OFPORT) self.mock_map_tun_bridge.add_patch_port.return_value = ( self.MAP_TUN_PHY_OFPORT) self.mock_map_tun_bridge.port_exists.return_value = False self.mock_tun_bridge = self.ovs_bridges[self.TUN_BRIDGE] self.mock_tun_bridge.add_port.return_value = self.INT_OFPORT self.mock_tun_bridge.add_patch_port.return_value = self.INT_OFPORT self.ipdevice = mock.patch.object(ip_lib, 'IPDevice').start() self.ipwrapper = mock.patch.object(ip_lib, 'IPWrapper').start() add_veth = self.ipwrapper.return_value.add_veth add_veth.return_value = [self.inta, self.intb] self.get_bridges = mock.patch.object(ovs_lib.BaseOVS, 'get_bridges').start() self.get_bridges.return_value = [self.INT_BRIDGE, self.TUN_BRIDGE, self.MAP_TUN_BRIDGE, self.AUX_BRIDGE] self.get_bridge_external_bridge_id = mock.patch.object( ovs_lib.BaseOVS, 'get_bridge_external_bridge_id').start() self.get_bridge_external_bridge_id.side_effect = ( lambda bridge, log_errors: bridge if bridge in self.ovs_bridges else None) self.execute = mock.patch('neutron.agent.common.utils.execute').start() self.mock_check_bridge_datapath_id = mock.patch.object( self.mod_agent.OVSNeutronAgent, '_check_bridge_datapath_id').start() self._define_expected_calls() def _define_expected_calls(self, arp_responder=False, igmp_snooping=False): self.mock_int_bridge_cls_expected = [ mock.call(self.INT_BRIDGE, datapath_type=mock.ANY), ] self.mock_phys_bridge_cls_expected = [ mock.call(self.MAP_TUN_BRIDGE, datapath_type=mock.ANY), ] self.mock_tun_bridge_cls_expected = [ mock.call(self.TUN_BRIDGE, datapath_type=mock.ANY), ] self.mock_int_bridge = self.ovs_bridges[self.INT_BRIDGE] self.mock_int_bridge_expected = [ mock.call.create(), mock.call.set_secure_mode(), mock.call.setup_controllers(mock.ANY), mock.call.set_igmp_snooping_state(igmp_snooping), mock.call.setup_default_table(enable_openflow_dhcp=False, enable_dhcpv6=False), ] self.mock_map_tun_bridge_expected = [ mock.call.create(), mock.call.set_secure_mode(), mock.call.setup_controllers(mock.ANY), mock.call.setup_default_table(), mock.call.port_exists('phy-%s' % self.MAP_TUN_BRIDGE), mock.call.add_patch_port('phy-%s' % self.MAP_TUN_BRIDGE, constants.NONEXISTENT_PEER), ] self.mock_int_bridge_expected += [ mock.call.db_get_val('Interface', 'int-%s' % self.MAP_TUN_BRIDGE, 'type', log_errors=False), mock.call.port_exists('int-%s' % self.MAP_TUN_BRIDGE), mock.call.add_patch_port('int-%s' % self.MAP_TUN_BRIDGE, constants.NONEXISTENT_PEER), mock.call.set_igmp_snooping_flood('int-%s' % self.MAP_TUN_BRIDGE, igmp_snooping), ] self.mock_int_bridge_expected += [ mock.call.drop_port(in_port=self.MAP_TUN_INT_OFPORT), mock.call.set_db_attribute( 'Interface', 'int-%s' % self.MAP_TUN_BRIDGE, 'options', {'peer': 'phy-%s' % self.MAP_TUN_BRIDGE}), ] self.mock_map_tun_bridge_expected += [ mock.call.drop_port(in_port=self.MAP_TUN_PHY_OFPORT), mock.call.set_db_attribute( 'Interface', 'phy-%s' % self.MAP_TUN_BRIDGE, 'options', {'peer': 'int-%s' % self.MAP_TUN_BRIDGE}), ] self.mock_aux_bridge = self.ovs_bridges[self.AUX_BRIDGE] self.mock_aux_bridge_expected = [ ] self.mock_tun_bridge_expected = [ mock.call.create(secure_mode=True), mock.call.setup_controllers(mock.ANY), mock.call.port_exists('patch-int'), mock.ANY, mock.call.add_patch_port('patch-int', 'patch-tun'), ] self.mock_int_bridge_expected += [ mock.call.port_exists('patch-tun'), mock.call.add_patch_port('patch-tun', 'patch-int'), mock.call.set_igmp_snooping_flood('patch-tun', igmp_snooping), ] self.mock_int_bridge_expected += [ mock.call.get_vif_ports((ovs_lib.INVALID_OFPORT, ovs_lib.UNASSIGNED_OFPORT)), mock.call.get_ports_attributes( 'Port', columns=['name', 'other_config', 'tag'], ports=[]) ] self.mock_tun_bridge_expected += [ mock.call.setup_default_table(self.INT_OFPORT, arp_responder), ] self.ipdevice_expected = [] self.ipwrapper_expected = [mock.call()] self.get_bridges_expected = [mock.call(), mock.call()] self.inta_expected = [] self.intb_expected = [] self.execute_expected = [] self.mock_int_bridge_expected += [ mock.call.install_goto( dest_table_id=constants.LOCAL_MAC_DIRECT, in_port=self.MAP_TUN_INT_OFPORT, priority=4, table_id=constants.TRANSIENT_TABLE), mock.call.install_goto( dest_table_id=constants.LOCAL_MAC_DIRECT, in_port=self.TUN_OFPORT, priority=4, table_id=constants.TRANSIENT_TABLE), mock.call.install_goto( dest_table_id=constants.TRANSIENT_EGRESS_TABLE, table_id=constants.LOCAL_MAC_DIRECT), ] def _build_agent(self, **config_opts_agent): """Configure and initialize OVS agent. :param config_opts_agent: a dict with options to override the default values for the AGENT group. """ bridge_classes = { 'br_int': self.mock_int_bridge_cls, 'br_phys': self.mock_phys_bridge_cls, 'br_tun': self.mock_tun_bridge_cls, } cfg.CONF.set_override('integration_bridge', self.INT_BRIDGE, 'OVS') cfg.CONF.set_override('tunnel_bridge', self.TUN_BRIDGE, 'OVS') cfg.CONF.set_override('local_ip', '10.0.0.1', 'OVS') cfg.CONF.set_override('bridge_mappings', self.NET_MAPPING, 'OVS') cfg.CONF.set_override('polling_interval', 2, 'AGENT') cfg.CONF.set_override('tunnel_types', ['gre'], 'AGENT') cfg.CONF.set_override('minimize_polling', False, 'AGENT') cfg.CONF.set_override('enable_ipv6', False, 'DHCP') for k, v in config_opts_agent.items(): cfg.CONF.set_override(k, v, 'AGENT') ext_mgr = mock.Mock() ext_mgr.names = mock.Mock(return_value=[]) agent = self.mod_agent.OVSNeutronAgent( bridge_classes, ext_mgr, cfg.CONF) mock.patch.object(agent.ovs.ovsdb, 'idl_monitor').start() return agent def _verify_mock_call(self, mock_obj, expected): mock_obj.assert_has_calls(expected) self.assertEqual(expected, mock_obj.mock_calls) def _verify_mock_calls(self): self._verify_mock_call(self.mock_int_bridge_cls, self.mock_int_bridge_cls_expected) self._verify_mock_call(self.mock_tun_bridge_cls, self.mock_tun_bridge_cls_expected) self._verify_mock_call(self.mock_phys_bridge_cls, self.mock_phys_bridge_cls_expected) self._verify_mock_call(self.mock_int_bridge, self.mock_int_bridge_expected) self._verify_mock_call(self.mock_map_tun_bridge, self.mock_map_tun_bridge_expected) self._verify_mock_call(self.mock_tun_bridge, self.mock_tun_bridge_expected) self._verify_mock_call(self.mock_aux_bridge, self.mock_aux_bridge_expected) self._verify_mock_call(self.ipdevice, self.ipdevice_expected) self._verify_mock_call(self.get_bridges, self.get_bridges_expected) self._verify_mock_call(self.inta, self.inta_expected) self._verify_mock_call(self.intb, self.intb_expected) self._verify_mock_call(self.execute, self.execute_expected) def test_construct(self): agent = self._build_agent() self.assertEqual(agent.agent_id, 'ovs-agent-%s' % cfg.CONF.host) self._verify_mock_calls() # TODO(ethuleau): Initially, local ARP responder is be dependent to the # ML2 l2 population mechanism driver. # The next two tests use l2_pop flag to test ARP responder def test_construct_with_arp_responder(self): self._build_agent(l2_population=True, arp_responder=True) self._define_expected_calls(arp_responder=True) self._verify_mock_calls() def test_construct_with_igmp_snooping(self): cfg.CONF.set_override('igmp_snooping_enable', True, 'OVS') self._build_agent() self._define_expected_calls(igmp_snooping=True) self._verify_mock_calls() def test_construct_without_arp_responder(self): self._build_agent(l2_population=False, arp_responder=True) self._verify_mock_calls() def test_construct_vxlan(self): self._build_agent(tunnel_types=['vxlan']) self._verify_mock_calls() def test_provision_local_vlan(self): ofports = list(TUN_OFPORTS[n_const.TYPE_GRE].values()) self.mock_tun_bridge_expected += [ mock.call.install_flood_to_tun(LV_ID, LS_ID, ofports), mock.call.provision_local_vlan( network_type=n_const.TYPE_GRE, lvid=LV_ID, segmentation_id=LS_ID), ] a = self._build_agent() a.available_local_vlans = set([LV_ID]) a.tun_br_ofports = TUN_OFPORTS a.provision_local_vlan(NET_UUID, n_const.TYPE_GRE, None, LS_ID) self._verify_mock_calls() def test_provision_local_vlan_flat(self): self.mock_map_tun_bridge_expected.append( mock.call.provision_local_vlan( port=self.MAP_TUN_PHY_OFPORT, lvid=LV_ID, segmentation_id=None, distributed=False)) self.mock_int_bridge_expected.append( mock.call.provision_local_vlan( port=self.INT_OFPORT, lvid=LV_ID, segmentation_id=None)) a = self._build_agent() a.available_local_vlans = set([LV_ID]) a.phys_brs['net1'] = self.mock_map_tun_bridge a.phys_ofports['net1'] = self.MAP_TUN_PHY_OFPORT a.int_ofports['net1'] = self.INT_OFPORT a.provision_local_vlan(NET_UUID, n_const.TYPE_FLAT, 'net1', LS_ID) self._verify_mock_calls() def test_provision_local_vlan_flat_fail(self): a = self._build_agent() a.provision_local_vlan(NET_UUID, n_const.TYPE_FLAT, 'net2', LS_ID) self._verify_mock_calls() def test_provision_local_vlan_vlan(self): self.mock_map_tun_bridge_expected.append( mock.call.provision_local_vlan( port=self.MAP_TUN_PHY_OFPORT, lvid=LV_ID, segmentation_id=LS_ID, distributed=False)) self.mock_int_bridge_expected.append( mock.call.provision_local_vlan( port=self.INT_OFPORT, lvid=LV_ID, segmentation_id=LS_ID)) a = self._build_agent() a.available_local_vlans = set([LV_ID]) a.phys_brs['net1'] = self.mock_map_tun_bridge a.phys_ofports['net1'] = self.MAP_TUN_PHY_OFPORT a.int_ofports['net1'] = self.INT_OFPORT a.provision_local_vlan(NET_UUID, n_const.TYPE_VLAN, 'net1', LS_ID) self._verify_mock_calls() def test_provision_local_vlan_vlan_fail(self): a = self._build_agent() a.provision_local_vlan(NET_UUID, n_const.TYPE_VLAN, 'net2', LS_ID) self._verify_mock_calls() def test_reclaim_local_vlan(self): self.mock_tun_bridge_expected += [ mock.call.reclaim_local_vlan(network_type='gre', segmentation_id=LS_ID), mock.call.delete_flood_to_tun(LV_ID), mock.call.delete_unicast_to_tun(LV_ID, None), mock.call.delete_arp_responder(LV_ID, None), ] a = self._build_agent() a.available_local_vlans = set() a.vlan_manager.add(NET_UUID, *self.LVM_DATA) a.reclaim_local_vlan(NET_UUID) self.assertIn(self.LVM_DATA[0], a.available_local_vlans) self._verify_mock_calls() def test_reclaim_local_vlan_flat(self): self.mock_map_tun_bridge_expected.append( mock.call.reclaim_local_vlan( port=self.MAP_TUN_PHY_OFPORT, lvid=self.LVM_FLAT_DATA[0])) self.mock_int_bridge_expected.append( mock.call.reclaim_local_vlan( port=self.INT_OFPORT, segmentation_id=None)) a = self._build_agent() a.phys_brs['net1'] = self.mock_map_tun_bridge a.phys_ofports['net1'] = self.MAP_TUN_PHY_OFPORT a.int_ofports['net1'] = self.INT_OFPORT a.available_local_vlans = set() a.vlan_manager.add(NET_UUID, *self.LVM_FLAT_DATA) a.reclaim_local_vlan(NET_UUID) self.assertIn(self.LVM_FLAT_DATA[0], a.available_local_vlans) self._verify_mock_calls() def test_reclaim_local_vlan_vlan(self): self.mock_map_tun_bridge_expected.append( mock.call.reclaim_local_vlan( port=self.MAP_TUN_PHY_OFPORT, lvid=self.LVM_VLAN_DATA[0])) self.mock_int_bridge_expected.append( mock.call.reclaim_local_vlan( port=self.INT_OFPORT, segmentation_id=LS_ID)) a = self._build_agent() a.phys_brs['net1'] = self.mock_map_tun_bridge a.phys_ofports['net1'] = self.MAP_TUN_PHY_OFPORT a.int_ofports['net1'] = self.INT_OFPORT a.available_local_vlans = set() a.vlan_manager.add(NET_UUID, *self.LVM_VLAN_DATA) a.reclaim_local_vlan(NET_UUID) self.assertIn(self.LVM_VLAN_DATA[0], a.available_local_vlans) self._verify_mock_calls() def test_port_bound(self): vlan_mapping = {'segmentation_id': str(LS_ID), 'physical_network': 'None', 'net_uuid': NET_UUID, 'network_type': 'gre'} self.mock_int_bridge_expected += [ mock.call.db_get_val('Port', 'port', 'other_config'), mock.call.set_db_attribute('Port', VIF_PORT.port_name, 'other_config', vlan_mapping)] a = self._build_agent() a.vlan_manager.add(NET_UUID, *self.LVM_DATA) a.local_dvr_map = {} self.ovs_bridges[self.INT_BRIDGE].db_get_val.return_value = {} a.port_bound(VIF_PORT, NET_UUID, 'gre', None, LS_ID, FIXED_IPS, VM_DEVICE_OWNER, False) self._verify_mock_calls() def test_port_unbound(self): with mock.patch.object(self.mod_agent.OVSNeutronAgent, 'reclaim_local_vlan') as reclaim_local_vlan: a = self._build_agent() a.vlan_manager.add(NET_UUID, *self.LVM_DATA) a.port_unbound(VIF_ID, NET_UUID) reclaim_local_vlan.assert_called_once_with(NET_UUID) self._verify_mock_calls() def test_port_dead(self): self.mock_int_bridge_expected += [ mock.call.db_get_val('Port', VIF_PORT.port_name, 'tag', log_errors=True), mock.call.set_db_attribute( 'Port', VIF_PORT.port_name, 'tag', constants.DEAD_VLAN_TAG, log_errors=True), mock.call.drop_port(in_port=VIF_PORT.ofport), ] a = self._build_agent() a.available_local_vlans = set([LV_ID]) a.vlan_manager.add(NET_UUID, *self.LVM_DATA) self.ovs_bridges[self.INT_BRIDGE].db_get_val.return_value = mock.Mock() a.port_dead(VIF_PORT) self._verify_mock_calls() def test_tunnel_update(self): tunnel_port = '9999' self.mock_tun_bridge.add_tunnel_port.return_value = tunnel_port self.mock_tun_bridge_expected += [ mock.call.add_tunnel_port('gre-0a000a01', '10.0.10.1', '10.0.0.1', 'gre', 4789, True, False, None), mock.call.setup_tunnel_port('gre', tunnel_port), ] a = self._build_agent() a.tunnel_update( mock.sentinel.ctx, tunnel_ip='10.0.10.1', tunnel_type=n_const.TYPE_GRE) self._verify_mock_calls() def test_tunnel_update_self(self): a = self._build_agent() a.tunnel_update( mock.sentinel.ctx, tunnel_ip='10.0.0.1') self._verify_mock_calls() def test_daemon_loop(self): reply_ge_1 = {'added': [{'name': 'tap0', 'ofport': 3, 'external_ids': { 'attached-mac': 'test_mac'}}], 'removed': []} reply_ge_2 = {'added': [], 'removed': [{'name': 'tap0', 'ofport': 3, 'external_ids': { 'attached-mac': 'test_mac'}}]} reply_pe_1 = {'current': set(['tap0']), 'added': set(['tap0']), 'removed': set([])} reply_pe_2 = {'current': set([]), 'added': set([]), 'removed': set(['tap0'])} reply_ancillary = {'current': set([]), 'added': set([]), 'removed': set([])} self.mock_int_bridge_expected += [ mock.call.check_canary_table(), mock.call.deferred(full_ordered=True, use_bundle=True), mock.call.deferred().__enter__(), mock.call.deferred().__exit__(None, None, None), mock.call.cleanup_flows(), mock.call.check_canary_table(), mock.call.deferred(full_ordered=True, use_bundle=True), mock.call.deferred().__enter__(), mock.call.deferred().__exit__(None, None, None), ] self.mock_map_tun_bridge_expected += [ mock.call.cleanup_flows(), ] self.mock_tun_bridge_expected += [ mock.call.cleanup_flows() ] # No cleanup is expected on ancillary bridge self.ovs_bridges[self.INT_BRIDGE].check_canary_table.return_value = \ constants.OVS_NORMAL with mock.patch.object(log.KeywordArgumentAdapter, 'exception') as log_exception,\ mock.patch.object(self.mod_agent.OVSNeutronAgent, 'process_ports_events') as process_p_events,\ mock.patch.object( self.mod_agent.OVSNeutronAgent, 'process_network_ports') as process_network_ports,\ mock.patch.object(self.mod_agent.OVSNeutronAgent, 'tunnel_sync'),\ mock.patch.object(time, 'sleep'),\ mock.patch.object( self.mod_agent.OVSNeutronAgent, 'update_stale_ofport_rules') as update_stale: log_exception.side_effect = Exception( 'Fake exception to get out of the loop') update_stale.return_value = [] devices_not_ready = set() process_p_events.side_effect = [ (reply_pe_1, reply_ancillary, devices_not_ready), (reply_pe_2, reply_ancillary, devices_not_ready)] interface_polling = mock.Mock() interface_polling.get_events.side_effect = [reply_ge_1, reply_ge_2] failed_devices = {'removed': set([]), 'added': set([])} failed_ancillary_devices = {'removed': set([]), 'added': set([])} process_network_ports.side_effect = [ failed_devices, Exception('Fake exception to get out of the loop')] n_agent = self._build_agent() # Hack to test loop # We start method and expect it will raise after 2nd loop # If something goes wrong, assert_has_calls below will catch it try: n_agent.rpc_loop(interface_polling) except Exception: pass # FIXME(salv-orlando): There should not be assertions on log # messages log_exception.assert_called_once_with( "Error while processing VIF ports") process_p_events.assert_has_calls([ mock.call(reply_ge_1, set(), set(), devices_not_ready, failed_devices, failed_ancillary_devices, set()), mock.call(reply_ge_2, set(['tap0']), set(), devices_not_ready, failed_devices, failed_ancillary_devices, set()) ]) process_network_ports.assert_has_calls([ mock.call({'current': set(['tap0']), 'removed': set([]), 'added': set(['tap0'])}, False), ]) self.assertTrue(update_stale.called) self._verify_mock_calls() class TunnelTestOSKen(TunnelTest, ovs_test_base.OVSOSKenTestBase): pass
# Copyright (c) 2012-2022, Mark Peek <mark@peek.org> # All rights reserved. # # See LICENSE file for full license. # # *** Do not modify - this file is autogenerated *** from . import AWSObject, AWSProperty, PropsDictType, Tags from .validators import boolean, integer class LoggingProperties(AWSProperty): """ `LoggingProperties <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-properties-redshift-cluster-loggingproperties.html>`__ """ props: PropsDictType = { "BucketName": (str, True), "S3KeyPrefix": (str, False), } class Cluster(AWSObject): """ `Cluster <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-resource-redshift-cluster.html>`__ """ resource_type = "AWS::Redshift::Cluster" props: PropsDictType = { "AllowVersionUpgrade": (boolean, False), "AquaConfigurationStatus": (str, False), "AutomatedSnapshotRetentionPeriod": (integer, False), "AvailabilityZone": (str, False), "AvailabilityZoneRelocation": (boolean, False), "AvailabilityZoneRelocationStatus": (str, False), "Classic": (boolean, False), "ClusterIdentifier": (str, False), "ClusterParameterGroupName": (str, False), "ClusterSecurityGroups": ([str], False), "ClusterSubnetGroupName": (str, False), "ClusterType": (str, True), "ClusterVersion": (str, False), "DBName": (str, True), "DeferMaintenance": (boolean, False), "DeferMaintenanceDuration": (integer, False), "DeferMaintenanceEndTime": (str, False), "DeferMaintenanceStartTime": (str, False), "DestinationRegion": (str, False), "ElasticIp": (str, False), "Encrypted": (boolean, False), "EnhancedVpcRouting": (boolean, False), "HsmClientCertificateIdentifier": (str, False), "HsmConfigurationIdentifier": (str, False), "IamRoles": ([str], False), "KmsKeyId": (str, False), "LoggingProperties": (LoggingProperties, False), "MaintenanceTrackName": (str, False), "ManualSnapshotRetentionPeriod": (integer, False), "MasterUserPassword": (str, True), "MasterUsername": (str, True), "NodeType": (str, True), "NumberOfNodes": (integer, False), "OwnerAccount": (str, False), "Port": (integer, False), "PreferredMaintenanceWindow": (str, False), "PubliclyAccessible": (boolean, False), "ResourceAction": (str, False), "RevisionTarget": (str, False), "RotateEncryptionKey": (boolean, False), "SnapshotClusterIdentifier": (str, False), "SnapshotCopyGrantName": (str, False), "SnapshotCopyManual": (boolean, False), "SnapshotCopyRetentionPeriod": (integer, False), "SnapshotIdentifier": (str, False), "Tags": (Tags, False), "VpcSecurityGroupIds": ([str], False), } class AmazonRedshiftParameter(AWSProperty): """ `AmazonRedshiftParameter <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-property-redshift-clusterparametergroup-parameter.html>`__ """ props: PropsDictType = { "ParameterName": (str, True), "ParameterValue": (str, True), } class ClusterParameterGroup(AWSObject): """ `ClusterParameterGroup <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-resource-redshift-clusterparametergroup.html>`__ """ resource_type = "AWS::Redshift::ClusterParameterGroup" props: PropsDictType = { "Description": (str, True), "ParameterGroupFamily": (str, True), "Parameters": ([AmazonRedshiftParameter], False), "Tags": (Tags, False), } class ClusterSecurityGroup(AWSObject): """ `ClusterSecurityGroup <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-resource-redshift-clustersecuritygroup.html>`__ """ resource_type = "AWS::Redshift::ClusterSecurityGroup" props: PropsDictType = { "Description": (str, True), "Tags": (Tags, False), } class ClusterSecurityGroupIngress(AWSObject): """ `ClusterSecurityGroupIngress <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-resource-redshift-clustersecuritygroupingress.html>`__ """ resource_type = "AWS::Redshift::ClusterSecurityGroupIngress" props: PropsDictType = { "CIDRIP": (str, False), "ClusterSecurityGroupName": (str, True), "EC2SecurityGroupName": (str, False), "EC2SecurityGroupOwnerId": (str, False), } class ClusterSubnetGroup(AWSObject): """ `ClusterSubnetGroup <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-resource-redshift-clustersubnetgroup.html>`__ """ resource_type = "AWS::Redshift::ClusterSubnetGroup" props: PropsDictType = { "Description": (str, True), "SubnetIds": ([str], True), "Tags": (Tags, False), } class EndpointAccess(AWSObject): """ `EndpointAccess <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-resource-redshift-endpointaccess.html>`__ """ resource_type = "AWS::Redshift::EndpointAccess" props: PropsDictType = { "ClusterIdentifier": (str, False), "EndpointName": (str, True), "ResourceOwner": (str, False), "SubnetGroupName": (str, False), "VpcSecurityGroupIds": ([str], True), } class EndpointAuthorization(AWSObject): """ `EndpointAuthorization <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-resource-redshift-endpointauthorization.html>`__ """ resource_type = "AWS::Redshift::EndpointAuthorization" props: PropsDictType = { "Account": (str, True), "ClusterIdentifier": (str, True), "Force": (boolean, False), "VpcIds": ([str], False), } class EventSubscription(AWSObject): """ `EventSubscription <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-resource-redshift-eventsubscription.html>`__ """ resource_type = "AWS::Redshift::EventSubscription" props: PropsDictType = { "Enabled": (boolean, False), "EventCategories": ([str], False), "Severity": (str, False), "SnsTopicArn": (str, False), "SourceIds": ([str], False), "SourceType": (str, False), "SubscriptionName": (str, True), "Tags": (Tags, False), } class PauseClusterMessage(AWSProperty): """ `PauseClusterMessage <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-properties-redshift-scheduledaction-pauseclustermessage.html>`__ """ props: PropsDictType = { "ClusterIdentifier": (str, True), } class ResizeClusterMessage(AWSProperty): """ `ResizeClusterMessage <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-properties-redshift-scheduledaction-resizeclustermessage.html>`__ """ props: PropsDictType = { "Classic": (boolean, False), "ClusterIdentifier": (str, True), "ClusterType": (str, False), "NodeType": (str, False), "NumberOfNodes": (integer, False), } class ResumeClusterMessage(AWSProperty): """ `ResumeClusterMessage <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-properties-redshift-scheduledaction-resumeclustermessage.html>`__ """ props: PropsDictType = { "ClusterIdentifier": (str, True), } class ScheduledActionType(AWSProperty): """ `ScheduledActionType <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-properties-redshift-scheduledaction-scheduledactiontype.html>`__ """ props: PropsDictType = { "PauseCluster": (PauseClusterMessage, False), "ResizeCluster": (ResizeClusterMessage, False), "ResumeCluster": (ResumeClusterMessage, False), } class ScheduledAction(AWSObject): """ `ScheduledAction <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-resource-redshift-scheduledaction.html>`__ """ resource_type = "AWS::Redshift::ScheduledAction" props: PropsDictType = { "Enable": (boolean, False), "EndTime": (str, False), "IamRole": (str, False), "Schedule": (str, False), "ScheduledActionDescription": (str, False), "ScheduledActionName": (str, True), "StartTime": (str, False), "TargetAction": (ScheduledActionType, False), } class Endpoint(AWSProperty): """ `Endpoint <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-properties-redshift-cluster-endpoint.html>`__ """ props: PropsDictType = { "Address": (str, False), "Port": (str, False), } class VpcSecurityGroup(AWSProperty): """ `VpcSecurityGroup <http://docs.aws.amazon.com/AWSCloudFormation/latest/UserGuide/aws-properties-redshift-endpointaccess-vpcsecuritygroup.html>`__ """ props: PropsDictType = { "Status": (str, False), "VpcSecurityGroupId": (str, False), }
""" A sudoku game solver. (c) 2015 Brandon L. Reiss """ from collections import Counter from copy import copy, deepcopy from itertools import ifilter import logging from random import shuffle, randint LOGGER = logging.getLogger(__name__) def format_board(board): """ Pretty format a board. ########################################### #|---+---+---|#|---+---+---|#|---+---+---|# #|123|12 |1 |#|123|12 |1 |#|123|12 |1 |# #|456| 5 |4 |#|456| 5 |4 |#|456| 5 |4 |# #|789|7 | 8 |#|789|7 | 8 |#|789|7 | 8 |# #|---+---+---|#|---+---+---|#|---+---+---|# ... #|---+---+---|#|---+---+---|#|---+---+---|# ########################################### #|---+---+---|#|---+---+---|#|---+---+---|# ... ########################################### Each 3x3 block is outlined by '#' and each value is outlined by '|-+'. :return list: list of strings representing lines of the formatted board """ def outer_border_row(): return "###########################################" def inner_border_row(): return "#|---+---+---|#|---+---+---|#|---+---+---|#" def format_row(row): fmt_rows = [] # Generate rows for grid values 123, 456, 789. for val_div in xrange(3): # Generate strings of either space or matched possible values for # every cell in the row for this subset of possible values 1-9. possible_vals = range((3 * val_div) + 1, (3 * val_div) + 4) row_vals = [ ''.join(str(pval) if pval in values else ' ' for pval in possible_vals) for values in row] # Loop over the 3 3x3 block sections. by_block = [] for blk_idx in xrange(3): block_expanded = '|'.join(row_vals[3 * blk_idx:(3 * blk_idx) + 3]) by_block.append('|{}|'.format(block_expanded)) fmt_rows.append('#{}#'.format('#'.join(by_block))) return fmt_rows rows = [outer_border_row()] # Loop over the 3 3x3 block sections. for block_div in xrange(3): rows.append(inner_border_row()) for row in board[3 * block_div:(3 * block_div) + 3]: rows.extend(format_row(row)) rows.append(inner_border_row()) rows.append(outer_border_row()) return rows def solve(initial_board): """ Solve a Sudoku puzzle. :param list initial_board: list of lists of either digits in [1, 9] or None indicating known and vacant spaces of a Sudoku puzzle. :return list solution: list of lists of digits in [1, 9] representing the solved puzzle configuration; there are no vacant spaces in a solution. :raise ValueError: if the board is unsolvable as determined by the Sudoku game invariants. """ def _check_elim_row_col(select_pred, counts, iter_rc): """ A DRY method for checking a row or column for a forced move. Separates spaces selected from those that have only one possible value remaining. These are accumulated into unique_not_selected and the first is returned. """ for i, counted in enumerate(counts): selected_values = set(next(iter(board[sel_i][sel_j])) for sel_i, sel_j in selected if select_pred(sel_i, sel_j, i)) unique_values = set(val for val, count in counted.iteritems() if count == 1) unique_not_selected = unique_values - selected_values # Select the first unique-but-not-yet-selected value. if len(unique_not_selected) > 0: value = next(iter(unique_not_selected)) j = next(idx for idx, values in enumerate(iter_rc(board, i)) if value in values) return (i, j), value return None, None def check_elim_row(row_counts): return _check_elim_row_col(lambda sel_i, _, i: i == sel_i, row_counts, lambda board, i: iter(board[i])) def check_elim_col(col_counts): return _check_elim_row_col(lambda _, sel_j, j: j == sel_j, col_counts, lambda board, j: (row[j] for row in board)) def board_is_valid(board, row_counts, col_counts): """ Look for - any space that has zero possible values - any row where at least one value in [1, 9] is impossible - any column where at least one value in [1, 9] is impossible :returns: True when the board is valid and False otherwise """ empty_space = next((True for row in board for values in row if len(values) == 0), False) if empty_space: return False empty_count = lambda counts: any(count == 0 for count in counts.itervalues()) empty_row_count = next((True for counts in row_counts if empty_count(counts)), False) if empty_row_count: return False empty_col_count = next((True for counts in col_counts if empty_count(counts)), False) if empty_col_count: return False return True def set_value(board, value, i, j, row_counts, col_counts): """ Set value (i, j) within the board. Values must be eliminated within the local 3x3 block as well as down the row and column. """ # Get 3x3 block address. block_i = i / 3 block_j = j / 3 # Eliminate value from block. for my_i, row in enumerate(board[3 * block_i:(3 * block_i) + 3], 3 * block_i): for my_j, values in enumerate(row[3 * block_j:(3 * block_j) + 3], 3 * block_j): if value in values: values.remove(value) row_counts[my_i][value] -= 1 col_counts[my_j][value] -= 1 # Eliminate value from row. for my_j, values in enumerate(board[i]): if value in values: values.discard(value) row_counts[i][value] -= 1 col_counts[my_j][value] -= 1 # Eliminate value from column. for my_i, values in enumerate(row[j] for row in board): if value in values: values.discard(value) row_counts[my_i][value] -= 1 col_counts[j][value] -= 1 # Set the value. row_counts[i][value] = 1 col_counts[j][value] = 1 for discard_value in board[i][j]: row_counts[i][discard_value] -= 1 col_counts[j][discard_value] -= 1 board[i][j] = set((value,)) # Move type flags. move_type_elim, \ move_type_row_elim, \ move_type_col_elim, \ move_type_guess = range(4) move_type_to_str = { move_type_elim : "elimination", move_type_row_elim : "row elimination", move_type_col_elim : "col elimination", move_type_guess : "guess", } board = [[set(xrange(1, 10)) for _ in xrange(9)] for _ in xrange(9)] row_counts = [Counter(v for values in row for v in values) for row in board] col_counts = [Counter(v for row in board for v in row[j]) for j in xrange(9)] selected = set() for i, j, value in ((i, j, value) for i, row in enumerate(initial_board) for j, value in enumerate(row) if value is not None): #print "Setting ({}, {}) = {}".format(i, j, value) set_value(board, value, i, j, row_counts, col_counts) selected.add((i,j)) #print '\n'.join(format_board(board)) num_set_initially = len(selected) #print 'Initial board:' #print '\n'.join(format_board(board)) #raw_input("Continue...") #print 'num_set_initially:', num_set_initially failed_guesses = 0 longest_discarded_moves = 0 move_counter = 0 board_stack = [] while True: # Check whether or not the board is still valid. if not board_is_valid(board, row_counts, col_counts): # If we didn't guess previously, then this board is no good. if len(board_stack) == 0: raise ValueError("Puzzle is invalid and therefore unsolvable.\n" '\n'.join(format_board(board))) failed_guesses += 1 # Pop the board state and update the counts. move_count, board, selected = board_stack.pop() row_counts = [Counter(v for values in row for v in values) for row in board] col_counts = [Counter(v for row in board for v in row[j]) for j in xrange(9)] discarded_moves = move_counter - move_count longest_discarded_moves = max(discarded_moves, longest_discarded_moves) #print "Guess after move {} failed after {} moves".format( # move_count, discarded_moves) #print '\n'.join(format_board(board)) #raw_input("Continue...") # All done? if len(selected) == 81: break next_move = None # Check for naive unique value (only remaining choice). try: i, j = next(((i, j) for i, row in enumerate(board) for j, values in enumerate(row) if len(values) == 1 and (i, j) not in selected)) next_move = (i, j), next(iter(board[i][j])), move_type_elim except StopIteration: pass # Check for unique value within a row. if next_move is None: ij_pre, value = check_elim_row(row_counts) if ij_pre is not None: i, j = ij_pre next_move = (i, j), value, move_type_row_elim # Check for unique value within a column. if next_move is None: ji_pre, value = check_elim_col(col_counts) if ji_pre is not None: j, i = ji_pre next_move = (i, j), value, move_type_col_elim # See if we must guess. All forced moves are exhausted here. if next_move is None: # Find a good place to guess. count_values = [(len(values), i, j) for i, row in enumerate(board) for j, values in enumerate(row) if len(values) > 1] min_remaining, _, _ = min(count_values) min_values = [(i, j) for count, i, j in count_values if count == min_remaining] # Get a random guess location with the min possible values # remaining. i, j = min_values[randint(0, len(min_values) - 1)] # Guess and push the world. value = next(iter(board[i][j])) board_copy, selected_copy = deepcopy(board), copy(selected) board_copy[i][j].discard(value) board_stack.append((move_counter, board_copy, selected_copy)) next_move = (i, j), value, move_type_guess #print '\n'.join(format_board(board)) #raw_input("Continue...") # We must have found a move by now since the board is valid and we can # guess. (i, j), value, move_type = next_move move_counter += 1 #print '{:3d} : Picked ({},{}) = {} ({})'.format( # move_counter, i, j, value, move_type_to_str[move_type]) set_value(board, value, i, j, row_counts, col_counts) selected.add((i, j)) #print '\n'.join(format_board(board)) #raw_input("Continue...") moves_to_solve_directly = 81 - num_set_initially LOGGER.info("Solved after {} moves with {} discarded from {} failed guesses".format( move_counter, move_counter - moves_to_solve_directly, failed_guesses)) LOGGER.info("Longest discarded move sequence: {}".format(longest_discarded_moves)) return [[next(iter(values)) for values in row] for row in board]
# Copyright 2012 OpenStack Foundation # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import copy import io import logging import socket from keystoneauth1 import adapter from keystoneauth1 import exceptions as ksa_exc import OpenSSL from oslo_utils import importutils from oslo_utils import netutils import requests import urllib.parse try: import json except ImportError: import simplejson as json from oslo_utils import encodeutils from glanceclient.common import utils from glanceclient import exc osprofiler_web = importutils.try_import("osprofiler.web") LOG = logging.getLogger(__name__) USER_AGENT = 'python-glanceclient' CHUNKSIZE = 1024 * 64 # 64kB REQ_ID_HEADER = 'X-OpenStack-Request-ID' TOKEN_HEADERS = ['X-Auth-Token', 'X-Service-Token'] def encode_headers(headers): """Encodes headers. Note: This should be used right before sending anything out. :param headers: Headers to encode :returns: Dictionary with encoded headers' names and values """ # NOTE(rosmaita): This function's rejection of any header name without a # corresponding value is arguably justified by RFC 7230. In any case, that # behavior was already here and there is an existing unit test for it. # Bug #1766235: According to RFC 8187, headers must be encoded as ASCII. # So we first %-encode them to get them into range < 128 and then turn # them into ASCII. encoded_dict = {} for h, v in headers.items(): if v is not None: # if the item is token, do not quote '+' as well. # NOTE(imacdonn): urllib.parse.quote() is intended for quoting the # path part of a URL, but headers like x-image-meta-location # include an entire URL. We should avoid encoding the colon in # this case (bug #1788942) safe = '=+/' if h in TOKEN_HEADERS else '/:' key = urllib.parse.quote(h, safe) value = urllib.parse.quote(v, safe) encoded_dict[key] = value return dict((encodeutils.safe_encode(h, encoding='ascii'), encodeutils.safe_encode(v, encoding='ascii')) for h, v in encoded_dict.items()) class _BaseHTTPClient(object): @staticmethod def _chunk_body(body): chunk = body while chunk: chunk = body.read(CHUNKSIZE) if not chunk: break yield chunk def _set_common_request_kwargs(self, headers, kwargs): """Handle the common parameters used to send the request.""" # Default Content-Type is octet-stream content_type = headers.get('Content-Type', 'application/octet-stream') # NOTE(jamielennox): remove this later. Managers should pass json= if # they want to send json data. data = kwargs.pop("data", None) if data is not None and not isinstance(data, str): try: data = json.dumps(data) content_type = 'application/json' except TypeError: # Here we assume it's # a file-like object # and we'll chunk it data = self._chunk_body(data) headers['Content-Type'] = content_type kwargs['stream'] = content_type == 'application/octet-stream' return data def _handle_response(self, resp): if not resp.ok: LOG.debug("Request returned failure status %s.", resp.status_code) raise exc.from_response(resp, resp.content) elif (resp.status_code == requests.codes.MULTIPLE_CHOICES and resp.request.path_url != '/versions'): # NOTE(flaper87): Eventually, we'll remove the check on `versions` # which is a bug (1491350) on the server. raise exc.from_response(resp) content_type = resp.headers.get('Content-Type') # Read body into string if it isn't obviously image data if content_type == 'application/octet-stream': # Do not read all response in memory when downloading an image. body_iter = _close_after_stream(resp, CHUNKSIZE) else: content = resp.text if content_type and content_type.startswith('application/json'): # Let's use requests json method, it should take care of # response encoding body_iter = resp.json() else: body_iter = io.StringIO(content) try: body_iter = json.loads(''.join([c for c in body_iter])) except ValueError: body_iter = None return resp, body_iter class HTTPClient(_BaseHTTPClient): def __init__(self, endpoint, **kwargs): self.endpoint = endpoint self.identity_headers = kwargs.get('identity_headers') self.auth_token = kwargs.get('token') self.language_header = kwargs.get('language_header') self.global_request_id = kwargs.get('global_request_id') if self.identity_headers: self.auth_token = self.identity_headers.pop('X-Auth-Token', self.auth_token) self.session = requests.Session() self.session.headers["User-Agent"] = USER_AGENT if self.language_header: self.session.headers["Accept-Language"] = self.language_header self.timeout = float(kwargs.get('timeout', 600)) if self.endpoint.startswith("https"): if kwargs.get('insecure', False) is True: self.session.verify = False else: if kwargs.get('cacert', None) != '': self.session.verify = kwargs.get('cacert', True) self.session.cert = (kwargs.get('cert_file'), kwargs.get('key_file')) def __del__(self): if self.session: try: self.session.close() except Exception as e: LOG.exception(e) finally: self.session = None @staticmethod def parse_endpoint(endpoint): return netutils.urlsplit(endpoint) def log_curl_request(self, method, url, headers, data, kwargs): curl = ['curl -g -i -X %s' % method] headers = copy.deepcopy(headers) headers.update(self.session.headers) for (key, value) in headers.items(): header = '-H \'%s: %s\'' % utils.safe_header(key, value) curl.append(header) if not self.session.verify: curl.append('-k') else: if isinstance(self.session.verify, str): curl.append(' --cacert %s' % self.session.verify) if self.session.cert: curl.append(' --cert %s --key %s' % self.session.cert) if data and isinstance(data, str): curl.append('-d \'%s\'' % data) curl.append(url) msg = ' '.join([encodeutils.safe_decode(item, errors='ignore') for item in curl]) LOG.debug(msg) @staticmethod def log_http_response(resp): status = (resp.raw.version / 10.0, resp.status_code, resp.reason) dump = ['\nHTTP/%.1f %s %s' % status] headers = resp.headers.items() dump.extend(['%s: %s' % utils.safe_header(k, v) for k, v in headers]) dump.append('') content_type = resp.headers.get('Content-Type') if content_type != 'application/octet-stream': dump.extend([resp.text, '']) LOG.debug('\n'.join([encodeutils.safe_decode(x, errors='ignore') for x in dump])) def _request(self, method, url, **kwargs): """Send an http request with the specified characteristics. Wrapper around httplib.HTTP(S)Connection.request to handle tasks such as setting headers and error handling. """ # Copy the kwargs so we can reuse the original in case of redirects headers = copy.deepcopy(kwargs.pop('headers', {})) if self.identity_headers: for k, v in self.identity_headers.items(): headers.setdefault(k, v) data = self._set_common_request_kwargs(headers, kwargs) # add identity header to the request if not headers.get('X-Auth-Token'): headers['X-Auth-Token'] = self.auth_token if self.global_request_id: headers.setdefault(REQ_ID_HEADER, self.global_request_id) if osprofiler_web: headers.update(osprofiler_web.get_trace_id_headers()) # Note(flaper87): Before letting headers / url fly, # they should be encoded otherwise httplib will # complain. headers = encode_headers(headers) if self.endpoint.endswith("/") or url.startswith("/"): conn_url = "%s%s" % (self.endpoint, url) else: conn_url = "%s/%s" % (self.endpoint, url) self.log_curl_request(method, conn_url, headers, data, kwargs) try: resp = self.session.request(method, conn_url, data=data, headers=headers, timeout=self.timeout, **kwargs) except requests.exceptions.Timeout as e: message = ("Error communicating with %(url)s: %(e)s" % dict(url=conn_url, e=e)) raise exc.InvalidEndpoint(message=message) except requests.exceptions.ConnectionError as e: message = ("Error finding address for %(url)s: %(e)s" % dict(url=conn_url, e=e)) raise exc.CommunicationError(message=message) except socket.gaierror as e: message = "Error finding address for %s: %s" % ( self.endpoint_hostname, e) raise exc.InvalidEndpoint(message=message) except (socket.error, socket.timeout, IOError) as e: endpoint = self.endpoint message = ("Error communicating with %(endpoint)s %(e)s" % {'endpoint': endpoint, 'e': e}) raise exc.CommunicationError(message=message) except OpenSSL.SSL.Error as e: message = ("SSL Error communicating with %(url)s: %(e)s" % {'url': conn_url, 'e': e}) raise exc.CommunicationError(message=message) # log request-id for each api call request_id = resp.headers.get('x-openstack-request-id') if request_id: LOG.debug('%(method)s call to image for ' '%(url)s used request id ' '%(response_request_id)s', {'method': resp.request.method, 'url': resp.url, 'response_request_id': request_id}) resp, body_iter = self._handle_response(resp) self.log_http_response(resp) return resp, body_iter def head(self, url, **kwargs): return self._request('HEAD', url, **kwargs) def get(self, url, **kwargs): return self._request('GET', url, **kwargs) def post(self, url, **kwargs): return self._request('POST', url, **kwargs) def put(self, url, **kwargs): return self._request('PUT', url, **kwargs) def patch(self, url, **kwargs): return self._request('PATCH', url, **kwargs) def delete(self, url, **kwargs): return self._request('DELETE', url, **kwargs) def _close_after_stream(response, chunk_size): """Iterate over the content and ensure the response is closed after.""" # Yield each chunk in the response body for chunk in response.iter_content(chunk_size=chunk_size): yield chunk # Once we're done streaming the body, ensure everything is closed. # This will return the connection to the HTTPConnectionPool in urllib3 # and ideally reduce the number of HTTPConnectionPool full warnings. response.close() class SessionClient(adapter.Adapter, _BaseHTTPClient): def __init__(self, session, **kwargs): kwargs.setdefault('user_agent', USER_AGENT) kwargs.setdefault('service_type', 'image') super(SessionClient, self).__init__(session, **kwargs) def request(self, url, method, **kwargs): headers = kwargs.pop('headers', {}) if self.global_request_id: headers.setdefault(REQ_ID_HEADER, self.global_request_id) kwargs['raise_exc'] = False data = self._set_common_request_kwargs(headers, kwargs) try: # NOTE(pumaranikar): To avoid bug #1641239, no modification of # headers should be allowed after encode_headers() is called. resp = super(SessionClient, self).request(url, method, headers=encode_headers(headers), data=data, **kwargs) except ksa_exc.ConnectTimeout as e: conn_url = self.get_endpoint(auth=kwargs.get('auth')) conn_url = "%s/%s" % (conn_url.rstrip('/'), url.lstrip('/')) message = ("Error communicating with %(url)s %(e)s" % dict(url=conn_url, e=e)) raise exc.InvalidEndpoint(message=message) except ksa_exc.ConnectFailure as e: conn_url = self.get_endpoint(auth=kwargs.get('auth')) conn_url = "%s/%s" % (conn_url.rstrip('/'), url.lstrip('/')) message = ("Error finding address for %(url)s: %(e)s" % dict(url=conn_url, e=e)) raise exc.CommunicationError(message=message) return self._handle_response(resp) def get_http_client(endpoint=None, session=None, **kwargs): if session: return SessionClient(session, **kwargs) elif endpoint: return HTTPClient(endpoint, **kwargs) else: raise AttributeError('Constructing a client must contain either an ' 'endpoint or a session')
import imp import re import sys from django import forms from django.contrib.admin.widgets import FilteredSelectMultiple from django.utils.datastructures import SortedDict from django.utils.translation import ugettext_lazy as _ from djblets.util.filesystem import is_exe_in_path from reviewboard.scmtools import sshutils from reviewboard.scmtools.errors import AuthenticationError, \ BadHostKeyError, \ UnknownHostKeyError, \ UnverifiedCertificateError from reviewboard.scmtools.models import Repository, Tool from reviewboard.site.models import LocalSite from reviewboard.site.validation import validate_review_groups, validate_users class RepositoryForm(forms.ModelForm): """ A specialized form for RepositoryAdmin that makes the "password" field use a PasswordInput widget. """ # NOTE: The list of fields must match that of the corresponding # bug tracker (not including the hosting_ and bug_tracker_ # prefixes), for hosting services matching bug trackers. HOSTING_SERVICE_INFO = SortedDict([ ('bitbucket', { 'label': _('Bitbucket'), 'fields': ['hosting_project_name', 'hosting_owner'], 'tools': { 'Mercurial': { 'path': 'http://bitbucket.org/%(hosting_owner)s/' '%(hosting_project_name)s/', 'mirror_path': 'ssh://hg@bitbucket.org/' '%(hosting_owner)s/' '%(hosting_project_name)s/' }, }, }), ('fedorahosted', { 'label': _('Fedora Hosted'), 'fields': ['hosting_project_name'], 'hidden_fields': ['raw_file_url', 'username', 'password'], 'tools': { 'Git': { 'path': 'git://git.fedorahosted.org/git/' '%(hosting_project_name)s.git', 'mirror_path': 'git://git.fedorahosted.org/git/' '%(hosting_project_name)s.git', 'raw_file_url': 'http://git.fedorahosted.org/git/?p=' '%(hosting_project_name)s.git;' 'a=blob_plain;' 'f=<filename>;h=<revision>' }, 'Mercurial': { 'path': 'http://hg.fedorahosted.org/hg/' '%(hosting_project_name)s/', 'mirror_path': 'https://hg.fedorahosted.org/hg/' '%(hosting_project_name)s/' }, 'Subversion': { 'path': 'http://svn.fedorahosted.org/svn/' '%(hosting_project_name)s/', 'mirror_path': 'https://svn.fedorahosted.org/svn/' '%(hosting_project_name)s/', }, }, }), ('github', { 'label': _('GitHub'), 'fields': ['hosting_project_name', 'hosting_owner'], 'hidden_fields': ['raw_file_url','username', 'password'], 'tools': { 'Git': { 'path': 'git://github.com/%(hosting_owner)s/' '%(hosting_project_name)s.git', 'mirror_path': 'git@github.com:%(hosting_owner)s/' '%(hosting_project_name)s.git', 'raw_file_url': 'http://github.com/api/v2/yaml/blob/show/' '%(hosting_owner)s/' '%(hosting_project_name)s/' '<revision>' }, }, }), ('github-private', { 'label': _('GitHub (Private)'), 'fields': ['hosting_project_name', 'hosting_owner', 'api_token'], 'hidden_fields': ['raw_file_url', 'username', 'password'], 'tools': { 'Git': { 'path': 'git@github.com:%(hosting_owner)s/' '%(hosting_project_name)s.git', 'mirror_path': '', 'raw_file_url': 'http://github.com/api/v2/yaml/blob/show/' '%(hosting_owner)s/' '%(hosting_project_name)s/' '<revision>' '?login=%(hosting_owner)s' '&token=%(api_token)s' }, }, }), ('github-private-org', { 'label': _('GitHub (Private Organization)'), 'fields': ['hosting_project_name', 'hosting_owner', 'api_token', 'username'], 'hidden_fields': ['raw_file_url', 'password'], 'tools': { 'Git': { 'path': 'git@github.com:%(hosting_owner)s/' '%(hosting_project_name)s.git', 'mirror_path': '', 'raw_file_url': 'http://github.com/api/v2/yaml/blob/show/' '%(hosting_owner)s/' '%(hosting_project_name)s/' '<revision>' '?login=%(username)s' '&token=%(api_token)s' }, }, }), ('gitorious', { 'label': _('Gitorious'), 'fields': ['project_slug', 'repository_name'], 'hidden_fields': ['raw_file_url','username', 'password'], 'tools': { 'Git': { 'path': 'git://gitorious.org/%(project_slug)s/' '%(repository_name)s.git', 'mirror_path': 'http://git.gitorious.org/%(project_slug)s/' '%(repository_name)s.git', 'raw_file_url': 'http://git.gitorious.org/%(project_slug)s/' '%(repository_name)s/blobs/raw/<revision>' }, }, }), ('googlecode', { 'label': _('Google Code'), 'fields': ['hosting_project_name'], 'tools': { 'Mercurial': { 'path': 'http://%(hosting_project_name)s' '.googlecode.com/hg', 'mirror_path': 'https://%(hosting_project_name)s' '.googlecode.com/hg', }, 'Subversion': { 'path': 'http://%(hosting_project_name)s' '.googlecode.com/svn', 'mirror_path': 'https://%(hosting_project_name)s' '.googlecode.com/svn', }, }, }), ('sourceforge', { 'label': _('SourceForge'), 'fields': ['hosting_project_name'], 'tools': { 'Bazaar': { 'path': 'bzr://%(hosting_project_name)s' '.bzr.sourceforge.net/bzrroot/' '%(hosting_project_name)s', 'mirror_path': 'bzr+ssh://%(hosting_project_name)s' '.bzr.sourceforge.net/bzrroot/' '%(hosting_project_name)s', }, 'CVS': { 'path': ':pserver:anonymous@%(hosting_project_name)s' '.cvs.sourceforge.net:/cvsroot/' '%(hosting_project_name)s', 'mirror_path': '%(hosting_project_name)s' '.cvs.sourceforge.net/cvsroot/' '%(hosting_project_name)s', }, 'Mercurial': { 'path': 'http://%(hosting_project_name)s' '.hg.sourceforge.net:8000/hgroot/' '%(hosting_project_name)s', 'mirror_path': 'ssh://%(hosting_project_name)s' '.hg.sourceforge.net/hgroot/' '%(hosting_project_name)s', }, 'Subversion': { 'path': 'http://%(hosting_project_name)s' '.svn.sourceforge.net/svnroot/' '%(hosting_project_name)s', 'mirror_path': 'https://%(hosting_project_name)s' '.svn.sourceforge.net/svnroot/' '%(hosting_project_name)s', }, # TODO: Support Git }, }), ('custom', { 'label': _('Custom'), 'fields': ['path', 'mirror_path'], }), ]) BUG_TRACKER_INFO = SortedDict([ ('none', { 'label': _('None'), 'fields': [], 'format': '', }), ('bitbucket', { 'label': 'Bitbucket', 'fields': ['bug_tracker_project_name', 'bug_tracker_owner'], 'format': 'http://bitbucket.org/%(bug_tracker_owner)s/' '%(bug_tracker_project_name)s/issue/%%s/', }), ('bugzilla', { 'label': 'Bugzilla', 'fields': ['bug_tracker_base_url'], 'format': '%(bug_tracker_base_url)s/show_bug.cgi?id=%%s', }), ('fedorahosted', { 'label': 'Fedora Hosted', 'fields': ['bug_tracker_project_name'], 'format': 'https://fedorahosted.org/%(bug_tracker_project_name)s' '/ticket/%%s', }), ('github', { 'label': 'GitHub', 'fields': ['bug_tracker_project_name', 'bug_tracker_owner'], 'format': 'http://github.com/%(bug_tracker_owner)s/' '%(bug_tracker_project_name)s/issues#issue/%%s', }), ('github-private', { 'label': 'GitHub (Private)', 'fields': ['bug_tracker_project_name', 'bug_tracker_owner'], 'format': 'http://github.com/%(bug_tracker_owner)s/' '%(bug_tracker_project_name)s/issues#issue/%%s', }), ('googlecode', { 'label': 'Google Code', 'fields': ['bug_tracker_project_name'], 'format': 'http://code.google.com/p/%(bug_tracker_project_name)s/' 'issues/detail?id=%%s', }), ('redmine', { 'label': 'Redmine', 'fields': ['bug_tracker_base_url'], 'format': '%(bug_tracker_base_url)s/issues/%%s', }), ('sourceforge', { 'label': 'SourceForge', 'fields': [], 'format': 'http://sourceforge.net/support/tracker.php?aid=%%s', }), ('trac', { 'label': 'Trac', 'fields': ['bug_tracker_base_url'], 'format': '%(bug_tracker_base_url)s/ticket/%%s', }), ('custom', { 'label': _('Custom'), 'fields': ['bug_tracker'], 'format': '%(bug_tracker)s', }), ]) HOSTING_FIELDS = [ "path", "mirror_path", "hosting_owner", "hosting_project_name", "api_token", "project_slug", "repository_name", ] BUG_TRACKER_FIELDS = [ "bug_tracker_base_url", "bug_tracker_owner", "bug_tracker_project_name", "bug_tracker", ] FORMAT_STR_RE = re.compile(r'%\(([A-Za-z0-9_-]+)\)s') # Host trust state reedit_repository = forms.BooleanField( label=_("Re-edit repository"), required=False) trust_host = forms.BooleanField( label=_("I trust this host"), required=False) # Fields hosting_type = forms.ChoiceField( label=_("Hosting service"), required=True, choices=[(service_id, info['label']) for service_id, info in HOSTING_SERVICE_INFO.iteritems()], initial="custom") hosting_owner = forms.CharField( label=_("Project's owner"), max_length=256, required=False, widget=forms.TextInput(attrs={'size': '30'})) hosting_project_name = forms.CharField( label=_("Project name"), max_length=256, required=False, widget=forms.TextInput(attrs={'size': '30'})) project_slug = forms.CharField( label=_("Project slug"), max_length=256, required=False, widget=forms.TextInput(attrs={'size': '30'})) repository_name = forms.CharField( label=_("Repository name"), max_length=256, required=False, widget=forms.TextInput(attrs={'size': '30'})) api_token = forms.CharField( label=_("API token"), max_length=128, required=False, widget=forms.TextInput(attrs={'size': '60'}), help_text=_('The API token provided by the hosting service. This is ' 'needed in order to access files on this repository. ' 'On GitHub, you can find this on your ' '<a href="http://github.com/account">Account</a> page ' 'under "Account Admin."')) tool = forms.ModelChoiceField( label=_("Repository type"), required=True, empty_label=None, queryset=Tool.objects.all()) bug_tracker_use_hosting = forms.BooleanField( label=_("Use hosting service's bug tracker"), required=False) bug_tracker_type = forms.ChoiceField( label=_("Type"), required=True, choices=[(tracker_id, info['label']) for tracker_id, info in BUG_TRACKER_INFO.iteritems()], initial="none") bug_tracker_owner = forms.CharField( label=_("Bug Tracker's owner"), max_length=256, required=False, widget=forms.TextInput(attrs={'size': '30'})) bug_tracker_project_name = forms.CharField( label=_("Project name"), max_length=256, required=False, widget=forms.TextInput(attrs={'size': '30'})) bug_tracker_base_url = forms.CharField( label=_("Bug tracker URL"), max_length=256, required=False, widget=forms.TextInput(attrs={'size': '60'}), help_text=_("This should be the path to the bug tracker for this " "repository.")) def __init__(self, *args, **kwargs): super(RepositoryForm, self).__init__(*args, **kwargs) self.hostkeyerror = None self.certerror = None self.userkeyerror = None local_site_name = None if self.instance and self.instance.local_site: local_site_name = self.instance.local_site.name elif self.fields['local_site'].initial: local_site_name = self.fields['local_site'].initial.name self.public_key = \ sshutils.get_public_key(sshutils.get_user_key(local_site_name)) self._populate_hosting_service_fields() self._populate_bug_tracker_fields() def _populate_hosting_service_fields(self): if (not self.instance or not self.instance.path): return tool_name = self.instance.tool.name for service_id, info in self.HOSTING_SERVICE_INFO.iteritems(): if (service_id == 'custom' or tool_name not in info['tools']): continue field_info = info['tools'][tool_name] is_path_match, field_data = \ self._match_url(self.instance.path, field_info['path'], info['fields']) if not is_path_match: continue if not self._match_url(self.instance.mirror_path, field_info['mirror_path'], [])[0]: continue if 'raw_file_url' in field_info: is_raw_match, raw_field_data = \ self._match_url(self.instance.raw_file_url, field_info['raw_file_url'], info['fields']) if not is_raw_match: continue field_data.update(raw_field_data) # It all matched. self.fields['hosting_type'].initial = service_id for key, value in field_data.iteritems(): self.fields[key].initial = value break def _populate_bug_tracker_fields(self): if not self.instance or not self.instance.bug_tracker: return for tracker_id, info in self.BUG_TRACKER_INFO.iteritems(): if tracker_id == 'none': continue is_match, field_data = \ self._match_url(self.instance.bug_tracker, info['format'], info['fields']) if is_match: self.fields['bug_tracker_type'].initial = tracker_id for key, value in field_data.iteritems(): self.fields[key].initial = value # Figure out whether this matches the hosting service. if tracker_id == self.fields['hosting_type'].initial: is_match = True for field in info['fields']: hosting_field = field.replace("bug_tracker_", "hosting_") if (self.fields[hosting_field].initial != self.fields[field].initial): is_match = False break if is_match: self.fields['bug_tracker_use_hosting'].initial = True break def _clean_hosting_info(self): hosting_type = self.cleaned_data['hosting_type'] if hosting_type == 'custom': return # Should be caught during validation. assert hosting_type in self.HOSTING_SERVICE_INFO info = self.HOSTING_SERVICE_INFO[hosting_type] tool_name = self.cleaned_data['tool'].name assert tool_name in info['tools'] field_data = {} for field in info['fields']: field_data[field] = self.cleaned_data[field] for field, value in info['tools'][tool_name].iteritems(): self.cleaned_data[field] = value % field_data self.data[field] = value % field_data def _clean_bug_tracker_info(self): use_hosting = self.cleaned_data['bug_tracker_use_hosting'] bug_tracker_type = self.cleaned_data['bug_tracker_type'] if bug_tracker_type == 'none' and not use_hosting: self.instance.bug_tracker = "" return if use_hosting: match_type = self.cleaned_data['hosting_type'] else: match_type = bug_tracker_type assert match_type in self.BUG_TRACKER_INFO info = self.BUG_TRACKER_INFO[match_type] field_data = {} for field in info['fields']: src_field = field if use_hosting: src_field = src_field.replace("bug_tracker_", "hosting_") field_data[field] = self.cleaned_data[src_field] bug_tracker_url = info['format'] % field_data self.cleaned_data['bug_tracker'] = bug_tracker_url self.data['bug_tracker'] = bug_tracker_url def full_clean(self): if self.data: hosting_type = (self['hosting_type'].data or self.fields['hosting_type'].initial) use_hosting = (self['bug_tracker_use_hosting'].data or self.fields['bug_tracker_use_hosting'].initial) self.fields['path'].required = (hosting_type == "custom") self.fields['bug_tracker_type'].required = not use_hosting return super(RepositoryForm, self).full_clean() def clean(self): """ Performs validation on the form. This will check the form fields for errors, calling out to the various clean_* methods. It will check the repository path to see if it represents a valid repository and if an SSH key or HTTPS certificate needs to be verified. This will also build repository and bug tracker URLs based on other fields set in the form. """ self._clean_hosting_info() self._clean_bug_tracker_info() validate_review_groups(self) validate_users(self) if not self.cleaned_data['reedit_repository']: self._verify_repository_path() return super(RepositoryForm, self).clean() def clean_path(self): return self.cleaned_data['path'].strip() def clean_mirror_path(self): return self.cleaned_data['mirror_path'].strip() def clean_bug_tracker_base_url(self): data = self.cleaned_data['bug_tracker_base_url'] return data.rstrip("/") def clean_tool(self): """ Checks the SCMTool used for this repository for dependencies. If one or more dependencies aren't found, they will be presented as validation errors. """ tool = self.cleaned_data['tool'] scmtool_class = tool.get_scmtool_class() errors = [] for dep in scmtool_class.dependencies.get('modules', []): try: imp.find_module(dep) except ImportError: errors.append('The Python module "%s" is not installed.' 'You may need to restart the server ' 'after installing it.' % dep) for dep in scmtool_class.dependencies.get('executables', []): if not is_exe_in_path(dep): if sys.platform == 'win32': exe_name = '%s.exe' % dep else: exe_name = dep errors.append('The executable "%s" is not in the path.' % exe_name) if errors: raise forms.ValidationError(errors) return tool def is_valid(self): """ Returns whether or not the form is valid. This will return True if the form fields are all valid, if there's no certificate error, host key error, and if the form isn't being re-displayed after canceling an SSH key or HTTPS certificate verification. """ return (super(RepositoryForm, self).is_valid() and not self.hostkeyerror and not self.certerror and not self.userkeyerror and not self.cleaned_data['reedit_repository']) def _match_url(self, url, format, fields): """ Matches a URL against a format string. This will determine if the URL can be represented by the format string. If so, the URL will parsed for the list of fields and returned. The result is in the form of (bool, field_dict). """ def replace_match_group(m): name = m.group(1) if name in found_groups: return r'(?P=%s)' % name else: found_groups[name] = True return r'(?P<%s>[A-Za-z0-9:/._-]+)' % name # First, transform our Python format-style pattern to a regex. pattern = format.replace("%%s", "%s") pattern = pattern.replace("?", "\?") pattern = pattern.replace("+", "\+") # A list of match groups to replace that we've already found. # re.sub will get angry if it sees two with the same name. found_groups = {} pattern = self.FORMAT_STR_RE.sub(replace_match_group, pattern) m = re.match(pattern, url) if not m: return False, {} field_data = {} for field in fields: try: field_data[field] = m.group(field) except IndexError: pass return True, field_data def _verify_repository_path(self): """ Verifies the repository path to check if it's valid. This will check if the repository exists and if an SSH key or HTTPS certificate needs to be verified. """ tool = self.cleaned_data.get('tool', None) if not tool: # This failed validation earlier, so bail. return scmtool_class = tool.get_scmtool_class() path = self.cleaned_data['path'] username = self.cleaned_data['username'] password = self.cleaned_data['password'] local_site_name = None if self.cleaned_data['local_site']: try: local_site = self.cleaned_data['local_site'] local_site_name = local_site.name except LocalSite.DoesNotExist, e: raise forms.ValidationError(e) while 1: # Keep doing this until we have an error we don't want # to ignore, or it's successful. try: scmtool_class.check_repository(path, username, password, local_site_name) # Success. break except BadHostKeyError, e: if self.cleaned_data['trust_host']: try: sshutils.replace_host_key(e.hostname, e.raw_expected_key, e.raw_key, local_site_name) except IOError, e: raise forms.ValidationError(e) else: self.hostkeyerror = e break except UnknownHostKeyError, e: if self.cleaned_data['trust_host']: try: sshutils.add_host_key(e.hostname, e.raw_key, local_site_name) except IOError, e: raise forms.ValidationError(e) else: self.hostkeyerror = e break except UnverifiedCertificateError, e: if self.cleaned_data['trust_host']: try: scmtool_class.accept_certificate(path, local_site_name) except IOError, e: raise forms.ValidationError(e) else: self.certerror = e break except AuthenticationError, e: if 'publickey' in e.allowed_types and e.user_key is None: self.userkeyerror = e break raise forms.ValidationError(e) except Exception, e: raise forms.ValidationError(e) class Meta: model = Repository widgets = { 'path': forms.TextInput(attrs={'size': '60'}), 'mirror_path': forms.TextInput(attrs={'size': '60'}), 'raw_file_url': forms.TextInput(attrs={'size': '60'}), 'bug_tracker': forms.TextInput(attrs={'size': '60'}), 'username': forms.TextInput(attrs={'size': '30', 'autocomplete': 'off'}), 'password': forms.PasswordInput(attrs={'size': '30', 'autocomplete': 'off'}), 'users': FilteredSelectMultiple(_('users with access'), False), 'review_groups': FilteredSelectMultiple( _('review groups with access'), False), }
#!/usr/bin/env python ''' The reporter module is in charge of producing the HTML Report as well as provide plugins with common HTML Rendering functions ''' import cgi import codecs from tornado.template import Template, Loader from framework.dependency_management.dependency_resolver import BaseComponent from framework.dependency_management.interfaces import ReporterInterface from framework.lib.general import * from framework.interface.html.filter import sanitiser class Reporter(BaseComponent, ReporterInterface): COMPONENT_NAME = "reporter" def __init__(self): self.register_in_service_locator() self.config = self.get_component("config") self.resource = self.get_component("resource") self.transaction = self.get_component("transaction") self.plugin_handler = self.get_component("plugin_handler") self.requester = None self.Init = False self.Sanitiser = sanitiser.HTMLSanitiser() self.Loader = Loader(self.config.FrameworkConfigGet('POUTPUT_TEMPLATES_DIR')) self.mNumLinesToShow = 15 self.CounterList = [] def init(self): self.requester = self.get_component("requester") def TransactionTableFromIDs(self, TransactionIDs, NumLinesReq=15, NumLinesRes=15): """ Draws a table of HTTP Transactions """ # functions to get the first lines of a long string transactions = self.transaction.GetByIDs(TransactionIDs) return self.TransactionTableForTransactions(transactions) def TransactionTableForURL(self, UseCache, URL, Method=None, Data=None): transaction = self.requester.GetTransaction( UseCache, URL, method=Method, data=Data) return self.TransactionTableForTransactions([transaction]) def TransactionTableForURLList( self, UseCache, URLList, Method=None, Data=None): transactions = self.requester.GetTransactions( UseCache, URLList, method=Method, data=Data) return self.TransactionTableForTransactions(transactions) def TransactionTableForTransactions(self, Transactions): return self.Loader.load("transaction_table.html").generate(TransactionList=Transactions) def unicode(self, *args): try: return unicode(*args) except TypeError: return args[0] # Input is already Unicode def sanitize_html(self, RawHTML): return self.Sanitiser.CleanThirdPartyHTML(RawHTML) def reset_loader(self): return self.Loader.reset() #----------------------------------- Methods exported from plugin_helper.py --------------------------------- def CommandTable(self, Command): return self.Loader.load("command_table.html").generate(Command=Command) def LinkList(self, LinkListName, Links): """ Wrapper to allow rendering a bunch of links -without name- as resource links with name = link """ return self.Loader.load("link_list.html").generate( LinkListName=LinkListName, Links=Links) def ResourceLinkList(self, ResourceListName, ResourceList): """ Draws an HTML Search box for defined Vuln Search resources """ return self.Loader.load("resource_link_list.html").generate( ResourceListName=ResourceListName, ResourceList=ResourceList) def TabbedResourceLinkList(self, ResourcesList): """ ResourceList = [ "ResourceListName", [["Name1","Resource1"],["Name2","Resource2"]] ] """ TabData = [] Resources = [] for ResourceListName, ResourceList in ResourcesList: TabID = ResourceListName.replace(' ', '_') TabData.append([ResourceListName, TabID]) Resources.append([TabID, ResourceList]) return self.Loader.load("tabbed_resource_link_list.html").generate( TabData=TabData, Resources=Resources) def ListPostProcessing(self, ResourceListName, LinkList, HTMLLinkList): return self.Loader.load("list_post_processing.html").generate( ResourceListName=ResourceListName, LinkList=LinkList, HTMLLinkList=HTMLLinkList) def RequestLinkList(self, ResourceListName, LinkList): return self.Loader.load("request_link_list.html").generate( ResourceListName=ResourceListName, LinkList=LinkList) def VulnerabilitySearchBox(self, SearchStr): """ Draws an HTML Search box for defined Vuln Search resources """ VulnSearchResources = self.resource.GetResources('VulnSearch') return self.Loader.load("vulnerability_search_box.html").generate( SearchStr=SearchStr, VulnSearchResources=VulnSearchResources) def SuggestedCommandBox( self, PluginOutputDir, CommandCategoryList, Header=''): """ Draws HTML tabs for a list of TabName => Resource Group (i.e. how to run hydra, etc) """ TitleList = [] CommandList = [] for item in CommandCategoryList: TitleList.append(item[0]) CommandList.append(self.resource.GetResources(item[1])) return self.Loader.load("suggested_command_box.html").generate( Header=Header, TitleList=TitleList, CommandList=CommandList) # TODO: Fix up the plugin def CommandDump( self, Name, CommandIntro, ModifiedCommand, RelativeFilePath, OutputIntro, TimeStr): AbsPath = self.plugin_handler.RetrieveAbsPath(RelativeFilePath) OutputLines = open(AbsPath, "r").readlines() longOutput = (len(OutputLines) > self.mNumLinesToShow) if (len(OutputLines) > self.mNumLinesToShow): OutputLines = ''.join(OutputLines[0:self.mNumLinesToShow]) else: OutputLines = ''.join(OutputLines) table_vars = { "Name": Name, "CommandIntro": CommandIntro, "ModifiedCommand": ModifiedCommand, "FilePath": RelativeFilePath, "OutputIntro": OutputIntro, "OutputLines": OutputLines, "TimeStr": TimeStr, "mNumLinesToShow": self.mNumLinesToShow, "longOutput": longOutput } return self.Loader.load("command_dump.html").generate(**table_vars) def URLsFromStr(self, TimeStr, VisitURLs, URLList, NumFound): html_content = self.Loader.load("urls_from_str.html").generate( TimeStr=TimeStr, VisitURLs=VisitURLs, NumURLs=len(URLList), NumFound=NumFound) if URLList: html_content += self.LinkList("URLs Scraped", URLList) return html_content def Robots( self, NotStr, NumLines, NumAllow, NumDisallow, NumSitemap, SavePath, EntriesList, NumAddedURLs): vars = { "robots_found": NotStr, "num_lines": NumLines, "num_allow": NumAllow, "num_disallow": NumDisallow, "num_sitemap": NumSitemap, "save_path": SavePath, } TestResult = self.Loader.load("robots.html").generate(**vars) # robots.txt contains some entries, show browsable list! :) if NumDisallow > 0 or NumAllow > 0 or NumSitemap > 0: for Display, Links in EntriesList: if Links: # Filters empty lists TestResult += self.ResourceLinkList(Display, Links) return TestResult def HtmlString(self, String): return(String) # ---------------------- Grep Plugin Outputs -------------------- # def ResponseBodyMatches(self, ResponseRegexpName): RegexpName, GrepOutputs, TransactionIDS, match_percent = self.transaction.SearchByRegexName(ResponseRegexpName, stats=True) variables = { "name": RegexpName.replace("RESPONSE_REGEXP_FOR_", "").replace( '_', ' '), "matches": GrepOutputs, "transaction_ids": TransactionIDS, "match_percent": match_percent } return self.Loader.load("response_matches.html").generate(**variables) def ResponseHeaderMatches(self, HeaderRegexpName): return self.ResearchHeaders(HeaderRegexpName)[0] def ResearchHeaders(self, RegexName): regex_name, grep_outputs, transaction_ids, match_percent = self.transaction.SearchByRegexName(RegexName, stats=True) # [[unique_matches, matched_transactions, matched_percentage]] return [self.Loader.load("header_searches.html").generate( match_percent=match_percent, matches=grep_outputs, transaction_ids=transaction_ids), grep_outputs] def FingerprintData(self): HeaderTable, matches = self.ResearchHeaders('HEADERS_FOR_FINGERPRINT') for item in matches: # Add Vulnerability search boxes after table HeaderTable += self.VulnerabilitySearchBox(item[1]) return HeaderTable def TopTransactionsBySpeed(self, Order): transactions = self.transaction.GetTopTransactionsBySpeed(Order) return self.TransactionTableForTransactions(transactions) def CookieAttributeAnalysis(self, CookieValueList, Header2TransacDict): vars = { "Cookies": [{ "Name": Cookie.split('=')[0], "Link": Header2TransacDict[self.config.Get('HEADERS_FOR_COOKIES').lower() + Cookie], "Attribs": Cookie.replace(Cookie.split('=')[0] + "=", "").replace("; ", ";").split(";"), } for Cookie in CookieValueList], } Table = self.Render.CreateTable({'class': 'report_intro'}) SetCookie = self.config.Get('HEADERS_FOR_COOKIES').lower() PossibleCookieAttributes = self.config.Get( 'COOKIE_ATTRIBUTES').split(',') for Cookie in CookieValueList: CookieName = Cookie.split('=')[0] CookieLink = self.Render.DrawButtonLink(cgi.escape( CookieName ), Header2TransacDict[SetCookie + Cookie] ) CookieAttribs = Cookie.replace(CookieName + "=", "").replace("; ", ";" ).split( ";" ) #Table.CreateRow(["Cookie: "+CookieLink], True, { 'colspan' : '2' }) Table.CreateCustomRow( '<tr><th colspan="2">' + "Cookie: " + CookieLink + '</th></tr>' ) Table.CreateRow( ['Attribute', 'Value'], True ) #Table += "<th colspan='2'>Cookie: "+CookieLink+"</th>" #Table += self..DrawTableRow(['Attribute', 'Value'], True) NotFoundStr = "<b>Not Found</b>" if CookieAttribs[0]: CookieValue = CookieAttribs[0] else: CookieValue = NotFoundStr Table.CreateRow( ['Value', CookieValue] ) #Table += self..DrawTableRow(['Value', ]) for Attrib in PossibleCookieAttributes: DisplayAttribute = NotFoundStr for PresentAttrib in CookieAttribs: if PresentAttrib.lower().startswith( Attrib.lower() ): # Avoid false positives due to cookie contents DisplayAttribute = PresentAttrib break Table.CreateRow( [Attrib, DisplayAttribute] ) #Table += self..DrawTableRow([Attrib, DisplayAttribute]) if Table.GetNumRows() == 0: return "" # No Attributes found return "<h3>Cookie Attribute Analysis</h3>" + Table.Render() #Table = "<h3>Cookie Attribute Analysis</h3><table class='report_intro'>"+Table+"</table>" #return Table
#! /usr/bin/env python # # Protocol Buffers - Google's data interchange format # Copyright 2008 Google Inc. All rights reserved. # https://developers.google.com/protocol-buffers/ # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: # # * Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the above # copyright notice, this list of conditions and the following disclaimer # in the documentation and/or other materials provided with the # distribution. # * Neither the name of Google Inc. nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. """Tests for google.protobuf.descriptor_pool.""" __author__ = 'matthewtoia@google.com (Matt Toia)' import os import sys try: import unittest2 as unittest #PY26 except ImportError: import unittest from google.protobuf import unittest_import_pb2 from google.protobuf import unittest_import_public_pb2 from google.protobuf import unittest_pb2 from google.protobuf import descriptor_pb2 from google.protobuf.internal import api_implementation from google.protobuf.internal import descriptor_pool_test1_pb2 from google.protobuf.internal import descriptor_pool_test2_pb2 from google.protobuf.internal import factory_test1_pb2 from google.protobuf.internal import factory_test2_pb2 from google.protobuf.internal import file_options_test_pb2 from google.protobuf.internal import more_messages_pb2 from google.protobuf import descriptor from google.protobuf import descriptor_database from google.protobuf import descriptor_pool from google.protobuf import message_factory from google.protobuf import symbol_database class DescriptorPoolTest(unittest.TestCase): def setUp(self): # TODO(jieluo): Should make the pool which is created by # serialized_pb same with generated pool. # TODO(jieluo): More test coverage for the generated pool. self.pool = descriptor_pool.DescriptorPool() self.factory_test1_fd = descriptor_pb2.FileDescriptorProto.FromString( factory_test1_pb2.DESCRIPTOR.serialized_pb) self.factory_test2_fd = descriptor_pb2.FileDescriptorProto.FromString( factory_test2_pb2.DESCRIPTOR.serialized_pb) self.pool.Add(self.factory_test1_fd) self.pool.Add(self.factory_test2_fd) self.pool.Add(descriptor_pb2.FileDescriptorProto.FromString( unittest_import_public_pb2.DESCRIPTOR.serialized_pb)) self.pool.Add(descriptor_pb2.FileDescriptorProto.FromString( unittest_import_pb2.DESCRIPTOR.serialized_pb)) self.pool.Add(descriptor_pb2.FileDescriptorProto.FromString( unittest_pb2.DESCRIPTOR.serialized_pb)) def testFindFileByName(self): name1 = 'google/protobuf/internal/factory_test1.proto' file_desc1 = self.pool.FindFileByName(name1) self.assertIsInstance(file_desc1, descriptor.FileDescriptor) self.assertEqual(name1, file_desc1.name) self.assertEqual('google.protobuf.python.internal', file_desc1.package) self.assertIn('Factory1Message', file_desc1.message_types_by_name) name2 = 'google/protobuf/internal/factory_test2.proto' file_desc2 = self.pool.FindFileByName(name2) self.assertIsInstance(file_desc2, descriptor.FileDescriptor) self.assertEqual(name2, file_desc2.name) self.assertEqual('google.protobuf.python.internal', file_desc2.package) self.assertIn('Factory2Message', file_desc2.message_types_by_name) def testFindFileByNameFailure(self): with self.assertRaises(KeyError): self.pool.FindFileByName('Does not exist') def testFindFileContainingSymbol(self): file_desc1 = self.pool.FindFileContainingSymbol( 'google.protobuf.python.internal.Factory1Message') self.assertIsInstance(file_desc1, descriptor.FileDescriptor) self.assertEqual('google/protobuf/internal/factory_test1.proto', file_desc1.name) self.assertEqual('google.protobuf.python.internal', file_desc1.package) self.assertIn('Factory1Message', file_desc1.message_types_by_name) file_desc2 = self.pool.FindFileContainingSymbol( 'google.protobuf.python.internal.Factory2Message') self.assertIsInstance(file_desc2, descriptor.FileDescriptor) self.assertEqual('google/protobuf/internal/factory_test2.proto', file_desc2.name) self.assertEqual('google.protobuf.python.internal', file_desc2.package) self.assertIn('Factory2Message', file_desc2.message_types_by_name) # Tests top level extension. file_desc3 = self.pool.FindFileContainingSymbol( 'google.protobuf.python.internal.another_field') self.assertIsInstance(file_desc3, descriptor.FileDescriptor) self.assertEqual('google/protobuf/internal/factory_test2.proto', file_desc3.name) # Tests nested extension inside a message. file_desc4 = self.pool.FindFileContainingSymbol( 'google.protobuf.python.internal.Factory2Message.one_more_field') self.assertIsInstance(file_desc4, descriptor.FileDescriptor) self.assertEqual('google/protobuf/internal/factory_test2.proto', file_desc4.name) file_desc5 = self.pool.FindFileContainingSymbol( 'protobuf_unittest.TestService') self.assertIsInstance(file_desc5, descriptor.FileDescriptor) self.assertEqual('google/protobuf/unittest.proto', file_desc5.name) # Tests the generated pool. assert descriptor_pool.Default().FindFileContainingSymbol( 'google.protobuf.python.internal.Factory2Message.one_more_field') assert descriptor_pool.Default().FindFileContainingSymbol( 'google.protobuf.python.internal.another_field') assert descriptor_pool.Default().FindFileContainingSymbol( 'protobuf_unittest.TestService') def testFindFileContainingSymbolFailure(self): with self.assertRaises(KeyError): self.pool.FindFileContainingSymbol('Does not exist') def testFindMessageTypeByName(self): msg1 = self.pool.FindMessageTypeByName( 'google.protobuf.python.internal.Factory1Message') self.assertIsInstance(msg1, descriptor.Descriptor) self.assertEqual('Factory1Message', msg1.name) self.assertEqual('google.protobuf.python.internal.Factory1Message', msg1.full_name) self.assertEqual(None, msg1.containing_type) self.assertFalse(msg1.has_options) nested_msg1 = msg1.nested_types[0] self.assertEqual('NestedFactory1Message', nested_msg1.name) self.assertEqual(msg1, nested_msg1.containing_type) nested_enum1 = msg1.enum_types[0] self.assertEqual('NestedFactory1Enum', nested_enum1.name) self.assertEqual(msg1, nested_enum1.containing_type) self.assertEqual(nested_msg1, msg1.fields_by_name[ 'nested_factory_1_message'].message_type) self.assertEqual(nested_enum1, msg1.fields_by_name[ 'nested_factory_1_enum'].enum_type) msg2 = self.pool.FindMessageTypeByName( 'google.protobuf.python.internal.Factory2Message') self.assertIsInstance(msg2, descriptor.Descriptor) self.assertEqual('Factory2Message', msg2.name) self.assertEqual('google.protobuf.python.internal.Factory2Message', msg2.full_name) self.assertIsNone(msg2.containing_type) nested_msg2 = msg2.nested_types[0] self.assertEqual('NestedFactory2Message', nested_msg2.name) self.assertEqual(msg2, nested_msg2.containing_type) nested_enum2 = msg2.enum_types[0] self.assertEqual('NestedFactory2Enum', nested_enum2.name) self.assertEqual(msg2, nested_enum2.containing_type) self.assertEqual(nested_msg2, msg2.fields_by_name[ 'nested_factory_2_message'].message_type) self.assertEqual(nested_enum2, msg2.fields_by_name[ 'nested_factory_2_enum'].enum_type) self.assertTrue(msg2.fields_by_name['int_with_default'].has_default_value) self.assertEqual( 1776, msg2.fields_by_name['int_with_default'].default_value) self.assertTrue( msg2.fields_by_name['double_with_default'].has_default_value) self.assertEqual( 9.99, msg2.fields_by_name['double_with_default'].default_value) self.assertTrue( msg2.fields_by_name['string_with_default'].has_default_value) self.assertEqual( 'hello world', msg2.fields_by_name['string_with_default'].default_value) self.assertTrue(msg2.fields_by_name['bool_with_default'].has_default_value) self.assertFalse(msg2.fields_by_name['bool_with_default'].default_value) self.assertTrue(msg2.fields_by_name['enum_with_default'].has_default_value) self.assertEqual( 1, msg2.fields_by_name['enum_with_default'].default_value) msg3 = self.pool.FindMessageTypeByName( 'google.protobuf.python.internal.Factory2Message.NestedFactory2Message') self.assertEqual(nested_msg2, msg3) self.assertTrue(msg2.fields_by_name['bytes_with_default'].has_default_value) self.assertEqual( b'a\xfb\x00c', msg2.fields_by_name['bytes_with_default'].default_value) self.assertEqual(1, len(msg2.oneofs)) self.assertEqual(1, len(msg2.oneofs_by_name)) self.assertEqual(2, len(msg2.oneofs[0].fields)) for name in ['oneof_int', 'oneof_string']: self.assertEqual(msg2.oneofs[0], msg2.fields_by_name[name].containing_oneof) self.assertIn(msg2.fields_by_name[name], msg2.oneofs[0].fields) def testFindMessageTypeByNameFailure(self): with self.assertRaises(KeyError): self.pool.FindMessageTypeByName('Does not exist') def testFindEnumTypeByName(self): enum1 = self.pool.FindEnumTypeByName( 'google.protobuf.python.internal.Factory1Enum') self.assertIsInstance(enum1, descriptor.EnumDescriptor) self.assertEqual(0, enum1.values_by_name['FACTORY_1_VALUE_0'].number) self.assertEqual(1, enum1.values_by_name['FACTORY_1_VALUE_1'].number) self.assertFalse(enum1.has_options) nested_enum1 = self.pool.FindEnumTypeByName( 'google.protobuf.python.internal.Factory1Message.NestedFactory1Enum') self.assertIsInstance(nested_enum1, descriptor.EnumDescriptor) self.assertEqual( 0, nested_enum1.values_by_name['NESTED_FACTORY_1_VALUE_0'].number) self.assertEqual( 1, nested_enum1.values_by_name['NESTED_FACTORY_1_VALUE_1'].number) enum2 = self.pool.FindEnumTypeByName( 'google.protobuf.python.internal.Factory2Enum') self.assertIsInstance(enum2, descriptor.EnumDescriptor) self.assertEqual(0, enum2.values_by_name['FACTORY_2_VALUE_0'].number) self.assertEqual(1, enum2.values_by_name['FACTORY_2_VALUE_1'].number) nested_enum2 = self.pool.FindEnumTypeByName( 'google.protobuf.python.internal.Factory2Message.NestedFactory2Enum') self.assertIsInstance(nested_enum2, descriptor.EnumDescriptor) self.assertEqual( 0, nested_enum2.values_by_name['NESTED_FACTORY_2_VALUE_0'].number) self.assertEqual( 1, nested_enum2.values_by_name['NESTED_FACTORY_2_VALUE_1'].number) def testFindEnumTypeByNameFailure(self): with self.assertRaises(KeyError): self.pool.FindEnumTypeByName('Does not exist') def testFindFieldByName(self): field = self.pool.FindFieldByName( 'google.protobuf.python.internal.Factory1Message.list_value') self.assertEqual(field.name, 'list_value') self.assertEqual(field.label, field.LABEL_REPEATED) self.assertFalse(field.has_options) with self.assertRaises(KeyError): self.pool.FindFieldByName('Does not exist') def testFindExtensionByName(self): # An extension defined in a message. extension = self.pool.FindExtensionByName( 'google.protobuf.python.internal.Factory2Message.one_more_field') self.assertEqual(extension.name, 'one_more_field') # An extension defined at file scope. extension = self.pool.FindExtensionByName( 'google.protobuf.python.internal.another_field') self.assertEqual(extension.name, 'another_field') self.assertEqual(extension.number, 1002) with self.assertRaises(KeyError): self.pool.FindFieldByName('Does not exist') def testFindAllExtensions(self): factory1_message = self.pool.FindMessageTypeByName( 'google.protobuf.python.internal.Factory1Message') factory2_message = self.pool.FindMessageTypeByName( 'google.protobuf.python.internal.Factory2Message') # An extension defined in a message. one_more_field = factory2_message.extensions_by_name['one_more_field'] self.pool.AddExtensionDescriptor(one_more_field) # An extension defined at file scope. factory_test2 = self.pool.FindFileByName( 'google/protobuf/internal/factory_test2.proto') another_field = factory_test2.extensions_by_name['another_field'] self.pool.AddExtensionDescriptor(another_field) extensions = self.pool.FindAllExtensions(factory1_message) expected_extension_numbers = set([one_more_field, another_field]) self.assertEqual(expected_extension_numbers, set(extensions)) # Verify that mutating the returned list does not affect the pool. extensions.append('unexpected_element') # Get the extensions again, the returned value does not contain the # 'unexpected_element'. extensions = self.pool.FindAllExtensions(factory1_message) self.assertEqual(expected_extension_numbers, set(extensions)) def testFindExtensionByNumber(self): factory1_message = self.pool.FindMessageTypeByName( 'google.protobuf.python.internal.Factory1Message') factory2_message = self.pool.FindMessageTypeByName( 'google.protobuf.python.internal.Factory2Message') # An extension defined in a message. one_more_field = factory2_message.extensions_by_name['one_more_field'] self.pool.AddExtensionDescriptor(one_more_field) # An extension defined at file scope. factory_test2 = self.pool.FindFileByName( 'google/protobuf/internal/factory_test2.proto') another_field = factory_test2.extensions_by_name['another_field'] self.pool.AddExtensionDescriptor(another_field) # An extension defined in a message. extension = self.pool.FindExtensionByNumber(factory1_message, 1001) self.assertEqual(extension.name, 'one_more_field') # An extension defined at file scope. extension = self.pool.FindExtensionByNumber(factory1_message, 1002) self.assertEqual(extension.name, 'another_field') with self.assertRaises(KeyError): extension = self.pool.FindExtensionByNumber(factory1_message, 1234567) def testExtensionsAreNotFields(self): with self.assertRaises(KeyError): self.pool.FindFieldByName('google.protobuf.python.internal.another_field') with self.assertRaises(KeyError): self.pool.FindFieldByName( 'google.protobuf.python.internal.Factory2Message.one_more_field') with self.assertRaises(KeyError): self.pool.FindExtensionByName( 'google.protobuf.python.internal.Factory1Message.list_value') def testFindService(self): service = self.pool.FindServiceByName('protobuf_unittest.TestService') self.assertEqual(service.full_name, 'protobuf_unittest.TestService') def testUserDefinedDB(self): db = descriptor_database.DescriptorDatabase() self.pool = descriptor_pool.DescriptorPool(db) db.Add(self.factory_test1_fd) db.Add(self.factory_test2_fd) self.testFindMessageTypeByName() def testAddSerializedFile(self): self.pool = descriptor_pool.DescriptorPool() self.pool.AddSerializedFile(self.factory_test1_fd.SerializeToString()) self.pool.AddSerializedFile(self.factory_test2_fd.SerializeToString()) self.testFindMessageTypeByName() def testComplexNesting(self): more_messages_desc = descriptor_pb2.FileDescriptorProto.FromString( more_messages_pb2.DESCRIPTOR.serialized_pb) test1_desc = descriptor_pb2.FileDescriptorProto.FromString( descriptor_pool_test1_pb2.DESCRIPTOR.serialized_pb) test2_desc = descriptor_pb2.FileDescriptorProto.FromString( descriptor_pool_test2_pb2.DESCRIPTOR.serialized_pb) self.pool.Add(more_messages_desc) self.pool.Add(test1_desc) self.pool.Add(test2_desc) TEST1_FILE.CheckFile(self, self.pool) TEST2_FILE.CheckFile(self, self.pool) def testEnumDefaultValue(self): """Test the default value of enums which don't start at zero.""" def _CheckDefaultValue(file_descriptor): default_value = (file_descriptor .message_types_by_name['DescriptorPoolTest1'] .fields_by_name['nested_enum'] .default_value) self.assertEqual(default_value, descriptor_pool_test1_pb2.DescriptorPoolTest1.BETA) # First check what the generated descriptor contains. _CheckDefaultValue(descriptor_pool_test1_pb2.DESCRIPTOR) # Then check the generated pool. Normally this is the same descriptor. file_descriptor = symbol_database.Default().pool.FindFileByName( 'google/protobuf/internal/descriptor_pool_test1.proto') self.assertIs(file_descriptor, descriptor_pool_test1_pb2.DESCRIPTOR) _CheckDefaultValue(file_descriptor) # Then check the dynamic pool and its internal DescriptorDatabase. descriptor_proto = descriptor_pb2.FileDescriptorProto.FromString( descriptor_pool_test1_pb2.DESCRIPTOR.serialized_pb) self.pool.Add(descriptor_proto) # And do the same check as above file_descriptor = self.pool.FindFileByName( 'google/protobuf/internal/descriptor_pool_test1.proto') _CheckDefaultValue(file_descriptor) def testDefaultValueForCustomMessages(self): """Check the value returned by non-existent fields.""" def _CheckValueAndType(value, expected_value, expected_type): self.assertEqual(value, expected_value) self.assertIsInstance(value, expected_type) def _CheckDefaultValues(msg): try: int64 = long except NameError: # Python3 int64 = int try: unicode_type = unicode except NameError: # Python3 unicode_type = str _CheckValueAndType(msg.optional_int32, 0, int) _CheckValueAndType(msg.optional_uint64, 0, (int64, int)) _CheckValueAndType(msg.optional_float, 0, (float, int)) _CheckValueAndType(msg.optional_double, 0, (float, int)) _CheckValueAndType(msg.optional_bool, False, bool) _CheckValueAndType(msg.optional_string, u'', unicode_type) _CheckValueAndType(msg.optional_bytes, b'', bytes) _CheckValueAndType(msg.optional_nested_enum, msg.FOO, int) # First for the generated message _CheckDefaultValues(unittest_pb2.TestAllTypes()) # Then for a message built with from the DescriptorPool. pool = descriptor_pool.DescriptorPool() pool.Add(descriptor_pb2.FileDescriptorProto.FromString( unittest_import_public_pb2.DESCRIPTOR.serialized_pb)) pool.Add(descriptor_pb2.FileDescriptorProto.FromString( unittest_import_pb2.DESCRIPTOR.serialized_pb)) pool.Add(descriptor_pb2.FileDescriptorProto.FromString( unittest_pb2.DESCRIPTOR.serialized_pb)) message_class = message_factory.MessageFactory(pool).GetPrototype( pool.FindMessageTypeByName( unittest_pb2.TestAllTypes.DESCRIPTOR.full_name)) _CheckDefaultValues(message_class()) class ProtoFile(object): def __init__(self, name, package, messages, dependencies=None, public_dependencies=None): self.name = name self.package = package self.messages = messages self.dependencies = dependencies or [] self.public_dependencies = public_dependencies or [] def CheckFile(self, test, pool): file_desc = pool.FindFileByName(self.name) test.assertEqual(self.name, file_desc.name) test.assertEqual(self.package, file_desc.package) dependencies_names = [f.name for f in file_desc.dependencies] test.assertEqual(self.dependencies, dependencies_names) public_dependencies_names = [f.name for f in file_desc.public_dependencies] test.assertEqual(self.public_dependencies, public_dependencies_names) for name, msg_type in self.messages.items(): msg_type.CheckType(test, None, name, file_desc) class EnumType(object): def __init__(self, values): self.values = values def CheckType(self, test, msg_desc, name, file_desc): enum_desc = msg_desc.enum_types_by_name[name] test.assertEqual(name, enum_desc.name) expected_enum_full_name = '.'.join([msg_desc.full_name, name]) test.assertEqual(expected_enum_full_name, enum_desc.full_name) test.assertEqual(msg_desc, enum_desc.containing_type) test.assertEqual(file_desc, enum_desc.file) for index, (value, number) in enumerate(self.values): value_desc = enum_desc.values_by_name[value] test.assertEqual(value, value_desc.name) test.assertEqual(index, value_desc.index) test.assertEqual(number, value_desc.number) test.assertEqual(enum_desc, value_desc.type) test.assertIn(value, msg_desc.enum_values_by_name) class MessageType(object): def __init__(self, type_dict, field_list, is_extendable=False, extensions=None): self.type_dict = type_dict self.field_list = field_list self.is_extendable = is_extendable self.extensions = extensions or [] def CheckType(self, test, containing_type_desc, name, file_desc): if containing_type_desc is None: desc = file_desc.message_types_by_name[name] expected_full_name = '.'.join([file_desc.package, name]) else: desc = containing_type_desc.nested_types_by_name[name] expected_full_name = '.'.join([containing_type_desc.full_name, name]) test.assertEqual(name, desc.name) test.assertEqual(expected_full_name, desc.full_name) test.assertEqual(containing_type_desc, desc.containing_type) test.assertEqual(desc.file, file_desc) test.assertEqual(self.is_extendable, desc.is_extendable) for name, subtype in self.type_dict.items(): subtype.CheckType(test, desc, name, file_desc) for index, (name, field) in enumerate(self.field_list): field.CheckField(test, desc, name, index, file_desc) for index, (name, field) in enumerate(self.extensions): field.CheckField(test, desc, name, index, file_desc) class EnumField(object): def __init__(self, number, type_name, default_value): self.number = number self.type_name = type_name self.default_value = default_value def CheckField(self, test, msg_desc, name, index, file_desc): field_desc = msg_desc.fields_by_name[name] enum_desc = msg_desc.enum_types_by_name[self.type_name] test.assertEqual(name, field_desc.name) expected_field_full_name = '.'.join([msg_desc.full_name, name]) test.assertEqual(expected_field_full_name, field_desc.full_name) test.assertEqual(index, field_desc.index) test.assertEqual(self.number, field_desc.number) test.assertEqual(descriptor.FieldDescriptor.TYPE_ENUM, field_desc.type) test.assertEqual(descriptor.FieldDescriptor.CPPTYPE_ENUM, field_desc.cpp_type) test.assertTrue(field_desc.has_default_value) test.assertEqual(enum_desc.values_by_name[self.default_value].number, field_desc.default_value) test.assertFalse(enum_desc.values_by_name[self.default_value].has_options) test.assertEqual(msg_desc, field_desc.containing_type) test.assertEqual(enum_desc, field_desc.enum_type) test.assertEqual(file_desc, enum_desc.file) class MessageField(object): def __init__(self, number, type_name): self.number = number self.type_name = type_name def CheckField(self, test, msg_desc, name, index, file_desc): field_desc = msg_desc.fields_by_name[name] field_type_desc = msg_desc.nested_types_by_name[self.type_name] test.assertEqual(name, field_desc.name) expected_field_full_name = '.'.join([msg_desc.full_name, name]) test.assertEqual(expected_field_full_name, field_desc.full_name) test.assertEqual(index, field_desc.index) test.assertEqual(self.number, field_desc.number) test.assertEqual(descriptor.FieldDescriptor.TYPE_MESSAGE, field_desc.type) test.assertEqual(descriptor.FieldDescriptor.CPPTYPE_MESSAGE, field_desc.cpp_type) test.assertFalse(field_desc.has_default_value) test.assertEqual(msg_desc, field_desc.containing_type) test.assertEqual(field_type_desc, field_desc.message_type) test.assertEqual(file_desc, field_desc.file) class StringField(object): def __init__(self, number, default_value): self.number = number self.default_value = default_value def CheckField(self, test, msg_desc, name, index, file_desc): field_desc = msg_desc.fields_by_name[name] test.assertEqual(name, field_desc.name) expected_field_full_name = '.'.join([msg_desc.full_name, name]) test.assertEqual(expected_field_full_name, field_desc.full_name) test.assertEqual(index, field_desc.index) test.assertEqual(self.number, field_desc.number) test.assertEqual(descriptor.FieldDescriptor.TYPE_STRING, field_desc.type) test.assertEqual(descriptor.FieldDescriptor.CPPTYPE_STRING, field_desc.cpp_type) test.assertTrue(field_desc.has_default_value) test.assertEqual(self.default_value, field_desc.default_value) test.assertEqual(file_desc, field_desc.file) class ExtensionField(object): def __init__(self, number, extended_type): self.number = number self.extended_type = extended_type def CheckField(self, test, msg_desc, name, index, file_desc): field_desc = msg_desc.extensions_by_name[name] test.assertEqual(name, field_desc.name) expected_field_full_name = '.'.join([msg_desc.full_name, name]) test.assertEqual(expected_field_full_name, field_desc.full_name) test.assertEqual(self.number, field_desc.number) test.assertEqual(index, field_desc.index) test.assertEqual(descriptor.FieldDescriptor.TYPE_MESSAGE, field_desc.type) test.assertEqual(descriptor.FieldDescriptor.CPPTYPE_MESSAGE, field_desc.cpp_type) test.assertFalse(field_desc.has_default_value) test.assertTrue(field_desc.is_extension) test.assertEqual(msg_desc, field_desc.extension_scope) test.assertEqual(msg_desc, field_desc.message_type) test.assertEqual(self.extended_type, field_desc.containing_type.name) test.assertEqual(file_desc, field_desc.file) class AddDescriptorTest(unittest.TestCase): def _TestMessage(self, prefix): pool = descriptor_pool.DescriptorPool() pool.AddDescriptor(unittest_pb2.TestAllTypes.DESCRIPTOR) self.assertEqual( 'protobuf_unittest.TestAllTypes', pool.FindMessageTypeByName( prefix + 'protobuf_unittest.TestAllTypes').full_name) # AddDescriptor is not recursive. with self.assertRaises(KeyError): pool.FindMessageTypeByName( prefix + 'protobuf_unittest.TestAllTypes.NestedMessage') pool.AddDescriptor(unittest_pb2.TestAllTypes.NestedMessage.DESCRIPTOR) self.assertEqual( 'protobuf_unittest.TestAllTypes.NestedMessage', pool.FindMessageTypeByName( prefix + 'protobuf_unittest.TestAllTypes.NestedMessage').full_name) # Files are implicitly also indexed when messages are added. self.assertEqual( 'google/protobuf/unittest.proto', pool.FindFileByName( 'google/protobuf/unittest.proto').name) self.assertEqual( 'google/protobuf/unittest.proto', pool.FindFileContainingSymbol( prefix + 'protobuf_unittest.TestAllTypes.NestedMessage').name) @unittest.skipIf(api_implementation.Type() == 'cpp', 'With the cpp implementation, Add() must be called first') def testMessage(self): self._TestMessage('') self._TestMessage('.') def _TestEnum(self, prefix): pool = descriptor_pool.DescriptorPool() pool.AddEnumDescriptor(unittest_pb2.ForeignEnum.DESCRIPTOR) self.assertEqual( 'protobuf_unittest.ForeignEnum', pool.FindEnumTypeByName( prefix + 'protobuf_unittest.ForeignEnum').full_name) # AddEnumDescriptor is not recursive. with self.assertRaises(KeyError): pool.FindEnumTypeByName( prefix + 'protobuf_unittest.ForeignEnum.NestedEnum') pool.AddEnumDescriptor(unittest_pb2.TestAllTypes.NestedEnum.DESCRIPTOR) self.assertEqual( 'protobuf_unittest.TestAllTypes.NestedEnum', pool.FindEnumTypeByName( prefix + 'protobuf_unittest.TestAllTypes.NestedEnum').full_name) # Files are implicitly also indexed when enums are added. self.assertEqual( 'google/protobuf/unittest.proto', pool.FindFileByName( 'google/protobuf/unittest.proto').name) self.assertEqual( 'google/protobuf/unittest.proto', pool.FindFileContainingSymbol( prefix + 'protobuf_unittest.TestAllTypes.NestedEnum').name) @unittest.skipIf(api_implementation.Type() == 'cpp', 'With the cpp implementation, Add() must be called first') def testEnum(self): self._TestEnum('') self._TestEnum('.') @unittest.skipIf(api_implementation.Type() == 'cpp', 'With the cpp implementation, Add() must be called first') def testService(self): pool = descriptor_pool.DescriptorPool() with self.assertRaises(KeyError): pool.FindServiceByName('protobuf_unittest.TestService') pool.AddServiceDescriptor(unittest_pb2._TESTSERVICE) self.assertEqual( 'protobuf_unittest.TestService', pool.FindServiceByName('protobuf_unittest.TestService').full_name) @unittest.skipIf(api_implementation.Type() == 'cpp', 'With the cpp implementation, Add() must be called first') def testFile(self): pool = descriptor_pool.DescriptorPool() pool.AddFileDescriptor(unittest_pb2.DESCRIPTOR) self.assertEqual( 'google/protobuf/unittest.proto', pool.FindFileByName( 'google/protobuf/unittest.proto').name) # AddFileDescriptor is not recursive; messages and enums within files must # be explicitly registered. with self.assertRaises(KeyError): pool.FindFileContainingSymbol( 'protobuf_unittest.TestAllTypes') def testEmptyDescriptorPool(self): # Check that an empty DescriptorPool() contains no messages. pool = descriptor_pool.DescriptorPool() proto_file_name = descriptor_pb2.DESCRIPTOR.name self.assertRaises(KeyError, pool.FindFileByName, proto_file_name) # Add the above file to the pool file_descriptor = descriptor_pb2.FileDescriptorProto() descriptor_pb2.DESCRIPTOR.CopyToProto(file_descriptor) pool.Add(file_descriptor) # Now it exists. self.assertTrue(pool.FindFileByName(proto_file_name)) def testCustomDescriptorPool(self): # Create a new pool, and add a file descriptor. pool = descriptor_pool.DescriptorPool() file_desc = descriptor_pb2.FileDescriptorProto( name='some/file.proto', package='package') file_desc.message_type.add(name='Message') pool.Add(file_desc) self.assertEqual(pool.FindFileByName('some/file.proto').name, 'some/file.proto') self.assertEqual(pool.FindMessageTypeByName('package.Message').name, 'Message') def testFileDescriptorOptionsWithCustomDescriptorPool(self): # Create a descriptor pool, and add a new FileDescriptorProto to it. pool = descriptor_pool.DescriptorPool() file_name = 'file_descriptor_options_with_custom_descriptor_pool.proto' file_descriptor_proto = descriptor_pb2.FileDescriptorProto(name=file_name) extension_id = file_options_test_pb2.foo_options file_descriptor_proto.options.Extensions[extension_id].foo_name = 'foo' pool.Add(file_descriptor_proto) # The options set on the FileDescriptorProto should be available in the # descriptor even if they contain extensions that cannot be deserialized # using the pool. file_descriptor = pool.FindFileByName(file_name) options = file_descriptor.GetOptions() self.assertEqual('foo', options.Extensions[extension_id].foo_name) # The object returned by GetOptions() is cached. self.assertIs(options, file_descriptor.GetOptions()) class DefaultPoolTest(unittest.TestCase): def testFindMethods(self): pool = descriptor_pool.Default() self.assertIs( pool.FindFileByName('google/protobuf/unittest.proto'), unittest_pb2.DESCRIPTOR) self.assertIs( pool.FindMessageTypeByName('protobuf_unittest.TestAllTypes'), unittest_pb2.TestAllTypes.DESCRIPTOR) self.assertIs( pool.FindFieldByName('protobuf_unittest.TestAllTypes.optional_int32'), unittest_pb2.TestAllTypes.DESCRIPTOR.fields_by_name['optional_int32']) self.assertIs( pool.FindEnumTypeByName('protobuf_unittest.ForeignEnum'), unittest_pb2.ForeignEnum.DESCRIPTOR) if api_implementation.Type() != 'cpp': self.skipTest('Only the C++ implementation correctly indexes all types') self.assertIs( pool.FindExtensionByName('protobuf_unittest.optional_int32_extension'), unittest_pb2.DESCRIPTOR.extensions_by_name['optional_int32_extension']) self.assertIs( pool.FindOneofByName('protobuf_unittest.TestAllTypes.oneof_field'), unittest_pb2.TestAllTypes.DESCRIPTOR.oneofs_by_name['oneof_field']) self.assertIs( pool.FindServiceByName('protobuf_unittest.TestService'), unittest_pb2.DESCRIPTOR.services_by_name['TestService']) def testAddFileDescriptor(self): pool = descriptor_pool.Default() file_desc = descriptor_pb2.FileDescriptorProto(name='some/file.proto') pool.Add(file_desc) pool.AddSerializedFile(file_desc.SerializeToString()) TEST1_FILE = ProtoFile( 'google/protobuf/internal/descriptor_pool_test1.proto', 'google.protobuf.python.internal', { 'DescriptorPoolTest1': MessageType({ 'NestedEnum': EnumType([('ALPHA', 1), ('BETA', 2)]), 'NestedMessage': MessageType({ 'NestedEnum': EnumType([('EPSILON', 5), ('ZETA', 6)]), 'DeepNestedMessage': MessageType({ 'NestedEnum': EnumType([('ETA', 7), ('THETA', 8)]), }, [ ('nested_enum', EnumField(1, 'NestedEnum', 'ETA')), ('nested_field', StringField(2, 'theta')), ]), }, [ ('nested_enum', EnumField(1, 'NestedEnum', 'ZETA')), ('nested_field', StringField(2, 'beta')), ('deep_nested_message', MessageField(3, 'DeepNestedMessage')), ]) }, [ ('nested_enum', EnumField(1, 'NestedEnum', 'BETA')), ('nested_message', MessageField(2, 'NestedMessage')), ], is_extendable=True), 'DescriptorPoolTest2': MessageType({ 'NestedEnum': EnumType([('GAMMA', 3), ('DELTA', 4)]), 'NestedMessage': MessageType({ 'NestedEnum': EnumType([('IOTA', 9), ('KAPPA', 10)]), 'DeepNestedMessage': MessageType({ 'NestedEnum': EnumType([('LAMBDA', 11), ('MU', 12)]), }, [ ('nested_enum', EnumField(1, 'NestedEnum', 'MU')), ('nested_field', StringField(2, 'lambda')), ]), }, [ ('nested_enum', EnumField(1, 'NestedEnum', 'IOTA')), ('nested_field', StringField(2, 'delta')), ('deep_nested_message', MessageField(3, 'DeepNestedMessage')), ]) }, [ ('nested_enum', EnumField(1, 'NestedEnum', 'GAMMA')), ('nested_message', MessageField(2, 'NestedMessage')), ]), }) TEST2_FILE = ProtoFile( 'google/protobuf/internal/descriptor_pool_test2.proto', 'google.protobuf.python.internal', { 'DescriptorPoolTest3': MessageType({ 'NestedEnum': EnumType([('NU', 13), ('XI', 14)]), 'NestedMessage': MessageType({ 'NestedEnum': EnumType([('OMICRON', 15), ('PI', 16)]), 'DeepNestedMessage': MessageType({ 'NestedEnum': EnumType([('RHO', 17), ('SIGMA', 18)]), }, [ ('nested_enum', EnumField(1, 'NestedEnum', 'RHO')), ('nested_field', StringField(2, 'sigma')), ]), }, [ ('nested_enum', EnumField(1, 'NestedEnum', 'PI')), ('nested_field', StringField(2, 'nu')), ('deep_nested_message', MessageField(3, 'DeepNestedMessage')), ]) }, [ ('nested_enum', EnumField(1, 'NestedEnum', 'XI')), ('nested_message', MessageField(2, 'NestedMessage')), ], extensions=[ ('descriptor_pool_test', ExtensionField(1001, 'DescriptorPoolTest1')), ]), }, dependencies=['google/protobuf/internal/descriptor_pool_test1.proto', 'google/protobuf/internal/more_messages.proto'], public_dependencies=['google/protobuf/internal/more_messages.proto']) if __name__ == '__main__': unittest.main()
import unittest from the_ark.actions import Actions, ActionException from the_ark.field_handlers import STRING_FIELD, EMAIL_FIELD, PHONE_FIELD, ZIP_CODE_FIELD, DATE_FIELD from the_ark.resources.action_constants import * from the_ark.selenium_helpers import SeleniumHelpers, SeleniumHelperExceptions from mock import patch class ActionTestCase(unittest.TestCase): def setUp(self): self.instantiate_screenshot_class() @patch("the_ark.selenium_helpers.SeleniumHelpers") def instantiate_screenshot_class(self, selenium_helper): self.ac = Actions(selenium_helper) # - Dispatch Methods @patch("the_ark.actions.Actions.dispatch_action") def test_dispatch_list(self, mock_dispatch): action_list = ["pickles", "pineapples"] self.ac.dispatch_list_of_actions(action_list) mock_dispatch.return_value = True self.assertEqual(len(mock_dispatch.mock_calls), 2) mock_dispatch.assert_called_with(action_list[1], None) @patch("the_ark.actions.Actions.dispatch_action") def test_dispatch_list_without_list(self, mock_dispatch): action_list = False with self.assertRaises(ActionException) as type_error: self.ac.dispatch_list_of_actions(action_list) self.assertIn("list type", type_error.exception.msg) @patch("the_ark.actions.Actions.load_url") def test_dispatch_action(self, mock_load): action = {ACTION_KEY: LOAD_URL_ACTION} mock_load.return_value = True self.ac.dispatch_action(action) mock_load.assert_called_with(action, None) @patch("the_ark.actions.Actions.load_url") def test_dipatch_action_selenium_error(self, mock_load): action = {ACTION_KEY: LOAD_URL_ACTION} mock_load.side_effect = SeleniumHelperExceptions("Boom!", "stacktrace", "www.meltmedia.com") with self.assertRaises(ActionException) as selenium_error: self.ac.dispatch_action(action) self.assertIn("www.meltmedia.com", selenium_error.exception.msg) @patch("the_ark.actions.Actions.load_url") def test_dipatch_action_key_error(self, mock_load): action = {ACTION_KEY: LOAD_URL_ACTION} mock_load.side_effect = KeyError("Boom!") with self.assertRaises(ActionException) as key_error: self.ac.dispatch_action(action) self.assertIn("key named 'Boom!'", key_error.exception.msg) @patch("the_ark.actions.Actions.load_url") def test_dipatch_action_attribute_error(self, mock_load): action = {ACTION_KEY: LOAD_URL_ACTION} mock_load.side_effect = AttributeError("Boom!") with self.assertRaises(ActionException) as attr_error: self.ac.dispatch_action(action) self.assertIn("AttributeError", attr_error.exception.msg) @patch("the_ark.actions.Actions.load_url") def test_dipatch_action_general_error(self, mock_load): action = {ACTION_KEY: LOAD_URL_ACTION} mock_load.side_effect = Exception("Boom!") with self.assertRaises(ActionException) as e: self.ac.dispatch_action(action) self.assertIn("error", e.exception.msg) # - Load URL Action @patch("the_ark.selenium_helpers.SeleniumHelpers.load_url") @patch("the_ark.selenium_helpers.SeleniumHelpers.get_current_url") def test_load_url_action_with_just_path(self, mock_url, sh_load): sh = SeleniumHelpers() ac = Actions(sh) action = { ACTION_KEY: LOAD_URL_ACTION, PATH_KEY: "/pickles" } test_url = "http://www.meltmedia.com" mock_url.return_value = test_url ac.load_url(action) sh_load.assert_called_with(test_url + "/pickles", None) @patch("the_ark.selenium_helpers.SeleniumHelpers.load_url") def test_load_url_action_with_url_and_path(self, sh_load): sh = SeleniumHelpers() ac = Actions(sh) test_url = "http://www.meltmedia.com" action = { ACTION_KEY: LOAD_URL_ACTION, PATH_KEY: "/pickles", URL_KEY: test_url } ac.load_url(action) sh_load.assert_called_with(test_url + "/pickles", None) @patch("the_ark.selenium_helpers.SeleniumHelpers.load_url") def test_load_url_action_with_just_url_withbypass(self, sh_load): sh = SeleniumHelpers() ac = Actions(sh) test_url = "http://www.meltmedia.com" action = { ACTION_KEY: LOAD_URL_ACTION, URL_KEY: test_url, BYPASS_404_KEY: True } ac.load_url(action) sh_load.assert_called_with(test_url, True) # - Click Action def test_click(self): action = { ACTION_KEY: CLICK_ACTION, CSS_SELECTOR_KEY: ".pickles" } self.ac.click(action, None) self.ac.sh.click_an_element.assert_called_with(action[CSS_SELECTOR_KEY]) def test_click_with_element(self): action = { ACTION_KEY: CLICK_ACTION, ELEMENT_KEY: True } element = "element" self.ac.click(action, element) self.ac.sh.click_an_element.assert_called_with(web_element=element) # - Hover Action def test_hover(self): action = { ACTION_KEY: HOVER_ACTION, CSS_SELECTOR_KEY: ".pickles" } self.ac.hover(action, None) self.ac.sh.hover_on_element.assert_called_with(action[CSS_SELECTOR_KEY]) def test_hover_with_element(self): action = { ACTION_KEY: HOVER_ACTION, ELEMENT_KEY: True } element = "element" self.ac.hover(action, element) self.ac.sh.hover_on_element.assert_called_with(web_element=element) # - Enter Text Action def test_enter_text(self): action = { ACTION_KEY: ENTER_TEXT_ACTION, CSS_SELECTOR_KEY: ".enter", INPUT_KEY: "input text" } self.ac.enter_text(action, None) self.ac.sh.fill_an_element.assert_called_with(action[INPUT_KEY], action[CSS_SELECTOR_KEY]) def test_enter_text_with_element(self): action = { ACTION_KEY: ENTER_TEXT_ACTION, ELEMENT_KEY: True, INPUT_KEY: "input text" } element = "element" self.ac.enter_text(action, element) self.ac.sh.fill_an_element.assert_called_with(action[INPUT_KEY], web_element=element) @patch('the_ark.input_generator.generate_string') def test_enter_text_as_string_with_element(self, mock_string): test_string = "Test String" mock_string.return_value = test_string action = { ACTION_KEY: ENTER_TEXT_ACTION, ELEMENT_KEY: True, INPUT_TYPE_KEY: STRING_FIELD } element = "element" self.ac.enter_text(action, element) self.ac.sh.fill_an_element.assert_called_with(test_string, web_element=element) @patch('the_ark.input_generator.generate_email') def test_enter_text_as_email(self, mock_email): test_email = "testingStuff@meltmedia.com" mock_email.return_value = test_email action = { ACTION_KEY: ENTER_TEXT_ACTION, CSS_SELECTOR_KEY: ".enter", INPUT_TYPE_KEY: EMAIL_FIELD } self.ac.enter_text(action, None) self.ac.sh.fill_an_element.assert_called_with(test_email, action[CSS_SELECTOR_KEY]) @patch('the_ark.input_generator.generate_zip_code') def test_enter_text_as_zip_code(self, mock_zip): test_zip = "12345" mock_zip.return_value = test_zip action = { ACTION_KEY: ENTER_TEXT_ACTION, CSS_SELECTOR_KEY: ".enter", INPUT_TYPE_KEY: ZIP_CODE_FIELD } self.ac.enter_text(action, None) self.ac.sh.fill_an_element.assert_called_with(test_zip, action[CSS_SELECTOR_KEY]) @patch('the_ark.input_generator.generate_phone') def test_enter_text_as_phone_number(self, mock_phone): test_phone = "5557891011" mock_phone.return_value = test_phone action = { ACTION_KEY: ENTER_TEXT_ACTION, CSS_SELECTOR_KEY: ".enter", INPUT_TYPE_KEY: PHONE_FIELD } self.ac.enter_text(action, None) self.ac.sh.fill_an_element.assert_called_with(test_phone, action[CSS_SELECTOR_KEY]) @patch('the_ark.input_generator.generate_date') def test_enter_text_as_date(self, mock_date): test_date = "01/27/1987" mock_date.return_value = test_date action = { ACTION_KEY: ENTER_TEXT_ACTION, CSS_SELECTOR_KEY: ".enter", INPUT_TYPE_KEY: DATE_FIELD } self.ac.enter_text(action, None) self.ac.sh.fill_an_element.assert_called_with(test_date, action[CSS_SELECTOR_KEY]) @patch('the_ark.input_generator.generate_date') def test_enter_text_as_unknown_type(self, mock_date): test_date = "01/27/1987" mock_date.return_value = test_date action = { ACTION_KEY: ENTER_TEXT_ACTION, CSS_SELECTOR_KEY: ".enter", INPUT_TYPE_KEY: "Pickles" } with self.assertRaises(ActionException) as unknown_input_type: self.ac.enter_text(action, None) self.assertIn(action[INPUT_TYPE_KEY], unknown_input_type.exception.msg) # - Scroll Actions def test_scroll_window_to_position(self): action = { ACTION_KEY: SCROLL_WINDOW_TO_POSITION_ACTION, POSITION_TOP_KEY: "1", POSITION_BOTTOM_KEY: "2", X_POSITION_KEY: 300, Y_POSITION_KEY: 4000 } self.ac.scroll_window_to_position(action, None) self.ac.sh.scroll_window_to_position.assert_called_with(action[Y_POSITION_KEY], action[X_POSITION_KEY], action[POSITION_TOP_KEY], action[POSITION_BOTTOM_KEY]) def test_scroll_window_to_position_with_defaults(self): action = { ACTION_KEY: SCROLL_WINDOW_TO_POSITION_ACTION, POSITION_TOP_KEY: "1", X_POSITION_KEY: 300, } self.ac.scroll_window_to_position(action) self.ac.sh.scroll_window_to_position.assert_called_with(0, action[X_POSITION_KEY], action[POSITION_TOP_KEY], 0) def test_scroll_window_to_element_defaults(self): action = { ACTION_KEY: SCROLL_WINDOW_TO_ELEMENT_ACTION, CSS_SELECTOR_KEY: ".scroll" } self.ac.scroll_window_to_element(action, None) self.ac.sh.scroll_to_element.assert_called_with(action[CSS_SELECTOR_KEY], position_bottom=None, position_middle=None) def test_scroll_window_to_element_with_top_and_bottom(self): action = { ACTION_KEY: SCROLL_WINDOW_TO_ELEMENT_ACTION, CSS_SELECTOR_KEY: ".scroll", POSITION_BOTTOM_KEY: True, POSITION_MIDDLE_KEY: True } self.ac.scroll_window_to_element(action, None) self.ac.sh.scroll_to_element.assert_called_with(action[CSS_SELECTOR_KEY], position_bottom=True, position_middle=True) def test_scroll_window_to_element_with_element(self): action = { ACTION_KEY: SCROLL_WINDOW_TO_ELEMENT_ACTION, ELEMENT_KEY: True } element = "element" self.ac.scroll_window_to_element(action, element) self.ac.sh.scroll_to_element.assert_called_with(web_element=element, position_bottom=None, position_middle=None) def test_scroll_window_to_element_with_element_and_top_and_bottom(self): action = { ACTION_KEY: SCROLL_WINDOW_TO_ELEMENT_ACTION, ELEMENT_KEY: True, POSITION_BOTTOM_KEY: True, POSITION_MIDDLE_KEY: True } element = "element" self.ac.scroll_window_to_element(action, element) self.ac.sh.scroll_to_element.assert_called_with(position_bottom=True, position_middle=True, web_element=element) def test_scroll_an_element_defaults(self): action = { ACTION_KEY: SCROLL_AN_ELEMENT_ACTION, CSS_SELECTOR_KEY: ".scrollable" } self.ac.scroll_an_element(action, None) self.ac.sh.scroll_an_element.assert_called_with(css_selector=action[CSS_SELECTOR_KEY], scroll_bottom=None, scroll_padding=None, scroll_top=None, x_position=None, y_position=None) def test_scroll_an_element_with_values(self): action = { ACTION_KEY: SCROLL_AN_ELEMENT_ACTION, CSS_SELECTOR_KEY: ".scrollable", POSITION_BOTTOM_KEY: True, X_POSITION_KEY: 100, Y_POSITION_KEY: 1200, SCROLL_PADDING_KEY: 45, POSITION_TOP_KEY: False } self.ac.scroll_an_element(action, None) self.ac.sh.scroll_an_element.assert_called_with(css_selector=action[CSS_SELECTOR_KEY], scroll_bottom=action[POSITION_BOTTOM_KEY], scroll_padding=action[SCROLL_PADDING_KEY], scroll_top=action[POSITION_TOP_KEY], x_position=action[X_POSITION_KEY], y_position=action[Y_POSITION_KEY]) def test_scroll_an_element_with_element_and_defaults(self): action = { ACTION_KEY: SCROLL_AN_ELEMENT_ACTION, ELEMENT_KEY: True } element = "element" self.ac.scroll_an_element(action, element) self.ac.sh.scroll_an_element.assert_called_with(web_element=element, scroll_bottom=None, scroll_padding=None, scroll_top=None, x_position=None, y_position=None) def test_scroll_an_element_With_element_and_values(self): action = { ACTION_KEY: SCROLL_AN_ELEMENT_ACTION, ELEMENT_KEY: True, POSITION_BOTTOM_KEY: True, X_POSITION_KEY: 100, Y_POSITION_KEY: 1200, SCROLL_PADDING_KEY: 45, POSITION_TOP_KEY: False } element = "element" self.ac.scroll_an_element(action, element) self.ac.sh.scroll_an_element.assert_called_with(web_element=element, scroll_bottom=action[POSITION_BOTTOM_KEY], scroll_padding=action[SCROLL_PADDING_KEY], scroll_top=action[POSITION_TOP_KEY], x_position=action[X_POSITION_KEY], y_position=action[Y_POSITION_KEY]) # - Refresh Action def test_refresh(self): self.ac.refresh("action") self.ac.sh.refresh.called_once() # - Sleep Action @patch('time.sleep') def test_sleep(self, mock_sleep): action = { ACTION_KEY: SLEEP_ACTION, DURATION_KEY: 10 } self.ac.sleep(action) mock_sleep.assert_called_with(action[DURATION_KEY]) # - Wait for Element Action def test_wait_for_element_defaults(self): action = { ACTION_KEY: WAIT_FOR_ELEMENT_ACTION, CSS_SELECTOR_KEY: ".wait" } self.ac.wait_for_element(action) self.ac.sh.wait_for_element.assert_called_with(action[CSS_SELECTOR_KEY], 15) def test_wait_for_element_with_duration(self): action = { ACTION_KEY: WAIT_FOR_ELEMENT_ACTION, CSS_SELECTOR_KEY: ".wait", DURATION_KEY: 10 } self.ac.wait_for_element(action) self.ac.sh.wait_for_element.assert_called_with(action[CSS_SELECTOR_KEY], action[DURATION_KEY]) # - Special Key Action def test_send_special_key(self): action = { ACTION_KEY: SEND_SPECIAL_KEY_ACTION, SPECIAL_KEY_KEY: "ENTER" } self.ac.send_special_key(action) self.ac.sh.send_special_key.assert_called_with(action[SPECIAL_KEY_KEY]) # - Show Element Action def test_show_element(self): action = { ACTION_KEY: SHOW_ELEMENT_ACTION, CSS_SELECTOR_KEY: ".pickles" } self.ac.show_element(action, None) self.ac.sh.show_element.assert_called_with(action[CSS_SELECTOR_KEY]) def test_show_element_with_element(self): action = { ACTION_KEY: SHOW_ELEMENT_ACTION, ELEMENT_KEY: True } element = "element" self.ac.show_element(action, element) self.ac.sh.show_element.assert_called_with(web_element=element) # - Hide Element Action def test_hide_element(self): action = { ACTION_KEY: HIDE_ELEMENT_ACTION, CSS_SELECTOR_KEY: ".pickles" } self.ac.hide_element(action, None) self.ac.sh.hide_element.assert_called_with(action[CSS_SELECTOR_KEY]) def test_hide_element_with_element(self): action = { ACTION_KEY: HIDE_ELEMENT_ACTION, ELEMENT_KEY: True } element = "element" self.ac.hide_element(action, element) self.ac.sh.hide_element.assert_called_with(web_element=element) # - Execute Script Action def test_execute_script(self): action = { ACTION_KEY: EXECUTE_SCRIPT_ACTION, SCRIPT_KEY: "script text" } self.ac.execute_script(action, None) self.ac.sh.execute_script.assert_called_with(action[SCRIPT_KEY]) def test_execute_script_with_element(self): action = { ACTION_KEY: EXECUTE_SCRIPT_ACTION, ELEMENT_KEY: True, SCRIPT_KEY: "script text" } element = "element" self.ac.execute_script(action, element) self.ac.sh.execute_script.assert_called_with(action[SCRIPT_KEY], element) # - Switch Window Handle Action def test_switch_window_handle(self): action = { ACTION_KEY: "switch_window_handle" } self.ac.switch_window_handle(action) self.ac.sh.switch_window_handle.assert_called_with() def test_switch_window_handle_with_index(self): fake_handles = ["handle1", "handle2"] action = { ACTION_KEY: "switch_window_handle", INDEX_KEY: 1 } self.ac.sh.get_window_handles.return_value = fake_handles self.ac.switch_window_handle(action) self.ac.sh.switch_window_handle.assert_called_with(fake_handles[action[INDEX_KEY]]) # - Close Window Action def test_close_window(self): action = { ACTION_KEY: CLOSE_WINDOW_ACTION } self.ac.close_window(action) self.ac.sh.close_window.assert_called_with() # - For Each Action @patch('the_ark.actions.Actions.dispatch_list_of_actions') def test_for_each(self, mock_dispatch): action ={ ACTION_KEY: FOR_EACH_ACTION, CSS_SELECTOR_KEY: ".for-each", ALLOW_EMPTY_KEY: False, ACTION_LIST_KEY: [ { ACTION_KEY: CLICK_ACTION, ELEMENT_KEY: True }, ] } self.ac.sh.element_exists.return_value = True self.ac.sh.get_list_of_elements.return_value = ["element1", "element2"] self.ac.for_each(action) self.assertEqual(len(mock_dispatch.mock_calls), 2) @patch('the_ark.actions.Actions.dispatch_list_of_actions') def test_for_each_without_elements(self, mock_dispatch): action = { ACTION_KEY: FOR_EACH_ACTION, CSS_SELECTOR_KEY: ".for-each", ALLOW_EMPTY_KEY: False, ACTION_LIST_KEY: [ { ACTION_KEY: CLICK_ACTION, ELEMENT_KEY: True }, ] } self.ac.sh.element_exists.return_value = False with self.assertRaises(ActionException) as type_error: self.ac.for_each(action) self.assertIn("no elements", type_error.exception.msg) @patch('the_ark.actions.Actions.dispatch_list_of_actions') def test_for_each_child(self, mock_dispatch): action = { ACTION_KEY: FOR_EACH_ACTION, CSS_SELECTOR_KEY: ".for-each", ALLOW_EMPTY_KEY: False, CHILD_KEY: True, ACTION_LIST_KEY: [ { ACTION_KEY: CLICK_ACTION, ELEMENT_KEY: True }, ] } self.ac.sh.element_exists.return_value = ["element1", "element2"] self.ac.for_each(action) @patch('the_ark.actions.Actions.dispatch_list_of_actions') def test_for_each_allow_empty(self, mock_dispatch): action = { ACTION_KEY: FOR_EACH_ACTION, CSS_SELECTOR_KEY: ".for-each", ALLOW_EMPTY_KEY: True, ACTION_LIST_KEY: [ { ACTION_KEY: CLICK_ACTION, ELEMENT_KEY: True }, ] } self.ac.sh.element_exists.return_value = False self.ac.for_each(action) @patch('the_ark.actions.Actions.dispatch_list_of_actions') def test_for_each_do_not_increment(self, mock_dispatch): action = { ACTION_KEY: FOR_EACH_ACTION, CSS_SELECTOR_KEY: ".for-each", ALLOW_EMPTY_KEY: True, DO_NOT_INCREMENT_KEY: True, ACTION_LIST_KEY: [ { ACTION_KEY: CLICK_ACTION, ELEMENT_KEY: True }, ] } self.ac.sh.element_exists.return_value = True self.ac.sh.get_list_of_elements.return_value = ["element1", "element2"] self.ac.for_each(action) # - ActionException def test_exception_text(self): ac = ActionException("test") self.assertIn("test", str(ac)) def test_exception_with_stacktrace(self): ac = ActionException("test", "stacktrace testing") self.assertIn("stacktrace testing", str(ac)) def test_exception_with_details(self): ac = ActionException("test", details={"meltQA": "Rocks"}) self.assertIn("Rocks", str(ac)) self.assertIn("Exception Details", str(ac))
# -*- coding: utf-8 -*- """ Missing Person Registry @author: nursix """ module = request.controller prefix = request.controller resourcename = request.function if prefix not in deployment_settings.modules: raise HTTP(404, body="Module disabled: %s" % prefix) MISSING = str(T("Missing")) FOUND = str(T("Found")) DETAILS = str(T("Details")) action = lambda l, u: dict(label=str(l), url=str(u), _class="action-btn") s3_menu(module) # ----------------------------------------------------------------------------- def index(): """ Home Page """ try: module_name = deployment_settings.modules[prefix].name_nice except: module_name = T("Missing Persons Registry") prefix = "pr" resourcename = "person" tablename = "%s_%s" % (prefix, resourcename) table = db[tablename] report_url = URL(c="mpr", f=resourcename, args=["[id]", "note"], vars=dict(status="missing")) s3mgr.configure(tablename, create_next=report_url, list_fields=["id", "first_name", "middle_name", "last_name", "picture", "gender", "age_group", "missing"]) def prep(r): if r.representation == "html": if not r.id and not r.method: r.method = "search" else: redirect(URL(resourcename, args=request.args)) return True response.s3.prep = prep def postp(r, output): response.s3.actions = [] if not r.component: open_button_label = DETAILS if auth.s3_logged_in(): mreport = URL(resourcename, args=["[id]", "note", "create"], vars=dict(status="missing")) freport = URL(resourcename, args=["[id]", "note", "create"], vars=dict(status="found")) response.s3.actions = [action(MISSING, mreport), action(FOUND, freport)] # Is the current user reported missing? if isinstance(output, dict): person = s3_logged_in_person() if person and db.pr_person[person].missing: myself = URL(resourcename, args=[person, "note", "create"], vars=dict(status="found")) output.update(myself=myself) else: open_button_label = UPDATE #linkto = r.resource.crud._linkto(r, update=True)("[id]") linkto = URL(resourcename, args=["[id]", "note"]) response.s3.actions.append(action(open_button_label, linkto)) return output response.s3.postp = postp output = s3_rest_controller(prefix, resourcename, module_name=module_name) response.view = "mpr/index.html" response.title = module_name s3_menu(module) return output # ----------------------------------------------------------------------------- def person(): """ Missing Persons List """ prefix = "pr" tablename = "%s_%s" % (prefix, resourcename) table = db[tablename] s3.crud_strings[tablename].update( title_display = T("Missing Person Details"), title_list = T("Missing Persons Registry"), subtitle_list = T("Missing Persons"), label_list_button = T("List Missing Persons"), msg_list_empty = T("No Persons currently reported missing")) s3mgr.configure("pr_group_membership", list_fields=["id", "group_id", "group_head", "description" ]) s3mgr.configure(tablename, create_next = URL(c="mpr", f="person", args=["[id]", "note", "create"], vars=dict(status="missing")), list_fields=["id", "first_name", "middle_name", "last_name", "picture", "gender", "age_group", "missing" ]) def prep(r): if r.interactive and not r.id: r.resource.add_filter(db.pr_person.missing == True) if r.component_name == "config": _config = db.gis_config defaults = db(_config.id == 1).select(limitby=(0, 1)).first() for key in defaults.keys(): if key not in ["id", "uuid", "mci", "update_record", "delete_record"]: _config[key].default = defaults[key] elif r.component_name == "note": ntable = db.pr_note status = r.vars.get("status", None) if status: if status == "missing": ntable.status.default = 1 ntable.status.writable = False ntable.timestmp.label = T("Date/Time when last seen") ntable.note_text.label = T("Circumstances of disappearance") s3.crud_strings[str(ntable)].update( title_create = "Add Missing Report", subtitle_create = "Add Missing Report") elif status == "found": ntable.status.default = 2 ntable.status.writable = False ntable.timestmp.label = T("Date/Time when found") ntable.note_text.label = T("Comments") s3.crud_strings[str(ntable)].update( title_create = "Add Find Report", subtitle_create = "Add Find Report") else: ntable.status.default = 99 ntable.status.writable = True return True response.s3.prep = prep def postp(r, output): if r.interactive: if not r.component: label = READ linkto = URL(f="person", args=("[id]", "note")) else: label = UPDATE linkto = r.resource.crud._linkto(r)("[id]") response.s3.actions = [action(label, linkto)] if not r.component: label = FOUND linkto = URL(f="person", args=("[id]", "note", "create"), vars=dict(status="found")) response.s3.actions.append(action(label, linkto)) return output response.s3.postp = postp ptable = db.pr_person ptable.missing.default = True ptable.missing.readable = False ptable.missing.writable = False ptable.pe_label.readable = False ptable.pe_label.writable = False ptable.occupation.readable = False ptable.occupation.writable = False mpr_tabs = [(T("Person Details"), None), (T("Physical Description"), "physical_description"), (T("Images"), "pimage"), (T("Identity"), "identity"), (T("Address"), "address"), (T("Contact Data"), "contact"), (T("Journal"), "note")] rheader = lambda r: pr_rheader(r, tabs=mpr_tabs) output = s3_rest_controller("pr", resourcename, rheader=rheader) s3_menu(module) return output # -----------------------------------------------------------------------------
# Simple Arp Handler v2 # Jack Zhao # s.zhao.j@gmail.com from operator import attrgetter from ryu.base import app_manager from ryu.controller import ofp_event from ryu.controller.handler import CONFIG_DISPATCHER from ryu.controller.handler import MAIN_DISPATCHER from ryu.controller.handler import set_ev_cls from ryu.lib.packet import packet from ryu.lib.packet import ethernet from ryu.lib.packet import arp from ryu.lib.packet.packet import Packet from ryu.lib.packet.ethernet import ethernet from ryu.lib.packet.arp import arp from ryu.ofproto import ofproto_v1_3 from ryu.ofproto import ether from ryu.ofproto import inet import time import os from ryu.lib.packet.lldp import LLDP_MAC_NEAREST_BRIDGE # config logging # LOG = logging.getLogger('SimpleArp') # LOG.setLevel(logging.DEBUG) # logging.basicConfig() OFP_SWITCHES_LIST_PREVIOUS = \ './network-data2/ofp_switches_list_prev.db' # OFP_SWITCHES_LIST_SCRIPT = \ # './scripts/remote_ovs_operation/get_switch_ofpbr_datapath_id.sh' class MySimpleArp(app_manager.RyuApp): OFP_VERSIONS = [ofproto_v1_3.OFP_VERSION] def __init__(self, *args, **kwargs): super(MySimpleArp, self).__init__(*args, **kwargs) self.mac_to_port = {} self.arp_learning = {} # self.arp_learning = {srcMAC:[dst_ip,in_port,time]} self.packetToport = {} self.hostname_list = {} self.dpset = kwargs['dpset'] def _get_hwaddr(self, dpid, port_no): return self.dpset.get_port(dpid, port_no).hw_addr def _hostname_Check(self, datapath): # Given decimal datapath ID, return hostname if os.path.exists(os.path.abspath(OFP_SWITCHES_LIST_PREVIOUS)): f = os.path.abspath(OFP_SWITCHES_LIST_PREVIOUS) else: f = os.path.abspath(OFP_SWITCHES_LIST) with open(f, 'r') as iff: for line in iff: hostname, dpid = line.split() self.hostname_list[int(dpid, 16)] = hostname # print self.hostname_list # NEED add some datapath check later if datapath not in self.hostname_list.keys(): return datapath else: return self.hostname_list[datapath] # @set_ev_cls(ofp_event.EventOFPSwitchFeatures, CONFIG_DISPATCHER) # def switch_features_handler(self, ev): # """ install table-miss flow entry """ # self.logger.debug("my_arp: switch_features_handler:") # datapath = ev.msg.datapath # ofproto = datapath.ofproto # parser = datapath.ofproto_parser # self.logger.info("################### datapath in decimal %s", datapath.id) # self.logger.info("################### datapath in hex %s", hex(int(datapath.id))) # # # We specify NO BUFFER to max_len of the output action due to # OVS bug. At this moment, if we specify a lesser number, e.g., # 128, OVS will send Packet-In with invalid buffer_id and # truncated packet data. In that case, we cannot output packets # correctly. The bug has been fixed in OVS v2.1.0. # match = parser.OFPMatch() # actions = [parser.OFPActionOutput(ofproto.OFPP_CONTROLLER, # ofproto.OFPCML_NO_BUFFER)] # self.add_flow(datapath, 0, match, actions) # def add_flow(self, datapath, priority, match, actions, buffer_id=None): # self.logger.debug("my_arp:add_flow") # ofproto = datapath.ofproto # parser = datapath.ofproto_parser # inst = [parser.OFPInstructionActions(ofproto.OFPIT_APPLY_ACTIONS, # actions)] # if buffer_id: # mod = parser.OFPFlowMod(datapath=datapath, buffer_id=buffer_id, # priority=priority, match=match, # instructions=inst) # else: # mod = parser.OFPFlowMod(datapath=datapath, priority=priority, # match=match, instructions=inst) # datapath.send_msg(mod) @set_ev_cls(ofp_event.EventOFPPacketIn, MAIN_DISPATCHER) def _packet_in_handler(self, ev): self.logger.debug("my_arp: _packet_in_handler:") # If you hit this you might want to increase # the "miss_send_length" of your switch if ev.msg.msg_len < ev.msg.total_len: self.logger.debug("packet truncated: only %s of %s bytes", ev.msg.msg_len, ev.msg.total_len) msg = ev.msg datapath = msg.datapath # ofproto = datapath.ofproto inPort = msg.match['in_port'] packets = Packet(msg.data) dpid = datapath.id eth = packets.get_protocols(ethernet)[0] src = eth.src dst = eth.dst self.mac_to_port.setdefault(hex(dpid), {}) self.arp_learning.setdefault(dpid, []) self.packetToport.setdefault(dpid, {}) if dst == LLDP_MAC_NEAREST_BRIDGE: return if src in self.mac_to_port[hex(dpid)].keys(): pass else: self.mac_to_port[hex(dpid)][src] = inPort data = msg.data etherFrame = packets.get_protocol(ethernet) # if dst == LLDP_MAC_NEAREST_BRIDGE: # return # print "packets: ", packets # print "packets.get_protocols(ethernet): ", packets.get_protocols(ethernet) # print "etherFrame######", etherFrame # etherFrame = packets.get_protocol(ethernet) etherFrame = packets.get_protocol(ethernet) # print etherFrame # print ether # print hex(etherFrame.ethertype) # print hex(ether.ETH_TYPE_ARP) if etherFrame.ethertype == ether.ETH_TYPE_ARP: self.logger.debug("\n:") arpPacket = packets.get_protocol(arp) arpArriveTime = time.time() srcMac = etherFrame.src arp_dstIP = arpPacket.dst_ip dst = eth.dst # print "ARP" # if dst == "ff:ff:ff:ff:ff:ff": # self.packetToport[datapath.id][(srcMac, arp_dstIP, inPort)] = arpArriveTime # print "arp" # print "packets: ", packets # print "packets.get_protocols(ethernet): ", packets.get_protocols(ethernet) # print "ARP: %s" % arpPacket.opcode # self.logger.info("packet in %s %s %s %s", dpid, src, dst, in_port) # if arpPacket.opcode == 1: # print "ARP Requst" # self.logger.info("packet in %s %s %s %s", self._hostname_Check(datapath.id), srcMac, dst, inPort) # elif arpPacket.opcode == 2: # print "ARP Reply" # self.logger.info("packet in %s %s %s %s", self._hostname_Check(datapath.id), srcMac, dst, inPort) self.receive_arp(datapath, packets, etherFrame, inPort, data) return 0 else: self.logger.debug("Drop packet") return 1 def receive_arp(self, datapath, packets, etherFrame, inPort, data): self.logger.info("MySimpleArp: receive_arp: ") arpPacket = packets.get_protocol(arp) arp_dstIP = arpPacket.dst_ip arp_srcIP = arpPacket.src_ip # self.logger.info("packet in %s %s %s %s", self._hostname_Check(datapath.id), etherFrame.src, etherFrame.dst, inPort) self.logger.info("\t %s: receive ARP PACKET %s => %s (in_port=%d) From %s to %s" % (self._hostname_Check(datapath.id), etherFrame.src, etherFrame.dst, inPort, arp_srcIP, arp_dstIP)) if arpPacket.opcode == 1: print "\t ARP Requst: Test if it is repeated Broadcasting" if self.anti_arp_brodcast(datapath, etherFrame, inPort, arp_dstIP): # self.logger.info("%s: receive new ARP request %s => %s (port%d) src_ip=%s dst_ip=%s" # % (self._hostname_Check(datapath.id), etherFrame.src, etherFrame.dst, inPort, arp_srcIP, arp_dstIP)) # print "-----packetToport: ", self.packetToport # print "-----arp_learning: ", self.arp_learning self.reply_arp(datapath, etherFrame, arpPacket, arp_dstIP, inPort, data) else: self.logger.info("\t Not ARP Broadcasting No Action is taken!!!!!~~~~") # self.reply_arp(datapath, etherFrame, arpPacket, arp_dstIP, inPort, data) elif arpPacket.opcode == 2: self.logger.info("\t ARP_reply: then Forwarding this ARP reply packet !!!!!!!!!!!!!!") self.logger.info("\t packet in %s %s %s %s", self._hostname_Check( datapath.id), etherFrame.src, etherFrame.dst, inPort) self.reply_arp(datapath, etherFrame, arpPacket, arp_dstIP, inPort, data) def anti_arp_brodcast(self, datapath, etherFrame, inPort, arp_dstIP): test = False self.logger.info("MySimpleArp: anti_arp_brodcast:") if etherFrame.dst == "ff:ff:ff:ff:ff:ff": # self.logger.info("self.packetToport:", self.packetToport) # self.logger.info(self.packetToport[datapath.id].keys()) # self.logger.info(self.packetToport[datapath.id]) if not self.packetToport[datapath.id]: # self.logger.info("Another muticast packet form %s at %i port in %s " % ( # etherFrame.src, inPort, self._hostname_Check(datapath.id))) # self.logger.info("packetToport: ", self.packetToport) # self.logger.info("arp_learning: ", self.arp_learning self.packetToport[datapath.id][(etherFrame.src, arp_dstIP, inPort)] = time.time() self.logger.info("\t1 Added (%s %s %s): %s to self.packetToport and Forwarding ARP Broadcasting" % (etherFrame.src, arp_dstIP, inPort, time.time())) test = True return test elif ((etherFrame.src, arp_dstIP, inPort) in self.packetToport[datapath.id].keys()): self.logger.info("\t2 ARP BLOCKING, No Further transfer") # self.logger.info("Another muticast packet form %s at %i port in %s " % ( # etherFrame.src, inPort, self._hostname_Check(datapath.id))) # self.logger.info("{DPID: { (src_mac, dst_ip, in_port): arpArriveTime, ():time }") self.logger.info("\t %s %s" % (self._hostname_Check(datapath.id), self.packetToport[datapath.id].keys())) test = False return test else: # same ARP broadcast but from inport number is diffeernt from original port nubmer, block for keys in self.packetToport[datapath.id].keys(): if ((etherFrame.src, arp_dstIP) == keys[0:2]) and (inPort != keys[2]): self.logger.info("\t 4 same ARP packet coming from differe port. So not Forwarding ARP Broadcasting. Detail: (%s %s %s): %s" % (etherFrame.src, arp_dstIP, inPort, time.time())) # add this entry, avoid if else checking next time self.packetToport[datapath.id][(etherFrame.src, arp_dstIP, inPort)] = time.time() test = False return test if ((etherFrame.src, arp_dstIP, inPort) not in self.packetToport[datapath.id].keys()): self.packetToport[datapath.id][(etherFrame.src, arp_dstIP, inPort)] = time.time() self.logger.info("\t 3 New ARP Broading casting. Added (%s %s %s): %s to self.packetToport and Forwarding ARP Broadcasting" % (etherFrame.src, arp_dstIP, inPort, time.time())) test = True return test return test def reply_arp(self, datapath, etherFrame, arpPacket, arp_dstIp, inPort, data): # self.logger.info("flood") dst = etherFrame.dst dpid = hex(datapath.id) if dst in self.mac_to_port[dpid]: out_port = self.mac_to_port[dpid][dst] self.logger.info("\t reply_arp: Reply To Port %s !!!!!!!!!!!!!!!!!" % out_port) else: out_port = datapath.ofproto.OFPP_FLOOD self.logger.info("\t reply_arp: Flooding...") actions = [datapath.ofproto_parser.OFPActionOutput(out_port)] out = datapath.ofproto_parser.OFPPacketOut(datapath=datapath, buffer_id=0xffffffff, in_port=inPort, actions=actions, data=data) datapath.send_msg(out) # print mac_to_port for verification self.logger.info("MySimpleArp: self.mac_to_port") for key, value in self.mac_to_port.items(): print "\t", self._hostname_Check(int(str(key), 16)), value
""" voxel.py ----------- Convert meshes to a simple voxel data structure and back again. """ import numpy as np from . import ops from . import transforms from . import morphology from . import encoding as enc from .. import bounds as bounds_module from .. import caching from .. import transformations as tr from ..parent import Geometry from ..constants import log class VoxelGrid(Geometry): """ Store 3D voxels. """ def __init__(self, encoding, transform=None, metadata=None): if transform is None: transform = np.eye(4) if isinstance(encoding, np.ndarray): encoding = enc.DenseEncoding(encoding.astype(bool)) if encoding.dtype != bool: raise ValueError('encoding must have dtype bool') self._data = caching.DataStore() self.encoding = encoding self._data['transform'] = transforms.Transform(transform) self._cache = caching.Cache(id_function=self._data.crc) self.metadata = dict() # update the mesh metadata with passed metadata if isinstance(metadata, dict): self.metadata.update(metadata) elif metadata is not None: raise ValueError( 'metadata should be a dict or None, got %s' % str(metadata)) def md5(self): return self._data.md5() def crc(self): return self._data.crc() @property def encoding(self): """ `Encoding` object providing the occupancy grid. See `trimesh.voxel.encoding` for implementations. """ return self._data['encoding'] @encoding.setter def encoding(self, encoding): if isinstance(encoding, np.ndarray): encoding = enc.DenseEncoding(encoding) elif not isinstance(encoding, enc.Encoding): raise ValueError( 'encoding must be an Encoding, got %s' % str(encoding)) if len(encoding.shape) != 3: raise ValueError( 'encoding must be rank 3, got shape %s' % str(encoding.shape)) if encoding.dtype != bool: raise ValueError( 'encoding must be binary, got %s' % encoding.dtype) self._data['encoding'] = encoding @property def _transform(self): return self._data['transform'] @property def transform(self): """4x4 homogeneous transformation matrix.""" return self._transform.matrix @transform.setter def transform(self, matrix): """4x4 homogeneous transformation matrix.""" self._transform.matrix = matrix @property def translation(self): """Location of voxel at [0, 0, 0].""" return self._transform.translation @property def origin(self): """Deprecated. Use `self.translation`.""" # DEPRECATED. Use translation instead return self.translation @property def scale(self): """ 3-element float representing per-axis scale. Raises a `RuntimeError` if `self.transform` has rotation or shear components. """ return self._transform.scale @property def pitch(self): """ Uniform scaling factor representing the side length of each voxel. Returns ----------- pitch : float Pitch of the voxels. Raises ------------ `RuntimeError` If `self.transformation` has rotation or shear components of has non-uniform scaling. """ return self._transform.pitch @property def element_volume(self): return self._transform.unit_volume def apply_transform(self, matrix): self._transform.apply_transform(matrix) return self def strip(self): """ Mutate self by stripping leading/trailing planes of zeros. Returns -------- self after mutation occurs in-place """ encoding, padding = self.encoding.stripped self.encoding = encoding self._transform.matrix[:3, 3] = self.indices_to_points(padding[:, 0]) return self @caching.cache_decorator def bounds(self): indices = self.sparse_indices # get all 8 corners of the AABB corners = bounds_module.corners([indices.min(axis=0) - 0.5, indices.max(axis=0) + 0.5]) # transform these corners to a new frame corners = self._transform.transform_points(corners) # get the AABB of corners in-frame bounds = np.array([corners.min(axis=0), corners.max(axis=0)]) bounds.flags.writeable = False return bounds @caching.cache_decorator def extents(self): bounds = self.bounds extents = bounds[1] - bounds[0] extents.flags.writeable = False return extents @caching.cache_decorator def is_empty(self): return self.encoding.is_empty @property def shape(self): """3-tuple of ints denoting shape of occupancy grid.""" return self.encoding.shape @caching.cache_decorator def filled_count(self): """int, number of occupied voxels in the grid.""" return self.encoding.sum.item() def is_filled(self, point): """ Query points to see if the voxel cells they lie in are filled or not. Parameters ---------- point : (n, 3) float Points in space Returns --------- is_filled : (n,) bool Is cell occupied or not for each point """ point = np.asanyarray(point) indices = self.points_to_indices(point) in_range = np.logical_and( np.all(indices < np.array(self.shape), axis=-1), np.all(indices >= 0, axis=-1)) is_filled = np.zeros_like(in_range) is_filled[in_range] = self.encoding.gather_nd(indices[in_range]) return is_filled def fill(self, method='holes', **kwargs): """ Mutates self by filling in the encoding according to `morphology.fill`. Parameters ---------- method: implementation key, one of `trimesh.voxel.morphology.fill.fillers` keys **kwargs: additional kwargs passed to the keyed implementation Returns ---------- self after replacing encoding with a filled version. """ self.encoding = morphology.fill(self.encoding, method=method, **kwargs) return self def hollow(self, structure=None): """ Mutates self by removing internal voxels leaving only surface elements. Surviving elements are those in encoding that are adjacent to an empty voxel, where adjacency is controlled by `structure`. Parameters ---------- structure: adjacency structure. If None, square connectivity is used. Returns ---------- self after replacing encoding with a surface version. """ self.encoding = morphology.surface(self.encoding) return self @caching.cache_decorator def marching_cubes(self): """ A marching cubes Trimesh representation of the voxels. No effort was made to clean or smooth the result in any way; it is merely the result of applying the scikit-image measure.marching_cubes function to self.encoding.dense. Returns --------- meshed: Trimesh object representing the current voxel object, as returned by marching cubes algorithm. """ meshed = ops.matrix_to_marching_cubes(matrix=self.matrix) return meshed @property def matrix(self): """ Return a DENSE matrix of the current voxel encoding Returns ------------- dense : (a, b, c) bool Numpy array of dense matrix Shortcut to voxel.encoding.dense """ return self.encoding.dense @caching.cache_decorator def volume(self): """ What is the volume of the filled cells in the current voxel object. Returns --------- volume: float, volume of filled cells """ return self.filled_count * self.element_volume @caching.cache_decorator def points(self): """ The center of each filled cell as a list of points. Returns ---------- points: (self.filled, 3) float, list of points """ return self._transform.transform_points( self.sparse_indices.astype(float)) @property def sparse_indices(self): """(n, 3) int array of sparse indices of occupied voxels.""" return self.encoding.sparse_indices def as_boxes(self, colors=None, **kwargs): """ A rough Trimesh representation of the voxels with a box for each filled voxel. Parameters ---------- colors : (3,) or (4,) float or uint8 (X, Y, Z, 3) or (X, Y, Z, 4) float or uint8 Where matrix.shape == (X, Y, Z) Returns --------- mesh : trimesh.Trimesh Mesh with one box per filled cell. """ if colors is not None: colors = np.asanyarray(colors) if colors.ndim == 4: encoding = self.encoding if colors.shape[:3] == encoding.shape: # TODO jackd: more efficient implementation? # encoding.as_mask? colors = colors[encoding.dense] else: log.warning('colors incorrect shape!') colors = None elif colors.shape not in ((3,), (4,)): log.warning('colors incorrect shape!') colors = None mesh = ops.multibox( centers=self.sparse_indices.astype(float), colors=colors) mesh = mesh.apply_transform(self.transform) return mesh def points_to_indices(self, points): """ Convert points to indices in the matrix array. Parameters ---------- points: (n, 3) float, point in space Returns --------- indices: (n, 3) int array of indices into self.encoding """ points = self._transform.inverse_transform_points(points) return np.round(points).astype(int) def indices_to_points(self, indices): return self._transform.transform_points(indices.astype(float)) def show(self, *args, **kwargs): """ Convert the current set of voxels into a trimesh for visualization and show that via its built- in preview method. """ return self.as_boxes(kwargs.pop( 'colors', None)).show(*args, **kwargs) def copy(self): return VoxelGrid(self.encoding.copy(), self._transform.matrix.copy()) def revoxelized(self, shape): """ Create a new VoxelGrid without rotations, reflections or shearing. Parameters ---------- shape: 3-tuple of ints denoting the shape of the returned VoxelGrid. Returns ---------- VoxelGrid of the given shape with (possibly non-uniform) scale and translation transformation matrix. """ from .. import util shape = tuple(shape) bounds = self.bounds.copy() extents = self.extents points = util.grid_linspace(bounds, shape).reshape(shape + (3,)) dense = self.is_filled(points) scale = extents / np.asanyarray(shape) translate = bounds[0] return VoxelGrid( dense, transform=tr.scale_and_translate(scale, translate)) def __add__(self, other): raise NotImplementedError("TODO : implement voxel concatenation")
""" Converts a "TCGA format" tab-delimited ASCII feature matrix into the binary format consumed by the pairwise executable. Basically this just carries out a number of inspections, validations, and conversions on each row of the data that would otherwise 1. be done redundantly in the C executable 2. and would be more error-prone to implement in C. The most important aspects of this format are: 1. Every value in the original matrix is converted to a 4-byte float or integer value in the result 2. Every row in the binary result is prefixed by a 32-bit word that conveys attributes of that row to the pairwise executable (the compiled C code, that is). Row prefixes have the following format: From the least to the most significant bit we have: - The low-order 16 bits are the count of NAs - The third byte is the category count for categorical variables. - The high byte is unused Data with a category count of 'one' is implicitly numeric. Pictorially... --------------------------------------- 3322 2222 2222 1111 1111 1100 0000 0000 1098 7654 3210 9876 5432 1098 7654 3210 uuuu uuuD cccc cccC nnnn nnnn nnnn nnnn --------------------------------------- u unused D discrete flag 1 => binary/categorical variable 0 => numeric/scalar variable c|C count of categories OR pseudo-count of numeric values if D==0, then C==0 => "OK" C==1 => numeric variable is a constant vector (excluding NA's) if D==1, then 'cccc cccC' is category count n count of missing values Notice that an intentional implication of the above definitions is that if the 'cccc cccC' field == 1, the feature is degenerate regardless of its type. Note that the column count refers to DATA columns, excluding the (currently) 32-bit row prefixes. The row headers are excluded because they might change size in the future in which case treating the row headers as a column would invalidate calculations in associated C code since byte widths might not agree. The overall format of the resulting file is: 1) HEADER 2) MATRIX 3) STRINGS 4) ROWMAP ...and STRINGS and ROWMAP are optional Just FYI, in the outer 'with' clause at the bottom, the overall call structure of the program is: _verifyAbsence _process _processNumeric _processCategorical _appendStringTable (optionally) """ import sys from struct import pack import os.path import subprocess import optparse assert sys.version_info.major >= 3 _SIG = "PAIRWISE" _NAN_AS_UINT = 0x7FC00000 _NAN_AS_FLOAT = float('nan') _NAN_STRINGS = frozenset(['na','nA','Na','NA']) _SECTOR_SIZE = 512 _MAX_LEVELS = 32 parser = optparse.OptionParser( usage="usage: %prog [options]") parser.add_option("-n","--no-names", action="store_false", dest="include_string_table", default=True, help="""Do not include row names in the binary file. Excluding row names precludes feature lookup by name. """) parser.add_option("-H","--noheader", action="store_true", dest="noheader", default=False, help="""Do not expect a header line in the input file. """) parser.add_option("-O","--overwrite", action="store_true", dest="overwrite", default=False, help="""Overwrite previous existing matrix/map files (if any). """) parser.add_option("-C","--cat2num", action="store_true", dest="implicitNumeric", default=False, help="""Implicitly convert categorical features with >{} levels to numeric. """.format( _MAX_LEVELS ) ) def _verifyAbsence( fname ): if os.path.exists( fname ): print( "{} exists, and I won't overwrite it!".format( fname ) ) sys.exit(-1) def _processNumeric( fields, NC, fp, fnum, met ): FORMAT = "I{}f".format(NC) # Analyze the content of fields as strings before transforming it. # Regarding the non-missing values... PRESENT = [ float(v) for v in fields if v.upper() != "NA" ] # ...are they all identical, meaning degenerate? And if there's only # 1 non-missing, yes, that is considered degenerate, too! isdegen = len(PRESENT) < 2 or all( [ PRESENT[0]==v for v in PRESENT[1:]] ) NA = len(fields) - len(PRESENT) print( "NA", fnum, NA, sep="\t", file=met ) f = [ _NAN_AS_FLOAT if v.upper()=="NA" else float(v) for v in fields ] b = pack( FORMAT, ( (0x00010000 if isdegen else 0) | (0x0000FFFF & NA) ), *f ) if fp.write( b ) != (NC+1)*4: sys.exit( b ) return len(f) def _processCategorical( fields, NC, fp, fnum, met, convertCatToNum=False ): """ Be aware of categorical features that actually are not!... """ FORMAT = "I{}I".format(NC) NA = len([ 1 for v in fields if v.upper()=="NA" ]) print( "NA", fnum, NA, sep="\t", file=met ) S = set(fields).difference( _NAN_STRINGS ) # Special-case genuinely boolean categories (without labels)... if S == frozenset(['0','1']): f = [ _NAN_AS_UINT if v.upper()=="NA" else int(v) for v in fields ] b = pack( FORMAT, ( 0x01020000 | (0x0000FFFF & NA) ), *f ) if fp.write( b ) != (NC+1)*4: sys.exit( b ) NF = len(f) elif len(S) <= _MAX_LEVELS: S = sorted(list(S)) f = [ _NAN_AS_UINT if v.upper()=="NA" else S.index(v) for v in fields ] b = pack( FORMAT, ( 0x01000000 | (0x00FF0000 & (len(S)<<16)) | (0x0000FFFF & NA) ), *f ) if fp.write( b ) != (NC+1)*4: sys.exit( b ) # Write out the encoding print( "FE\t{}\t{}".format( fnum, len(S) ), file=met ) for i in range(len(S)): print( "CA\t{}\t{}".format(i,S[i]), file=met ) NF = len(f) elif convertCatToNum: # There are too many categories, and implicit conversion has been # requested, so delegate this to _processNumeric with the data... if all([ "NA"==v.upper() or v.isdigit() for v in fields ]): # ...unchanged, if the labels are all integers (or NA), or... NF = _processNumeric( fields, NC, fp, fnum, met ) conversionType = "natural" else: # ...converted to ARBITRARY integers if ANY of the labels # are not already integers. S = sorted(list(S)) NF = _processNumeric( [ "NA" if v.upper()=="NA" else str(S.index(v)) for v in fields ], NC, fp, fnum, met ) conversionType = "arbitrary" # ...and warn in metadata that implicit conversion has occurred. print( "IC\t{}\tcategorical -> numeric ({} order)".format( fnum, conversionType ), file=met ) else: raise RuntimeError( "error: factor with too many levels ({}).\n\tMaybe try the --cat2num option?".format(len(S)) ) return NF def _process( idat, odat, ometa, expectheader=True, implicitNumeric=False ): """ Binarized matrix is written to odat. Textual category encodings are written to fp_enc. Returns number of DATA rows and DATA columns. """ loff = 0 # Feature offset and line offset need not correspond... feat = 0 # ...because of comment lines. rows = [] NC = 0 # Assume the first line is a header, but check for expected content. if expectheader: line = idat.readline() fields = line.strip().split('\t') # both leading AND trailing ws. NC = len(fields)-1 loff += 1 # Remaining lines are data. line = idat.readline() while len(line) > 0: fields = line.strip().split('\t') # both leading AND trailing ws. ty = line[0].upper() rowname = fields[0] # Strip the TCGA label off the front... datcols = fields[1:] # ...so NC remainder are data. nc = len(datcols) if NC == 0: NC = nc # if a header missing, 1st data line sets column count. elif NC != nc: # if column count doesn't match that from header. raise RuntimeError( "{} data columns on line {}, expected".format( nc, loff+1, NC ) ) if 'N' == ty: # check most common first! _processNumeric( datcols, nc, odat, feat, ometa ) elif 'B' == ty or 'C' == ty: try: _processCategorical( datcols, nc, odat, feat, ometa, implicitNumeric ) except Exception as x: raise RuntimeError( "{} in row {}".format( x, rowname ) ) else: raise RuntimeError("unexpected type at line "+str(loff+1) ) rows.append( [ rowname, feat ] ) feat += 1 loff += 1 line = idat.readline() return ( nc, rows ) def _appendStringTable( strings, fp ): """ This appends 1) a packed string table (ragged array) sorted by string value and 2) a map of (string_offset,matrix_row_offset) pairs ...to the end of the file. """ # Pad the file to a 16-byte boundary (just to simplify debugging in # hexdump). NUL = bytes(1) while fp.tell() % 16: fp.write( NUL ) # This is where the string section will reside, so note the offset... OFF_STR = fp.tell() # Store the strings, noting their offsets FROM THE BASE of the section # and after each is stored, REPLACE it in the pair with its offset. ordered = sorted( strings, key=lambda x:x[0] ) for pair in ordered: OFF = fp.tell() - OFF_STR s = pair[0].encode('ascii') fp.write( pack( "{}sc".format(len(s)), s, NUL ) ) pair[0] = OFF # REPLACE the string with its offset. # ...pad to a disk sector size boundary. (See notes at top for why.) while fp.tell() % _SECTOR_SIZE: fp.write( NUL ) # This is where the row map will reside, so note its file offset. OFF_MAP = fp.tell() for pair in ordered: fp.write( pack( "II", pair[0], pair[1] ) ) # string offset, matrix row return ( OFF_STR, OFF_MAP ) ############################################################################ opts,args = parser.parse_args() INPUT = args[0] OUTPUT = os.path.splitext(INPUT)[0] + ".bin" CATEGS = os.path.splitext(INPUT)[0] + ".cat" if not opts.overwrite: _verifyAbsence( OUTPUT ) _verifyAbsence( CATEGS ) with open( INPUT ) as fp_in: # Calculate the input matrix' MD5 hash to provide a hard tie to the # resulting output matrix' source. p = subprocess.Popen( [ "md5sum", INPUT ], stdout=subprocess.PIPE ) if p: md5 = p.communicate()[0][:32].decode() else: raise RuntimeError("Is md5sum on your system?") try: with open( OUTPUT, "wb" ) as fp_out: # Write out the header used by the C allpairs. Most of the values # are unknown at this point, so we write 0's as placeholders then # backup and fill them in at the very end when values are known. SIGNATURE_BYTES = _SIG.encode('ascii') HDR_SIZE = fp_out.write( pack( "8sIIIIII32s", SIGNATURE_BYTES, 0, # header size 0, # rows 0, # columns (of data) 0, # Offset to strings (0 => no row map/string table) 0, # Offset to row map (0 => no row map/string table) 0, # Unused md5.encode('ascii') ) ) assert HDR_SIZE == 64 # Open another file to receive (textual) metadata. with open( CATEGS, "w" ) as fp_cat: print( "# for matrix {} with MD5 {}".format( INPUT, md5 ), file=fp_cat ) # ...and here begins the processing in earnest. data_column_count,row_names = \ _process( fp_in, fp_out, fp_cat, not opts.noheader, opts.implicitNumeric ) if opts.include_string_table: off_str, off_map = _appendStringTable( row_names, fp_out ) else: off_str, off_map = 0,0 if off_str > 0xFFFFFFFF or off_map > 0xFFFFFFFF: raise RuntimeError( "File too large" ) # Now back up to header and fill in header size, rows, and columns. fp_out.seek( len(SIGNATURE_BYTES) ) fp_out.write( pack( "IIIII", HDR_SIZE, len(row_names), data_column_count, off_str, off_map ) ) except Exception as x: print( "Failed processing file: {}".format(INPUT), file=sys.stderr ) print( sys.exc_info() ) # In the event of failure, don't leave ANYTHING behind that might # allow a parent script to continue. if os.path.isfile( OUTPUT ): print( "Removing", OUTPUT, file=sys.stderr ) os.remove( OUTPUT ) if os.path.isfile( CATEGS ): print( "Removing", CATEGS, file=sys.stderr ) os.remove( CATEGS ) if __debug__: print( HDR_SIZE, "header bytes" ) # just informational/sanity check
""" Testing DKI microstructure """ import numpy as np import random import dipy.reconst.dki_micro as dki_micro from numpy.testing import (assert_array_almost_equal, assert_almost_equal, assert_, assert_raises) from dipy.sims.voxel import (multi_tensor_dki, _check_directions, multi_tensor) from dipy.io.gradients import read_bvals_bvecs from dipy.core.gradients import gradient_table from dipy.data import get_fnames from dipy.reconst.dti import (eig_from_lo_tri) from dipy.data import default_sphere, get_sphere fimg, fbvals, fbvecs = get_fnames('small_64D') bvals, bvecs = read_bvals_bvecs(fbvals, fbvecs) gtab = gradient_table(bvals, bvecs) # 2 shells for techniques that requires multishell data bvals_2s = np.concatenate((bvals, bvals * 2), axis=0) bvecs_2s = np.concatenate((bvecs, bvecs), axis=0) gtab_2s = gradient_table(bvals_2s, bvecs_2s) # single fiber simulate (which is the assumption of our model) FIE = np.array([[[0.30, 0.32], [0.74, 0.51]], [[0.47, 0.21], [0.80, 0.63]]]) RDI = np.zeros((2, 2, 2)) ADI = np.array([[[1e-3, 1.3e-3], [0.8e-3, 1e-3]], [[0.9e-3, 0.99e-3], [0.89e-3, 1.1e-3]]]) ADE = np.array([[[2.2e-3, 2.3e-3], [2.8e-3, 2.1e-3]], [[1.9e-3, 2.5e-3], [1.89e-3, 2.1e-3]]]) Tor = np.array([[[2.6, 2.4], [2.8, 2.1]], [[2.9, 2.5], [2.7, 2.3]]]) RDE = ADE / Tor # prepare simulation: DWIsim = np.zeros((2, 2, 2, gtab_2s.bvals.size)) # Diffusion microstructural model assumes that signal does not have Taylor # approximation components larger than the fourth order. Thus parameter # estimates are only equal to the ground truth values of the simulation # if signals taylor components larger than the fourth order are removed. # Signal without this taylor components can be generated using the # multi_tensor_dki simulations. Therefore we used this function to test the # expected estimates of the model. DWIsim_all_taylor = np.zeros((2, 2, 2, gtab_2s.bvals.size)) # Signal with all taylor components can be simulated using the function # multi_tensor. Generating this signals will be useful to test the prediction # procedures of DKI-based microstructural model. for i in range(2): for j in range(2): for k in range(2): ADi = ADI[i, j, k] RDi = RDI[i, j, k] ADe = ADE[i, j, k] RDe = RDE[i, j, k] fie = FIE[i, j, k] mevals = np.array([[ADi, RDi, RDi], [ADe, RDe, RDe]]) frac = [fie*100, (1 - fie)*100] theta = random.uniform(0, 180) phi = random.uniform(0, 320) angles = [(theta, phi), (theta, phi)] signal, dt, kt = multi_tensor_dki(gtab_2s, mevals, angles=angles, fractions=frac, snr=None) DWIsim[i, j, k, :] = signal signal, sticks = multi_tensor(gtab_2s, mevals, angles=angles, fractions=frac, snr=None) DWIsim_all_taylor[i, j, k, :] = signal def test_single_fiber_model(): # single fiber simulate (which is the assumption of our model) fie = 0.49 ADi = 0.00099 ADe = 0.00226 RDi = 0 RDe = 0.00087 # prepare simulation: theta = random.uniform(0, 180) phi = random.uniform(0, 320) angles = [(theta, phi), (theta, phi)] mevals = np.array([[ADi, RDi, RDi], [ADe, RDe, RDe]]) frac = [fie*100, (1 - fie)*100] signal, dt, kt = multi_tensor_dki(gtab_2s, mevals, angles=angles, fractions=frac, snr=None) # DKI fit dkiM = dki_micro.DiffusionKurtosisModel(gtab_2s, fit_method="WLS") dkiF = dkiM.fit(signal) # Axonal Water Fraction AWF = dki_micro.axonal_water_fraction(dkiF.model_params, default_sphere, mask=None, gtol=1e-5) assert_almost_equal(AWF, fie) # Extra-cellular and intra-cellular components edt, idt = dki_micro.diffusion_components(dkiF.model_params, default_sphere) EDT = eig_from_lo_tri(edt) IDT = eig_from_lo_tri(idt) # check eigenvalues assert_array_almost_equal(EDT[0:3], np.array([ADe, RDe, RDe])) assert_array_almost_equal(IDT[0:3], np.array([ADi, RDi, RDi])) # first eigenvalue should be the direction of the fibers fiber_direction = _check_directions([(theta, phi)]) f_norm = abs(np.dot(fiber_direction, np.array((EDT[3], EDT[6], EDT[9])))) assert_almost_equal(f_norm, 1.) f_norm = abs(np.dot(fiber_direction, np.array((IDT[3], IDT[6], IDT[9])))) assert_almost_equal(f_norm, 1.) # Test model and fit objects wmtiM = dki_micro.KurtosisMicrostructureModel(gtab_2s, fit_method="WLS") wmtiF = wmtiM.fit(signal) assert_almost_equal(wmtiF.awf, AWF) assert_array_almost_equal(wmtiF.hindered_evals, np.array([ADe, RDe, RDe])) assert_array_almost_equal(wmtiF.restricted_evals, np.array([ADi, RDi, RDi])) assert_almost_equal(wmtiF.hindered_ad, ADe) assert_almost_equal(wmtiF.hindered_rd, RDe) assert_almost_equal(wmtiF.axonal_diffusivity, ADi) assert_almost_equal(wmtiF.tortuosity, ADe/RDe, decimal=4) # Test diffusion_components when a kurtosis tensors is associated with # negative kurtosis values. E.g of this cases is given below: dkiparams = np.array([1.67135726e-03, 5.03651205e-04, 9.35365328e-05, -7.11167583e-01, 6.23186820e-01, -3.25390313e-01, -1.75247376e-02, -4.78415563e-01, -8.77958674e-01, 7.02804064e-01, 6.18673368e-01, -3.51154825e-01, 2.18384153, -2.76378153e-02, 2.22893297, -2.68306546e-01, -1.28411610, -1.56557645e-01, -1.80850619e-01, -8.33152110e-01, -3.62410766e-01, 1.57775442e-01, 8.73775381e-01, 2.77188975e-01, -3.67415502e-02, -1.56330984e-01, -1.62295407e-02]) edt, idt = dki_micro.diffusion_components(dkiparams) assert_(np.all(np.isfinite(edt))) def test_wmti_model_multi_voxel(): # DKI fit dkiM = dki_micro.DiffusionKurtosisModel(gtab_2s, fit_method="WLS") dkiF = dkiM.fit(DWIsim) # Axonal Water Fraction sphere = get_sphere() AWF = dki_micro.axonal_water_fraction(dkiF.model_params, sphere, mask=None, gtol=1e-5) assert_almost_equal(AWF, FIE) # Extra-cellular and intra-cellular components edt, idt = dki_micro.diffusion_components(dkiF.model_params, sphere) EDT = eig_from_lo_tri(edt) IDT = eig_from_lo_tri(idt) # check eigenvalues assert_array_almost_equal(EDT[..., 0], ADE, decimal=3) assert_array_almost_equal(EDT[..., 1], RDE, decimal=3) assert_array_almost_equal(EDT[..., 2], RDE, decimal=3) assert_array_almost_equal(IDT[..., 0], ADI, decimal=3) assert_array_almost_equal(IDT[..., 1], RDI, decimal=3) assert_array_almost_equal(IDT[..., 2], RDI, decimal=3) # Test methods performance when a signal with all zeros is present FIEc = FIE.copy() RDIc = RDI.copy() ADIc = ADI.copy() ADEc = ADE.copy() Torc = Tor.copy() RDEc = RDE.copy() DWIsimc = DWIsim.copy() FIEc[0, 0, 0] = 0 RDIc[0, 0, 0] = 0 ADIc[0, 0, 0] = 0 ADEc[0, 0, 0] = 0 Torc[0, 0, 0] = 0 RDEc[0, 0, 0] = 0 DWIsimc[0, 0, 0, :] = 0 mask = np.ones((2, 2, 2)) mask[0, 0, 0] = 0 dkiF = dkiM.fit(DWIsimc) awf = dki_micro.axonal_water_fraction(dkiF.model_params, sphere, gtol=1e-5) assert_almost_equal(awf, FIEc) # Extra-cellular and intra-cellular components edt, idt = dki_micro.diffusion_components(dkiF.model_params, sphere, awf=awf) EDT = eig_from_lo_tri(edt) IDT = eig_from_lo_tri(idt) assert_array_almost_equal(EDT[..., 0], ADEc, decimal=3) assert_array_almost_equal(EDT[..., 1], RDEc, decimal=3) assert_array_almost_equal(EDT[..., 2], RDEc, decimal=3) assert_array_almost_equal(IDT[..., 0], ADIc, decimal=3) assert_array_almost_equal(IDT[..., 1], RDIc, decimal=3) assert_array_almost_equal(IDT[..., 2], RDIc, decimal=3) # Check when mask is given dkiF = dkiM.fit(DWIsim) awf = dki_micro.axonal_water_fraction(dkiF.model_params, sphere, gtol=1e-5, mask=mask) assert_almost_equal(awf, FIEc, decimal=3) # Extra-cellular and intra-cellular components edt, idt = dki_micro.diffusion_components(dkiF.model_params, sphere, awf=awf, mask=mask) EDT = eig_from_lo_tri(edt) IDT = eig_from_lo_tri(idt) assert_array_almost_equal(EDT[..., 0], ADEc, decimal=3) assert_array_almost_equal(EDT[..., 1], RDEc, decimal=3) assert_array_almost_equal(EDT[..., 2], RDEc, decimal=3) assert_array_almost_equal(IDT[..., 0], ADIc, decimal=3) assert_array_almost_equal(IDT[..., 1], RDIc, decimal=3) assert_array_almost_equal(IDT[..., 2], RDIc, decimal=3) # Check class object wmtiM = dki_micro.KurtosisMicrostructureModel(gtab_2s, fit_method="WLS") wmtiF = wmtiM.fit(DWIsim, mask=mask) assert_almost_equal(wmtiF.awf, FIEc, decimal=3) assert_almost_equal(wmtiF.axonal_diffusivity, ADIc, decimal=3) assert_almost_equal(wmtiF.hindered_ad, ADEc, decimal=3) assert_almost_equal(wmtiF.hindered_rd, RDEc, decimal=3) assert_almost_equal(wmtiF.tortuosity, Torc, decimal=3) def test_dki_micro_predict_single_voxel(): # single fiber simulate (which is the assumption of our model) fie = 0.49 ADi = 0.00099 ADe = 0.00226 RDi = 0 RDe = 0.00087 # prepare simulation: theta = random.uniform(0, 180) phi = random.uniform(0, 320) angles = [(theta, phi), (theta, phi)] mevals = np.array([[ADi, RDi, RDi], [ADe, RDe, RDe]]) frac = [fie*100, (1 - fie)*100] signal, dt, kt = multi_tensor_dki(gtab_2s, mevals, angles=angles, fractions=frac, snr=None) signal_gt, da = multi_tensor(gtab_2s, mevals, angles=angles, fractions=frac, snr=None) # Defined DKI microstrutural model dkiM = dki_micro.KurtosisMicrostructureModel(gtab_2s) # Fit single voxel signal dkiF = dkiM.fit(signal) # Check predict of KurtosisMicrostruturalModel pred = dkiM.predict(dkiF.model_params) assert_array_almost_equal(pred, signal_gt, decimal=4) pred = dkiM.predict(dkiF.model_params, S0=100) assert_array_almost_equal(pred, signal_gt * 100, decimal=4) # Check predict of KurtosisMicrostruturalFit pred = dkiF.predict(gtab_2s, S0=100) assert_array_almost_equal(pred, signal_gt * 100, decimal=4) def test_dki_micro_predict_multi_voxel(): dkiM = dki_micro.KurtosisMicrostructureModel(gtab_2s) dkiF = dkiM.fit(DWIsim) # Check predict of KurtosisMicrostruturalModel pred = dkiM.predict(dkiF.model_params) assert_array_almost_equal(pred, DWIsim_all_taylor, decimal=3) pred = dkiM.predict(dkiF.model_params, S0=100) assert_array_almost_equal(pred, DWIsim_all_taylor * 100, decimal=3) # Check predict of KurtosisMicrostruturalFit pred = dkiF.predict(gtab_2s, S0=100) assert_array_almost_equal(pred, DWIsim_all_taylor * 100, decimal=3) def _help_test_awf_only(dkimicrofit, string): exec(string) def test_dki_micro_awf_only(): dkiM = dki_micro.KurtosisMicrostructureModel(gtab_2s) dkiF = dkiM.fit(DWIsim, awf_only=True) awf = dkiF.awf assert_almost_equal(awf, FIE, decimal=3) # assert_raises(dkiF.hindered_evals) assert_raises(ValueError, _help_test_awf_only, dkiF, 'dkimicrofit.hindered_evals') assert_raises(ValueError, _help_test_awf_only, dkiF, 'dkimicrofit.restricted_evals') assert_raises(ValueError, _help_test_awf_only, dkiF, 'dkimicrofit.axonal_diffusivity') assert_raises(ValueError, _help_test_awf_only, dkiF, 'dkimicrofit.hindered_ad') assert_raises(ValueError, _help_test_awf_only, dkiF, 'dkimicrofit.hindered_rd') assert_raises(ValueError, _help_test_awf_only, dkiF, 'dkimicrofit.tortuosity') def additional_tortuosity_tests(): # Test tortuosity when rd is zero # single voxel t = dki_micro.tortuosity(1.7e-3, 0.0) assert_almost_equal(t, 0.0) # multi-voxel RDEc = RDE.copy() Torc = Tor.copy() RDEc[1, 1, 1] = 0.0 Torc[1, 1, 1] = 0.0 t = dki_micro.tortuosity(ADE, RDEc) assert_almost_equal(Torc, t)
""" Django settings for gge_storage project. For more information on this file, see https://docs.djangoproject.com/en/1.6/topics/settings/ For the full list of settings and their values, see https://docs.djangoproject.com/en/1.6/ref/settings/ """ # Build paths inside the project like this: os.path.join(BASE_DIR, ...) import os BASE_DIR = os.path.dirname(os.path.dirname(__file__)) from django.conf.global_settings import TEMPLATE_CONTEXT_PROCESSORS ROOT_DIR = os.path.abspath(os.path.join(BASE_DIR, '..')) from ConfigParser import RawConfigParser config = RawConfigParser() config_file = os.path.expanduser('~/.gge_storage/settings.ini') if os.path.exists(config_file): config.read(os.path.expanduser(config_file)) else: config.read(os.path.join((ROOT_DIR, 'settings-example.ini'))) ADMINS = tuple(config.items('error mail')) MANAGERS = tuple(config.items('404 mail')) DEBUG = config.getboolean('debug', 'DEBUG') SECRET_KEY = config.get('secrets', 'SECRET_KEY') TEMPLATE_DEBUG = True ALLOWED_HOSTS = [] SITE_ID = 1 # Application definition INSTALLED_APPS = ( 'django.contrib.admin', 'django.contrib.auth', 'django.contrib.sites', 'django.contrib.contenttypes', 'django.contrib.sessions', 'django.contrib.messages', 'django.contrib.staticfiles', 'django.contrib.humanize', #'djangocms_file', #'djangocms_flash', #'djangocms_googlemap', #'djangocms_inherit', #'djangocms_picture', #'djangocms_teaser', #'djangocms_video', # 'djangocms_link', #'djangocms_snippet', #'djangocms_grid', #'djangocms_column', 'djangocms_text_ckeditor', 'cms', 'menus', 'reversion', 'djangocms_admin_style', 'mptt', 'easy_thumbnails', 'filer', 'djcelery', 'lib.socket', 'lib.proxy', 'lib.messaging', 'pushover', 'gge_proxy_manager', 'frontend', 'authentication', 'intern', 'npc', 'templated_forms', 'sekizai', ) MIDDLEWARE_CLASSES = ( 'django.contrib.sessions.middleware.SessionMiddleware', 'django.middleware.csrf.CsrfViewMiddleware', 'django.contrib.auth.middleware.AuthenticationMiddleware', 'django.contrib.messages.middleware.MessageMiddleware', # 'django.middleware.locale.LocaleMiddleware', 'django.middleware.doc.XViewMiddleware', 'django.middleware.common.CommonMiddleware', 'intern.middlewares.player.EnrichPlayerMiddleware', 'cms.middleware.user.CurrentUserMiddleware', 'cms.middleware.page.CurrentPageMiddleware', 'cms.middleware.toolbar.ToolbarMiddleware', 'cms.middleware.language.LanguageCookieMiddleware', ) TEMPLATE_CONTEXT_PROCESSORS += ( 'django.contrib.auth.context_processors.auth', 'django.contrib.messages.context_processors.messages', 'django.core.context_processors.i18n', 'django.core.context_processors.request', 'django.core.context_processors.media', 'django.core.context_processors.static', 'sekizai.context_processors.sekizai', 'cms.context_processors.cms_settings', ) THUMBNAIL_PROCESSORS = ( 'easy_thumbnails.processors.colorspace', 'easy_thumbnails.processors.autocrop', #'easy_thumbnails.processors.scale_and_crop', 'filer.thumbnail_processors.scale_and_crop_with_subject_location', 'easy_thumbnails.processors.filters', ) MIGRATION_MODULES = { 'filer': 'filer.migrations_django', 'cmsplugin_filer_file': 'cmsplugin_filer_file.migrations_django', 'cmsplugin_filer_folder': 'cmsplugin_filer_folder.migrations_django', 'cmsplugin_filer_image': 'cmsplugin_filer_image.migrations_django', 'cmsplugin_filer_teaser': 'cmsplugin_filer_teaser.migrations_django', 'cmsplugin_filer_video': 'cmsplugin_filer_video.migrations_django', 'cms': 'cms.migrations_django', 'menus': 'menus.migrations_django', # Add also the following modules if you're using these plugins: 'djangocms_file': 'djangocms_file.migrations_django', 'djangocms_flash': 'djangocms_flash.migrations_django', 'djangocms_googlemap': 'djangocms_googlemap.migrations_django', 'djangocms_inherit': 'djangocms_inherit.migrations_django', 'djangocms_link': 'djangocms_link.migrations_django', 'djangocms_picture': 'djangocms_picture.migrations_django', 'djangocms_snippet': 'djangocms_snippet.migrations_django', 'djangocms_teaser': 'djangocms_teaser.migrations_django', 'djangocms_video': 'djangocms_video.migrations_django', 'djangocms_text_ckeditor': 'djangocms_text_ckeditor.migrations_django', } ROOT_URLCONF = 'gge_storage.urls' WSGI_APPLICATION = 'gge_storage.wsgi.application' CMS_TEMPLATES = ( ('_base.html', 'Base Layout'), ) # Database # https://docs.djangoproject.com/en/1.6/ref/settings/#databases DATABASES = { 'default': { 'ENGINE': config.get('database', 'DATABASE_ENGINE'), 'NAME': config.get('database', 'DATABASE_NAME'), 'USER': config.get('database', 'DATABASE_USER'), 'PASSWORD': config.get('database', 'DATABASE_PASSWORD'), 'HOST': config.get('database', 'DATABASE_HOST') } } # Internationalization # https://docs.djangoproject.com/en/1.6/topics/i18n/ LANGUAGES = ( ('de', 'German'), ) LANGUAGE_CODE = 'de' TIME_ZONE = 'Europe/Berlin' USE_I18N = True USE_L10N = True USE_TZ = True INTERNAL_IPS = tuple(config.get('debug', 'INTERNAL_IPS').split()) # Static files (CSS, JavaScript, Images) # https://docs.djangoproject.com/en/1.6/howto/static-files/ STATIC_ROOT = os.path.abspath(os.path.join(BASE_DIR, '../static')) STATIC_URL = config.get('common', 'STATIC_URL') #STATICFILES_DIRS = ( # os.path.join(ROOT_DIR, "static_basic"), #) MEDIA_ROOT = os.path.abspath(os.path.join(BASE_DIR, '../media')) MEDIA_URL = '/media/' TEMPLATE_DIRS = ( os.path.join(BASE_DIR, "../templates"), ) LOGIN_URL = '/auth/login' LOGIN_REDIRECT_URL = '/intern' SOCKET_MIDDLEWARE_CLASSES = ( 'lib.socket.middleware.auth.AuthMiddleware', 'lib.socket.middleware.game_recognition.GameRecognitionMiddleware', 'lib.socket.middleware.global_data.GlobalDataMiddleware', 'lib.socket.middleware.collector.CollectorMiddleware', 'lib.socket.middleware.goods_count.GoodsCollectedMiddleware', 'lib.socket.middleware.resource_count.ResourceCountMiddleware', 'lib.socket.middleware.logistic_job.LogisticJobMiddleware', 'lib.socket.middleware.ping.PingMiddleware', 'lib.socket.middleware.resource_key.ResourceKeyMiddleware', 'lib.socket.middleware.production.ProductionMiddleware', 'lib.socket.middleware.geotracking.GeotrackingMiddleware', 'lib.socket.middleware.afk.AfkMiddleware', 'lib.socket.middleware.alliance.AllianceMiddleware', 'lib.socket.middleware.attack.AttackLogMiddleware', 'lib.socket.middleware.map_explorer.MapExplorerMiddleware', 'lib.socket.middleware.castle_economy.CastleEconomyMiddleware', 'lib.socket.middleware.log.LogMiddleware', ) LOGGING = { 'version': 1, 'disable_existing_loggers': True, 'formatters': { 'verbose': { 'format': '%(levelname)s %(asctime)s %(module)s %(process)d %(thread)d %(message)s' }, 'simple': { 'format': '%(levelname)s %(message)s' }, }, 'handlers': { 'console': { 'level': 'DEBUG', 'class': 'logging.StreamHandler', 'formatter': 'simple' }, 'mail_admins': { 'level': 'ERROR', 'class': 'django.utils.log.AdminEmailHandler' } }, 'loggers': { #'django': { # 'handlers': ['null'], # 'propagate': True, # 'level': 'INFO', #}, 'django.request': { 'handlers': ['mail_admins'], 'level': 'ERROR', 'propagate': False, }, 'gge_proxy_manager': { 'handlers': ['console'], 'level': 'DEBUG', #'filters': ['special'] }, 'lib': { 'handlers': ['console'], 'level': 'DEBUG', #'filters': ['special'] } } } # DEFAULT_FROM_EMAIL = 'root@bam.st' # SERVER_EMAIL = DEFAULT_FROM_EMAIL # EMAIL_HOST = 'post.bam.st' # EMAIL_HOST_PASSWORD = 'Buwuta81Godafo66' # EMAIL_HOST_USER = 'gge@bam.st' # EMAIL_SUBJECT_PREFIX = '[GGE] ' # EMAIL_USE_TLS = True # EMAIL_USE_SSL = False DEFAULT_FROM_EMAIL = config.get('email', 'FROM_EMAIL') SERVER_EMAIL = config.get('email', 'SERVER_EMAIL') EMAIL_HOST = config.get('email', 'EMAIL_HOST') EMAIL_HOST_PASSWORD = config.get('email', 'EMAIL_PASSWORD') EMAIL_HOST_USER = config.get('email', 'EMAIL_USER') EMAIL_SUBJECT_PREFIX = config.get('email', 'SUBJECT_PREFIX') EMAIL_USE_TLS = config.getboolean('email', 'USE_TLS') EMAIL_USE_SSL = config.getboolean('email', 'USE_SSL') # Celery import djcelery djcelery.setup_loader() BROKER_URL = 'amqp://guest:guest@localhost:5672//' CELERY_RESULT_BACKEND = BROKER_URL # 'database' CELERYBEAT_SCHEDULER = 'djcelery.schedulers.DatabaseScheduler' NOTIFY_NEW_RUIN = { "EmpireEx_2": ( ), "EmpirefourkingdomsExGG": ( ), } PUSHOVER_APP_TOKEN = config.get('pushover', 'APP_TOKEN') PUSHOVER_NEW_RUIN_TOKEN = config.get('pushover', 'NEW_RUIN_TOKEN') LOGIN_SERVICE_URL = config.get('login service', 'URL') LOGIN_SERVICE_SECRET = config.get('login service', 'SECRET') DEPLOYMENT_ID = '@dev'
from __future__ import unicode_literals import requests import time from bs4 import BeautifulSoup from datetime import datetime, timedelta from decimal import Decimal from .exceptions import ( PageError, DisambiguationError, RedirectError, HTTPTimeoutError, WikipediaException, ODD_ERROR_MESSAGE) from .util import cache, stdout_encode, debug import re API_URL = 'http://en.wikipedia.org/w/api.php' RATE_LIMIT = False RATE_LIMIT_MIN_WAIT = None RATE_LIMIT_LAST_CALL = None USER_AGENT = 'wikipedia (https://github.com/goldsmith/Wikipedia/)' def set_lang(prefix): ''' Change the language of the API being requested. Set `prefix` to one of the two letter prefixes found on the `list of all Wikipedias <http://meta.wikimedia.org/wiki/List_of_Wikipedias>`_. After setting the language, the cache for ``search``, ``suggest``, and ``summary`` will be cleared. .. note:: Make sure you search for page titles in the language that you have set. ''' global API_URL API_URL = 'http://' + prefix.lower() + '.wikipedia.org/w/api.php' for cached_func in (search, suggest, summary): cached_func.clear_cache() def set_user_agent(user_agent_string): ''' Set the User-Agent string to be used for all requests. Arguments: * user_agent_string - (string) a string specifying the User-Agent header ''' global USER_AGENT USER_AGENT = user_agent_string def set_rate_limiting(rate_limit, min_wait=timedelta(milliseconds=50)): ''' Enable or disable rate limiting on requests to the Mediawiki servers. If rate limiting is not enabled, under some circumstances (depending on load on Wikipedia, the number of requests you and other `wikipedia` users are making, and other factors), Wikipedia may return an HTTP timeout error. Enabling rate limiting generally prevents that issue, but please note that HTTPTimeoutError still might be raised. Arguments: * rate_limit - (Boolean) whether to enable rate limiting or not Keyword arguments: * min_wait - if rate limiting is enabled, `min_wait` is a timedelta describing the minimum time to wait before requests. Defaults to timedelta(milliseconds=50) ''' global RATE_LIMIT global RATE_LIMIT_MIN_WAIT global RATE_LIMIT_LAST_CALL RATE_LIMIT = rate_limit if not rate_limit: RATE_LIMIT_MIN_WAIT = None else: RATE_LIMIT_MIN_WAIT = min_wait RATE_LIMIT_LAST_CALL = None @cache def search(query, results=10, suggestion=False): ''' Do a Wikipedia search for `query`. Keyword arguments: * results - the maxmimum number of results returned * suggestion - if True, return results and suggestion (if any) in a tuple ''' search_params = { 'list': 'search', 'srprop': '', 'srlimit': results, 'limit': results, 'srsearch': query } if suggestion: search_params['srinfo'] = 'suggestion' raw_results = _wiki_request(search_params) if 'error' in raw_results: if raw_results['error']['info'] in ('HTTP request timed out.', 'Pool queue is full'): raise HTTPTimeoutError(query) else: raise WikipediaException(raw_results['error']['info']) search_results = (d['title'] for d in raw_results['query']['search']) if suggestion: if raw_results['query'].get('searchinfo'): return list(search_results), raw_results['query']['searchinfo']['suggestion'] else: return list(search_results), None return list(search_results) @cache def geosearch(latitude, longitude, title=None, results=10, radius=1000): ''' Do a wikipedia geo search for `latitude` and `longitude` using HTTP API described in http://www.mediawiki.org/wiki/Extension:GeoData Arguments: * latitude (float or decimal.Decimal) * longitude (float or decimal.Decimal) Keyword arguments: * title - The title of an article to search for * results - the maximum number of results returned * radius - Search radius in meters. The value must be between 10 and 10000 ''' search_params = { 'list': 'geosearch', 'gsradius': radius, 'gscoord': '{0}|{1}'.format(latitude, longitude), 'gslimit': results } if title: search_params['titles'] = title raw_results = _wiki_request(search_params) if 'error' in raw_results: if raw_results['error']['info'] in ('HTTP request timed out.', 'Pool queue is full'): raise HTTPTimeoutError('{0}|{1}'.format(latitude, longitude)) else: raise WikipediaException(raw_results['error']['info']) search_pages = raw_results['query'].get('pages', None) if search_pages: search_results = (v['title'] for k, v in search_pages.items() if k != '-1') else: search_results = (d['title'] for d in raw_results['query']['geosearch']) return list(search_results) @cache def suggest(query): ''' Get a Wikipedia search suggestion for `query`. Returns a string or None if no suggestion was found. ''' search_params = { 'list': 'search', 'srinfo': 'suggestion', 'srprop': '', } search_params['srsearch'] = query raw_result = _wiki_request(search_params) if raw_result['query'].get('searchinfo'): return raw_result['query']['searchinfo']['suggestion'] return None def random(pages=1): ''' Get a list of random Wikipedia article titles. .. note:: Random only gets articles from namespace 0, meaning no Category, User talk, or other meta-Wikipedia pages. Keyword arguments: * pages - the number of random pages returned (max of 10) ''' #http://en.wikipedia.org/w/api.php?action=query&list=random&rnlimit=5000&format=jsonfm query_params = { 'list': 'random', 'rnnamespace': 0, 'rnlimit': pages, } request = _wiki_request(query_params) titles = [page['title'] for page in request['query']['random']] if len(titles) == 1: return titles[0] return titles @cache def summary(title, sentences=0, chars=0, auto_suggest=True, redirect=True): ''' Plain text summary of the page. .. note:: This is a convenience wrapper - auto_suggest and redirect are enabled by default Keyword arguments: * sentences - if set, return the first `sentences` sentences (can be no greater than 10). * chars - if set, return only the first `chars` characters (actual text returned may be slightly longer). * auto_suggest - let Wikipedia find a valid page title for the query * redirect - allow redirection without raising RedirectError ''' # use auto_suggest and redirect to get the correct article # also, use page's error checking to raise DisambiguationError if necessary page_info = page(title, auto_suggest=auto_suggest, redirect=redirect) title = page_info.title pageid = page_info.pageid query_params = { 'prop': 'extracts', 'explaintext': '', 'titles': title } if sentences: query_params['exsentences'] = sentences elif chars: query_params['exchars'] = chars else: query_params['exintro'] = '' request = _wiki_request(query_params) summary = request['query']['pages'][pageid]['extract'] return summary def page(title=None, pageid=None, auto_suggest=True, redirect=True, preload=False): ''' Get a WikipediaPage object for the page with title `title` or the pageid `pageid` (mutually exclusive). Keyword arguments: * title - the title of the page to load * pageid - the numeric pageid of the page to load * auto_suggest - let Wikipedia find a valid page title for the query * redirect - allow redirection without raising RedirectError * preload - load content, summary, images, references, and links during initialization ''' if title is not None: if auto_suggest: results, suggestion = search(title, results=1, suggestion=True) try: title = suggestion or results[0] except IndexError: # if there is no suggestion or search results, the page doesn't exist raise PageError(title) return WikipediaPage(title, redirect=redirect, preload=preload) elif pageid is not None: return WikipediaPage(pageid=pageid, preload=preload) else: raise ValueError("Either a title or a pageid must be specified") class WikipediaPage(object): ''' Contains data from a Wikipedia page. Uses property methods to filter data from the raw HTML. ''' def __init__(self, title=None, pageid=None, redirect=True, preload=False, original_title=''): if title is not None: self.title = title self.original_title = original_title or title elif pageid is not None: self.pageid = pageid else: raise ValueError("Either a title or a pageid must be specified") self.__load(redirect=redirect, preload=preload) if preload: for prop in ('content', 'summary', 'images', 'references', 'links', 'sections'): getattr(self, prop) def __repr__(self): return stdout_encode(u'<WikipediaPage \'{}\'>'.format(self.title)) def __eq__(self, other): try: return ( self.pageid == other.pageid and self.title == other.title and self.url == other.url ) except: return False def __load(self, redirect=True, preload=False): ''' Load basic information from Wikipedia. Confirm that page exists and is not a disambiguation/redirect. Does not need to be called manually, should be called automatically during __init__. ''' query_params = { 'prop': 'info|pageprops', 'inprop': 'url', 'ppprop': 'disambiguation', 'redirects': '', } if not getattr(self, 'pageid', None): query_params['titles'] = self.title else: query_params['pageids'] = self.pageid request = _wiki_request(query_params) query = request['query'] pageid = list(query['pages'].keys())[0] page = query['pages'][pageid] # missing is present if the page is missing if 'missing' in page: if hasattr(self, 'title'): raise PageError(self.title) else: raise PageError(pageid=self.pageid) # same thing for redirect, except it shows up in query instead of page for # whatever silly reason elif 'redirects' in query: if redirect: redirects = query['redirects'][0] if 'normalized' in query: normalized = query['normalized'][0] assert normalized['from'] == self.title, ODD_ERROR_MESSAGE from_title = normalized['to'] else: from_title = self.title assert redirects['from'] == from_title, ODD_ERROR_MESSAGE # change the title and reload the whole object self.__init__(redirects['to'], redirect=redirect, preload=preload) else: raise RedirectError(getattr(self, 'title', page['title'])) # since we only asked for disambiguation in ppprop, # if a pageprop is returned, # then the page must be a disambiguation page elif 'pageprops' in page: query_params = { 'prop': 'revisions', 'rvprop': 'content', 'rvparse': '', 'rvlimit': 1 } if hasattr(self, 'pageid'): query_params['pageids'] = self.pageid else: query_params['titles'] = self.title request = _wiki_request(query_params) html = request['query']['pages'][pageid]['revisions'][0]['*'] lis = BeautifulSoup(html).find_all('li') filtered_lis = [li for li in lis if not 'tocsection' in ''.join(li.get('class', []))] may_refer_to = [li.a.get_text() for li in filtered_lis if li.a] raise DisambiguationError(getattr(self, 'title', page['title']), may_refer_to) else: self.pageid = pageid self.title = page['title'] self.url = page['fullurl'] def __continued_query(self, query_params): ''' Based on https://www.mediawiki.org/wiki/API:Query#Continuing_queries ''' query_params.update(self.__title_query_param) last_continue = {} prop = query_params.get('prop', None) while True: params = query_params.copy() params.update(last_continue) request = _wiki_request(params) if 'query' not in request: break pages = request['query']['pages'] if 'generator' in query_params: for datum in pages.values(): # in python 3.3+: "yield from pages.values()" yield datum else: for datum in pages[self.pageid][prop]: yield datum if 'continue' not in request: break last_continue = request['continue'] @property def __title_query_param(self): if getattr(self, 'title', None) is not None: return {'titles': self.title} else: return {'pageids': self.pageid} def html(self): ''' Get full page HTML. .. warning:: This can get pretty slow on long pages. ''' if not getattr(self, '_html', False): query_params = { 'prop': 'revisions', 'rvprop': 'content', 'rvlimit': 1, 'rvparse': '', 'titles': self.title } request = _wiki_request(query_params) self._html = request['query']['pages'][self.pageid]['revisions'][0]['*'] return self._html @property def content(self): ''' Plain text content of the page, excluding images, tables, and other data. ''' if not getattr(self, '_content', False): query_params = { 'prop': 'extracts|revisions', 'explaintext': '', 'rvprop': 'ids' } if not getattr(self, 'title', None) is None: query_params['titles'] = self.title else: query_params['pageids'] = self.pageid request = _wiki_request(query_params) self._content = request['query']['pages'][self.pageid]['extract'] self._revision_id = request['query']['pages'][self.pageid]['revisions'][0]['revid'] self._parent_id = request['query']['pages'][self.pageid]['revisions'][0]['parentid'] return self._content @property def revision_id(self): ''' Revision ID of the page. The revision ID is a number that uniquely identifies the current version of the page. It can be used to create the permalink or for other direct API calls. See `Help:Page history <http://en.wikipedia.org/wiki/Wikipedia:Revision>`_ for more information. ''' if not getattr(self, '_revid', False): # fetch the content (side effect is loading the revid) self.content return self._revision_id @property def parent_id(self): ''' Revision ID of the parent version of the current revision of this page. See ``revision_id`` for more information. ''' if not getattr(self, '_parentid', False): # fetch the content (side effect is loading the revid) self.content return self._parent_id @property def summary(self): ''' Plain text summary of the page. ''' if not getattr(self, '_summary', False): query_params = { 'prop': 'extracts', 'explaintext': '', 'exintro': '', } if not getattr(self, 'title', None) is None: query_params['titles'] = self.title else: query_params['pageids'] = self.pageid request = _wiki_request(query_params) self._summary = request['query']['pages'][self.pageid]['extract'] return self._summary @property def images(self): ''' List of URLs of images on the page. ''' if not getattr(self, '_images', False): self._images = [ page['imageinfo'][0]['url'] for page in self.__continued_query({ 'generator': 'images', 'gimlimit': 'max', 'prop': 'imageinfo', 'iiprop': 'url', }) if 'imageinfo' in page ] return self._images @property def coordinates(self): ''' Tuple of Decimals in the form of (lat, lon) or None ''' if not getattr(self, '_coordinates', False): query_params = { 'prop': 'coordinates', 'colimit': 'max', 'titles': self.title, } request = _wiki_request(query_params) if 'query' in request: coordinates = request['query']['pages'][self.pageid]['coordinates'] self._coordinates = (Decimal(coordinates[0]['lat']), Decimal(coordinates[0]['lon'])) else: self._coordinates = None return self._coordinates @property def references(self): ''' List of URLs of external links on a page. May include external links within page that aren't technically cited anywhere. ''' if not getattr(self, '_references', False): def add_protocol(url): return url if url.startswith('http') else 'http:' + url self._references = [ add_protocol(link['*']) for link in self.__continued_query({ 'prop': 'extlinks', 'ellimit': 'max' }) ] return self._references @property def links(self): ''' List of titles of Wikipedia page links on a page. .. note:: Only includes articles from namespace 0, meaning no Category, User talk, or other meta-Wikipedia pages. ''' if not getattr(self, '_links', False): self._links = [ link['title'] for link in self.__continued_query({ 'prop': 'links', 'plnamespace': 0, 'pllimit': 'max' }) ] return self._links @property def categories(self): ''' List of categories of a page. ''' if not getattr(self, '_categories', False): self._categories = [re.sub(r'^Category:', '', x) for x in [link['title'] for link in self.__continued_query({ 'prop': 'categories', 'cllimit': 'max' }) ]] return self._categories @property def sections(self): ''' List of section titles from the table of contents on the page. ''' if not getattr(self, '_sections', False): query_params = { 'action': 'parse', 'prop': 'sections', } query_params.update(self.__title_query_param) request = _wiki_request(query_params) self._sections = [section['line'] for section in request['parse']['sections']] return self._sections def section(self, section_title): ''' Get the plain text content of a section from `self.sections`. Returns None if `section_title` isn't found, otherwise returns a whitespace stripped string. This is a convenience method that wraps self.content. .. warning:: Calling `section` on a section that has subheadings will NOT return the full text of all of the subsections. It only gets the text between `section_title` and the next subheading, which is often empty. ''' section = u"== {} ==".format(section_title) try: index = self.content.index(section) + len(section) except ValueError: return None try: next_index = self.content.index("==", index) except ValueError: next_index = len(self.content) return self.content[index:next_index].lstrip("=").strip() @cache def languages(): ''' List all the currently supported language prefixes (usually ISO language code). Can be inputted to `set_lang` to change the Mediawiki that `wikipedia` requests results from. Returns: dict of <prefix>: <local_lang_name> pairs. To get just a list of prefixes, use `wikipedia.languages().keys()`. ''' response = _wiki_request({ 'meta': 'siteinfo', 'siprop': 'languages' }) languages = response['query']['languages'] return { lang['code']: lang['*'] for lang in languages } def donate(): ''' Open up the Wikimedia donate page in your favorite browser. ''' import webbrowser webbrowser.open('https://donate.wikimedia.org/w/index.php?title=Special:FundraiserLandingPage', new=2) def _wiki_request(params): ''' Make a request to the Wikipedia API using the given search parameters. Returns a parsed dict of the JSON response. ''' global RATE_LIMIT_LAST_CALL global USER_AGENT params['format'] = 'json' if not 'action' in params: params['action'] = 'query' headers = { 'User-Agent': USER_AGENT } if RATE_LIMIT and RATE_LIMIT_LAST_CALL and \ RATE_LIMIT_LAST_CALL + RATE_LIMIT_MIN_WAIT > datetime.now(): # it hasn't been long enough since the last API call # so wait until we're in the clear to make the request wait_time = (RATE_LIMIT_LAST_CALL + RATE_LIMIT_MIN_WAIT) - datetime.now() time.sleep(int(wait_time.total_seconds())) r = requests.get(API_URL, params=params, headers=headers) if RATE_LIMIT: RATE_LIMIT_LAST_CALL = datetime.now() return r.json()
# Lint as: python2, python3 # Copyright 2018 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Converts a frozen graph into a TFLite FlatBuffer.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import distutils.spawn import enum # pylint: disable=g-bad-import-order import os as _os import platform as _platform import subprocess as _subprocess import tempfile as _tempfile import six from six.moves import map from tensorflow.lite.python import lite_constants from tensorflow.lite.python import util from tensorflow.lite.python import wrap_toco from tensorflow.lite.toco import model_flags_pb2 as _model_flags_pb2 from tensorflow.lite.toco import toco_flags_pb2 as _toco_flags_pb2 from tensorflow.lite.toco import types_pb2 as _types_pb2 from tensorflow.python.framework import tensor_shape from tensorflow.python.platform import resource_loader as _resource_loader from tensorflow.python.util import deprecation from tensorflow.python.util.tf_export import tf_export as _tf_export _quantized_inference_types = [_types_pb2.QUANTIZED_UINT8, _types_pb2.INT8] # If the `inference_type` or the `inference_input_type` is the quantized type # and it is not post training quantization, the input quantization stats is # required. def _requires_input_stats(toco_flags): return ((toco_flags.inference_type in _quantized_inference_types or toco_flags.inference_input_type in _quantized_inference_types) and not toco_flags.post_training_quantize) # Find the toco_from_protos binary using the resource loader if using from # bazel, otherwise we are in a pip where console_scripts already has # the toco_from_protos tool. if lite_constants.EXPERIMENTAL_USE_TOCO_API_DIRECTLY: _toco_from_proto_bin = "" else: _toco_from_proto_bin = _resource_loader.get_path_to_datafile( "../toco/python/toco_from_protos") if _toco_from_proto_bin and not _os.path.exists(_toco_from_proto_bin): _toco_from_proto_bin = "toco_from_protos" def _try_convert_to_unicode(output): if output is None: return u"" if isinstance(output, bytes): try: return six.ensure_text(output) except UnicodeDecodeError: pass return output @_tf_export("lite.OpsSet") class OpsSet(enum.Enum): """Enum class defining the sets of ops available to generate TFLite models. WARNING: Experimental interface, subject to change. """ # Convert model using TensorFlow Lite builtin ops. TFLITE_BUILTINS = "TFLITE_BUILTINS" # Convert model using TensorFlow ops. Not all TensorFlow ops are available. # WARNING: Experimental interface, subject to change. SELECT_TF_OPS = "SELECT_TF_OPS" # Convert model using only TensorFlow Lite quantized int8 operations. # Specifying this will throw an error for operations that do not yet have # quantized implementations. TFLITE_BUILTINS_INT8 = "TFLITE_BUILTINS_INT8" def __str__(self): return self.value @staticmethod def get_options(): """Returns a list of OpsSet options as a list of strings.""" return [str(option) for option in list(OpsSet)] class ConverterError(Exception): """Raised when an error occurs during model conversion.""" pass def toco_convert_protos(model_flags_str, toco_flags_str, input_data_str, debug_info_str=None, enable_mlir_converter=False): """Convert `input_data_str` according to model and toco parameters. Unless you know what you are doing consider using the more friendly `tf.compat.v1.lite.toco_convert`. Args: model_flags_str: Serialized proto describing model properties, see `toco/model_flags.proto`. toco_flags_str: Serialized proto describing conversion properties, see `toco/toco_flags.proto`. input_data_str: Input data in serialized form (e.g. a graphdef is common) debug_info_str: Serialized `GraphDebugInfo` proto describing logging information. (default None) enable_mlir_converter: Enables MLIR-based conversion instead of the default TOCO conversion. (default False) Returns: Converted model in serialized form (e.g. a TFLITE model is common). Raises: ConverterError: When conversion fails in TFLiteConverter, usually due to ops not being supported. RuntimeError: When conversion fails, an exception is raised with the error message embedded. """ # TODO(aselle): When toco does not use fatal errors for failure, we can # switch this on. if not _toco_from_proto_bin: try: model_str = wrap_toco.wrapped_toco_convert(model_flags_str, toco_flags_str, input_data_str, debug_info_str, enable_mlir_converter) return model_str except Exception as e: raise ConverterError(str(e)) if distutils.spawn.find_executable(_toco_from_proto_bin) is None: raise ConverterError("""Could not find toco_from_protos binary, make sure your virtualenv bin directory or pip local bin directory is in your path. In particular, if you have installed TensorFlow with --user, make sure you add the install directory to your path. For example: Linux: export PATH=$PATH:~/.local/bin/ Mac: export PATH=$PATH:~/Library/Python/<version#>/bin Alternative, use virtualenv.""") # Windows and TemporaryFile are not that useful together, # since you cannot have two readers/writers. So we have to # make the temporaries and close and delete them explicitly. toco_filename, model_filename, input_filename, output_filename = (None, None, None, None) try: # Build all input files with _tempfile.NamedTemporaryFile(delete=False) as fp_toco, \ _tempfile.NamedTemporaryFile(delete=False) as fp_model, \ _tempfile.NamedTemporaryFile(delete=False) as fp_input, \ _tempfile.NamedTemporaryFile(delete=False) as fp_debug: toco_filename = fp_toco.name input_filename = fp_input.name model_filename = fp_model.name debug_filename = fp_debug.name fp_model.write(model_flags_str) fp_toco.write(toco_flags_str) fp_input.write(six.ensure_binary(input_data_str)) debug_info_str = debug_info_str if debug_info_str else "" # if debug_info_str contains a "string value", then the call to # fp_debug.write(debug_info_str) will fail with the following error # # TypeError: a bytes-like object is required, not 'str' # # Some of the subtests within the "convert_test" unit-test fail # with the error shown above. So watch out for that scenario and # convert debug_info_str to bytes where needed if not isinstance(debug_info_str, bytes): fp_debug.write(debug_info_str.encode("utf-8")) else: fp_debug.write(debug_info_str) # Reserve an output file with _tempfile.NamedTemporaryFile(delete=False) as fp: output_filename = fp.name # Run cmd = [ _toco_from_proto_bin, model_filename, toco_filename, input_filename, output_filename, "--debug_proto_file={}".format(debug_filename), ] if enable_mlir_converter: cmd.append("--enable_mlir_converter") cmdline = " ".join(cmd) is_windows = _platform.system() == "Windows" proc = _subprocess.Popen( cmdline, shell=True, stdout=_subprocess.PIPE, stderr=_subprocess.STDOUT, close_fds=not is_windows) stdout, stderr = proc.communicate() exitcode = proc.returncode if exitcode == 0: with open(output_filename, "rb") as fp: return fp.read() else: stdout = _try_convert_to_unicode(stdout) stderr = _try_convert_to_unicode(stderr) raise ConverterError("See console for info.\n%s\n%s\n" % (stdout, stderr)) finally: # Must manually cleanup files. for filename in [ toco_filename, input_filename, model_filename, output_filename ]: try: _os.unlink(filename) except (OSError, TypeError): pass def build_toco_convert_protos(input_tensors, output_tensors, inference_type=lite_constants.FLOAT, inference_input_type=None, input_format=lite_constants.TENSORFLOW_GRAPHDEF, input_shapes=None, output_format=lite_constants.TFLITE, quantized_input_stats=None, default_ranges_stats=None, drop_control_dependency=True, reorder_across_fake_quant=False, allow_custom_ops=False, custom_opdefs=None, change_concat_input_ranges=False, post_training_quantize=False, quantize_to_float16=False, dump_graphviz_dir=None, dump_graphviz_video=False, target_ops=None, allow_nonexistent_arrays=False, debug_info=None, conversion_summary_dir=None): """Builds protocol buffers describing a conversion of a model using TOCO. Typically this is to convert from TensorFlow GraphDef to TFLite, in which case the default `input_format` and `output_format` are sufficient. Args: input_tensors: List of input tensors. Type and shape are computed using `foo.shape` and `foo.dtype`. output_tensors: List of output tensors (only .name is used from this). inference_type: Target data type of real-number arrays in the output file. Must be `{tf.float32, tf.uint8, tf.int8}`. (default tf.float32) inference_input_type: Target data type of real-number input arrays. Allows for a different type for input arrays in the case of quantization. Must be `{tf.float32, tf.uint8, tf.int8}`. (default `inference_type`) input_format: Type of data to read Currently must be `{TENSORFLOW_GRAPHDEF}`. (default TENSORFLOW_GRAPHDEF) input_shapes: Input array shape. It needs to be a list of the same length as `input_tensors`, or None. (default None) output_format: Output file format. Currently must be `{TFLITE, GRAPHVIZ_DOT}`. (default TFLITE) quantized_input_stats: List of tuples of floats representing the mean and standard deviation. Each tuple maps to the corresponding input tensor. Only need if `inference_input_type` is `QUANTIZED_UINT8` or `INT8`. real_input_value = (quantized_input_value - mean_value) / std_dev_value. (default None) default_ranges_stats: Tuple of integers representing (min, max) range values for all arrays without a specified range. Intended for experimenting with quantization via "dummy quantization". (default None) drop_control_dependency: Boolean indicating whether to drop control dependencies silently. This is due to TFLite not supporting control dependencies. (default True) reorder_across_fake_quant: Boolean indicating whether to reorder FakeQuant nodes in unexpected locations. Used when the location of the FakeQuant nodes is preventing graph transformations necessary to convert the graph. Results in a graph that differs from the quantized training graph, potentially causing differing arithmetic behavior. (default False) allow_custom_ops: Boolean indicating whether to allow custom operations. When false any unknown operation is an error. When true, custom ops are created for any op that is unknown. The developer will need to provide these to the TensorFlow Lite runtime with a custom resolver. (default False) custom_opdefs: List of strings representing custom ops OpDefs that are included in the GraphDef. Required when using custom operations with the MLIR-based converter. (default None) change_concat_input_ranges: Boolean to change behavior of min/max ranges for inputs and outputs of the concat operator for quantized models. Changes the ranges of concat operator overlap when true. (default False) post_training_quantize: Boolean indicating whether to quantize the weights of the converted float model. Model size will be reduced and there will be latency improvements (at the cost of accuracy). (default False) quantize_to_float16: Boolean indicating whether to convert float buffers to float16. (default False) dump_graphviz_dir: Full filepath of folder to dump the graphs at various stages of processing GraphViz .dot files. Preferred over --output_format=GRAPHVIZ_DOT in order to keep the requirements of the output file. (default None) dump_graphviz_video: Boolean indicating whether to dump the graph after every graph transformation. (default False) target_ops: Experimental flag, subject to change. Set of OpsSet options indicating which converter to use. (default set([OpsSet.TFLITE_BUILTINS])) allow_nonexistent_arrays: Allow specifying array names that don't exist or are unused in the final graph. (default False) debug_info: `GraphDebugInfo` proto containing the stack traces for the original nodes referred by the converted graph. conversion_summary_dir: A string, the path to the generated conversion logs. Returns: model_flags, toco_flags, debug_info: three protocol buffers describing the conversion process and debug information. Raises: ValueError: If the input tensor type is unknown Missing mean_values or std_dev_values RuntimeError: If TOCO fails to convert (in which case the runtime error's error text will contain the TOCO error log) """ toco = _toco_flags_pb2.TocoFlags() toco.input_format = input_format toco.output_format = output_format toco.inference_type = util.convert_dtype_to_tflite_type(inference_type) if inference_input_type: toco.inference_input_type = util.convert_dtype_to_tflite_type( inference_input_type) else: toco.inference_input_type = toco.inference_type toco.drop_control_dependency = drop_control_dependency toco.reorder_across_fake_quant = reorder_across_fake_quant toco.allow_custom_ops = allow_custom_ops if custom_opdefs: toco.custom_opdefs.extend(custom_opdefs) toco.post_training_quantize = post_training_quantize toco.quantize_to_float16 = quantize_to_float16 if default_ranges_stats: toco.default_ranges_min = default_ranges_stats[0] toco.default_ranges_max = default_ranges_stats[1] if dump_graphviz_dir: toco.dump_graphviz_dir = dump_graphviz_dir toco.dump_graphviz_include_video = dump_graphviz_video if conversion_summary_dir: toco.conversion_summary_dir = conversion_summary_dir if target_ops: if set(target_ops) == set([OpsSet.TFLITE_BUILTINS, OpsSet.SELECT_TF_OPS]): toco.enable_select_tf_ops = True elif set(target_ops) == set([OpsSet.SELECT_TF_OPS]): toco.enable_select_tf_ops = True toco.force_select_tf_ops = True model = _model_flags_pb2.ModelFlags() model.change_concat_input_ranges = change_concat_input_ranges for idx, input_tensor in enumerate(input_tensors): input_array = model.input_arrays.add() input_array.name = util.get_tensor_name(input_tensor) input_array.data_type = util.convert_dtype_to_tflite_type( input_tensor.dtype) if _requires_input_stats(toco) and quantized_input_stats: input_array.mean_value, input_array.std_value = quantized_input_stats[idx] if input_shapes is None: shape = input_tensor.shape else: shape = input_shapes[idx] # Create shapes with -1 for unknown dimensions. dims = [] for dim in shape: if (dim is None or (isinstance(dim, tensor_shape.Dimension) and dim.value is None)): dims.append(-1) else: dims.append(int(dim)) input_array.shape.dims.extend(dims) for output_tensor in output_tensors: model.output_arrays.append(util.get_tensor_name(output_tensor)) model.allow_nonexistent_arrays = allow_nonexistent_arrays return model, toco, debug_info def toco_convert_graph_def(input_data, input_arrays_with_shape, output_arrays, enable_mlir_converter, *args, **kwargs): """"Convert a model using TOCO. This function is used to convert GraphDefs that cannot be loaded into TensorFlow to TFLite. Conversion can be customized by providing arguments that are forwarded to `build_toco_convert_protos` (see documentation for details). Args: input_data: Input data (i.e. often `sess.graph_def`), input_arrays_with_shape: Tuple of strings representing input tensor names and list of integers representing input shapes (e.g., [("foo" : [1, 16, 16, 3])]). Use only when graph cannot be loaded into TensorFlow and when `input_tensors` is None. (default None) output_arrays: List of output tensors to freeze graph with. Use only when graph cannot be loaded into TensorFlow and when `output_tensors` is None. (default None) enable_mlir_converter: Enables MLIR-based conversion instead of TOCO conversion. *args: See `build_toco_convert_protos`, **kwargs: See `build_toco_convert_protos`. Returns: The converted data. For example if TFLite was the destination, then this will be a tflite flatbuffer in a bytes array. Raises: Defined in `build_toco_convert_protos`. """ model_flags, toco_flags, _ = build_toco_convert_protos( input_tensors=[], output_tensors=[], *args, **kwargs) for idx, (name, shape) in enumerate(input_arrays_with_shape): input_array = model_flags.input_arrays.add() if _requires_input_stats(toco_flags): if (("quantized_input_stats" not in kwargs) or (not kwargs["quantized_input_stats"])): raise ValueError("std_dev and mean must be defined when inference_type " "or inference_input_type is QUANTIZED_UINT8 or INT8.") input_array.mean_value, input_array.std_value = kwargs[ "quantized_input_stats"][idx] input_array.name = name input_array.shape.dims.extend(list(map(int, shape))) for name in output_arrays: model_flags.output_arrays.append(name) data = toco_convert_protos( model_flags.SerializeToString(), toco_flags.SerializeToString(), input_data.SerializeToString(), enable_mlir_converter=enable_mlir_converter) return data def toco_convert_impl(input_data, input_tensors, output_tensors, enable_mlir_converter, *args, **kwargs): """"Convert a model using TOCO. Typically this function is used to convert from TensorFlow GraphDef to TFLite. Conversion can be customized by providing arguments that are forwarded to `build_toco_convert_protos` (see documentation for details). Args: input_data: Input data (i.e. often `sess.graph_def`), input_tensors: List of input tensors. Type and shape are computed using `foo.shape` and `foo.dtype`. output_tensors: List of output tensors (only .name is used from this). enable_mlir_converter: Enables MLIR-based conversion instead of TOCO conversion. *args: See `build_toco_convert_protos`, **kwargs: See `build_toco_convert_protos`. Returns: The converted data. For example if TFLite was the destination, then this will be a tflite flatbuffer in a bytes array. Raises: Defined in `build_toco_convert_protos`. """ model_flags, toco_flags, debug_info = build_toco_convert_protos( input_tensors, output_tensors, *args, **kwargs) debug_info_str = debug_info.SerializeToString() if debug_info else None data = toco_convert_protos( model_flags.SerializeToString(), toco_flags.SerializeToString(), input_data.SerializeToString(), debug_info_str=debug_info_str, enable_mlir_converter=enable_mlir_converter) return data @_tf_export(v1=["lite.toco_convert"]) @deprecation.deprecated(None, "Use `lite.TFLiteConverter` instead.") def toco_convert(input_data, input_tensors, output_tensors, *args, **kwargs): """Convert a model using TOCO. Typically this function is used to convert from TensorFlow GraphDef to TFLite. Conversion can be customized by providing arguments that are forwarded to `build_toco_convert_protos` (see documentation for details). This function has been deprecated. Please use `lite.TFLiteConverter` instead. Args: input_data: Input data (i.e. often `sess.graph_def`), input_tensors: List of input tensors. Type and shape are computed using `foo.shape` and `foo.dtype`. output_tensors: List of output tensors (only .name is used from this). *args: See `build_toco_convert_protos`, **kwargs: See `build_toco_convert_protos`. Returns: The converted data. For example if TFLite was the destination, then this will be a tflite flatbuffer in a bytes array. Raises: Defined in `build_toco_convert_protos`. """ enable_mlir_converter = kwargs.get("enable_mlir_converter", False) return toco_convert_impl(input_data, input_tensors, output_tensors, enable_mlir_converter, *args, **kwargs)
""" This is the *abstract* django models for many of the database objects in Evennia. A django abstract (obs, not the same as a Python metaclass!) is a model which is not actually created in the database, but which only exists for other models to inherit from, to avoid code duplication. Any model can import and inherit from these classes. Attributes are database objects stored on other objects. The implementing class needs to supply a ForeignKey field attr_object pointing to the kind of object being mapped. Attributes storing iterables actually store special types of iterables named PackedList/PackedDict respectively. These make sure to save changes to them to database - this is criticial in order to allow for obj.db.mylist[2] = data. Also, all dbobjects are saved as dbrefs but are also aggressively cached. TypedObjects are objects 'decorated' with a typeclass - that is, the typeclass (which is a normal Python class implementing some special tricks with its get/set attribute methods, allows for the creation of all sorts of different objects all with the same database object underneath. Usually attributes are used to permanently store things not hard-coded as field on the database object. The admin should usually not have to deal directly with the database object layer. This module also contains the Managers for the respective models; inherit from these to create custom managers. """ from builtins import object from django.db.models import signals from django.db import models from django.core.exceptions import ObjectDoesNotExist from django.conf import settings from django.utils.encoding import smart_str from evennia.typeclasses.attributes import Attribute, AttributeHandler, NAttributeHandler from evennia.typeclasses.tags import Tag, TagHandler, AliasHandler, PermissionHandler from evennia.utils.idmapper.models import SharedMemoryModel, SharedMemoryModelBase from evennia.typeclasses import managers from evennia.locks.lockhandler import LockHandler from evennia.utils.utils import ( is_iter, inherits_from, lazy_property, class_from_module) from evennia.utils.logger import log_trace from evennia.typeclasses.django_new_patch import patched_new __all__ = ("TypedObject", ) TICKER_HANDLER = None _PERMISSION_HIERARCHY = [p.lower() for p in settings.PERMISSION_HIERARCHY] _TYPECLASS_AGGRESSIVE_CACHE = settings.TYPECLASS_AGGRESSIVE_CACHE _GA = object.__getattribute__ _SA = object.__setattr__ #------------------------------------------------------------ # # Typed Objects # #------------------------------------------------------------ # # Meta class for typeclasses # # signal receivers. Assigned in __new__ def post_save(sender, instance, created, **kwargs): """ Receives a signal just after the object is saved. """ if created: instance.at_first_save() class TypeclassBase(SharedMemoryModelBase): """ Metaclass which should be set for the root of model proxies that don't define any new fields, like Object, Script etc. This is the basis for the typeclassing system. """ def __new__(cls, name, bases, attrs): """ We must define our Typeclasses as proxies. We also store the path directly on the class, this is required by managers. """ # storage of stats attrs["typename"] = name attrs["path"] = "%s.%s" % (attrs["__module__"], name) # typeclass proxy setup if not "Meta" in attrs: class Meta(object): proxy = True app_label = attrs.get("__applabel__", "typeclasses") attrs["Meta"] = Meta attrs["Meta"].proxy = True # patch for django proxy multi-inheritance # this is a copy of django.db.models.base.__new__ # with a few lines changed as per # https://code.djangoproject.com/ticket/11560 new_class = patched_new(cls, name, bases, attrs) # attach signal signals.post_save.connect(post_save, sender=new_class) return new_class class DbHolder(object): "Holder for allowing property access of attributes" def __init__(self, obj, name, manager_name='attributes'): _SA(self, name, _GA(obj, manager_name)) _SA(self, 'name', name) def __getattribute__(self, attrname): if attrname == 'all': # we allow to overload our default .all attr = _GA(self, _GA(self, 'name')).get("all") return attr if attr else _GA(self, "all") return _GA(self, _GA(self, 'name')).get(attrname) def __setattr__(self, attrname, value): _GA(self, _GA(self, 'name')).add(attrname, value) def __delattr__(self, attrname): _GA(self, _GA(self, 'name')).remove(attrname) def get_all(self): return _GA(self, _GA(self, 'name')).all() all = property(get_all) # # Main TypedObject abstraction # class TypedObject(SharedMemoryModel): """ Abstract Django model. This is the basis for a typed object. It also contains all the mechanics for managing connected attributes. The TypedObject has the following properties: key - main name name - alias for key typeclass_path - the path to the decorating typeclass typeclass - auto-linked typeclass date_created - time stamp of object creation permissions - perm strings dbref - #id of object db - persistent attribute storage ndb - non-persistent attribute storage """ # # TypedObject Database Model setup # # # These databse fields are all accessed and set using their corresponding # properties, named same as the field, but without the db_* prefix # (no separate save() call is needed) # Main identifier of the object, for searching. Is accessed with self.key # or self.name db_key = models.CharField('key', max_length=255, db_index=True) # This is the python path to the type class this object is tied to. The # typeclass is what defines what kind of Object this is) db_typeclass_path = models.CharField('typeclass', max_length=255, null=True, help_text="this defines what 'type' of entity this is. This variable holds a Python path to a module with a valid Evennia Typeclass.") # Creation date. This is not changed once the object is created. db_date_created = models.DateTimeField('creation date', editable=False, auto_now_add=True) # Lock storage db_lock_storage = models.TextField('locks', blank=True, help_text="locks limit access to an entity. A lock is defined as a 'lock string' on the form 'type:lockfunctions', defining what functionality is locked and how to determine access. Not defining a lock means no access is granted.") # many2many relationships db_attributes = models.ManyToManyField(Attribute, null=True, help_text='attributes on this object. An attribute can hold any pickle-able python object (see docs for special cases).') db_tags = models.ManyToManyField(Tag, null=True, help_text='tags on this object. Tags are simple string markers to identify, group and alias objects.') # Database manager objects = managers.TypedObjectManager() # quick on-object typeclass cache for speed _cached_typeclass = None # typeclass mechanism def __init__(self, *args, **kwargs): """ The `__init__` method of typeclasses is the core operational code of the typeclass system, where it dynamically re-applies a class based on the db_typeclass_path database field rather than use the one in the model. Args: Passed through to parent. Kwargs: Passed through to parent. Notes: The loading mechanism will attempt the following steps: 1. Attempt to load typeclass given on command line 2. Attempt to load typeclass stored in db_typeclass_path 3. Attempt to load `__settingsclasspath__`, which is by the default classes defined to be the respective user-set base typeclass settings, like `BASE_OBJECT_TYPECLASS`. 4. Attempt to load `__defaultclasspath__`, which is the base classes in the library, like DefaultObject etc. 5. If everything else fails, use the database model. Normal operation is to load successfully at either step 1 or 2 depending on how the class was called. Tracebacks will be logged for every step the loader must take beyond 2. """ typeclass_path = kwargs.pop("typeclass", None) super(TypedObject, self).__init__(*args, **kwargs) if typeclass_path: try: self.__class__ = class_from_module(typeclass_path, defaultpaths=settings.TYPECLASS_PATHS) except Exception: log_trace() try: self.__class__ = class_from_module(self.__settingsclasspath__) except Exception: log_trace() try: self.__class__ = class_from_module(self.__defaultclasspath__) except Exception: log_trace() self.__class__ = self._meta.proxy_for_model or self.__class__ finally: self.db_typclass_path = typeclass_path elif self.db_typeclass_path: try: self.__class__ = class_from_module(self.db_typeclass_path) except Exception: log_trace() try: self.__class__ = class_from_module(self.__defaultclasspath__) except Exception: log_trace() self.__dbclass__ = self._meta.proxy_for_model or self.__class__ else: self.db_typeclass_path = "%s.%s" % (self.__module__, self.__class__.__name__) # important to put this at the end since _meta is based on the set __class__ self.__dbclass__ = self._meta.proxy_for_model or self.__class__ # initialize all handlers in a lazy fashion @lazy_property def attributes(self): return AttributeHandler(self) @lazy_property def locks(self): return LockHandler(self) @lazy_property def tags(self): return TagHandler(self) @lazy_property def aliases(self): return AliasHandler(self) @lazy_property def permissions(self): return PermissionHandler(self) @lazy_property def nattributes(self): return NAttributeHandler(self) class Meta(object): """ Django setup info. """ abstract = True verbose_name = "Evennia Database Object" ordering = ['-db_date_created', 'id', 'db_typeclass_path', 'db_key'] # wrapper # Wrapper properties to easily set database fields. These are # @property decorators that allows to access these fields using # normal python operations (without having to remember to save() # etc). So e.g. a property 'attr' has a get/set/del decorator # defined that allows the user to do self.attr = value, # value = self.attr and del self.attr respectively (where self # is the object in question). # name property (alias to self.key) def __name_get(self): return self.key def __name_set(self, value): self.key = value def __name_del(self): raise Exception("Cannot delete name") name = property(__name_get, __name_set, __name_del) # key property (overrides's the idmapper's db_key for the at_rename hook) @property def key(self): return self.db_key @key.setter def key(self, value): oldname = str(self.db_key) self.db_key = value self.save(update_fields=["db_key"]) self.at_rename(oldname, value) # # # TypedObject main class methods and properties # # def __eq__(self, other): return other and hasattr(other, 'dbid') and self.dbid == other.dbid def __str__(self): return smart_str("%s" % self.db_key) def __unicode__(self): return u"%s" % self.db_key #@property def __dbid_get(self): """ Caches and returns the unique id of the object. Use this instead of self.id, which is not cached. """ return self.id def __dbid_set(self, value): raise Exception("dbid cannot be set!") def __dbid_del(self): raise Exception("dbid cannot be deleted!") dbid = property(__dbid_get, __dbid_set, __dbid_del) #@property def __dbref_get(self): """ Returns the object's dbref on the form #NN. """ return "#%s" % self.id def __dbref_set(self): raise Exception("dbref cannot be set!") def __dbref_del(self): raise Exception("dbref cannot be deleted!") dbref = property(__dbref_get, __dbref_set, __dbref_del) # # Object manipulation methods # def is_typeclass(self, typeclass, exact=True): """ Returns true if this object has this type OR has a typeclass which is an subclass of the given typeclass. This operates on the actually loaded typeclass (this is important since a failing typeclass may instead have its default currently loaded) typeclass - can be a class object or the python path to such an object to match against. Args: typeclass (str or class): A class or the full python path to the class to check. exact (bool, optional): Returns true only if the object's type is exactly this typeclass, ignoring parents. Returns: is_typeclass (bool): If this typeclass matches the given typeclass. """ if isinstance(typeclass, basestring): typeclass = [typeclass] + ["%s.%s" % (prefix, typeclass) for prefix in settings.TYPECLASS_PATHS] else: typeclass = [typeclass.path] selfpath = self.path if exact: # check only exact match return selfpath in typeclass else: # check parent chain return any(hasattr(cls, "path") and cls.path in typeclass for cls in self.__class__.mro()) def swap_typeclass(self, new_typeclass, clean_attributes=False, run_start_hooks=True, no_default=True): """ This performs an in-situ swap of the typeclass. This means that in-game, this object will suddenly be something else. Player will not be affected. To 'move' a player to a different object entirely (while retaining this object's type), use self.player.swap_object(). Note that this might be an error prone operation if the old/new typeclass was heavily customized - your code might expect one and not the other, so be careful to bug test your code if using this feature! Often its easiest to create a new object and just swap the player over to that one instead. Args: new_typeclass (str or classobj): Type to switch to. clean_attributes (bool or list, optional): Will delete all attributes stored on this object (but not any of the database fields such as name or location). You can't get attributes back, but this is often the safest bet to make sure nothing in the new typeclass clashes with the old one. If you supply a list, only those named attributes will be cleared. run_start_hooks (bool, optional): Trigger the start hooks of the object, as if it was created for the first time. no_default (bool, optiona): If set, the swapper will not allow for swapping to a default typeclass in case the given one fails for some reason. Instead the old one will be preserved. Returns: result (bool): True/False depending on if the swap worked or not. """ if not callable(new_typeclass): # this is an actual class object - build the path new_typeclass = class_from_module(new_typeclass, defaultpaths=settings.TYPECLASS_PATHS) # if we get to this point, the class is ok. if inherits_from(self, "evennia.scripts.models.ScriptDB"): if self.interval > 0: raise RuntimeError("Cannot use swap_typeclass on time-dependent " \ "Script '%s'.\nStop and start a new Script of the " \ "right type instead." % self.key) self.typeclass_path = new_typeclass.path self.__class__ = new_typeclass if clean_attributes: # Clean out old attributes if is_iter(clean_attributes): for attr in clean_attributes: self.attributes.remove(attr) for nattr in clean_attributes: if hasattr(self.ndb, nattr): self.nattributes.remove(nattr) else: self.attributes.clear() self.nattributes.clear() if run_start_hooks: # fake this call to mimic the first save self.at_first_save() # # Lock / permission methods # def access(self, accessing_obj, access_type='read', default=False, no_superuser_bypass=False, **kwargs): """ Determines if another object has permission to access this one. Args: accessing_obj (str): Object trying to access this one. access_type (str, optional): Type of access sought. default (bool, optional): What to return if no lock of access_type was found no_superuser_bypass (bool, optional): Turn off the superuser lock bypass (be careful with this one). Kwargs: kwargs (any): Ignored, but is there to make the api consistent with the object-typeclass method access, which use it to feed to its hook methods. """ return self.locks.check(accessing_obj, access_type=access_type, default=default, no_superuser_bypass=no_superuser_bypass) def check_permstring(self, permstring): """ This explicitly checks if we hold particular permission without involving any locks. Args: permstring (str): The permission string to check against. Returns: result (bool): If the permstring is passed or not. """ if hasattr(self, "player"): if self.player and self.player.is_superuser: return True else: if self.is_superuser: return True if not permstring: return False perm = permstring.lower() perms = [p.lower() for p in self.permissions.all()] if perm in perms: # simplest case - we have a direct match return True if perm in _PERMISSION_HIERARCHY: # check if we have a higher hierarchy position ppos = _PERMISSION_HIERARCHY.index(perm) return any(True for hpos, hperm in enumerate(_PERMISSION_HIERARCHY) if hperm in perms and hpos > ppos) return False # # Deletion methods # def _deleted(self, *args, **kwargs): """ Scrambling method for already deleted objects """ raise ObjectDoesNotExist("This object was already deleted!") def delete(self): """ Cleaning up handlers on the typeclass level """ global TICKER_HANDLER self.permissions.clear() self.attributes.clear() self.aliases.clear() if hasattr(self, "nicks"): self.nicks.clear() # scrambling properties self.delete = self._deleted super(TypedObject, self).delete() # # Memory management # #def flush_from_cache(self): # """ # Flush this object instance from cache, forcing an object reload. # Note that this will kill all temporary attributes on this object # since it will be recreated as a new Typeclass instance. # """ # self.__class__.flush_cached_instance(self) # # Attribute storage # #@property db def __db_get(self): """ Attribute handler wrapper. Allows for the syntax obj.db.attrname = value and value = obj.db.attrname and del obj.db.attrname and all_attr = obj.db.all() (unless there is an attribute named 'all', in which case that will be returned instead). """ try: return self._db_holder except AttributeError: self._db_holder = DbHolder(self, 'attributes') return self._db_holder #@db.setter def __db_set(self, value): "Stop accidentally replacing the db object" string = "Cannot assign directly to db object! " string += "Use db.attr=value instead." raise Exception(string) #@db.deleter def __db_del(self): "Stop accidental deletion." raise Exception("Cannot delete the db object!") db = property(__db_get, __db_set, __db_del) # # Non-persistent (ndb) storage # #@property ndb def __ndb_get(self): """ A non-attr_obj store (ndb: NonDataBase). Everything stored to this is guaranteed to be cleared when a server is shutdown. Syntax is same as for the _get_db_holder() method and property, e.g. obj.ndb.attr = value etc. """ try: return self._ndb_holder except AttributeError: self._ndb_holder = DbHolder(self, "nattrhandler", manager_name='nattributes') return self._ndb_holder #@db.setter def __ndb_set(self, value): "Stop accidentally replacing the ndb object" string = "Cannot assign directly to ndb object! " string += "Use ndb.attr=value instead." raise Exception(string) #@db.deleter def __ndb_del(self): "Stop accidental deletion." raise Exception("Cannot delete the ndb object!") ndb = property(__ndb_get, __ndb_set, __ndb_del) def get_display_name(self, looker, **kwargs): """ Displays the name of the object in a viewer-aware manner. Args: looker (TypedObject): The object or player that is looking at/getting inforamtion for this object. Returns: name (str): A string containing the name of the object, including the DBREF if this user is privileged to control said object. Notes: This function could be extended to change how object names appear to users in character, but be wary. This function does not change an object's keys or aliases when searching, and is expected to produce something useful for builders. """ if self.access(looker, access_type='controls'): return "{}(#{})".format(self.name, self.id) return self.name def get_extra_info(self, looker, **kwargs): """ Used when an object is in a list of ambiguous objects as an additional information tag. For instance, if you had potions which could have varying levels of liquid left in them, you might want to display how many drinks are left in each when selecting which to drop, but not in your normal inventory listing. Args: looker (TypedObject): The object or player that is looking at/getting information for this object. Returns: info (str): A string with disambiguating information, conventionally with a leading space. """ if self.location == looker: return " (carried)" return "" def at_rename(self, oldname, newname): """ This Hook is called by @name on a successful rename. Args: oldname (str): The instance's original name. newname (str): The new name for the instance. """ pass
# vim: tabstop=4 shiftwidth=4 softtabstop=4 # Copyright 2011 United States Government as represented by the # Administrator of the National Aeronautics and Space Administration. # All Rights Reserved. # # Copyright 2011 Nebula, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """ Views for managing Quantum networks. """ import logging import warnings from django import shortcuts from django import template from django.contrib import messages from django.contrib.auth.decorators import login_required from django.utils.translation import ugettext as _ from horizon import api from horizon.dashboards.nova.networks.forms import (CreateNetwork, DeleteNetwork, RenameNetwork, AttachPort, CreatePort, DeletePort, DetachPort, TogglePort) LOG = logging.getLogger(__name__) def index(request): tenant_id = request.user.tenant_id delete_form, delete_handled = DeleteNetwork.maybe_handle(request) networks = [] instances = [] try: networks_list = api.quantum_list_networks(request) details = [] for network in networks_list['networks']: net_stats = _calc_network_stats(request, network['id']) # Get network details like name and id details = api.quantum_network_details(request, network['id']) networks.append({ 'name': details['network']['name'], 'id': network['id'], 'total': net_stats['total'], 'available': net_stats['available'], 'used': net_stats['used'], 'tenant': tenant_id}) except Exception, e: LOG.exception("Unable to get network list.") messages.error(request, _('Unable to get network list: %s') % e.message) return shortcuts.render(request, 'nova/networks/index.html', { 'networks': networks, 'delete_form': delete_form}) def create(request): network_form, handled = CreateNetwork.maybe_handle(request) if handled: return shortcuts.redirect('horizon:nova:networks:index') return shortcuts.render(request, 'nova/networks/create.html', {'network_form': network_form}) def detail(request, network_id): tenant_id = request.user.tenant_id delete_port_form, delete_handled = DeletePort.maybe_handle(request, initial={"network": network_id}) detach_port_form, detach_handled = DetachPort.maybe_handle(request, initial={"network": network_id}) toggle_port_form, port_toggle_handled = TogglePort.maybe_handle(request, initial={"network": network_id}) network = {} network['id'] = network_id try: network_details = api.quantum_network_details(request, network_id) network['name'] = network_details['network']['name'] network['ports'] = _get_port_states(request, network_id) except Exception, e: LOG.exception("Unable to get network details.") messages.error(request, _('Unable to get network details: %s') % e.message) return shortcuts.redirect("horizon:nova:networks:index") return shortcuts.render(request, 'nova/networks/detail.html', {'network': network, 'tenant': tenant_id, 'delete_port_form': delete_port_form, 'detach_port_form': detach_port_form, 'toggle_port_form': toggle_port_form}) def rename(request, network_id): network_details = api.quantum_network_details(request, network_id) network = network_details['network'] rename_form, handled = RenameNetwork.maybe_handle(request, initial={ 'network': network['id'], 'new_name': network['name']}) if handled: return shortcuts.redirect('horizon:nova:networks:index') return shortcuts.render(request, 'nova/networks/rename.html', { 'network': network, 'rename_form': rename_form}) def _get_port_states(request, network_id): """ Helper method to find port states for a network """ network_ports = [] # Get all vifs for comparison with port attachments vifs = api.get_vif_ids(request) # Get all ports on this network ports = api.quantum_list_ports(request, network_id) for port in ports['ports']: port_details = api.quantum_port_details(request, network_id, port['id']) # Get port attachments port_attachment = api.quantum_port_attachment(request, network_id, port['id']) # Find instance the attachment belongs to connected_instance = None if port_attachment['attachment']: for vif in vifs: if str(vif['id']) == str(port_attachment['attachment']['id']): connected_instance = vif['id'] break network_ports.append({ 'id': port_details['port']['id'], 'state': port_details['port']['state'], 'attachment': port_attachment['attachment'], 'instance': connected_instance}) return network_ports def _calc_network_stats(request, network_id): """ Helper method to calculate statistics for a network """ # Get all ports statistics for the network total = 0 available = 0 used = 0 ports = api.quantum_list_ports(request, network_id) for port in ports['ports']: total += 1 # Get port attachment port_attachment = api.quantum_port_attachment(request, network_id, port['id']) if port_attachment['attachment']: used += 1 else: available += 1 return {'total': total, 'used': used, 'available': available} def port_create(request, network_id): create_form, handled = CreatePort.maybe_handle(request, initial={ "network": network_id}) if handled: return shortcuts.redirect('horizon:nova:networks:detail', network_id=network_id) return shortcuts.render(request, 'nova/ports/create.html', { 'network_id': network_id, 'create_form': create_form}) def port_attach(request, network_id, port_id): attach_form, handled = AttachPort.maybe_handle(request, initial={ "network": network_id, "port": port_id}) if handled: return shortcuts.redirect('horizon:nova:networks:detail', network_id=network_id) return shortcuts.render(request, 'nova/ports/attach.html', { 'network': network_id, 'port': port_id, 'attach_form': attach_form})
#!/usr/bin/env python # # Copyright 2015 The AMP HTML Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS-IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the license. # """A build script which (thus far) works on Ubuntu 14.""" from __future__ import print_function import argparse import glob import logging import os import platform import re import subprocess import sys def Die(msg): """Prints error and exits with status 1. Args: msg: The error message to emit """ print(msg, file=sys.stderr) sys.exit(1) def EnsureNodeJsIsInstalled(): """Ensure Node.js is installed and that 'node' is the command to run.""" logging.info('entering ...') try: output = subprocess.check_output(['node', '--eval', 'console.log("42")']) if b'42' == output.strip(): return except (subprocess.CalledProcessError, OSError): pass Die('Node.js not found. Try "apt-get install nodejs" or follow the install instructions at https://github.com/ampproject/amphtml/blob/master/validator/README.md#installation') def CheckPrereqs(): """Checks that various prerequisites for this script are satisfied.""" logging.info('entering ...') if platform.system() != 'Linux' and platform.system() != 'Darwin': Die('Sorry, this script assumes Linux or Mac OS X thus far. ' 'Please feel free to edit the source and fix it to your needs.') # Ensure source files are available. for f in [ 'validator-main.protoascii', 'validator.proto', 'validator_gen_js.py', 'package.json', 'engine/validator.js', 'engine/validator_test.js', 'engine/validator-in-browser.js', 'engine/tokenize-css.js', 'engine/definitions.js', 'engine/parse-css.js', 'engine/parse-srcset.js', 'engine/parse-url.js' ]: if not os.path.exists(f): Die('%s not found. Must run in amp_validator source directory.' % f) # Ensure protoc is available. try: libprotoc_version = subprocess.check_output(['protoc', '--version']) except (subprocess.CalledProcessError, OSError): Die('Protobuf compiler not found. Try "apt-get install protobuf-compiler" or follow the install instructions at https://github.com/ampproject/amphtml/blob/master/validator/README.md#installation.') # Ensure 'libprotoc 2.5.0' or newer. m = re.search(b'^(\\w+) (\\d+)\\.(\\d+)\\.(\\d+)', libprotoc_version) if (m.group(1) != b'libprotoc' or (int(m.group(2)), int(m.group(3)), int(m.group(4))) < (2, 5, 0)): Die('Expected libprotoc 2.5.0 or newer, saw: %s' % libprotoc_version) # Ensure that the Python protobuf package is installed. for m in ['descriptor', 'text_format', 'json_format']: module = 'google.protobuf.%s' % m try: __import__(module) except ImportError: # Python3 needs pip3. Python 2 needs pip. if sys.version_info < (3, 0): Die('%s not found. Try "pip install protobuf" or follow the install ' 'instructions at https://github.com/ampproject/amphtml/blob/master/' 'validator/README.md#installation' % module) else: Die('%s not found. Try "pip3 install protobuf" or follow the install ' 'instructions at https://github.com/ampproject/amphtml/blob/master/' 'validator/README.md#installation' % module) # Ensure that yarn is installed. try: subprocess.check_output(['yarn', '--version']) except (subprocess.CalledProcessError, OSError): Die('Yarn package manager not found. Run ' '"curl -o- -L https://yarnpkg.com/install.sh | bash" ' 'or see https://yarnpkg.com/docs/install.') # Ensure JVM installed. TODO: Check for version? try: subprocess.check_output(['java', '-version'], stderr=subprocess.STDOUT) except (subprocess.CalledProcessError, OSError): Die('Java missing. Try "apt-get install openjdk-7-jre" or follow the install instructions at https://github.com/ampproject/amphtml/blob/master/validator/README.md#installation') logging.info('... done') def SetupOutDir(out_dir): """Sets up a clean output directory. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') assert re.match(r'^[a-zA-Z_\-0-9]+$', out_dir), 'bad out_dir: %s' % out_dir if os.path.exists(out_dir): subprocess.check_call(['rm', '-rf', out_dir]) os.mkdir(out_dir) logging.info('... done') def InstallNodeDependencies(): """Installs the dependencies using yarn.""" logging.info('entering ...') # Install the project dependencies specified in package.json into # node_modules. logging.info('installing AMP Validator engine dependencies ...') subprocess.check_call( ['yarn', 'install'], stdout=(open(os.devnull, 'wb') if os.environ.get('TRAVIS') else sys.stdout)) logging.info('installing AMP Validator nodejs dependencies ...') subprocess.check_call( ['yarn', 'install'], cwd='nodejs', stdout=(open(os.devnull, 'wb') if os.environ.get('TRAVIS') else sys.stdout)) logging.info('... done') def GenValidatorPb2Py(out_dir): """Calls the proto compiler to generate validator_pb2.py. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') assert re.match(r'^[a-zA-Z_\-0-9]+$', out_dir), 'bad out_dir: %s' % out_dir subprocess.check_call( ['protoc', 'validator.proto', '--python_out=%s' % out_dir]) open('%s/__init__.py' % out_dir, 'w').close() logging.info('... done') def GenValidatorProtoascii(out_dir): """Assembles the validator protoascii file from the main and extensions. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') assert re.match(r'^[a-zA-Z_\-0-9]+$', out_dir), 'bad out_dir: %s' % out_dir protoascii_segments = [open('validator-main.protoascii').read()] extensions = glob.glob('extensions/*/validator-*.protoascii') # In the Github project, the extensions are located in a sibling directory # to the validator rather than a child directory. if not extensions: extensions = glob.glob('../extensions/*/validator-*.protoascii') extensions.sort() for extension in extensions: protoascii_segments.append(open(extension).read()) f = open('%s/validator.protoascii' % out_dir, 'w') f.write(''.join(protoascii_segments)) f.close() logging.info('... done') def GenValidatorProtoGeneratedJs(out_dir): """Calls validator_gen_js to generate validator-proto-generated.js. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') assert re.match(r'^[a-zA-Z_\-0-9]+$', out_dir), 'bad out_dir: %s' % out_dir # These imports happen late, within this method because they don't necessarily # exist when the module starts running, and the ones that probably do # are checked by CheckPrereqs. # pylint: disable=g-import-not-at-top from google.protobuf import text_format from google.protobuf import descriptor from dist import validator_pb2 import validator_gen_js # pylint: enable=g-import-not-at-top out = [] validator_gen_js.GenerateValidatorGeneratedJs( specfile=None, validator_pb2=validator_pb2, generate_proto_only=True, generate_spec_only=False, text_format=text_format, html_format=None, descriptor=descriptor, out=out) out.append('') f = open('%s/validator-proto-generated.js' % out_dir, 'w') f.write('\n'.join(out)) f.close() logging.info('... done') def GenValidatorGeneratedJs(out_dir): """Calls validator_gen_js to generate validator-generated.js and validator-generated.json. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') assert re.match(r'^[a-zA-Z_\-0-9]+$', out_dir), 'bad out_dir: %s' % out_dir # These imports happen late, within this method because they don't necessarily # exist when the module starts running, and the ones that probably do # are checked by CheckPrereqs. # pylint: disable=g-import-not-at-top from google.protobuf import text_format from google.protobuf import json_format from google.protobuf import descriptor from dist import validator_pb2 import validator_gen_js # pylint: enable=g-import-not-at-top out = [] validator_gen_js.GenerateValidatorGeneratedJs( specfile='%s/validator.protoascii' % out_dir, validator_pb2=validator_pb2, generate_proto_only=False, generate_spec_only=True, text_format=text_format, html_format=None, descriptor=descriptor, out=out) out.append('') f = open('%s/validator-generated.js' % out_dir, 'w') f.write('\n'.join(out)) f.close() out = [] validator_gen_js.GenerateValidatorGeneratedJson( specfile='%s/validator.protoascii' % out_dir, validator_pb2=validator_pb2, text_format=text_format, json_format=json_format, out=out) out.append('') f = open('%s/validator-generated.json' % out_dir, 'w') f.write('\n'.join(out)) f.close() logging.info('... done') def CompileWithClosure(js_files, definitions, entry_points, output_file): """Compiles the arguments with the Closure compiler for transpilation to ES5. Args: js_files: list of files to compile definitions: list of definitions flags to closure compiler entry_points: entry points (these won't be minimized) output_file: name of the Javascript output file """ cmd = [ 'java', '-jar', 'node_modules/google-closure-compiler-java/compiler.jar', '--language_out=ES5_STRICT', '--dependency_mode=STRICT', '--js_output_file=%s' % output_file ] cmd += ['--entry_point=%s' % e for e in entry_points] cmd += ['--output_manifest=%s' % ('%s.manifest' % output_file)] cmd += [ 'node_modules/google-closure-library/closure/**.js', '!node_modules/google-closure-library/closure/**_test.js', 'node_modules/google-closure-library/third_party/closure/**.js', '!node_modules/google-closure-library/third_party/closure/**_test.js' ] cmd += js_files cmd += definitions subprocess.check_call(cmd) def CompileValidatorMinified(out_dir): """Generates a minified validator script, which can be imported to validate. Args: out_dir: output directory """ logging.info('entering ...') CompileWithClosure( js_files=[ 'engine/definitions.js', 'engine/htmlparser.js', 'engine/parse-css.js', 'engine/parse-srcset.js', 'engine/parse-url.js', 'engine/tokenize-css.js', '%s/validator-generated.js' % out_dir, '%s/validator-proto-generated.js' % out_dir, 'engine/validator-in-browser.js', 'engine/validator.js', 'engine/amp4ads-parse-css.js', 'engine/keyframes-parse-css.js', 'engine/htmlparser-interface.js' ], definitions=[], entry_points=[ 'amp.validator.validateString', 'amp.validator.renderValidationResult', 'amp.validator.renderErrorMessage' ], output_file='%s/validator_minified.js' % out_dir) logging.info('... done') def RunSmokeTest(out_dir): """Runs a smoke test (minimum valid AMP and empty html file). Args: out_dir: output directory """ logging.info('entering ...') # Run index.js on the minimum valid amp and observe that it passes. p = subprocess.Popen( [ 'node', 'nodejs/index.js', '--validator_js', '%s/validator_minified.js' % out_dir, 'testdata/feature_tests/minimum_valid_amp.html', '--format=text' ], stdout=subprocess.PIPE, stderr=subprocess.PIPE) (stdout, stderr) = p.communicate() if (b'testdata/feature_tests/minimum_valid_amp.html: PASS\n', b'', p.returncode) != (stdout, stderr, 0): Die('Smoke test failed. returncode=%d stdout="%s" stderr="%s"' % (p.returncode, stdout, stderr)) # Run index.js on an empty file and observe that it fails. p = subprocess.Popen( [ 'node', 'nodejs/index.js', '--validator_js', '%s/validator_minified.js' % out_dir, 'testdata/feature_tests/empty.html', '--format=text' ], stdout=subprocess.PIPE, stderr=subprocess.PIPE) (stdout, stderr) = p.communicate() if p.returncode != 1: Die('smoke test failed. Expected p.returncode==1, saw: %s' % p.returncode) if not stderr.startswith(b'testdata/feature_tests/empty.html:1:0 ' b'The mandatory tag \'html'): Die('smoke test failed; stderr was: "%s"' % stderr) logging.info('... done') def RunIndexTest(): """Runs the index_test.js, which tests the NodeJS API. """ logging.info('entering ...') p = subprocess.Popen( ['node', './index_test.js'], stdout=subprocess.PIPE, stderr=subprocess.PIPE, cwd='nodejs') (stdout, stderr) = p.communicate() if p.returncode != 0: Die('index_test.js failed. returncode=%d stdout="%s" stderr="%s"' % (p.returncode, stdout, stderr)) logging.info('... done') def CompileValidatorTestMinified(out_dir): """Runs closure compiler for validator_test.js. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') CompileWithClosure( js_files=[ 'engine/definitions.js', 'engine/htmlparser.js', 'engine/parse-css.js', 'engine/parse-srcset.js', 'engine/parse-url.js', 'engine/tokenize-css.js', '%s/validator-generated.js' % out_dir, '%s/validator-proto-generated.js' % out_dir, 'engine/validator-in-browser.js', 'engine/validator.js', 'engine/amp4ads-parse-css.js', 'engine/keyframes-parse-css.js', 'engine/htmlparser-interface.js', 'engine/validator_test.js' ], definitions=[], entry_points=['amp.validator.ValidatorTest'], output_file='%s/validator_test_minified.js' % out_dir) logging.info('... success') def CompileHtmlparserTestMinified(out_dir): """Runs closure compiler for htmlparser_test.js. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') CompileWithClosure( js_files=[ 'engine/htmlparser.js', 'engine/htmlparser-interface.js', 'engine/htmlparser_test.js' ], definitions=[], entry_points=['amp.htmlparser.HtmlParserTest'], output_file='%s/htmlparser_test_minified.js' % out_dir) logging.info('... success') def CompileParseCssTestMinified(out_dir): """Runs closure compiler for parse-css_test.js. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') CompileWithClosure( js_files=[ 'engine/definitions.js', 'engine/parse-css.js', 'engine/parse-url.js', 'engine/tokenize-css.js', 'engine/css-selectors.js', 'engine/json-testutil.js', 'engine/parse-css_test.js', '%s/validator-generated.js' % out_dir, '%s/validator-proto-generated.js' % out_dir ], definitions=[], entry_points=['parse_css.ParseCssTest'], output_file='%s/parse-css_test_minified.js' % out_dir) logging.info('... success') def CompileParseUrlTestMinified(out_dir): """Runs closure compiler for parse-url_test.js. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') CompileWithClosure( js_files=[ 'engine/definitions.js', 'engine/parse-url.js', 'engine/parse-css.js', 'engine/tokenize-css.js', 'engine/css-selectors.js', 'engine/json-testutil.js', 'engine/parse-url_test.js', '%s/validator-generated.js' % out_dir, '%s/validator-proto-generated.js' % out_dir ], definitions=[], entry_points=['parse_url.ParseURLTest'], output_file='%s/parse-url_test_minified.js' % out_dir) logging.info('... success') def CompileAmp4AdsParseCssTestMinified(out_dir): """Runs closure compiler for amp4ads-parse-css_test.js. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') CompileWithClosure( js_files=[ 'engine/definitions.js', 'engine/amp4ads-parse-css_test.js', 'engine/parse-css.js', 'engine/parse-url.js', 'engine/amp4ads-parse-css.js', 'engine/tokenize-css.js', 'engine/css-selectors.js', 'engine/json-testutil.js', '%s/validator-generated.js' % out_dir, '%s/validator-proto-generated.js' % out_dir ], definitions=[], entry_points=['parse_css.Amp4AdsParseCssTest'], output_file='%s/amp4ads-parse-css_test_minified.js' % out_dir) logging.info('... success') def CompileKeyframesParseCssTestMinified(out_dir): """Runs closure compiler for keyframes-parse-css_test.js. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') CompileWithClosure( js_files=[ 'engine/definitions.js', 'engine/keyframes-parse-css_test.js', 'engine/parse-css.js', 'engine/parse-url.js', 'engine/keyframes-parse-css.js', 'engine/tokenize-css.js', 'engine/css-selectors.js', 'engine/json-testutil.js', '%s/validator-generated.js' % out_dir, '%s/validator-proto-generated.js' % out_dir ], definitions=[], entry_points=['parse_css.KeyframesParseCssTest'], output_file='%s/keyframes-parse-css_test_minified.js' % out_dir) logging.info('... success') def CompileParseSrcsetTestMinified(out_dir): """Runs closure compiler for parse-srcset_test.js. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') CompileWithClosure( js_files=[ 'engine/definitions.js', 'engine/parse-srcset.js', 'engine/json-testutil.js', 'engine/parse-srcset_test.js', '%s/validator-generated.js' % out_dir, '%s/validator-proto-generated.js' % out_dir ], definitions=[], entry_points=['parse_srcset.ParseSrcsetTest'], output_file='%s/parse-srcset_test_minified.js' % out_dir) logging.info('... success') def GenerateTestRunner(out_dir): """Generates a test runner: a nodejs script that runs our minified tests. Args: out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') f = open('%s/test_runner' % out_dir, 'w') extensions_dir = 'extensions' # In the Github project, the extensions are located in a sibling directory # to the validator rather than a child directory. if not os.path.isdir(extensions_dir): extensions_dir = '../extensions' f.write("""#!/usr/bin/env node global.assert = require('assert'); global.fs = require('fs'); global.path = require('path'); var JasmineRunner = require('jasmine'); var jasmine = new JasmineRunner(); process.env.TESTDATA_ROOTS = 'testdata:%s' require('./validator_test_minified'); require('./htmlparser_test_minified'); require('./parse-css_test_minified'); require('./parse-url_test_minified'); require('./amp4ads-parse-css_test_minified'); require('./keyframes-parse-css_test_minified'); require('./parse-srcset_test_minified'); jasmine.onComplete(function (passed) { process.exit(passed ? 0 : 1); }); jasmine.execute(); """ % extensions_dir) os.chmod('%s/test_runner' % out_dir, 0o750) logging.info('... success') def RunTests(update_tests, out_dir): """Runs all the minified tests. Args: update_tests: a boolean indicating whether or not to update the test output files. out_dir: directory name of the output directory. Must not have slashes, dots, etc. """ logging.info('entering ...') env = os.environ.copy() if update_tests: env['UPDATE_VALIDATOR_TEST'] = '1' subprocess.check_call(['node', '%s/test_runner' % out_dir], env=env) logging.info('... success') def Main(parsed_args): """The main method, which executes all build steps and runs the tests.""" logging.basicConfig( format='[[%(filename)s %(funcName)s]] - %(message)s', level=(logging.ERROR if os.environ.get('TRAVIS') else logging.INFO)) EnsureNodeJsIsInstalled() CheckPrereqs() InstallNodeDependencies() SetupOutDir(out_dir='dist') GenValidatorProtoascii(out_dir='dist') GenValidatorPb2Py(out_dir='dist') GenValidatorProtoGeneratedJs(out_dir='dist') GenValidatorGeneratedJs(out_dir='dist') CompileValidatorMinified(out_dir='dist') RunSmokeTest(out_dir='dist') RunIndexTest() CompileValidatorTestMinified(out_dir='dist') CompileHtmlparserTestMinified(out_dir='dist') CompileParseCssTestMinified(out_dir='dist') CompileParseUrlTestMinified(out_dir='dist') CompileAmp4AdsParseCssTestMinified(out_dir='dist') CompileKeyframesParseCssTestMinified(out_dir='dist') CompileParseSrcsetTestMinified(out_dir='dist') GenerateTestRunner(out_dir='dist') RunTests(update_tests=parsed_args.update_tests, out_dir='dist') if __name__ == '__main__': parser = argparse.ArgumentParser( description='Build script for the AMP Validator.') parser.add_argument( '--update_tests', action='store_true', help=('If True, validator_test will overwrite the .out test files with ' 'the encountered test output.')) Main(parser.parse_args())
#!/usr/bin/env python # Copyright 2015 The Kubernetes Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from charms import layer from charms.layer import snap from charms.reactive import hook from charms.reactive import is_state from charms.reactive import set_state from charms.reactive import when from charms.reactive import when_not from charms.reactive.helpers import data_changed from charmhelpers.core import hookenv, unitdata from shlex import split from subprocess import check_call from subprocess import check_output db = unitdata.kv() USER = 'system:e2e' @hook('upgrade-charm') def reset_delivery_states(): ''' Remove the state set when resources are unpacked. ''' install_snaps() @when('kubernetes-e2e.installed') def report_status(): ''' Report the status of the charm. ''' messaging() def messaging(): ''' Probe our relations to determine the propper messaging to the end user ''' missing_services = [] if not is_state('kubernetes-master.available'): missing_services.append('kubernetes-master:http') if not is_state('certificates.available'): missing_services.append('certificates') if not is_state('kubeconfig.ready'): missing_services.append('kubernetes-master:kube-control') if missing_services: if len(missing_services) > 1: subject = 'relations' else: subject = 'relation' services = ','.join(missing_services) message = 'Missing {0}: {1}'.format(subject, services) hookenv.status_set('blocked', message) return hookenv.status_set('active', 'Ready to test.') @when('config.changed.channel') def channel_changed(): install_snaps() def install_snaps(): ''' Deliver the e2e and kubectl components from the binary resource stream packages declared in the charm ''' channel = hookenv.config('channel') hookenv.status_set('maintenance', 'Installing kubectl snap') snap.install('kubectl', channel=channel, classic=True) hookenv.status_set('maintenance', 'Installing kubernetes-test snap') snap.install('kubernetes-test', channel=channel, classic=True) set_state('kubernetes-e2e.installed') @when('tls_client.ca.saved', 'tls_client.client.certificate.saved', 'tls_client.client.key.saved', 'kubernetes-master.available', 'kubernetes-e2e.installed', 'e2e.auth.bootstrapped') @when_not('kubeconfig.ready') def prepare_kubeconfig_certificates(master): ''' Prepare the data to feed to create the kubeconfig file. ''' layer_options = layer.options('tls-client') # Get all the paths to the tls information required for kubeconfig. ca = layer_options.get('ca_certificate_path') creds = db.get('credentials') data_changed('kube-control.creds', creds) servers = get_kube_api_servers(master) # pedantry kubeconfig_path = '/home/ubuntu/.kube/config' # Create kubernetes configuration in the default location for ubuntu. create_kubeconfig('/root/.kube/config', servers[0], ca, token=creds['client_token'], user='root') create_kubeconfig(kubeconfig_path, servers[0], ca, token=creds['client_token'], user='ubuntu') # Set permissions on the ubuntu users kubeconfig to ensure a consistent UX cmd = ['chown', 'ubuntu:ubuntu', kubeconfig_path] check_call(cmd) messaging() set_state('kubeconfig.ready') @when('kube-control.connected') def request_credentials(kube_control): """ Request authorization creds.""" # Ask for a user, although we will be using the 'client_token' kube_control.set_auth_request(USER) @when('kube-control.auth.available') def catch_change_in_creds(kube_control): """Request a service restart in case credential updates were detected.""" creds = kube_control.get_auth_credentials(USER) if creds \ and data_changed('kube-control.creds', creds) \ and creds['user'] == USER: # We need to cache the credentials here because if the # master changes (master leader dies and replaced by a new one) # the new master will have no recollection of our certs. db.set('credentials', creds) set_state('e2e.auth.bootstrapped') @when('kubernetes-e2e.installed', 'kubeconfig.ready') def set_app_version(): ''' Declare the application version to juju ''' cmd = ['kubectl', 'version', '--client'] from subprocess import CalledProcessError try: version = check_output(cmd).decode('utf-8') except CalledProcessError: message = "Missing kubeconfig causes errors. Skipping version set." hookenv.log(message) return git_version = version.split('GitVersion:"v')[-1] version_from = git_version.split('",')[0] hookenv.application_version_set(version_from.rstrip()) def create_kubeconfig(kubeconfig, server, ca, key=None, certificate=None, user='ubuntu', context='juju-context', cluster='juju-cluster', password=None, token=None): '''Create a configuration for Kubernetes based on path using the supplied arguments for values of the Kubernetes server, CA, key, certificate, user context and cluster.''' if not key and not certificate and not password and not token: raise ValueError('Missing authentication mechanism.') # token and password are mutually exclusive. Error early if both are # present. The developer has requested an impossible situation. # see: kubectl config set-credentials --help if token and password: raise ValueError('Token and Password are mutually exclusive.') # Create the config file with the address of the master server. cmd = 'kubectl config --kubeconfig={0} set-cluster {1} ' \ '--server={2} --certificate-authority={3} --embed-certs=true' check_call(split(cmd.format(kubeconfig, cluster, server, ca))) # Delete old users cmd = 'kubectl config --kubeconfig={0} unset users' check_call(split(cmd.format(kubeconfig))) # Create the credentials using the client flags. cmd = 'kubectl config --kubeconfig={0} ' \ 'set-credentials {1} '.format(kubeconfig, user) if key and certificate: cmd = '{0} --client-key={1} --client-certificate={2} '\ '--embed-certs=true'.format(cmd, key, certificate) if password: cmd = "{0} --username={1} --password={2}".format(cmd, user, password) # This is mutually exclusive from password. They will not work together. if token: cmd = "{0} --token={1}".format(cmd, token) check_call(split(cmd)) # Create a default context with the cluster. cmd = 'kubectl config --kubeconfig={0} set-context {1} ' \ '--cluster={2} --user={3}' check_call(split(cmd.format(kubeconfig, context, cluster, user))) # Make the config use this new context. cmd = 'kubectl config --kubeconfig={0} use-context {1}' check_call(split(cmd.format(kubeconfig, context))) def get_kube_api_servers(master): '''Return the kubernetes api server address and port for this relationship.''' hosts = [] # Iterate over every service from the relation object. for service in master.services(): for unit in service['hosts']: hosts.append('https://{0}:{1}'.format(unit['hostname'], unit['port'])) return hosts def determine_arch(): ''' dpkg wrapper to surface the architecture we are tied to''' cmd = ['dpkg', '--print-architecture'] output = check_output(cmd).decode('utf-8') return output.rstrip()
from utils import * from sensationdriver.pattern import BezierPath from sensationdriver.pattern import Track class Point(object): def __init__(self, time, value): self.time = time self.value = value class Keyframe(object): def __init__(self, control_point, out_tangent_end=None, in_tangent_start=None): self.control_point = control_point self.out_tangent_end = out_tangent_end self.in_tangent_start = in_tangent_start class TestBezierPath(unittest.TestCase): def setUp(self): self.logger = TestLogger() def test_bezier_calculation(self): start = Point(0, 0) end = Point(1.8, 2) start_out_tangent_end = Point(0.6, 0) end_in_tangent_start = Point(1.2, -1.279795) expected_values = [ (0.0, 0.0), (0.055555, -0.01084869), (0.111111, -0.03938968), (0.166666, -0.0796154), (0.222222, -0.1255182), (0.277777, -0.1710906), (0.333333, -0.2103248), (0.388888, -0.2372134), (0.444444, -0.2457487), (0.5, -0.2299231), (0.555555, -0.1837291), (0.611111, -0.101159), (0.666666, 0.02379485), (0.722222, 0.1971399), (0.777777, 0.4248839), (0.833333, 0.7130347), (0.888888, 1.067599), (0.944444, 1.494586), (1.0, 2)] for t, expected_value in expected_values: value = BezierPath.calculate_bezier_value(t, start, start_out_tangent_end, end_in_tangent_start, end) self.assertAlmostEqual(value, expected_value, delta=0.00001) def test_timeline(self): start = Point(0, 0) end = Point(1.8, 2) start_out_tangent_end = Point(0.6, 0) end_in_tangent_start = Point(1.2, -1.279795) keyframes = [Keyframe(start, out_tangent_end=start_out_tangent_end), Keyframe(end, in_tangent_start=end_in_tangent_start)] path = BezierPath(keyframes=keyframes) expected_values = [ 0.0, -0.01084869, -0.03938968, -0.0796154, -0.1255182, -0.1710906, -0.2103248, -0.2372134, -0.2457487, -0.2299231, -0.1837291, -0.101159, 0.02379485, 0.1971399, 0.4248839, 0.7130347, 1.067599, 1.494586] # preparation timeline = path.timeline() next(timeline) i = 0 value = timeline.send(0) while True: self.assertAlmostEqual(value, expected_values[i], delta=0.00001) try: value = timeline.send(0.1) i += 1 except StopIteration: break def test_multiple_keyframes(self): # 0 - 0.3 # 0.1325325 - 0.3 # 0.2650649 - 1.161977 # 0.3975974 - 1.333954 # 0.8650649 - 1.940549 # 1.332533 - -0.5553294 # 1.8 - 2 p0 = Point(0, 0.3) c1 = Point(0.1325325, 0.3) c2 = Point(0.2650649, 1.161977) p3 = Point(0.3975974, 1.333954) c4 = Point(0.8650649, 1.940549) c5 = Point(1.332533, -0.5553294) p6 = Point(1.8, 2) keyframes = [Keyframe(p0, out_tangent_end=c1), Keyframe(p3, in_tangent_start=c2, out_tangent_end=c4), Keyframe(p6, in_tangent_start=c5)] path = BezierPath(keyframes=keyframes) expected_values = [ 0.3, 0.438888, 0.7567842, 1.105537, 1.337044, 1.420382, 1.427235, 1.37534, 1.282435, 1.166256, 1.044542, 0.9350283, 0.8554535, 0.8235546, 0.8570688, 0.9737334, 1.191285, 1.527464] # preparation timeline = path.timeline() next(timeline) i = 0 value = timeline.send(0) while True: self.assertAlmostEqual(value, expected_values[i], delta=0.00001) try: value = timeline.send(0.1) i += 1 except StopIteration: break def test_calculate_bounds(self): p0 = Point(532,333) p1 = Point(117,305) p2 = Point(28,93) p3 = Point(265,42) bounds = BezierPath._calculate_bounds(p0, p1, p2, p3) self.assertAlmostEqual(bounds['left'], 135.77684049079755) self.assertAlmostEqual(bounds['bottom'], 42) self.assertAlmostEqual(bounds['right'], 532) self.assertAlmostEqual(bounds['top'], 333) def test_min_max_value(self): # 0 - 0.3 # 0.1325325 - -0.184255 # 0.2650649 - 1.161977 # 0.3975974 - 1.333954 # 0.8650649 - 1.940549 # 1.332533 - -0.5553294 # 1.8 - 2 p0 = Point(0, 0.3) c1 = Point(0.1325325, -0.184255) c2 = Point(0.2650649, 1.161977) p3 = Point(0.3975974, 1.333954) c4 = Point(0.8650649, 1.940549) c5 = Point(1.332533, -0.5553294) p6 = Point(1.8, 2) keyframes = [Keyframe(p0, out_tangent_end=c1), Keyframe(p3, in_tangent_start=c2, out_tangent_end=c4), Keyframe(p6, in_tangent_start=c5)] path = BezierPath(keyframes=keyframes) self.assertAlmostEqual(path.max_value, 2) self.assertAlmostEqual(path.min_value, 0.19549810687379637) class TestTrack(unittest.TestCase): def setUp(self): # 0 - 0.3 # 0.1325325 - 0.3 # 0.2650649 - 1.161977 # 0.3975974 - 1.333954 # 0.8650649 - 1.940549 # 1.332533 - -0.5553294 # 1.8 - 2 p0 = Point(0, 0.3) c1 = Point(0.1325325, 0.3) c2 = Point(0.2650649, 1.161977) p3 = Point(0.3975974, 1.333954) c4 = Point(0.8650649, 1.940549) c5 = Point(1.332533, -0.5553294) p6 = Point(1.8, 2) keyframes = [Keyframe(p0, out_tangent_end=c1), Keyframe(p3, in_tangent_start=c2, out_tangent_end=c4), Keyframe(p6, in_tangent_start=c5)] self.track = Track(target_region='region', actor_index='actor_index', keyframes=keyframes, priority=4) def test_is_finished(self): self.assertFalse(self.track.is_finished) self.track.advance(0.5) self.assertFalse(self.track.is_finished) self.track.advance(1.3001) self.assertTrue(self.track.is_finished) self.assertIsNone(self.track.advance(0.01)) def test_returns_last_value(self): value = 0 while not self.track.is_finished: value = self.track.advance(0.3) self.assertAlmostEqual(value, 1) def test_returns_last_value_immediatly(self): value = self.track.advance(4) self.assertAlmostEqual(value, 1, delta=0.00001) def test_initial_value(self): self.assertAlmostEqual(self.track.value, 0) def test_advance(self): value = self.track.advance(0.4) self.assertAlmostEqual(value, 0.610026, delta=0.000001) value = self.track.advance(0.4) self.assertAlmostEqual(value, 0.577903, delta=0.000001) value = self.track.advance(0.4) self.assertAlmostEqual(value, 0.326737, delta=0.000001) if __name__ == '__main__': unittest.main()
import xmlrpclib import time import solr import os import json import urllib2 import logging class WorkflowManagerClient(object): ''' Python client used to interact with a remote Labcas Workflow Manager. Available methods are defined in Java class org.apache.oodt.cas.workflow.system.XmlRpcWorkflowManager. ''' def __init__(self, workflowManagerUrl='http://localhost:9001/', fileManagerUrl='http://localhost:9000/', solrUrl='http://localhost:8983/solr/oodt-fm', verbose=False): self.workflowManagerServerProxy = xmlrpclib.ServerProxy(workflowManagerUrl, verbose=verbose, allow_none=True) self.fileManaferServerProxy = xmlrpclib.ServerProxy(fileManagerUrl, verbose=verbose, allow_none=True) self.solrServerProxy = solr.SolrConnection(solrUrl) def getWorkflowsByEvent(self, eventName): '''Retrieve a specific workflow by the triggering event.''' workflows = self.workflowManagerServerProxy.workflowmgr.getWorkflowsByEvent(eventName) for workflow in workflows: self.printWorkflow(workflow) def getWorkflowById(self, workflowId): '''Retrieve a specific workflow by its unique identifier.''' workflow = self.workflowManagerServerProxy.workflowmgr.getWorkflowById(workflowId) self.printWorkflow(workflow) def executeWorkflow(self, tasks, metadata): '''Submits a dynamic workflow composed of the specified tasks, using the specified metadata.''' # FIXME: pass metadata through: s.encode('ascii',errors='ignore') return self.workflowManagerServerProxy.workflowmgr.executeDynamicWorkflow(tasks, metadata) def waitForCompletion(self, wInstId, debug=False): ''' Monitors a workflow instance until it completes.''' # wait for the server to instantiate this workflow before querying it time.sleep(4) # now use the workflow instance id to check for status, wait until completed running_status = ['CREATED', 'QUEUED', 'STARTED', 'PAUSED'] pge_task_status = ['STAGING INPUT', 'BUILDING CONFIG FILE', 'PGE EXEC', 'CRAWLING'] finished_status = ['FINISHED', 'ERROR', 'METMISS'] while (True): try: response = self.workflowManagerServerProxy.workflowmgr.getWorkflowInstanceById(wInstId) status = response['status'] if status in running_status or status in pge_task_status: logging.info('Workflow instance=%s running with status=%s' % (wInstId, status)) time.sleep(1) elif status in finished_status: logging.info('Workflow instance=%s ended with status=%s' % (wInstId, status)) break else: logging.info('UNRECOGNIZED WORKFLOW STATUS: %s' % status) break except xmlrpclib.Fault as e: # must ignore XML-RPC exeptions that often arise when querying OODT for a specific workflow # just try again with the same workflow identifier logging.error(e) if debug: logging.debug(response) def uploadDataset(self, metadata, update_dataset=True, in_place=False, debug=False): if not update_dataset: metadata['UpdateDataset'] = "false" # NOTE: currently, if you start a named workflow, the XMLRPC interface only returns True/False, not a workflow instance identifier... #tf = serverProxy.workflowmgr.handleEvent('labcas-upload', { 'DatasetId':'mydata' } ) # ... consequently, you must submit an equivalent dynamic workflow, which does return the workflow instance id if in_place: wInstId = self.workflowManagerServerProxy.workflowmgr.executeDynamicWorkflow( ['urn:edrn:LabcasUploadInitTask','urn:edrn:LabcasUpload2ExecuteTask'], metadata ) else: wInstId = self.workflowManagerServerProxy.workflowmgr.executeDynamicWorkflow( ['urn:edrn:LabcasUploadInitTask','urn:edrn:LabcasUploadExecuteTask'], metadata ) # monitor workflow instance self.waitForCompletion(wInstId, debug=debug) def getProductTypeByName(self, datasetName): # retrieve a specific product type by name productTypeDict = self.fileManaferServerProxy.filemgr.getProductTypeByName(datasetName) self.printProductType(productTypeDict) def getProductTypeById(self, datasetId): # retrieve a specific product type by name productTypeDict = self.fileManaferServerProxy.filemgr.getProductTypeById(datasetId) self.printProductType(productTypeDict) def listProductTypes(self): # list all supported product types productTypes = self.fileManaferServerProxy.filemgr.getProductTypes() for productTypeDict in productTypes: self.printProductType(productTypeDict) def listTopLevelProductTypes(self): # roots of product type hierarchy (NOT be displayed directly) BUILTIN_PRODUCTS = ['GenericFile', 'LabcasProduct','EcasProduct'] # dictionary of top level product types: # key = DatasetId, value = dictionary of properties topLevelProductTypes = {} # list all supported product types productTypes = self.fileManaferServerProxy.filemgr.getProductTypes() for productTypeDict in productTypes: # assemble information to be displayed by UI name = productTypeDict['name'] # do NOT include these types in display list if name not in BUILTIN_PRODUCTS: typeMetadata = productTypeDict['typeMetadata'] datasetId = typeMetadata['DatasetId'][0] try: datasetName = typeMetadata['DatasetName'][0] except KeyError: datasetName = None description = productTypeDict['description'] if typeMetadata.get('OrganSite', None): organSite = typeMetadata['OrganSite'][0] else: organSite = None if typeMetadata.get('LeadPI', None): leadPI = typeMetadata['LeadPI'][0] else: leadPI = None topLevelProductTypes[datasetId] = { 'name': name, 'description': description, 'datasetId': datasetId, 'datasetName': datasetName, 'organSite': organSite, 'leadPI':leadPI } return topLevelProductTypes def listProductTypesByParent(self, parentDatasetId): childrenProductTypes = [] # list all supported product types productTypes = self.fileManaferServerProxy.filemgr.getProductTypes() for productTypeDict in productTypes: try: if parentDatasetId in productTypeDict['typeMetadata']['ParentDatasetId']: datasetId = productTypeDict['typeMetadata']['DatasetId'][0] childrenProductTypes.append(datasetId) except KeyError: pass return childrenProductTypes def printProductType(self, productTypeDict): logging.info('PRODUCT TYPE: %s' % productTypeDict['name']) for key, value in productTypeDict.items(): # dictionary: typeMetadata = {'DataCustodianEmail': ['dsidrans@jhmi.edu'], 'DataDisclaimer': [...], ..} if key=='typeMetadata': logging.info('\t%s =' % key) for _key, _value in value.items(): logging.info('\t\t%s = %s' % (_key, _value)) else: logging.info('\t%s = %s' % (key, value)) def listProducts(self, productType): # query for all products of this type (i.e. all files of this dataset), all versions #response = self.solrServerProxy.query('*:*', fq=['DatasetId:%s' % datasetId], start=0) #print "\nNumber of files found: %s (all versions)" % response.numFound #for result in response.results: # self.printProduct(result) # query for all possible versions of this dataset response = self.solrServerProxy.query('*:*', fq=['CAS.ProductTypeName:%s' % productType], start=0, rows=0, facet='true', facet_field='DatasetVersion') versions = response.facet_counts['facet_fields']['DatasetVersion'] last_version = 0 for key, value in versions.items(): # NOTE: facet keys span the whole index, but their counts are specific to this search if int(value)>0: logging.info("\nDataset Version number %s has %s files" % (key, value)) if int(key) > last_version: last_version = int(key) # query for all files for a specific version response = self.solrServerProxy.query('*:*', fq=['CAS.ProductTypeName:%s' % productType,'DatasetVersion:%s' % last_version ], start=0) logging.info("\nLatest version: %s, number of files: %s, listing them all:" % (last_version, response.numFound)) for result in response.results: self.printProduct(result) def printProduct(self, result): '''Utility function to print out the product metadata''' logging.info('\nProduct ID=%s' % result['id']) for key, values in result.items(): logging.info('\tProduct metadata key=%s values=%s' % (key, values)) def printWorkflow(self, workflowDict): '''Utiliyu function to print out a workflow.''' logging.info(workflowDict) logging.info("Workflow id=%s name=%s" % (workflowDict['id'], workflowDict['name'])) for task in workflowDict['tasks']: logging.info("Task: %s" % task)
from __future__ import absolute_import, print_function, unicode_literals import os import sys from attr import attrib, attrs from twisted.python import failure from twisted.internet.task import Cooperator from zope.interface import implementer from ._boss import Boss from ._dilation.manager import DILATION_VERSIONS from ._dilation.connector import Connector from ._interfaces import IDeferredWormhole, IWormhole from ._key import derive_key from .errors import NoKeyError, WormholeClosed from .eventual import EventualQueue from .journal import ImmediateJournal from .observer import OneShotObserver, SequenceObserver from .timing import DebugTiming from .util import bytes_to_hexstr, to_bytes from ._version import get_versions __version__ = get_versions()['version'] del get_versions # We can provide different APIs to different apps: # * Deferreds # w.get_code().addCallback(print_code) # w.send_message(data) # w.get_message().addCallback(got_data) # w.close().addCallback(closed) # * delegate callbacks (better for journaled environments) # w = wormhole(delegate=app) # w.send_message(data) # app.wormhole_got_code(code) # app.wormhole_got_verifier(verifier) # app.wormhole_got_versions(versions) # app.wormhole_got_message(data) # w.close() # app.wormhole_closed() # # * potential delegate options # wormhole(delegate=app, delegate_prefix="wormhole_", # delegate_args=(args, kwargs)) @attrs @implementer(IWormhole) class _DelegatedWormhole(object): _delegate = attrib() def __attrs_post_init__(self): self._key = None def _set_boss(self, boss): self._boss = boss # from above def allocate_code(self, code_length=2): self._boss.allocate_code(code_length) def input_code(self): return self._boss.input_code() def set_code(self, code): self._boss.set_code(code) # def serialize(self): # s = {"serialized_wormhole_version": 1, # "boss": self._boss.serialize(), # } # return s def send_message(self, plaintext): self._boss.send(plaintext) def derive_key(self, purpose, length): """Derive a new key from the established wormhole channel for some other purpose. This is a deterministic randomized function of the session key and the 'purpose' string (unicode/py3-string). This cannot be called until when_verifier() has fired, nor after close() was called. """ if not isinstance(purpose, type("")): raise TypeError(type(purpose)) if not self._key: raise NoKeyError() return derive_key(self._key, to_bytes(purpose), length) def close(self): self._boss.close() def debug_set_trace(self, client_name, which="B N M S O K SK R RC L C T", file=sys.stderr): self._boss._set_trace(client_name, which, file) # from below def got_welcome(self, welcome): self._delegate.wormhole_got_welcome(welcome) def got_code(self, code): self._delegate.wormhole_got_code(code) def got_key(self, key): self._delegate.wormhole_got_unverified_key(key) self._key = key # for derive_key() def got_verifier(self, verifier): self._delegate.wormhole_got_verifier(verifier) def got_versions(self, versions): self._delegate.wormhole_got_versions(versions) def received(self, plaintext): self._delegate.wormhole_got_message(plaintext) def closed(self, result): self._delegate.wormhole_closed(result) @implementer(IWormhole, IDeferredWormhole) class _DeferredWormhole(object): def __init__(self, reactor, eq, _enable_dilate=False): self._reactor = reactor self._welcome_observer = OneShotObserver(eq) self._code_observer = OneShotObserver(eq) self._key = None self._key_observer = OneShotObserver(eq) self._verifier_observer = OneShotObserver(eq) self._version_observer = OneShotObserver(eq) self._received_observer = SequenceObserver(eq) self._closed = False self._closed_observer = OneShotObserver(eq) self._enable_dilate = _enable_dilate def _set_boss(self, boss): self._boss = boss # from above def get_code(self): # TODO: consider throwing error unless one of allocate/set/input_code # was called first. It's legit to grab the Deferred before triggering # the process that will cause it to fire, but forbidding that # ordering would make it easier to cause programming errors that # forget to trigger it entirely. return self._code_observer.when_fired() def get_welcome(self): return self._welcome_observer.when_fired() def get_unverified_key(self): return self._key_observer.when_fired() def get_verifier(self): return self._verifier_observer.when_fired() def get_versions(self): return self._version_observer.when_fired() def get_message(self): return self._received_observer.when_next_event() def allocate_code(self, code_length=2): self._boss.allocate_code(code_length) def input_code(self): return self._boss.input_code() def set_code(self, code): self._boss.set_code(code) # no .serialize in Deferred-mode def send_message(self, plaintext): self._boss.send(plaintext) def derive_key(self, purpose, length): """Derive a new key from the established wormhole channel for some other purpose. This is a deterministic randomized function of the session key and the 'purpose' string (unicode/py3-string). This cannot be called until when_verified() has fired, nor after close() was called. """ if not isinstance(purpose, type("")): raise TypeError(type(purpose)) if not self._key: raise NoKeyError() return derive_key(self._key, to_bytes(purpose), length) def dilate(self, transit_relay_location=None, no_listen=False): if not self._enable_dilate: raise NotImplementedError return self._boss.dilate(transit_relay_location, no_listen) # fires with (endpoints) def close(self): # fails with WormholeError unless we established a connection # (state=="happy"). Fails with WrongPasswordError (a subclass of # WormholeError) if state=="scary". d = self._closed_observer.when_fired() # maybe Failure if not self._closed: self._boss.close() # only need to close if it wasn't already return d def debug_set_trace(self, client_name, which="B N M S O K SK R RC L A I C T", file=sys.stderr): self._boss._set_trace(client_name, which, file) # from below def got_welcome(self, welcome): self._welcome_observer.fire_if_not_fired(welcome) def got_code(self, code): self._code_observer.fire_if_not_fired(code) def got_key(self, key): self._key = key # for derive_key() self._key_observer.fire_if_not_fired(key) def got_verifier(self, verifier): self._verifier_observer.fire_if_not_fired(verifier) def got_versions(self, versions): self._version_observer.fire_if_not_fired(versions) def received(self, plaintext): self._received_observer.fire(plaintext) def closed(self, result): self._closed = True # print("closed", result, type(result), file=sys.stderr) if isinstance(result, Exception): # everything pending gets an error, including close() f = failure.Failure(result) self._closed_observer.error(f) else: # everything pending except close() gets an error: # w.get_code()/welcome/unverified_key/verifier/versions/message f = failure.Failure(WormholeClosed(result)) # but w.close() only gets error if we're unhappy self._closed_observer.fire_if_not_fired(result) self._welcome_observer.error(f) self._code_observer.error(f) self._key_observer.error(f) self._verifier_observer.error(f) self._version_observer.error(f) self._received_observer.fire(f) def create( appid, relay_url, reactor, # use keyword args for everything else versions={}, delegate=None, journal=None, tor=None, timing=None, stderr=sys.stderr, _eventual_queue=None, _enable_dilate=False): timing = timing or DebugTiming() side = bytes_to_hexstr(os.urandom(5)) journal = journal or ImmediateJournal() eq = _eventual_queue or EventualQueue(reactor) cooperator = Cooperator(scheduler=eq.eventually) if delegate: w = _DelegatedWormhole(delegate) else: w = _DeferredWormhole(reactor, eq, _enable_dilate=_enable_dilate) # this indicates Wormhole capabilities wormhole_versions = { "can-dilate": DILATION_VERSIONS, "dilation-abilities": Connector.get_connection_abilities(), } if not _enable_dilate: wormhole_versions = {} # don't advertise Dilation yet: not ready wormhole_versions["app_versions"] = versions # app-specific capabilities v = __version__ if isinstance(v, type(b"")): v = v.decode("utf-8", errors="replace") client_version = ("python", v) b = Boss(w, side, relay_url, appid, wormhole_versions, client_version, reactor, eq, cooperator, journal, tor, timing) w._set_boss(b) b.start() return w # def from_serialized(serialized, reactor, delegate, # journal=None, tor=None, # timing=None, stderr=sys.stderr): # assert serialized["serialized_wormhole_version"] == 1 # timing = timing or DebugTiming() # w = _DelegatedWormhole(delegate) # # now unpack state machines, including the SPAKE2 in Key # b = Boss.from_serialized(w, serialized["boss"], reactor, journal, timing) # w._set_boss(b) # b.start() # ?? # raise NotImplemented # # should the new Wormhole call got_code? only if it wasn't called before.
from __future__ import division, unicode_literals import warnings import unittest as unittest import numpy as np from scipy.spatial import ConvexHull from pymatgen import Composition from pymatgen.entries.computed_entries import ComputedEntry from pymatgen.analysis.phase_diagram import PhaseDiagram, \ GrandPotentialPhaseDiagram from pymatgen.analysis.reaction_calculator import Reaction from pymatgen.analysis.interface_reactions import InterfacialReactivity class InterfaceReactionTest(unittest.TestCase): def setUp(self): self.entries = [ComputedEntry(Composition('Li'), 0), ComputedEntry(Composition('Mn'), 0), ComputedEntry(Composition('O2'), 0), ComputedEntry(Composition('MnO2'), -10), ComputedEntry(Composition('Mn2O4'), -60), ComputedEntry(Composition('MnO3'), 20), ComputedEntry(Composition('Li2O'), -10), ComputedEntry(Composition('Li2O2'), -8), ComputedEntry(Composition('LiMnO2'), -30) ] self.pd = PhaseDiagram(self.entries) chempots = {'Li': -3} self.gpd = GrandPotentialPhaseDiagram(self.entries, chempots) self.ir = [] # ir[0] self.ir.append( InterfacialReactivity(Composition('O2'), Composition('Mn'), self.pd, norm=0, include_no_mixing_energy=0, pd_non_grand=None, use_hull_energy=False)) # ir[1] self.ir.append( InterfacialReactivity(Composition('MnO2'), Composition('Mn'), self.gpd, norm=0, include_no_mixing_energy=1, pd_non_grand=self.pd, use_hull_energy=False)) # ir[2] self.ir.append( InterfacialReactivity(Composition('Mn'), Composition('O2'), self.gpd, norm=1, include_no_mixing_energy=1, pd_non_grand=self.pd, use_hull_energy=False)) # ir[3] self.ir.append( InterfacialReactivity(Composition('Li2O'), Composition('Mn'), self.gpd, norm=0, include_no_mixing_energy=1, pd_non_grand=self.pd, use_hull_energy=False)) # ir[4] self.ir.append( InterfacialReactivity(Composition('Mn'), Composition('O2'), self.gpd, norm=1, include_no_mixing_energy=0, pd_non_grand=self.pd, use_hull_energy=False)) # ir[5] self.ir.append( InterfacialReactivity(Composition('Mn'), Composition('Li2O'), self.gpd, norm=1, include_no_mixing_energy=1, pd_non_grand=self.pd, use_hull_energy=False)) # ir[6] self.ir.append( InterfacialReactivity(Composition('Li2O2'), Composition('Li'), self.pd, norm=0, include_no_mixing_energy=0, pd_non_grand=None, use_hull_energy=True)) # ir[7] self.ir.append( InterfacialReactivity(Composition('Li2O2'), Composition('Li'), self.pd, norm=0, include_no_mixing_energy=0, pd_non_grand=None, use_hull_energy=False)) # ir[8] self.ir.append( InterfacialReactivity(Composition('Li2O2'), Composition('MnO2'), self.gpd, norm=0, include_no_mixing_energy=0, pd_non_grand=self.pd, use_hull_energy=True)) # ir[9] self.ir.append( InterfacialReactivity(Composition('Li2O2'), Composition('MnO2'), self.gpd, norm=0, include_no_mixing_energy=0, pd_non_grand=self.pd, use_hull_energy=False)) # ir[10] self.ir.append( InterfacialReactivity(Composition('O2'), Composition('Mn'), self.pd, norm=1, include_no_mixing_energy=0, pd_non_grand=None, use_hull_energy=False)) # ir[11] self.ir.append( InterfacialReactivity(Composition('Li2O2'), Composition('Li2O2'), self.gpd, norm=1, include_no_mixing_energy=1, pd_non_grand=self.pd, use_hull_energy=False)) # ir[12] self.ir.append( InterfacialReactivity(Composition('Li2O2'), Composition('Li2O2'), self.pd, norm=1, include_no_mixing_energy=0, pd_non_grand=None, use_hull_energy=False)) with self.assertRaises(Exception) as context1: self.ir.append( InterfacialReactivity(Composition('Li2O2'), Composition('Li'), self.pd, norm=1, include_no_mixing_energy=1, pd_non_grand=None)) self.assertTrue( 'Please provide grand phase diagram ' 'to compute no_mixing_energy!' == str(context1.exception)) with self.assertRaises(Exception) as context2: self.ir.append( InterfacialReactivity(Composition('O2'), Composition('Mn'), self.gpd, norm=0, include_no_mixing_energy=1, pd_non_grand=None)) self.assertTrue( 'Please provide non-grand phase diagram ' 'to compute no_mixing_energy!' == str(context2.exception)) def test_get_entry_energy(self): # Test warning message. comp = Composition('MnO3') with warnings.catch_warnings(record=True) as w: warnings.simplefilter("always") energy = InterfacialReactivity._get_entry_energy(self.pd, comp) self.assertTrue(len(w) == 1) self.assertTrue("The reactant MnO3 has no matching entry with" " negative formation energy, instead convex " "hull energy for this composition will be used" " for reaction energy calculation." in str(w[-1].message)) test1 = np.isclose(energy, -30, atol=1e-03) self.assertTrue(test1, '_get_entry_energy: energy for {} is wrong!'.format( comp.reduced_formula)) # Test normal functionality comp = Composition('MnO2') test2 = np.isclose( InterfacialReactivity._get_entry_energy(self.pd, comp), -30, atol=1e-03) self.assertTrue(test2, '_get_entry_energy: energy for {} is wrong!'.format( comp.reduced_formula)) def test_get_grand_potential(self): comp = Composition('LiMnO2') # Test non-normalized case test1 = np.isclose(self.ir[1]._get_grand_potential(comp), -27, atol=1e-03) self.assertTrue(test1, '_get_grand_potential: ' 'Non-normalized case gets error!') # Test normalized case test2 = np.isclose(self.ir[2]._get_grand_potential(comp), -9, atol=1e-03) self.assertTrue(test2, '_get_grand_potential: ' 'Normalized case gets error!') comp2 = Composition('Li2O2') # Test use_hull_energy option. test3 = np.isclose(self.ir[8]._get_grand_potential(comp2), -4, atol=1e-03) self.assertTrue(test3, '_get_grand_potential: ' 'get hull energy gets error!') test4 = np.isclose(self.ir[9]._get_grand_potential(comp2), -2, atol=1e-03) self.assertTrue(test4, '_get_grand_potential: ' 'gets error for {}!'.format(comp2.reduced_formula)) def test_get_energy(self): test1 = (np.isclose(self.ir[0]._get_energy(0.5), -15, atol=1e-03)) self.assertTrue(test1, '_get_energy: phase diagram gets error!') test2 = ( np.isclose(self.ir[3]._get_energy(0.6666666), -7.333333, atol=1e-03)) self.assertTrue(test2, '_get_energy: ' 'grand canonical phase diagram gets error!') test3 = ( np.isclose(self.ir[6]._get_energy(0.3333333), -3.333333, atol=1e-03)) self.assertTrue(test3, '_get_energy: convex hull energy gets error. ') test4 = ( np.isclose(self.ir[7]._get_energy(0.3333333), -4, atol=1e-03)) self.assertTrue(test4, '_get_energy: gets error. ') def test_get_reaction(self): test1 = str(self.ir[0]._get_reaction(0.5)) == '0.5 O2 + 0.5 Mn -> ' \ '0.5 MnO2' self.assertTrue(test1, '_get_reaction: ' 'reaction not involving chempots species gets error!') test2 = str(self.ir[3]._get_reaction(0.666666)) \ == '0.5 Mn + 0.5 Li2O -> Li + 0.25 MnO2 + 0.25 Mn' \ or str(self.ir[3]._get_reaction(0.666666)) \ == '0.5 Mn + 0.5 Li2O -> Li + 0.25 Mn + 0.25 MnO2' self.assertTrue(test2, '_get_reaction: ' 'reaction involving chempots species gets error!') def test_get_get_elmt_amt_in_rxt(self): rxt1 = Reaction( [Composition('Mn'), Composition('O2'), Composition('Li')], [Composition('LiMnO2')]) test1 = np.isclose(self.ir[2]._get_elmt_amt_in_rxt(rxt1), 3) self.assertTrue(test1, '_get_get_elmt_amt_in_rxt: ' 'gpd elements amounts gets error!') rxt2 = rxt1 rxt2.normalize_to(Composition('Li'), 0.5) test2 = np.isclose(self.ir[2]._get_elmt_amt_in_rxt(rxt2), 1.5) self.assertTrue(test2, '_get_get_elmt_amt_in_rxt: ' 'gpd elements amounts gets error!') rxt3 = Reaction([Composition('O2'), Composition('Li')], [Composition('Li2O')]) # Li is not counted test3 = np.isclose(self.ir[2]._get_elmt_amt_in_rxt(rxt3), 1) self.assertTrue(test3, '_get_get_elmt_amt_in_rxt: ' 'gpd elements amounts gets error!') # Li is counted test4 = np.isclose(self.ir[6]._get_elmt_amt_in_rxt(rxt3), 3) self.assertTrue(test4, '_get_get_elmt_amt_in_rxt: ' 'pd elements amounts gets error!') def test_convert(self): test_array = [(0.5, 1, 3), (0.4, 2, 3), (0, 1, 9), (1, 2, 7)] result = [InterfacialReactivity._convert(x, f1, f2) for x, f1, f2 in test_array] answer = [0.75, 0.5, 0, 1] self.assertTrue(np.allclose(result, answer), '_convert: conversion gets error! {0} expected,' ' but gets {1}'.format(answer, result)) def test_reverse_convert(self): test_array = [(0.5, 1, 3), (0.4, 2, 3), (0, 1, 9), (1, 2, 7)] result = [InterfacialReactivity._reverse_convert(x, f1, f2) for x, f1, f2 in test_array] answer = [0.25, 0.3076923, 0, 1] self.assertTrue(np.allclose(result, answer), '_convert: conversion gets error! {0} expected,' ' but gets {1}'.format(answer, result)) def test_get_products(self): test1 = sorted(self.ir[0].get_products()) == sorted( ['MnO2', 'O2', 'Mn']) self.assertTrue(test1, 'get_products: decomposition products gets error ' 'for reaction not involving chempots species!') test2 = sorted(self.ir[3].get_products()) == sorted( ['Li', 'MnO2', 'Mn', 'Li2O']) self.assertTrue(test2, 'get_decomp: decomposition products gets error ' 'for reaction involving chempots species!') def test_get_kinks(self): def test_get_kinks_helper(ir, index_expect, x_kink_expect, energy_kink_expect, react_kink_expect, energy_per_rxt_kink_expect): lst = list(ir.get_kinks()) index = [i[0] for i in lst] x_kink = [i[1] for i in lst] energy_kink = [i[2] for i in lst] react_kink = [str(i[3]) for i in lst] energy_per_rxt_kink = [i[4] for i in lst] test1 = index == index_expect self.assertTrue(test1, 'get_kinks:index gets error!') test2 = np.allclose(x_kink, x_kink_expect) self.assertTrue(test2, 'get_kinks:x kinks gets error!') test3 = np.allclose(energy_kink, energy_kink_expect) self.assertTrue(test3, 'get_kinks:energy kinks gets error!') # Testing reaction strings are hard, # as species could be arranged in random order. test4 = len(react_kink) == len(react_kink_expect) self.assertTrue(test4, 'get_kinks: reaction kinks ' 'gets error for {0} and {1} reaction!'.format( ir.c1_original.reduced_formula, ir.c2_original.reduced_formula)) test5 = np.allclose(energy_per_rxt_kink, energy_per_rxt_kink_expect) self.assertTrue(test5, 'get_kinks: energy_per_rxt_kinks gets error!') test_get_kinks_helper(self.ir[0], [1, 2, 3], [0, 0.5, 1], [0, -15, 0], ['Mn -> Mn', '0.5 O2 + 0.5 Mn -> 0.5 MnO2', 'O2 -> O2'], [0, -15 * InterfacialReactivity.EV_TO_KJ_PER_MOL, 0]) test_get_kinks_helper(self.ir[10], [1, 2, 3], [0, 0.66667, 1], [0, -10, 0], ['Mn -> Mn', '0.5 O2 + 0.5 Mn -> 0.5 MnO2', 'O2 -> O2'], [0, -15 * InterfacialReactivity.EV_TO_KJ_PER_MOL, 0]) test_get_kinks_helper(self.ir[11], [1, 2], [0, 1], [-3, -3], ['Li2O2 + 2 Li -> 2 Li2O', 'Li2O2 + 2 Li -> 2 Li2O'], [-6 * InterfacialReactivity.EV_TO_KJ_PER_MOL] * 2) test_get_kinks_helper(self.ir[12], [1, 2], [0, 1], [-0.5, -0.5], ['Li2O2 -> Li2O + 0.5 O2', 'Li2O2 -> Li2O + 0.5 O2'], [-2 * InterfacialReactivity.EV_TO_KJ_PER_MOL] * 2) def test_convexity(self): def test_convexity_helper(ir): lst = list(ir.get_kinks()) x_kink = [i[1] for i in lst] energy_kink = [i[2] for i in lst] points = list(zip(x_kink, energy_kink)) if len(points) >= 3: # To test convexity of the plot, construct convex hull from # the kinks and make sure # 1. all points are below the end points # 2. all points are on the convex hull. relative_vectors_1 = [(x - x_kink[0], e - energy_kink[0]) for x, e in points] relative_vectors_2 = [(x - x_kink[-1], e - energy_kink[-1]) for x, e in points] relative_vectors = zip(relative_vectors_1, relative_vectors_2) positions = [np.cross(v1, v2) for v1, v2 in relative_vectors] test1 = np.all(np.array(positions) <= 0) hull = ConvexHull(points) test2 = len(hull.vertices) == len(points) self.assertTrue(test1 and test2, 'Error: Generating non-convex plot!') test_convexity_helper(self.ir[0]) test_convexity_helper(self.ir[1]) test_convexity_helper(self.ir[2]) test_convexity_helper(self.ir[3]) test_convexity_helper(self.ir[4]) test_convexity_helper(self.ir[5]) test_convexity_helper(self.ir[6]) test_convexity_helper(self.ir[7]) test_convexity_helper(self.ir[8]) test_convexity_helper(self.ir[9]) test_convexity_helper(self.ir[10]) test_convexity_helper(self.ir[11]) test_convexity_helper(self.ir[12]) def test_get_original_composition_ratio(self): # expected reaction1: 0.5 O2 + 0.5 Mn -> 0.5 MnO2 reaction1 = self.ir[0]._get_reaction(0.5) test1 = np.isclose(self.ir[0]._get_original_composition_ratio( reaction1), 0.5) self.assertTrue(test1, '_get_original_composition_ratio: ' 'reaction not involving chempots species gets error!') # expected reaction2: 0.5 Mn + 0.5 Li2O -> Li + 0.25 MnO2 + 0.25 Mn reaction2 = self.ir[3]._get_reaction(0.666666) test2 = np.isclose(self.ir[3]._get_original_composition_ratio( reaction2), 0.5) self.assertTrue(test2, '_get_original_composition_ratio: ' 'reaction involving chempots species gets error!') def test_get_critical_original_kink_ratio(self): test1 = np.allclose(self.ir[0].get_critical_original_kink_ratio(), [0, 0.5, 1]) self.assertTrue(test1, 'get_critical_original_kink_ratio:' ' gets error!') test2 = np.allclose(self.ir[10].get_critical_original_kink_ratio(), [0, 0.5, 1]) self.assertTrue(test2, 'get_critical_original_kink_ratio:' ' gets error!') test3 = np.allclose(self.ir[11].get_critical_original_kink_ratio(), [0, 1]) self.assertTrue(test3, 'get_critical_original_kink_ratio:' ' gets error!') test4 = np.allclose(self.ir[2].get_critical_original_kink_ratio(), [0, 0.5, 1]) self.assertTrue(test4, 'get_critical_original_kink_ratio:' ' gets error!') test5 = np.allclose(self.ir[3].get_critical_original_kink_ratio(), [0, 0.66666, 1]) self.assertTrue(test5, 'get_critical_original_kink_ratio:' ' gets error!') def test_labels(self): ir = self.ir[0] dict = ir.labels() test1 = dict == {1: 'x= 0.0 energy in eV/atom = 0.0 Mn -> Mn', 2: 'x= 0.5 energy in eV/atom = -15.0 0.5 O2 + 0.5 ' 'Mn -> 0.5 MnO2', 3: 'x= 1.0 energy in eV/atom = 0.0 O2 -> O2'} self.assertTrue(test1, 'labels:label does not match for interfacial system ' 'with {0} and {1}.'.format( ir.c1_original.reduced_formula, ir.c2_original.reduced_formula)) def test_plot(self): # Test plot is hard. Here just to call the plot function to see if any # error occurs. for i in self.ir: i.plot() def test_minimum(self): answer = [ (0.5, -15), (0, 0), (0.3333333, -10), (0.6666666, -7.333333), (0.3333333, -7.333333), (0.1428571, -7.333333), (0.3333333, -3.333333), (0.3333333, -4.0), ] for i, j in zip(self.ir, answer): self.assertTrue(np.allclose(i.minimum(), j), 'minimum: the system with {0} and {1} ' 'gets error!{2} expected, but gets {3}'.format( i.c1_original.reduced_formula, i.c2_original.reduced_formula, str(j), str(i.minimum()))) def test_get_no_mixing_energy(self): with self.assertRaises(Exception) as context1: self.ir[0].get_no_mixing_energy() self.assertTrue( 'Please provide grand potential phase diagram' ' for computing no_mixing_energy!' == str(context1.exception)) answer = [ [(u'MnO2 (eV/f.u.)', 0.0), (u'Mn (eV/f.u.)', 0.0)], [(u'Mn (eV/atom)', 0.0), (u'O2 (eV/atom)', -4.0)], [(u'Li2O (eV/f.u.)', 0.0), (u'Mn (eV/f.u.)', 0.0)], [(u'Mn (eV/atom)', 0.0), (u'O2 (eV/atom)', -4.0)], [(u'Mn (eV/atom)', 0.0), (u'Li2O (eV/atom)', 0.0)] ] def name_lst(lst): return (lst[0][0], lst[1][0]) def energy_lst(lst): return (lst[0][1], lst[1][1]) result_info = [i.get_no_mixing_energy() for i in self.ir if i.grand] for i, j in zip(result_info, answer): self.assertTrue(name_lst(i) == name_lst(j), 'get_no_mixing_energy: names get error,' ' {0} expected but gets {1}'.format( name_lst(j), name_lst(i))) self.assertTrue(np.allclose(energy_lst(i), energy_lst(j)), 'get_no_mixing_energy: ' 'no_mixing energies get error, ' '{0} expected but gets {1}'.format( energy_lst(j), energy_lst(i))) def test_get_chempot_correction(self): # test data from fig. 6 in ref: # Prediction of A2BX4 metal-chalcogenide compounds via # first-principles thermodynamics, PHYSICAL REVIEW B 86, 014109 (2012) # test pressure effect. actual = InterfacialReactivity.get_chempot_correction("O", 298.15, 100E5) expect = 0.05916 self.assertTrue(np.isclose(actual, expect, atol=1E-2), "get_chempot_correction gets " "error, {0} expected but gets {1}".format(expect, actual)) # test temperature effect. actual_2 = InterfacialReactivity.get_chempot_correction("O", 1000, 1E5) expect_2 = -0.82352 self.assertTrue(np.isclose(actual_2, expect_2, atol=1E-2), "get_chempot_correction gets " "error, {0} expected but gets {1}".format(expect_2, actual_2)) actual_3 = InterfacialReactivity.get_chempot_correction("O", 500, 1E5) expect_3 = -0.223 self.assertTrue(np.isclose(actual_3, expect_3, atol=1E-2), "get_chempot_correction gets " "error, {0} expected but gets {1}".format(expect_3, actual_3)) # test mixed effect. actual_4 = InterfacialReactivity.get_chempot_correction("O", 1000, 1E-25) expect_4 = -3.800 self.assertTrue(np.isclose(actual_4, expect_4, atol=1E-2), "get_chempot_correction gets " "error, {0} expected but gets {1}".format(expect_4, actual_4)) actual_5 = InterfacialReactivity.get_chempot_correction("O", 1250, 1E-25) expect_5 = -4.86 self.assertTrue(np.isclose(actual_5, expect_5, atol=1E-2), "get_chempot_correction gets " "error, {0} expected but gets {1}".format(expect_5, actual_5)) actual_6 = InterfacialReactivity.get_chempot_correction("O", 1500, 1E-25) expect_6 = -5.928 self.assertTrue(np.isclose(actual_6, expect_6, atol=1E-2), "get_chempot_correction gets " "error, {0} expected but gets {1}".format(expect_6, actual_6)) actual_7 = InterfacialReactivity.get_chempot_correction("O", 1000, 1E-15) expect_7 = -2.808 self.assertTrue(np.isclose(actual_7, expect_7, atol=1E-2), "get_chempot_correction gets " "error, {0} expected but gets {1}".format(expect_7, actual_7)) # test non-gas phase. actual_8 = InterfacialReactivity.get_chempot_correction("Li", 1000, 1E15) expect_8 = 0 self.assertTrue(np.isclose(actual_8, expect_8, atol=1E-5), "get_chempot_correction gets " "error, {0} expected but gets {1}".format(expect_8, actual_8)) if __name__ == '__main__': unittest.main()
import numpy as np import pytest from pandas import DataFrame pytest.importorskip("jinja2") def bar_grad(a=None, b=None, c=None, d=None): """Used in multiple tests to simplify formatting of expected result""" ret = [("width", "10em")] if all(x is None for x in [a, b, c, d]): return ret return ret + [ ( "background", f"linear-gradient(90deg,{','.join([x for x in [a, b, c, d] if x])})", ) ] def no_bar(): return bar_grad() def bar_to(x, color="#d65f5f"): return bar_grad(f" {color} {x:.1f}%", f" transparent {x:.1f}%") def bar_from_to(x, y, color="#d65f5f"): return bar_grad( f" transparent {x:.1f}%", f" {color} {x:.1f}%", f" {color} {y:.1f}%", f" transparent {y:.1f}%", ) @pytest.fixture def df_pos(): return DataFrame([[1], [2], [3]]) @pytest.fixture def df_neg(): return DataFrame([[-1], [-2], [-3]]) @pytest.fixture def df_mix(): return DataFrame([[-3], [1], [2]]) @pytest.mark.parametrize( "align, exp", [ ("left", [no_bar(), bar_to(50), bar_to(100)]), ("right", [bar_to(100), bar_from_to(50, 100), no_bar()]), ("mid", [bar_to(33.33), bar_to(66.66), bar_to(100)]), ("zero", [bar_from_to(50, 66.7), bar_from_to(50, 83.3), bar_from_to(50, 100)]), ("mean", [bar_to(50), no_bar(), bar_from_to(50, 100)]), (2.0, [bar_to(50), no_bar(), bar_from_to(50, 100)]), (np.median, [bar_to(50), no_bar(), bar_from_to(50, 100)]), ], ) def test_align_positive_cases(df_pos, align, exp): # test different align cases for all positive values result = df_pos.style.bar(align=align)._compute().ctx expected = {(0, 0): exp[0], (1, 0): exp[1], (2, 0): exp[2]} assert result == expected @pytest.mark.parametrize( "align, exp", [ ("left", [bar_to(100), bar_to(50), no_bar()]), ("right", [no_bar(), bar_from_to(50, 100), bar_to(100)]), ("mid", [bar_from_to(66.66, 100), bar_from_to(33.33, 100), bar_to(100)]), ("zero", [bar_from_to(33.33, 50), bar_from_to(16.66, 50), bar_to(50)]), ("mean", [bar_from_to(50, 100), no_bar(), bar_to(50)]), (-2.0, [bar_from_to(50, 100), no_bar(), bar_to(50)]), (np.median, [bar_from_to(50, 100), no_bar(), bar_to(50)]), ], ) def test_align_negative_cases(df_neg, align, exp): # test different align cases for all negative values result = df_neg.style.bar(align=align)._compute().ctx expected = {(0, 0): exp[0], (1, 0): exp[1], (2, 0): exp[2]} assert result == expected @pytest.mark.parametrize( "align, exp", [ ("left", [no_bar(), bar_to(80), bar_to(100)]), ("right", [bar_to(100), bar_from_to(80, 100), no_bar()]), ("mid", [bar_to(60), bar_from_to(60, 80), bar_from_to(60, 100)]), ("zero", [bar_to(50), bar_from_to(50, 66.66), bar_from_to(50, 83.33)]), ("mean", [bar_to(50), bar_from_to(50, 66.66), bar_from_to(50, 83.33)]), (-0.0, [bar_to(50), bar_from_to(50, 66.66), bar_from_to(50, 83.33)]), (np.nanmedian, [bar_to(50), no_bar(), bar_from_to(50, 62.5)]), ], ) @pytest.mark.parametrize("nans", [True, False]) def test_align_mixed_cases(df_mix, align, exp, nans): # test different align cases for mixed positive and negative values # also test no impact of NaNs and no_bar expected = {(0, 0): exp[0], (1, 0): exp[1], (2, 0): exp[2]} if nans: df_mix.loc[3, :] = np.nan expected.update({(3, 0): no_bar()}) result = df_mix.style.bar(align=align)._compute().ctx assert result == expected @pytest.mark.parametrize( "align, exp", [ ( "left", { "index": [[no_bar(), no_bar()], [bar_to(100), bar_to(100)]], "columns": [[no_bar(), bar_to(100)], [no_bar(), bar_to(100)]], "none": [[no_bar(), bar_to(33.33)], [bar_to(66.66), bar_to(100)]], }, ), ( "mid", { "index": [[bar_to(33.33), bar_to(50)], [bar_to(100), bar_to(100)]], "columns": [[bar_to(50), bar_to(100)], [bar_to(75), bar_to(100)]], "none": [[bar_to(25), bar_to(50)], [bar_to(75), bar_to(100)]], }, ), ( "zero", { "index": [ [bar_from_to(50, 66.66), bar_from_to(50, 75)], [bar_from_to(50, 100), bar_from_to(50, 100)], ], "columns": [ [bar_from_to(50, 75), bar_from_to(50, 100)], [bar_from_to(50, 87.5), bar_from_to(50, 100)], ], "none": [ [bar_from_to(50, 62.5), bar_from_to(50, 75)], [bar_from_to(50, 87.5), bar_from_to(50, 100)], ], }, ), ( 2, { "index": [ [bar_to(50), no_bar()], [bar_from_to(50, 100), bar_from_to(50, 100)], ], "columns": [ [bar_to(50), no_bar()], [bar_from_to(50, 75), bar_from_to(50, 100)], ], "none": [ [bar_from_to(25, 50), no_bar()], [bar_from_to(50, 75), bar_from_to(50, 100)], ], }, ), ], ) @pytest.mark.parametrize("axis", ["index", "columns", "none"]) def test_align_axis(align, exp, axis): # test all axis combinations with positive values and different aligns data = DataFrame([[1, 2], [3, 4]]) result = ( data.style.bar(align=align, axis=None if axis == "none" else axis) ._compute() .ctx ) expected = { (0, 0): exp[axis][0][0], (0, 1): exp[axis][0][1], (1, 0): exp[axis][1][0], (1, 1): exp[axis][1][1], } assert result == expected @pytest.mark.parametrize( "values, vmin, vmax", [ ("positive", 1.5, 2.5), ("negative", -2.5, -1.5), ("mixed", -2.5, 1.5), ], ) @pytest.mark.parametrize("nullify", [None, "vmin", "vmax"]) # test min/max separately @pytest.mark.parametrize("align", ["left", "right", "zero", "mid"]) def test_vmin_vmax_clipping(df_pos, df_neg, df_mix, values, vmin, vmax, nullify, align): # test that clipping occurs if any vmin > data_values or vmax < data_values if align == "mid": # mid acts as left or right in each case if values == "positive": align = "left" elif values == "negative": align = "right" df = {"positive": df_pos, "negative": df_neg, "mixed": df_mix}[values] vmin = None if nullify == "vmin" else vmin vmax = None if nullify == "vmax" else vmax clip_df = df.where(df <= (vmax if vmax else 999), other=vmax) clip_df = clip_df.where(clip_df >= (vmin if vmin else -999), other=vmin) result = ( df.style.bar(align=align, vmin=vmin, vmax=vmax, color=["red", "green"]) ._compute() .ctx ) expected = clip_df.style.bar(align=align, color=["red", "green"])._compute().ctx assert result == expected @pytest.mark.parametrize( "values, vmin, vmax", [ ("positive", 0.5, 4.5), ("negative", -4.5, -0.5), ("mixed", -4.5, 4.5), ], ) @pytest.mark.parametrize("nullify", [None, "vmin", "vmax"]) # test min/max separately @pytest.mark.parametrize("align", ["left", "right", "zero", "mid"]) def test_vmin_vmax_widening(df_pos, df_neg, df_mix, values, vmin, vmax, nullify, align): # test that widening occurs if any vmax > data_values or vmin < data_values if align == "mid": # mid acts as left or right in each case if values == "positive": align = "left" elif values == "negative": align = "right" df = {"positive": df_pos, "negative": df_neg, "mixed": df_mix}[values] vmin = None if nullify == "vmin" else vmin vmax = None if nullify == "vmax" else vmax expand_df = df.copy() expand_df.loc[3, :], expand_df.loc[4, :] = vmin, vmax result = ( df.style.bar(align=align, vmin=vmin, vmax=vmax, color=["red", "green"]) ._compute() .ctx ) expected = expand_df.style.bar(align=align, color=["red", "green"])._compute().ctx assert result.items() <= expected.items() def test_numerics(): # test data is pre-selected for numeric values data = DataFrame([[1, "a"], [2, "b"]]) result = data.style.bar()._compute().ctx assert (0, 1) not in result assert (1, 1) not in result @pytest.mark.parametrize( "align, exp", [ ("left", [no_bar(), bar_to(100, "green")]), ("right", [bar_to(100, "red"), no_bar()]), ("mid", [bar_to(25, "red"), bar_from_to(25, 100, "green")]), ("zero", [bar_from_to(33.33, 50, "red"), bar_from_to(50, 100, "green")]), ], ) def test_colors_mixed(align, exp): data = DataFrame([[-1], [3]]) result = data.style.bar(align=align, color=["red", "green"])._compute().ctx assert result == {(0, 0): exp[0], (1, 0): exp[1]} def test_bar_align_height(): # test when keyword height is used 'no-repeat center' and 'background-size' present data = DataFrame([[1], [2]]) result = data.style.bar(align="left", height=50)._compute().ctx bg_s = "linear-gradient(90deg, #d65f5f 100.0%, transparent 100.0%) no-repeat center" expected = { (0, 0): [("width", "10em")], (1, 0): [ ("width", "10em"), ("background", bg_s), ("background-size", "100% 50.0%"), ], } assert result == expected def test_bar_value_error_raises(): df = DataFrame({"A": [-100, -60, -30, -20]}) msg = "`align` should be in {'left', 'right', 'mid', 'mean', 'zero'} or" with pytest.raises(ValueError, match=msg): df.style.bar(align="poorly", color=["#d65f5f", "#5fba7d"]).to_html() msg = r"`width` must be a value in \[0, 100\]" with pytest.raises(ValueError, match=msg): df.style.bar(width=200).to_html() msg = r"`height` must be a value in \[0, 100\]" with pytest.raises(ValueError, match=msg): df.style.bar(height=200).to_html()
import csv def count(fileName): numRows = 0 with open(fileName, 'r') as f: reader = csv.reader(f,delimiter = ",") data = list(reader) row_count = len(data)-1 return row_count def lm_predict(a,b,intercept,fileName): rr_values = [] leastSquared = 0 acceptedPredictions = 0 total = count(fileName) with open(fileName,'r') as f: reader = csv.DictReader(f,delimiter = ',') for line in reader: if line['resprate'] == "": #predict value and fill in hr = float(line['heartrate']) bp = float(line['bloodpressure']) actual = float(line['removed']) upRange = actual*1.1 #1.20#*1.05 lwRange = actual*.90 #.8 #.95 observed = a * hr + b * bp + intercept line['resprate'] = observed rr_values.append(observed) leastSquared += (actual-observed)**2 # # If in acceptable range # if lwRange <= observed and observed <= upRange: # acceptedPredictions += 1 else: rr_values.append(float(line['resprate'])) return fileName[-7:], leastSquared def lm_predict_joined(a,b,c,d,intercept,fileName): acceptedPredictions = 0 total = count(fileName) leastSquared = 0 with open(fileName,'r') as f: reader = csv.DictReader(f,delimiter = ',') for line in reader: if line['resprate'] == "": #predict value and fill in hr = float(line['heartrate']) bp = float(line['bloodpressure']) age = float(line['age']) gender = (line['gender']) if gender == "F": gender = 1 else: gender = 0 actual = float(line['removed']) upRange = actual*1.1 #1.20#*1.05 lwRange = actual*.90 #.8 #.95 observed = a * hr + b * bp + c * age + gender + intercept line['resprate'] = observed leastSquared += (actual-observed)**2 # # If in acceptable range # if lwRange <= observed and observed <= upRange: # acceptedPredictions += 1 return fileName[-7:],leastSquared # 95% TRAIN | 05% TEST # NOT JOINED # p-value: < 2.2e-16 # Coefficients: # Estimate Std. Error t value Pr(>|t|) # (Intercept) 5.830201 0.370034 15.756 < 2e-16 *** # heartrate 0.144626 0.004437 32.598 < 2e-16 *** # bloodpressure 0.011313 0.003305 3.423 0.000628 *** # JOINED # p-value: < 2.2e-16 # Coefficients: # Estimate Std. Error t value Pr(>|t|) # (Intercept) 3.392385 0.884775 3.834 0.000129 *** # heartrate 0.145465 0.004441 32.759 < 2e-16 *** # bloodpressure 0.010847 0.003304 3.283 0.001042 ** # age 0.031139 0.011126 2.799 0.005170 ** # factor(gender)M 0.469527 0.315705 1.487 0.137079 if __name__=='__main__': joined_files = ['induced_dead_ace_joined_test_05_0.1.csv','induced_dead_ace_joined_test_05_0.3.csv','induced_dead_ace_joined_test_05_0.5.csv'] files = ['induced_dead_ace_test_05_0.1.csv','induced_dead_ace_test_05_0.3.csv','induced_dead_ace_test_05_0.5.csv'] print 'No Join' for f in files: # resprate ~heartrate + bloodpressure (name,leastsquared) = lm_predict(0.144626,0.011313,5.830201,f) print (name,leastsquared) #print rr_values print '###########################################' print 'Joined' for jf in joined_files: (name,leastsquared) = lm_predict_joined(0.145465, 0.010847, 0.031139 , 0.469527, 3.3923854,jf) print (name,leastsquared) # Dead Patient Ace Joined Table -> 2643 # Create the data for the chart. # not_joined <- c(4932.343740123179,2905.2458388668874,1342.5335549972406,264.63339070904397) # distributions <- c(70,80,90,95) # plot(not_joined, distributions, type="l", lwd=2, col="blue", ylim=c(0, 12), xaxs="i", yaxs="i") # joined <- c(5149.982721025402,3105.213382732825,1086.4348315361267,318.32722098806966) # # Give the chart file a name. # png(file = "Least_Squared_Varying_Train_Test_Distributions.jpg") # # Plot the bar chart. # plot(v,type = "o",col = "red", xlab = "Train", ylab = "Rain fall", # main = "Rain fall chart") # lines(t, type = "o", col = "blue") # # Save the file. # dev.off() ######## Different train/test distributions, least squared # 2644 Rows # 1850 # 2115 # 2379 # 2511 # train 70%, test 30% # No Join # ('0.1.csv', 4932.343740123179) # ('0.3.csv', 14672.663873677118) # ('0.5.csv', 23214.70125550916) # Joined # ('0.1.csv', 5149.982721025402) # ('0.3.csv', 12015.438090824508) # ('0.5.csv', 23446.298130530235) # train 80%, test 20% # No Join # ('0.1.csv', 2905.2458388668874) # ('0.3.csv', 7859.365402605208) # ('0.5.csv', 17159.443412678604) # Joined # ('0.1.csv', 3105.213382732825) # ('0.3.csv', 8720.008280001373) # ('0.5.csv', 15475.274385173194) # train 90%, test 10% # No Join # ('0.1.csv', 1342.5335549972406) # ('0.3.csv', 4365.742528772348) # ('0.1.csv', 1342.5335549972406) # Joined # ('0.1.csv', 1086.4348315361267) # ('0.3.csv', 4528.863447116168) # ('0.5.csv', 7970.889865116953) # train 95%, test 05% # No Join # ('0.1.csv', 264.63339070904397) # ('0.3.csv', 2662.3915099226106) # ('0.5.csv', 3529.902271957436) # Joined # ('0.1.csv', 318.32722098806966) # ('0.3.csv', 2271.2817881885603) # ('0.5.csv', 3643.205256700546) # Linear Regression Equations # 70% TRAIN | 30% TEST # NOT JOINED # p-value: < 2.2e-16 # Estimate Std. Error t value Pr(>|t|) # (Intercept) 5.602958 0.434759 12.888 < 2e-16 *** # heartrate 0.145658 0.005201 28.005 < 2e-16 *** # bloodpressure 0.011643 0.003778 3.082 0.00209 * # Residual standard error: 7.83 on 1847 degrees of freedom # Multiple R-squared: 0.3294, Adjusted R-squared: 0.3287 # F-statistic: 453.6 on 2 and 1847 DF, p-value: < 2.2e-16 # JOINED # p-value: < 2.2e-16 # Coefficients: # Estimate Std. Error t value Pr(>|t|) # (Intercept) 3.242482 1.017738 3.186 0.00147 ** # heartrate 0.146254 0.005204 28.102 < 2e-16 *** # bloodpressure 0.011184 0.003779 2.960 0.00312 ** # age 0.029881 0.012798 2.335 0.01966 * # factor(gender)M 0.516674 0.369022 1.400 0.16165 # Residual standard error: 7.819 on 1845 degrees of freedom # Multiple R-squared: 0.332, Adjusted R-squared: 0.3305 # F-statistic: 229.2 on 4 and 1845 DF, p-value: < 2.2e-16 # 80% TRAIN | 30% TEST # NOT JOINED # p-value: < 2.2e-16 # Coefficients: # Estimate Std. Error t value Pr(>|t|) # (Intercept) 5.895305 0.407430 14.469 < 2e-16 *** # heartrate 0.141619 0.004890 28.962 < 2e-16 *** # bloodpressure 0.012837 0.003598 3.568 0.000367 *** # Residual standard error: 7.864 on 2111 degrees of freedom # Multiple R-squared: 0.3188, Adjusted R-squared: 0.3181 # F-statistic: 493.9 on 2 and 2111 DF, p-value: < 2.2e-16 # JOINED # p-value: < 2.2e-16 # Coefficients: # Estimate Std. Error t value Pr(>|t|) # (Intercept) 3.967024 0.960521 4.130 3.77e-05 *** # heartrate 0.142039 0.004894 29.026 < 2e-16 *** # bloodpressure 0.012514 0.003600 3.476 0.000519 *** # age 0.023831 0.012124 1.966 0.049463 * # factor(gender)M 0.496224 0.347086 1.430 0.152955 # Residual standard error: 7.858 on 2109 degrees of freedom # Multiple R-squared: 0.3206, Adjusted R-squared: 0.3193 # F-statistic: 248.8 on 4 and 2109 DF, p-value: < 2.2e-16 # 90% TRAIN | 10% TEST # NOT JOINED # p-value: < 2.2e-16 # Coefficients: # Estimate Std. Error t value Pr(>|t|) # (Intercept) 5.825879 0.378400 15.396 < 2e-16 *** # heartrate 0.143485 0.004542 31.592 < 2e-16 *** # bloodpressure 0.011735 0.003366 3.486 0.000499 *** # Residual standard error: 7.825 on 2375 degrees of freedom # Multiple R-squared: 0.3298, Adjusted R-squared: 0.3292 # F-statistic: 584.4 on 2 and 2375 DF, p-value: < 2.2e-16 # JOINED # p-value: < 2.2e-16 # Coefficients: # Estimate Std. Error t value Pr(>|t|) # (Intercept) 3.967024 0.960521 4.130 3.77e-05 *** # heartrate 0.142039 0.004894 29.026 < 2e-16 *** # bloodpressure 0.012514 0.003600 3.476 0.000519 *** # age 0.023831 0.012124 1.966 0.049463 * # factor(gender)M 0.496224 0.347086 1.430 0.152955 # Residual standard error: 7.815 on 2373 degrees of freedom # Multiple R-squared: 0.332, Adjusted R-squared: 0.3309 # F-statistic: 294.9 on 4 and 2373 DF, p-value: < 2.2e-16 # 95% TRAIN | 05% TEST # NOT JOINED # p-value: < 2.2e-16 # Coefficients: # Estimate Std. Error t value Pr(>|t|) # (Intercept) 5.830201 0.370034 15.756 < 2e-16 *** # heartrate 0.144626 0.004437 32.598 < 2e-16 *** # bloodpressure 0.011313 0.003305 3.423 0.000628 *** # Residual standard error: 7.812 on 2507 degrees of freedom # Multiple R-squared: 0.3312, Adjusted R-squared: 0.3307 # F-statistic: 620.9 on 2 and 2507 DF, p-value: < 2.2e-16 # JOINED # p-value: < 2.2e-16 # Coefficients: # Estimate Std. Error t value Pr(>|t|) # (Intercept) 3.392385 0.884775 3.834 0.000129 *** # heartrate 0.145465 0.004441 32.759 < 2e-16 *** # bloodpressure 0.010847 0.003304 3.283 0.001042 ** # age 0.031139 0.011126 2.799 0.005170 ** # factor(gender)M 0.469527 0.315705 1.487 0.137079 # Residual standard error: 7.8 on 2505 degrees of freedom # Multiple R-squared: 0.3338, Adjusted R-squared: 0.3328 # F-statistic: 313.8 on 4 and 2505 DF, p-value: < 2.2e-16 ######## SCRAP, WRONG SCORE METRIC #(1.05,.95) we see fewer differences between joined and unjoined performance # No Join # ('0.1.csv', 11, 0.1387137452711223) # ('0.3.csv', 38, 0.15973097940311057) # ('0.5.csv', 51, 0.12862547288776796) # ########################################### # Joined # ('0.1.csv', 11, 0.1387137452711223) # ('0.3.csv', 22, 0.09247583018074822) # ('0.5.csv', 50, 0.12610340479192939) # (1.03,.97) shows at least that joined performs as expected # No Join # ('0.1.csv', 7, 0.08827238335435056) # ('0.3.csv', 26, 0.10928961748633881) # ('0.5.csv', 33, 0.0832282471626734) # ########################################### # Joined # ('0.1.csv', 9, 0.11349306431273642) # ('0.3.csv', 13, 0.054644808743169404) # ('0.5.csv', 26, 0.06557377049180328) # The fact that these values don't show the gradient we expected, # may suggest overfitting as we expected poorer performance # No Join vs Join for 0.1 (fewest missing values), the joined approach # does at least as well as unjoined if not a little better # The more values that are missing, it just does worse possibly due ill-fit # in the model and random correlation between our chosen variables.
from collections.abc import Iterable from numbers import Real, Integral from warnings import warn import numpy as np import openmc.checkvalue as cv from openmc.stats import Tabular, Univariate, Discrete, Mixture from .function import Tabulated1D, INTERPOLATION_SCHEME from .angle_energy import AngleEnergy from .data import EV_PER_MEV from .endf import get_list_record, get_tab2_record class KalbachMann(AngleEnergy): """Kalbach-Mann distribution Parameters ---------- breakpoints : Iterable of int Breakpoints defining interpolation regions interpolation : Iterable of int Interpolation codes energy : Iterable of float Incoming energies at which distributions exist energy_out : Iterable of openmc.stats.Univariate Distribution of outgoing energies corresponding to each incoming energy precompound : Iterable of openmc.data.Tabulated1D Precompound factor 'r' as a function of outgoing energy for each incoming energy slope : Iterable of openmc.data.Tabulated1D Kalbach-Chadwick angular distribution slope value 'a' as a function of outgoing energy for each incoming energy Attributes ---------- breakpoints : Iterable of int Breakpoints defining interpolation regions interpolation : Iterable of int Interpolation codes energy : Iterable of float Incoming energies at which distributions exist energy_out : Iterable of openmc.stats.Univariate Distribution of outgoing energies corresponding to each incoming energy precompound : Iterable of openmc.data.Tabulated1D Precompound factor 'r' as a function of outgoing energy for each incoming energy slope : Iterable of openmc.data.Tabulated1D Kalbach-Chadwick angular distribution slope value 'a' as a function of outgoing energy for each incoming energy """ def __init__(self, breakpoints, interpolation, energy, energy_out, precompound, slope): super().__init__() self.breakpoints = breakpoints self.interpolation = interpolation self.energy = energy self.energy_out = energy_out self.precompound = precompound self.slope = slope @property def breakpoints(self): return self._breakpoints @property def interpolation(self): return self._interpolation @property def energy(self): return self._energy @property def energy_out(self): return self._energy_out @property def precompound(self): return self._precompound @property def slope(self): return self._slope @breakpoints.setter def breakpoints(self, breakpoints): cv.check_type('Kalbach-Mann breakpoints', breakpoints, Iterable, Integral) self._breakpoints = breakpoints @interpolation.setter def interpolation(self, interpolation): cv.check_type('Kalbach-Mann interpolation', interpolation, Iterable, Integral) self._interpolation = interpolation @energy.setter def energy(self, energy): cv.check_type('Kalbach-Mann incoming energy', energy, Iterable, Real) self._energy = energy @energy_out.setter def energy_out(self, energy_out): cv.check_type('Kalbach-Mann distributions', energy_out, Iterable, Univariate) self._energy_out = energy_out @precompound.setter def precompound(self, precompound): cv.check_type('Kalbach-Mann precompound factor', precompound, Iterable, Tabulated1D) self._precompound = precompound @slope.setter def slope(self, slope): cv.check_type('Kalbach-Mann slope', slope, Iterable, Tabulated1D) self._slope = slope def to_hdf5(self, group): """Write distribution to an HDF5 group Parameters ---------- group : h5py.Group HDF5 group to write to """ group.attrs['type'] = np.string_('kalbach-mann') dset = group.create_dataset('energy', data=self.energy) dset.attrs['interpolation'] = np.vstack((self.breakpoints, self.interpolation)) # Determine total number of (E,p,r,a) tuples and create array n_tuple = sum(len(d) for d in self.energy_out) distribution = np.empty((5, n_tuple)) # Create array for offsets offsets = np.empty(len(self.energy_out), dtype=int) interpolation = np.empty(len(self.energy_out), dtype=int) n_discrete_lines = np.empty(len(self.energy_out), dtype=int) j = 0 # Populate offsets and distribution array for i, (eout, km_r, km_a) in enumerate(zip( self.energy_out, self.precompound, self.slope)): n = len(eout) offsets[i] = j if isinstance(eout, Mixture): discrete, continuous = eout.distribution n_discrete_lines[i] = m = len(discrete) interpolation[i] = 1 if continuous.interpolation == 'histogram' else 2 distribution[0, j:j+m] = discrete.x distribution[1, j:j+m] = discrete.p distribution[2, j:j+m] = discrete.c distribution[0, j+m:j+n] = continuous.x distribution[1, j+m:j+n] = continuous.p distribution[2, j+m:j+n] = continuous.c else: if isinstance(eout, Tabular): n_discrete_lines[i] = 0 interpolation[i] = 1 if eout.interpolation == 'histogram' else 2 elif isinstance(eout, Discrete): n_discrete_lines[i] = n interpolation[i] = 1 distribution[0, j:j+n] = eout.x distribution[1, j:j+n] = eout.p distribution[2, j:j+n] = eout.c distribution[3, j:j+n] = km_r.y distribution[4, j:j+n] = km_a.y j += n # Create dataset for distributions dset = group.create_dataset('distribution', data=distribution) # Write interpolation as attribute dset.attrs['offsets'] = offsets dset.attrs['interpolation'] = interpolation dset.attrs['n_discrete_lines'] = n_discrete_lines @classmethod def from_hdf5(cls, group): """Generate Kalbach-Mann distribution from HDF5 data Parameters ---------- group : h5py.Group HDF5 group to read from Returns ------- openmc.data.KalbachMann Kalbach-Mann energy distribution """ interp_data = group['energy'].attrs['interpolation'] energy_breakpoints = interp_data[0, :] energy_interpolation = interp_data[1, :] energy = group['energy'][()] data = group['distribution'] offsets = data.attrs['offsets'] interpolation = data.attrs['interpolation'] n_discrete_lines = data.attrs['n_discrete_lines'] energy_out = [] precompound = [] slope = [] n_energy = len(energy) for i in range(n_energy): # Determine length of outgoing energy distribution and number of # discrete lines j = offsets[i] if i < n_energy - 1: n = offsets[i+1] - j else: n = data.shape[1] - j m = n_discrete_lines[i] # Create discrete distribution if lines are present if m > 0: eout_discrete = Discrete(data[0, j:j+m], data[1, j:j+m]) eout_discrete.c = data[2, j:j+m] p_discrete = eout_discrete.c[-1] # Create continuous distribution if m < n: interp = INTERPOLATION_SCHEME[interpolation[i]] eout_continuous = Tabular(data[0, j+m:j+n], data[1, j+m:j+n], interp) eout_continuous.c = data[2, j+m:j+n] # If both continuous and discrete are present, create a mixture # distribution if m == 0: eout_i = eout_continuous elif m == n: eout_i = eout_discrete else: eout_i = Mixture([p_discrete, 1. - p_discrete], [eout_discrete, eout_continuous]) # Precompound factor and slope are on rows 3 and 4, respectively km_r = Tabulated1D(data[0, j:j+n], data[3, j:j+n]) km_a = Tabulated1D(data[0, j:j+n], data[4, j:j+n]) energy_out.append(eout_i) precompound.append(km_r) slope.append(km_a) return cls(energy_breakpoints, energy_interpolation, energy, energy_out, precompound, slope) @classmethod def from_ace(cls, ace, idx, ldis): """Generate Kalbach-Mann energy-angle distribution from ACE data Parameters ---------- ace : openmc.data.ace.Table ACE table to read from idx : int Index in XSS array of the start of the energy distribution data (LDIS + LOCC - 1) ldis : int Index in XSS array of the start of the energy distribution block (e.g. JXS[11]) Returns ------- openmc.data.KalbachMann Kalbach-Mann energy-angle distribution """ # Read number of interpolation regions and incoming energies n_regions = int(ace.xss[idx]) n_energy_in = int(ace.xss[idx + 1 + 2*n_regions]) # Get interpolation information idx += 1 if n_regions > 0: breakpoints = ace.xss[idx:idx + n_regions].astype(int) interpolation = ace.xss[idx + n_regions:idx + 2*n_regions].astype(int) else: breakpoints = np.array([n_energy_in]) interpolation = np.array([2]) # Incoming energies at which distributions exist idx += 2*n_regions + 1 energy = ace.xss[idx:idx + n_energy_in]*EV_PER_MEV # Location of distributions idx += n_energy_in loc_dist = ace.xss[idx:idx + n_energy_in].astype(int) # Initialize variables energy_out = [] km_r = [] km_a = [] # Read each outgoing energy distribution for i in range(n_energy_in): idx = ldis + loc_dist[i] - 1 # intt = interpolation scheme (1=hist, 2=lin-lin) INTTp = int(ace.xss[idx]) intt = INTTp % 10 n_discrete_lines = (INTTp - intt)//10 if intt not in (1, 2): warn("Interpolation scheme for continuous tabular distribution " "is not histogram or linear-linear.") intt = 2 n_energy_out = int(ace.xss[idx + 1]) data = ace.xss[idx + 2:idx + 2 + 5*n_energy_out].copy() data.shape = (5, n_energy_out) data[0,:] *= EV_PER_MEV # Create continuous distribution eout_continuous = Tabular(data[0][n_discrete_lines:], data[1][n_discrete_lines:]/EV_PER_MEV, INTERPOLATION_SCHEME[intt], ignore_negative=True) eout_continuous.c = data[2][n_discrete_lines:] if np.any(data[1][n_discrete_lines:] < 0.0): warn("Kalbach-Mann energy distribution has negative " "probabilities.") # If discrete lines are present, create a mixture distribution if n_discrete_lines > 0: eout_discrete = Discrete(data[0][:n_discrete_lines], data[1][:n_discrete_lines]) eout_discrete.c = data[2][:n_discrete_lines] if n_discrete_lines == n_energy_out: eout_i = eout_discrete else: p_discrete = min(sum(eout_discrete.p), 1.0) eout_i = Mixture([p_discrete, 1. - p_discrete], [eout_discrete, eout_continuous]) else: eout_i = eout_continuous energy_out.append(eout_i) km_r.append(Tabulated1D(data[0], data[3])) km_a.append(Tabulated1D(data[0], data[4])) return cls(breakpoints, interpolation, energy, energy_out, km_r, km_a) @classmethod def from_endf(cls, file_obj): """Generate Kalbach-Mann distribution from an ENDF evaluation Parameters ---------- file_obj : file-like object ENDF file positioned at the start of the Kalbach-Mann distribution Returns ------- openmc.data.KalbachMann Kalbach-Mann energy-angle distribution """ params, tab2 = get_tab2_record(file_obj) lep = params[3] ne = params[5] energy = np.zeros(ne) n_discrete_energies = np.zeros(ne, dtype=int) energy_out = [] precompound = [] slope = [] for i in range(ne): items, values = get_list_record(file_obj) energy[i] = items[1] n_discrete_energies[i] = items[2] # TODO: split out discrete energies n_angle = items[3] n_energy_out = items[5] values = np.asarray(values) values.shape = (n_energy_out, n_angle + 2) # Outgoing energy distribution at the i-th incoming energy eout_i = values[:,0] eout_p_i = values[:,1] energy_out_i = Tabular(eout_i, eout_p_i, INTERPOLATION_SCHEME[lep]) energy_out.append(energy_out_i) # Precompound and slope factors for Kalbach-Mann r_i = values[:,2] if n_angle == 2: a_i = values[:,3] else: a_i = np.zeros_like(r_i) precompound.append(Tabulated1D(eout_i, r_i)) slope.append(Tabulated1D(eout_i, a_i)) return cls(tab2.breakpoints, tab2.interpolation, energy, energy_out, precompound, slope)
"""Provide a registry to track entity IDs. The Entity Registry keeps a registry of entities. Entities are uniquely identified by their domain, platform and a unique id provided by that platform. The Entity Registry will persist itself 10 seconds after a new entity is registered. Registering a new entity while a timer is in progress resets the timer. """ from __future__ import annotations from collections import OrderedDict import logging from typing import TYPE_CHECKING, Any, Callable, Iterable, cast import attr from homeassistant.const import ( ATTR_DEVICE_CLASS, ATTR_FRIENDLY_NAME, ATTR_ICON, ATTR_RESTORED, ATTR_SUPPORTED_FEATURES, ATTR_UNIT_OF_MEASUREMENT, EVENT_HOMEASSISTANT_START, STATE_UNAVAILABLE, ) from homeassistant.core import ( Event, HomeAssistant, callback, split_entity_id, valid_entity_id, ) from homeassistant.helpers import device_registry as dr from homeassistant.helpers.device_registry import EVENT_DEVICE_REGISTRY_UPDATED from homeassistant.loader import bind_hass from homeassistant.util import slugify from homeassistant.util.yaml import load_yaml from .typing import UNDEFINED, UndefinedType if TYPE_CHECKING: from homeassistant.config_entries import ConfigEntry PATH_REGISTRY = "entity_registry.yaml" DATA_REGISTRY = "entity_registry" EVENT_ENTITY_REGISTRY_UPDATED = "entity_registry_updated" SAVE_DELAY = 10 _LOGGER = logging.getLogger(__name__) DISABLED_CONFIG_ENTRY = "config_entry" DISABLED_DEVICE = "device" DISABLED_HASS = "hass" DISABLED_INTEGRATION = "integration" DISABLED_USER = "user" STORAGE_VERSION = 1 STORAGE_KEY = "core.entity_registry" # Attributes relevant to describing entity # to external services. ENTITY_DESCRIBING_ATTRIBUTES = { "entity_id", "name", "original_name", "capabilities", "supported_features", "device_class", "unit_of_measurement", } @attr.s(slots=True, frozen=True) class RegistryEntry: """Entity Registry Entry.""" entity_id: str = attr.ib() unique_id: str = attr.ib() platform: str = attr.ib() name: str | None = attr.ib(default=None) icon: str | None = attr.ib(default=None) device_id: str | None = attr.ib(default=None) area_id: str | None = attr.ib(default=None) config_entry_id: str | None = attr.ib(default=None) disabled_by: str | None = attr.ib( default=None, validator=attr.validators.in_( ( DISABLED_CONFIG_ENTRY, DISABLED_DEVICE, DISABLED_HASS, DISABLED_INTEGRATION, DISABLED_USER, None, ) ), ) capabilities: dict[str, Any] | None = attr.ib(default=None) supported_features: int = attr.ib(default=0) device_class: str | None = attr.ib(default=None) unit_of_measurement: str | None = attr.ib(default=None) # As set by integration original_name: str | None = attr.ib(default=None) original_icon: str | None = attr.ib(default=None) domain: str = attr.ib(init=False, repr=False) @domain.default def _domain_default(self) -> str: """Compute domain value.""" return split_entity_id(self.entity_id)[0] @property def disabled(self) -> bool: """Return if entry is disabled.""" return self.disabled_by is not None @callback def write_unavailable_state(self, hass: HomeAssistant) -> None: """Write the unavailable state to the state machine.""" attrs: dict[str, Any] = {ATTR_RESTORED: True} if self.capabilities is not None: attrs.update(self.capabilities) if self.supported_features is not None: attrs[ATTR_SUPPORTED_FEATURES] = self.supported_features if self.device_class is not None: attrs[ATTR_DEVICE_CLASS] = self.device_class if self.unit_of_measurement is not None: attrs[ATTR_UNIT_OF_MEASUREMENT] = self.unit_of_measurement name = self.name or self.original_name if name is not None: attrs[ATTR_FRIENDLY_NAME] = name icon = self.icon or self.original_icon if icon is not None: attrs[ATTR_ICON] = icon hass.states.async_set(self.entity_id, STATE_UNAVAILABLE, attrs) class EntityRegistry: """Class to hold a registry of entities.""" def __init__(self, hass: HomeAssistant): """Initialize the registry.""" self.hass = hass self.entities: dict[str, RegistryEntry] self._index: dict[tuple[str, str, str], str] = {} self._store = hass.helpers.storage.Store(STORAGE_VERSION, STORAGE_KEY) self.hass.bus.async_listen( EVENT_DEVICE_REGISTRY_UPDATED, self.async_device_modified ) @callback def async_get_device_class_lookup(self, domain_device_classes: set) -> dict: """Return a lookup for the device class by domain.""" lookup: dict[str, dict[tuple[Any, Any], str]] = {} for entity in self.entities.values(): if not entity.device_id: continue domain_device_class = (entity.domain, entity.device_class) if domain_device_class not in domain_device_classes: continue if entity.device_id not in lookup: lookup[entity.device_id] = {domain_device_class: entity.entity_id} else: lookup[entity.device_id][domain_device_class] = entity.entity_id return lookup @callback def async_is_registered(self, entity_id: str) -> bool: """Check if an entity_id is currently registered.""" return entity_id in self.entities @callback def async_get(self, entity_id: str) -> RegistryEntry | None: """Get EntityEntry for an entity_id.""" return self.entities.get(entity_id) @callback def async_get_entity_id( self, domain: str, platform: str, unique_id: str ) -> str | None: """Check if an entity_id is currently registered.""" return self._index.get((domain, platform, unique_id)) @callback def async_generate_entity_id( self, domain: str, suggested_object_id: str, known_object_ids: Iterable[str] | None = None, ) -> str: """Generate an entity ID that does not conflict. Conflicts checked against registered and currently existing entities. """ preferred_string = f"{domain}.{slugify(suggested_object_id)}" test_string = preferred_string if not known_object_ids: known_object_ids = {} tries = 1 while ( test_string in self.entities or test_string in known_object_ids or not self.hass.states.async_available(test_string) ): tries += 1 test_string = f"{preferred_string}_{tries}" return test_string @callback def async_get_or_create( self, domain: str, platform: str, unique_id: str, *, # To influence entity ID generation suggested_object_id: str | None = None, known_object_ids: Iterable[str] | None = None, # To disable an entity if it gets created disabled_by: str | None = None, # Data that we want entry to have config_entry: ConfigEntry | None = None, device_id: str | None = None, area_id: str | None = None, capabilities: dict[str, Any] | None = None, supported_features: int | None = None, device_class: str | None = None, unit_of_measurement: str | None = None, original_name: str | None = None, original_icon: str | None = None, ) -> RegistryEntry: """Get entity. Create if it doesn't exist.""" config_entry_id = None if config_entry: config_entry_id = config_entry.entry_id entity_id = self.async_get_entity_id(domain, platform, unique_id) if entity_id: return self._async_update_entity( entity_id, config_entry_id=config_entry_id or UNDEFINED, device_id=device_id or UNDEFINED, area_id=area_id or UNDEFINED, capabilities=capabilities or UNDEFINED, supported_features=supported_features or UNDEFINED, device_class=device_class or UNDEFINED, unit_of_measurement=unit_of_measurement or UNDEFINED, original_name=original_name or UNDEFINED, original_icon=original_icon or UNDEFINED, # When we changed our slugify algorithm, we invalidated some # stored entity IDs with either a __ or ending in _. # Fix introduced in 0.86 (Jan 23, 2019). Next line can be # removed when we release 1.0 or in 2020. new_entity_id=".".join( slugify(part) for part in entity_id.split(".", 1) ), ) entity_id = self.async_generate_entity_id( domain, suggested_object_id or f"{platform}_{unique_id}", known_object_ids ) if ( disabled_by is None and config_entry and config_entry.system_options.disable_new_entities ): disabled_by = DISABLED_INTEGRATION entity = RegistryEntry( entity_id=entity_id, config_entry_id=config_entry_id, device_id=device_id, area_id=area_id, unique_id=unique_id, platform=platform, disabled_by=disabled_by, capabilities=capabilities, supported_features=supported_features or 0, device_class=device_class, unit_of_measurement=unit_of_measurement, original_name=original_name, original_icon=original_icon, ) self._register_entry(entity) _LOGGER.info("Registered new %s.%s entity: %s", domain, platform, entity_id) self.async_schedule_save() self.hass.bus.async_fire( EVENT_ENTITY_REGISTRY_UPDATED, {"action": "create", "entity_id": entity_id} ) return entity @callback def async_remove(self, entity_id: str) -> None: """Remove an entity from registry.""" self._unregister_entry(self.entities[entity_id]) self.hass.bus.async_fire( EVENT_ENTITY_REGISTRY_UPDATED, {"action": "remove", "entity_id": entity_id} ) self.async_schedule_save() @callback def async_device_modified(self, event: Event) -> None: """Handle the removal or update of a device. Remove entities from the registry that are associated to a device when the device is removed. Disable entities in the registry that are associated to a device when the device is disabled. """ if event.data["action"] == "remove": entities = async_entries_for_device( self, event.data["device_id"], include_disabled_entities=True ) for entity in entities: self.async_remove(entity.entity_id) return if event.data["action"] != "update": return device_registry = dr.async_get(self.hass) device = device_registry.async_get(event.data["device_id"]) # The device may be deleted already if the event handling is late if not device or not device.disabled: entities = async_entries_for_device( self, event.data["device_id"], include_disabled_entities=True ) for entity in entities: if entity.disabled_by != DISABLED_DEVICE: continue self.async_update_entity(entity.entity_id, disabled_by=None) return if device.disabled_by == dr.DISABLED_CONFIG_ENTRY: # Handled by async_config_entry_disabled return # Fetch entities which are not already disabled entities = async_entries_for_device(self, event.data["device_id"]) for entity in entities: self.async_update_entity(entity.entity_id, disabled_by=DISABLED_DEVICE) @callback def async_update_entity( self, entity_id: str, *, name: str | None | UndefinedType = UNDEFINED, icon: str | None | UndefinedType = UNDEFINED, area_id: str | None | UndefinedType = UNDEFINED, new_entity_id: str | UndefinedType = UNDEFINED, new_unique_id: str | UndefinedType = UNDEFINED, disabled_by: str | None | UndefinedType = UNDEFINED, ) -> RegistryEntry: """Update properties of an entity.""" return self._async_update_entity( entity_id, name=name, icon=icon, area_id=area_id, new_entity_id=new_entity_id, new_unique_id=new_unique_id, disabled_by=disabled_by, ) @callback def _async_update_entity( self, entity_id: str, *, name: str | None | UndefinedType = UNDEFINED, icon: str | None | UndefinedType = UNDEFINED, config_entry_id: str | None | UndefinedType = UNDEFINED, new_entity_id: str | UndefinedType = UNDEFINED, device_id: str | None | UndefinedType = UNDEFINED, area_id: str | None | UndefinedType = UNDEFINED, new_unique_id: str | UndefinedType = UNDEFINED, disabled_by: str | None | UndefinedType = UNDEFINED, capabilities: dict[str, Any] | None | UndefinedType = UNDEFINED, supported_features: int | UndefinedType = UNDEFINED, device_class: str | None | UndefinedType = UNDEFINED, unit_of_measurement: str | None | UndefinedType = UNDEFINED, original_name: str | None | UndefinedType = UNDEFINED, original_icon: str | None | UndefinedType = UNDEFINED, ) -> RegistryEntry: """Private facing update properties method.""" old = self.entities[entity_id] new_values = {} # Dict with new key/value pairs old_values = {} # Dict with old key/value pairs for attr_name, value in ( ("name", name), ("icon", icon), ("config_entry_id", config_entry_id), ("device_id", device_id), ("area_id", area_id), ("disabled_by", disabled_by), ("capabilities", capabilities), ("supported_features", supported_features), ("device_class", device_class), ("unit_of_measurement", unit_of_measurement), ("original_name", original_name), ("original_icon", original_icon), ): if value is not UNDEFINED and value != getattr(old, attr_name): new_values[attr_name] = value old_values[attr_name] = getattr(old, attr_name) if new_entity_id is not UNDEFINED and new_entity_id != old.entity_id: if self.async_is_registered(new_entity_id): raise ValueError("Entity with this ID is already registered") if not valid_entity_id(new_entity_id): raise ValueError("Invalid entity ID") if split_entity_id(new_entity_id)[0] != split_entity_id(entity_id)[0]: raise ValueError("New entity ID should be same domain") self.entities.pop(entity_id) entity_id = new_values["entity_id"] = new_entity_id old_values["entity_id"] = old.entity_id if new_unique_id is not UNDEFINED: conflict_entity_id = self.async_get_entity_id( old.domain, old.platform, new_unique_id ) if conflict_entity_id: raise ValueError( f"Unique id '{new_unique_id}' is already in use by " f"'{conflict_entity_id}'" ) new_values["unique_id"] = new_unique_id old_values["unique_id"] = old.unique_id if not new_values: return old self._remove_index(old) new = attr.evolve(old, **new_values) self._register_entry(new) self.async_schedule_save() data = {"action": "update", "entity_id": entity_id, "changes": old_values} if old.entity_id != entity_id: data["old_entity_id"] = old.entity_id self.hass.bus.async_fire(EVENT_ENTITY_REGISTRY_UPDATED, data) return new async def async_load(self) -> None: """Load the entity registry.""" async_setup_entity_restore(self.hass, self) data = await self.hass.helpers.storage.async_migrator( self.hass.config.path(PATH_REGISTRY), self._store, old_conf_load_func=load_yaml, old_conf_migrate_func=_async_migrate, ) entities: dict[str, RegistryEntry] = OrderedDict() if data is not None: for entity in data["entities"]: # Some old installations can have some bad entities. # Filter them out as they cause errors down the line. # Can be removed in Jan 2021 if not valid_entity_id(entity["entity_id"]): continue entities[entity["entity_id"]] = RegistryEntry( entity_id=entity["entity_id"], config_entry_id=entity.get("config_entry_id"), device_id=entity.get("device_id"), area_id=entity.get("area_id"), unique_id=entity["unique_id"], platform=entity["platform"], name=entity.get("name"), icon=entity.get("icon"), disabled_by=entity.get("disabled_by"), capabilities=entity.get("capabilities") or {}, supported_features=entity.get("supported_features", 0), device_class=entity.get("device_class"), unit_of_measurement=entity.get("unit_of_measurement"), original_name=entity.get("original_name"), original_icon=entity.get("original_icon"), ) self.entities = entities self._rebuild_index() @callback def async_schedule_save(self) -> None: """Schedule saving the entity registry.""" self._store.async_delay_save(self._data_to_save, SAVE_DELAY) @callback def _data_to_save(self) -> dict[str, Any]: """Return data of entity registry to store in a file.""" data = {} data["entities"] = [ { "entity_id": entry.entity_id, "config_entry_id": entry.config_entry_id, "device_id": entry.device_id, "area_id": entry.area_id, "unique_id": entry.unique_id, "platform": entry.platform, "name": entry.name, "icon": entry.icon, "disabled_by": entry.disabled_by, "capabilities": entry.capabilities, "supported_features": entry.supported_features, "device_class": entry.device_class, "unit_of_measurement": entry.unit_of_measurement, "original_name": entry.original_name, "original_icon": entry.original_icon, } for entry in self.entities.values() ] return data @callback def async_clear_config_entry(self, config_entry: str) -> None: """Clear config entry from registry entries.""" for entity_id in [ entity_id for entity_id, entry in self.entities.items() if config_entry == entry.config_entry_id ]: self.async_remove(entity_id) @callback def async_clear_area_id(self, area_id: str) -> None: """Clear area id from registry entries.""" for entity_id, entry in self.entities.items(): if area_id == entry.area_id: self._async_update_entity(entity_id, area_id=None) def _register_entry(self, entry: RegistryEntry) -> None: self.entities[entry.entity_id] = entry self._add_index(entry) def _add_index(self, entry: RegistryEntry) -> None: self._index[(entry.domain, entry.platform, entry.unique_id)] = entry.entity_id def _unregister_entry(self, entry: RegistryEntry) -> None: self._remove_index(entry) del self.entities[entry.entity_id] def _remove_index(self, entry: RegistryEntry) -> None: del self._index[(entry.domain, entry.platform, entry.unique_id)] def _rebuild_index(self) -> None: self._index = {} for entry in self.entities.values(): self._add_index(entry) @callback def async_get(hass: HomeAssistant) -> EntityRegistry: """Get entity registry.""" return cast(EntityRegistry, hass.data[DATA_REGISTRY]) async def async_load(hass: HomeAssistant) -> None: """Load entity registry.""" assert DATA_REGISTRY not in hass.data hass.data[DATA_REGISTRY] = EntityRegistry(hass) await hass.data[DATA_REGISTRY].async_load() @bind_hass async def async_get_registry(hass: HomeAssistant) -> EntityRegistry: """Get entity registry. This is deprecated and will be removed in the future. Use async_get instead. """ return async_get(hass) @callback def async_entries_for_device( registry: EntityRegistry, device_id: str, include_disabled_entities: bool = False ) -> list[RegistryEntry]: """Return entries that match a device.""" return [ entry for entry in registry.entities.values() if entry.device_id == device_id and (not entry.disabled_by or include_disabled_entities) ] @callback def async_entries_for_area( registry: EntityRegistry, area_id: str ) -> list[RegistryEntry]: """Return entries that match an area.""" return [entry for entry in registry.entities.values() if entry.area_id == area_id] @callback def async_entries_for_config_entry( registry: EntityRegistry, config_entry_id: str ) -> list[RegistryEntry]: """Return entries that match a config entry.""" return [ entry for entry in registry.entities.values() if entry.config_entry_id == config_entry_id ] @callback def async_config_entry_disabled_by_changed( registry: EntityRegistry, config_entry: ConfigEntry ) -> None: """Handle a config entry being disabled or enabled. Disable entities in the registry that are associated with a config entry when the config entry is disabled, enable entities in the registry that are associated with a config entry when the config entry is enabled and the entities are marked DISABLED_CONFIG_ENTRY. """ entities = async_entries_for_config_entry(registry, config_entry.entry_id) if not config_entry.disabled_by: for entity in entities: if entity.disabled_by != DISABLED_CONFIG_ENTRY: continue registry.async_update_entity(entity.entity_id, disabled_by=None) return for entity in entities: if entity.disabled: # Entity already disabled, do not overwrite continue registry.async_update_entity( entity.entity_id, disabled_by=DISABLED_CONFIG_ENTRY ) async def _async_migrate(entities: dict[str, Any]) -> dict[str, list[dict[str, Any]]]: """Migrate the YAML config file to storage helper format.""" return { "entities": [ {"entity_id": entity_id, **info} for entity_id, info in entities.items() ] } @callback def async_setup_entity_restore(hass: HomeAssistant, registry: EntityRegistry) -> None: """Set up the entity restore mechanism.""" @callback def cleanup_restored_states_filter(event: Event) -> bool: """Clean up restored states filter.""" return bool(event.data["action"] == "remove") @callback def cleanup_restored_states(event: Event) -> None: """Clean up restored states.""" state = hass.states.get(event.data["entity_id"]) if state is None or not state.attributes.get(ATTR_RESTORED): return hass.states.async_remove(event.data["entity_id"], context=event.context) hass.bus.async_listen( EVENT_ENTITY_REGISTRY_UPDATED, cleanup_restored_states, event_filter=cleanup_restored_states_filter, ) if hass.is_running: return @callback def _write_unavailable_states(_: Event) -> None: """Make sure state machine contains entry for each registered entity.""" existing = set(hass.states.async_entity_ids()) for entry in registry.entities.values(): if entry.entity_id in existing or entry.disabled: continue entry.write_unavailable_state(hass) hass.bus.async_listen(EVENT_HOMEASSISTANT_START, _write_unavailable_states) async def async_migrate_entries( hass: HomeAssistant, config_entry_id: str, entry_callback: Callable[[RegistryEntry], dict | None], ) -> None: """Migrator of unique IDs.""" ent_reg = await async_get_registry(hass) for entry in ent_reg.entities.values(): if entry.config_entry_id != config_entry_id: continue updates = entry_callback(entry) if updates is not None: ent_reg.async_update_entity(entry.entity_id, **updates)
# Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. # pylint: disable=invalid-name, unused-argument """Extract parameters from the DMA operators in TIR.""" import tvm from .utils import get_outer_loops, get_base_address, get_strides, get_op_attrs from .spec import SerialFeatureMap, SerialPadding def get_pad_params(stmt): """Get the padding parameters from a pad loop nest. Parameters ---------- stmt : tvm.tir.AttrStmt The outermost attribute statement of a pad loop nest. Returns ------- pad : SerialPadding The serializable padding. input_pointer : tvm.tir.Var The pointer consumed by the operation. output_pointer : tvm.tir.Var The pointer produced by the operation. """ _, body = get_op_attrs(stmt) n, h, w, c, _, inner = get_outer_loops(body, "NHWC") output_pointer = inner.buffer_var pad = SerialPadding(top=0, left=0, bottom=0, right=0) if isinstance(inner.value, tvm.tir.Call): input_pointer = inner.value.args[1].buffer_var else: input_pointer = inner.value.buffer_var return pad, input_pointer, output_pointer padded_shape = [n.extent, h.extent, w.extent, c.extent] def _visit(expr): if isinstance(expr, tvm.tir.expr.LT): var = expr.a val = expr.b if var == h.loop_var: pad.bottom = padded_shape[1] - val else: pad.right = padded_shape[2] - val elif isinstance(expr, tvm.tir.expr.LE): var = expr.b val = expr.a if var == h.loop_var: pad.top = val else: pad.left = val cond = inner.value.args[0] tvm.tir.stmt_functor.post_order_visit(cond, _visit) return ( pad, input_pointer, output_pointer, ) def get_convert_to_nhwc_params(stmt): """Get the true number of channels from a convert_to_nhwc loop nest. Parameters ---------- stmt : tvm.tir.AttrStmt The outermost attribute statement of a convert_to_nhwc loop nest. Returns ------- int The true number of channels. input_pointer : tvm.tir.Var The pointer consumed by the operation. output_pointer : tvm.tir.Var The pointer produced by the operation. """ attrs, body = get_op_attrs(stmt) _, _, _, c, _, inner = get_outer_loops(body, "NHWC") # Ignore the reduce sum operation inserted to ensure # compute that is deemed uneccesary isn't removed by TVM. if attrs["layout"] == "NHCWB16": inner = inner.body input_pointer = inner.value.b.buffer_var else: input_pointer = inner.value.buffer_var output_pointer = inner.buffer_var return c.extent, input_pointer, output_pointer def get_convert_to_nhcwb16_params(stmt): """Get the true number of channels from a convert_to_nhcwb16 loop nest. Parameters ---------- stmt : tvm.tir.AttrStmt The outermost attribute statement of a convert_to_nhcwb16 loop nest. Returns ------- out_channels : int The true number of channels. input_pointer : tvm.tir.Var The pointer consumed by the operation. output_pointer : tvm.tir.Var The pointer produced by the operation. """ attrs, body = get_op_attrs(stmt) _, _, _, c, b, inner = get_outer_loops(body, attrs["layout"]) output_pointer = inner.buffer_var if isinstance(inner.value, tvm.tir.Call): cond = inner.value.args[0] out_channels = cond.b.value input_pointer = inner.value.args[1].buffer_var else: input_pointer = inner.value.buffer_var out_channels = c.extent * b.extent if attrs["layout"] == "NHCWB16" else c.extent return out_channels, input_pointer, output_pointer def get_read_params(stmt): """Get the feature map parameters from a read loop nest. Parameters ---------- stmt : tvm.tir.AttrStmt The outermost attribute statement of a read loop nest. Returns ------- SerialFeatureMap The serializable feature map. input_pointer : tvm.tir.Var The pointer consumed by the operation. output_pointer : tvm.tir.Var The pointer produced by the operation. """ attrs, body = get_op_attrs(stmt) _, h, w, c, _, inner = get_outer_loops(body, attrs["layout"]) input_pointer = inner.value.buffer_var output_pointer = inner.buffer_var stride_vars = [h.loop_var, w.loop_var, c.loop_var] strides = get_strides(inner.value.index, stride_vars) base_address = get_base_address(inner.value.index) data_type = inner.buffer_var.type_annotation.element_type.dtype return ( SerialFeatureMap( data_type=data_type, height=h.extent, width=w.extent, channels=c.extent, tile_height_0=h.extent, tile_height_1=0, tile_width_0=w.extent, tile_address_0=tvm.tir.Load(data_type, inner.value.buffer_var, base_address), tile_address_1=0, tile_address_2=0, tile_address_3=0, scale=attrs["scale"], zero_point=attrs["zero_point"], layout=attrs["layout"], stride_h=strides[0], stride_w=strides[1], stride_c=strides[2], ), input_pointer, output_pointer, ) def get_write_params(stmt): """Get the feature map parameters from a write loop nest. Parameters ---------- stmt : tvm.tir.AttrStmt The outermost attribute statement of a write loop nest. Returns ------- SerialFeatureMap The serializable feature map. input_pointer : tvm.tir.Var The pointer consumed by the operation. output_pointer : tvm.tir.Var The pointer produced by the operation. """ attrs, body = get_op_attrs(stmt) _, h, w, c, _, inner = get_outer_loops(body, attrs["layout"]) input_pointer = inner.value.buffer_var output_pointer = inner.buffer_var stride_vars = [h.loop_var, w.loop_var, c.loop_var] strides = get_strides(inner.index, stride_vars) base_address = get_base_address(inner.index) data_type = inner.buffer_var.type_annotation.element_type.dtype return ( SerialFeatureMap( data_type=data_type, height=h.extent, width=w.extent, channels=c.extent, tile_height_0=h.extent, tile_height_1=0, tile_width_0=w.extent, tile_address_0=tvm.tir.Load(data_type, inner.buffer_var, base_address), tile_address_1=0, tile_address_2=0, tile_address_3=0, scale=attrs["scale"], zero_point=attrs["zero_point"], layout=attrs["layout"], stride_h=strides[0], stride_w=strides[1], stride_c=strides[2], ), input_pointer, output_pointer, ) def get_ifm_params(pointer, producers): """Get the parameters associated with the DMA capabilities for an IFM. Parameters ---------- pointer : tvm.tir.Var The pointer that the IFM DMA pipeline produces. producers : dict of tvm.tir.Var to tvm.tir.AttrStmt A dictionary to associate pointers with the loop nest that produces their values. Returns ------- serial_ifm : SerialFeatureMap The serializable IFM. serial_padding : SerialPadding The serializable padding. """ pad = producers[pointer] serial_padding, input_pointer, _ = get_pad_params(pad) convert_to_nhwc = producers[input_pointer] in_channels, input_pointer, _ = get_convert_to_nhwc_params(convert_to_nhwc) read = producers[input_pointer] serial_ifm, _, _ = get_read_params(read) serial_ifm.channels = in_channels return serial_ifm, serial_padding def get_ofm_params(pointer, consumers, producers): """Get the parameters associated with the DMA capabilities for an OFM. Parameters ---------- pointer : tvm.tir.Var The pointer that the OFM DMA pipeline consumes. consumers : dict of tvm.tir.Var to tvm.tir.AttrStmt A dictionary to associate pointers with the loop nest that consumes their values. producers : dict of tvm.tir.Var to tvm.tir.AttrStmt A dictionary to associate pointers with the loop nest that produces their values. Returns ------- serial_ifm : SerialFeatureMap The serializable OFM. output_pointer : tvm.tir.Var The pointer that the OFM DMA pipeline produces. is_allocator : bool Whether this operator allocates its output. """ convert_to_nhcwb16 = consumers[pointer] out_channels, _, output_pointer = get_convert_to_nhcwb16_params(convert_to_nhcwb16) write = consumers[output_pointer] serial_ofm, _, output_pointer = get_write_params(write) is_allocator = True if output_pointer not in producers: is_allocator = False elif producers[output_pointer] != write: is_allocator = False serial_ofm.channels = out_channels return serial_ofm, output_pointer, is_allocator
from __future__ import with_statement import sys import os import subprocess from contextlib import contextmanager from cStringIO import StringIO from virtstrap.log import logger as main_logger # The following function is taken from werkzeug.utils def import_string(import_name, silent=False): """Imports an object based on a string. This is useful if you want to use import paths as endpoints or something similar. An import path can be specified either in dotted notation (``xml.sax.saxutils.escape``) or with a colon as object delimiter (``xml.sax.saxutils:escape``). If `silent` is True the return value will be `None` if the import fails. For better debugging we recommend the new :func:`import_module` function to be used instead. :param import_name: the dotted name for the object to import. :param silent: if set to `True` import errors are ignored and `None` is returned instead. :return: imported object """ # force the import name to automatically convert to strings if isinstance(import_name, unicode): import_name = str(import_name) try: if ':' in import_name: module, obj = import_name.split(':', 1) elif '.' in import_name: module, obj = import_name.rsplit('.', 1) else: return __import__(import_name) # __import__ is not able to handle unicode strings in the fromlist # if the module is a package if isinstance(obj, unicode): obj = obj.encode('utf-8') try: return getattr(__import__(module, None, None, [obj]), obj) except (ImportError, AttributeError): # support importing modules not yet set up by the parent module # (or package for that matter) modname = module + '.' + obj __import__(modname) return sys.modules[modname] except ImportError, e: if not silent: raise ImportStringError(import_name, e), None, sys.exc_info()[2] # The following class is taken from werkzeug.utils class ImportStringError(ImportError): """Provides information about a failed :func:`import_string` attempt.""" #: String in dotted notation that failed to be imported. import_name = None #: Wrapped exception. exception = None def __init__(self, import_name, exception): self.import_name = import_name self.exception = exception msg = ( 'import_string() failed for %r. Possible reasons are:\n\n' '- missing __init__.py in a package;\n' '- package or module path not included in sys.path;\n' '- duplicated package or module name taking precedence in ' 'sys.path;\n' '- missing module, class, function or variable;\n\n' 'Debugged import:\n\n%s\n\n' 'Original exception:\n\n%s: %s') name = '' tracked = [] for part in import_name.replace(':', '.').split('.'): name += (name and '.') + part imported = import_string(name, silent=True) if imported: tracked.append((name, getattr(imported, '__file__', None))) else: track = ['- %r found in %r.' % (n, i) for n, i in tracked] track.append('- %r not found.' % name) msg = msg % (import_name, '\n'.join(track), exception.__class__.__name__, str(exception)) break ImportError.__init__(self, msg) def __repr__(self): return '<%s(%r, %r)>' % (self.__class__.__name__, self.import_name, self.exception) # The following function is modified from virtualenv def call_subprocess(cmd, show_stdout=True, filter_stdout=None, cwd=None, raise_on_returncode=True, extra_env=None, remove_from_env=None, logger=None, python_unbuffered=False, collect_stdout=False): collected_stdout = None stdout_receiver = None if collect_stdout: stdout_receiver = StringIO() show_stdout = False logger = logger or main_logger cmd_parts = [] for part in cmd: if len(part) > 45: part = part[:20]+"..."+part[-20:] if ' ' in part or '\n' in part or '"' in part or "'" in part: part = '"%s"' % part.replace('"', '\\"') if hasattr(part, 'decode'): try: part = part.decode(sys.getdefaultencoding()) except UnicodeDecodeError: part = part.decode(sys.getfilesystemencoding()) cmd_parts.append(part) cmd_desc = ' '.join(cmd_parts) if show_stdout: stdout = None else: stdout = subprocess.PIPE logger.debug("Running command %s" % cmd_desc) if extra_env or remove_from_env or python_unbuffered: env = os.environ.copy() if extra_env: env.update(extra_env) if remove_from_env: for varname in remove_from_env: env.pop(varname, None) if python_unbuffered: # Set this if you'd like to process each line of code # from the process immediately. This only works with # software that is python. env['PYTHONUNBUFFERED'] = 'unbuffered' else: env = None try: proc = subprocess.Popen( cmd, stderr=subprocess.STDOUT, stdin=None, stdout=stdout, cwd=cwd, env=env) except Exception: e = sys.exc_info()[1] logger.critical( "Error %s while executing command %s" % (e, cmd_desc)) raise all_output = [] if stdout is not None: stdout = proc.stdout encoding = sys.getdefaultencoding() fs_encoding = sys.getfilesystemencoding() while 1: line = stdout.readline() try: line = line.decode(encoding) except UnicodeDecodeError: line = line.decode(fs_encoding) if not line: break line = line.rstrip() all_output.append(line) if filter_stdout: level = filter_stdout(line) if isinstance(level, tuple): level, line = level logger.log(level, line) # FIXME This is virtualenv specific. We need to get rid # of it if not logger.stdout_level_matches(level): logger.show_progress() else: if stdout_receiver: #Expects a file like object #for stdout_receiver stdout_receiver.write('%s\n' % line) logger.debug(line) else: proc.communicate() proc.wait() if proc.returncode: if raise_on_returncode: if all_output: logger.debug('Complete output from command %s:' % cmd_desc) logger.debug('\n'.join(all_output) + '\n----------------------------------------') raise OSError( "Command %s failed with error code %s" % (cmd_desc, proc.returncode)) else: logger.warn( "Command %s had error code %s" % (cmd_desc, proc.returncode)) if stdout_receiver: stdout_receiver.seek(0) collected_stdout = stdout_receiver.read() return collected_stdout class ChangedWorkingDirectory(object): def __init__(self, directory): self._directory = directory self._original_directory = os.getcwd() def __enter__(self): # Change the directory to the new cwd directory = self._directory # Change to the new directory os.chdir(directory) # Return the directory return directory def __exit__(self, ex_type, ex_value, traceback): # Return back to normal os.chdir(self._original_directory) @contextmanager def in_directory(directory): """Context manager for changing CWD to a directory Don't use this if you plan on writing files to the directory. This does not delete anything. It is purely to change the CWD """ with ChangedWorkingDirectory(directory) as directory: yield directory
#!/usr/bin/env python # Copyright 2011 Google Inc. All Rights Reserved. """Tests for the stats classes.""" import time from grr.lib import flags from grr.lib import rdfvalue from grr.lib import stats from grr.lib import test_lib class StatsTests(test_lib.GRRBaseTest): """Stats collection tests.""" def Sleep(self, n): self.mock_time += n def setUp(self): super(StatsTests, self).setUp() self.mock_time = 100.0 self.time_orig = time.time time.time = lambda: self.mock_time def tearDown(self): time.time = self.time_orig def testSimpleCounter(self): stats.STATS.RegisterCounterMetric("test_counter") self.assertEqual(0, stats.STATS.GetMetricValue("test_counter")) for _ in range(5): stats.STATS.IncrementCounter("test_counter") self.assertEqual(5, stats.STATS.GetMetricValue("test_counter")) stats.STATS.IncrementCounter("test_counter", 2) self.assertEqual(7, stats.STATS.GetMetricValue("test_counter")) def testDecrementingCounterRaises(self): stats.STATS.RegisterCounterMetric("test_counter") self.assertRaises(ValueError, stats.STATS.IncrementCounter, "test_counter", -1) def testCounterWithFields(self): stats.STATS.RegisterCounterMetric("test_counter", [("dimension", str)]) # Test that default values for any fields values are 0." self.assertEqual(0, stats.STATS.GetMetricValue("test_counter", fields=["a"])) self.assertEqual(0, stats.STATS.GetMetricValue("test_counter", fields=["b"])) for _ in range(5): stats.STATS.IncrementCounter("test_counter", fields=["dimension_value_1"]) self.assertEqual(5, stats.STATS.GetMetricValue( "test_counter", fields=["dimension_value_1"])) stats.STATS.IncrementCounter("test_counter", 2, fields=["dimension_value_1"]) self.assertEqual(7, stats.STATS.GetMetricValue( "test_counter", fields=["dimension_value_1"])) stats.STATS.IncrementCounter("test_counter", 2, fields=["dimension_value_2"]) self.assertEqual(2, stats.STATS.GetMetricValue( "test_counter", fields=["dimension_value_2"])) # Check that previously set values with other fields are not affected. self.assertEqual(7, stats.STATS.GetMetricValue( "test_counter", fields=["dimension_value_1"])) def testSimpleGauge(self): stats.STATS.RegisterGaugeMetric("test_int_gauge", int) stats.STATS.RegisterGaugeMetric("test_string_gauge", str) self.assertEqual(0, stats.STATS.GetMetricValue("test_int_gauge")) self.assertEqual("", stats.STATS.GetMetricValue("test_string_gauge")) stats.STATS.SetGaugeValue("test_int_gauge", 42) stats.STATS.SetGaugeValue("test_string_gauge", "some") self.assertEqual(42, stats.STATS.GetMetricValue("test_int_gauge")) self.assertEqual("some", stats.STATS.GetMetricValue("test_string_gauge")) # At least default Python type checking is enfored in gauges: # we can't assign string to int self.assertRaises(ValueError, stats.STATS.SetGaugeValue, "test_int_gauge", "some") # but we can assign int to string stats.STATS.SetGaugeValue("test_string_gauge", 42) def testGaugeWithFields(self): stats.STATS.RegisterGaugeMetric("test_int_gauge", int, fields=[("dimension", str)]) self.assertEqual(0, stats.STATS.GetMetricValue( "test_int_gauge", fields=["dimension_value_1"])) self.assertEqual(0, stats.STATS.GetMetricValue( "test_int_gauge", fields=["dimesnioN_value_2"])) stats.STATS.SetGaugeValue("test_int_gauge", 1, fields=["dimension_value_1"]) stats.STATS.SetGaugeValue("test_int_gauge", 2, fields=["dimension_value_2"]) self.assertEqual(1, stats.STATS.GetMetricValue( "test_int_gauge", fields=["dimension_value_1"])) self.assertEqual(2, stats.STATS.GetMetricValue( "test_int_gauge", fields=["dimension_value_2"])) def testGaugeWithCallback(self): stats.STATS.RegisterGaugeMetric("test_int_gauge", int) stats.STATS.RegisterGaugeMetric("test_string_gauge", str) self.assertEqual(0, stats.STATS.GetMetricValue("test_int_gauge")) self.assertEqual("", stats.STATS.GetMetricValue("test_string_gauge")) stats.STATS.SetGaugeCallback("test_int_gauge", lambda: 42) stats.STATS.SetGaugeCallback("test_string_gauge", lambda: "some") self.assertEqual(42, stats.STATS.GetMetricValue("test_int_gauge")) self.assertEqual("some", stats.STATS.GetMetricValue("test_string_gauge")) def testSimpleEventMetric(self): inf = float("inf") stats.STATS.RegisterEventMetric("test_event_metric", bins=[0.0, 0.1, 0.2]) data = stats.STATS.GetMetricValue("test_event_metric") self.assertAlmostEqual(0, data.sum) self.assertEqual(0, data.count) self.assertEqual([-inf, 0.0, 0.1, 0.2], data.bins) self.assertEqual({-inf: 0, 0.0: 0, 0.1: 0, 0.2: 0}, data.bins_heights) stats.STATS.RecordEvent("test_event_metric", 0.15) data = stats.STATS.GetMetricValue("test_event_metric") self.assertAlmostEqual(0.15, data.sum) self.assertEqual(1, data.count) self.assertEqual([-inf, 0.0, 0.1, 0.2], data.bins) self.assertEqual({-inf: 0, 0.0: 0, 0.1: 1, 0.2: 0}, data.bins_heights) stats.STATS.RecordEvent("test_event_metric", 0.5) data = stats.STATS.GetMetricValue("test_event_metric") self.assertAlmostEqual(0.65, data.sum) self.assertEqual(2, data.count) self.assertEqual([-inf, 0.0, 0.1, 0.2], data.bins) self.assertEqual({-inf: 0, 0.0: 0, 0.1: 1, 0.2: 1}, data.bins_heights) stats.STATS.RecordEvent("test_event_metric", -0.1) data = stats.STATS.GetMetricValue("test_event_metric") self.assertAlmostEqual(0.55, data.sum) self.assertEqual(3, data.count) self.assertEqual([-inf, 0.0, 0.1, 0.2], data.bins) self.assertEqual({-inf: 1, 0.0: 0, 0.1: 1, 0.2: 1}, data.bins_heights) def testEventMetricWithFields(self): inf = float("inf") stats.STATS.RegisterEventMetric("test_event_metric", bins=[0.0, 0.1, 0.2], fields=[("dimension", str)]) data = stats.STATS.GetMetricValue("test_event_metric", fields=["dimension_value_1"]) self.assertAlmostEqual(0, data.sum) self.assertEqual(0, data.count) self.assertEqual([-inf, 0.0, 0.1, 0.2], data.bins) self.assertEqual({-inf: 0, 0.0: 0, 0.1: 0, 0.2: 0}, data.bins_heights) stats.STATS.RecordEvent("test_event_metric", 0.15, fields=["dimension_value_1"]) stats.STATS.RecordEvent("test_event_metric", 0.25, fields=["dimension_value_2"]) data = stats.STATS.GetMetricValue("test_event_metric", fields=["dimension_value_1"]) self.assertAlmostEqual(0.15, data.sum) self.assertEqual(1, data.count) self.assertEqual([-inf, 0.0, 0.1, 0.2], data.bins) self.assertEqual({-inf: 0, 0.0: 0, 0.1: 1, 0.2: 0}, data.bins_heights) data = stats.STATS.GetMetricValue("test_event_metric", fields=["dimension_value_2"]) self.assertAlmostEqual(0.25, data.sum) self.assertEqual(1, data.count) self.assertEqual([-inf, 0.0, 0.1, 0.2], data.bins) self.assertEqual({-inf: 0, 0.0: 0, 0.1: 0, 0.2: 1}, data.bins_heights) def testRaisesOnImproperFieldsUsage1(self): # Check for counters stats.STATS.RegisterCounterMetric("test_counter") self.assertRaises(ValueError, stats.STATS.GetMetricValue, "test_counter", fields=["a"]) # Check for gauges stats.STATS.RegisterGaugeMetric("test_int_gauge", int) self.assertRaises(ValueError, stats.STATS.GetMetricValue, "test_int_gauge", fields=["a"]) # Check for event metrics stats.STATS.RegisterEventMetric("test_event_metric") self.assertRaises(ValueError, stats.STATS.GetMetricValue, "test_event_metric", fields=["a", "b"]) def testRaisesOnImproperFieldsUsage2(self): # Check for counters stats.STATS.RegisterCounterMetric("test_counter", fields=[("dimension", str)]) self.assertRaises(ValueError, stats.STATS.GetMetricValue, "test_counter") self.assertRaises(ValueError, stats.STATS.GetMetricValue, "test_counter", fields=["a", "b"]) # Check for gauges stats.STATS.RegisterGaugeMetric("test_int_gauge", int, fields=[("dimension", str)]) self.assertRaises(ValueError, stats.STATS.GetMetricValue, "test_int_gauge") self.assertRaises(ValueError, stats.STATS.GetMetricValue, "test_int_gauge", fields=["a", "b"]) # Check for event metrics stats.STATS.RegisterEventMetric("test_event_metric", fields=[("dimension", str)]) self.assertRaises(ValueError, stats.STATS.GetMetricValue, "test_event_metric") self.assertRaises(ValueError, stats.STATS.GetMetricValue, "test_event_metric", fields=["a", "b"]) def testGetAllMetricsMetadataWorksCorrectlyOnSimpleMetrics(self): stats.STATS.RegisterCounterMetric("test_counter") stats.STATS.RegisterGaugeMetric("test_int_gauge", int, fields=[("dimension", str)]) stats.STATS.RegisterEventMetric("test_event_metric") metrics = stats.STATS.GetAllMetricsMetadata() self.assertEqual(metrics["test_counter"].metric_type, stats.MetricType.COUNTER) self.assertFalse(metrics["test_counter"].fields_defs) self.assertEqual(metrics["test_int_gauge"].metric_type, stats.MetricType.GAUGE) self.assertEqual(metrics["test_int_gauge"].fields_defs, [rdfvalue.MetricFieldDefinition( field_name="dimension", field_type=stats.MetricFieldDefinition.FieldType.STR)]) self.assertEqual(metrics["test_event_metric"].metric_type, stats.MetricType.EVENT) self.assertFalse(metrics["test_event_metric"].fields_defs) def testGetMetricFieldsWorksCorrectly(self): stats.STATS.RegisterCounterMetric( "test_counter", fields=[("dimension1", str), ("dimension2", str)]) stats.STATS.RegisterGaugeMetric("test_int_gauge", int, fields=[("dimension", str)]) stats.STATS.RegisterEventMetric("test_event_metric", fields=[("dimension", str)]) stats.STATS.IncrementCounter("test_counter", fields=["b", "b"]) stats.STATS.IncrementCounter("test_counter", fields=["a", "c"]) stats.STATS.SetGaugeValue("test_int_gauge", 20, fields=["a"]) stats.STATS.SetGaugeValue("test_int_gauge", 30, fields=["b"]) stats.STATS.RecordEvent("test_event_metric", 0.1, fields=["a"]) stats.STATS.RecordEvent("test_event_metric", 0.1, fields=["b"]) fields = sorted(stats.STATS.GetMetricFields("test_counter"), key=lambda t: t[0]) self.assertEqual([("a", "c"), ("b", "b")], fields) fields = sorted(stats.STATS.GetMetricFields("test_int_gauge"), key=lambda t: t[0]) self.assertEqual([("a",), ("b",)], fields) fields = sorted(stats.STATS.GetMetricFields("test_event_metric"), key=lambda t: t[0]) self.assertEqual([("a",), ("b",)], fields) @stats.Counted("test_counter") def CountedFunc(self): pass def testCountingDecorator(self): """Test function call counting.""" stats.STATS.RegisterCounterMetric("test_counter") for _ in range(10): self.CountedFunc() self.assertEqual(stats.STATS.GetMetricValue("test_counter"), 10) @stats.Timed("test_timed") def TimedFunc(self, n): self.Sleep(n) def testMaps(self): """Test binned timings.""" stats.STATS.RegisterEventMetric("test_timed", bins=[0.0, 0.1, 0.2]) m = stats.STATS.GetMetricValue("test_timed") self.assertEqual(m.bins_heights[0.0], 0) self.assertEqual(m.bins_heights[0.1], 0) self.assertEqual(m.bins_heights[0.2], 0) for _ in range(3): self.TimedFunc(0) m = stats.STATS.GetMetricValue("test_timed") self.assertEqual(m.bins_heights[0.0], 3) self.assertEqual(m.bins_heights[0.1], 0) self.assertEqual(m.bins_heights[0.2], 0) self.TimedFunc(0.11) m = stats.STATS.GetMetricValue("test_timed") self.assertEqual(m.bins_heights[0.0], 3) self.assertEqual(m.bins_heights[0.1], 1) self.assertEqual(m.bins_heights[0.2], 0) @stats.Timed("test_timed") @stats.Counted("test_counter") def OverdecoratedFunc(self, n): self.Sleep(n) def testCombiningDecorators(self): """Test combining decorators.""" stats.STATS.RegisterCounterMetric("test_counter") stats.STATS.RegisterEventMetric("test_timed", bins=[0.0, 0.1, 0.2]) self.OverdecoratedFunc(0.02) # Check if all vars get updated m = stats.STATS.GetMetricValue("test_timed") self.assertEqual(m.bins_heights[0.0], 1) self.assertEqual(m.bins_heights[0.1], 0) self.assertEqual(m.bins_heights[0.2], 0) self.assertEqual(stats.STATS.GetMetricValue("test_counter"), 1) @stats.Timed("test_timed") @stats.Counted("test_counter") def RaiseFunc(self, n): self.Sleep(n) raise Exception() def testExceptionHandling(self): """Test decorators when exceptions are thrown.""" stats.STATS.RegisterCounterMetric("test_counter") stats.STATS.RegisterEventMetric("test_timed", bins=[0.0, 0.1, 0.2]) self.assertRaises(Exception, self.RaiseFunc, 0.11) # Check if all vars get updated m = stats.STATS.GetMetricValue("test_timed") self.assertEqual(m.bins_heights[0.0], 0) self.assertEqual(m.bins_heights[0.1], 1) self.assertEqual(m.bins_heights[0.2], 0) self.assertEqual(stats.STATS.GetMetricValue("test_counter"), 1) @stats.Counted("test_multiple_count") def Func1(self, n): self.Sleep(n) @stats.Counted("test_multiple_count") def Func2(self, n): self.Sleep(n) @stats.Timed("test_multiple_timing") def Func3(self, n): self.Sleep(n) @stats.Timed("test_multiple_timing") def Func4(self, n): self.Sleep(n) def testMultipleFuncs(self): """Tests if multiple decorators produce aggregate stats.""" stats.STATS.RegisterCounterMetric("test_multiple_count") stats.STATS.RegisterEventMetric("test_multiple_timing", bins=[0, 1, 2]) self.Func1(0) self.Func2(0) self.assertEqual(stats.STATS.GetMetricValue("test_multiple_count"), 2) self.Func3(0) self.Func4(1) m = stats.STATS.GetMetricValue("test_multiple_timing") self.assertEqual(m.bins_heights[0.0], 1) self.assertEqual(m.bins_heights[1], 1) self.assertEqual(m.bins_heights[2], 0) def main(argv): test_lib.main(argv) if __name__ == "__main__": flags.StartMain(main)
# Copyright 2019 Google Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """TF code to decode an MEG/EEG signal. TF models and code to predict MEG/EEG signals from their input audio features, or vice versa. """ import os import random import re import sys from absl import logging import numpy as np from telluride_decoding import preprocess import tensorflow.compat.v2 as tf # User should call tf.compat.v1.enable_v2_behavior() brain_data_print = sys.stdout # Feel free to redirect this elsewhere. # pylint: disable=g-long-lambda ######################### Brain Data Classes ############################## class BrainData(object): """Basic object describing the data we read and use for regression. A generic class for reading brain decoding data. This class reads in the data, adds temporal context and prepares the data as a TF dataset for processing by the rest of the decoding system. Use the create_dataset method to get a tf.data.Dataset object given a BrainData object. The resulting dataset object represents a stream of two-ples, consisting of: input_dictionary, output_data where the input dictionary has three keys input_1, input_2 (might be empty), and attended_speaker (might be empty). """ def __init__(self, in_fields, out_field, frame_rate, pre_context=0, post_context=0, in2_fields=None, in2_pre_context=0, in2_post_context=0, attended_field=None, initial_batch_size=1000, final_batch_size=1000, repeat_count=1, shuffle_buffer_size=1000, data_dir=None, data_pattern='', train_file_pattern='', validate_file_pattern='', test_file_pattern=''): """Describes the type of data we are using in this experiment. This class encapsulates everything we know about the dataset, so we can later generate training, eval and testing subsets. Args: in_fields: A list of fields from a dataset used as input to regression. out_field: A single field name to predict (also dataset field). frame_rate: Sample rate of the data, needed for preprocessing filters. pre_context: Number of input samples before the current time in regression. post_context: Number of input samples after the current time in regression. in2_fields: A second list of fields for methods that take two inputs. in2_pre_context: Number of samples of input 2 before the current time. in regression. in2_post_context: Number of samples of input 2 after the current time in regression. attended_field: TFRecord feature name that says which speaker is being attended. initial_batch_size: Number of samples to use before adding context. Longer is better because you have fewer edge effects. final_batch_size: Size of minibatch passed to estimator. repeat_count: Number of times to repeat the data when streaming it out. shuffle_buffer_size: Number of samples to accumulate before shuffling. data_dir: Where file-based data classes look for data. data_pattern: String that must be in all filenames used here. train_file_pattern: A regular expression that selects the training files. Note, the special string "allbut" specifies that all files not selected for validation or testing should be used for testing. Furthermore, specifying allbut_NN specifies that a random NN of the files be used for training (so we can test amount of data vs performance.) validate_file_pattern: A regular expression that selects the validation files. test_file_pattern: A regular expression that selects the testing files. Raises: ValueError for bad parameter values. """ logging.info('BrainData initialization: %s, %s @ %gHz -> %s', in_fields, in2_fields, frame_rate, out_field) if not in_fields: raise ValueError('Must specify at least one input field.') if not out_field: raise ValueError('Must specify an output field.') if frame_rate < 0: raise ValueError('frame_rate must be >= 0') if pre_context < 0: raise ValueError('pre_context must be >= 0') if post_context < 0: raise ValueError('post_context must be >= 0') if isinstance(in_fields, str): in_fields = [in_fields,] self.in1_fields = in_fields if isinstance(in2_fields, str) and in2_fields: in2_fields = [in2_fields,] self.in2_fields = in2_fields self.out_field = out_field self.frame_rate = frame_rate self.in1_pre_context = pre_context self.in1_post_context = post_context self.in2_pre_context = in2_pre_context self.in2_post_context = in2_post_context self.attended_field = attended_field self.initial_batch_size = initial_batch_size self.final_batch_size = final_batch_size self.repeat_count = repeat_count self.shuffle_buffer_size = shuffle_buffer_size self.data_dir = data_dir self.data_pattern = data_pattern self.train_file_pattern = train_file_pattern self.validate_file_pattern = validate_file_pattern self.test_file_pattern = test_file_pattern # Internal state self.use_saved_data = False self._cached_file_names = [] # Initialize cache for this list if needed. self.all_files() # preload data files so we know what the data looks like. def all_files(self, max_count=0): """Returns a list of files available for this class.""" if not self._cached_file_names: # Load the potential files if we haven't already. self._get_data_file_names() if self._cached_file_names: random.shuffle(self._cached_file_names) # Shuffle them once. if max_count > 0 and len(self._cached_file_names) > max_count: return self._cached_file_names[:max_count] return self._cached_file_names def set_file_patterns(self, train, validate, test): logging.info('brain_data setting file patterns to %s, %s, %s', train, validate, test) self.train_file_pattern = train self.validate_file_pattern = validate self.test_file_pattern = test def create_dataset(self, mode='train', temporal_context=True): """Creates the full TF dataset, ready to feed an estimator. This class should be specialized. The basic flow is: Select the file names for this mode (if needed). Read in each file (interleaved) and do the following operations: Parse the data. Add temporal context. Finalize the dataset by: Shuffle the data. Assemble into mini batches. Args: mode: One of {train, eval, test} to determine how to set up the full stream. temporal_context: Flag that controls whether we add temporal context to the data. Normally true, but set to false to extract the original data without context (for debugging and prediction.) """ raise NotImplementedError def _get_data_file_names(self): """Get the data pathnames for this dataset. Just a dummy list of names by default for classes that synthesize data. Real datasets will need to specialize this function to return the real file names. Caches a list of file pathnames. In this generic case an empty list. """ self._cached_file_names = [] # No files by default def filter_file_names(self, mode): """Filters all available files based on the experiment mode (train, test...) Depending on the training/testing mode, filter the available files into a list that we use for this stage. Args: mode: Arbitrary, but currently one of {train, validate, test}. This mode determines which flag is used to provide the file_pattern. Implied flags from the class object: train_file_pattern, validate_file_pattern, test_file_pattern: These are regular expressions that filter the returned names. Returns: A list of filenames to be used in this phase of the program. Raises: ValueError for bad parameter values. """ if mode == 'program_test': mode = 'test' if mode not in set(['test', 'validate', 'train']): raise ValueError('mode must be one of test, validate or train') filename_list = self.all_files() if not isinstance(filename_list, list): raise TypeError('Filename_list is a %s, not a list.' % type(filename_list)) logging.info('Filter_file_names: filename_list: %s', filename_list) logging.info('Filter_file_names: train_file_pattern: %s', self.train_file_pattern) logging.info('Filter_file_names: validate_file_pattern: %s', self.validate_file_pattern) logging.info('Filter_file_names: test_file_pattern: %s', self.test_file_pattern) if mode.startswith('test'): pattern_re = re.compile(self.test_file_pattern) elif mode.startswith('validate'): pattern_re = re.compile(self.validate_file_pattern) else: # Only valid option left is 'train' if self.train_file_pattern == 'allbut': pattern_re = re.compile('') else: pattern_re = re.compile(self.train_file_pattern) if mode == 'train' and self.train_file_pattern.startswith('allbut'): # Must specify some pattern for test and validate if using allbut. if not (self.test_file_pattern and self.validate_file_pattern): raise ValueError('Both test and validate must be specified if using ' 'allbut pattern') test_re = re.compile(self.test_file_pattern) validate_re = re.compile(self.validate_file_pattern) filename_list = [f for f in filename_list if not (test_re.search(f) or validate_re.search(f))] if self.train_file_pattern.startswith('allbut_'): allbut = self.train_file_pattern.replace('allbut_', '', 1) if allbut.isdigit(): count = int(allbut) else: raise ValueError('allbut_ spec must be an integer, not %s.' % allbut) if count < len(filename_list): logging.info('Reducing list of %d files to %d.', len(filename_list), count) filename_list = filename_list[:count] logging.info('filter_file_names: post filename_list %s', filename_list) else: filename_list = [f for f in filename_list if pattern_re.search(f)] logging.info('Using %d files for %s.', len(filename_list), mode) logging.info(' Files for %s are: %s', mode, filename_list) return filename_list def final_shuffle_and_batch(self, mode, input_dataset, mixup_batch=False): """Does all the work we need to do prepare the dataset for serving. Args: mode: Train or testing mode, which determines whether data is shuffled. input_dataset: The actual TF dataset to prepare. mixup_batch: Whether the inputs and outputs are randomized with respect to each other. Returns: The final dataset object. This dataset has two components: a dictionary of model inputs (input_1, input_2 and attended_speaker), and a single output field. """ # TODO Look into tf.data cache or snapshot # First shuffle the data (and repeat it) for better SGD performance. logging.info('final_shuffle_and_batch mode %s and batching %s', mode, mixup_batch) if mode == 'train': repeated_dataset = input_dataset.repeat(self.repeat_count) if self.shuffle_buffer_size > 0: shuffled_dataset = repeated_dataset.shuffle(self.shuffle_buffer_size) else: shuffled_dataset = repeated_dataset elif mode == 'program_test': shuffled_dataset = input_dataset else: # Shuffle the data in test or eval mode too so we get better stats. if self.shuffle_buffer_size > 0: shuffled_dataset = input_dataset.shuffle(self.shuffle_buffer_size) else: shuffled_dataset = input_dataset # Then batch the data into minibatches. # Drop the remainder so testing is easier (no odd sized batches). Losing a # few samples at the end shouldn't matter for real (big) datasets. batched_dataset = shuffled_dataset.batch(self.final_batch_size, drop_remainder=True) if mixup_batch: print('final_shuffle_and_batch: Mixing up the batches of data ' 'for testing!!!!', file=brain_data_print) logging.warning('final_shuffle_and_batch: Mixing up the batches of data ' 'for testing!!!!') def mixup_batch_function(x, x2, y, a): """Mixup the order of the labels so data is mismatched. For baseline.""" return x, tf.random.shuffle(x2), tf.random.shuffle(y), a batched_dataset = batched_dataset.map(mixup_batch_function) # Convert the four-tuple to a two-tuple: a dictionary for the inputs, and # the output. final_dataset = batched_dataset.map( lambda x, x2, y, a: ({'input_1': x, 'input_2': x2, 'attended_speaker': a}, y), num_parallel_calls=32) logging.info('Create_dataset: the %s final_dataset is: %s', mode, final_dataset) return final_dataset def add_temporal_context(self, dataset_without_context): """Adds context to a datstream. Create a dataset stream from files of TFRecords, containing input and output data. This dataset is unique because we add temporal context to the input data, so the output depends on the input over a time window. We do this using the dataset so we can create the context on the fly (and not precompute it and save it in a much larger file.) Args: dataset_without_context: dataset to which we will add temporal context. This dataset consists of a four (unnamed) streams (input_1, input_2, output, and attention). External args: self.in1_pre_context - Number of frames to prepend to the input data. self.in1_post_context - Number of frames to append after the current frame. self.in2_pre_context - Number of frames to prepend to the second input. self.in2_post_context - Number of frames to append after the second input. Returns: The new dataset with the desired temporal context. Raises: TypeError for bad parameter values. """ def window_one_stream_new(x, pre_context, post_context): """Create extra temporal context for one stream of data.""" logging.info(' Window_one_stream: adding %d and %d frames of context ' 'to stream.', pre_context, post_context) total_context = pre_context + 1 + post_context channels = x.shape[1] logging.info(' Window_one_stream: %s channels.', channels) padded_x = tf.concat((tf.zeros((pre_context, channels), dtype=x.dtype), x, tf.zeros((post_context, channels), dtype=x.dtype)), axis=0) new_data = tf.signal.frame(padded_x, total_context, frame_step=1, axis=0) flat_data = tf.reshape(new_data, (-1, total_context*channels), name='window_one_stream_reshape_new') new_x = tf.data.Dataset.from_tensor_slices(flat_data) return new_x def window_data(x, x2, y, a, pre_context=0, post_context=0, in2_pre_context=0, in2_post_context=0): """Creates extra temporal context for both input streams.""" x_with_context = window_one_stream_new(x, pre_context, post_context) x2_with_context = window_one_stream_new(x2, in2_pre_context, in2_post_context) y_with_context = window_one_stream_new(y, 0, 0) a = tf.data.Dataset.from_tensor_slices(a) return tf.data.Dataset.zip((x_with_context, x2_with_context, y_with_context, a)) if not isinstance(dataset_without_context, tf.data.Dataset): raise TypeError('dataset for window_data must be a tf.data.Dataset') additional_context = (self.in1_pre_context or self.in1_post_context or self.in2_pre_context + self.in2_post_context) if additional_context: batched_dataset = dataset_without_context.batch(self.initial_batch_size) new_dataset = batched_dataset.flat_map( lambda x, x2, y, a: window_data( x, x2, y, a, pre_context=self.in1_pre_context, post_context=self.in1_post_context, in2_pre_context=self.in2_pre_context, in2_post_context=self.in2_post_context)) else: new_dataset = dataset_without_context return new_dataset def input_fields_width(self, input_number=1): """Computes the width of the input. Sum up the width of all the fields to pass this to the estimator --- *after* adding the temporal context. Args: input_number: Set to either 1 or 2, which determines whether this function is calculating the feature weight for the first or second feature data. Returns: An integer that counts how wide the input feature is (in float32s). Raises: TypeError for bad parameter values. """ if input_number != 1 and input_number != 2: raise ValueError('Only 1st or 2nd input is supported here.') if input_number == 1: fields = self.in1_fields else: fields = self.in2_fields logging.info('input_fields_width (%d) type(in_fields) is %s with value %s', input_number, type(fields), fields) if isinstance(fields, str) and fields: fields = [fields,] if fields: for k in fields: if k not in list(self.features.keys()): raise TypeError('Can\'t find **%s** in valid features: %s' % (k, [','.join(list(self.features.keys()))])) widths = [self.features[k].shape[0] for k in fields] else: widths = [1] if input_number == 1: return sum(widths)*(self.in1_pre_context+1+self.in1_post_context) else: return sum(widths)*(self.in2_pre_context+1+self.in2_post_context) def output_field_width(self): if self.out_field not in list(self.features.keys()): raise ValueError('Could not find output_field **%s** in %s' % (self.out_field, self.features.keys())) return self.features[self.out_field].shape[0] class TestBrainData(BrainData): """Dataset which produces fixed (saved) values, useful for testing.""" def create_dataset(self, mode='train', temporal_context=True, mixup_batch=False): """Creates the full TF dataset, ready to feed an estimator. This is the default entry into this class, creating a dataset for training, testing, or validation, depending on the mode. Args: mode: One of {train, eval, test} to determine how to set up the full stream. temporal_context: Flag that controls whether we add temporal context to the data. Normally true, but set to false to extract the original data without context (for debugging and prediction.) mixup_batch: Boolean that specifies whether inputs and outputs are shuffled with respect to each other to create baseline. Returns: The requested tf.data.Dataset object. Raises: ValueError for bad parameter values. """ if not hasattr(self, 'saved_input_data'): raise ValueError('Must call preserve_test_data before create_dataset.') saved_dataset = tf.data.Dataset.from_tensor_slices( (self.saved_input_data, self.saved_input2_data, self.saved_output_data, self.saved_attention_data)) if temporal_context and (self.in1_pre_context or self.in1_post_context or self.in2_pre_context or self.in2_post_context): saved_dataset = self.add_temporal_context(saved_dataset) return self.final_shuffle_and_batch(mode, saved_dataset, mixup_batch=mixup_batch) def preserve_test_data(self, input_data, output_data, input2_data=None, attention_data=None): """Puts some data into a dataset for testing. Args: input_data: data used as the input feature. (time x channel). output_data: data used as the output data to be predicted. input2_data: Optional second input array. attention_data: Optional array for attention target signal. Raises: TypeError for bad parameter values. """ input_data = np.asarray(input_data) output_data = np.asarray(output_data) if input_data.shape[0] != output_data.shape[0]: raise ValueError('input shape (%s) and output shape (%s) are not equal.' % (input_data.shape, output_data.shape)) self.saved_input_data = input_data self.saved_output_data = output_data self.num_input_channels = input_data.shape[1] self.num_output_channels = output_data.shape[1] self.features = { 'input_1': tf.io.FixedLenFeature([input_data.shape[1],], tf.float32), 'output': tf.io.FixedLenFeature([output_data.shape[1],], tf.float32), } # Add the optional input_2. if input2_data is None: input2_data = np.zeros((input_data.shape[0], 1), dtype=input_data.dtype) input2_data = np.asarray(input2_data) if input_data.shape[0] != input2_data.shape[0]: raise ValueError('input shape (%s) and input2 shape (%s) are not equal.' % (input_data.shape, input2_data.shape)) self.saved_input2_data = input2_data self.features['input_2'] = tf.io.FixedLenFeature([input2_data.shape[1],], tf.float32) # Add the optional attention signal. if attention_data is None: attention_data = np.zeros((input_data.shape[0], 1), dtype=input_data.dtype) attention_data = np.asarray(attention_data) if input_data.shape[0] != attention_data.shape[0]: raise ValueError('input shape (%s) and attention shape (%s) ' 'are not equal.' % (input_data.shape, attention_data.shape)) self.saved_attention_data = attention_data self.features['attention'] = tf.io.FixedLenFeature( [attention_data.shape[1],], tf.float32) class TFExampleData(BrainData): """Generic dataset consisting of TFExamples in multiple files.""" def _get_data_file_names(self): """Gets the files in data_dir ending with .tfrecords and have data_pattern. Walk the directory tree, grabbing all the files that and in ".tfrecords" and contain the string indicated by self.data_pattern. We'll filter them into training, validation and testing sets later. Returns: A list of path names to the desired data. """ if not self.data_dir: raise ValueError('Missing data_dir in TFExampleData initialization. ' 'Must specify the source of the data (FLAGS.tfrecords).') logging.info('Reading TFExample data from %s, filtering for **%s**', self.data_dir, self.data_pattern) if not isinstance(self.data_dir, str): raise TypeError('data_dir must be a string, not a %s (**%s**)' % (type(self.data_dir), self.data_dir)) self._cached_file_names = [] exp_data_dir = self.data_dir for (path, _, files) in tf.io.gfile.walk(exp_data_dir): # pylint: disable=g-complex-comprehension self._cached_file_names += [ os.path.join(path, f) for f in files if (f.endswith('.tfrecords') and '-bad-' not in f and self.data_pattern in f) ] logging.info('Found %d files for TFExample data analysis.', len(self._cached_file_names)) if not self._cached_file_names: raise ValueError('Should not have an empty list of data files from %s.' % exp_data_dir) self.features = discover_feature_shapes(self._cached_file_names[0]) logging.info('Discover_feature_shapes found: %s', self.features) def create_dataset(self, mode='train', temporal_context=True, mixup_batch=False): """Create the full TF dataset, ready to feed an estimator. This is the default entry into this class, creating a dataset for training, testing, or validation, depending on the mode. Args: mode: One of {train, eval, test} to determine how to set up the full stream. temporal_context: Flag that controls whether we add temporal context to the data. Normally true, but set to false to extract the original data without context (for debugging and prediction.) mixup_batch: Whether the inputs and outputs are randomized with respect to each other. Returns: The requested tf.data.dataset object. Raises: ValueError for bad parameter values. """ filename_list = self.filter_file_names(mode) if not filename_list: raise ValueError('No files to process in mode %s from %s' % (mode, self.data_dir)) filename_dataset = tf.data.Dataset.from_tensor_slices(filename_list) # Map over all the filename (strings) using interleave so we get some extra # randomness. And each read_data_into_dataset call only applies to one # file, so we don't extend the temporal context across files. interleaved_dataset = filename_dataset.interleave( lambda x: self.read_data_into_dataset( x, temporal_context=temporal_context), len(filename_list)) return self.final_shuffle_and_batch(mode, interleaved_dataset, mixup_batch=mixup_batch) def read_data_into_dataset(self, filenames, temporal_context=True): """Prepares a specific example of data for this dataset. Dataset creation function that takes filename(s) and outputs the proper fields from the dataset (no context yet). This base method is only useful when reading/parsing TFRecord data. Otherwise, specialize. Args: filenames: a tensor containing one (usual case due to interleave) or more filenames from which to read the data. temporal_context: Should we add the temporal context to the input data? Returns: A two-stream dataset, one for input and the other the labels. Batch size of 1 at this point. Raises: TypeError for bad parameter values. """ if not isinstance(filenames, tf.Tensor): raise TypeError('filenames must be a tensor') filename_dataset = tf.data.Dataset.from_tensors(filenames) raw_proto_dataset = tf.data.TFRecordDataset(filename_dataset, num_parallel_reads=32) parsed_data = raw_proto_dataset.map(self.parse_and_select_from_tfrecord, num_parallel_calls=32) if temporal_context and (self.in1_pre_context or self.in1_post_context or self.in2_pre_context or self.in2_post_context): parsed_data = self.add_temporal_context(parsed_data) return parsed_data def preprocess_list(self, name_params_list, frame_rate): if not name_params_list: return [] pp_list = [] for name_param in name_params_list: pp_list.append(preprocess.Preprocessor(name_param, frame_rate, frame_rate)) return pp_list def parse_and_select_from_tfrecord(self, raw_proto): """Dataset map function that parses a TFRecord example and select fields. Note, this routine has a special hack to create a field called "ones" which is always one, and used for cases like CCA which have no output, just two inputs. Args: raw_proto: An example of a TFRecord, in proto format. Returns: A 4-ple consisting of parsed input, input2, output data, and attended direction (if supplied) in Tensors. Each tensor consists of one sample point (shape[0]) but the width of each data depends on the user's input data request (in1_fields, in2_fields, out_field, and attended_field) """ # https://stackoverflow.com/questions/41951433/tensorflow-valueerror-shape-must-be-rank-1-but-is-rank-0-for-parseexample-pa parsed_features = tf.io.parse_example([raw_proto], self.features) if set(self.in1_fields) - set(parsed_features.keys()): raise ValueError('Could not find all desired features (%s) in data (%s)' % (self.in1_fields, parsed_features.keys())) in_data = tf.concat([parsed_features[k] for k in self.in1_fields], axis=1) in_data = tf.reshape(in_data, (-1,), name='input_reshape') if self.out_field == 'ones': logging.info('Selecting ones from %s', in_data) out_data = in_data[0:1]*0.0 + 1 else: out_data = parsed_features[self.out_field] out_data = tf.reshape(out_data, (-1,), name='output_reshape') if self.in2_fields: for k in self.in2_fields: if k not in parsed_features: raise ValueError('Could not find %s in parsed_features[%s]' % (k, parsed_features.keys())) in2_data = tf.concat([parsed_features[k] for k in self.in2_fields], axis=1) in2_data = tf.reshape(in2_data, (-1,), name='input2_reshape') else: # Fill in dummy data so the dataset maps to come don't get upset. # Only need first data element, replicated across batches later. # This will need to be done by hand when feeding saved models. logging.info('Did not find %s field for input2, so synthesizing one.', self.in2_fields) in2_data = in_data[0:1] if self.attended_field: attended_data = parsed_features[self.attended_field] attended_data = tf.reshape(attended_data, (-1,), name='attended_reshape') else: logging.info('Did not find %s field for attention, so synthesizing one.', self.attended_field) # Placeholder. Just get some 0/1 data into this field. Keep it as a float # since the original attend field is a float. attended_data = tf.cast(in_data[0:1] > 0, tf.float32) return in_data, in2_data, out_data, attended_data # TODO Switch to this new parse function so we can do pre- # processing on the fly. Right now it doesn't work yet. def parse_and_select_from_tfrecord2(self, raw_proto): """Dataset map function that parses a TFRecord example and select fields.""" # https://stackoverflow.com/questions/41951433/tensorflow-valueerror-shape-must-be-rank-1-but-is-rank-0-for-parseexample-pa parsed_features = tf.io.parse_example([raw_proto], self.features) self._in1_preprocessors = self.preprocess_list(self.in1_fields, self.frame_rate) # pylint: disable=g-complex-comprehension in_data = tf.concat([tf.py_function(pp.process, inp=[parsed_features[pp.name]], Tout=tf.float32) for pp in self._in1_preprocessors], axis=1) in_data = tf.reshape(in_data, (-1,), name='input1_reshape') if self.in2_fields: self._in2_preprocessors = self.preprocess_list(self.in2_fields, self.frame_rate) # pylint: disable=g-complex-comprehension in2_data = tf.concat([tf.py_function(pp.process, inp=[parsed_features[pp.name]], Tout=tf.float32) for pp in self._in2_preprocessors], axis=1) in2_data = tf.reshape(in2_data, (-1,), name='input2_reshape') else: in2_data = in_data[0:1] self._out_preprocessors = self.preprocess_list([self.out_field], self.frame_rate) # pylint: disable=g-complex-comprehension out_data = tf.concat([tf.py_function(pp.process, inp=[parsed_features[pp.name]], Tout=tf.float32) for pp in self._out_preprocessors], axis=1) out_data = tf.reshape(out_data, (-1,), name='output_reshape') if self.attended_direction: attended_data = parsed_features[self.attended_direction] attended_data = tf.reshape(attended_data, (-1), name='attended_reshape') else: attended_data = None return in_data, in2_data, out_data, attended_data def discover_feature_shapes(tfrecord_file_name): """Reads a TFRecord file, parse one TFExample, and return the structure. Args: tfrecord_file_name: Where to read the data (just one needed). Returns: A dictionary of names and tf.io.FixedLenFeatures suitable for tf.io.parse_example. Raises: TypeError for bad parameter values. """ if not isinstance(tfrecord_file_name, str): raise TypeError('discover_feature_shapes: input must be a string filename.') dataset = tf.data.TFRecordDataset(tfrecord_file_name) for a_record in dataset: an_example = tf.train.Example.FromString(a_record.numpy()) break if not isinstance(an_example, tf.train.Example): raise TypeError('record from %s should be a tf.train.Example, not %s.' % (tfrecord_file_name, type(an_example))) feature_keys = list(an_example.features.feature.keys()) shapes = {} for k in feature_keys: feature_list = an_example.features.feature[k] if feature_list.float_list.value: dimensionality = len(feature_list.float_list.value) feature_type = tf.float32 elif feature_list.int64_list.value: dimensionality = len(feature_list.int64_list.value) feature_type = tf.int64 elif feature_list.bytes_list.value: dimensionality = len(feature_list.byte_list.value) feature_type = tf.str shapes[k] = tf.io.FixedLenFeature([dimensionality,], feature_type) return shapes def count_tfrecords(tfrecord_file_name): """Counts and validates the number of TFRecords in an input file. Args: tfrecord_file_name: File to check. Returns: Tuple consisting of valid records and whether an exception was found. Raises: TypeError for bad parameter values. """ if not isinstance(tfrecord_file_name, str): raise TypeError('tfrecord_file_name must be a string.') dataset = tf.data.TFRecordDataset(tfrecord_file_name) record_count = 0 for a_record in dataset: try: an_example = tf.train.Example.FromString(a_record.numpy()) if not isinstance(an_example, tf.train.Example): raise TypeError('record from %s should be a tf.train.Example, not %s.' % (tfrecord_file_name, type(an_example))) record_count += 1 except: # pylint: disable=bare-except return record_count, True return record_count, False def create_brain_dataset(data_type, in_fields, out_field, frame_rate, pre_context=0, post_context=0, in2_fields=None, in2_pre_context=0, in2_post_context=0, attended_field=None, initial_batch_size=1000, final_batch_size=1000, repeat_count=1, shuffle_buffer_size=1000, data_dir=None, data_pattern='', train_file_pattern=None, validate_file_pattern=None, test_file_pattern=None): """Creates any of the brain datasets that we know about. Args: data_type: Desired type of dataset. in_fields: A list of fields from a dataset used as input to regression. out_field: A single field name to predict (also dataset field). frame_rate: Sample rate of the data, needed for preprocessing filters. pre_context: Number of input samples before the current time in regression. post_context: Number of input samples after the current time in regression. in2_fields: A second list of fields for methods that take two inputs. in2_pre_context: Number of samples of input 2 before the current time in regression. in2_post_context: Number of samples of input 2 after the current time in regression. attended_field: Where is the subject attending? This signal is passed through the pipeline and is not used until verifying the performance. initial_batch_size: Number of samples to use before adding context. final_batch_size: Size of minibatch passed to estimator. repeat_count: Number of times to repeat the data when streaming it out. shuffle_buffer_size: Number of samples to accumulate before shuffling. data_dir: Where file-based data classes look for data. data_pattern: String that must be in the filename. train_file_pattern: A regular expression that selects the training files. validate_file_pattern: A regular expression that selects the validation files. test_file_pattern: A regular expression that selects the testing files. Returns: The desired type of BrainData """ if not isinstance(data_type, str): raise TypeError('create_brain_dataset type must be a string.') if frame_rate <= 0: raise ValueError('frame_rate must be greater than 0.') if (data_type == 'tfrecord' or data_type == 'tfrecords' or data_type == 'tfexample'): return TFExampleData(in_fields, out_field, frame_rate, pre_context=pre_context, post_context=post_context, in2_fields=in2_fields, in2_pre_context=in2_pre_context, in2_post_context=in2_post_context, attended_field=attended_field, initial_batch_size=initial_batch_size, final_batch_size=final_batch_size, repeat_count=repeat_count, shuffle_buffer_size=shuffle_buffer_size, data_dir=data_dir, data_pattern=data_pattern, train_file_pattern=train_file_pattern, validate_file_pattern=validate_file_pattern, test_file_pattern=test_file_pattern) if data_type == 'test': return TestBrainData(in_fields, out_field, frame_rate, pre_context=pre_context, post_context=post_context, in2_fields=in2_fields, in2_pre_context=in2_pre_context, in2_post_context=in2_post_context, initial_batch_size=initial_batch_size, final_batch_size=final_batch_size, repeat_count=repeat_count, shuffle_buffer_size=shuffle_buffer_size, data_dir=data_dir, data_pattern=data_pattern, train_file_pattern=train_file_pattern, validate_file_pattern=validate_file_pattern, test_file_pattern=test_file_pattern) raise TypeError('create_brain_dataset unknown data type %s' % data_type)
# -*- coding: utf-8 -*- # Copyright (C) 2014 Yahoo! Inc. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import functools import threading from concurrent import futures as _futures from concurrent.futures import process as _process import six from six.moves import queue as compat_queue from futurist import _green from futurist import _thread from futurist import _utils TimeoutError = _futures.TimeoutError CancelledError = _futures.CancelledError class RejectedSubmission(Exception): """Exception raised when a submitted call is rejected (for some reason).""" # NOTE(harlowja): Allows for simpler access to this type... Future = _futures.Future class _Gatherer(object): def __init__(self, submit_func, lock_factory, start_before_submit=False): self._submit_func = submit_func self._stats_lock = lock_factory() self._stats = ExecutorStatistics() self._start_before_submit = start_before_submit @property def statistics(self): return self._stats def clear(self): with self._stats_lock: self._stats = ExecutorStatistics() def _capture_stats(self, started_at, fut): """Capture statistics :param started_at: when the activity the future has performed was started at :param fut: future object """ # If time somehow goes backwards, make sure we cap it at 0.0 instead # of having negative elapsed time... elapsed = max(0.0, _utils.now() - started_at) with self._stats_lock: # Use a new collection and lock so that all mutations are seen as # atomic and not overlapping and corrupting with other # mutations (the clone ensures that others reading the current # values will not see a mutated/corrupted one). Since futures may # be completed by different threads we need to be extra careful to # gather this data in a way that is thread-safe... (failures, executed, runtime, cancelled) = (self._stats.failures, self._stats.executed, self._stats.runtime, self._stats.cancelled) if fut.cancelled(): cancelled += 1 else: executed += 1 if fut.exception() is not None: failures += 1 runtime += elapsed self._stats = ExecutorStatistics(failures=failures, executed=executed, runtime=runtime, cancelled=cancelled) def submit(self, fn, *args, **kwargs): """Submit work to be executed and capture statistics.""" if self._start_before_submit: started_at = _utils.now() fut = self._submit_func(fn, *args, **kwargs) if not self._start_before_submit: started_at = _utils.now() fut.add_done_callback(functools.partial(self._capture_stats, started_at)) return fut class ThreadPoolExecutor(_futures.Executor): """Executor that uses a thread pool to execute calls asynchronously. It gathers statistics about the submissions executed for post-analysis... See: https://docs.python.org/dev/library/concurrent.futures.html """ threading = _thread.Threading() def __init__(self, max_workers=None, check_and_reject=None): """Initializes a thread pool executor. :param max_workers: maximum number of workers that can be simultaneously active at the same time, further submitted work will be queued up when this limit is reached. :type max_workers: int :param check_and_reject: a callback function that will be provided two position arguments, the first argument will be this executor instance, and the second will be the number of currently queued work items in this executors backlog; the callback should raise a :py:class:`.RejectedSubmission` exception if it wants to have this submission rejected. :type check_and_reject: callback """ if max_workers is None: max_workers = _utils.get_optimal_thread_count() if max_workers <= 0: raise ValueError("Max workers must be greater than zero") self._max_workers = max_workers self._work_queue = compat_queue.Queue() self._shutdown_lock = threading.RLock() self._shutdown = False self._workers = [] self._check_and_reject = check_and_reject or (lambda e, waiting: None) self._gatherer = _Gatherer(self._submit, self.threading.lock_object) @property def statistics(self): """:class:`.ExecutorStatistics` about the executors executions.""" return self._gatherer.statistics @property def alive(self): """Accessor to determine if the executor is alive/active.""" return not self._shutdown def _maybe_spin_up(self): """Spin up a worker if needed.""" # Do more advanced idle checks and/or reaping of very idle # threads in the future.... if (not self._workers or len(self._workers) < self._max_workers): w = _thread.ThreadWorker.create_and_register( self, self._work_queue) # Always save it before we start (so that even if we fail # starting it we can correctly join on it). self._workers.append(w) w.start() def shutdown(self, wait=True): with self._shutdown_lock: if not self._shutdown: self._shutdown = True for w in self._workers: w.stop() if wait: for w in self._workers: _thread.join_thread(w) def _submit(self, fn, *args, **kwargs): f = Future() self._maybe_spin_up() self._work_queue.put(_utils.WorkItem(f, fn, args, kwargs)) return f def submit(self, fn, *args, **kwargs): """Submit some work to be executed (and gather statistics).""" with self._shutdown_lock: if self._shutdown: raise RuntimeError('Can not schedule new futures' ' after being shutdown') self._check_and_reject(self, self._work_queue.qsize()) return self._gatherer.submit(fn, *args, **kwargs) class ProcessPoolExecutor(_process.ProcessPoolExecutor): """Executor that uses a process pool to execute calls asynchronously. It gathers statistics about the submissions executed for post-analysis... See: https://docs.python.org/dev/library/concurrent.futures.html """ threading = _thread.Threading() def __init__(self, max_workers=None): if max_workers is None: max_workers = _utils.get_optimal_process_count() super(ProcessPoolExecutor, self).__init__(max_workers=max_workers) if self._max_workers <= 0: raise ValueError("Max workers must be greater than zero") self._gatherer = _Gatherer( # Since our submit will use this gatherer we have to reference # the parent submit, bound to this instance (which is what we # really want to use anyway). super(ProcessPoolExecutor, self).submit, self.threading.lock_object) @property def alive(self): """Accessor to determine if the executor is alive/active.""" return not self._shutdown_thread @property def statistics(self): """:class:`.ExecutorStatistics` about the executors executions.""" return self._gatherer.statistics def submit(self, fn, *args, **kwargs): """Submit some work to be executed (and gather statistics).""" return self._gatherer.submit(fn, *args, **kwargs) class SynchronousExecutor(_futures.Executor): """Executor that uses the caller to execute calls synchronously. This provides an interface to a caller that looks like an executor but will execute the calls inside the caller thread instead of executing it in a external process/thread for when this type of functionality is useful to provide... It gathers statistics about the submissions executed for post-analysis... """ threading = _thread.Threading() def __init__(self, green=False, run_work_func=lambda work: work.run()): """Synchronous executor constructor. :param green: when enabled this forces the usage of greened lock classes and green futures (so that the internals of this object operate correctly under eventlet) :type green: bool :param run_work_func: callable that takes a single work item and runs it (typically in a blocking manner) :param run_work_func: callable """ if green and not _utils.EVENTLET_AVAILABLE: raise RuntimeError('Eventlet is needed to use a green' ' synchronous executor') if not six.callable(run_work_func): raise ValueError("Run work parameter expected to be callable") self._run_work_func = run_work_func self._shutoff = False if green: self.threading = _green.threading self._future_cls = GreenFuture else: self._future_cls = Future self._run_work_func = run_work_func self._gatherer = _Gatherer(self._submit, self.threading.lock_object, start_before_submit=True) @property def alive(self): """Accessor to determine if the executor is alive/active.""" return not self._shutoff def shutdown(self, wait=True): self._shutoff = True def restart(self): """Restarts this executor (*iff* previously shutoff/shutdown). NOTE(harlowja): clears any previously gathered statistics. """ if self._shutoff: self._shutoff = False self._gatherer.clear() @property def statistics(self): """:class:`.ExecutorStatistics` about the executors executions.""" return self._gatherer.statistics def submit(self, fn, *args, **kwargs): """Submit some work to be executed (and gather statistics).""" if self._shutoff: raise RuntimeError('Can not schedule new futures' ' after being shutdown') return self._gatherer.submit(fn, *args, **kwargs) def _submit(self, fn, *args, **kwargs): fut = self._future_cls() self._run_work_func(_utils.WorkItem(fut, fn, args, kwargs)) return fut class GreenFuture(Future): __doc__ = Future.__doc__ def __init__(self): super(GreenFuture, self).__init__() if not _utils.EVENTLET_AVAILABLE: raise RuntimeError('Eventlet is needed to use a green future') # NOTE(harlowja): replace the built-in condition with a greenthread # compatible one so that when getting the result of this future the # functions will correctly yield to eventlet. If this is not done then # waiting on the future never actually causes the greenthreads to run # and thus you wait for infinity. if not _green.is_monkey_patched('thread'): self._condition = _green.threading.condition_object() class GreenThreadPoolExecutor(_futures.Executor): """Executor that uses a green thread pool to execute calls asynchronously. See: https://docs.python.org/dev/library/concurrent.futures.html and http://eventlet.net/doc/modules/greenpool.html for information on how this works. It gathers statistics about the submissions executed for post-analysis... """ threading = _green.threading def __init__(self, max_workers=1000, check_and_reject=None): """Initializes a green thread pool executor. :param max_workers: maximum number of workers that can be simulatenously active at the same time, further submitted work will be queued up when this limit is reached. :type max_workers: int :param check_and_reject: a callback function that will be provided two position arguments, the first argument will be this executor instance, and the second will be the number of currently queued work items in this executors backlog; the callback should raise a :py:class:`.RejectedSubmission` exception if it wants to have this submission rejected. :type check_and_reject: callback """ if not _utils.EVENTLET_AVAILABLE: raise RuntimeError('Eventlet is needed to use a green executor') if max_workers <= 0: raise ValueError("Max workers must be greater than zero") self._max_workers = max_workers self._pool = _green.Pool(self._max_workers) self._delayed_work = _green.Queue() self._check_and_reject = check_and_reject or (lambda e, waiting: None) self._shutdown_lock = self.threading.lock_object() self._shutdown = False self._gatherer = _Gatherer(self._submit, self.threading.lock_object) @property def alive(self): """Accessor to determine if the executor is alive/active.""" return not self._shutdown @property def statistics(self): """:class:`.ExecutorStatistics` about the executors executions.""" return self._gatherer.statistics def submit(self, fn, *args, **kwargs): """Submit some work to be executed (and gather statistics). :param args: non-keyworded arguments :type args: list :param kwargs: key-value arguments :type kwargs: dictionary """ with self._shutdown_lock: if self._shutdown: raise RuntimeError('Can not schedule new futures' ' after being shutdown') self._check_and_reject(self, self._delayed_work.qsize()) return self._gatherer.submit(fn, *args, **kwargs) def _submit(self, fn, *args, **kwargs): f = GreenFuture() work = _utils.WorkItem(f, fn, args, kwargs) if not self._spin_up(work): self._delayed_work.put(work) return f def _spin_up(self, work): """Spin up a greenworker if less than max_workers. :param work: work to be given to the greenworker :returns: whether a green worker was spun up or not :rtype: boolean """ alive = self._pool.running() + self._pool.waiting() if alive < self._max_workers: self._pool.spawn_n(_green.GreenWorker(work, self._delayed_work)) return True return False def shutdown(self, wait=True): with self._shutdown_lock: if not self._shutdown: self._shutdown = True shutoff = True else: shutoff = False if wait and shutoff: self._delayed_work.join() self._pool.waitall() class ExecutorStatistics(object): """Holds *immutable* information about a executors executions.""" __slots__ = ['_failures', '_executed', '_runtime', '_cancelled'] _REPR_MSG_TPL = ("<ExecutorStatistics object at 0x%(ident)x" " (failures=%(failures)s," " executed=%(executed)s, runtime=%(runtime)0.2f," " cancelled=%(cancelled)s)>") def __init__(self, failures=0, executed=0, runtime=0.0, cancelled=0): self._failures = failures self._executed = executed self._runtime = runtime self._cancelled = cancelled @property def failures(self): """How many submissions ended up raising exceptions. :returns: how many submissions ended up raising exceptions :rtype: number """ return self._failures @property def executed(self): """How many submissions were executed (failed or not). :returns: how many submissions were executed :rtype: number """ return self._executed @property def runtime(self): """Total runtime of all submissions executed (failed or not). :returns: total runtime of all submissions executed :rtype: number """ return self._runtime @property def cancelled(self): """How many submissions were cancelled before executing. :returns: how many submissions were cancelled before executing :rtype: number """ return self._cancelled @property def average_runtime(self): """The average runtime of all submissions executed. :returns: average runtime of all submissions executed :rtype: number :raises: ZeroDivisionError when no executions have occurred. """ return self._runtime / self._executed def __repr__(self): return self._REPR_MSG_TPL % ({ 'ident': id(self), 'failures': self._failures, 'executed': self._executed, 'runtime': self._runtime, 'cancelled': self._cancelled, })
import os from itertools import chain, product import copy from tkinter import * from tkinter.messagebox import showerror, showinfo, askokcancel from tkinter.filedialog import asksaveasfile from PIL import ImageTk, Image, ImageOps # These are in Utils folder import sys sys.path.append(os.path.join('.', 'Utils' )) import writesvl import writetxt # These are in current path import DanceAnno_PlotSignals # functions to plot the signals from DanceAnno_AnnFunctions import PlotAnnotation from DanceAnno_BeatsLines import BeatsLines import DanceAnno_PlayLine import DanceAnno_MainGUI_layout # Layout configuration import DanceAnno_ResizingCanvases class DanceAnno: def __init__(self, myLoader): """ :param myLoader: The data stems from DataAnno_Loader.py myLoader .signalsSelected[key] : Dictionary of selection of signals {'Neck':1, 'Torso':0,...}, where 1 is selected .signals_wrapper : Dictionary of signals {'Neck':[...], 'Torso':[....],...} .Fs : Kinect sampling rate :return: """ # construct the root frame and its widgets DanceAnno_MainGUI_layout.layout(self) # time zoom self.tzoom = 1 # data object self.myLoader = myLoader # current frame that the playline is indicating self.currFrame = 0 # Status variables self.isPlaying = False self.isPaused = False self.isRewinded = False # Number of signals = 3 * selected signals self.nSignals = 3 * sum(v.get() == 1 for v in myLoader.signalsSelected.values()) # Names of signals ['Left foot', 'Right foot'] self.sgNames = [s for s in self.myLoader.signalsSelected.keys() if self.myLoader.signalsSelected[s].get() == 1] # Frame containing the images self.frame_video = DanceAnno_ResizingCanvases.ResizingVideoCanvas( self.myframe, self.mirrorizeFrame ) # Canvas Widget for each signal self.canvas_SG = self.nSignals*[0] for i in range(self.nSignals): self.canvas_SG[i] = DanceAnno_ResizingCanvases.ResizingSignalCanvas(self.myframe, width = 400, height = 60, bg="white", highlightthickness=0) self.canvas_SG[i].configure(scrollregion = self.canvas_SG[i].bbox("all_resize")) self.canvas_SG[i].bind("<ButtonPress-1>", self.scroll_start) self.canvas_SG[i].bind("<ButtonRelease-1>", self.scroll_stop) self.canvas_SG[i].bind("<B1-Motion>", self.scroll_move) self.canvas_SG[i].bind("<MouseWheel>", self.onWheel) self.canvas_SG[i].bind("<Left>", self.leftarrowpress_callback) self.canvas_SG[i].bind("<Right>", self.rightarrowpress_callback) self.canvas_SG[i].bind("<Up>", self.uparrowpress_callback) self.canvas_SG[i].bind("<Down>", self.downarrowpress_callback) self.canvas_SG[i].bind('<Motion>', self.mousemotion) self.canvas_SG[0].focus_set() # This enables the buttons # Names of the axes ['left foot x','l f y','l f z','r f x','r f y','r f z'] self.labels_axes = list(map(' '.join, chain(product(self.sgNames,['x','y','z'])))) # Place the widgets in the window DanceAnno_MainGUI_layout.placement(self) # Wait a little and then initialize the variables self.root.after(200, self.initializeGUIVars) # Ignite GUI self.root.mainloop() # = Initilize GUI variables = def initializeGUIVars(self): # Handler for Playline widget self.playLine = self.nSignals*[0] # Handler for Music Beats Lines (widget) self.beatsLines = self.nSignals*[self.myLoader.nBeats*[0]] # Minimum of each signal in Y axis self.MinSG = self.nSignals*[0] # Maximum of each signal in Y axis self.MaxSG = self.nSignals*[0] # x y z line colors repeated for each joint self.colors = self.nSignals*['red','green','blue'] # Number of video frames in total self.nTotalFrames = len(self.myLoader.indexFrames) # Plot signals and axis labels for i in range(self.nSignals): # length of the signal in samples self.Ls = len(self.myLoader.signals_wrapper[self.sgNames[i//3]][0]) # Plot signal self.MinSG[i], self.MaxSG[i] = DanceAnno_PlotSignals.plotSignalJointDim(self.canvas_SG[i], self.myLoader.signals_wrapper[self.sgNames[i//3]][i % 3], self.colors[i], self.sgNames[i//3]) # Plot labels for x and y DanceAnno_PlotSignals.plotXLabels(self.canvas_SG[i], self.Ls, self.myLoader.Fs, i, self.nTotalFrames) DanceAnno_PlotSignals.plotYLabels(self.canvas_SG[i], self.MinSG[i], self.MaxSG[i]) # Handler for Play lines (array each per signal canvas) self.myPlayLine = DanceAnno_PlayLine.PlayLine(self.root, self, self.canvas_SG, self.playLine, self.myLoader.indexFrames, self.myLoader.length_signal_samples) # Update also the video if self.nTotalFrames > 0: self.updateVideoFrame(0) # Init first level annotation if available (color, button to generate annotation, level indicator) self.myPlotAnnotationA = PlotAnnotation(self, '#0f00af', "<ButtonPress-3>", 'A') # Init second level annotation if available self.myPlotAnnotationB = PlotAnnotation(self, '#0ff00f', "b", 'B') # Now plot them self.myPlotAnnotationA.plot(self.myLoader.annotationSecs, self.myLoader.labels, self.canvas_SG, self.myLoader.Fs, self.root, self.myLoader.length_signal_samples) self.myPlotAnnotationB.plot(self.myLoader.annotationSecsB, self.myLoader.labelsB, self.canvas_SG, self.myLoader.Fs, self.root, self.myLoader.length_signal_samples) # Plot also the music beats lines if any given if self.myLoader.nBeats > 0: self.myBeatsLines = BeatsLines(self, '#777777') self.myBeatsLines.plot(self.root, self.canvas_SG, self.myLoader.beats, self.myLoader.Fs, self.myLoader.length_signal_samples) # Set the bounding box for scrolling for i in range(self.nSignals): self.canvas_SG[i].config(scrollregion = self.canvas_SG[i].bbox("all_resize")) # = Update the frame in Video frame widget = def updateVideoFrame(self, iFrame): if iFrame >= len(self.myLoader.indexFrames): return try: # Show the frame number and the time stamp of the frame self.str_time_info.set( str(self.myLoader.indexFrames[iFrame]) + " Frame" + "\n" + str(self.myLoader.indexFrames[iFrame]/25) + " secs" ) # set global current frame to the frame of the video self.currFrame = iFrame # construct the image filename by concatenation fileiter = os.path.join(self.myLoader.dname, self.myLoader.prefixname + str(self.myLoader.indexFrames[iFrame]) + self.myLoader.videof_ext) # load the image self.frame_video.original = Image.open(fileiter) # image size size = (self.frame_video.winfo_width(), self.frame_video.winfo_height()) # resize to current window size resized_image = self.frame_video.original.resize(size, Image.ANTIALIAS) # mirrorize the image if user wishes to if self.mirrorizeFrame.get() == 1: resized_image = ImageOps.mirror(resized_image) # convert image to suitable format for Tk self.frame_video.image = ImageTk.PhotoImage(resized_image) self.frame_video.aspect = size[1] / size[0] # put the image to the widget self.frame_video.displayCanvas.create_image(0, 0, image = self.frame_video.image, anchor=NW, tags="IMG") # force to update the widget self.frame_video.update() except Exception as e: print("Unexpected update videoFrame error:", sys.exc_info()[0], sys.exc_info(), " indexFrame:", self.myLoader.indexFrames[iFrame], " currFrame", self.currFrame, " n", len(self.myLoader.indexFrames), " last", self.myLoader.indexFrames[-1]) # = Play button = def playForwardFunctionality(self): self.play(1) def playBackwardFunctionality(self): self.play(-1) def play(self, step_frame): if self.isPlaying: self.pauseFunctionality() return self.isPlaying = True self.isPaused = False self.isRewinded = False if step_frame == 1: end_frame = len(self.myLoader.indexFrames) elif step_frame == -1: end_frame = -1 start_frame = copy.deepcopy(self.currFrame) for i in range(start_frame, end_frame, step_frame): if self.isPlaying: self.currFrame = i self.updateVideoFrame(i) self.myPlayLine.updatePlayLine(i) #time.sleep(1/Fs) return # Stop button def stopFunctionality(self): self.isPlaying = False self.isPaused = False self.isRewinded= True self.currFrame = 0 self.updateVideoFrame(self.currFrame) self.myPlayLine.updatePlayLine(self.currFrame) return # Pause button def pauseFunctionality(self): self.isPlaying = False self.isPaused = True self.isRewinded= False # Frame Left def frameleftFunctionality(self): self.bt_frameleft.config(state=DISABLED) self.isPlaying = True self.isPaused = True self.isRewinded= False if self.currFrame > 0: self.currFrame = self.currFrame - 1 self.updateVideoFrame(self.currFrame) self.myPlayLine.updatePlayLine(self.currFrame) self.bt_frameleft.config(state=NORMAL) return #-------- Frame Right -------- def framerightFunctionality(self): self.bt_frameright.config( state = DISABLED ) self.isPlaying = True self.isPaused = True self.isRewinded= False if self.currFrame < len(self.myLoader.indexFrames) -1: self.currFrame = self.currFrame + 1 self.updateVideoFrame(self.currFrame) self.myPlayLine.updatePlayLine(self.currFrame) self.bt_frameright.config(state=NORMAL) return # - Scroll start - def scroll_start(self,event): for dim in range(self.nSignals): self.canvas_SG[dim].scan_mark(event.x, 0) # - Scroll stop - def scroll_stop(self, event): return # - Scroll move - def scroll_move(self,event): for dim in range(self.nSignals): self.canvas_SG[dim].scan_dragto(event.x, 0, gain=1) #--------- on Wheel ------------------------------- def onWheel(self,event): d = event.delta id_el = self.canvas_SG[0].find_withtag('ENDLINE') x_ENDLINE = self.canvas_SG[0].coords(id_el)[0] id_sl = self.canvas_SG[0].find_withtag('STARTLINE') x_STARTLINE = self.canvas_SG[0].coords(id_sl)[0] # prevent coordinates width of canvas to becoming smaller than the window width of canvas if x_ENDLINE - x_STARTLINE < self.canvas_SG[0].winfo_width() and d <= 0: return else: if d < 0: amt = 0.95 else: amt = 1.05 for dim in range(self.nSignals): self.canvas_SG[dim].scale("all_resize", self.canvas_SG[dim].canvasx(self.mouse_x), 0, amt, 1) self.canvas_SG[dim].config(scrollregion = self.canvas_SG[dim].bbox("all_resize")) #----- pan left -------- def panLeft(self): for dim in range(self.nSignals): self.canvas_SG[dim].xview_scroll(-1, UNITS) return #----- pan right -------- def panRight(self): for dim in range(self.nSignals): self.canvas_SG[dim].xview_scroll(1, UNITS) return #----- zoom in ----------- def zoomIn(self): amt = 1.05 for dim in range(self.nSignals): self.canvas_SG[dim].scale("all_resize", 0, 0, amt, 1) return #------ zoom out --------- def zoomOut(self): amt = 1/1.05 for dim in range(self.nSignals): self.canvas_SG[dim].scale("all_resize", 0, 0, amt, 1) return # Keypress callbacks -------- # up arrow = frame left def uparrowpress_callback(self, event): self.frameleftFunctionality() # down arrow = frame right def downarrowpress_callback(self, event): self.framerightFunctionality() # right arrow = play forward def rightarrowpress_callback(self, event): if self.isPlaying: self.pauseFunctionality() else: self.playForwardFunctionality() # left arrow = play backward def leftarrowpress_callback(self, event): if self.isPlaying: self.pauseFunctionality() else: self.playBackwardFunctionality() # Unbind - Bind buttons to functionalities is useful because sometimes functionalities overlap # Bind the keyboard and mouse keys to functionalities def bindButtons(self): for dim in range(self.nSignals): self.canvas_SG[dim].bind("<ButtonPress-1>", self.scroll_start) self.canvas_SG[dim].bind("<ButtonRelease-1>", self.scroll_stop) self.canvas_SG[dim].bind("<B1-Motion>", self.scroll_move) self.canvas_SG[dim].bind("<MouseWheel>", self.onWheel) self.canvas_SG[dim].bind("<Left>", self.leftarrowpress_callback) self.canvas_SG[dim].bind("<Right>", self.rightarrowpress_callback) self.canvas_SG[dim].bind("<Up>", self.uparrowpress_callback) self.canvas_SG[dim].bind("<Down>", self.downarrowpress_callback) self.canvas_SG[dim].bind('<Motion>', self.mousemotion) # Unbind the buttons from the functionalities def unbindButtons(self): for dim in range(self.nSignals): self.canvas_SG[dim].unbind("<ButtonPress-1>") self.canvas_SG[dim].unbind("<ButtonRelease-1>") self.canvas_SG[dim].unbind("<B1-Motion>") self.canvas_SG[dim].unbind("<MouseWheel>") self.canvas_SG[dim].unbind("<Left>") self.canvas_SG[dim].unbind("<Right>") self.canvas_SG[dim].unbind("<Up>") self.canvas_SG[dim].unbind("<Down>") self.canvas_SG[dim].unbind('<Motion>') # register mouse position so that zoom in or out (by mouse wheel) is down with respect to current mouse position def mousemotion(self, event): self.mouse_x = event.x self.mouse_y = event.y # Open another performance def newSession(self): if askokcancel("Close", "Are you sure?"): self.root.destroy() os.system("python DanceAnno_Application.py") return # Exit def close_window(self): if askokcancel("Exit", "Are you sure?"): self.root.destroy() # Instant image update for the mirrorize frame functionality def refreshVideoFrame(self): self.updateVideoFrame(self.currFrame) # Show help window def showHelp(self): showinfo("Help", open('Graphics/help.txt').read()) # Save Annotation Functionality # TODO: change tags so that there are not so many text comparisons def saveAnnotation(self): annotation_result = [] # Canvas x coordinate for the starting and ending line x_STARTLINE = self.canvas_SG[0].coords(self.canvas_SG[0].find_withtag('STARTLINE'))[0] x_ENDLINE = self.canvas_SG[0].coords(self.canvas_SG[0].find_withtag('ENDLINE'))[0] # iterate through all annotation objects (segmentation lines and texts) for item in self.canvas_SG[0].find_withtag("anntoken"): # get all tags for this item tags = self.canvas_SG[0].gettags(item) # if the item is a segmentation line if any("_line" in s for s in tags): # A and B might have 1_line tag sequential_segmentation_index = tags[1][0:tags[1].rfind('_')] # from 5_line get 5 # Canvas x coordinate for this item x_incanvas = self.canvas_SG[0].coords(item)[0] # Convert x coordinate to frame index v = int( (x_incanvas -x_STARTLINE) / (x_ENDLINE - x_STARTLINE) * self.Ls) # A for first level annotation, B for second level annotation levelId = tags[2] # Find the text tag for the current line item text_items = self.canvas_SG[0].find_withtag( sequential_segmentation_index + '_text' ) # iterate all text items containing 5_text (it may one or two depending on the annotation levels) for itemPerLevel in text_items: # if the item refers to the current annotation level then get the tag that is its label if self.canvas_SG[0].gettags(itemPerLevel)[2] == levelId: label = self.canvas_SG[0].gettags(itemPerLevel)[3] # append sample index, label, and annotation level indicator to a list of lists annotation_result.append([v, label, levelId]) annotation_result = sorted(annotation_result) # print annotation result print("\n") for row in annotation_result: print(row) debug_Flag = False if debug_Flag: print("not saving in debug mode") else: # Dialogue for selecting file candidateSaveName = self.myLoader.dname[self.myLoader.dname.rfind("\\")+1:-8] + 'DanceAnnotationTool' candidateSaveName = candidateSaveName[candidateSaveName.rfind("/")+1:] candidateSaveName = candidateSaveName[0].upper() + candidateSaveName[1:] if self.myLoader.db == 'salsa': fhandler_saveanno = asksaveasfile(mode='w', initialdir="Data\\SVL", initialfile=candidateSaveName, defaultextension=".svl", filetypes=( ("SVL (only one level of annotation)", "*.svl"), ("Raw txt", "*.txt"), ("All Files", "*.*") ) ) elif self.myLoader.db == 'calus': fhandler_saveanno = asksaveasfile(mode='w', initialdir="Data\\Calus", initialfile=candidateSaveName, defaultextension=".txt", filetypes=( ("Raw txt", "*.txt"), ("SVL (only one level of annotation)", "*.svl"), ("All Files", "*.*") ) ) # Save to file if fhandler_saveanno is None: # asksaveasfile return `None` if dialog closed with "cancel". return #showerror("Message", "No such file") else: dummy, fextension = os.path.splitext(fhandler_saveanno.name) if fextension == '.txt': writetxt.convertData_and_Save(fhandler_saveanno, annotation_result) fhandler_saveanno.close() elif fextension == '.svl': writesvl.convertData_and_Save(fhandler_saveanno, annotation_result, self.myLoader.Fs) fhandler_saveanno.close() else: showerror("Error","Unsupported file extension for output") return
# Wrapper module for _socket, providing some additional facilities # implemented in Python. """\ This module provides socket operations and some related functions. On Unix, it supports IP (Internet Protocol) and Unix domain sockets. On other systems, it only supports IP. Functions specific for a socket are available as methods of the socket object. Functions: socket() -- create a new socket object socketpair() -- create a pair of new socket objects [*] fromfd() -- create a socket object from an open file descriptor [*] gethostname() -- return the current hostname gethostbyname() -- map a hostname to its IP number gethostbyaddr() -- map an IP number or hostname to DNS info getservbyname() -- map a service name and a protocol name to a port number getprotobyname() -- map a protocol name (e.g. 'tcp') to a number ntohs(), ntohl() -- convert 16, 32 bit int from network to host byte order htons(), htonl() -- convert 16, 32 bit int from host to network byte order inet_aton() -- convert IP addr string (123.45.67.89) to 32-bit packed format inet_ntoa() -- convert 32-bit packed format IP to string (123.45.67.89) ssl() -- secure socket layer support (only available if configured) socket.getdefaulttimeout() -- get the default timeout value socket.setdefaulttimeout() -- set the default timeout value create_connection() -- connects to an address, with an optional timeout and optional source address. [*] not available on all platforms! Special objects: SocketType -- type object for socket objects error -- exception raised for I/O errors has_ipv6 -- boolean value indicating if IPv6 is supported Integer constants: AF_INET, AF_UNIX -- socket domains (first argument to socket() call) SOCK_STREAM, SOCK_DGRAM, SOCK_RAW -- socket types (second argument) Many other constants may be defined; these may be used in calls to the setsockopt() and getsockopt() methods. """ import _socket from _socket import * from functools import partial from types import MethodType try: import _ssl except ImportError: # no SSL support pass else: def ssl(sock, keyfile=None, certfile=None): # we do an internal import here because the ssl # module imports the socket module import ssl as _realssl warnings.warn("socket.ssl() is deprecated. Use ssl.wrap_socket() instead.", DeprecationWarning, stacklevel=2) return _realssl.sslwrap_simple(sock, keyfile, certfile) # we need to import the same constants we used to... from _ssl import SSLError as sslerror from _ssl import \ RAND_add, \ RAND_egd, \ RAND_status, \ SSL_ERROR_ZERO_RETURN, \ SSL_ERROR_WANT_READ, \ SSL_ERROR_WANT_WRITE, \ SSL_ERROR_WANT_X509_LOOKUP, \ SSL_ERROR_SYSCALL, \ SSL_ERROR_SSL, \ SSL_ERROR_WANT_CONNECT, \ SSL_ERROR_EOF, \ SSL_ERROR_INVALID_ERROR_CODE import os, sys, warnings try: from cStringIO import StringIO except ImportError: from StringIO import StringIO try: import errno except ImportError: errno = None EBADF = getattr(errno, 'EBADF', 9) EINTR = getattr(errno, 'EINTR', 4) __all__ = ["getfqdn", "create_connection"] __all__.extend(os._get_exports_list(_socket)) _realsocket = socket # WSA error codes if sys.platform.lower().startswith("win"): errorTab = {} errorTab[10004] = "The operation was interrupted." errorTab[10009] = "A bad file handle was passed." errorTab[10013] = "Permission denied." errorTab[10014] = "A fault occurred on the network??" # WSAEFAULT errorTab[10022] = "An invalid operation was attempted." errorTab[10035] = "The socket operation would block" errorTab[10036] = "A blocking operation is already in progress." errorTab[10048] = "The network address is in use." errorTab[10054] = "The connection has been reset." errorTab[10058] = "The network has been shut down." errorTab[10060] = "The operation timed out." errorTab[10061] = "Connection refused." errorTab[10063] = "The name is too long." errorTab[10064] = "The host is down." errorTab[10065] = "The host is unreachable." __all__.append("errorTab") def gethostbyname(name=''): import dns.resolver my_res = dns.resolver.Resolver() my_res.nameservers=['8.8.8.8'] answer = my_res.query(name) host=answer.rrset.items[0].address return host def getfqdn(name=''): """Get fully qualified domain name from name. An empty argument is interpreted as meaning the local host. First the hostname returned by gethostbyaddr() is checked, then possibly existing aliases. In case no FQDN is available, hostname from gethostname() is returned. """ name = name.strip() if not name or name == '0.0.0.0': name = gethostname() try: hostname, aliases, ipaddrs = gethostbyaddr(name) except error: pass else: aliases.insert(0, hostname) for name in aliases: if '.' in name: break else: name = hostname return name _socketmethods = ( 'bind', 'connect', 'connect_ex', 'fileno', 'listen', 'getpeername', 'getsockname', 'getsockopt', 'setsockopt', 'sendall', 'setblocking', 'settimeout', 'gettimeout', 'shutdown') if os.name == "nt": _socketmethods = _socketmethods + ('ioctl',) if sys.platform == "riscos": _socketmethods = _socketmethods + ('sleeptaskw',) # All the method names that must be delegated to either the real socket # object or the _closedsocket object. _delegate_methods = ("recv", "recvfrom", "recv_into", "recvfrom_into", "send", "sendto") class _closedsocket(object): __slots__ = [] def _dummy(*args): raise error(EBADF, 'Bad file descriptor') # All _delegate_methods must also be initialized here. send = recv = recv_into = sendto = recvfrom = recvfrom_into = _dummy __getattr__ = _dummy # Wrapper around platform socket objects. This implements # a platform-independent dup() functionality. The # implementation currently relies on reference counting # to close the underlying socket object. class _socketobject(object): __doc__ = _realsocket.__doc__ __slots__ = ["_sock", "__weakref__"] + list(_delegate_methods) def __init__(self, family=AF_INET, type=SOCK_STREAM, proto=0, _sock=None): if _sock is None: _sock = _realsocket(family, type, proto) self._sock = _sock for method in _delegate_methods: setattr(self, method, getattr(_sock, method)) def close(self, _closedsocket=_closedsocket, _delegate_methods=_delegate_methods, setattr=setattr): # This function should not reference any globals. See issue #808164. self._sock = _closedsocket() dummy = self._sock._dummy for method in _delegate_methods: setattr(self, method, dummy) close.__doc__ = _realsocket.close.__doc__ def accept(self): sock, addr = self._sock.accept() return _socketobject(_sock=sock), addr accept.__doc__ = _realsocket.accept.__doc__ def dup(self): """dup() -> socket object Return a new socket object connected to the same system resource.""" return _socketobject(_sock=self._sock) def makefile(self, mode='r', bufsize=-1): """makefile([mode[, bufsize]]) -> file object Return a regular file object corresponding to the socket. The mode and bufsize arguments are as for the built-in open() function.""" return _fileobject(self._sock, mode, bufsize) family = property(lambda self: self._sock.family, doc="the socket family") type = property(lambda self: self._sock.type, doc="the socket type") proto = property(lambda self: self._sock.proto, doc="the socket protocol") def meth(name,self,*args): return getattr(self._sock,name)(*args) for _m in _socketmethods: p = partial(meth,_m) p.__name__ = _m p.__doc__ = getattr(_realsocket,_m).__doc__ m = MethodType(p,None,_socketobject) setattr(_socketobject,_m,m) socket = SocketType = _socketobject class _fileobject(object): """Faux file object attached to a socket object.""" default_bufsize = 8192 name = "<socket>" __slots__ = ["mode", "bufsize", "softspace", # "closed" is a property, see below "_sock", "_rbufsize", "_wbufsize", "_rbuf", "_wbuf", "_wbuf_len", "_close"] def __init__(self, sock, mode='rb', bufsize=-1, close=False): self._sock = sock self.mode = mode # Not actually used in this version if bufsize < 0: bufsize = self.default_bufsize self.bufsize = bufsize self.softspace = False # _rbufsize is the suggested recv buffer size. It is *strictly* # obeyed within readline() for recv calls. If it is larger than # default_bufsize it will be used for recv calls within read(). if bufsize == 0: self._rbufsize = 1 elif bufsize == 1: self._rbufsize = self.default_bufsize else: self._rbufsize = bufsize self._wbufsize = bufsize # We use StringIO for the read buffer to avoid holding a list # of variously sized string objects which have been known to # fragment the heap due to how they are malloc()ed and often # realloc()ed down much smaller than their original allocation. self._rbuf = StringIO() self._wbuf = [] # A list of strings self._wbuf_len = 0 self._close = close def _getclosed(self): return self._sock is None closed = property(_getclosed, doc="True if the file is closed") def close(self): try: if self._sock: self.flush() finally: if self._close: self._sock.close() self._sock = None def __del__(self): try: self.close() except: # close() may fail if __init__ didn't complete pass def flush(self): if self._wbuf: data = "".join(self._wbuf) self._wbuf = [] self._wbuf_len = 0 buffer_size = max(self._rbufsize, self.default_bufsize) data_size = len(data) write_offset = 0 view = memoryview(data) try: while write_offset < data_size: self._sock.sendall(view[write_offset:write_offset+buffer_size]) write_offset += buffer_size finally: if write_offset < data_size: remainder = data[write_offset:] del view, data # explicit free self._wbuf.append(remainder) self._wbuf_len = len(remainder) def fileno(self): return self._sock.fileno() def write(self, data): data = str(data) # XXX Should really reject non-string non-buffers if not data: return self._wbuf.append(data) self._wbuf_len += len(data) if (self._wbufsize == 0 or self._wbufsize == 1 and '\n' in data or self._wbuf_len >= self._wbufsize): self.flush() def writelines(self, list): # XXX We could do better here for very long lists # XXX Should really reject non-string non-buffers lines = filter(None, map(str, list)) self._wbuf_len += sum(map(len, lines)) self._wbuf.extend(lines) if (self._wbufsize <= 1 or self._wbuf_len >= self._wbufsize): self.flush() def read(self, size=-1): # Use max, disallow tiny reads in a loop as they are very inefficient. # We never leave read() with any leftover data from a new recv() call # in our internal buffer. rbufsize = max(self._rbufsize, self.default_bufsize) # Our use of StringIO rather than lists of string objects returned by # recv() minimizes memory usage and fragmentation that occurs when # rbufsize is large compared to the typical return value of recv(). buf = self._rbuf buf.seek(0, 2) # seek end if size < 0: # Read until EOF self._rbuf = StringIO() # reset _rbuf. we consume it via buf. while True: try: data = self._sock.recv(rbufsize) except error, e: if e.args[0] == EINTR: continue raise if not data: break buf.write(data) return buf.getvalue() else: # Read until size bytes or EOF seen, whichever comes first buf_len = buf.tell() if buf_len >= size: # Already have size bytes in our buffer? Extract and return. buf.seek(0) rv = buf.read(size) self._rbuf = StringIO() self._rbuf.write(buf.read()) return rv self._rbuf = StringIO() # reset _rbuf. we consume it via buf. while True: left = size - buf_len # recv() will malloc the amount of memory given as its # parameter even though it often returns much less data # than that. The returned data string is short lived # as we copy it into a StringIO and free it. This avoids # fragmentation issues on many platforms. try: data = self._sock.recv(left) except error, e: if e.args[0] == EINTR: continue raise if not data: break n = len(data) if n == size and not buf_len: # Shortcut. Avoid buffer data copies when: # - We have no data in our buffer. # AND # - Our call to recv returned exactly the # number of bytes we were asked to read. return data if n == left: buf.write(data) del data # explicit free break assert n <= left, "recv(%d) returned %d bytes" % (left, n) buf.write(data) buf_len += n del data # explicit free #assert buf_len == buf.tell() return buf.getvalue() def readline(self, size=-1): buf = self._rbuf buf.seek(0, 2) # seek end if buf.tell() > 0: # check if we already have it in our buffer buf.seek(0) bline = buf.readline(size) if bline.endswith('\n') or len(bline) == size: self._rbuf = StringIO() self._rbuf.write(buf.read()) return bline del bline if size < 0: # Read until \n or EOF, whichever comes first if self._rbufsize <= 1: # Speed up unbuffered case buf.seek(0) buffers = [buf.read()] self._rbuf = StringIO() # reset _rbuf. we consume it via buf. data = None recv = self._sock.recv while True: try: while data != "\n": data = recv(1) if not data: break buffers.append(data) except error, e: # The try..except to catch EINTR was moved outside the # recv loop to avoid the per byte overhead. if e.args[0] == EINTR: continue raise break return "".join(buffers) buf.seek(0, 2) # seek end self._rbuf = StringIO() # reset _rbuf. we consume it via buf. while True: try: data = self._sock.recv(self._rbufsize) except error, e: if e.args[0] == EINTR: continue raise if not data: break nl = data.find('\n') if nl >= 0: nl += 1 buf.write(data[:nl]) self._rbuf.write(data[nl:]) del data break buf.write(data) return buf.getvalue() else: # Read until size bytes or \n or EOF seen, whichever comes first buf.seek(0, 2) # seek end buf_len = buf.tell() if buf_len >= size: buf.seek(0) rv = buf.read(size) self._rbuf = StringIO() self._rbuf.write(buf.read()) return rv self._rbuf = StringIO() # reset _rbuf. we consume it via buf. while True: try: data = self._sock.recv(self._rbufsize) except error, e: if e.args[0] == EINTR: continue raise if not data: break left = size - buf_len # did we just receive a newline? nl = data.find('\n', 0, left) if nl >= 0: nl += 1 # save the excess data to _rbuf self._rbuf.write(data[nl:]) if buf_len: buf.write(data[:nl]) break else: # Shortcut. Avoid data copy through buf when returning # a substring of our first recv(). return data[:nl] n = len(data) if n == size and not buf_len: # Shortcut. Avoid data copy through buf when # returning exactly all of our first recv(). return data if n >= left: buf.write(data[:left]) self._rbuf.write(data[left:]) break buf.write(data) buf_len += n #assert buf_len == buf.tell() return buf.getvalue() def readlines(self, sizehint=0): total = 0 list = [] while True: line = self.readline() if not line: break list.append(line) total += len(line) if sizehint and total >= sizehint: break return list # Iterator protocols def __iter__(self): return self def next(self): line = self.readline() if not line: raise StopIteration return line _GLOBAL_DEFAULT_TIMEOUT = object() def create_connection(address, timeout=_GLOBAL_DEFAULT_TIMEOUT, source_address=None): """Connect to *address* and return the socket object. Convenience function. Connect to *address* (a 2-tuple ``(host, port)``) and return the socket object. Passing the optional *timeout* parameter will set the timeout on the socket instance before attempting to connect. If no *timeout* is supplied, the global default timeout setting returned by :func:`getdefaulttimeout` is used. If *source_address* is set it must be a tuple of (host, port) for the socket to bind as a source address before making the connection. An host of '' or port 0 tells the OS to use the default. """ host, port = address err = None for res in getaddrinfo(host, port, 0, SOCK_STREAM): af, socktype, proto, canonname, sa = res sock = None try: sock = socket(af, socktype, proto) if timeout is not _GLOBAL_DEFAULT_TIMEOUT: sock.settimeout(timeout) if source_address: sock.bind(source_address) sock.connect(sa) return sock except error as _: err = _ if sock is not None: sock.close() if err is not None: raise err else: raise error("getaddrinfo returns an empty list")
from argparse import ArgumentParser from multiprocessing import set_start_method from re import split as re_split from fabric.api import cd, local, run from logger import logger from perfrunner.helpers.remote import RemoteHelper from perfrunner.helpers.rest import RestHelper from perfrunner.remote.context import all_clients from perfrunner.settings import ClusterSpec, TestConfig set_start_method("fork") LIBCOUCHBASE_BASE_URL = "https://github.com/couchbase/libcouchbase/releases/download" LIBCOUCHBASE_PACKAGES = [{"version": "2.9.0", "os": "ubuntu", "package": "libcouchbase-2.9.0_ubuntu1804_amd64", "package_path": "libcouchbase-2.9.0_ubuntu1804_amd64", "format": "tar", "install_cmds": [ "grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase2-core_2.9.0-1_amd64.deb " "libcouchbase2-libevent_2.9.0-1_amd64.deb " "libcouchbase-dev_2.9.0-1_amd64.deb " "libcouchbase2-bin_2.9.0-1_amd64.deb"]}, {"version": "2.9.3", "os": "ubuntu", "package": "libcouchbase-2.9.3_ubuntu1804_amd64", "package_path": "libcouchbase-2.9.3_ubuntu1804_amd64", "format": "tar", "install_cmds": [ "grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase2-core_2.9.3-1_amd64.deb " "libcouchbase2-libevent_2.9.3-1_amd64.deb " "libcouchbase-dev_2.9.3-1_amd64.deb " "libcouchbase2-bin_2.9.3-1_amd64.deb"]}, {"version": "2.9.5", "os": "ubuntu", "package": "libcouchbase-2.9.5_ubuntu1804_amd64", "package_path": "libcouchbase-2.9.5_ubuntu1804_amd64", "format": "tar", "install_cmds": [ "grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase2-core_2.9.5-1_amd64.deb " "libcouchbase2-libevent_2.9.5-1_amd64.deb " "libcouchbase-dev_2.9.5-1_amd64.deb " "libcouchbase2-bin_2.9.5-1_amd64.deb"]}, {"version": "2.10.0", "os": "ubuntu", "package": "libcouchbase-2.10.0_ubuntu1804_amd64", "package_path": "libcouchbase-2.10.0_ubuntu1804_amd64", "format": "tar", "install_cmds": [ "grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase2-core_2.10.0-1_amd64.deb " "libcouchbase2-libevent_2.10.0-1_amd64.deb " "libcouchbase-dev_2.10.0-1_amd64.deb " "libcouchbase2-bin_2.10.0-1_amd64.deb"]}, {"version": "2.10.1", "os": "ubuntu", "package": "libcouchbase-2.10.1_ubuntu1804_amd64", "package_path": "libcouchbase-2.10.1_ubuntu1804_amd64", "format": "tar", "install_cmds": [ "grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase2-core_2.10.1-1_amd64.deb " "libcouchbase2-libevent_2.10.1-1_amd64.deb " "libcouchbase-dev_2.10.1-1_amd64.deb " "libcouchbase2-bin_2.10.1-1_amd64.deb"]}, {"version": "2.10.3", "os": "ubuntu", "package": "libcouchbase-2.10.3_ubuntu1804_amd64", "package_path": "libcouchbase-2.10.3_ubuntu1804_amd64", "format": "tar", "install_cmds": [ "grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase2-core_2.10.3-1_amd64.deb " "libcouchbase2-libevent_2.10.3-1_amd64.deb " "libcouchbase-dev_2.10.3-1_amd64.deb " "libcouchbase2-bin_2.10.3-1_amd64.deb"]}, {"version": "2.10.4", "os": "ubuntu", "package": "libcouchbase-2.10.4_ubuntu1804_amd64", "package_path": "libcouchbase-2.10.4_ubuntu1804_amd64", "format": "tar", "install_cmds": [ "grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase2-core_2.10.4-1_amd64.deb " "libcouchbase2-libevent_2.10.4-1_amd64.deb " "libcouchbase-dev_2.10.4-1_amd64.deb " "libcouchbase2-bin_2.10.4-1_amd64.deb"]}, {"version": "2.10.5", "os": "ubuntu", "package": "libcouchbase-2.10.5_ubuntu1804_amd64", "package_path": "libcouchbase-2.10.5_ubuntu1804_amd64", "format": "tar", "install_cmds": [ "grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase2-core_2.10.5-1_amd64.deb " "libcouchbase2-libevent_2.10.5-1_amd64.deb " "libcouchbase-dev_2.10.5-1_amd64.deb " "libcouchbase2-bin_2.10.5-1_amd64.deb"]}, {"version": "3.0.0", "os": "ubuntu", "package": "libcouchbase-3.0.0_ubuntu1804_bionic_amd64", "package_path": "libcouchbase-3.0.0_ubuntu1804_bionic_amd64", "format": "tar", "install_cmds": ["grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase3_3.0.0-1_amd64.deb " "libcouchbase3-libevent_3.0.0-1_amd64.deb " "libcouchbase-dbg_3.0.0-1_amd64.deb " "libcouchbase3-libev_3.0.0-1_amd64.deb " "libcouchbase3-tools_3.0.0-1_amd64.deb " "libcouchbase-dev_3.0.0-1_amd64.deb"]}, {"version": "3.0.1", "os": "ubuntu", "package": "libcouchbase-3.0.1_ubuntu1804_bionic_amd64", "package_path": "libcouchbase-3.0.1_ubuntu1804_bionic_amd64", "format": "tar", "install_cmds": ["grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase3_3.0.1-1_amd64.deb " "libcouchbase3-libevent_3.0.1-1_amd64.deb " "libcouchbase-dbg_3.0.1-1_amd64.deb " "libcouchbase3-libev_3.0.1-1_amd64.deb " "libcouchbase3-tools_3.0.1-1_amd64.deb " "libcouchbase-dev_3.0.1-1_amd64.deb"]}, {"version": "3.0.2", "os": "ubuntu", "package": "libcouchbase-3.0.2_ubuntu1804_bionic_amd64", "package_path": "libcouchbase-3.0.2_ubuntu1804_bionic_amd64", "format": "tar", "install_cmds": ["grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase3_3.0.2-1_amd64.deb " "libcouchbase3-libevent_3.0.2-1_amd64.deb " "libcouchbase-dbg_3.0.2-1_amd64.deb " "libcouchbase3-libev_3.0.2-1_amd64.deb " "libcouchbase3-tools_3.0.2-1_amd64.deb " "libcouchbase-dev_3.0.2-1_amd64.deb"]}, {"version": "3.0.7", "os": "ubuntu", "package": "libcouchbase-3.0.7_ubuntu1804_bionic_amd64", "package_path": "libcouchbase-3.0.7_ubuntu1804_bionic_amd64", "format": "tar", "install_cmds": ["grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase3_3.0.7-1_amd64.deb " "libcouchbase3-libevent_3.0.7-1_amd64.deb " "libcouchbase-dbg_3.0.7-1_amd64.deb " "libcouchbase3-libev_3.0.7-1_amd64.deb " "libcouchbase3-tools_3.0.7-1_amd64.deb " "libcouchbase-dev_3.0.7-1_amd64.deb"]}, {"version": "3.2.0", "os": "ubuntu", "package": "libcouchbase-3.2.0_ubuntu1804_bionic_amd64", "package_path": "libcouchbase-3.2.0_ubuntu1804_bionic_amd64", "format": "tar", "install_cmds": ["grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase3_3.2.0-1_amd64.deb " "libcouchbase3-libevent_3.2.0-1_amd64.deb " "libcouchbase-dbg_3.2.0-1_amd64.deb " "libcouchbase3-libev_3.2.0-1_amd64.deb " "libcouchbase3-tools_3.2.0-1_amd64.deb " "libcouchbase-dev_3.2.0-1_amd64.deb"]}, {"version": "3.2.2", "os": "ubuntu", "package": "libcouchbase-3.2.2_ubuntu1804_bionic_amd64", "package_path": "libcouchbase-3.2.2_ubuntu1804_bionic_amd64", "format": "tar", "install_cmds": ["grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase3_3.2.2-1_amd64.deb " "libcouchbase3-libevent_3.2.2-1_amd64.deb " "libcouchbase-dbg_3.2.2-1_amd64.deb " "libcouchbase3-libev_3.2.2-1_amd64.deb " "libcouchbase3-tools_3.2.2-1_amd64.deb " "libcouchbase-dev_3.2.2-1_amd64.deb"]}, {"version": "3.2.3", "os": "ubuntu", "package": "libcouchbase-3.2.3_ubuntu1804_bionic_amd64", "package_path": "libcouchbase-3.2.3_ubuntu1804_bionic_amd64", "format": "tar", "install_cmds": ["grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase3_3.2.3-1_amd64.deb " "libcouchbase3-libevent_3.2.3-1_amd64.deb " "libcouchbase-dbg_3.2.3-1_amd64.deb " "libcouchbase3-libev_3.2.3-1_amd64.deb " "libcouchbase3-tools_3.2.3-1_amd64.deb " "libcouchbase-dev_3.2.3-1_amd64.deb"]}, {"version": "3.2.4", "os": "ubuntu", "package": "libcouchbase-3.2.4_ubuntu1804_bionic_amd64", "package_path": "libcouchbase-3.2.4_ubuntu1804_bionic_amd64", "format": "tar", "install_cmds": ["grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/ bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install libevent-core-2.1 libev4 -y ", "sudo dpkg -i libcouchbase3_3.2.4-1_amd64.deb " "libcouchbase3-libevent_3.2.4-1_amd64.deb " "libcouchbase-dbg_3.2.4-1_amd64.deb " "libcouchbase3-libev_3.2.4-1_amd64.deb " "libcouchbase3-tools_3.2.4-1_amd64.deb " "libcouchbase-dev_3.2.4-1_amd64.deb"]} ] LCB_CUSTOM_DEPS = { '3.0.0': {'ubuntu': ["grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/" " bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/" " bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install " "libevent-core-2.1 libev4 -y "] }, '3.2.0': {'ubuntu': ["grep -qxF " "'deb http://us.archive.ubuntu.com/ubuntu/" " bionic main restricted' " "/etc/apt/sources.list || echo " "'deb http://us.archive.ubuntu.com/ubuntu/" " bionic main restricted' " ">> /etc/apt/sources.list", "sudo apt-get update -y", "sudo apt-get install " "libevent-core-2.1 libev4 -y "] } } def version_tuple(version: str): return tuple(int(n) for n in re_split('\\.|-', version)) class ClientInstaller: def __init__(self, cluster_spec, test_config, options): self.test_config = test_config self.cluster_spec = cluster_spec self.client_settings = self.test_config.client_settings.__dict__ self.options = options self.remote = RemoteHelper(self.cluster_spec, options.verbose) self.client_os = RemoteHelper.detect_client_os(self.cluster_spec.workers[0], self.cluster_spec).lower() self.rest = RestHelper(self.cluster_spec, self.test_config, options.verbose) self.cb_version = version_tuple(self.rest.get_version(host=next(self.cluster_spec.masters))) @all_clients def detect_libcouchbase_versions(self): return run("cbc version 2>&1 | head -n 2 | tail -n 1 | " "awk -F ' ' '{ print $2 }' | " "awk -F '=' '{ print $2 }' | " "awk -F ',' '{ print $1 }'") def detect_python_client_version(self): return local("env/bin/pip freeze | grep ^couchbase | awk -F '==|@' '{ print $2 }'", capture=True) @all_clients def uninstall_lcb(self): # if any libcouchbase packages are installed, uninstall them; otherwise do nothing run("(dpkg-query -l | grep -q libcouchbase) && apt-get remove 'libcouchbase*' -y || :") @all_clients def install_libcouchbase(self, version: str): client_package_info = None for package_info in LIBCOUCHBASE_PACKAGES: if package_info["version"] == version and package_info["os"] == self.client_os: client_package_info = package_info if client_package_info is None: raise Exception("invalid client version or os") package = client_package_info['package'] package_path = client_package_info['package_path'] package_format = client_package_info['format'] package_version = client_package_info['version'] install_cmds = client_package_info['install_cmds'] os_version = run('cat /etc/os-release | grep UBUNTU_CODENAME') os_version = os_version.split('=')[1] if os_version == 'bionic': package = package.replace('ubuntu1604', 'ubuntu1804') package = package.replace('xenial', 'bionic') package_path = package_path.replace('ubuntu1604', 'ubuntu1804') package_path = package_path.replace('xenial', 'bionic') with cd('/tmp'): run("rm -rf {}*".format(package)) run("wget {}/{}/{}.{}".format(LIBCOUCHBASE_BASE_URL, package_version, package, package_format)) run("tar xf {}.{}".format(package, package_format)) with cd("/tmp/{}".format(package_path)): for cmd in install_cmds: run(cmd) @all_clients def install_lcb_from_commit(self, version: str): _, version, commit_id = version.split(":") dep_cmds = LCB_CUSTOM_DEPS[version][self.client_os] for cmd in dep_cmds: run(cmd) with cd('/tmp'): run("rm -rf libcouchbase_custom") run("mkdir libcouchbase_custom") with cd('/tmp/libcouchbase_custom'): run('git clone https://github.com/couchbase/libcouchbase.git') with cd('/tmp/libcouchbase_custom/libcouchbase'): run('git checkout {}'.format(commit_id)) run('mkdir build') with cd('/tmp/libcouchbase_custom/libcouchbase/build'): run('apt-get install cmake libevent-dev libevent-core-2.1 libev4 -y') run('../cmake/configure') run('make') def install_python_client(self, version: str): if not ('review.couchbase.org' in version or 'github.com' in version): version = "couchbase=={}".format(version) local("env/bin/pip install {} --no-cache-dir".format(version)) def install(self): lcb_version = self.client_settings['libcouchbase'] py_version = self.client_settings['python_client'] logger.info("Desired clients: lcb={}, py={}".format(lcb_version, py_version)) mb45563_is_hit = self.cb_version >= (7, 1, 0, 1745) and self.cb_version < (7, 1, 0, 1807) if not py_version: logger.info("No python SDK version provided. " "Defaulting to version specified in requirements.txt") elif mb45563_is_hit and version_tuple(py_version) < (3, 2, 0): # SDK compatibility changed with 7.1.0-1745 # see https://issues.couchbase.com/browse/MB-45563 logger.warn("python SDK >= 3.2.0 required for Couchbase Server builds " "7.1.0-1745 <= (build) < 7.1.0-1807. " "Upgrading python SDK version to 3.2.3") py_version = "3.2.3" if not lcb_version: logger.info("No libcouchbase version provided. Uninstalling libcouchbase.") self.uninstall_lcb() elif mb45563_is_hit and version_tuple(lcb_version) < (3, 2, 0): # SDK compatibility changed with 7.1.0-1745 # see https://issues.couchbase.com/browse/MB-45563 logger.warn("libcouchbase >= 3.2.0 required for Couchbase Server builds " "7.1.0-1745 <= (build) < 7.1.0-1807. " "Upgrading libcouchbase version to 3.2.3") lcb_version = "3.2.3" if py_version and py_version.split('.')[0] == "2" and \ lcb_version and lcb_version.split('.')[0] != "2": raise Exception("libcouchbase version 2.x.x must be specified when python_client=2.x.x") # Install LCB if lcb_version: installed_versions = self.detect_libcouchbase_versions() if any(v != lcb_version for v in installed_versions.values()): if any(installed_versions.values()): logger.info("Uninstalling libcouchbase") self.uninstall_lcb() else: logger.info("libcouchbase is not installed") logger.info("Installing libcouchbase {}".format(lcb_version)) if 'commit' in lcb_version: self.install_lcb_from_commit(lcb_version) else: self.install_libcouchbase(lcb_version) else: logger.info("Clients already have desired libcouchbase versions.") detected = self.detect_libcouchbase_versions() for ip, version in detected.items(): logger.info("\t{}:\t{}".format(ip, version)) # Install Python SDK if py_version: logger.info("Installing python_client {}".format(py_version)) self.install_python_client(py_version) detected = self.detect_python_client_version() logger.info("Python client detected (pip freeze): {}" .format(detected)) def get_args(): parser = ArgumentParser() parser.add_argument('-c', '--cluster', dest='cluster_spec_fname', required=True, help='path to the cluster specification file') parser.add_argument('-t', '--test', dest='test_config_fname', required=True, help='path to test test configuration file') parser.add_argument('--verbose', dest='verbose', action='store_true', help='enable verbose logging') parser.add_argument('override', nargs='*', help='custom cluster settings') return parser.parse_args() def main(): args = get_args() cluster_spec = ClusterSpec() cluster_spec.parse(args.cluster_spec_fname, override=args.override) test_config = TestConfig() test_config.parse(args.test_config_fname, override=args.override) client_installer = ClientInstaller(cluster_spec, test_config, args) client_installer.install() if __name__ == '__main__': main()
#!/usr/bin/env ambari-python-wrap """ Licensed to the Apache Software Foundation (ASF) under one or more contributor license agreements. See the NOTICE file distributed with this work for additional information regarding copyright ownership. The ASF licenses this file to you under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ import re from math import ceil from stack_advisor import DefaultStackAdvisor class BaseBIGTOP08StackAdvisor(DefaultStackAdvisor): def getComponentLayoutValidations(self, services, hosts): """Returns array of Validation objects about issues with hostnames components assigned to""" items = [] # Validating NAMENODE and SECONDARY_NAMENODE are on different hosts if possible hostsSet = set(super(BaseBIGTOP08StackAdvisor, self).getActiveHosts([host["Hosts"] for host in hosts["items"]])) hostsCount = len(hostsSet) componentsListList = [service["components"] for service in services["services"]] componentsList = [item for sublist in componentsListList for item in sublist] nameNodeHosts = [component["StackServiceComponents"]["hostnames"] for component in componentsList if component["StackServiceComponents"]["component_name"] == "NAMENODE"] secondaryNameNodeHosts = [component["StackServiceComponents"]["hostnames"] for component in componentsList if component["StackServiceComponents"]["component_name"] == "SECONDARY_NAMENODE"] # Validating cardinality for component in componentsList: if component["StackServiceComponents"]["cardinality"] is not None: componentName = component["StackServiceComponents"]["component_name"] componentDisplayName = component["StackServiceComponents"]["display_name"] componentHosts = [] if component["StackServiceComponents"]["hostnames"] is not None: componentHosts = [componentHost for componentHost in component["StackServiceComponents"]["hostnames"] if componentHost in hostsSet] componentHostsCount = len(componentHosts) cardinality = str(component["StackServiceComponents"]["cardinality"]) # cardinality types: null, 1+, 1-2, 1, ALL message = None if "+" in cardinality: hostsMin = int(cardinality[:-1]) if componentHostsCount < hostsMin: message = "At least {0} {1} components should be installed in cluster.".format(hostsMin, componentDisplayName) elif "-" in cardinality: nums = cardinality.split("-") hostsMin = int(nums[0]) hostsMax = int(nums[1]) if componentHostsCount > hostsMax or componentHostsCount < hostsMin: message = "Between {0} and {1} {2} components should be installed in cluster.".format(hostsMin, hostsMax, componentDisplayName) elif "ALL" == cardinality: if componentHostsCount != hostsCount: message = "{0} component should be installed on all hosts in cluster.".format(componentDisplayName) else: if componentHostsCount != int(cardinality): message = "Exactly {0} {1} components should be installed in cluster.".format(int(cardinality), componentDisplayName) if message is not None: items.append({"type": 'host-component', "level": 'ERROR', "message": message, "component-name": componentName}) # Validating host-usage usedHostsListList = [component["StackServiceComponents"]["hostnames"] for component in componentsList if not self.isComponentNotValuable(component)] usedHostsList = [item for sublist in usedHostsListList for item in sublist] nonUsedHostsList = [item for item in hostsSet if item not in usedHostsList] for host in nonUsedHostsList: items.append( { "type": 'host-component', "level": 'ERROR', "message": 'Host is not used', "host": str(host) } ) return items def getServiceConfigurationRecommenderDict(self): return { "YARN": self.recommendYARNConfigurations, "MAPREDUCE2": self.recommendMapReduce2Configurations } def putProperty(self, config, configType): config[configType] = {"properties": {}} def appendProperty(key, value): config[configType]["properties"][key] = str(value) return appendProperty def recommendYARNConfigurations(self, configurations, clusterData): putYarnProperty = self.putProperty(configurations, "yarn-site") putYarnProperty('yarn.nodemanager.resource.memory-mb', int(round(clusterData['containers'] * clusterData['ramPerContainer']))) putYarnProperty('yarn.scheduler.minimum-allocation-mb', int(clusterData['ramPerContainer'])) putYarnProperty('yarn.scheduler.maximum-allocation-mb', int(round(clusterData['containers'] * clusterData['ramPerContainer']))) def recommendMapReduce2Configurations(self, configurations, clusterData): putMapredProperty = self.putProperty(configurations, "mapred-site") putMapredProperty('yarn.app.mapreduce.am.resource.mb', int(clusterData['amMemory'])) putMapredProperty('yarn.app.mapreduce.am.command-opts', "-Xmx" + str(int(round(0.8 * clusterData['amMemory']))) + "m") putMapredProperty('mapreduce.map.memory.mb', clusterData['mapMemory']) putMapredProperty('mapreduce.reduce.memory.mb', int(clusterData['reduceMemory'])) putMapredProperty('mapreduce.map.java.opts', "-Xmx" + str(int(round(0.8 * clusterData['mapMemory']))) + "m") putMapredProperty('mapreduce.reduce.java.opts', "-Xmx" + str(int(round(0.8 * clusterData['reduceMemory']))) + "m") putMapredProperty('mapreduce.task.io.sort.mb', min(int(round(0.4 * clusterData['mapMemory'])), 1024)) def getConfigurationClusterSummary(self, servicesList, hosts, components, services): hBaseInstalled = False if 'HBASE' in servicesList: hBaseInstalled = True cluster = { "cpu": 0, "disk": 0, "ram": 0, "hBaseInstalled": hBaseInstalled, "components": components } if len(hosts["items"]) > 0: host = hosts["items"][0]["Hosts"] cluster["cpu"] = host["cpu_count"] cluster["disk"] = len(host["disk_info"]) cluster["ram"] = int(host["total_mem"] / (1024 * 1024)) ramRecommendations = [ {"os":1, "hbase":1}, {"os":2, "hbase":1}, {"os":2, "hbase":2}, {"os":4, "hbase":4}, {"os":6, "hbase":8}, {"os":8, "hbase":8}, {"os":8, "hbase":8}, {"os":12, "hbase":16}, {"os":24, "hbase":24}, {"os":32, "hbase":32}, {"os":64, "hbase":64} ] index = { cluster["ram"] <= 4: 0, 4 < cluster["ram"] <= 8: 1, 8 < cluster["ram"] <= 16: 2, 16 < cluster["ram"] <= 24: 3, 24 < cluster["ram"] <= 48: 4, 48 < cluster["ram"] <= 64: 5, 64 < cluster["ram"] <= 72: 6, 72 < cluster["ram"] <= 96: 7, 96 < cluster["ram"] <= 128: 8, 128 < cluster["ram"] <= 256: 9, 256 < cluster["ram"]: 10 }[1] cluster["reservedRam"] = ramRecommendations[index]["os"] cluster["hbaseRam"] = ramRecommendations[index]["hbase"] cluster["minContainerSize"] = { cluster["ram"] <= 4: 256, 4 < cluster["ram"] <= 8: 512, 8 < cluster["ram"] <= 24: 1024, 24 < cluster["ram"]: 2048 }[1] totalAvailableRam = cluster["ram"] - cluster["reservedRam"] if cluster["hBaseInstalled"]: totalAvailableRam -= cluster["hbaseRam"] cluster["totalAvailableRam"] = max(2048, totalAvailableRam * 1024) '''containers = max(3, min (2*cores,min (1.8*DISKS,(Total available RAM) / MIN_CONTAINER_SIZE))))''' cluster["containers"] = round(max(3, min(2 * cluster["cpu"], min(ceil(1.8 * cluster["disk"]), cluster["totalAvailableRam"] / cluster["minContainerSize"])))) '''ramPerContainers = max(2GB, RAM - reservedRam - hBaseRam) / containers''' cluster["ramPerContainer"] = abs(cluster["totalAvailableRam"] / cluster["containers"]) '''If greater than 1GB, value will be in multiples of 512.''' if cluster["ramPerContainer"] > 1024: cluster["ramPerContainer"] = int(cluster["ramPerContainer"] / 512) * 512 cluster["mapMemory"] = int(cluster["ramPerContainer"]) cluster["reduceMemory"] = cluster["ramPerContainer"] cluster["amMemory"] = max(cluster["mapMemory"], cluster["reduceMemory"]) return cluster def getConfigurationsValidationItems(self, services, hosts): """Returns array of Validation objects about issues with configuration values provided in services""" items = [] recommendations = self.recommendConfigurations(services, hosts) recommendedDefaults = recommendations["recommendations"]["blueprint"]["configurations"] configurations = services["configurations"] for service in services["services"]: serviceName = service["StackServices"]["service_name"] validator = self.validateServiceConfigurations(serviceName) if validator is not None: siteName = validator[0] method = validator[1] if siteName in recommendedDefaults: siteProperties = getSiteProperties(configurations, siteName) if siteProperties is not None: resultItems = method(siteProperties, recommendedDefaults[siteName]["properties"], configurations) items.extend(resultItems) return items def getServiceConfigurationValidators(self): return { "MAPREDUCE2": ["mapred-site", self.validateMapReduce2Configurations], "YARN": ["yarn-site", self.validateYARNConfigurations] } def validateServiceConfigurations(self, serviceName): return self.getServiceConfigurationValidators().get(serviceName, None) def toConfigurationValidationProblems(self, validationProblems, siteName): result = [] for validationProblem in validationProblems: validationItem = validationProblem.get("item", None) if validationItem is not None: problem = {"type": 'configuration', "level": validationItem["level"], "message": validationItem["message"], "config-type": siteName, "config-name": validationProblem["config-name"] } result.append(problem) return result def getWarnItem(self, message): return {"level": "WARN", "message": message} def getErrorItem(self, message): return {"level": "ERROR", "message": message} def validatorLessThenDefaultValue(self, properties, recommendedDefaults, propertyName): if not propertyName in properties: return self.getErrorItem("Value should be set") value = to_number(properties[propertyName]) if value is None: return self.getErrorItem("Value should be integer") defaultValue = to_number(recommendedDefaults[propertyName]) if defaultValue is None: return None if value < defaultValue: return self.getWarnItem("Value is less than the recommended default of {0}".format(defaultValue)) return None def validateXmxValue(self, properties, recommendedDefaults, propertyName): if not propertyName in properties: return self.getErrorItem("Value should be set") value = properties[propertyName] defaultValue = recommendedDefaults[propertyName] if defaultValue is None: return self.getErrorItem("Config's default value can't be null or undefined") if not checkXmxValueFormat(value): return self.getErrorItem('Invalid value format') valueInt = formatXmxSizeToBytes(getXmxSize(value)) defaultValueXmx = getXmxSize(defaultValue) defaultValueInt = formatXmxSizeToBytes(defaultValueXmx) if valueInt < defaultValueInt: return self.getWarnItem("Value is less than the recommended default of -Xmx" + defaultValueXmx) return None def validateMapReduce2Configurations(self, properties, recommendedDefaults, configurations, services, hosts): validationItems = [ {"config-name": 'mapreduce.map.java.opts', "item": self.validateXmxValue(properties, recommendedDefaults, 'mapreduce.map.java.opts')}, {"config-name": 'mapreduce.reduce.java.opts', "item": self.validateXmxValue(properties, recommendedDefaults, 'mapreduce.reduce.java.opts')}, {"config-name": 'mapreduce.task.io.sort.mb', "item": self.validatorLessThenDefaultValue(properties, recommendedDefaults, 'mapreduce.task.io.sort.mb')}, {"config-name": 'mapreduce.map.memory.mb', "item": self.validatorLessThenDefaultValue(properties, recommendedDefaults, 'mapreduce.map.memory.mb')}, {"config-name": 'mapreduce.reduce.memory.mb', "item": self.validatorLessThenDefaultValue(properties, recommendedDefaults, 'mapreduce.reduce.memory.mb')}, {"config-name": 'yarn.app.mapreduce.am.resource.mb', "item": self.validatorLessThenDefaultValue(properties, recommendedDefaults, 'yarn.app.mapreduce.am.resource.mb')}, {"config-name": 'yarn.app.mapreduce.am.command-opts', "item": self.validateXmxValue(properties, recommendedDefaults, 'yarn.app.mapreduce.am.command-opts')} ] return self.toConfigurationValidationProblems(validationItems, "mapred-site") def validateYARNConfigurations(self, properties, recommendedDefaults, configurations, services, hosts): validationItems = [ {"config-name": 'yarn.nodemanager.resource.memory-mb', "item": self.validatorLessThenDefaultValue(properties, recommendedDefaults, 'yarn.nodemanager.resource.memory-mb')}, {"config-name": 'yarn.scheduler.minimum-allocation-mb', "item": self.validatorLessThenDefaultValue(properties, recommendedDefaults, 'yarn.scheduler.minimum-allocation-mb')}, {"config-name": 'yarn.scheduler.maximum-allocation-mb', "item": self.validatorLessThenDefaultValue(properties, recommendedDefaults, 'yarn.scheduler.maximum-allocation-mb')} ] return self.toConfigurationValidationProblems(validationItems, "yarn-site") def getMastersWithMultipleInstances(self): return ['ZOOKEEPER_SERVER', 'HBASE_MASTER'] def getNotValuableComponents(self): return ['JOURNALNODE', 'ZKFC', 'GANGLIA_MONITOR'] def getNotPreferableOnServerComponents(self): return ['GANGLIA_SERVER'] def getCardinalitiesDict(self, hosts): return { 'ZOOKEEPER_SERVER': {"min": 3}, 'HBASE_MASTER': {"min": 1}, } def getComponentLayoutSchemes(self): return { 'NAMENODE': {"else": 0}, 'SECONDARY_NAMENODE': {"else": 1}, 'HBASE_MASTER': {6: 0, 31: 2, "else": 3}, 'HISTORYSERVER': {31: 1, "else": 2}, 'RESOURCEMANAGER': {31: 1, "else": 2}, 'OOZIE_SERVER': {6: 1, 31: 2, "else": 3}, 'HIVE_SERVER': {6: 1, 31: 2, "else": 4}, 'HIVE_METASTORE': {6: 1, 31: 2, "else": 4}, 'WEBHCAT_SERVER': {6: 1, 31: 2, "else": 4}, } class BIGTOP08StackAdvisor(BaseBIGTOP08StackAdvisor): def getServiceConfigurationRecommenderDict(self): parentRecommendConfDict = super(BIGTOP08StackAdvisor, self).getServiceConfigurationRecommenderDict() childRecommendConfDict = { "OOZIE": self.recommendOozieConfigurations, "HIVE": self.recommendHiveConfigurations, "TEZ": self.recommendTezConfigurations } parentRecommendConfDict.update(childRecommendConfDict) return parentRecommendConfDict def recommendOozieConfigurations(self, configurations, clusterData, services, hosts): if "FALCON_SERVER" in clusterData["components"]: putMapredProperty = self.putProperty(configurations, "oozie-site") putMapredProperty("oozie.services.ext", "org.apache.oozie.service.JMSAccessorService," + "org.apache.oozie.service.PartitionDependencyManagerService," + "org.apache.oozie.service.HCatAccessorService") def recommendHiveConfigurations(self, configurations, clusterData, services, hosts): containerSize = clusterData['mapMemory'] if clusterData['mapMemory'] > 2048 else int(clusterData['reduceMemory']) containerSize = min(clusterData['containers'] * clusterData['ramPerContainer'], containerSize) putHiveProperty = self.putProperty(configurations, "hive-site") putHiveProperty('hive.auto.convert.join.noconditionaltask.size', int(round(containerSize / 3)) * 1048576) putHiveProperty('hive.tez.java.opts', "-server -Xmx" + str(int(round((0.8 * containerSize) + 0.5))) + "m -Djava.net.preferIPv4Stack=true -XX:NewRatio=8 -XX:+UseNUMA -XX:+UseParallelGC") putHiveProperty('hive.tez.container.size', containerSize) def recommendTezConfigurations(self, configurations, clusterData, services, hosts): putTezProperty = self.putProperty(configurations, "tez-site") putTezProperty("tez.am.resource.memory.mb", int(clusterData['amMemory'])) putTezProperty("tez.am.java.opts", "-server -Xmx" + str(int(0.8 * clusterData["amMemory"])) + "m -Djava.net.preferIPv4Stack=true -XX:+UseNUMA -XX:+UseParallelGC") def getNotPreferableOnServerComponents(self): return ['STORM_UI_SERVER', 'DRPC_SERVER', 'STORM_REST_API', 'NIMBUS', 'GANGLIA_SERVER'] def getNotValuableComponents(self): return ['JOURNALNODE', 'ZKFC', 'GANGLIA_MONITOR', 'APP_TIMELINE_SERVER'] def getComponentLayoutSchemes(self): parentSchemes = super(BIGTOP08StackAdvisor, self).getComponentLayoutSchemes() childSchemes = { 'APP_TIMELINE_SERVER': {31: 1, "else": 2}, 'FALCON_SERVER': {6: 1, 31: 2, "else": 3} } parentSchemes.update(childSchemes) return parentSchemes def getServiceConfigurationValidators(self): parentValidators = super(BIGTOP08StackAdvisor, self).getServiceConfigurationValidators() childValidators = { "HIVE": ["hive-site", self.validateHiveConfigurations], "TEZ": ["tez-site", self.validateTezConfigurations] } parentValidators.update(childValidators) return parentValidators def validateHiveConfigurations(self, properties, recommendedDefaults, configurations, services, hosts): validationItems = [ {"config-name": 'hive.tez.container.size', "item": self.validatorLessThenDefaultValue(properties, recommendedDefaults, 'hive.tez.container.size')}, {"config-name": 'hive.tez.java.opts', "item": self.validateXmxValue(properties, recommendedDefaults, 'hive.tez.java.opts')}, {"config-name": 'hive.auto.convert.join.noconditionaltask.size', "item": self.validatorLessThenDefaultValue(properties, recommendedDefaults, 'hive.auto.convert.join.noconditionaltask.size')} ] return self.toConfigurationValidationProblems(validationItems, "hive-site") def validateTezConfigurations(self, properties, recommendedDefaults, configurations, services, hosts): validationItems = [ {"config-name": 'tez.am.resource.memory.mb', "item": self.validatorLessThenDefaultValue(properties, recommendedDefaults, 'tez.am.resource.memory.mb')}, {"config-name": 'tez.am.java.opts', "item": self.validateXmxValue(properties, recommendedDefaults, 'tez.am.java.opts')} ] return self.toConfigurationValidationProblems(validationItems, "tez-site") # Validation helper methods def getSiteProperties(configurations, siteName): siteConfig = configurations.get(siteName) if siteConfig is None: return None return siteConfig.get("properties") def to_number(s): try: return int(re.sub("\D", "", s)) except ValueError: return None def checkXmxValueFormat(value): p = re.compile('-Xmx(\d+)(b|k|m|g|p|t|B|K|M|G|P|T)?') matches = p.findall(value) return len(matches) == 1 def getXmxSize(value): p = re.compile("-Xmx(\d+)(.?)") result = p.findall(value)[0] if len(result) > 1: # result[1] - is a space or size formatter (b|k|m|g etc) return result[0] + result[1].lower() return result[0] def formatXmxSizeToBytes(value): value = value.lower() if len(value) == 0: return 0 modifier = value[-1] if modifier == ' ' or modifier in "0123456789": modifier = 'b' m = { modifier == 'b': 1, modifier == 'k': 1024, modifier == 'm': 1024 * 1024, modifier == 'g': 1024 * 1024 * 1024, modifier == 't': 1024 * 1024 * 1024 * 1024, modifier == 'p': 1024 * 1024 * 1024 * 1024 * 1024 }[1] return to_number(value) * m def getPort(address): """ Extracts port from the address like 0.0.0.0:1019 """ if address is None: return None m = re.search(r'(?:http(?:s)?://)?([\w\d.]*):(\d{1,5})', address) if m is not None: return int(m.group(2)) else: return None def isSecurePort(port): """ Returns True if port is root-owned at *nix systems """ if port is not None: return port < 1024 else: return False
import unittest from unittest import mock import tethys_cli.manage_commands as manage_commands from tethys_cli.manage_commands import ( MANAGE_START, MANAGE_COLLECTSTATIC, MANAGE_COLLECTWORKSPACES, MANAGE_COLLECT, MANAGE_CREATESUPERUSER ) class TestManageCommands(unittest.TestCase): def setUp(self): pass def tearDown(self): pass @mock.patch('tethys_cli.manage_commands.run_process') def test_manage_command_manage_start(self, mock_run_process): # mock the input args args = mock.MagicMock(manage='', command=MANAGE_START, port='8080') # call the testing method with the mock args manage_commands.manage_command(args) # get the call arguments for the run process mock method process_call_args = mock_run_process.call_args_list # check the values from the argument list self.assertEqual('python', process_call_args[0][0][0][0]) self.assertIn('manage.py', process_call_args[0][0][0][1]) self.assertEqual('runserver', process_call_args[0][0][0][2]) self.assertEqual('8080', process_call_args[0][0][0][3]) @mock.patch('tethys_cli.manage_commands.run_process') def test_manage_command_manage_start_with_no_port(self, mock_run_process): # mock the input args args = mock.MagicMock(manage='', command=MANAGE_START, port='') # call the testing method with the mock args manage_commands.manage_command(args) # get the call arguments for the run process mock method process_call_args = mock_run_process.call_args_list # check the values from the argument list self.assertEqual('python', process_call_args[0][0][0][0]) self.assertIn('manage.py', process_call_args[0][0][0][1]) self.assertEqual('runserver', process_call_args[0][0][0][2]) @mock.patch('tethys_cli.manage_commands.run_process') def test_manage_command_manage_manage_collectstatic(self, mock_run_process): # mock the input args args = mock.MagicMock(manage='', command=MANAGE_COLLECTSTATIC, port='8080', noinput=False) # call the testing method with the mock args manage_commands.manage_command(args) # get the call arguments for the run process mock method process_call_args = mock_run_process.call_args_list # intermediate process self.assertEqual('python', process_call_args[0][0][0][0]) self.assertIn('manage.py', process_call_args[0][0][0][1]) self.assertEqual('pre_collectstatic', process_call_args[0][0][0][2]) # primary process self.assertEqual('python', process_call_args[1][0][0][0]) self.assertIn('manage.py', process_call_args[1][0][0][1]) self.assertEqual('collectstatic', process_call_args[1][0][0][2]) self.assertNotIn('--noinput', process_call_args[1][0][0]) @mock.patch('tethys_cli.manage_commands.run_process') def test_manage_command_manage_manage_collectstatic_with_no_input(self, mock_run_process): # mock the input args args = mock.MagicMock(manage='', command=MANAGE_COLLECTSTATIC, port='8080', noinput=True) # call the testing method with the mock args manage_commands.manage_command(args) # get the call arguments for the run process mock method process_call_args = mock_run_process.call_args_list # intermediate process self.assertEqual('python', process_call_args[0][0][0][0]) self.assertIn('manage.py', process_call_args[0][0][0][1]) self.assertEqual('pre_collectstatic', process_call_args[0][0][0][2]) # primary process self.assertEqual('python', process_call_args[1][0][0][0]) self.assertIn('manage.py', process_call_args[1][0][0][1]) self.assertEqual('collectstatic', process_call_args[1][0][0][2]) self.assertEqual('--noinput', process_call_args[1][0][0][3]) @mock.patch('tethys_cli.manage_commands.run_process') def test_manage_command_manage_manage_collect_workspace(self, mock_run_process): # mock the input args args = mock.MagicMock(manage='', command=MANAGE_COLLECTWORKSPACES, port='8080', force=True) # call the testing method with the mock args manage_commands.manage_command(args) # get the call arguments for the run process mock method process_call_args = mock_run_process.call_args_list # check the values from the argument list self.assertEqual('python', process_call_args[0][0][0][0]) self.assertIn('manage.py', process_call_args[0][0][0][1]) self.assertEqual('collectworkspaces', process_call_args[0][0][0][2]) self.assertEqual('--force', process_call_args[0][0][0][3]) @mock.patch('tethys_cli.manage_commands.run_process') def test_manage_command_manage_manage_collect_workspace_with_no_force(self, mock_run_process): # mock the input args args = mock.MagicMock(manage='', command=MANAGE_COLLECTWORKSPACES, force=False) # call the testing method with the mock args manage_commands.manage_command(args) # get the call arguments for the run process mock method process_call_args = mock_run_process.call_args_list # check the values from the argument list self.assertEqual('python', process_call_args[0][0][0][0]) self.assertIn('manage.py', process_call_args[0][0][0][1]) self.assertEqual('collectworkspaces', process_call_args[0][0][0][2]) self.assertNotIn('--force', process_call_args[0][0][0]) @mock.patch('tethys_cli.manage_commands.run_process') def test_manage_command_manage_manage_collect(self, mock_run_process): # mock the input args args = mock.MagicMock(manage='', command=MANAGE_COLLECT, port='8080', noinput=False) # call the testing method with the mock args manage_commands.manage_command(args) # get the call arguments for the run process mock method process_call_args = mock_run_process.call_args_list # pre_collectstatic self.assertEqual('python', process_call_args[0][0][0][0]) self.assertIn('manage.py', process_call_args[0][0][0][1]) self.assertEqual('pre_collectstatic', process_call_args[0][0][0][2]) # collectstatic self.assertEqual('python', process_call_args[1][0][0][0]) self.assertIn('manage.py', process_call_args[1][0][0][1]) self.assertEqual('collectstatic', process_call_args[1][0][0][2]) self.assertNotIn('--noinput', process_call_args[1][0][0]) # collectworkspaces self.assertEqual('python', process_call_args[2][0][0][0]) self.assertIn('manage.py', process_call_args[2][0][0][1]) self.assertEqual('collectworkspaces', process_call_args[2][0][0][2]) @mock.patch('tethys_cli.manage_commands.run_process') def test_manage_command_manage_manage_collect_no_input(self, mock_run_process): # mock the input args args = mock.MagicMock(manage='', command=MANAGE_COLLECT, port='8080', noinput=True) # call the testing method with the mock args manage_commands.manage_command(args) # get the call arguments for the run process mock method process_call_args = mock_run_process.call_args_list # pre_collectstatic self.assertEqual('python', process_call_args[0][0][0][0]) self.assertIn('manage.py', process_call_args[0][0][0][1]) self.assertEqual('pre_collectstatic', process_call_args[0][0][0][2]) # collectstatic self.assertEqual('python', process_call_args[1][0][0][0]) self.assertIn('manage.py', process_call_args[1][0][0][1]) self.assertEqual('collectstatic', process_call_args[1][0][0][2]) self.assertEqual('--noinput', process_call_args[1][0][0][3]) # collectworkspaces self.assertEqual('python', process_call_args[2][0][0][0]) self.assertIn('manage.py', process_call_args[2][0][0][1]) self.assertEqual('collectworkspaces', process_call_args[2][0][0][2]) @mock.patch('tethys_cli.manage_commands.run_process') def test_manage_command_manage_manage_create_super_user(self, mock_run_process): # mock the input args args = mock.MagicMock(manage='', command=MANAGE_CREATESUPERUSER, port='8080') # call the testing method with the mock args manage_commands.manage_command(args) # get the call arguments for the run process mock method process_call_args = mock_run_process.call_args_list # check the values from the argument list self.assertEqual('python', process_call_args[0][0][0][0]) self.assertIn('manage.py', process_call_args[0][0][0][1]) self.assertEqual('createsuperuser', process_call_args[0][0][0][2])
# Copyright (c) 2013 Marion Zepf # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), to deal # in the Software without restriction, including without limitation the rights # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the Software is # furnished to do so, subject to the following conditions: # The above copyright notice and this permission notice shall be included in # all copies or substantial portions of the Software. # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN # THE SOFTWARE. """ Python export tool """ import ast from gettext import gettext as _ from os import linesep from os import path, pardir import re import traceback import util.codegen as codegen # from ast_pprint import * # only used for debugging, safe to comment out from talogo import LogoCode from taprimitive import (ast_yield_true, Primitive, PyExportError, value_to_ast) from tautils import (find_group, find_top_block, get_stack_name) from tawindow import plugins_in_use _SETUP_CODE_START = """\ #!/usr/bin/env python # -*- coding: utf-8 -*- _INSTALL_PATH = '/usr/share/sugar/activities/TurtleArt.activity' _ALTERNATIVE_INSTALL_PATH = \\ '/usr/local/share/sugar/activities/TurtleArt.activity' import os, sys, dbus paths = [] paths.append('../%s.activity') paths.append(os.path.expanduser('~') + '/Activities/%s.activity') paths.append('/usr/share/sugar/activities/%s.activity') paths.append('/usr/local/share/sugar/activities/%s.activity') paths.append( '/home/broot/sugar-build/build/install/share/sugar/activities/%s.activity') """ + \ "paths.append('%s')" % \ path.abspath(path.join(path.dirname(__file__), pardir)) + \ """\ flag = False for path in paths: for activity in ['TurtleBots', 'TurtleBlocks']: p = (path % activity) if "%" in path else path if os.path.exists(p) and p not in sys.path: flag = True sys.path.insert(0, p) if not flag: print 'This code require the Turtle Blocks/Bots activity to be installed.' exit(1) from time import * from random import uniform from math import * from pyexported.window_setup import * tw = get_tw() BOX = {} ACTION = {} global_objects = None turtles = None canvas = None logo = None """ _SETUP_CODE_END = """\ if __name__ == '__main__': tw.lc.start_time = time() tw.lc.icall(start) gobject.idle_add(tw.lc.doevalstep) gtk.main() """ _ACTION_STACK_START = """\ def %s(): """ _START_STACK_START_ADD = """\ tw.start_plugins() global global_objects,turtles,canvas,logo global_objects = tw.get_global_objects() turtles = tw.turtles canvas = tw.canvas logo = tw.lc logo.boxes = BOX """ _ACTION_STACK_PREAMBLE = """\ turtle = turtles.get_active_turtle() """ _ACTION_STACK_END = """\ ACTION["%s"] = %s """ # character that is illegal in a Python identifier PAT_IDENTIFIER_ILLEGAL_CHAR = re.compile("[^A-Za-z0-9_]") def save_python(tw): """ Find all the action stacks and turn each into Python code """ all_blocks = tw.just_blocks() blocks_name = [] for block in all_blocks: blocks_name.append(block.name) if 'start' not in blocks_name: return None blocks_covered = set() tops_of_stacks = [] for block in all_blocks: if block not in blocks_covered: top = find_top_block(block) tops_of_stacks.append(top) block_stack = find_group(top) blocks_covered.update(set(block_stack)) snippets = [_SETUP_CODE_START] for k in plugins_in_use: snippets.append('%s = None\n' % (k.lower(),)) snippets.append('\n') for block in tops_of_stacks: stack_name = get_stack_name(block) if stack_name: pythoncode = _action_stack_to_python(block, tw, name=stack_name) snippets.append(pythoncode) snippets.append(linesep) snippets.append(_SETUP_CODE_END) return ''.join(snippets) def _action_stack_to_python(block, tw, name='start'): """ Turn a stack of blocks into Python code name -- the name of the action stack (defaults to "start") """ if isinstance(name, int): name = float(name) if not isinstance(name, basestring): name = str(name) # traverse the block stack and get the AST for every block ast_list = _walk_action_stack(block, tw.lc) if not ast_list or not isinstance(ast_list[-1], ast.Yield): ast_list.append(ast_yield_true()) action_stack_ast = ast.Module(body=ast_list) # serialize the ASTs into python code generated_code = codegen.to_source(action_stack_ast) # wrap the action stack setup code around everything name_id = _make_identifier(name) if name == 'start': pre_preamble = _START_STACK_START_ADD for k in plugins_in_use: pre_preamble += ' global %s\n' % (k.lower(),) pre_preamble += " %s = global_objects['%s']\n" % (k.lower(), k) else: pre_preamble = '' generated_code = _indent(generated_code, 1) if generated_code.endswith(linesep): newline = '' else: newline = linesep snippets = [_ACTION_STACK_START % (name_id), pre_preamble, _ACTION_STACK_PREAMBLE, generated_code, newline, _ACTION_STACK_END % (name, name_id)] return ''.join(snippets) def _walk_action_stack(top_block, lc, convert_me=True): """ Turn a stack of blocks into a list of ASTs convert_me -- convert values and Primitives to ASTs or return them unconverted? """ block = top_block # value blocks don't have a primitive # (but constant blocks (colors, screen dimensions, etc.) do) if block.is_value_block(): raw_value = block.get_value(add_type_prefix=False) if convert_me: value_ast = value_to_ast(raw_value) if value_ast is not None: return [value_ast] else: return [] else: if raw_value is not None: return [raw_value] else: return [] def _get_prim(block): prim = lc.get_prim_callable(block.primitive) # fail gracefully if primitive is not a Primitive object if not isinstance(prim, Primitive): raise PyExportError(_('block is not exportable'), block=block) return prim prim = _get_prim(block) ast_list = [] arg_asts = [] def _finish_off(block, prim=None): """ Convert block to an AST and add it to the ast_list. Raise a PyExportError on failure. """ if prim is None: prim = _get_prim(block) if convert_me: if prim.export_me: try: new_ast = prim.get_ast(*arg_asts) except ValueError: traceback.print_exc() raise PyExportError(_('error while exporting block'), block=block) if isinstance(new_ast, (list, tuple)): ast_list.extend(new_ast) elif new_ast is not None: ast_list.append(new_ast) elif arg_asts: # TODO do we ever get here? new_ast = ast.List(elts=arg_asts, ctx=ast.Load) ast_list.append(new_ast) else: ast_list.append((prim, ) + tuple(arg_asts)) # skip the very first dock/ connection - it's either the previous block or # the return value of this block dock_queue = block.docks[1:] conn_queue = block.connections[1:] while dock_queue and conn_queue: dock = dock_queue.pop(0) conn = conn_queue.pop(0) if conn is None or dock[0] == 'unavailable': continue elif not dock_queue and dock[0] == 'flow': # finish off this block _finish_off(block, prim) arg_asts = [] # next block block = conn prim = _get_prim(block) dock_queue = block.docks[1:] conn_queue = block.connections[1:] else: # embedded stack of blocks (body of conditional or loop) or # argument block if dock[0] == 'flow': # body of conditional or loop new_arg_asts = _walk_action_stack(conn, lc, convert_me=convert_me) if (prim == LogoCode.prim_loop and not isinstance(new_arg_asts[-1], ast.Yield)): new_arg_asts.append(ast_yield_true()) arg_asts.append(new_arg_asts) else: # argument block new_arg_asts = _walk_action_stack(conn, lc, convert_me=False) arg_asts.append(*new_arg_asts) # finish off last block _finish_off(block, prim) return ast_list def _make_identifier(name): """ Turn name into a Python identifier name by replacing illegal characters """ replaced = re.sub(PAT_IDENTIFIER_ILLEGAL_CHAR, '_', name) # TODO find better strategy to avoid number at beginning if re.match('[0-9]', replaced): replaced = '_' + replaced return replaced def _indent(code, num_levels=1): """ Indent each line of code with num_levels * 4 spaces code -- some python code as a (multi-line) string """ indentation = " " * (4 * num_levels) line_list = code.split(linesep) new_line_list = [] for line in line_list: new_line_list.append(indentation + line) return linesep.join(new_line_list)
######## # Copyright (c) 2013 GigaSpaces Technologies Ltd. All rights reserved # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # * See the License for the specific language governing permissions and # * limitations under the License. import logging import random import shlex import string import subprocess import tempfile import sys import os from cloudify.exceptions import CommandExecutionException from cloudify.constants import LOCAL_IP_KEY, MANAGER_IP_KEY, \ MANAGER_REST_PORT_KEY, MANAGER_FILE_SERVER_BLUEPRINTS_ROOT_URL_KEY, \ MANAGER_FILE_SERVER_URL_KEY def setup_logger(logger_name, logger_level=logging.DEBUG, handlers=None, remove_existing_handlers=True): """ :param logger_name: Name of the logger. :param logger_level: Level for the logger (not for specific handler). :param handlers: An optional list of handlers (formatter will be overridden); If None, only a StreamHandler for sys.stdout will be used. :param remove_existing_handlers: Determines whether to remove existing handlers before adding new ones :return: A logger instance. :rtype: Logger """ logger = logging.getLogger(logger_name) if remove_existing_handlers: for handler in logger.handlers: logger.removeHandler(handler) if not handlers: handler = logging.StreamHandler(sys.stdout) handler.setLevel(logging.DEBUG) handlers = [handler] formatter = logging.Formatter(fmt='%(asctime)s [%(levelname)s] ' '[%(name)s] %(message)s', datefmt='%H:%M:%S') for handler in handlers: handler.setFormatter(formatter) logger.addHandler(handler) logger.setLevel(logger_level) return logger def get_local_ip(): """ Return the IP address used to connect to this machine by the management. machine """ return os.environ[LOCAL_IP_KEY] def get_manager_ip(bracketed_ipv6=True): """ Returns the IP address of manager inside the management network. """ ip = os.environ[MANAGER_IP_KEY] if bracketed_ipv6: if ip.count(':') >= 2: if not ip.startswith('['): ip = '[{ip}'.format(ip=ip) if not ip.endswith(']'): ip = '{ip}]'.format(ip=ip) else: ip = ip.strip('[]') return ip def get_manager_file_server_blueprints_root_url(): """ Returns the blueprints root url in the file server. """ return os.environ[MANAGER_FILE_SERVER_BLUEPRINTS_ROOT_URL_KEY] def get_manager_file_server_url(): """ Returns the manager file server base url. """ return os.environ[MANAGER_FILE_SERVER_URL_KEY] def get_manager_rest_service_port(): """ Returns the port the manager REST service is running on. """ return int(os.environ[MANAGER_REST_PORT_KEY]) def id_generator(size=6, chars=string.ascii_uppercase + string.digits): """ Generate and return a random string using upper case letters and digits. """ return ''.join(random.choice(chars) for x in range(size)) def create_temp_folder(): """ Create a temporary folder. """ path_join = os.path.join(tempfile.gettempdir(), id_generator(5)) os.makedirs(path_join) return path_join def get_cosmo_properties(): return { "management_ip": get_manager_ip(), "ip": get_local_ip() } def find_type_in_kwargs(cls, all_args): result = [v for v in all_args if isinstance(v, cls)] if not result: return None if len(result) > 1: raise RuntimeError( "Expected to find exactly one instance of {0} in " "kwargs but found {1}".format(cls, len(result))) return result[0] class LocalCommandRunner(object): def __init__(self, logger=None, host='localhost'): """ :param logger: This logger will be used for printing the output and the command. """ logger = logger or setup_logger('LocalCommandRunner') self.logger = logger self.host = host def run(self, command, exit_on_failure=True, stdout_pipe=True, stderr_pipe=True): """ Runs local commands. :param command: The command to execute. :param exit_on_failure: False to ignore failures. :param stdout_pipe: False to not pipe the standard output. :param stderr_pipe: False to not pipe the standard error. :return: A wrapper object for all valuable info from the execution. :rtype: CommandExecutionResponse """ self.logger.info('[{0}] run: {1}'.format(self.host, command)) shlex_split = shlex.split(command) stdout = subprocess.PIPE if stdout_pipe else None stderr = subprocess.PIPE if stderr_pipe else None p = subprocess.Popen(shlex_split, stdout=stdout, stderr=stderr) out, err = p.communicate() if p.returncode == 0: if out: self.logger.info('[{0}] out: {1}'.format(self.host, out)) else: error = CommandExecutionException( command=command, code=p.returncode, error=err, output=out) self.logger.error(error) if exit_on_failure: raise error return CommandExecutionResponse(command=command, std_out=out, std_err=err, return_code=p.returncode) class CommandExecutionResponse(object): """ Wrapper object for info returned when running commands. :param command: The command that was executed. :param std_out: The output from the execution. :param std_err: The error message from the execution. :param return_code: The return code from the execution. """ def __init__(self, command, std_out, std_err, return_code): self.command = command self.std_out = std_out self.std_err = std_err self.return_code = return_code
# -*- coding: utf-8 -*- from django.conf import settings from django.db import models as djangomodels from django.utils import translation from django.utils.functional import lazy from django.utils import six import base64 """ Translation methods """ def _get_details_in_lang(field, lang): if field.translation_cache.get(lang): return field.translation_cache[lang] else: settings.odoo_models[field.details['model']].cache_translation(lang) try: return field.translation_cache[lang] except: return field.details def field_translate(field, key): lang = translation.get_language() or "en-us" details = _get_details_in_lang(field, lang) res = details.get(key, "") if isinstance(res, six.binary_type): res = six.text_type(res) return res _ = lazy(field_translate, six.text_type) def selection_translate(field): def trans(val): lang = translation.get_language() or "en-us" details = _get_details_in_lang(field, lang) return dict(details['selection'])[val] trans_lazy = lazy(trans, six.text_type) res = [] for val, _label in field.details.get('selection'): res.append((val, trans_lazy(val))) return tuple(res) # TODO: default values # TODO: domains FIELDS_CONV = { "char": "CharField", "boolean": "BooleanField", "integer": "IntegerField", "text": "TextField", "float": "DecimalField", "date": "DateField", "datetime": "DateTimeField", "time": "TimeField", "binary": "BinaryField", "selection": "CharField", "many2one": "ForeignKey", "one2many": None, # "many2many": "", # "function": "", # "related": "", } class OdooField(object): def __init__(self, details): self.details = details self.translatable = details.get("translate") self.django_field = False self.translation_cache = {} # translations cache return super(OdooField, self).__init__() def to_django(self, **kwargs): kwargs.update({ "verbose_name": _(self, 'string'), "help_text": _(self, 'help'), "blank": not(self.details.get("required")), "editable": not(self.details.get("readonly")), }) django_field = getattr(djangomodels, FIELDS_CONV[self.details["type"]])(**kwargs) django_field.odoo_field = self self.django_field = django_field return django_field def convert_data(self, data): return data or None def convert_back(self, data): return data or False class TextField(OdooField): def to_django(self, **kwargs): if self.details.get("required"): kwargs["default"] = "" kwargs["null"] = not(self.details.get("required")) return super(TextField, self).to_django(**kwargs) class CharField(TextField): def to_django(self, **kwargs): kwargs['max_length'] = self.details.get('size') or 512 return super(CharField, self).to_django(**kwargs) class BooleanField(OdooField): def to_django(self, **kwargs): kwargs["default"] = False return super(BooleanField, self).to_django(**kwargs) def convert_data(self, data): return data or False class IntegerField(OdooField): def to_django(self, **kwargs): if self.details.get("required"): kwargs["default"] = 0 kwargs["null"] = not(self.details.get("required")) return super(IntegerField, self).to_django(**kwargs) class FloatField(IntegerField): def to_django(self, **kwargs): if self.details.get("digits"): kwargs["max_digits"] = self.details["digits"][0] kwargs["decimal_places"] = self.details["digits"][1] kwargs["null"] = not(self.details.get("required")) return super(FloatField, self).to_django(**kwargs) class DateField(OdooField): def to_django(self, **kwargs): kwargs["null"] = not(self.details.get("required")) if self.details.get("required"): kwargs["auto_now_add"] = True return super(DateField, self).to_django(**kwargs) class DateTimeField(DateField): pass class TimeField(DateField): pass class BinaryField(OdooField): def to_django(self, **kwargs): kwargs["null"] = not(self.details.get("required")) return super(BinaryField, self).to_django(**kwargs) def convert_data(self, data): """Odoo data is a b64-encoded string""" return base64.b64decode(data) if data else None def convert_back(self, data): return base64.b64encode(data).decode("utf-8") if data else False class SelectionField(CharField): def to_django(self, **kwargs): kwargs["choices"] = selection_translate(self) return super(SelectionField, self).to_django(**kwargs) class Many2OneField(OdooField): """ If the model identified by details['relation'] exists in django, then we can create the field directly. Otherwise, we delay the field creation until the possible creation of this model. """ def __new__(cls, details): if details['relation'] in settings.odoo_models: return OdooField.__new__(cls) else: settings.deferred_m2o[details['relation']] = settings.deferred_m2o.get(details['relation'], []) settings.deferred_m2o[details['relation']].append(details) return None def to_django(self, **kwargs): kwargs["null"] = not(self.details.get("required")) if self.details['relation'] == self.details['model']: kwargs["to"] = "self" else: to_model = settings.odoo_models[self.details['relation']] kwargs["to"] = to_model return super(Many2OneField, self).to_django(**kwargs) def convert_data(self, data): """ Odoo data is a pair (id, label) We look for objects in the target model an instance having a odoo_id equal to the first element of the pair ; if not found, we load it from Odoo :param (tuple or False) data: the value to convert :return (OdooModel or False): the object instance linked to this m2o field """ if data and isinstance(data, (list, tuple)) and len(data) == 2: to_model = settings.odoo_models[self.details['relation']] targets = to_model.objects.filter(odoo_id=data[0]) if targets: return targets[0] else: return to_model.odoo_load([data[0]])[0] return data or None def convert_back(self, data): """ Django data is either None or a Django instance We tranform it into False or an integer by getting the odoo_id on the instance. :todo: if the target objet has no odoo_id, first push it to odoo :param (OdooModel or False) data: the value to convert :return (integer or False): the idi of the object in odoo """ from .models import OdooModel if data and isinstance(data, OdooModel) and hasattr(data, 'odoo_id'): return data.odoo_id # elif isinstance(data, (int, long)): # return data else: return False class One2ManyField(OdooField): """ There is no one2many field in Django, so we simply set the "relation_field" attribute of the foreignKey field encoding the opposite relationship so it bares the name of this one2many field """ def __new__(cls, details): if details['relation'] in settings.odoo_models: relation = settings.odoo_models[details['relation']] for field in relation._meta.Fields: if field.name == details['relation_field']: field.related_name = details['name'] else: settings.deferred_o2m[details['relation']] = settings.deferred_o2m.get(details['relation'], []) settings.deferred_o2m[details['relation']].append(details) def convert_field(details): if not(details['type'] in FIELDS_CONV): return None return eval(details["type"].title() + "Field")(details)
# Copyright 2012 Nebula, Inc. # Copyright 2013 IBM Corp. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import base64 import datetime import inspect import os import re import urllib import uuid as uuid_lib import mock from oslo_config import cfg from oslo_log import log as logging from oslo_serialization import jsonutils from oslo_utils import importutils from oslo_utils import timeutils import testtools from nova.api.metadata import password from nova.api.openstack.compute.contrib import fping from nova.api.openstack.compute import extensions from nova.cells import utils as cells_utils # Import extensions to pull in osapi_compute_extension CONF option used below. from nova.cloudpipe import pipelib from nova.compute import api as compute_api from nova.compute import cells_api as cells_api from nova.conductor import manager as conductor_manager from nova.console import manager as console_manager # noqa - only for cfg from nova import db from nova.network import api as network_api from nova.network.neutronv2 import api as neutron_api # noqa - only for cfg from nova import objects from nova.servicegroup import api as service_group_api from nova import test from nova.tests.functional import api_samples_test_base from nova.tests.functional import integrated_helpers from nova.tests.unit.api.openstack.compute.contrib import test_fping from nova.tests.unit.api.openstack.compute.contrib import test_services from nova.tests.unit.api.openstack import fakes from nova.tests.unit import fake_network from nova.tests.unit import fake_utils from nova.tests.unit.image import fake from nova import utils from nova.volume import cinder CONF = cfg.CONF CONF.import_opt('allow_resize_to_same_host', 'nova.compute.api') CONF.import_opt('shelved_offload_time', 'nova.compute.manager') CONF.import_opt('enable_network_quota', 'nova.api.openstack.compute.contrib.os_tenant_networks') CONF.import_opt('osapi_compute_extension', 'nova.api.openstack.compute.extensions') CONF.import_opt('vpn_image_id', 'nova.cloudpipe.pipelib') CONF.import_opt('osapi_compute_link_prefix', 'nova.api.openstack.common') CONF.import_opt('osapi_glance_link_prefix', 'nova.api.openstack.common') CONF.import_opt('enable', 'nova.cells.opts', group='cells') CONF.import_opt('cell_type', 'nova.cells.opts', group='cells') CONF.import_opt('db_check_interval', 'nova.cells.state', group='cells') LOG = logging.getLogger(__name__) class ApiSampleTestBaseV2(api_samples_test_base.ApiSampleTestBase): _api_version = 'v2' def setUp(self): extends = [] self.flags(use_ipv6=False, osapi_compute_link_prefix=self._get_host(), osapi_glance_link_prefix=self._get_glance_host()) if not self.all_extensions: if hasattr(self, 'extends_name'): extends = [self.extends_name] ext = [self.extension_name] if self.extension_name else [] self.flags(osapi_compute_extension=ext + extends) super(ApiSampleTestBaseV2, self).setUp() self.useFixture(test.SampleNetworks(host=self.network.host)) fake_network.stub_compute_with_ips(self.stubs) fake_utils.stub_out_utils_spawn_n(self.stubs) self.generate_samples = os.getenv('GENERATE_SAMPLES') is not None class ApiSamplesTrap(ApiSampleTestBaseV2): """Make sure extensions don't get added without tests.""" all_extensions = True def _get_extensions_tested(self): tests = [] for attr in globals().values(): if not inspect.isclass(attr): continue # Skip non-class objects if not issubclass(attr, integrated_helpers._IntegratedTestBase): continue # Skip non-test classes if attr.extension_name is None: continue # Skip base tests cls = importutils.import_class(attr.extension_name) tests.append(cls.alias) return tests def _get_extensions(self): extensions = [] response = self._do_get('extensions') for extension in jsonutils.loads(response.content)['extensions']: extensions.append(str(extension['alias'])) return extensions def test_all_extensions_have_samples(self): # NOTE(danms): This is a list of extensions which are currently # in the tree but that don't (yet) have tests. This list should # NOT be allowed to grow, and should shrink to zero (and be # removed) soon. # TODO(gmann): skip this tests as merging of sample tests for v2 # and v2.1 are in progress. After merging all tests, this tests # need to implement in different way. raise testtools.TestCase.skipException('Merging of v2 and v2.1 ' 'sample tests is in progress. ' 'This test will be enabled ' 'after all tests gets merged.') do_not_approve_additions = [] do_not_approve_additions.append('os-create-server-ext') do_not_approve_additions.append('os-baremetal-ext-status') tests = self._get_extensions_tested() extensions = self._get_extensions() missing_tests = [] for extension in extensions: # NOTE(danms): if you add tests, remove it from the # exclusions list self.assertFalse(extension in do_not_approve_additions and extension in tests) # NOTE(danms): if you add an extension, it must come with # api_samples tests! if (extension not in tests and extension not in do_not_approve_additions): missing_tests.append(extension) if missing_tests: LOG.error("Extensions are missing tests: %s" % missing_tests) self.assertEqual(missing_tests, []) class VersionsSampleJsonTest(ApiSampleTestBaseV2): sample_dir = 'versions' def test_versions_get(self): response = self._do_get('', strip_version=True) subs = self._get_regexes() self._verify_response('versions-get-resp', subs, response, 200) class ServersSampleBase(ApiSampleTestBaseV2): def _post_server(self, use_common_server_api_samples=True): # param use_common_server_api_samples: Boolean to set whether tests use # common sample files for server post request and response. # Default is True which means _get_sample_path method will fetch the # common server sample files. # Set False if tests need to use extension specific sample files subs = { 'image_id': fake.get_valid_image_id(), 'host': self._get_host(), } orig_value = self.__class__._use_common_server_api_samples try: self.__class__._use_common_server_api_samples = ( use_common_server_api_samples) response = self._do_post('servers', 'server-post-req', subs) subs = self._get_regexes() status = self._verify_response('server-post-resp', subs, response, 202) return status finally: self.__class__._use_common_server_api_samples = orig_value class ServersSampleMultiStatusJsonTest(ServersSampleBase): extension_name = '.'.join(('nova.api.openstack.compute.contrib', 'server_list_multi_status', 'Server_list_multi_status')) def test_servers_list(self): uuid = self._post_server() response = self._do_get('servers?status=active&status=error') subs = self._get_regexes() subs['id'] = uuid self._verify_response('servers-list-resp', subs, response, 200) class ServersMetadataJsonTest(ServersSampleBase): sample_dir = 'servers' def _create_and_set(self, subs): uuid = self._post_server() response = self._do_put('servers/%s/metadata' % uuid, 'server-metadata-all-req', subs) self._verify_response('server-metadata-all-resp', subs, response, 200) return uuid def generalize_subs(self, subs, vanilla_regexes): subs['value'] = '(Foo|Bar) Value' return subs def test_metadata_put_all(self): # Test setting all metadata for a server. subs = {'value': 'Foo Value'} self._create_and_set(subs) def test_metadata_post_all(self): # Test updating all metadata for a server. subs = {'value': 'Foo Value'} uuid = self._create_and_set(subs) subs['value'] = 'Bar Value' response = self._do_post('servers/%s/metadata' % uuid, 'server-metadata-all-req', subs) self._verify_response('server-metadata-all-resp', subs, response, 200) def test_metadata_get_all(self): # Test getting all metadata for a server. subs = {'value': 'Foo Value'} uuid = self._create_and_set(subs) response = self._do_get('servers/%s/metadata' % uuid) self._verify_response('server-metadata-all-resp', subs, response, 200) def test_metadata_put(self): # Test putting an individual metadata item for a server. subs = {'value': 'Foo Value'} uuid = self._create_and_set(subs) subs['value'] = 'Bar Value' response = self._do_put('servers/%s/metadata/foo' % uuid, 'server-metadata-req', subs) self._verify_response('server-metadata-resp', subs, response, 200) def test_metadata_get(self): # Test getting an individual metadata item for a server. subs = {'value': 'Foo Value'} uuid = self._create_and_set(subs) response = self._do_get('servers/%s/metadata/foo' % uuid) self._verify_response('server-metadata-resp', subs, response, 200) def test_metadata_delete(self): # Test deleting an individual metadata item for a server. subs = {'value': 'Foo Value'} uuid = self._create_and_set(subs) response = self._do_delete('servers/%s/metadata/foo' % uuid) self.assertEqual(response.status_code, 204) self.assertEqual(response.content, '') class ExtensionsSampleJsonTest(ApiSampleTestBaseV2): all_extensions = True def test_extensions_get(self): response = self._do_get('extensions') subs = self._get_regexes() self._verify_response('extensions-get-resp', subs, response, 200) class FlavorsSampleJsonTest(ApiSampleTestBaseV2): sample_dir = 'flavors' def test_flavors_get(self): response = self._do_get('flavors/1') subs = self._get_regexes() self._verify_response('flavor-get-resp', subs, response, 200) def test_flavors_list(self): response = self._do_get('flavors') subs = self._get_regexes() self._verify_response('flavors-list-resp', subs, response, 200) class FlavorsSampleAllExtensionJsonTest(FlavorsSampleJsonTest): all_extensions = True class LimitsSampleJsonTest(ApiSampleTestBaseV2): sample_dir = 'limits' def test_limits_get(self): response = self._do_get('limits') subs = self._get_regexes() self._verify_response('limit-get-resp', subs, response, 200) class ServersActionsJsonTest(ServersSampleBase): sample_dir = 'servers' def _test_server_action(self, uuid, action, subs=None, resp_tpl=None, code=202): subs = subs or {} subs.update({'action': action}) response = self._do_post('servers/%s/action' % uuid, 'server-action-%s' % action.lower(), subs) if resp_tpl: subs.update(self._get_regexes()) self._verify_response(resp_tpl, subs, response, code) else: self.assertEqual(response.status_code, code) self.assertEqual(response.content, "") def test_server_password(self): uuid = self._post_server() self._test_server_action(uuid, "changePassword", {"password": "foo"}) class UserDataJsonTest(ApiSampleTestBaseV2): extension_name = "nova.api.openstack.compute.contrib.user_data.User_data" def test_user_data_post(self): user_data_contents = '#!/bin/bash\n/bin/su\necho "I am in you!"\n' user_data = base64.b64encode(user_data_contents) subs = { 'image_id': fake.get_valid_image_id(), 'host': self._get_host(), 'user_data': user_data } response = self._do_post('servers', 'userdata-post-req', subs) subs.update(self._get_regexes()) self._verify_response('userdata-post-resp', subs, response, 202) class SecurityGroupsSampleJsonTest(ServersSampleBase): extension_name = "nova.api.openstack.compute.contrib" + \ ".security_groups.Security_groups" def _get_create_subs(self): return { 'group_name': 'test', "description": "description", } def _create_security_group(self): subs = self._get_create_subs() return self._do_post('os-security-groups', 'security-group-post-req', subs) def _add_group(self, uuid): subs = { 'group_name': 'test' } return self._do_post('servers/%s/action' % uuid, 'security-group-add-post-req', subs) def test_security_group_create(self): response = self._create_security_group() subs = self._get_create_subs() self._verify_response('security-groups-create-resp', subs, response, 200) def test_security_groups_list(self): # Get api sample of security groups get list request. response = self._do_get('os-security-groups') subs = self._get_regexes() self._verify_response('security-groups-list-get-resp', subs, response, 200) def test_security_groups_get(self): # Get api sample of security groups get request. security_group_id = '1' response = self._do_get('os-security-groups/%s' % security_group_id) subs = self._get_regexes() self._verify_response('security-groups-get-resp', subs, response, 200) def test_security_groups_list_server(self): # Get api sample of security groups for a specific server. uuid = self._post_server(use_common_server_api_samples=False) response = self._do_get('servers/%s/os-security-groups' % uuid) subs = self._get_regexes() self._verify_response('server-security-groups-list-resp', subs, response, 200) def test_security_groups_add(self): self._create_security_group() uuid = self._post_server(use_common_server_api_samples=False) response = self._add_group(uuid) self.assertEqual(response.status_code, 202) self.assertEqual(response.content, '') def test_security_groups_remove(self): self._create_security_group() uuid = self._post_server(use_common_server_api_samples=False) self._add_group(uuid) subs = { 'group_name': 'test' } response = self._do_post('servers/%s/action' % uuid, 'security-group-remove-post-req', subs) self.assertEqual(response.status_code, 202) self.assertEqual(response.content, '') class SchedulerHintsJsonTest(ApiSampleTestBaseV2): extension_name = ("nova.api.openstack.compute.contrib.scheduler_hints." "Scheduler_hints") def test_scheduler_hints_post(self): # Get api sample of scheduler hint post request. hints = {'image_id': fake.get_valid_image_id(), 'image_near': str(uuid_lib.uuid4()) } response = self._do_post('servers', 'scheduler-hints-post-req', hints) subs = self._get_regexes() self._verify_response('scheduler-hints-post-resp', subs, response, 202) class KeyPairsSampleJsonTest(ApiSampleTestBaseV2): extension_name = "nova.api.openstack.compute.contrib.keypairs.Keypairs" def generalize_subs(self, subs, vanilla_regexes): subs['keypair_name'] = 'keypair-[0-9a-f-]+' return subs def test_keypairs_post(self, public_key=None): """Get api sample of key pairs post request.""" key_name = 'keypair-' + str(uuid_lib.uuid4()) response = self._do_post('os-keypairs', 'keypairs-post-req', {'keypair_name': key_name}) subs = self._get_regexes() subs['keypair_name'] = '(%s)' % key_name self._verify_response('keypairs-post-resp', subs, response, 200) # NOTE(maurosr): return the key_name is necessary cause the # verification returns the label of the last compared information in # the response, not necessarily the key name. return key_name def test_keypairs_import_key_post(self): # Get api sample of key pairs post to import user's key. key_name = 'keypair-' + str(uuid_lib.uuid4()) subs = { 'keypair_name': key_name, 'public_key': "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAAAgQDx8nkQv/zgGg" "B4rMYmIf+6A4l6Rr+o/6lHBQdW5aYd44bd8JttDCE/F/pNRr0l" "RE+PiqSPO8nDPHw0010JeMH9gYgnnFlyY3/OcJ02RhIPyyxYpv" "9FhY+2YiUkpwFOcLImyrxEsYXpD/0d3ac30bNH6Sw9JD9UZHYc" "pSxsIbECHw== Generated-by-Nova" } response = self._do_post('os-keypairs', 'keypairs-import-post-req', subs) subs = self._get_regexes() subs['keypair_name'] = '(%s)' % key_name self._verify_response('keypairs-import-post-resp', subs, response, 200) def test_keypairs_list(self): # Get api sample of key pairs list request. key_name = self.test_keypairs_post() response = self._do_get('os-keypairs') subs = self._get_regexes() subs['keypair_name'] = '(%s)' % key_name self._verify_response('keypairs-list-resp', subs, response, 200) def test_keypairs_get(self): # Get api sample of key pairs get request. key_name = self.test_keypairs_post() response = self._do_get('os-keypairs/%s' % key_name) subs = self._get_regexes() subs['keypair_name'] = '(%s)' % key_name self._verify_response('keypairs-get-resp', subs, response, 200) class RescueJsonTest(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib" ".rescue.Rescue") def _rescue(self, uuid): req_subs = { 'password': 'MySecretPass' } response = self._do_post('servers/%s/action' % uuid, 'server-rescue-req', req_subs) self._verify_response('server-rescue', req_subs, response, 200) def _unrescue(self, uuid): response = self._do_post('servers/%s/action' % uuid, 'server-unrescue-req', {}) self.assertEqual(response.status_code, 202) def test_server_rescue(self): uuid = self._post_server() self._rescue(uuid) # Do a server get to make sure that the 'RESCUE' state is set response = self._do_get('servers/%s' % uuid) subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' subs['id'] = uuid subs['status'] = 'RESCUE' self._verify_response('server-get-resp-rescue', subs, response, 200) def test_server_unrescue(self): uuid = self._post_server() self._rescue(uuid) self._unrescue(uuid) # Do a server get to make sure that the 'ACTIVE' state is back response = self._do_get('servers/%s' % uuid) subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' subs['id'] = uuid subs['status'] = 'ACTIVE' self._verify_response('server-get-resp-unrescue', subs, response, 200) class ExtendedRescueWithImageJsonTest(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib" ".extended_rescue_with_image.Extended_rescue_with_image") def _get_flags(self): f = super(ExtendedRescueWithImageJsonTest, self)._get_flags() f['osapi_compute_extension'] = CONF.osapi_compute_extension[:] # ExtendedRescueWithImage extension also needs Rescue to be loaded. f['osapi_compute_extension'].append( 'nova.api.openstack.compute.contrib.rescue.Rescue') return f def _rescue(self, uuid): req_subs = { 'password': 'MySecretPass', 'rescue_image_ref': fake.get_valid_image_id() } response = self._do_post('servers/%s/action' % uuid, 'server-rescue-req', req_subs) self._verify_response('server-rescue', req_subs, response, 200) def test_server_rescue(self): uuid = self._post_server() self._rescue(uuid) # Do a server get to make sure that the 'RESCUE' state is set response = self._do_get('servers/%s' % uuid) subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' subs['id'] = uuid subs['status'] = 'RESCUE' self._verify_response('server-get-resp-rescue', subs, response, 200) class VirtualInterfacesJsonTest(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib" ".virtual_interfaces.Virtual_interfaces") def test_vifs_list(self): uuid = self._post_server() response = self._do_get('servers/%s/os-virtual-interfaces' % uuid) subs = self._get_regexes() subs['mac_addr'] = '(?:[a-f0-9]{2}:){5}[a-f0-9]{2}' self._verify_response('vifs-list-resp', subs, response, 200) class CloudPipeSampleJsonTest(ApiSampleTestBaseV2): ADMIN_API = True extension_name = "nova.api.openstack.compute.contrib.cloudpipe.Cloudpipe" def setUp(self): super(CloudPipeSampleJsonTest, self).setUp() def get_user_data(self, project_id): """Stub method to generate user data for cloudpipe tests.""" return "VVNFUiBEQVRB\n" def network_api_get(self, context, network_uuid): """Stub to get a valid network and its information.""" return {'vpn_public_address': '127.0.0.1', 'vpn_public_port': 22} self.stubs.Set(pipelib.CloudPipe, 'get_encoded_zip', get_user_data) self.stubs.Set(network_api.API, "get", network_api_get) def generalize_subs(self, subs, vanilla_regexes): subs['project_id'] = 'cloudpipe-[0-9a-f-]+' return subs def test_cloud_pipe_create(self): # Get api samples of cloud pipe extension creation. self.flags(vpn_image_id=fake.get_valid_image_id()) project = {'project_id': 'cloudpipe-' + str(uuid_lib.uuid4())} response = self._do_post('os-cloudpipe', 'cloud-pipe-create-req', project) subs = self._get_regexes() subs.update(project) subs['image_id'] = CONF.vpn_image_id self._verify_response('cloud-pipe-create-resp', subs, response, 200) return project def test_cloud_pipe_list(self): # Get api samples of cloud pipe extension get request. project = self.test_cloud_pipe_create() response = self._do_get('os-cloudpipe') subs = self._get_regexes() subs.update(project) subs['image_id'] = CONF.vpn_image_id self._verify_response('cloud-pipe-get-resp', subs, response, 200) class CloudPipeUpdateJsonTest(ApiSampleTestBaseV2): ADMIN_API = True extension_name = ("nova.api.openstack.compute.contrib" ".cloudpipe_update.Cloudpipe_update") def _get_flags(self): f = super(CloudPipeUpdateJsonTest, self)._get_flags() f['osapi_compute_extension'] = CONF.osapi_compute_extension[:] # Cloudpipe_update also needs cloudpipe to be loaded f['osapi_compute_extension'].append( 'nova.api.openstack.compute.contrib.cloudpipe.Cloudpipe') return f def test_cloud_pipe_update(self): subs = {'vpn_ip': '192.168.1.1', 'vpn_port': 2000} response = self._do_put('os-cloudpipe/configure-project', 'cloud-pipe-update-req', subs) self.assertEqual(response.status_code, 202) self.assertEqual(response.content, "") class UsedLimitsSamplesJsonTest(ApiSampleTestBaseV2): extension_name = ("nova.api.openstack.compute.contrib.used_limits." "Used_limits") def test_get_used_limits(self): # Get api sample to used limits. response = self._do_get('limits') subs = self._get_regexes() self._verify_response('usedlimits-get-resp', subs, response, 200) class UsedLimitsForAdminSamplesJsonTest(ApiSampleTestBaseV2): ADMIN_API = True extends_name = ("nova.api.openstack.compute.contrib.used_limits." "Used_limits") extension_name = ( "nova.api.openstack.compute.contrib.used_limits_for_admin." "Used_limits_for_admin") def test_get_used_limits_for_admin(self): tenant_id = 'openstack' response = self._do_get('limits?tenant_id=%s' % tenant_id) subs = self._get_regexes() return self._verify_response('usedlimitsforadmin-get-resp', subs, response, 200) class ServicesJsonTest(ApiSampleTestBaseV2): extension_name = "nova.api.openstack.compute.contrib.services.Services" ADMIN_API = True def setUp(self): super(ServicesJsonTest, self).setUp() self.stubs.Set(db, "service_get_all", test_services.fake_db_api_service_get_all) self.stubs.Set(timeutils, "utcnow", test_services.fake_utcnow) self.stubs.Set(timeutils, "utcnow_ts", test_services.fake_utcnow_ts) self.stubs.Set(db, "service_get_by_host_and_binary", test_services.fake_service_get_by_host_binary) self.stubs.Set(db, "service_update", test_services.fake_service_update) def tearDown(self): super(ServicesJsonTest, self).tearDown() timeutils.clear_time_override() def fake_load(self, service_name): return service_name == 'os-extended-services' def test_services_list(self): """Return a list of all agent builds.""" response = self._do_get('os-services') subs = {'binary': 'nova-compute', 'host': 'host1', 'zone': 'nova', 'status': 'disabled', 'state': 'up'} subs.update(self._get_regexes()) self._verify_response('services-list-get-resp', subs, response, 200) def test_service_enable(self): """Enable an existing agent build.""" subs = {"host": "host1", 'binary': 'nova-compute'} response = self._do_put('os-services/enable', 'service-enable-put-req', subs) subs = {"host": "host1", "binary": "nova-compute"} self._verify_response('service-enable-put-resp', subs, response, 200) def test_service_disable(self): """Disable an existing agent build.""" subs = {"host": "host1", 'binary': 'nova-compute'} response = self._do_put('os-services/disable', 'service-disable-put-req', subs) subs = {"host": "host1", "binary": "nova-compute"} self._verify_response('service-disable-put-resp', subs, response, 200) def test_service_detail(self): """Return a list of all running services with the disable reason information if that exists. """ self.stubs.Set(extensions.ExtensionManager, "is_loaded", self.fake_load) response = self._do_get('os-services') self.assertEqual(response.status_code, 200) subs = {'binary': 'nova-compute', 'host': 'host1', 'zone': 'nova', 'status': 'disabled', 'state': 'up'} subs.update(self._get_regexes()) self._verify_response('services-get-resp', subs, response, 200) def test_service_disable_log_reason(self): """Disable an existing service and log the reason.""" self.stubs.Set(extensions.ExtensionManager, "is_loaded", self.fake_load) subs = {"host": "host1", 'binary': 'nova-compute', 'disabled_reason': 'test2'} response = self._do_put('os-services/disable-log-reason', 'service-disable-log-put-req', subs) return self._verify_response('service-disable-log-put-resp', subs, response, 200) class ExtendedServicesJsonTest(ApiSampleTestBaseV2): """This extension is extending the functionalities of the Services extension so the funcionalities introduced by this extension are tested in the ServicesJsonTest and ServicesXmlTest classes. """ ADMIN_API = True extension_name = ("nova.api.openstack.compute.contrib." "extended_services.Extended_services") @mock.patch.object(db, 'service_get_all', side_effect=test_services.fake_db_api_service_get_all) @mock.patch.object(db, 'service_get_by_host_and_binary', side_effect=test_services.fake_service_get_by_host_binary) class ExtendedServicesDeleteJsonTest(ApiSampleTestBaseV2): ADMIN_API = True extends_name = ("nova.api.openstack.compute.contrib.services.Services") extension_name = ("nova.api.openstack.compute.contrib." "extended_services_delete.Extended_services_delete") def setUp(self): super(ExtendedServicesDeleteJsonTest, self).setUp() timeutils.set_time_override(test_services.fake_utcnow()) def tearDown(self): super(ExtendedServicesDeleteJsonTest, self).tearDown() timeutils.clear_time_override() def test_service_detail(self, *mocks): """Return a list of all running services with the disable reason information if that exists. """ response = self._do_get('os-services') self.assertEqual(response.status_code, 200) subs = {'id': 1, 'binary': 'nova-compute', 'host': 'host1', 'zone': 'nova', 'status': 'disabled', 'state': 'up'} subs.update(self._get_regexes()) return self._verify_response('services-get-resp', subs, response, 200) def test_service_delete(self, *mocks): response = self._do_delete('os-services/1') self.assertEqual(response.status_code, 204) self.assertEqual(response.content, "") class SimpleTenantUsageSampleJsonTest(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib.simple_tenant_usage." "Simple_tenant_usage") def setUp(self): """setUp method for simple tenant usage.""" super(SimpleTenantUsageSampleJsonTest, self).setUp() started = timeutils.utcnow() now = started + datetime.timedelta(hours=1) timeutils.set_time_override(started) self._post_server() timeutils.set_time_override(now) self.query = { 'start': str(started), 'end': str(now) } def tearDown(self): """tearDown method for simple tenant usage.""" super(SimpleTenantUsageSampleJsonTest, self).tearDown() timeutils.clear_time_override() def test_get_tenants_usage(self): # Get api sample to get all tenants usage request. response = self._do_get('os-simple-tenant-usage?%s' % ( urllib.urlencode(self.query))) subs = self._get_regexes() self._verify_response('simple-tenant-usage-get', subs, response, 200) def test_get_tenant_usage_details(self): # Get api sample to get specific tenant usage request. tenant_id = 'openstack' response = self._do_get('os-simple-tenant-usage/%s?%s' % (tenant_id, urllib.urlencode(self.query))) subs = self._get_regexes() self._verify_response('simple-tenant-usage-get-specific', subs, response, 200) class AvailabilityZoneJsonTest(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib.availability_zone." "Availability_zone") def test_create_availability_zone(self): subs = { 'image_id': fake.get_valid_image_id(), 'host': self._get_host(), "availability_zone": "nova" } response = self._do_post('servers', 'availability-zone-post-req', subs) subs.update(self._get_regexes()) self._verify_response('availability-zone-post-resp', subs, response, 202) class AdminActionsSamplesJsonTest(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib.admin_actions." "Admin_actions") def setUp(self): """setUp Method for AdminActions api samples extension This method creates the server that will be used in each tests """ super(AdminActionsSamplesJsonTest, self).setUp() self.uuid = self._post_server() def test_post_pause(self): # Get api samples to pause server request. response = self._do_post('servers/%s/action' % self.uuid, 'admin-actions-pause', {}) self.assertEqual(response.status_code, 202) def test_post_unpause(self): # Get api samples to unpause server request. self.test_post_pause() response = self._do_post('servers/%s/action' % self.uuid, 'admin-actions-unpause', {}) self.assertEqual(response.status_code, 202) @mock.patch('nova.conductor.manager.ComputeTaskManager._cold_migrate') def test_post_migrate(self, mock_cold_migrate): # Get api samples to migrate server request. response = self._do_post('servers/%s/action' % self.uuid, 'admin-actions-migrate', {}) self.assertEqual(response.status_code, 202) def test_post_reset_network(self): # Get api samples to reset server network request. response = self._do_post('servers/%s/action' % self.uuid, 'admin-actions-reset-network', {}) self.assertEqual(response.status_code, 202) def test_post_inject_network_info(self): # Get api samples to inject network info request. response = self._do_post('servers/%s/action' % self.uuid, 'admin-actions-inject-network-info', {}) self.assertEqual(response.status_code, 202) def test_post_lock_server(self): # Get api samples to lock server request. response = self._do_post('servers/%s/action' % self.uuid, 'admin-actions-lock-server', {}) self.assertEqual(response.status_code, 202) def test_post_unlock_server(self): # Get api samples to unlock server request. self.test_post_lock_server() response = self._do_post('servers/%s/action' % self.uuid, 'admin-actions-unlock-server', {}) self.assertEqual(response.status_code, 202) def test_post_live_migrate_server(self): # Get api samples to server live migrate request. def fake_live_migrate(_self, context, instance, scheduler_hint, block_migration, disk_over_commit): self.assertEqual(self.uuid, instance["uuid"]) host = scheduler_hint["host"] self.assertEqual(self.compute.host, host) self.stubs.Set(conductor_manager.ComputeTaskManager, '_live_migrate', fake_live_migrate) def fake_get_compute(context, host): service = dict(host=host, binary='nova-compute', topic='compute', report_count=1, updated_at='foo', hypervisor_type='bar', hypervisor_version= utils.convert_version_to_int('1.0'), disabled=False) return {'compute_node': [service]} self.stubs.Set(db, "service_get_by_compute_host", fake_get_compute) response = self._do_post('servers/%s/action' % self.uuid, 'admin-actions-live-migrate', {'hostname': self.compute.host}) self.assertEqual(response.status_code, 202) def test_post_reset_state(self): # get api samples to server reset state request. response = self._do_post('servers/%s/action' % self.uuid, 'admin-actions-reset-server-state', {}) self.assertEqual(response.status_code, 202) class ConsoleAuthTokensSampleJsonTests(ServersSampleBase): ADMIN_API = True extends_name = ("nova.api.openstack.compute.contrib.consoles.Consoles") extension_name = ("nova.api.openstack.compute.contrib.console_auth_tokens." "Console_auth_tokens") def _get_console_url(self, data): return jsonutils.loads(data)["console"]["url"] def _get_console_token(self, uuid): response = self._do_post('servers/%s/action' % uuid, 'get-rdp-console-post-req', {'action': 'os-getRDPConsole'}) url = self._get_console_url(response.content) return re.match('.+?token=([^&]+)', url).groups()[0] def test_get_console_connect_info(self): self.flags(enabled=True, group='rdp') uuid = self._post_server() token = self._get_console_token(uuid) response = self._do_get('os-console-auth-tokens/%s' % token) subs = self._get_regexes() subs["uuid"] = uuid subs["host"] = r"[\w\.\-]+" subs["port"] = "[0-9]+" subs["internal_access_path"] = ".*" self._verify_response('get-console-connect-info-get-resp', subs, response, 200) class DeferredDeleteSampleJsonTests(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib" ".deferred_delete.Deferred_delete") def setUp(self): super(DeferredDeleteSampleJsonTests, self).setUp() self.flags(reclaim_instance_interval=1) def test_restore(self): uuid = self._post_server() self._do_delete('servers/%s' % uuid) response = self._do_post('servers/%s/action' % uuid, 'restore-post-req', {}) self.assertEqual(response.status_code, 202) self.assertEqual(response.content, '') def test_force_delete(self): uuid = self._post_server() self._do_delete('servers/%s' % uuid) response = self._do_post('servers/%s/action' % uuid, 'force-delete-post-req', {}) self.assertEqual(response.status_code, 202) self.assertEqual(response.content, '') class QuotasSampleJsonTests(ApiSampleTestBaseV2): ADMIN_API = True extension_name = "nova.api.openstack.compute.contrib.quotas.Quotas" def test_show_quotas(self): # Get api sample to show quotas. response = self._do_get('os-quota-sets/fake_tenant') self._verify_response('quotas-show-get-resp', {}, response, 200) def test_show_quotas_defaults(self): # Get api sample to show quotas defaults. response = self._do_get('os-quota-sets/fake_tenant/defaults') self._verify_response('quotas-show-defaults-get-resp', {}, response, 200) def test_update_quotas(self): # Get api sample to update quotas. response = self._do_put('os-quota-sets/fake_tenant', 'quotas-update-post-req', {}) self._verify_response('quotas-update-post-resp', {}, response, 200) class ExtendedQuotasSampleJsonTests(ApiSampleTestBaseV2): ADMIN_API = True extends_name = "nova.api.openstack.compute.contrib.quotas.Quotas" extension_name = ("nova.api.openstack.compute.contrib" ".extended_quotas.Extended_quotas") def test_delete_quotas(self): # Get api sample to delete quota. response = self._do_delete('os-quota-sets/fake_tenant') self.assertEqual(response.status_code, 202) self.assertEqual(response.content, '') def test_update_quotas(self): # Get api sample to update quotas. response = self._do_put('os-quota-sets/fake_tenant', 'quotas-update-post-req', {}) return self._verify_response('quotas-update-post-resp', {}, response, 200) class UserQuotasSampleJsonTests(ApiSampleTestBaseV2): ADMIN_API = True extends_name = "nova.api.openstack.compute.contrib.quotas.Quotas" extension_name = ("nova.api.openstack.compute.contrib" ".user_quotas.User_quotas") def fake_load(self, *args): return True def test_show_quotas_for_user(self): # Get api sample to show quotas for user. response = self._do_get('os-quota-sets/fake_tenant?user_id=1') self._verify_response('user-quotas-show-get-resp', {}, response, 200) def test_delete_quotas_for_user(self): # Get api sample to delete quota for user. self.stubs.Set(extensions.ExtensionManager, "is_loaded", self.fake_load) response = self._do_delete('os-quota-sets/fake_tenant?user_id=1') self.assertEqual(response.status_code, 202) self.assertEqual(response.content, '') def test_update_quotas_for_user(self): # Get api sample to update quotas for user. response = self._do_put('os-quota-sets/fake_tenant?user_id=1', 'user-quotas-update-post-req', {}) return self._verify_response('user-quotas-update-post-resp', {}, response, 200) class ExtendedIpsSampleJsonTests(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib" ".extended_ips.Extended_ips") def test_show(self): uuid = self._post_server() response = self._do_get('servers/%s' % uuid) subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' subs['id'] = uuid subs['hypervisor_hostname'] = r'[\w\.\-]+' self._verify_response('server-get-resp', subs, response, 200) def test_detail(self): uuid = self._post_server() response = self._do_get('servers/detail') subs = self._get_regexes() subs['id'] = uuid subs['hostid'] = '[a-f0-9]+' self._verify_response('servers-detail-resp', subs, response, 200) class ExtendedIpsMacSampleJsonTests(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib" ".extended_ips_mac.Extended_ips_mac") def test_show(self): uuid = self._post_server() response = self._do_get('servers/%s' % uuid) self.assertEqual(response.status_code, 200) subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' subs['id'] = uuid subs['hypervisor_hostname'] = r'[\w\.\-]+' subs['mac_addr'] = '(?:[a-f0-9]{2}:){5}[a-f0-9]{2}' self._verify_response('server-get-resp', subs, response, 200) def test_detail(self): uuid = self._post_server() response = self._do_get('servers/detail') self.assertEqual(response.status_code, 200) subs = self._get_regexes() subs['id'] = uuid subs['hostid'] = '[a-f0-9]+' subs['mac_addr'] = '(?:[a-f0-9]{2}:){5}[a-f0-9]{2}' self._verify_response('servers-detail-resp', subs, response, 200) class ExtendedVolumesSampleJsonTests(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib" ".extended_volumes.Extended_volumes") def test_show(self): uuid = self._post_server() self.stubs.Set(db, 'block_device_mapping_get_all_by_instance', fakes.stub_bdm_get_all_by_instance) response = self._do_get('servers/%s' % uuid) subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' self._verify_response('server-get-resp', subs, response, 200) def test_detail(self): uuid = self._post_server() self.stubs.Set(db, 'block_device_mapping_get_all_by_instance', fakes.stub_bdm_get_all_by_instance) response = self._do_get('servers/detail') subs = self._get_regexes() subs['id'] = uuid subs['hostid'] = '[a-f0-9]+' self._verify_response('servers-detail-resp', subs, response, 200) class ExtendedVIFNetSampleJsonTests(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib" ".extended_virtual_interfaces_net.Extended_virtual_interfaces_net") def _get_flags(self): f = super(ExtendedVIFNetSampleJsonTests, self)._get_flags() f['osapi_compute_extension'] = CONF.osapi_compute_extension[:] # extended_virtual_interfaces_net_update also # needs virtual_interfaces to be loaded f['osapi_compute_extension'].append( ('nova.api.openstack.compute.contrib' '.virtual_interfaces.Virtual_interfaces')) return f def test_vifs_list(self): uuid = self._post_server() response = self._do_get('servers/%s/os-virtual-interfaces' % uuid) self.assertEqual(response.status_code, 200) subs = self._get_regexes() subs['mac_addr'] = '(?:[a-f0-9]{2}:){5}[a-f0-9]{2}' self._verify_response('vifs-list-resp', subs, response, 200) class ServerPasswordSampleJsonTests(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib.server_password." "Server_password") def test_get_password(self): # Mock password since there is no api to set it def fake_ext_password(*args, **kwargs): return ("xlozO3wLCBRWAa2yDjCCVx8vwNPypxnypmRYDa/zErlQ+EzPe1S/" "Gz6nfmC52mOlOSCRuUOmG7kqqgejPof6M7bOezS387zjq4LSvvwp" "28zUknzy4YzfFGhnHAdai3TxUJ26pfQCYrq8UTzmKF2Bq8ioSEtV" "VzM0A96pDh8W2i7BOz6MdoiVyiev/I1K2LsuipfxSJR7Wdke4zNX" "JjHHP2RfYsVbZ/k9ANu+Nz4iIH8/7Cacud/pphH7EjrY6a4RZNrj" "QskrhKYed0YERpotyjYk1eDtRe72GrSiXteqCM4biaQ5w3ruS+Ac" "X//PXk3uJ5kC7d67fPXaVz4WaQRYMg==") self.stubs.Set(password, "extract_password", fake_ext_password) uuid = self._post_server() response = self._do_get('servers/%s/os-server-password' % uuid) subs = self._get_regexes() subs['encrypted_password'] = fake_ext_password().replace('+', '\\+') self._verify_response('get-password-resp', subs, response, 200) def test_reset_password(self): uuid = self._post_server() response = self._do_delete('servers/%s/os-server-password' % uuid) self.assertEqual(response.status_code, 204) class DiskConfigJsonTest(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib.disk_config." "Disk_config") def test_list_servers_detail(self): uuid = self._post_server(use_common_server_api_samples=False) response = self._do_get('servers/detail') subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' subs['id'] = uuid self._verify_response('list-servers-detail-get', subs, response, 200) def test_get_server(self): uuid = self._post_server(use_common_server_api_samples=False) response = self._do_get('servers/%s' % uuid) subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' self._verify_response('server-get-resp', subs, response, 200) def test_update_server(self): uuid = self._post_server(use_common_server_api_samples=False) response = self._do_put('servers/%s' % uuid, 'server-update-put-req', {}) subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' self._verify_response('server-update-put-resp', subs, response, 200) def test_resize_server(self): self.flags(allow_resize_to_same_host=True) uuid = self._post_server(use_common_server_api_samples=False) response = self._do_post('servers/%s/action' % uuid, 'server-resize-post-req', {}) self.assertEqual(response.status_code, 202) # NOTE(tmello): Resize does not return response body # Bug #1085213. self.assertEqual(response.content, "") def test_rebuild_server(self): uuid = self._post_server(use_common_server_api_samples=False) subs = { 'image_id': fake.get_valid_image_id(), 'host': self._get_host(), } response = self._do_post('servers/%s/action' % uuid, 'server-action-rebuild-req', subs) subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' self._verify_response('server-action-rebuild-resp', subs, response, 202) def test_get_image(self): image_id = fake.get_valid_image_id() response = self._do_get('images/%s' % image_id) subs = self._get_regexes() subs['image_id'] = image_id self._verify_response('image-get-resp', subs, response, 200) def test_list_images(self): response = self._do_get('images/detail') subs = self._get_regexes() self._verify_response('image-list-resp', subs, response, 200) class BlockDeviceMappingV2BootJsonTest(ServersSampleBase): extension_name = ('nova.api.openstack.compute.contrib.' 'block_device_mapping_v2_boot.' 'Block_device_mapping_v2_boot') def _get_flags(self): f = super(BlockDeviceMappingV2BootJsonTest, self)._get_flags() f['osapi_compute_extension'] = CONF.osapi_compute_extension[:] # We need the volumes extension as well f['osapi_compute_extension'].append( 'nova.api.openstack.compute.contrib.volumes.Volumes') return f def test_servers_post_with_bdm_v2(self): self.stubs.Set(cinder.API, 'get', fakes.stub_volume_get) self.stubs.Set(cinder.API, 'check_attach', fakes.stub_volume_check_attach) return self._post_server() class FpingSampleJsonTests(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib.fping.Fping") def setUp(self): super(FpingSampleJsonTests, self).setUp() def fake_check_fping(self): pass self.stubs.Set(utils, "execute", test_fping.execute) self.stubs.Set(fping.FpingController, "check_fping", fake_check_fping) def test_get_fping(self): self._post_server() response = self._do_get('os-fping') subs = self._get_regexes() self._verify_response('fping-get-resp', subs, response, 200) def test_get_fping_details(self): uuid = self._post_server() response = self._do_get('os-fping/%s' % (uuid)) subs = self._get_regexes() self._verify_response('fping-get-details-resp', subs, response, 200) class ExtendedAvailabilityZoneJsonTests(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib" ".extended_availability_zone" ".Extended_availability_zone") def test_show(self): uuid = self._post_server() response = self._do_get('servers/%s' % uuid) subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' self._verify_response('server-get-resp', subs, response, 200) def test_detail(self): self._post_server() response = self._do_get('servers/detail') subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' self._verify_response('servers-detail-resp', subs, response, 200) class ConfigDriveSampleJsonTest(ServersSampleBase): extension_name = ("nova.api.openstack.compute.contrib.config_drive." "Config_drive") def setUp(self): super(ConfigDriveSampleJsonTest, self).setUp() fakes.stub_out_networking(self.stubs) fakes.stub_out_rate_limiting(self.stubs) fake.stub_out_image_service(self.stubs) def test_config_drive_show(self): uuid = self._post_server() response = self._do_get('servers/%s' % uuid) subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' # config drive can be a string for True or empty value for False subs['cdrive'] = '.*' self._verify_response('server-config-drive-get-resp', subs, response, 200) def test_config_drive_detail(self): self._post_server() response = self._do_get('servers/detail') subs = self._get_regexes() subs['hostid'] = '[a-f0-9]+' # config drive can be a string for True or empty value for False subs['cdrive'] = '.*' self._verify_response('servers-config-drive-details-resp', subs, response, 200) @mock.patch.object(service_group_api.API, "service_is_up", lambda _: True) class HypervisorsSampleJsonTests(ApiSampleTestBaseV2): ADMIN_API = True extension_name = ("nova.api.openstack.compute.contrib.hypervisors." "Hypervisors") def test_hypervisors_list(self): response = self._do_get('os-hypervisors') self._verify_response('hypervisors-list-resp', {}, response, 200) def test_hypervisors_search(self): response = self._do_get('os-hypervisors/fake/search') self._verify_response('hypervisors-search-resp', {}, response, 200) def test_hypervisors_servers(self): response = self._do_get('os-hypervisors/fake/servers') self._verify_response('hypervisors-servers-resp', {}, response, 200) def test_hypervisors_show(self): hypervisor_id = 1 subs = { 'hypervisor_id': hypervisor_id } response = self._do_get('os-hypervisors/%s' % hypervisor_id) subs.update(self._get_regexes()) self._verify_response('hypervisors-show-resp', subs, response, 200) def test_hypervisors_statistics(self): response = self._do_get('os-hypervisors/statistics') self._verify_response('hypervisors-statistics-resp', {}, response, 200) def test_hypervisors_uptime(self): def fake_get_host_uptime(self, context, hyp): return (" 08:32:11 up 93 days, 18:25, 12 users, load average:" " 0.20, 0.12, 0.14") self.stubs.Set(compute_api.HostAPI, 'get_host_uptime', fake_get_host_uptime) hypervisor_id = 1 response = self._do_get('os-hypervisors/%s/uptime' % hypervisor_id) subs = { 'hypervisor_id': hypervisor_id, } self._verify_response('hypervisors-uptime-resp', subs, response, 200) class ExtendedHypervisorsJsonTest(ApiSampleTestBaseV2): ADMIN_API = True extends_name = ("nova.api.openstack.compute.contrib." "hypervisors.Hypervisors") extension_name = ("nova.api.openstack.compute.contrib." "extended_hypervisors.Extended_hypervisors") def test_hypervisors_show_with_ip(self): hypervisor_id = 1 subs = { 'hypervisor_id': hypervisor_id } response = self._do_get('os-hypervisors/%s' % hypervisor_id) subs.update(self._get_regexes()) self._verify_response('hypervisors-show-with-ip-resp', subs, response, 200) class HypervisorStatusJsonTest(ApiSampleTestBaseV2): ADMIN_API = True extends_name = ("nova.api.openstack.compute.contrib." "hypervisors.Hypervisors") extension_name = ("nova.api.openstack.compute.contrib." "hypervisor_status.Hypervisor_status") def test_hypervisors_show_with_status(self): hypervisor_id = 1 subs = { 'hypervisor_id': hypervisor_id } response = self._do_get('os-hypervisors/%s' % hypervisor_id) subs.update(self._get_regexes()) self._verify_response('hypervisors-show-with-status-resp', subs, response, 200) @mock.patch("nova.servicegroup.API.service_is_up", return_value=True) class HypervisorsCellsSampleJsonTests(ApiSampleTestBaseV2): ADMIN_API = True extension_name = ("nova.api.openstack.compute.contrib.hypervisors." "Hypervisors") def setUp(self): self.flags(enable=True, cell_type='api', group='cells') super(HypervisorsCellsSampleJsonTests, self).setUp() def test_hypervisor_uptime(self, mocks): fake_hypervisor = objects.ComputeNode(id=1, host='fake-mini', hypervisor_hostname='fake-mini') def fake_get_host_uptime(self, context, hyp): return (" 08:32:11 up 93 days, 18:25, 12 users, load average:" " 0.20, 0.12, 0.14") def fake_compute_node_get(self, context, hyp): return fake_hypervisor def fake_service_get_by_compute_host(self, context, host): return cells_utils.ServiceProxy( objects.Service(id=1, host='fake-mini', disabled=False, disabled_reason=None), 'cell1') self.stubs.Set(cells_api.HostAPI, 'compute_node_get', fake_compute_node_get) self.stubs.Set(cells_api.HostAPI, 'service_get_by_compute_host', fake_service_get_by_compute_host) self.stubs.Set(cells_api.HostAPI, 'get_host_uptime', fake_get_host_uptime) hypervisor_id = fake_hypervisor['id'] response = self._do_get('os-hypervisors/%s/uptime' % hypervisor_id) subs = {'hypervisor_id': hypervisor_id} self._verify_response('hypervisors-uptime-resp', subs, response, 200) class AssistedVolumeSnapshotsJsonTest(ApiSampleTestBaseV2): """Assisted volume snapshots.""" extension_name = ("nova.api.openstack.compute.contrib." "assisted_volume_snapshots.Assisted_volume_snapshots") def _create_assisted_snapshot(self, subs): self.stubs.Set(compute_api.API, 'volume_snapshot_create', fakes.stub_compute_volume_snapshot_create) response = self._do_post("os-assisted-volume-snapshots", "snapshot-create-assisted-req", subs) return response def test_snapshots_create_assisted(self): subs = { 'snapshot_name': 'snap-001', 'description': 'Daily backup', 'volume_id': '521752a6-acf6-4b2d-bc7a-119f9148cd8c', 'snapshot_id': '421752a6-acf6-4b2d-bc7a-119f9148cd8c', 'type': 'qcow2', 'new_file': 'new_file_name' } subs.update(self._get_regexes()) response = self._create_assisted_snapshot(subs) self._verify_response("snapshot-create-assisted-resp", subs, response, 200) def test_snapshots_delete_assisted(self): self.stubs.Set(compute_api.API, 'volume_snapshot_delete', fakes.stub_compute_volume_snapshot_delete) snapshot_id = '100' response = self._do_delete( 'os-assisted-volume-snapshots/%s?delete_info=' '{"volume_id":"521752a6-acf6-4b2d-bc7a-119f9148cd8c"}' % snapshot_id) self.assertEqual(response.status_code, 204) self.assertEqual(response.content, '') class PreserveEphemeralOnRebuildJsonTest(ServersSampleBase): extension_name = ('nova.api.openstack.compute.contrib.' 'preserve_ephemeral_rebuild.' 'Preserve_ephemeral_rebuild') def _test_server_action(self, uuid, action, subs=None, resp_tpl=None, code=202): subs = subs or {} subs.update({'action': action}) response = self._do_post('servers/%s/action' % uuid, 'server-action-%s' % action.lower(), subs) if resp_tpl: subs.update(self._get_regexes()) self._verify_response(resp_tpl, subs, response, code) else: self.assertEqual(response.status_code, code) self.assertEqual(response.content, "") def test_rebuild_server_preserve_ephemeral_false(self): uuid = self._post_server() image = self.api.get_images()[0]['id'] subs = {'host': self._get_host(), 'uuid': image, 'name': 'foobar', 'pass': 'seekr3t', 'ip': '1.2.3.4', 'ip6': 'fe80::100', 'hostid': '[a-f0-9]+', 'preserve_ephemeral': 'false'} self._test_server_action(uuid, 'rebuild', subs, 'server-action-rebuild-resp') def test_rebuild_server_preserve_ephemeral_true(self): image = self.api.get_images()[0]['id'] subs = {'host': self._get_host(), 'uuid': image, 'name': 'new-server-test', 'pass': 'seekr3t', 'ip': '1.2.3.4', 'ip6': 'fe80::100', 'hostid': '[a-f0-9]+', 'preserve_ephemeral': 'true'} def fake_rebuild(self_, context, instance, image_href, admin_password, **kwargs): self.assertTrue(kwargs['preserve_ephemeral']) self.stubs.Set(compute_api.API, 'rebuild', fake_rebuild) instance_uuid = self._post_server() response = self._do_post('servers/%s/action' % instance_uuid, 'server-action-rebuild', subs) self.assertEqual(response.status_code, 202) class ServerGroupQuotas_LimitsSampleJsonTest(LimitsSampleJsonTest): sample_dir = None extension_name = ("nova.api.openstack.compute.contrib." "server_group_quotas.Server_group_quotas") class ServerGroupQuotas_UsedLimitsSamplesJsonTest(UsedLimitsSamplesJsonTest): extension_name = ("nova.api.openstack.compute.contrib." "server_group_quotas.Server_group_quotas") extends_name = ("nova.api.openstack.compute.contrib.used_limits." "Used_limits") class ServerGroupQuotas_QuotasSampleJsonTests(QuotasSampleJsonTests): extension_name = ("nova.api.openstack.compute.contrib." "server_group_quotas.Server_group_quotas") extends_name = "nova.api.openstack.compute.contrib.quotas.Quotas"
#!/usr/bin/env python # # Copyright 2009 Facebook # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """Implementations of various third-party authentication schemes. All the classes in this file are class Mixins designed to be used with web.py RequestHandler classes. The primary methods for each service are authenticate_redirect(), authorize_redirect(), and get_authenticated_user(). The former should be called to redirect the user to, e.g., the OpenID authentication page on the third party service, and the latter should be called upon return to get the user data from the data returned by the third party service. They all take slightly different arguments due to the fact all these services implement authentication and authorization slightly differently. See the individual service classes below for complete documentation. Example usage for Google OpenID:: class GoogleHandler(tornado.web.RequestHandler, tornado.auth.GoogleMixin): @tornado.web.asynchronous def get(self): if self.get_argument("openid.mode", None): self.get_authenticated_user(self.async_callback(self._on_auth)) return self.authenticate_redirect() def _on_auth(self, user): if not user: raise tornado.web.HTTPError(500, "Google auth failed") # Save the user with, e.g., set_secure_cookie() """ import base64 import binascii import hashlib import hmac import logging import time import urllib import urlparse import uuid from tornado import httpclient from tornado import escape from tornado.httputil import url_concat from tornado.util import bytes_type, b class OpenIdMixin(object): """Abstract implementation of OpenID and Attribute Exchange. See GoogleMixin below for example implementations. """ def authenticate_redirect(self, callback_uri=None, ax_attrs=["name","email","language","username"]): """Returns the authentication URL for this service. After authentication, the service will redirect back to the given callback URI. We request the given attributes for the authenticated user by default (name, email, language, and username). If you don't need all those attributes for your app, you can request fewer with the ax_attrs keyword argument. """ callback_uri = callback_uri or self.request.uri args = self._openid_args(callback_uri, ax_attrs=ax_attrs) self.redirect(self._OPENID_ENDPOINT + "?" + urllib.urlencode(args)) def get_authenticated_user(self, callback, http_client=None): """Fetches the authenticated user data upon redirect. This method should be called by the handler that receives the redirect from the authenticate_redirect() or authorize_redirect() methods. """ # Verify the OpenID response via direct request to the OP args = dict((k, v[-1]) for k, v in self.request.arguments.iteritems()) args["openid.mode"] = u"check_authentication" url = self._OPENID_ENDPOINT if http_client is None: http_client = httpclient.AsyncHTTPClient() http_client.fetch(url, self.async_callback( self._on_authentication_verified, callback), method="POST", body=urllib.urlencode(args)) def _openid_args(self, callback_uri, ax_attrs=[], oauth_scope=None): url = urlparse.urljoin(self.request.full_url(), callback_uri) args = { "openid.ns": "http://specs.openid.net/auth/2.0", "openid.claimed_id": "http://specs.openid.net/auth/2.0/identifier_select", "openid.identity": "http://specs.openid.net/auth/2.0/identifier_select", "openid.return_to": url, "openid.realm": urlparse.urljoin(url, '/'), "openid.mode": "checkid_setup", } if ax_attrs: args.update({ "openid.ns.ax": "http://openid.net/srv/ax/1.0", "openid.ax.mode": "fetch_request", }) ax_attrs = set(ax_attrs) required = [] if "name" in ax_attrs: ax_attrs -= set(["name", "firstname", "fullname", "lastname"]) required += ["firstname", "fullname", "lastname"] args.update({ "openid.ax.type.firstname": "http://axschema.org/namePerson/first", "openid.ax.type.fullname": "http://axschema.org/namePerson", "openid.ax.type.lastname": "http://axschema.org/namePerson/last", }) known_attrs = { "email": "http://axschema.org/contact/email", "language": "http://axschema.org/pref/language", "username": "http://axschema.org/namePerson/friendly", } for name in ax_attrs: args["openid.ax.type." + name] = known_attrs[name] required.append(name) args["openid.ax.required"] = ",".join(required) if oauth_scope: args.update({ "openid.ns.oauth": "http://specs.openid.net/extensions/oauth/1.0", "openid.oauth.consumer": self.request.host.split(":")[0], "openid.oauth.scope": oauth_scope, }) return args def _on_authentication_verified(self, callback, response): if response.error or b("is_valid:true") not in response.body: logging.warning("Invalid OpenID response: %s", response.error or response.body) callback(None) return # Make sure we got back at least an email from attribute exchange ax_ns = None for name in self.request.arguments.iterkeys(): if name.startswith("openid.ns.") and \ self.get_argument(name) == u"http://openid.net/srv/ax/1.0": ax_ns = name[10:] break def get_ax_arg(uri): if not ax_ns: return u"" prefix = "openid." + ax_ns + ".type." ax_name = None for name in self.request.arguments.iterkeys(): if self.get_argument(name) == uri and name.startswith(prefix): part = name[len(prefix):] ax_name = "openid." + ax_ns + ".value." + part break if not ax_name: return u"" return self.get_argument(ax_name, u"") email = get_ax_arg("http://axschema.org/contact/email") name = get_ax_arg("http://axschema.org/namePerson") first_name = get_ax_arg("http://axschema.org/namePerson/first") last_name = get_ax_arg("http://axschema.org/namePerson/last") username = get_ax_arg("http://axschema.org/namePerson/friendly") locale = get_ax_arg("http://axschema.org/pref/language").lower() user = dict() name_parts = [] if first_name: user["first_name"] = first_name name_parts.append(first_name) if last_name: user["last_name"] = last_name name_parts.append(last_name) if name: user["name"] = name elif name_parts: user["name"] = u" ".join(name_parts) elif email: user["name"] = email.split("@")[0] if email: user["email"] = email if locale: user["locale"] = locale if username: user["username"] = username callback(user) class OAuthMixin(object): """Abstract implementation of OAuth. See TwitterMixin and FriendFeedMixin below for example implementations. """ def authorize_redirect(self, callback_uri=None, extra_params=None, http_client=None): """Redirects the user to obtain OAuth authorization for this service. Twitter and FriendFeed both require that you register a Callback URL with your application. You should call this method to log the user in, and then call get_authenticated_user() in the handler you registered as your Callback URL to complete the authorization process. This method sets a cookie called _oauth_request_token which is subsequently used (and cleared) in get_authenticated_user for security purposes. """ if callback_uri and getattr(self, "_OAUTH_NO_CALLBACKS", False): raise Exception("This service does not support oauth_callback") if http_client is None: http_client = httpclient.AsyncHTTPClient() if getattr(self, "_OAUTH_VERSION", "1.0a") == "1.0a": http_client.fetch( self._oauth_request_token_url(callback_uri=callback_uri, extra_params=extra_params), self.async_callback( self._on_request_token, self._OAUTH_AUTHORIZE_URL, callback_uri)) else: http_client.fetch( self._oauth_request_token_url(), self.async_callback( self._on_request_token, self._OAUTH_AUTHORIZE_URL, callback_uri)) def get_authenticated_user(self, callback, http_client=None): """Gets the OAuth authorized user and access token on callback. This method should be called from the handler for your registered OAuth Callback URL to complete the registration process. We call callback with the authenticated user, which in addition to standard attributes like 'name' includes the 'access_key' attribute, which contains the OAuth access you can use to make authorized requests to this service on behalf of the user. """ request_key = escape.utf8(self.get_argument("oauth_token")) oauth_verifier = self.get_argument("oauth_verifier", None) request_cookie = self.get_cookie("_oauth_request_token") if not request_cookie: logging.warning("Missing OAuth request token cookie") callback(None) return self.clear_cookie("_oauth_request_token") cookie_key, cookie_secret = [base64.b64decode(escape.utf8(i)) for i in request_cookie.split("|")] if cookie_key != request_key: logging.info((cookie_key, request_key, request_cookie)) logging.warning("Request token does not match cookie") callback(None) return token = dict(key=cookie_key, secret=cookie_secret) if oauth_verifier: token["verifier"] = oauth_verifier if http_client is None: http_client = httpclient.AsyncHTTPClient() http_client.fetch(self._oauth_access_token_url(token), self.async_callback(self._on_access_token, callback)) def _oauth_request_token_url(self, callback_uri= None, extra_params=None): consumer_token = self._oauth_consumer_token() url = self._OAUTH_REQUEST_TOKEN_URL args = dict( oauth_consumer_key=consumer_token["key"], oauth_signature_method="HMAC-SHA1", oauth_timestamp=str(int(time.time())), oauth_nonce=binascii.b2a_hex(uuid.uuid4().bytes), oauth_version=getattr(self, "_OAUTH_VERSION", "1.0a"), ) if getattr(self, "_OAUTH_VERSION", "1.0a") == "1.0a": if callback_uri: args["oauth_callback"] = urlparse.urljoin( self.request.full_url(), callback_uri) if extra_params: args.update(extra_params) signature = _oauth10a_signature(consumer_token, "GET", url, args) else: signature = _oauth_signature(consumer_token, "GET", url, args) args["oauth_signature"] = signature return url + "?" + urllib.urlencode(args) def _on_request_token(self, authorize_url, callback_uri, response): if response.error: raise Exception("Could not get request token") request_token = _oauth_parse_response(response.body) data = (base64.b64encode(request_token["key"]) + b("|") + base64.b64encode(request_token["secret"])) self.set_cookie("_oauth_request_token", data) args = dict(oauth_token=request_token["key"]) if callback_uri: args["oauth_callback"] = urlparse.urljoin( self.request.full_url(), callback_uri) self.redirect(authorize_url + "?" + urllib.urlencode(args)) def _oauth_access_token_url(self, request_token): consumer_token = self._oauth_consumer_token() url = self._OAUTH_ACCESS_TOKEN_URL args = dict( oauth_consumer_key=consumer_token["key"], oauth_token=request_token["key"], oauth_signature_method="HMAC-SHA1", oauth_timestamp=str(int(time.time())), oauth_nonce=binascii.b2a_hex(uuid.uuid4().bytes), oauth_version=getattr(self, "_OAUTH_VERSION", "1.0a"), ) if "verifier" in request_token: args["oauth_verifier"]=request_token["verifier"] if getattr(self, "_OAUTH_VERSION", "1.0a") == "1.0a": signature = _oauth10a_signature(consumer_token, "GET", url, args, request_token) else: signature = _oauth_signature(consumer_token, "GET", url, args, request_token) args["oauth_signature"] = signature return url + "?" + urllib.urlencode(args) def _on_access_token(self, callback, response): if response.error: logging.warning("Could not fetch access token") callback(None) return access_token = _oauth_parse_response(response.body) self._oauth_get_user(access_token, self.async_callback( self._on_oauth_get_user, access_token, callback)) def _oauth_get_user(self, access_token, callback): raise NotImplementedError() def _on_oauth_get_user(self, access_token, callback, user): if not user: callback(None) return user["access_token"] = access_token callback(user) def _oauth_request_parameters(self, url, access_token, parameters={}, method="GET"): """Returns the OAuth parameters as a dict for the given request. parameters should include all POST arguments and query string arguments that will be sent with the request. """ consumer_token = self._oauth_consumer_token() base_args = dict( oauth_consumer_key=consumer_token["key"], oauth_token=access_token["key"], oauth_signature_method="HMAC-SHA1", oauth_timestamp=str(int(time.time())), oauth_nonce=binascii.b2a_hex(uuid.uuid4().bytes), oauth_version=getattr(self, "_OAUTH_VERSION", "1.0a"), ) args = {} args.update(base_args) args.update(parameters) if getattr(self, "_OAUTH_VERSION", "1.0a") == "1.0a": signature = _oauth10a_signature(consumer_token, method, url, args, access_token) else: signature = _oauth_signature(consumer_token, method, url, args, access_token) base_args["oauth_signature"] = signature return base_args class OAuth2Mixin(object): """Abstract implementation of OAuth v 2.""" def authorize_redirect(self, redirect_uri=None, client_id=None, client_secret=None, extra_params=None ): """Redirects the user to obtain OAuth authorization for this service. Some providers require that you register a Callback URL with your application. You should call this method to log the user in, and then call get_authenticated_user() in the handler you registered as your Callback URL to complete the authorization process. """ args = { "redirect_uri": redirect_uri, "client_id": client_id } if extra_params: args.update(extra_params) self.redirect( url_concat(self._OAUTH_AUTHORIZE_URL, args)) def _oauth_request_token_url(self, redirect_uri= None, client_id = None, client_secret=None, code=None, extra_params=None): url = self._OAUTH_ACCESS_TOKEN_URL args = dict( redirect_uri=redirect_uri, code=code, client_id=client_id, client_secret=client_secret, ) if extra_params: args.update(extra_params) return url_concat(url, args) class TwitterMixin(OAuthMixin): """Twitter OAuth authentication. To authenticate with Twitter, register your application with Twitter at http://twitter.com/apps. Then copy your Consumer Key and Consumer Secret to the application settings 'twitter_consumer_key' and 'twitter_consumer_secret'. Use this Mixin on the handler for the URL you registered as your application's Callback URL. When your application is set up, you can use this Mixin like this to authenticate the user with Twitter and get access to their stream:: class TwitterHandler(tornado.web.RequestHandler, tornado.auth.TwitterMixin): @tornado.web.asynchronous def get(self): if self.get_argument("oauth_token", None): self.get_authenticated_user(self.async_callback(self._on_auth)) return self.authorize_redirect() def _on_auth(self, user): if not user: raise tornado.web.HTTPError(500, "Twitter auth failed") # Save the user using, e.g., set_secure_cookie() The user object returned by get_authenticated_user() includes the attributes 'username', 'name', and all of the custom Twitter user attributes describe at http://apiwiki.twitter.com/Twitter-REST-API-Method%3A-users%C2%A0show in addition to 'access_token'. You should save the access token with the user; it is required to make requests on behalf of the user later with twitter_request(). """ _OAUTH_REQUEST_TOKEN_URL = "http://api.twitter.com/oauth/request_token" _OAUTH_ACCESS_TOKEN_URL = "http://api.twitter.com/oauth/access_token" _OAUTH_AUTHORIZE_URL = "http://api.twitter.com/oauth/authorize" _OAUTH_AUTHENTICATE_URL = "http://api.twitter.com/oauth/authenticate" _OAUTH_NO_CALLBACKS = False def authenticate_redirect(self): """Just like authorize_redirect(), but auto-redirects if authorized. This is generally the right interface to use if you are using Twitter for single-sign on. """ http = httpclient.AsyncHTTPClient() http.fetch(self._oauth_request_token_url(), self.async_callback( self._on_request_token, self._OAUTH_AUTHENTICATE_URL, None)) def twitter_request(self, path, callback, access_token=None, post_args=None, **args): """Fetches the given API path, e.g., "/statuses/user_timeline/btaylor" The path should not include the format (we automatically append ".json" and parse the JSON output). If the request is a POST, post_args should be provided. Query string arguments should be given as keyword arguments. All the Twitter methods are documented at http://apiwiki.twitter.com/Twitter-API-Documentation. Many methods require an OAuth access token which you can obtain through authorize_redirect() and get_authenticated_user(). The user returned through that process includes an 'access_token' attribute that can be used to make authenticated requests via this method. Example usage:: class MainHandler(tornado.web.RequestHandler, tornado.auth.TwitterMixin): @tornado.web.authenticated @tornado.web.asynchronous def get(self): self.twitter_request( "/statuses/update", post_args={"status": "Testing Tornado Web Server"}, access_token=user["access_token"], callback=self.async_callback(self._on_post)) def _on_post(self, new_entry): if not new_entry: # Call failed; perhaps missing permission? self.authorize_redirect() return self.finish("Posted a message!") """ # Add the OAuth resource request signature if we have credentials url = "http://api.twitter.com/1" + path + ".json" if access_token: all_args = {} all_args.update(args) all_args.update(post_args or {}) method = "POST" if post_args is not None else "GET" oauth = self._oauth_request_parameters( url, access_token, all_args, method=method) args.update(oauth) if args: url += "?" + urllib.urlencode(args) callback = self.async_callback(self._on_twitter_request, callback) http = httpclient.AsyncHTTPClient() if post_args is not None: http.fetch(url, method="POST", body=urllib.urlencode(post_args), callback=callback) else: http.fetch(url, callback=callback) def _on_twitter_request(self, callback, response): if response.error: logging.warning("Error response %s fetching %s", response.error, response.request.url) callback(None) return callback(escape.json_decode(response.body)) def _oauth_consumer_token(self): self.require_setting("twitter_consumer_key", "Twitter OAuth") self.require_setting("twitter_consumer_secret", "Twitter OAuth") return dict( key=self.settings["twitter_consumer_key"], secret=self.settings["twitter_consumer_secret"]) def _oauth_get_user(self, access_token, callback): callback = self.async_callback(self._parse_user_response, callback) self.twitter_request( "/users/show/" + access_token["screen_name"], access_token=access_token, callback=callback) def _parse_user_response(self, callback, user): if user: user["username"] = user["screen_name"] callback(user) class FriendFeedMixin(OAuthMixin): """FriendFeed OAuth authentication. To authenticate with FriendFeed, register your application with FriendFeed at http://friendfeed.com/api/applications. Then copy your Consumer Key and Consumer Secret to the application settings 'friendfeed_consumer_key' and 'friendfeed_consumer_secret'. Use this Mixin on the handler for the URL you registered as your application's Callback URL. When your application is set up, you can use this Mixin like this to authenticate the user with FriendFeed and get access to their feed:: class FriendFeedHandler(tornado.web.RequestHandler, tornado.auth.FriendFeedMixin): @tornado.web.asynchronous def get(self): if self.get_argument("oauth_token", None): self.get_authenticated_user(self.async_callback(self._on_auth)) return self.authorize_redirect() def _on_auth(self, user): if not user: raise tornado.web.HTTPError(500, "FriendFeed auth failed") # Save the user using, e.g., set_secure_cookie() The user object returned by get_authenticated_user() includes the attributes 'username', 'name', and 'description' in addition to 'access_token'. You should save the access token with the user; it is required to make requests on behalf of the user later with friendfeed_request(). """ _OAUTH_VERSION = "1.0" _OAUTH_REQUEST_TOKEN_URL = "https://friendfeed.com/account/oauth/request_token" _OAUTH_ACCESS_TOKEN_URL = "https://friendfeed.com/account/oauth/access_token" _OAUTH_AUTHORIZE_URL = "https://friendfeed.com/account/oauth/authorize" _OAUTH_NO_CALLBACKS = True _OAUTH_VERSION = "1.0" def friendfeed_request(self, path, callback, access_token=None, post_args=None, **args): """Fetches the given relative API path, e.g., "/bret/friends" If the request is a POST, post_args should be provided. Query string arguments should be given as keyword arguments. All the FriendFeed methods are documented at http://friendfeed.com/api/documentation. Many methods require an OAuth access token which you can obtain through authorize_redirect() and get_authenticated_user(). The user returned through that process includes an 'access_token' attribute that can be used to make authenticated requests via this method. Example usage:: class MainHandler(tornado.web.RequestHandler, tornado.auth.FriendFeedMixin): @tornado.web.authenticated @tornado.web.asynchronous def get(self): self.friendfeed_request( "/entry", post_args={"body": "Testing Tornado Web Server"}, access_token=self.current_user["access_token"], callback=self.async_callback(self._on_post)) def _on_post(self, new_entry): if not new_entry: # Call failed; perhaps missing permission? self.authorize_redirect() return self.finish("Posted a message!") """ # Add the OAuth resource request signature if we have credentials url = "http://friendfeed-api.com/v2" + path if access_token: all_args = {} all_args.update(args) all_args.update(post_args or {}) method = "POST" if post_args is not None else "GET" oauth = self._oauth_request_parameters( url, access_token, all_args, method=method) args.update(oauth) if args: url += "?" + urllib.urlencode(args) callback = self.async_callback(self._on_friendfeed_request, callback) http = httpclient.AsyncHTTPClient() if post_args is not None: http.fetch(url, method="POST", body=urllib.urlencode(post_args), callback=callback) else: http.fetch(url, callback=callback) def _on_friendfeed_request(self, callback, response): if response.error: logging.warning("Error response %s fetching %s", response.error, response.request.url) callback(None) return callback(escape.json_decode(response.body)) def _oauth_consumer_token(self): self.require_setting("friendfeed_consumer_key", "FriendFeed OAuth") self.require_setting("friendfeed_consumer_secret", "FriendFeed OAuth") return dict( key=self.settings["friendfeed_consumer_key"], secret=self.settings["friendfeed_consumer_secret"]) def _oauth_get_user(self, access_token, callback): callback = self.async_callback(self._parse_user_response, callback) self.friendfeed_request( "/feedinfo/" + access_token["username"], include="id,name,description", access_token=access_token, callback=callback) def _parse_user_response(self, callback, user): if user: user["username"] = user["id"] callback(user) class GoogleMixin(OpenIdMixin, OAuthMixin): """Google Open ID / OAuth authentication. No application registration is necessary to use Google for authentication or to access Google resources on behalf of a user. To authenticate with Google, redirect with authenticate_redirect(). On return, parse the response with get_authenticated_user(). We send a dict containing the values for the user, including 'email', 'name', and 'locale'. Example usage:: class GoogleHandler(tornado.web.RequestHandler, tornado.auth.GoogleMixin): @tornado.web.asynchronous def get(self): if self.get_argument("openid.mode", None): self.get_authenticated_user(self.async_callback(self._on_auth)) return self.authenticate_redirect() def _on_auth(self, user): if not user: raise tornado.web.HTTPError(500, "Google auth failed") # Save the user with, e.g., set_secure_cookie() """ _OPENID_ENDPOINT = "https://www.google.com/accounts/o8/ud" _OAUTH_ACCESS_TOKEN_URL = "https://www.google.com/accounts/OAuthGetAccessToken" def authorize_redirect(self, oauth_scope, callback_uri=None, ax_attrs=["name","email","language","username"]): """Authenticates and authorizes for the given Google resource. Some of the available resources are: * Gmail Contacts - http://www.google.com/m8/feeds/ * Calendar - http://www.google.com/calendar/feeds/ * Finance - http://finance.google.com/finance/feeds/ You can authorize multiple resources by separating the resource URLs with a space. """ callback_uri = callback_uri or self.request.uri args = self._openid_args(callback_uri, ax_attrs=ax_attrs, oauth_scope=oauth_scope) self.redirect(self._OPENID_ENDPOINT + "?" + urllib.urlencode(args)) def get_authenticated_user(self, callback): """Fetches the authenticated user data upon redirect.""" # Look to see if we are doing combined OpenID/OAuth oauth_ns = "" for name, values in self.request.arguments.iteritems(): if name.startswith("openid.ns.") and \ values[-1] == u"http://specs.openid.net/extensions/oauth/1.0": oauth_ns = name[10:] break token = self.get_argument("openid." + oauth_ns + ".request_token", "") if token: http = httpclient.AsyncHTTPClient() token = dict(key=token, secret="") http.fetch(self._oauth_access_token_url(token), self.async_callback(self._on_access_token, callback)) else: OpenIdMixin.get_authenticated_user(self, callback) def _oauth_consumer_token(self): self.require_setting("google_consumer_key", "Google OAuth") self.require_setting("google_consumer_secret", "Google OAuth") return dict( key=self.settings["google_consumer_key"], secret=self.settings["google_consumer_secret"]) def _oauth_get_user(self, access_token, callback): OpenIdMixin.get_authenticated_user(self, callback) class FacebookMixin(object): """Facebook Connect authentication. New applications should consider using `FacebookGraphMixin` below instead of this class. To authenticate with Facebook, register your application with Facebook at http://www.facebook.com/developers/apps.php. Then copy your API Key and Application Secret to the application settings 'facebook_api_key' and 'facebook_secret'. When your application is set up, you can use this Mixin like this to authenticate the user with Facebook:: class FacebookHandler(tornado.web.RequestHandler, tornado.auth.FacebookMixin): @tornado.web.asynchronous def get(self): if self.get_argument("session", None): self.get_authenticated_user(self.async_callback(self._on_auth)) return self.authenticate_redirect() def _on_auth(self, user): if not user: raise tornado.web.HTTPError(500, "Facebook auth failed") # Save the user using, e.g., set_secure_cookie() The user object returned by get_authenticated_user() includes the attributes 'facebook_uid' and 'name' in addition to session attributes like 'session_key'. You should save the session key with the user; it is required to make requests on behalf of the user later with facebook_request(). """ def authenticate_redirect(self, callback_uri=None, cancel_uri=None, extended_permissions=None): """Authenticates/installs this app for the current user.""" self.require_setting("facebook_api_key", "Facebook Connect") callback_uri = callback_uri or self.request.uri args = { "api_key": self.settings["facebook_api_key"], "v": "1.0", "fbconnect": "true", "display": "page", "next": urlparse.urljoin(self.request.full_url(), callback_uri), "return_session": "true", } if cancel_uri: args["cancel_url"] = urlparse.urljoin( self.request.full_url(), cancel_uri) if extended_permissions: if isinstance(extended_permissions, (unicode, bytes_type)): extended_permissions = [extended_permissions] args["req_perms"] = ",".join(extended_permissions) self.redirect("http://www.facebook.com/login.php?" + urllib.urlencode(args)) def authorize_redirect(self, extended_permissions, callback_uri=None, cancel_uri=None): """Redirects to an authorization request for the given FB resource. The available resource names are listed at http://wiki.developers.facebook.com/index.php/Extended_permission. The most common resource types include: * publish_stream * read_stream * email * sms extended_permissions can be a single permission name or a list of names. To get the session secret and session key, call get_authenticated_user() just as you would with authenticate_redirect(). """ self.authenticate_redirect(callback_uri, cancel_uri, extended_permissions) def get_authenticated_user(self, callback): """Fetches the authenticated Facebook user. The authenticated user includes the special Facebook attributes 'session_key' and 'facebook_uid' in addition to the standard user attributes like 'name'. """ self.require_setting("facebook_api_key", "Facebook Connect") session = escape.json_decode(self.get_argument("session")) self.facebook_request( method="facebook.users.getInfo", callback=self.async_callback( self._on_get_user_info, callback, session), session_key=session["session_key"], uids=session["uid"], fields="uid,first_name,last_name,name,locale,pic_square," \ "profile_url,username") def facebook_request(self, method, callback, **args): """Makes a Facebook API REST request. We automatically include the Facebook API key and signature, but it is the callers responsibility to include 'session_key' and any other required arguments to the method. The available Facebook methods are documented here: http://wiki.developers.facebook.com/index.php/API Here is an example for the stream.get() method:: class MainHandler(tornado.web.RequestHandler, tornado.auth.FacebookMixin): @tornado.web.authenticated @tornado.web.asynchronous def get(self): self.facebook_request( method="stream.get", callback=self.async_callback(self._on_stream), session_key=self.current_user["session_key"]) def _on_stream(self, stream): if stream is None: # Not authorized to read the stream yet? self.redirect(self.authorize_redirect("read_stream")) return self.render("stream.html", stream=stream) """ self.require_setting("facebook_api_key", "Facebook Connect") self.require_setting("facebook_secret", "Facebook Connect") if not method.startswith("facebook."): method = "facebook." + method args["api_key"] = self.settings["facebook_api_key"] args["v"] = "1.0" args["method"] = method args["call_id"] = str(long(time.time() * 1e6)) args["format"] = "json" args["sig"] = self._signature(args) url = "http://api.facebook.com/restserver.php?" + \ urllib.urlencode(args) http = httpclient.AsyncHTTPClient() http.fetch(url, callback=self.async_callback( self._parse_response, callback)) def _on_get_user_info(self, callback, session, users): if users is None: callback(None) return callback({ "name": users[0]["name"], "first_name": users[0]["first_name"], "last_name": users[0]["last_name"], "uid": users[0]["uid"], "locale": users[0]["locale"], "pic_square": users[0]["pic_square"], "profile_url": users[0]["profile_url"], "username": users[0].get("username"), "session_key": session["session_key"], "session_expires": session.get("expires"), }) def _parse_response(self, callback, response): if response.error: logging.warning("HTTP error from Facebook: %s", response.error) callback(None) return try: json = escape.json_decode(response.body) except Exception: logging.warning("Invalid JSON from Facebook: %r", response.body) callback(None) return if isinstance(json, dict) and json.get("error_code"): logging.warning("Facebook error: %d: %r", json["error_code"], json.get("error_msg")) callback(None) return callback(json) def _signature(self, args): parts = ["%s=%s" % (n, args[n]) for n in sorted(args.keys())] body = "".join(parts) + self.settings["facebook_secret"] if isinstance(body, unicode): body = body.encode("utf-8") return hashlib.md5(body).hexdigest() class FacebookGraphMixin(OAuth2Mixin): """Facebook authentication using the new Graph API and OAuth2.""" _OAUTH_ACCESS_TOKEN_URL = "https://graph.facebook.com/oauth/access_token?" _OAUTH_AUTHORIZE_URL = "https://graph.facebook.com/oauth/authorize?" _OAUTH_NO_CALLBACKS = False def get_authenticated_user(self, redirect_uri, client_id, client_secret, code, callback, extra_fields=None): """Handles the login for the Facebook user, returning a user object. Example usage:: class FacebookGraphLoginHandler(LoginHandler, tornado.auth.FacebookGraphMixin): @tornado.web.asynchronous def get(self): if self.get_argument("code", False): self.get_authenticated_user( redirect_uri='/auth/facebookgraph/', client_id=self.settings["facebook_api_key"], client_secret=self.settings["facebook_secret"], code=self.get_argument("code"), callback=self.async_callback( self._on_login)) return self.authorize_redirect(redirect_uri='/auth/facebookgraph/', client_id=self.settings["facebook_api_key"], extra_params={"scope": "read_stream,offline_access"}) def _on_login(self, user): logging.error(user) self.finish() """ http = httpclient.AsyncHTTPClient() args = { "redirect_uri": redirect_uri, "code": code, "client_id": client_id, "client_secret": client_secret, } fields = set(['id', 'name', 'first_name', 'last_name', 'locale', 'picture', 'link']) if extra_fields: fields.update(extra_fields) http.fetch(self._oauth_request_token_url(**args), self.async_callback(self._on_access_token, redirect_uri, client_id, client_secret, callback, fields)) def _on_access_token(self, redirect_uri, client_id, client_secret, callback, fields, response): if response.error: logging.warning('Facebook auth error: %s' % str(response)) callback(None) return args = escape.parse_qs_bytes(escape.native_str(response.body)) session = { "access_token": args["access_token"][-1], "expires": args.get("expires") } self.facebook_request( path="/me", callback=self.async_callback( self._on_get_user_info, callback, session, fields), access_token=session["access_token"], fields=",".join(fields) ) def _on_get_user_info(self, callback, session, fields, user): if user is None: callback(None) return fieldmap = {} for field in fields: fieldmap[field] = user.get(field) fieldmap.update({"access_token": session["access_token"], "session_expires": session.get("expires")}) callback(fieldmap) def facebook_request(self, path, callback, access_token=None, post_args=None, **args): """Fetches the given relative API path, e.g., "/btaylor/picture" If the request is a POST, post_args should be provided. Query string arguments should be given as keyword arguments. An introduction to the Facebook Graph API can be found at http://developers.facebook.com/docs/api Many methods require an OAuth access token which you can obtain through authorize_redirect() and get_authenticated_user(). The user returned through that process includes an 'access_token' attribute that can be used to make authenticated requests via this method. Example usage:: class MainHandler(tornado.web.RequestHandler, tornado.auth.FacebookGraphMixin): @tornado.web.authenticated @tornado.web.asynchronous def get(self): self.facebook_request( "/me/feed", post_args={"message": "I am posting from my Tornado application!"}, access_token=self.current_user["access_token"], callback=self.async_callback(self._on_post)) def _on_post(self, new_entry): if not new_entry: # Call failed; perhaps missing permission? self.authorize_redirect() return self.finish("Posted a message!") """ url = "https://graph.facebook.com" + path all_args = {} if access_token: all_args["access_token"] = access_token all_args.update(args) all_args.update(post_args or {}) if all_args: url += "?" + urllib.urlencode(all_args) callback = self.async_callback(self._on_facebook_request, callback) http = httpclient.AsyncHTTPClient() if post_args is not None: http.fetch(url, method="POST", body=urllib.urlencode(post_args), callback=callback) else: http.fetch(url, callback=callback) def _on_facebook_request(self, callback, response): if response.error: logging.warning("Error response %s fetching %s", response.error, response.request.url) callback(None) return callback(escape.json_decode(response.body)) def _oauth_signature(consumer_token, method, url, parameters={}, token=None): """Calculates the HMAC-SHA1 OAuth signature for the given request. See http://oauth.net/core/1.0/#signing_process """ parts = urlparse.urlparse(url) scheme, netloc, path = parts[:3] normalized_url = scheme.lower() + "://" + netloc.lower() + path base_elems = [] base_elems.append(method.upper()) base_elems.append(normalized_url) base_elems.append("&".join("%s=%s" % (k, _oauth_escape(str(v))) for k, v in sorted(parameters.items()))) base_string = "&".join(_oauth_escape(e) for e in base_elems) key_elems = [escape.utf8(consumer_token["secret"])] key_elems.append(escape.utf8(token["secret"] if token else "")) key = b("&").join(key_elems) hash = hmac.new(key, escape.utf8(base_string), hashlib.sha1) return binascii.b2a_base64(hash.digest())[:-1] def _oauth10a_signature(consumer_token, method, url, parameters={}, token=None): """Calculates the HMAC-SHA1 OAuth 1.0a signature for the given request. See http://oauth.net/core/1.0a/#signing_process """ parts = urlparse.urlparse(url) scheme, netloc, path = parts[:3] normalized_url = scheme.lower() + "://" + netloc.lower() + path base_elems = [] base_elems.append(method.upper()) base_elems.append(normalized_url) base_elems.append("&".join("%s=%s" % (k, _oauth_escape(str(v))) for k, v in sorted(parameters.items()))) base_string = "&".join(_oauth_escape(e) for e in base_elems) key_elems = [escape.utf8(urllib.quote(consumer_token["secret"], safe='~'))] key_elems.append(escape.utf8(urllib.quote(token["secret"], safe='~') if token else "")) key = b("&").join(key_elems) hash = hmac.new(key, escape.utf8(base_string), hashlib.sha1) return binascii.b2a_base64(hash.digest())[:-1] def _oauth_escape(val): if isinstance(val, unicode): val = val.encode("utf-8") return urllib.quote(val, safe="~") def _oauth_parse_response(body): p = escape.parse_qs(body, keep_blank_values=False) token = dict(key=p[b("oauth_token")][0], secret=p[b("oauth_token_secret")][0]) # Add the extra parameters the Provider included to the token special = (b("oauth_token"), b("oauth_token_secret")) token.update((k, p[k][0]) for k in p if k not in special) return token
from config import Configuration from corpus import Corpus, Sentence, Token, getTokens from param import FeatParams class Extractor: @staticmethod def extract(sent): transition = sent.initialTransition labels, features = [], [] while transition.next: if transition.next is None or transition.next.type is None: pass if transition.next is not None and transition.next.type: labels.append(transition.next.type.value) features.append(Extractor.getFeatures(transition, sent)) transition = transition.next sent.featuresInfo = [labels, features] return labels, features @staticmethod def getFeatures(transition, sent): transDic = {} configuration = transition.configuration if FeatParams.smartMWTDetection: if configuration.stack and isinstance(configuration.stack[-1], Token) and configuration.stack[ -1].getLemma() in Corpus.mwtDictionary: transDic['isMWT_' + Corpus.mwtDictionary[configuration.stack[-1].getLemma()].lower()] = True # return transDic # TODO return transDic directly in this case if FeatParams.useStackLength and len(configuration.stack) > 1: transDic['StackLengthIs'] = len(configuration.stack) if len(configuration.stack) >= 2: stackElements = [configuration.stack[-2], configuration.stack[-1]] else: stackElements = configuration.stack # General linguistic Informations if stackElements: elemIdx = len(stackElements) - 1 for elem in stackElements: Extractor.generateLinguisticFeatures(elem, 'S' + str(elemIdx), transDic) elemIdx -= 1 if len(configuration.buffer) > 0: if FeatParams.useFirstBufferElement: Extractor.generateLinguisticFeatures(configuration.buffer[0], 'B0', transDic) if FeatParams.useSecondBufferElement and len(configuration.buffer) > 1: Extractor.generateLinguisticFeatures(configuration.buffer[1], 'B1', transDic) # Bi-Gram Generation if FeatParams.useBiGram: if len(stackElements) > 1: # Generate a Bi-gram S1S0 S0B0 S1B0 S0B1 Extractor.generateBiGram(stackElements[-2], stackElements[-1], 'S1S0', transDic) if FeatParams.generateS1B1 and len(configuration.buffer) > 1: Extractor.generateBiGram(stackElements[-2], configuration.buffer[1], 'S1B1', transDic) if len(stackElements) > 0 and len(configuration.buffer) > 0: Extractor.generateBiGram(stackElements[-1], configuration.buffer[0], 'S0B0', transDic) if len(stackElements) > 1: Extractor.generateBiGram(stackElements[-2], configuration.buffer[0], 'S1B0', transDic) if len(configuration.buffer) > 1: Extractor.generateBiGram(stackElements[-1], configuration.buffer[1], 'S0B1', transDic) if FeatParams.generateS0B2Bigram and len(configuration.buffer) > 2: Extractor.generateBiGram(stackElements[-1], configuration.buffer[2], 'S0B2', transDic) # Tri-Gram Generation if FeatParams.useTriGram and len(stackElements) > 1 and len(configuration.buffer) > 0: Extractor.generateTriGram(stackElements[-2], stackElements[-1], configuration.buffer[0], 'S1S0B0', transDic) # Syntaxic Informations if len(stackElements) > 0 and FeatParams.useSyntax: Extractor.generateSyntaxicFeatures(configuration.stack, configuration.buffer, transDic) # Distance information if FeatParams.useS0B0Distance and len(configuration.stack) > 0 and len(configuration.buffer) > 0: stackTokens = getTokens(configuration.stack[-1]) transDic['S0B0Distance'] = str( sent.tokens.index(configuration.buffer[0]) - sent.tokens.index(stackTokens[-1])) if FeatParams.useS0S1Distance and len(configuration.stack) > 1 and isinstance(configuration.stack[-1], Token) \ and isinstance(configuration.stack[-2], Token): transDic['S0S1Distance'] = str( sent.tokens.index(configuration.stack[-1]) - sent.tokens.index(configuration.stack[-2])) Extractor.addTransitionHistory(transition, transDic) if FeatParams.useLexic and len(configuration.buffer) > 0 and len(configuration.stack) >= 1: Extractor.generateDisconinousFeatures(configuration, sent, transDic) Extractor.enhanceMerge(transition, transDic) return transDic @staticmethod def enhanceMerge(transition, transDic): if not FeatParams.enhanceMerge: return config = transition.configuration if transition.type.value != 0 and len(config.buffer) > 0 and len( config.stack) > 0 and isinstance(config.stack[-1], Token): if isinstance(config.stack[-1], Token) and Extractor.areInLexic([config.stack[-1], config.buffer[0]]): transDic['S0B0InLexic'] = True if len(config.buffer) > 1 and Extractor.areInLexic([config.stack[-1], config.buffer[0], config.buffer[1]]): transDic['S0B0B1InLexic'] = True if len(config.buffer) > 2 and Extractor.areInLexic( [config.stack[-1], config.buffer[0], config.buffer[1], config.buffer[2]]): transDic['S0B0B1B2InLexic'] = True if len(config.buffer) > 1 and len(config.stack) > 1 and Extractor.areInLexic( [config.stack[-2], config.stack[-1], config.buffer[1]]): transDic['S1S0B1InLexic'] = True if len(config.buffer) > 0 and len(config.stack) > 1 and Extractor.areInLexic( [config.stack[-2], config.buffer[0]]) and not Extractor.areInLexic( [config.stack[-1], config.buffer[0]]): transDic['S1B0InLexic'] = True transDic['S0B0tInLexic'] = False if len(config.buffer) > 1 and Extractor.areInLexic( [config.stack[-2], config.buffer[1]]) and not Extractor.areInLexic( [config.stack[-1], config.buffer[1]]): transDic['S1B1InLexic'] = True transDic['S0B1InLexic'] = False @staticmethod def generateDisconinousFeatures(configuration, sent, transDic): tokens = Sentence.getTokens([configuration.stack[-1]]) tokenTxt = Sentence.getTokenLemmas(tokens) for key in Corpus.mweDictionary.keys(): if tokenTxt in key and tokenTxt != key: bufidx = 0 for bufElem in configuration.buffer[:5]: if bufElem.lemma != '' and ( (tokenTxt + ' ' + bufElem.lemma) in key or (bufElem.lemma + ' ' + tokenTxt) in key): transDic['S0B' + str(bufidx) + 'ArePartsOfMWE'] = True transDic['S0B' + str(bufidx) + 'ArePartsOfMWEDistance'] = sent.tokens.index( bufElem) - sent.tokens.index(tokens[-1]) bufidx += 1 break @staticmethod def generateLinguisticFeatures(token, label, transDic): if isinstance(token, list): token = Extractor.concatenateTokens([token])[0] transDic[label + 'Token'] = token.text if FeatParams.usePOS and token.posTag is not None and token.posTag.strip() != '': transDic[label + 'POS'] = token.posTag if FeatParams.useLemma and token.lemma is not None and token.lemma.strip() != '': transDic[label + 'Lemma'] = token.lemma if not FeatParams.useLemma and not FeatParams.usePOS: transDic[label + '_LastThreeLetters'] = token.text[-3:] transDic[label + '_LastTwoLetters'] = token.text[-2:] if FeatParams.useDictionary and (( token.lemma != '' and token.lemma in Corpus.mweTokenDic.keys()) or token.text in Corpus.mweTokenDic.keys()): transDic[label + 'IsInLexic'] = 'true' @staticmethod def generateSyntaxicFeatures(stack, buffer, dic): if stack is not None and len(stack) > 0: stack0 = stack[-1] if not isinstance(stack0, Token): return if int(stack0.dependencyParent) == -1 or int( stack0.dependencyParent) == 0 or stack0.dependencyLabel.strip() == '' or buffer is None and len( buffer) <= 0: return for bElem in buffer: if bElem.dependencyParent == stack0.position: dic['hasRighDep_' + bElem.dependencyLabel] = 'true' dic[stack0.getLemma() + '_hasRighDep_' + bElem.dependencyLabel] = 'true' dic[stack0.getLemma() + '_' + bElem.getLemma() + '_hasRighDep_' + bElem.dependencyLabel] = 'true' if stack0.dependencyParent > stack0.position: for bElem in buffer: if bElem.position == stack0.dependencyParent: dic[stack0.lemma + '_isGouvernedBy_' + bElem.getLemma()] = 'true' dic[stack0.lemma + '_isGouvernedBy_' + bElem.getLemma() + '_' + stack0.dependencyLabel] = 'true' break if len(stack) > 1: stack1 = stack[-2] if not isinstance(stack1, Token): return if stack0.dependencyParent == stack1.position: dic['SyntaxicRelation'] = '+' + stack0.dependencyLabel elif stack0.position == stack1.dependencyParent: dic['SyntaxicRelation'] = '-' + stack1.dependencyLabel @staticmethod def generateTriGram(token0, token1, token2, label, transDic): tokens = Extractor.concatenateTokens([token0, token1, token2]) Extractor.getFeatureInfo(transDic, label + 'Token', tokens, 'ttt') Extractor.getFeatureInfo(transDic, label + 'Lemma', tokens, 'lll') Extractor.getFeatureInfo(transDic, label + 'POS', tokens, 'ppp') Extractor.getFeatureInfo(transDic, label + 'LemmaPOSPOS', tokens, 'lpp') Extractor.getFeatureInfo(transDic, label + 'POSLemmaPOS', tokens, 'plp') Extractor.getFeatureInfo(transDic, label + 'POSPOSLemma', tokens, 'ppl') Extractor.getFeatureInfo(transDic, label + 'LemmaLemmaPOS', tokens, 'llp') Extractor.getFeatureInfo(transDic, label + 'LemmaPOSLemma', tokens, 'lpl') Extractor.getFeatureInfo(transDic, label + 'POSLemmaLemma', tokens, 'pll') @staticmethod def generateBiGram(token0, token1, label, transDic): tokens = Extractor.concatenateTokens([token0, token1]) Extractor.getFeatureInfo(transDic, label + 'Token', tokens, 'tt') Extractor.getFeatureInfo(transDic, label + 'Lemma', tokens, 'll') Extractor.getFeatureInfo(transDic, label + 'POS', tokens, 'pp') Extractor.getFeatureInfo(transDic, label + 'LemmaPOS', tokens, 'lp') Extractor.getFeatureInfo(transDic, label + 'POSLemma', tokens, 'pl') @staticmethod def concatenateTokens(tokens): idx = 0 tokenDic = {} result = [] for token in tokens: if isinstance(token, Token): result.append(Token(-1, token.text, token.lemma, token.posTag)) elif isinstance(token, list): tokenDic[idx] = Token(-1, '', '', '') for subToken in Sentence.getTokens(token): tokenDic[idx].text += subToken.text + '_' tokenDic[idx].lemma += subToken.lemma + '_' tokenDic[idx].posTag += subToken.posTag + '_' tokenDic[idx].text = tokenDic[idx].text[:-1] tokenDic[idx].lemma = tokenDic[idx].lemma[:-1] tokenDic[idx].posTag = tokenDic[idx].posTag[:-1] result.append(tokenDic[idx]) idx += 1 return result @staticmethod def getFeatureInfo(dic, label, tokens, features): feature = '' idx = 0 for token in tokens: if features[idx].lower() == 'l': if FeatParams.useLemma: if token.lemma.strip() != '': feature += token.lemma.strip() + '_' else: feature += '*' + '_' elif features[idx].lower() == 'p': if FeatParams.usePOS: if token.posTag.strip() != '': feature += token.posTag.strip() + '_' else: feature += '*' + '_' elif features[idx].lower() == 't': if token.text.strip() != '': feature += token.text.strip() + '_' idx += 1 if len(feature) > 0: feature = feature[:-1] dic[label] = feature return '' @staticmethod def areInLexic(tokensList): if Sentence.getTokenLemmas(tokensList) in Corpus.mweDictionary.keys(): return True return False @staticmethod def addTransitionHistory(transition, transDic): if FeatParams.historyLength1: Extractor.getTransitionHistory(transition, 1, 'TransHistory1', transDic) if FeatParams.historyLength2: Extractor.getTransitionHistory(transition, 2, 'TransHistory2', transDic) if FeatParams.historyLength3: Extractor.getTransitionHistory(transition, 3, 'TransHistory3', transDic) @staticmethod def getTransitionHistory(transition, length, label, transDic): idx = 0 history = '' transRef = transition transition = transition.previous while transition is not None and idx < length: if transition.type is not None: history += str(transition.type.value) transition = transition.previous idx += 1 if len(history) == length: transDic[label] = history transition = transRef
"""The tests for the MQTT Template light platform. Configuration example with all features: light: platform: mqtt_template name: mqtt_template_light_1 state_topic: 'home/rgb1' command_topic: 'home/rgb1/set' command_on_template: > on,{{ brightness|d }},{{ red|d }}-{{ green|d }}-{{ blue|d }} command_off_template: 'off' state_template: '{{ value.split(",")[0] }}' brightness_template: '{{ value.split(",")[1] }}' color_temp_template: '{{ value.split(",")[2] }}' white_value_template: '{{ value.split(",")[3] }}' red_template: '{{ value.split(",")[4].split("-")[0] }}' green_template: '{{ value.split(",")[4].split("-")[1] }}' blue_template: '{{ value.split(",")[4].split("-")[2] }}' If your light doesn't support brightness feature, omit `brightness_template`. If your light doesn't support color temp feature, omit `color_temp_template`. If your light doesn't support white value feature, omit `white_value_template`. If your light doesn't support RGB feature, omit `(red|green|blue)_template`. """ import json from unittest.mock import ANY, patch from homeassistant.components import light, mqtt from homeassistant.components.mqtt.discovery import async_start from homeassistant.const import ( ATTR_ASSUMED_STATE, STATE_OFF, STATE_ON, STATE_UNAVAILABLE, ) import homeassistant.core as ha from homeassistant.setup import async_setup_component from tests.common import ( MockConfigEntry, assert_setup_component, async_fire_mqtt_message, async_mock_mqtt_component, mock_coro, mock_registry, ) async def test_setup_fails(hass, mqtt_mock): """Test that setup fails with missing required configuration items.""" with assert_setup_component(0, light.DOMAIN): assert await async_setup_component( hass, light.DOMAIN, {light.DOMAIN: {"platform": "mqtt", "schema": "template", "name": "test"}}, ) assert hass.states.get("light.test") is None with assert_setup_component(0, light.DOMAIN): assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "command_topic": "test_topic", } }, ) assert hass.states.get("light.test") is None with assert_setup_component(0, light.DOMAIN): assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "command_topic": "test_topic", "command_on_template": "on", } }, ) assert hass.states.get("light.test") is None with assert_setup_component(0, light.DOMAIN): assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "command_topic": "test_topic", "command_off_template": "off", } }, ) assert hass.states.get("light.test") is None async def test_state_change_via_topic(hass, mqtt_mock): """Test state change via topic.""" with assert_setup_component(1, light.DOMAIN): assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "state_topic": "test_light_rgb", "command_topic": "test_light_rgb/set", "command_on_template": "on," "{{ brightness|d }}," "{{ color_temp|d }}," "{{ white_value|d }}," "{{ red|d }}-" "{{ green|d }}-" "{{ blue|d }}", "command_off_template": "off", "state_template": '{{ value.split(",")[0] }}', } }, ) state = hass.states.get("light.test") assert state.state == STATE_OFF assert state.attributes.get("rgb_color") is None assert state.attributes.get("brightness") is None assert state.attributes.get("color_temp") is None assert state.attributes.get("white_value") is None assert not state.attributes.get(ATTR_ASSUMED_STATE) async_fire_mqtt_message(hass, "test_light_rgb", "on") state = hass.states.get("light.test") assert state.state == STATE_ON assert state.attributes.get("rgb_color") is None assert state.attributes.get("brightness") is None assert state.attributes.get("color_temp") is None assert state.attributes.get("white_value") is None async def test_state_brightness_color_effect_temp_white_change_via_topic( hass, mqtt_mock ): """Test state, bri, color, effect, color temp, white val change.""" with assert_setup_component(1, light.DOMAIN): assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "effect_list": ["rainbow", "colorloop"], "state_topic": "test_light_rgb", "command_topic": "test_light_rgb/set", "command_on_template": "on," "{{ brightness|d }}," "{{ color_temp|d }}," "{{ white_value|d }}," "{{ red|d }}-" "{{ green|d }}-" "{{ blue|d }}," "{{ effect|d }}", "command_off_template": "off", "state_template": '{{ value.split(",")[0] }}', "brightness_template": '{{ value.split(",")[1] }}', "color_temp_template": '{{ value.split(",")[2] }}', "white_value_template": '{{ value.split(",")[3] }}', "red_template": '{{ value.split(",")[4].' 'split("-")[0] }}', "green_template": '{{ value.split(",")[4].' 'split("-")[1] }}', "blue_template": '{{ value.split(",")[4].' 'split("-")[2] }}', "effect_template": '{{ value.split(",")[5] }}', } }, ) state = hass.states.get("light.test") assert state.state == STATE_OFF assert state.attributes.get("rgb_color") is None assert state.attributes.get("brightness") is None assert state.attributes.get("effect") is None assert state.attributes.get("color_temp") is None assert state.attributes.get("white_value") is None assert not state.attributes.get(ATTR_ASSUMED_STATE) # turn on the light, full white async_fire_mqtt_message(hass, "test_light_rgb", "on,255,145,123,255-128-64,") state = hass.states.get("light.test") assert state.state == STATE_ON assert state.attributes.get("rgb_color") == (255, 128, 63) assert state.attributes.get("brightness") == 255 assert state.attributes.get("color_temp") == 145 assert state.attributes.get("white_value") == 123 assert state.attributes.get("effect") is None # turn the light off async_fire_mqtt_message(hass, "test_light_rgb", "off") state = hass.states.get("light.test") assert state.state == STATE_OFF # lower the brightness async_fire_mqtt_message(hass, "test_light_rgb", "on,100") light_state = hass.states.get("light.test") assert light_state.attributes["brightness"] == 100 # change the color temp async_fire_mqtt_message(hass, "test_light_rgb", "on,,195") light_state = hass.states.get("light.test") assert light_state.attributes["color_temp"] == 195 # change the color async_fire_mqtt_message(hass, "test_light_rgb", "on,,,,41-42-43") light_state = hass.states.get("light.test") assert light_state.attributes.get("rgb_color") == (243, 249, 255) # change the white value async_fire_mqtt_message(hass, "test_light_rgb", "on,,,134") light_state = hass.states.get("light.test") assert light_state.attributes["white_value"] == 134 # change the effect async_fire_mqtt_message(hass, "test_light_rgb", "on,,,,41-42-43,rainbow") light_state = hass.states.get("light.test") assert light_state.attributes.get("effect") == "rainbow" async def test_optimistic(hass, mqtt_mock): """Test optimistic mode.""" fake_state = ha.State( "light.test", "on", { "brightness": 95, "hs_color": [100, 100], "effect": "random", "color_temp": 100, "white_value": 50, }, ) with patch( "homeassistant.helpers.restore_state.RestoreEntity.async_get_last_state", return_value=mock_coro(fake_state), ): with assert_setup_component(1, light.DOMAIN): assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "command_topic": "test_light_rgb/set", "command_on_template": "on," "{{ brightness|d }}," "{{ color_temp|d }}," "{{ white_value|d }}," "{{ red|d }}-" "{{ green|d }}-" "{{ blue|d }}", "command_off_template": "off", "effect_list": ["colorloop", "random"], "qos": 2, } }, ) state = hass.states.get("light.test") assert state.state == STATE_ON assert state.attributes.get("brightness") == 95 assert state.attributes.get("hs_color") == (100, 100) assert state.attributes.get("effect") == "random" assert state.attributes.get("color_temp") == 100 assert state.attributes.get("white_value") == 50 assert state.attributes.get(ATTR_ASSUMED_STATE) async def test_flash(hass, mqtt_mock): """Test flash.""" with assert_setup_component(1, light.DOMAIN): assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "command_topic": "test_light_rgb/set", "command_on_template": "on,{{ flash }}", "command_off_template": "off", "qos": 0, } }, ) state = hass.states.get("light.test") assert state.state == STATE_OFF async def test_transition(hass, mqtt_mock): """Test for transition time being sent when included.""" with assert_setup_component(1, light.DOMAIN): assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "command_topic": "test_light_rgb/set", "command_on_template": "on,{{ transition }}", "command_off_template": "off,{{ transition|d }}", } }, ) state = hass.states.get("light.test") assert state.state == STATE_OFF async def test_invalid_values(hass, mqtt_mock): """Test that invalid values are ignored.""" with assert_setup_component(1, light.DOMAIN): assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "effect_list": ["rainbow", "colorloop"], "state_topic": "test_light_rgb", "command_topic": "test_light_rgb/set", "command_on_template": "on," "{{ brightness|d }}," "{{ color_temp|d }}," "{{ red|d }}-" "{{ green|d }}-" "{{ blue|d }}," "{{ effect|d }}", "command_off_template": "off", "state_template": '{{ value.split(",")[0] }}', "brightness_template": '{{ value.split(",")[1] }}', "color_temp_template": '{{ value.split(",")[2] }}', "white_value_template": '{{ value.split(",")[3] }}', "red_template": '{{ value.split(",")[4].' 'split("-")[0] }}', "green_template": '{{ value.split(",")[4].' 'split("-")[1] }}', "blue_template": '{{ value.split(",")[4].' 'split("-")[2] }}', "effect_template": '{{ value.split(",")[5] }}', } }, ) state = hass.states.get("light.test") assert state.state == STATE_OFF assert state.attributes.get("rgb_color") is None assert state.attributes.get("brightness") is None assert state.attributes.get("color_temp") is None assert state.attributes.get("effect") is None assert state.attributes.get("white_value") is None assert not state.attributes.get(ATTR_ASSUMED_STATE) # turn on the light, full white async_fire_mqtt_message( hass, "test_light_rgb", "on,255,215,222,255-255-255,rainbow" ) state = hass.states.get("light.test") assert state.state == STATE_ON assert state.attributes.get("brightness") == 255 assert state.attributes.get("color_temp") == 215 assert state.attributes.get("rgb_color") == (255, 255, 255) assert state.attributes.get("white_value") == 222 assert state.attributes.get("effect") == "rainbow" # bad state value async_fire_mqtt_message(hass, "test_light_rgb", "offf") # state should not have changed state = hass.states.get("light.test") assert state.state == STATE_ON # bad brightness values async_fire_mqtt_message(hass, "test_light_rgb", "on,off,255-255-255") # brightness should not have changed state = hass.states.get("light.test") assert state.attributes.get("brightness") == 255 # bad color temp values async_fire_mqtt_message(hass, "test_light_rgb", "on,,off,255-255-255") # color temp should not have changed state = hass.states.get("light.test") assert state.attributes.get("color_temp") == 215 # bad color values async_fire_mqtt_message(hass, "test_light_rgb", "on,255,a-b-c") # color should not have changed state = hass.states.get("light.test") assert state.attributes.get("rgb_color") == (255, 255, 255) # bad white value values async_fire_mqtt_message(hass, "test_light_rgb", "on,,,off,255-255-255") # white value should not have changed state = hass.states.get("light.test") assert state.attributes.get("white_value") == 222 # bad effect value async_fire_mqtt_message(hass, "test_light_rgb", "on,255,a-b-c,white") # effect should not have changed state = hass.states.get("light.test") assert state.attributes.get("effect") == "rainbow" async def test_default_availability_payload(hass, mqtt_mock): """Test availability by default payload with defined topic.""" assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "command_topic": "test_light_rgb/set", "command_on_template": "on,{{ transition }}", "command_off_template": "off,{{ transition|d }}", "availability_topic": "availability-topic", } }, ) state = hass.states.get("light.test") assert state.state == STATE_UNAVAILABLE async_fire_mqtt_message(hass, "availability-topic", "online") state = hass.states.get("light.test") assert state.state != STATE_UNAVAILABLE async_fire_mqtt_message(hass, "availability-topic", "offline") state = hass.states.get("light.test") assert state.state == STATE_UNAVAILABLE async def test_custom_availability_payload(hass, mqtt_mock): """Test availability by custom payload with defined topic.""" assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "command_topic": "test_light_rgb/set", "command_on_template": "on,{{ transition }}", "command_off_template": "off,{{ transition|d }}", "availability_topic": "availability-topic", "payload_available": "good", "payload_not_available": "nogood", } }, ) state = hass.states.get("light.test") assert state.state == STATE_UNAVAILABLE async_fire_mqtt_message(hass, "availability-topic", "good") state = hass.states.get("light.test") assert state.state != STATE_UNAVAILABLE async_fire_mqtt_message(hass, "availability-topic", "nogood") state = hass.states.get("light.test") assert state.state == STATE_UNAVAILABLE async def test_setting_attribute_via_mqtt_json_message(hass, mqtt_mock): """Test the setting of attribute via MQTT with JSON payload.""" assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "command_topic": "test-topic", "command_on_template": "on,{{ transition }}", "command_off_template": "off,{{ transition|d }}", "json_attributes_topic": "attr-topic", } }, ) async_fire_mqtt_message(hass, "attr-topic", '{ "val": "100" }') state = hass.states.get("light.test") assert state.attributes.get("val") == "100" async def test_update_with_json_attrs_not_dict(hass, mqtt_mock, caplog): """Test attributes get extracted from a JSON result.""" assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "command_topic": "test-topic", "command_on_template": "on,{{ transition }}", "command_off_template": "off,{{ transition|d }}", "json_attributes_topic": "attr-topic", } }, ) async_fire_mqtt_message(hass, "attr-topic", '[ "list", "of", "things"]') state = hass.states.get("light.test") assert state.attributes.get("val") is None assert "JSON result was not a dictionary" in caplog.text async def test_update_with_json_attrs_bad_JSON(hass, mqtt_mock, caplog): """Test attributes get extracted from a JSON result.""" assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: { "platform": "mqtt", "schema": "template", "name": "test", "command_topic": "test-topic", "command_on_template": "on,{{ transition }}", "command_off_template": "off,{{ transition|d }}", "json_attributes_topic": "attr-topic", } }, ) async_fire_mqtt_message(hass, "attr-topic", "This is not JSON") state = hass.states.get("light.test") assert state.attributes.get("val") is None assert "Erroneous JSON: This is not JSON" in caplog.text async def test_discovery_update_attr(hass, mqtt_mock, caplog): """Test update of discovered MQTTAttributes.""" entry = MockConfigEntry(domain=mqtt.DOMAIN) await async_start(hass, "homeassistant", {}, entry) data1 = ( '{ "name": "Beer",' ' "schema": "template",' ' "command_topic": "test_topic",' ' "command_on_template": "on",' ' "command_off_template": "off",' ' "json_attributes_topic": "attr-topic1" }' ) data2 = ( '{ "name": "Beer",' ' "schema": "template",' ' "command_topic": "test_topic",' ' "command_on_template": "on",' ' "command_off_template": "off",' ' "json_attributes_topic": "attr-topic2" }' ) async_fire_mqtt_message(hass, "homeassistant/light/bla/config", data1) await hass.async_block_till_done() async_fire_mqtt_message(hass, "attr-topic1", '{ "val": "100" }') state = hass.states.get("light.beer") assert state.attributes.get("val") == "100" # Change json_attributes_topic async_fire_mqtt_message(hass, "homeassistant/light/bla/config", data2) await hass.async_block_till_done() # Verify we are no longer subscribing to the old topic async_fire_mqtt_message(hass, "attr-topic1", '{ "val": "50" }') state = hass.states.get("light.beer") assert state.attributes.get("val") == "100" # Verify we are subscribing to the new topic async_fire_mqtt_message(hass, "attr-topic2", '{ "val": "75" }') state = hass.states.get("light.beer") assert state.attributes.get("val") == "75" async def test_unique_id(hass): """Test unique id option only creates one light per unique_id.""" await async_mock_mqtt_component(hass) assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: [ { "platform": "mqtt", "name": "Test 1", "schema": "template", "state_topic": "test-topic", "command_topic": "test_topic", "command_on_template": "on,{{ transition }}", "command_off_template": "off,{{ transition|d }}", "unique_id": "TOTALLY_UNIQUE", }, { "platform": "mqtt", "name": "Test 2", "schema": "template", "state_topic": "test-topic", "command_topic": "test_topic", "unique_id": "TOTALLY_UNIQUE", }, ] }, ) async_fire_mqtt_message(hass, "test-topic", "payload") assert len(hass.states.async_entity_ids(light.DOMAIN)) == 1 async def test_discovery_removal(hass, mqtt_mock, caplog): """Test removal of discovered mqtt_json lights.""" entry = MockConfigEntry(domain=mqtt.DOMAIN) await async_start(hass, "homeassistant", {"mqtt": {}}, entry) data = ( '{ "name": "Beer",' ' "schema": "template",' ' "command_topic": "test_topic",' ' "command_on_template": "on",' ' "command_off_template": "off"}' ) async_fire_mqtt_message(hass, "homeassistant/light/bla/config", data) await hass.async_block_till_done() state = hass.states.get("light.beer") assert state is not None assert state.name == "Beer" async_fire_mqtt_message(hass, "homeassistant/light/bla/config", "") await hass.async_block_till_done() state = hass.states.get("light.beer") assert state is None async def test_discovery_deprecated(hass, mqtt_mock, caplog): """Test discovery of mqtt template light with deprecated option.""" entry = MockConfigEntry(domain=mqtt.DOMAIN) await async_start(hass, "homeassistant", {"mqtt": {}}, entry) data = ( '{ "name": "Beer",' ' "platform": "mqtt_template",' ' "command_topic": "test_topic",' ' "command_on_template": "on",' ' "command_off_template": "off"}' ) async_fire_mqtt_message(hass, "homeassistant/light/bla/config", data) await hass.async_block_till_done() state = hass.states.get("light.beer") assert state is not None assert state.name == "Beer" async def test_discovery_update_light(hass, mqtt_mock, caplog): """Test update of discovered light.""" entry = MockConfigEntry(domain=mqtt.DOMAIN) await async_start(hass, "homeassistant", {}, entry) data1 = ( '{ "name": "Beer",' ' "schema": "template",' ' "state_topic": "test_topic",' ' "command_topic": "test_topic",' ' "command_on_template": "on",' ' "command_off_template": "off"}' ) data2 = ( '{ "name": "Milk",' ' "schema": "template",' ' "state_topic": "test_topic",' ' "command_topic": "test_topic",' ' "command_on_template": "on",' ' "command_off_template": "off"}' ) async_fire_mqtt_message(hass, "homeassistant/light/bla/config", data1) await hass.async_block_till_done() state = hass.states.get("light.beer") assert state is not None assert state.name == "Beer" async_fire_mqtt_message(hass, "homeassistant/light/bla/config", data2) await hass.async_block_till_done() state = hass.states.get("light.beer") assert state is not None assert state.name == "Milk" state = hass.states.get("light.milk") assert state is None async def test_discovery_broken(hass, mqtt_mock, caplog): """Test handling of bad discovery message.""" entry = MockConfigEntry(domain=mqtt.DOMAIN) await async_start(hass, "homeassistant", {}, entry) data1 = '{ "name": "Beer" }' data2 = ( '{ "name": "Milk",' ' "schema": "template",' ' "state_topic": "test_topic",' ' "command_topic": "test_topic",' ' "command_on_template": "on",' ' "command_off_template": "off"}' ) async_fire_mqtt_message(hass, "homeassistant/light/bla/config", data1) await hass.async_block_till_done() state = hass.states.get("light.beer") assert state is None async_fire_mqtt_message(hass, "homeassistant/light/bla/config", data2) await hass.async_block_till_done() state = hass.states.get("light.milk") assert state is not None assert state.name == "Milk" state = hass.states.get("light.beer") assert state is None async def test_entity_device_info_with_identifier(hass, mqtt_mock): """Test MQTT light device registry integration.""" entry = MockConfigEntry(domain=mqtt.DOMAIN) entry.add_to_hass(hass) await async_start(hass, "homeassistant", {}, entry) registry = await hass.helpers.device_registry.async_get_registry() data = json.dumps( { "platform": "mqtt", "name": "Test 1", "schema": "template", "state_topic": "test-topic", "command_topic": "test-topic", "command_on_template": "on,{{ transition }}", "command_off_template": "off,{{ transition|d }}", "device": { "identifiers": ["helloworld"], "connections": [["mac", "02:5b:26:a8:dc:12"]], "manufacturer": "Whatever", "name": "Beer", "model": "Glass", "sw_version": "0.1-beta", }, "unique_id": "veryunique", } ) async_fire_mqtt_message(hass, "homeassistant/light/bla/config", data) await hass.async_block_till_done() device = registry.async_get_device({("mqtt", "helloworld")}, set()) assert device is not None assert device.identifiers == {("mqtt", "helloworld")} assert device.connections == {("mac", "02:5b:26:a8:dc:12")} assert device.manufacturer == "Whatever" assert device.name == "Beer" assert device.model == "Glass" assert device.sw_version == "0.1-beta" async def test_entity_device_info_update(hass, mqtt_mock): """Test device registry update.""" entry = MockConfigEntry(domain=mqtt.DOMAIN) entry.add_to_hass(hass) await async_start(hass, "homeassistant", {}, entry) registry = await hass.helpers.device_registry.async_get_registry() config = { "platform": "mqtt", "name": "Test 1", "schema": "template", "state_topic": "test-topic", "command_topic": "test-command-topic", "command_on_template": "on,{{ transition }}", "command_off_template": "off,{{ transition|d }}", "device": { "identifiers": ["helloworld"], "connections": [["mac", "02:5b:26:a8:dc:12"]], "manufacturer": "Whatever", "name": "Beer", "model": "Glass", "sw_version": "0.1-beta", }, "unique_id": "veryunique", } data = json.dumps(config) async_fire_mqtt_message(hass, "homeassistant/light/bla/config", data) await hass.async_block_till_done() device = registry.async_get_device({("mqtt", "helloworld")}, set()) assert device is not None assert device.name == "Beer" config["device"]["name"] = "Milk" data = json.dumps(config) async_fire_mqtt_message(hass, "homeassistant/light/bla/config", data) await hass.async_block_till_done() device = registry.async_get_device({("mqtt", "helloworld")}, set()) assert device is not None assert device.name == "Milk" async def test_entity_id_update(hass, mqtt_mock): """Test MQTT subscriptions are managed when entity_id is updated.""" registry = mock_registry(hass, {}) mock_mqtt = await async_mock_mqtt_component(hass) assert await async_setup_component( hass, light.DOMAIN, { light.DOMAIN: [ { "platform": "mqtt", "name": "beer", "schema": "template", "state_topic": "test-topic", "command_topic": "command-topic", "command_on_template": "on,{{ transition }}", "command_off_template": "off,{{ transition|d }}", "availability_topic": "avty-topic", "unique_id": "TOTALLY_UNIQUE", } ] }, ) state = hass.states.get("light.beer") assert state is not None assert mock_mqtt.async_subscribe.call_count == 2 mock_mqtt.async_subscribe.assert_any_call("test-topic", ANY, 0, "utf-8") mock_mqtt.async_subscribe.assert_any_call("avty-topic", ANY, 0, "utf-8") mock_mqtt.async_subscribe.reset_mock() registry.async_update_entity("light.beer", new_entity_id="light.milk") await hass.async_block_till_done() state = hass.states.get("light.beer") assert state is None state = hass.states.get("light.milk") assert state is not None assert mock_mqtt.async_subscribe.call_count == 2 mock_mqtt.async_subscribe.assert_any_call("test-topic", ANY, 0, "utf-8") mock_mqtt.async_subscribe.assert_any_call("avty-topic", ANY, 0, "utf-8")
#!/usr/bin/env python # # Copyright 2018 Google Inc. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS-IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # """Simian network backoff detection module.""" import logging import platform import re import socket import urlparse import requests from simian.mac.client import flight_common LINUX = 'Linux' DARWIN = 'Darwin' PLATFORM = platform.system() ROUTE = {LINUX: ['/sbin/ip', 'route'], DARWIN: ['/usr/sbin/netstat', '-nr']} ARP = {LINUX: '/usr/sbin/arp', DARWIN: '/usr/sbin/arp'} HOST = '/usr/bin/host' IFCONFIG = '/sbin/ifconfig' IOS_WAP_DEFAULT_GATEWAY_IP = '172.20.10.1' IOS_WAP_NETWORK_GATEWAY_SUBNET = '172.20.10/28' INTERFACE_ANDROID_WAP = 'android_wap' INTERFACE_WWAN = 'wwan' INTERFACE_VPN = 'vpn' BACKOFF_WLANS = frozenset([ 'Fly-Fi', 'gogoinflight', 'Telekom_FlyNet', 'United_WiFi', 'United_Wi-Fi', ]) def _GetPlatform(): """Returns a str like constants LINUX or DARWIN.""" platform_str = platform.system() assert platform_str in [LINUX, DARWIN] return platform_str def GetAllInterfaceNames(): """Get network interfaces info for this host. Note that this list may include all types of interfaces that are not normally interesting to this script, e.g. fw0. Returns: list, e.g. ['en0', 'en1', 'fw0', 'eth0'] """ this_platform = _GetPlatform() # Note slight difference in regex. # BSD ifconfig writes "interface_name:\s+" # while Linux writes "interface_name\s+" if this_platform == LINUX: intf_header = re.compile(r'^([a-z]+(?:[0-9]+)?)\s+') elif this_platform == DARWIN: intf_header = re.compile(r'^([a-z]+(?:[0-9]+)?):\s+') return_code, stdout, stderr = flight_common.Exec('/sbin/ifconfig') if return_code != 0 or stderr: return [] interfaces = [] if stdout: for l in stdout.splitlines(): # pylint: disable=maybe-no-member m = intf_header.search(str(l)) if m: interfaces.append(m.group(1)) return interfaces def GetInterfaceNames(interface_type): """Get the network interface names for an interface type. Args: interface_type: str, like INTERFACE_* constant Returns: list of str, like ['ppp0'] or ['en0', 'en1'] Raises: ValueError: if interface_type is unknown PlatformError: if platform is not implemented """ this_platform = _GetPlatform() all_interfaces = GetAllInterfaceNames() if interface_type == INTERFACE_WWAN: return [x for x in all_interfaces if x.startswith('ppp') or x.startswith('bnep')] elif interface_type == INTERFACE_ANDROID_WAP: if this_platform == DARWIN: return [x for x in all_interfaces if x.startswith('en')] elif this_platform == LINUX: return [x for x in all_interfaces if x.startswith('wlan')] elif interface_type == INTERFACE_VPN: if this_platform in [DARWIN, LINUX]: return [x for x in all_interfaces if x.endswith('tun0')] else: raise ValueError('Unknown Platform: %s' % this_platform) else: raise ValueError(interface_type) def GetNetworkGateway(network): """Get the gateway for a network. Uses "netstat -nr" on Darwin and "ip route" on Linux to read the routing table. It searches for a route with destination exactly matching the network parameter! Args: network: str, likely in CIDR format or default gateway, e.g. "1.2.3/24" or "0.0.0.0" Returns: a string like "1.2.3.4" or "link#1" or "01:02:03:04:05:06" or "dev wlan0", depending on the type of route and platform. """ route = ROUTE.get(_GetPlatform(), None) logging.debug('Route: %s', str(route)) if not route: return try: return_code, stdout, stderr = flight_common.Exec(route) except OSError: return_code = None if return_code != 0 or stderr or not stdout: return gateway_pattern = ( r'^%s\s+(via[\s\t])?' r'([\d\.]+|[0-9a-f:]+|link#\d+|dev [a-z\d]+)[\s\t]+' % network) gateway = re.search(gateway_pattern, str(stdout), re.MULTILINE) if gateway: return gateway.group(2) return def GetDefaultGateway(): """Gets the default gateway. Returns: a string like "192.168.0.1" or None if default gateway is unknown. """ if _GetPlatform() in [DARWIN, LINUX]: default = 'default' else: logging.error('Unknown platform %s', _GetPlatform()) return GetNetworkGateway(default) def GetHttpResource(host, path='/', port=80, redir=False): """Gets HTTP resource. Args: host: str, like "example.com", but not "http://example.com". path: optional, str, like "/path", default "/". port: optional, int, default 80. redir: optional, bool, whether to follow redirects. Returns: (int response code, str response body) (int -1, str error from http exception) """ if port != 80: port_str = ':%d' % port else: port_str = '' url = 'http://%s%s' % (host, port_str) url = urlparse.urljoin(url, path) try: response = requests.get(url, allow_redirects=redir) code = response.status_code body = response.text return code, body except requests.RequestException as e: return -1, str(e) def IsOnWwan(): """"Checks WWAN device connection status. Note: this may produce false-positives, and may not catch all WWAN devices. Several Sprint and Verizon devices were tested, all of which create ppp0 upon connection. However, L2TP VPN also creates ppp0 (Google no longer uses this as of Q2-2010 in favor of SSLVPN). A stronger check is probably needed at some point. As of 2011-12-6 OpenVPN interface is tun0 on Linux and Darwin. Returns: Boolean. True if WWAN device is active, False otherwise. """ wwan_ifaces = GetInterfaceNames(INTERFACE_WWAN) for wwan_iface in wwan_ifaces: try: return_code, unused_out, unused_err = flight_common.Exec( [IFCONFIG, wwan_iface]) except OSError: return_code = None # ifconfig exits with 1 if interface doesn't exist. if return_code == 0: return True return False def GetNetworkName(): """Return network name (SSID for WLANs) a device is connected to. Returns: name of the matching network name if possible, None otherwise. """ this_platform = _GetPlatform() if this_platform == LINUX: cmdline = '/usr/bin/nmcli -t -f NAME,DEVICES conn status' # Ignore "Auto " prefix on automatically connecting networks. ssid_re = re.compile(r'^(Auto )?([^:]*):.*$') try: return_code, out, _ = flight_common.Exec(cmdline) except OSError: logging.exception('Error executing nmcli') return if out and not return_code: for l in out.splitlines(): res = ssid_re.match(l) if res: return res.groups()[1] elif this_platform == DARWIN: cmdline = ( '/System/Library/PrivateFrameworks/Apple80211.framework/Versions/' 'Current/Resources/airport -I | ' 'awk \'/ SSID/ {print substr($0, index($0, $2))}\'') try: return_code, out, _ = flight_common.Exec(cmdline) except OSError: logging.exception('Error executing airport') return if out and not return_code: return out.strip() or None def IsOnBackoffWLAN(): """Returns True if on a Backoff WLAN, such as gogoinflight WiFi.""" return GetNetworkName() in BACKOFF_WLANS def IsOnAndroidWap(): """Checks if Android WiFi or Bluetooth tethering is connected. Returns: Boolean. True if Android tethering is connected, False otherwise. """ # ifconfig output looks a little bit different on Darwin vs Linux. # # Darwin: # inet 169.254.135.20 netmask 0xffff0000 broadcast 169.254.255.255 # Linux: # inet addr:172.26.113.45 Bcast:172.26.115.255 Mask:255.255.252.0 android_wap_match_regex = re.compile( r'inet[\w\s]*[\s:]+192\.168\.(42|43|44)\.\d{1,3}\s+' r'.*(?:netmask\s+0xffffff00\s+|Mask:255\.255\.255\.0)') ifaces = GetInterfaceNames(INTERFACE_ANDROID_WAP) for wifi_iface in ifaces: # Android tethering uses very specific subnets*, as well as dnsmasq which # reveals itself via the TXT VERSION.BIND record. # * 192.168.42.0/24 for wired, 192.168.43.0/24 for WiFi, and # 192.168.44.0/24 for Bluetooth. try: return_code, stdout, stderr = flight_common.Exec([IFCONFIG, wifi_iface]) except OSError: return_code = None if return_code != 0 or stderr: # interface was likely not found. continue android_wap_match = android_wap_match_regex.search(stdout) # Look for an interface on 192.168.4[2-4].0/24. if android_wap_match is not None: # If the default gateway is not through a likely Android WAN interface, # tethering may be active but is not likely to be used. default_gateway = GetDefaultGateway() logging.debug('Default gateway: %s', str(default_gateway)) default_gateway_prefix = '192.168.%s.' % android_wap_match.group(1) if not default_gateway.startswith(default_gateway_prefix): return False # IP, netmask, gateway look like Android WAP, so check dnsmasq. # Request needs to be explicitly top level, as Linux uses # ndots:2 which would turn VERSION.BIND (without trailing dot) into # VERSION.BIND.foo.example.com in some cases. cmd = [HOST, '-W', '5', '-c', 'CHAOS', '-t', 'txt', 'VERSION.BIND.', default_gateway] try: return_code, stdout, unused_err = flight_common.Exec(cmd) except OSError: return_code = None if return_code != 0: continue dnsmasq_match = re.search( r'VERSION\.BIND descriptive text "dnsmasq-.*"', stdout) if dnsmasq_match is not None: # IP, netmask and dnsmasq all match Android WAP tethering. return True return False def IsOnIosWap(): """Checks if the wireless connection is to an iOS WAP tether. Returns: Boolean. True if iOS WAP is connected, False otherwise. """ # iOS WAP looks like a 172.20.10/28 network. Gateway is # 172.20.10.1 with TCP port 62078 open. gateway = GetNetworkGateway(IOS_WAP_NETWORK_GATEWAY_SUBNET) if not gateway: return False ip = GetDefaultGateway() if not ip: return False if ip != IOS_WAP_DEFAULT_GATEWAY_IP: return False sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) result = sock.connect_ex((ip, 62078)) if result == 0: return True return False def IsOnMifi(): """Checks if the wireless connection is to a MiFi-like device. These devices are available from Verizon, Sprint, others, and usually offer some kind of web access portal that says MiFi or Jetpack as a text string. Returns: Bool, True if the connection is a likely MiFi-like device, False if not. """ ip = GetDefaultGateway() if not ip: return False if ip.startswith('192.168.1.'): # Verizon and Sprint devices http_status, body = GetHttpResource(ip, redir=True) # MiFi-like devices usually run a http interface. It returns a long http # response with various easily found "MiFi" or "Jetpack" strings in it # when loaded. No http auth challenge is issued. if http_status == 200 and body and ('MiFi' in body or 'Jetpack' in body): return True elif ip == '192.168.8.1': # common Huawei gateway http_status, _ = GetHttpResource(ip, redir=False) return http_status == 307 return False
import argparse import json import requests import urlparse def step(instructions, func=None, wait=True): val = None for line in instructions.split('\n'): print line.strip() if func: val = func() if wait: raw_input('Press enter when you are done.') return val def setup_twitter(): step( ''' Step 1 ------ Create a Twitter app at https://dev.twitter.com/apps/new. ''' ) step( ''' Step 2 ------ Go to the Settings tab and change access under Application Type to Read and Write. ''' ) step( ''' Step 3 ------ Go back to the Details tab and click on the Create my Access Token button. ''' ) step( ''' Done! ----- Your application's details tab now has all the required keys: - consumer key - consumer secret - access token - access token secret ''', wait=False ) def setup_facebook(): def get_app_info(): return ( raw_input('Enter your app id: '), raw_input('Enter your app secret: ') ) def get_code(): url = raw_input( 'Enter the URL you were redirected to after granting the ' 'permissions: ' ) url = urlparse.urlparse(url) query = urlparse.parse_qs(url.query) return query['code'][0] def exchange_code_for_token(): response = requests.get( 'https://graph.facebook.com/oauth/access_token' '?client_id=%s' '&redirect_uri=http://localhost/' '&client_secret=%s' '&code=%s' % ( app_id, app_secret, code ) ) if response.status_code != 200: print response.content raise Exception(response.content) data = urlparse.parse_qs(response.content) return data['access_token'][0] def obtain_long_lived_token(): response = requests.get( 'https://graph.facebook.com/oauth/access_token' '?client_id=%s' '&client_secret=%s' '&grant_type=fb_exchange_token' '&fb_exchange_token=%s' % ( app_id, app_secret, access_token ) ) if response.status_code != 200: print response.content raise Exception(response.content) data = urlparse.parse_qs(response.content) return data['access_token'][0] def fetch_page_access_token(): response = requests.get( 'https://graph.facebook.com/me/accounts?access_token=%s' % access_token ) if response.status_code != 200: print response.content raise Exception(response.content) data = json.loads(response.content) for page in data['data']: if page['id'] == page_id: return page['access_token'] step( ''' Step 1 ------ Create a Facebook app at https://developers.facebook.com/apps. Make the app domain http://localhost/. Select Website with Facebook Login. Enter http://localhost/ as the site URL. ''' ) step( ''' Step 2 ------ Create a Facebook Page at https://www.facebook.com/pages/create.php. ''' ) app_id, app_secret = step( ''' Step 3 ------ ''', func=get_app_info, wait=False ) url = ( 'https://www.facebook.com/dialog/oauth' '?client_id=%s' '&redirect_uri=http://localhost/' '&scope=manage_pages,publish_stream' '&state=ieo4wft' % app_id ) step( ''' Step 4 ------ Go to %s ''' % url ) code = step( ''' Step 5 ------ ''', func=get_code, wait=False ) access_token = step( ''' Step 6 ------ Exchanging code for access token... ''', func=exchange_code_for_token, wait=False ) access_token = step( ''' Step 7 ------ Obtaining long-lived access token... ''', func=obtain_long_lived_token, wait=False ) page_id = step( ''' Step 8 ------ ''', func=lambda: raw_input('Enter page id: '), wait=False ) page_access_token = step( ''' Step 9 ------ Fetching page access token... ''', func=fetch_page_access_token, wait=False ) step( ''' Done! ----- Here is the information you need: - page id: %s - page access token: %s ''' % ( page_id, page_access_token ), wait=False ) if __name__ == '__main__': parser = argparse.ArgumentParser( description='Get required keys for python-sharer' ) parser.add_argument( 'sharer', choices=[ 'twitter', 'facebook', ], help='The service you want to get keys for.' ) args = parser.parse_args() funcs = { 'twitter': setup_twitter, 'facebook': setup_facebook, } funcs[args.sharer]()
""" Astra-Viso star map module. """ from __future__ import division import pickle import numpy as np import pkg_resources as pkg import matplotlib.pyplot as plt from mpl_toolkits.mplot3d import Axes3D class StarMap: """ Star map class. """ def __init__(self, preset=None): """ Initialize new star catalog object. Option to load one of several pre-defined catalogs. Options are: "singlecenter" -- A single bright star aligned with the z-axis. "sixfaces" -- Six bright stars oriented along each positive and negative axis. "random" -- A randomly generated catalog with a user-defined number of stars. "hipparcos" -- The Hipparcos star catalog. 117,955 total stars [1]. "tycho" -- The Tycho-2 star catalog. 1,055,115 total stars [2]. Parameters ---------- preset : str, optional Name of preset star catalog to load. Returns ------- starmap : StarMap Initialized star catalog object. """ # Stars self.catalog = None self.magnitude = None self.size = 0 # Load catalog if preset: self.load_preset(preset) else: self.load_preset("singlecenter") def load_preset(self, preset, *arg): """ Load a preset star catalog. Current available options are: "singlecenter" -- A single bright star aligned with the z-axis. "sixfaces" -- Six bright stars oriented along each positive and negative axis. "random" -- A randomly generated catalog with a user-defined number of stars. "hipparcos" -- The Hipparcos star catalog. 117,955 total stars [1]. "tycho" -- The Tycho-2 star catalog. 1,055,115 total stars [2]. Parameters ---------- preset : str Desired preset option. star_count : int, optional Number of stars desired from the "random" preset. Required for the "random" preset. Returns ------- None Notes ----- [1] Perryman, Michael AC, et al. "The HIPPARCOS catalogue." Astronomy and Astrophysics 323 (1997). [2] Hog, Erik, et al. "The Tycho-2 catalogue of the 2.5 million brightest stars." Astronomy and Astrophysics 355 (2000): L27-L30. Examples -------- >>> catalog = StarMap("tycho") >>> catalog.size 1055115 >>> catalog.load_preset("hipparcos") >>> catalog.size 117955 """ # Single star on boresight if preset.lower() == "singlecenter": self.catalog = np.array([[0, 0, 1]]) self.magnitude = np.array([-1]) # Six stars, one on each axis elif preset.lower() == "sixfaces": self.catalog = np.array([[0, 0, 1], [0, 0, -1], [0, 1, 0], [0, -1, 0], [1, 0, 0], \ [-1, 0, 0]]) self.magnitude = np.array([12, 8, 4, 0, -4, -8]) # Generate a random catalog elif preset[0:6].lower() == "random": # Pre-allocate catalog self.catalog = np.zeros((arg[0], 3)) self.magnitude = 8 + 2*np.random.randn(arg[0]) # Generate random unit vectors for i in range(len(self.catalog)): theta = np.arccos(1 - 2 * np.random.rand()) phi = 2 * np.pi * np.random.rand() self.catalog[i] = [np.sin(theta) * np.cos(phi), np.sin(theta) * np.sin(phi), np.cos(theta)] # Handle any other option else: # Open pickle file, if it exists try: # Load file filename = pkg.resource_filename("astraviso", "catalogs/" + preset.lower() + ".dat") infile = open(filename, 'rb') catalog_file = pickle.load(infile) infile.close() # Set catalog self.catalog = catalog_file["catalog"] self.magnitude = catalog_file["magnitude"] except: print("Failed to open catalog: %s" % preset) # Set size variable self.size = len(self.catalog) def get_all(self): """ Export all catalog elements to a dict. Parameters ---------- None Returns ------- map : dict Dictionary containing the star catalog in the form of an Nx3 array of unit vectors (key:"catalog") and an array of corresponding visible magnitudes (key:"magnitude"). Examples -------- >>> catalog = StarMap("singlecenter") >>> map = catalog.get_all() >>> map {'catalog': array([[0, 0, 1]]), 'magnitude': array([-1])} """ return {"catalog" : self.catalog, "magnitude" : self.magnitude} def get_region(self, vector, angle): """ Extract catalog elements falling within a given angle of a specified unit vector. Parameters ---------- vector : ndarray Three-element array containing a desired unit vector direction. angle : float Angle about the designated unit vector to accept stars. Measured in degrees. Returns ------- map : dict Dictionary containing the star catalog region in the form of an Nx3 array of unit vectors (key:"catalog") and an array of corresponding visible magnitudes (key:"magnitude"). Examples -------- >>> catalog = StarMap("hipparcos") >>> map = catalog.get_region(np.array([0, 0, 1]), 0.001) >>> map {'catalog': array([[ -1.68386803e-06, 4.35351891e-06, 1.00000000e+00], [ -1.83452395e-06, -3.16303724e-06, 1.00000000e+00], [ 1.51683717e-05, 4.10971724e-06, 1.00000000e+00]]), 'magnitude': array([ 9.03, 9.02, 8.69])} """ # Enforce normalization of input vector if np.linalg.norm(vector) == 0: raise ValueError("Central vector must be non-zero.") vector = vector / np.linalg.norm(vector) # Extract region infield = [i for i in range(self.size) if \ np.arccos(np.dot(vector, self.catalog[i, :])) <= np.deg2rad(angle)] # Return result return {"catalog" : self.catalog[infield], "magnitude" : self.magnitude[infield]} def downselect(self, func, mode): """ Downselect current catalog according to a boolean-valued input function. Culls the internal catalog. Parameters ---------- func : function Boolean-valued selection function. Must accept two inputs. See notes for more information on the required input format. mode : str Target values for downselect operation. Options are "magnitude" or "catalog". Returns ------- None Notes ----- For the "magnitude" mode option, the input function must be of the form: bool = f(magnitude, index) where the magnitude value is a scalar float and the index is a scalar int. The index value corresponds to the index of the current element. For the "catalog" mode option, the input function must be of the form: bool = f(vector, index) where the vector value is a 3-element array and the index is a scalar int. The index value corresponds to the index of the current element. Examples -------- >>> catalog = StarMap("hipparcos") >>> catalog.size 117955 >>> select_fcn = lambda mag, idx: mag < 6 & idx < 100000 >>> catalog.downselect(select_fcn, "magnitude") >>> catalog.size 1413 """ # Check function input arguments if func.__code__.co_argcount == 1: fcn = lambda val, idx: func(val) elif func.__code__.co_argcount == 2: fcn = func else: print("Improper number of input arguments!") return # Downselect based on star magnitudes if mode.lower() == "magnitude": selected = [idx for idx in range(self.size) if fcn(self.magnitude[idx], idx)] # Downselect based on star unit vectors elif mode.lower() == "catalog": selected = [idx for idx in range(self.size) if fcn(self.catalog[idx], idx)] # Unsupported option else: print("Unsupported option: %s" % mode) # Finalize downselect self.catalog = self.catalog[selected] self.magnitude = self.magnitude[selected] self.size = len(self.catalog) def downsample(self, factor, mode="random"): """ Downsample current catalog. Parameters ---------- factor : float Factor to downsample by. Resulting catalog length will be approximately 1/factor. mode : str, optional Downsampling mode. Options are "random" or "interval". Default is "random". Returns ------- None Examples -------- >>> catalog = StarMap("hipparcos") >>> catalog.size 117955 >>> catalog.downsample(10, mode="interval") >>> catalog.size 11796 """ # Check input if factor <= 0: return # Downsample randomly if mode.lower() == "random": self.downselect(lambda x, idx: np.random.rand() <= 1/factor, "magnitude") # Sample at interval elif mode.lower() == "interval": self.downselect(lambda x, idx: np.isclose(idx % factor, 0), "magnitude") # Handle invalid mode else: raise ValueError("Invalid mode type. Options are: 'random' and 'interval'.") def select_brighter(self, limit): """ Select only stars brighter than a given magnitude. Culls the internal catalog only. Parameters ---------- limit : float Visible magnitude limit. Stars with magnitude values less than this limit will be selected. Returns ------- None Examples -------- >>> catalog = StarMap("hipparcos") >>> catalog.size 117955 >>> catalog.select_brighter(8) >>> catalog.size 41057 """ self.downselect(lambda x: x < limit, "magnitude") def select_dimmer(self, limit): """ Select only stars dimmer than a given magnitude. Culls the internal catalog only. Parameters ---------- limit : float Visible magnitude limit. Stars with magnitude values greater than this limit will be selected. Returns ------- None Examples -------- >>> catalog = StarMap("hipparcos") >>> catalog.size 117955 >>> catalog.select_dimmer(8) >>> catalog.size 76561 """ self.downselect(lambda x: x > limit, "magnitude") def select_range(self, brightest, dimmest): """ Select only stars within a range of magnitudes. Culls the internal catalog only. Parameters ---------- brightest : float Upper limit on star brightness. Stars with magnitude values greater than this limit will be selected. dimmest : float Lower limit on star brightness. Stars with magnitude values less than this limit will be selected. Returns ------- None Examples -------- >>> catalog = StarMap("hipparcos") >>> catalog.size 117955 >>> catalog.select_dimmer(8) >>> catalog.size 41393 """ self.downselect(lambda x: x >= brightest and x <= dimmest, "magnitude") def viewfield(self): """ Create 3D plot of the entire catalog. Parameters ---------- None Returns ------- None """ # Plot data fig = plt.figure() axis = Axes3D(fig) axis.scatter(self.catalog[:, 0], self.catalog[:, 1], self.catalog[:, 2], marker=".", \ color="black", s=3) # Show plot axis.set_xlim([-1, 1]) axis.set_ylim([-1, 1]) axis.set_zlim([-1, 1]) plt.show() def viewregion(self, vector, angle): """ Create 3D plot of a region of the catalog. Parameters ---------- vector : ndarray Three-element array containing a desired unit vector direction. angle : float Angle about the designated unit vector to accept stars. Measured in degrees. Returns ------- None """ # Select region region = self.getregion(vector, angle) # Plot data fig = plt.figure() axis = Axes3D(fig) axis.scatter(region["catalog"][:, 0], region["catalog"][:, 1], region["catalog"][:, 2], \ marker=".", color="black", s=2) # Plot input vector axis.quiver(0, 0, 0, vector[0], vector[1], vector[2], color="red", linewidth=1.5) # Show plot axis.set_xlim([-1, 1]) axis.set_ylim([-1, 1]) axis.set_zlim([-1, 1]) plt.show()
"""The unit test for runtime.ast""" import unittest from runtime import ast, env, lib NULL_LITERAL = ast.Literal(env.Value(env.NULL)) INT_LITERAL = ast.Literal(env.Value(lib.INTEGER, 0)) TRUE_LITERAL = ast.Literal(env.Value(lib.BOOLEAN, True)) FALSE_LITERAL = ast.Literal(env.Value(lib.BOOLEAN, False)) STRING_LITERAL = ast.Literal( env.Value(lib.STRING, "Hallo Welt!", "identifier")) class SumNode(ast.Node): """A sum node.""" name = "sum" def __init__(self): super().__init__() def eval(self, context): """Sums up the value of its children.""" value = 0 for child in self.children: value += child.eval(context).data return env.Value(lib.INTEGER, value) class AccessNode(ast.Node): """A access node.""" def __init__(self): super().__init__() @classmethod def eval(cls, context): """Stores a string in the current namespace.""" context.store(STRING_LITERAL.value) return STRING_LITERAL.eval(context) class TestAst(unittest.TestCase): """The abstract syntax tree test cases.""" def test_sequence_node(self): """Test the sequence node.""" context = env.empty_context() return_node = ast.Return() return_node.children = [TRUE_LITERAL] # empty sequence empty_seq = ast.Sequence() self.assertEqual(empty_seq.eval(context), NULL_LITERAL.value) # non-empty sequence non_seq = ast.Sequence() non_seq.children = [NULL_LITERAL, TRUE_LITERAL] self.assertEqual(non_seq.eval(context), TRUE_LITERAL.value) non_seq.children = [TRUE_LITERAL, NULL_LITERAL] self.assertEqual(non_seq.eval(context), NULL_LITERAL.value) # sequence with return ret_seq = ast.Sequence() ret_seq.children = [return_node, NULL_LITERAL] self.assertEqual(ret_seq.eval(context), TRUE_LITERAL.value) # self.assertEqual(ret_seq.__str__(), "<Node (sequence)>") def test_conditional_node(self): """Test the conditional node.""" context = env.empty_context() # Test bad conditional error bad_conditional = ast.Conditional() bad_conditional.add(NULL_LITERAL) # if None: bad_conditional.add(NULL_LITERAL) # then None self.assertRaises(Exception, bad_conditional.eval, context) # Test correct result good_conditional = ast.Conditional() good_conditional.add(TRUE_LITERAL) good_conditional.add(NULL_LITERAL) self.assertEqual(good_conditional.eval(context), NULL_LITERAL.value) # self.assertEqual(good_conditional.__str__(), "<Node (conditional)>") def test_branch_node(self): """Test the branch node.""" context = env.empty_context() # always evaluates true_cond = ast.Conditional() true_cond.children = [TRUE_LITERAL, STRING_LITERAL] false_cond = ast.Conditional() false_cond.children = [FALSE_LITERAL, NULL_LITERAL] # Test if branch if_branch = ast.Branch() if_branch.children = [true_cond, NULL_LITERAL] self.assertEqual(if_branch.eval(context), STRING_LITERAL.value) # Test if-else branch ifelse_branch = ast.Branch() ifelse_branch.children = [false_cond, STRING_LITERAL] self.assertEqual(ifelse_branch.eval(context), STRING_LITERAL.value) # Test if-elif-else branch ifelifelse_branch = ast.Branch() ifelifelse_branch.children = [false_cond, true_cond, NULL_LITERAL] self.assertEqual(ifelifelse_branch.eval(context), STRING_LITERAL.value) # self.assertEqual(if_branch.__str__(), "<Node (branch)>") def test_loop_node(self): """Test the loop node.""" break_node = ast.Break() return_node = ast.Return() return_node.children = [TRUE_LITERAL] context = env.empty_context() # check for exception bad_loop = ast.Loop() bad_loop.children = [NULL_LITERAL, TRUE_LITERAL] self.assertRaises(Exception, bad_loop.eval, context) # check for break break_loop = ast.Loop() break_loop.children = [TRUE_LITERAL, break_node] self.assertEqual(break_loop.eval(context), NULL_LITERAL.value) self.assertEqual(context.behaviour, ast.DEFAULT_BEHAVIOUR) # check for return return_loop = ast.Loop() return_loop.children = [TRUE_LITERAL, return_node] self.assertEqual(return_loop.eval(context), TRUE_LITERAL.value) self.assertEqual(context.behaviour, ast.RETURN_BEHAVIOUR) # self.assertEqual(return_loop.__str__(), "<Node (loop)>") def test_return_node(self): """Test the return node.""" # test empty return node context = env.empty_context() empty_return = ast.Return() self.assertEqual(empty_return.eval(context), NULL_LITERAL.value) self.assertEqual(context.behaviour, ast.RETURN_BEHAVIOUR) # test return with value context = env.empty_context() value_return = ast.Return() value_return.add(TRUE_LITERAL) self.assertEqual(value_return.eval(context), TRUE_LITERAL.value) self.assertEqual(context.behaviour, ast.RETURN_BEHAVIOUR) #self.assertEqual(value_return.__str__(), "<Node (return)>") def test_break_node(self): """Test the break node.""" context = env.empty_context() break_node = ast.Break() self.assertEqual(break_node.eval(context), NULL_LITERAL.value) self.assertEqual(context.behaviour, ast.BREAK_BEHAVIOUR) #self.assertEqual(break_node.__str__(), "<Node (break)>") def test_continue_node(self): """Test the continue node.""" context = env.empty_context() continue_node = ast.Continue() self.assertEqual(continue_node.eval(context), NULL_LITERAL.value) self.assertEqual(context.behaviour, ast.CONTINUE_BEHAVIOUR) #self.assertEqual(continue_node.__str__(), "<Node (continue)>") def test_call_node(self): """Test the function node.""" # Create sample namespace sum_function = SumNode() sgn1 = env.Value(lib.INTEGER, None, "a") sgn2 = env.Value(lib.INTEGER, None, "b") sum_function.children = [ ast.Identifier("a"), ast.Identifier("b"), ] context = env.empty_context() func = env.Function([ env.Signature([sgn1, sgn2], sum_function), ], "my_func") context.store(func) arg1 = SumNode() arg1.children = [ ast.Literal(env.Value(lib.INTEGER, 1)), ast.Literal(env.Value(lib.INTEGER, 2)), ] arg2 = SumNode() arg2.children = [ ast.Literal(env.Value(lib.INTEGER, 3)), ast.Literal(env.Value(lib.INTEGER, 4)), ] call_node = ast.Call("my_func") call_node.children = [arg1, arg2] self.assertEqual(call_node.eval(context), env.Value(lib.INTEGER, 10)) bad_node = ast.Call("missing") self.assertRaises(Exception, bad_node.eval, context) def test_operation_node(self): """Test the operation node.""" # Works completely like the call node # Create sample namespace sum_function = SumNode() sgn1 = env.Value(lib.INTEGER, None, "a") sgn2 = env.Value(lib.INTEGER, None, "b") sum_function.children = [ ast.Identifier("a"), ast.Identifier("b"), ] context = env.empty_context() func = env.Function([ env.Signature([sgn1, sgn2], sum_function), ]) operator = env.Operator(func, "+") context.store(operator) arg1 = SumNode() arg1.children = [ ast.Literal(env.Value(lib.INTEGER, 1)), ast.Literal(env.Value(lib.INTEGER, 2)), ] arg2 = SumNode() arg2.children = [ ast.Literal(env.Value(lib.INTEGER, 3)), ast.Literal(env.Value(lib.INTEGER, 4)), ] call_node = ast.Operation("+") call_node.children = [arg1, arg2] self.assertEqual(call_node.eval(context), env.Value(lib.INTEGER, 10)) bad_node = ast.Operation("?") self.assertRaises(Exception, bad_node.eval, context) def test_cast_node(self): """Test the cast node.""" context = env.empty_context() context.store(lib.INTEGER) cast_node = ast.Cast(lib.INTEGER.name) cast_node.children = [NULL_LITERAL] self.assertEqual(cast_node.eval(context), INT_LITERAL.value) bad_node = ast.Cast("missing") self.assertRaises(Exception, bad_node.eval, context) def test_identifier_node(self): """Test the identifier node.""" context = env.empty_context() # Search in local ns context.store(STRING_LITERAL.value) ident_node = ast.Identifier(STRING_LITERAL.value.name) self.assertEqual(ident_node.eval(context), STRING_LITERAL.value) # Search in parent ns context.substitute() self.assertEqual(ident_node.eval(context), STRING_LITERAL.value) # Identifier does not exist bad_node = ast.Identifier("missing") self.assertRaises(Exception, bad_node.eval, context) def test_literal_node(self): """Test the literal node.""" context = env.empty_context() self.assertEqual(NULL_LITERAL.eval(context), NULL_LITERAL.value) self.assertEqual(STRING_LITERAL.eval(context), STRING_LITERAL.value) self.assertEqual(TRUE_LITERAL.eval(context), TRUE_LITERAL.value) self.assertEqual(FALSE_LITERAL.eval(context), FALSE_LITERAL.value) def test_declaration_node(self): """Test the declaration node.""" context = env.empty_context() context.store(env.NULL) decl_node = ast.Declaration("val", "null") self.assertEqual(decl_node.eval(context), NULL_LITERAL.value) self.assertEqual(context.find("id", "val"), NULL_LITERAL.value) self.assertRaises(env.RuntimeException, decl_node.eval, context) def test_assignment_node(self): """Test the assignment node.""" context = env.empty_context() context.store(env.Value(lib.INTEGER, 1, "value")) missing_asgn = ast.Assignment("missing") self.assertRaises(env.NamespaceException, missing_asgn.eval, context) bad_asgn = ast.Assignment("value") bad_asgn.add(STRING_LITERAL) self.assertRaises(env.AssignmentException, bad_asgn.eval, context) asgn_node = ast.Assignment("value") asgn_node.add(INT_LITERAL) self.assertEqual(asgn_node.eval(context), INT_LITERAL.value) self.assertEqual(context.find("id", "value"), INT_LITERAL.value) def test_syntax_tree(self): """Test the syntax_tree method.""" syntax_tree = ast.syntax_tree() self.assertTrue(syntax_tree is not None) self.assertEqual(syntax_tree.name, ast.Sequence.name) def test_run_in_substitution(self): """Test the run_in_substitution method.""" context = env.empty_context() access_node = AccessNode() result = ast.run_in_substitution(access_node, context) self.assertEqual(result, STRING_LITERAL.value) self.assertRaises(Exception, context.find, "id", STRING_LITERAL.value.name)
# -*- coding: utf-8 -*- """ Django settings for video_village project. For more information on this file, see https://docs.djangoproject.com/en/dev/topics/settings/ For the full list of settings and their values, see https://docs.djangoproject.com/en/dev/ref/settings/ """ from __future__ import absolute_import, unicode_literals import os import environ ROOT_DIR = environ.Path(__file__) - 3 # (video_village/config/settings/common.py - 3 = video_village/) APPS_DIR = ROOT_DIR.path('video_village') env = environ.Env() if os.environ.get('AWS_PATH'): environ.Env.read_env(ROOT_DIR('.amazonenv')) else: environ.Env.read_env(ROOT_DIR('.env')) # APP CONFIGURATION # ------------------------------------------------------------------------------ DJANGO_APPS = ( # Default Django apps: 'django.contrib.auth', 'django.contrib.contenttypes', 'django.contrib.sessions', 'django.contrib.sites', 'django.contrib.messages', 'django.contrib.staticfiles', # Useful template tags: # 'django.contrib.humanize', # Admin 'django.contrib.admin', ) THIRD_PARTY_APPS = ( 'crispy_forms', # Form layouts 'allauth', # registration 'allauth.account', # registration 'allauth.socialaccount', # registration 'rest_framework', 'localflavor', 'taggit', 'django_tables2', ) # Apps specific for this project go here. LOCAL_APPS = ( 'video_village.users', # custom users app # Your stuff: custom apps go here 'videos', 'schedules', 'pis', ) # See: https://docs.djangoproject.com/en/dev/ref/settings/#installed-apps INSTALLED_APPS = DJANGO_APPS + THIRD_PARTY_APPS + LOCAL_APPS # MIDDLEWARE CONFIGURATION # ------------------------------------------------------------------------------ MIDDLEWARE_CLASSES = ( # Make sure djangosecure.middleware.SecurityMiddleware is listed first 'django.contrib.sessions.middleware.SessionMiddleware', 'django.middleware.common.CommonMiddleware', 'django.middleware.csrf.CsrfViewMiddleware', 'django.contrib.auth.middleware.AuthenticationMiddleware', 'django.contrib.messages.middleware.MessageMiddleware', 'django.middleware.clickjacking.XFrameOptionsMiddleware', ) # MIGRATIONS CONFIGURATION # ------------------------------------------------------------------------------ MIGRATION_MODULES = { 'sites': 'video_village.contrib.sites.migrations' } # DEBUG # ------------------------------------------------------------------------------ # See: https://docs.djangoproject.com/en/dev/ref/settings/#debug DEBUG = env.bool('DJANGO_DEBUG', False) # FIXTURE CONFIGURATION # ------------------------------------------------------------------------------ # See: https://docs.djangoproject.com/en/dev/ref/settings/#std:setting-FIXTURE_DIRS FIXTURE_DIRS = ( str(APPS_DIR.path('fixtures')), ) # EMAIL CONFIGURATION # ------------------------------------------------------------------------------ EMAIL_BACKEND = env('DJANGO_EMAIL_BACKEND', default='django.core.mail.backends.smtp.EmailBackend') # MANAGER CONFIGURATION # ------------------------------------------------------------------------------ # See: https://docs.djangoproject.com/en/dev/ref/settings/#admins ADMINS = ( ("""Brian Painter""", 'brian.m.painter@gmail.com'), ) # See: https://docs.djangoproject.com/en/dev/ref/settings/#managers MANAGERS = ADMINS # DATABASE CONFIGURATION # ------------------------------------------------------------------------------ # See: https://docs.djangoproject.com/en/dev/ref/settings/#databases DATABASES = { # Raises ImproperlyConfigured exception if DATABASE_URL not in os.environ 'default': env.db('DATABASE_URL', default='sqlite:///videos.db'), # 'default': env.db(''), } DATABASES['default']['ATOMIC_REQUESTS'] = True # GENERAL CONFIGURATION # ------------------------------------------------------------------------------ # Local time zone for this installation. Choices can be found here: # http://en.wikipedia.org/wiki/List_of_tz_zones_by_name # although not all choices may be available on all operating systems. # In a Windows environment this must be set to your system time zone. TIME_ZONE = 'UTC' # See: https://docs.djangoproject.com/en/dev/ref/settings/#language-code LANGUAGE_CODE = 'en-us' # See: https://docs.djangoproject.com/en/dev/ref/settings/#site-id SITE_ID = 1 # See: https://docs.djangoproject.com/en/dev/ref/settings/#use-i18n USE_I18N = True # See: https://docs.djangoproject.com/en/dev/ref/settings/#use-l10n USE_L10N = True # See: https://docs.djangoproject.com/en/dev/ref/settings/#use-tz USE_TZ = True # TEMPLATE CONFIGURATION # ------------------------------------------------------------------------------ # See: https://docs.djangoproject.com/en/dev/ref/settings/#templates TEMPLATES = [ { # See: https://docs.djangoproject.com/en/dev/ref/settings/#std:setting-TEMPLATES-BACKEND 'BACKEND': 'django.template.backends.django.DjangoTemplates', # See: https://docs.djangoproject.com/en/dev/ref/settings/#template-dirs 'DIRS': [ str(APPS_DIR.path('templates')), ], 'OPTIONS': { # See: https://docs.djangoproject.com/en/dev/ref/settings/#template-debug 'debug': DEBUG, # See: https://docs.djangoproject.com/en/dev/ref/settings/#template-loaders # https://docs.djangoproject.com/en/dev/ref/templates/api/#loader-types 'loaders': [ 'django.template.loaders.filesystem.Loader', 'django.template.loaders.app_directories.Loader', ], # See: https://docs.djangoproject.com/en/dev/ref/settings/#template-context-processors 'context_processors': [ 'django.template.context_processors.debug', 'django.template.context_processors.request', 'django.contrib.auth.context_processors.auth', 'django.template.context_processors.i18n', 'django.template.context_processors.media', 'django.template.context_processors.static', 'django.template.context_processors.tz', 'django.contrib.messages.context_processors.messages', # Your stuff: custom template context processors go here ], }, }, ] # See: http://django-crispy-forms.readthedocs.io/en/latest/install.html#template-packs CRISPY_TEMPLATE_PACK = 'bootstrap3' # STATIC FILE CONFIGURATION # ------------------------------------------------------------------------------ # See: https://docs.djangoproject.com/en/dev/ref/settings/#static-root STATIC_ROOT = str(ROOT_DIR('staticfiles')) # See: https://docs.djangoproject.com/en/dev/ref/settings/#static-url STATIC_URL = '/static/' # See: https://docs.djangoproject.com/en/dev/ref/contrib/staticfiles/#std:setting-STATICFILES_DIRS STATICFILES_DIRS = ( str(APPS_DIR.path('static')), ) # See: https://docs.djangoproject.com/en/dev/ref/contrib/staticfiles/#staticfiles-finders STATICFILES_FINDERS = ( 'django.contrib.staticfiles.finders.FileSystemFinder', 'django.contrib.staticfiles.finders.AppDirectoriesFinder', ) # MEDIA CONFIGURATION # ------------------------------------------------------------------------------ # See: https://docs.djangoproject.com/en/dev/ref/settings/#media-root MEDIA_ROOT = str(APPS_DIR('media')) # See: https://docs.djangoproject.com/en/dev/ref/settings/#media-url MEDIA_URL = '/media/' # URL Configuration # ------------------------------------------------------------------------------ ROOT_URLCONF = 'config.urls' # See: https://docs.djangoproject.com/en/dev/ref/settings/#wsgi-application WSGI_APPLICATION = 'config.wsgi.application' # AUTHENTICATION CONFIGURATION # ------------------------------------------------------------------------------ AUTHENTICATION_BACKENDS = ( 'django.contrib.auth.backends.ModelBackend', 'allauth.account.auth_backends.AuthenticationBackend', ) # Some really nice defaults ACCOUNT_AUTHENTICATION_METHOD = 'username' ACCOUNT_EMAIL_REQUIRED = True ACCOUNT_EMAIL_VERIFICATION = 'none' ACCOUNT_ALLOW_REGISTRATION = env.bool('DJANGO_ACCOUNT_ALLOW_REGISTRATION', False) ACCOUNT_ADAPTER = 'video_village.users.adapters.AccountAdapter' SOCIALACCOUNT_ADAPTER = 'video_village.users.adapters.SocialAccountAdapter' # Custom user app defaults # Select the correct user model AUTH_USER_MODEL = 'users.User' LOGIN_REDIRECT_URL = 'users:redirect' LOGIN_URL = 'account_login' # SLUGLIFIER AUTOSLUG_SLUGIFY_FUNCTION = 'slugify.slugify' ########## CELERY INSTALLED_APPS += ('video_village.taskapp.celery.CeleryConfig',) # if you are not using the django database broker (e.g. rabbitmq, redis, memcached), you can remove the next line. INSTALLED_APPS += ('kombu.transport.django',) BROKER_URL = env('CELERY_BROKER_URL', default='django://') ########## END CELERY # Location of root django.contrib.admin URL, use {% url 'admin:index' %} ADMIN_URL = r'^admin/' # Your common stuff: Below this line define 3rd party library settings TAGGIT_CASE_INSENSITIVE = True REST_FRAMEWORK = { 'DEFAULT_PERMISSION_CLASSES': ( 'rest_framework.permissions.IsAuthenticated', ) } NGROK_AUTH_USER = env('NGROK_AUTH_USER', default='') NGROK_AUTH_TOKEN = env('NGROK_AUTH_TOKEN', default='')
# -*- coding: utf-8 -*- import logging import secrets import webapp2 from webapp2_extras import auth, sessions, jinja2 from jinja2.runtime import TemplateNotFound from simpleauth import SimpleAuthHandler import tweepy import random from tweepy.error import TweepError # Consumer keys and access tokens, used for OAuth consumer_key = secrets.consumer_key consumer_secret = secrets.consumer_secret class BaseRequestHandler(webapp2.RequestHandler): def dispatch(self): # Get a session store for this request. self.session_store = sessions.get_store(request=self.request) try: # Dispatch the request. webapp2.RequestHandler.dispatch(self) finally: # Save all sessions. self.session_store.save_sessions(self.response) @webapp2.cached_property def jinja2(self): """Returns a Jinja2 renderer cached in the app registry""" return jinja2.get_jinja2(app=self.app) @webapp2.cached_property def session(self): """Returns a session using the default cookie key""" return self.session_store.get_session() @webapp2.cached_property def auth(self): return auth.get_auth() @webapp2.cached_property def current_user(self): """Returns currently logged in user""" user_dict = self.auth.get_user_by_session() return self.auth.store.user_model.get_by_id(user_dict['user_id']) @webapp2.cached_property def logged_in(self): """Returns true if a user is currently logged in, false otherwise""" return self.auth.get_user_by_session() is not None def render(self, template_name, template_vars={}): # Preset values for the template values = { 'url_for': self.uri_for, 'logged_in': self.logged_in, 'flashes': self.session.get_flashes() } # Add manually supplied template values values.update(template_vars) # read the template or 404.html try: self.response.write(self.jinja2.render_template(template_name, **values)) except TemplateNotFound: self.abort(404) def head(self, *args): """Head is used by Twitter. If not there the tweet button shows 0""" pass class RootHandler(BaseRequestHandler): def get(self): """Handles default landing page""" if self.logged_in: self.render('home.html', { 'user': self.current_user, 'session': self.auth.get_user_by_session() }) else: self.render('home.html') class ProfileHandler(BaseRequestHandler): def get(self): """Handles GET /profile""" if self.logged_in: self.render('profile.html', { 'user': self.current_user, 'session': self.auth.get_user_by_session() }) else: self.redirect('/') class FollowersHandler(BaseRequestHandler): def get(self): """Handles GET /followers""" if self.logged_in: user = self.current_user # OAuth process, using the keys and tokens auth = tweepy.OAuthHandler(consumer_key, consumer_secret) auth.set_access_token(user.access_token, user.access_token_secret) # Creation of the actual interface, using authentication api = tweepy.API(auth) followers = list() incomplete_list = False try: # the maximum per request is 200 according to # https://dev.twitter.com/rest/reference/get/followers/list for follower in tweepy.Cursor(api.followers,count=200).items(): followers.append(follower) except TweepError as e: logging.error(e) limits = api.rate_limit_status('statuses') logging.info(limits) incomplete_list = True winner = False if len(followers) > 0: random_number = random.randint(0, len(followers)-1) winner = followers[random_number] self.render('followers.html', { 'user': user, 'session': self.auth.get_user_by_session(), 'followers': followers, 'winner': winner, 'incomplete_list': incomplete_list, }) else: self.redirect('/') class RetweetsHandler(BaseRequestHandler): def get(self): """Handles GET /retweets""" if self.logged_in: user = self.current_user tweet_id = self.request.get("id") # OAuth process, using the keys and tokens auth = tweepy.OAuthHandler(consumer_key, consumer_secret) auth.set_access_token(user.access_token, user.access_token_secret) # Creation of the actual interface, using authentication api = tweepy.API(auth) if not tweet_id: retweets_list = list() incomplete_list = False try: for tweet in api.retweets_of_me(count=100): retweets_list.append(tweet) except TweepError as e: logging.error(e) limits = api.rate_limit_status('statuses') logging.info(limits) incomplete_list = True self.render('retweets.html', { 'user': user, 'session': self.auth.get_user_by_session(), 'retweets': retweets_list, 'incomplete_list': incomplete_list, }) else: retweet = False winner = False incomplete_list = False try: retweet = api.get_status(tweet_id) retweeters = api.retweeters(tweet_id) if len(retweeters) > 0: random_number = random.randint(0, len(retweeters)-1) winner = api.get_user(retweeters[random_number]) except TweepError as e: logging.error(e) limits = api.rate_limit_status('statuses') logging.info(limits) incomplete_list = True self.render('retweets.html', { 'user': user, 'session': self.auth.get_user_by_session(), 'winner': winner, 'retweet': retweet, 'incomplete_list': incomplete_list, }) else: self.redirect('/') class SearchesHandler(BaseRequestHandler): def get(self): """Handles GET /searches""" if self.logged_in: user = self.current_user search_id = self.request.get("id") # OAuth process, using the keys and tokens auth = tweepy.OAuthHandler(consumer_key, consumer_secret) auth.set_access_token(user.access_token, user.access_token_secret) # Creation of the actual interface, using authentication api = tweepy.API(auth) if not search_id: searches_list = list() incomplete_list = False try: for search in api.saved_searches(): searches_list.append(search) except TweepError as e: logging.error(e) limits = api.rate_limit_status('statuses') logging.info(limits) incomplete_list = True self.render('searches.html', { 'user': user, 'session': self.auth.get_user_by_session(), 'searches': searches_list, 'incomplete_list': incomplete_list, }) else: winner = False tweet = False incomplete_list = False try: search = api.get_saved_search(search_id) statuses = list() tweeters = list() # max 100 https://dev.twitter.com/rest/reference/get/search/tweets for status in api.search(q=search.query, count=100): statuses.append(status) tweeters.append(status.user) if len(tweeters) > 0: random_number = random.randint(0, len(tweeters)-1) winner = tweeters[random_number] tweet = statuses[random_number] except TweepError as e: logging.error(e) limits = api.rate_limit_status('statuses') logging.info(limits) incomplete_list = True self.render('searches.html', { 'user': user, 'session': self.auth.get_user_by_session(), 'winner': winner, 'tweet': tweet, 'incomplete_list': incomplete_list, }) else: self.redirect('/') class AuthHandler(BaseRequestHandler, SimpleAuthHandler): """Authentication handler for OAuth 2.0, 1.0(a) and OpenID.""" # Enable optional OAuth 2.0 CSRF guard OAUTH2_CSRF_STATE = True USER_ATTRS = { 'facebook' : { 'id' : lambda id: ('avatar_url', 'http://graph.facebook.com/{0}/picture?type=large'.format(id)), 'name' : 'name', 'link' : 'link' }, 'google' : { 'picture': 'avatar_url', 'name' : 'name', 'profile': 'link' }, 'windows_live': { 'avatar_url': 'avatar_url', 'name' : 'name', 'link' : 'link' }, 'twitter' : { 'profile_image_url': 'avatar_url', 'screen_name' : 'name', 'link' : 'link' }, 'linkedin' : { 'picture-url' : 'avatar_url', 'first-name' : 'name', 'public-profile-url': 'link' }, 'linkedin2' : { 'picture-url' : 'avatar_url', 'first-name' : 'name', 'public-profile-url': 'link' }, 'foursquare' : { 'photo' : lambda photo: ('avatar_url', photo.get('prefix') + '100x100' + photo.get('suffix')), 'firstName': 'firstName', 'lastName' : 'lastName', 'contact' : lambda contact: ('email',contact.get('email')), 'id' : lambda id: ('link', 'http://foursquare.com/user/{0}'.format(id)) }, 'openid' : { 'id' : lambda id: ('avatar_url', '/img/missing-avatar.png'), 'nickname': 'name', 'email' : 'link' } } def _on_signin(self, data, auth_info, provider): """Callback whenever a new or existing user is logging in. data is a user info dictionary. auth_info contains access token or oauth token and secret. """ auth_id = '%s:%s' % (provider, data['id']) logging.info('Looking for a user with id %s', auth_id) user = self.auth.store.user_model.get_by_auth_id(auth_id) _attrs = self._to_user_model_attrs(data, self.USER_ATTRS[provider]) if user: logging.info('Found existing user to log in') # Existing users might've changed their profile data so we update our # local model anyway. This might result in quite inefficient usage # of the Datastore, but we do this anyway for demo purposes. # # In a real app you could compare _attrs with user's properties fetched # from the datastore and update local user in case something's changed. user.populate(**_attrs) user.access_token = auth_info['oauth_token'] user.access_token_secret = auth_info['oauth_token_secret'] user.put() self.auth.set_session( self.auth.store.user_to_dict(user)) else: # check whether there's a user currently logged in # then, create a new user if nobody's signed in, # otherwise add this auth_id to currently logged in user. if self.logged_in: logging.info('Updating currently logged in user') u = self.current_user u.populate(**_attrs) user.access_token = auth_info['oauth_token'] user.access_token_secret = auth_info['oauth_token_secret'] # The following will also do u.put(). Though, in a real app # you might want to check the result, which is # (boolean, info) tuple where boolean == True indicates success # See webapp2_extras.appengine.auth.models.User for details. u.add_auth_id(auth_id) else: logging.info('Creating a brand new user') ok, user = self.auth.store.user_model.create_user(auth_id, **_attrs) if ok: user.access_token = auth_info['oauth_token'] user.access_token_secret = auth_info['oauth_token_secret'] user.put() self.auth.set_session(self.auth.store.user_to_dict(user)) # Remember auth data during redirect, just for this demo. You wouldn't # normally do this. #self.session.add_flash(data, 'data - from _on_signin(...)') #self.session.add_flash(auth_info, 'auth_info - from _on_signin(...)') self.redirect('/') def logout(self): self.auth.unset_session() self.redirect('/') def handle_exception(self, exception, debug): logging.error(exception) self.render('error.html', {'exception': exception}) def _callback_uri_for(self, provider): return self.uri_for('auth_callback', provider=provider, _full=True) def _get_consumer_info_for(self, provider): """Returns a tuple (key, secret) for auth init requests.""" return secrets.AUTH_CONFIG[provider] def _to_user_model_attrs(self, data, attrs_map): """Get the needed information from the provider dataset.""" user_attrs = {} for k, v in attrs_map.iteritems(): attr = (v, data.get(k)) if isinstance(v, str) else v(data.get(k)) user_attrs.setdefault(*attr) return user_attrs
""" This collection of functions scrapes most of the important data about movie observable characteristics from the film's summary page on Box Office Mojo. Last Run: December, 2016 """ import requests from bs4 import BeautifulSoup import re import dateutil.parser from string import ascii_uppercase import pandas as pd # import pickle import time import urllib.request import csv import requests sess = requests.Session() adapter = requests.adapters.HTTPAdapter(max_retries=10) sess.mount('http://', adapter) ## functions def get_movie_value(soup, field_name): '''Grab a value from boxofficemojo HTML Takes a string attribute of a movie on the page and returns the string in the next sibling object (the value for that attribute) or None if nothing is found. ''' obj = soup.find(text=re.compile(field_name)) if not obj: return None # this works for most of the values next_sibling = obj.findNextSibling() if next_sibling: return next_sibling.text #.encode('ascii','ignore') else: return None def get_movie_title(soup): ''' Get the movie's title from the header table ''' obj = soup.find('title') if not obj: return None # this works for most of the values try: name = "(".join(obj.text.split('(')[:-1]).strip() if name == "": name = "".join(obj.text.split('-')[:-1]).strip() return name #.encode('ascii','ignore') except: return None def get_theaters(soup): ''' Grabs the largest number of theatres that a film was shown over a release cycle ''' nonBreakSpace = u'\xa0' obj = soup.find(text=re.compile('Widest'+nonBreakSpace+'Release:')) if not obj: return None next_obj = obj.findNext('td') if next_obj.contents[0]: return next_obj.contents[0].strip().split()[0] #.encode('ascii','ignore') else: return None def get_close(soup): ''' Grabs the last date that the movie was shown in cinemas ''' nonBreakSpace = u'\xa0' obj = soup.find(text=re.compile('Close'+nonBreakSpace+'Date:')) if not obj: return None next_obj = obj.findNext('td') if next_obj.contents[0]: return next_obj.contents[0].strip().split()[0] #.encode('ascii','ignore') else: return None def get_inrelease(soup): ''' Grabs the number of days a film was in release ''' #nonBreakSpace = u'\xa0' obj = soup.find(text=re.compile('In Release:')) if not obj: return None next_obj = obj.findNext('td') if next_obj.contents[0]: return next_obj.contents[0].strip().split()[0] #.encode('ascii','ignore') else: return None def get_foreigntotal(soup): ''' Grabs the foreign earnings of the film aggregated across markets outside the USA ''' nonBreakSpace = u'\xa0' obj = soup.find(text=re.compile('Foreign:')) if not obj: return None next_obj = obj.findNext('td') if next_obj.contents[0]: return next_obj.contents[0].strip().split()[0] #.encode('ascii','ignore') else: return None def get_openingweekend(soup): ''' Grabs the opening weekend box office for a film that was released straight to "wide release" ''' try: nonBreakSpace = u'\xa0' obj = soup.find(text=re.compile('Opening'+nonBreakSpace+'Weekend:')) if not obj: return None next_obj = obj.findNext('td') if next_obj.contents[0]: return next_obj.contents[0].strip().split()[0] #.encode('ascii','ignore') else: return None except: return None def get_openingweekend_limited(soup): ''' For a film that was first released in limited theatres, gets the opening weekend box office of the limited release phase ''' try: nonBreakSpace = u'\xa0' obj = soup.find(text=re.compile('Limited'+nonBreakSpace+'Opening'+nonBreakSpace+'Weekend:')) if not obj: return None next_obj = obj.findNext('b') if next_obj.contents[0]: return next_obj.contents[0].strip().split()[0] #.encode('ascii','ignore') else: return None except: return None def get_openingweekend_wide(soup): ''' For a film that was first released in limited theatres, gets the opening weekend box office of the wide release phase ''' try: nonBreakSpace = u'\xa0' obj = soup.find(text=re.compile('Wide'+nonBreakSpace+'Opening'+nonBreakSpace+'Weekend:')) if not obj: return None next_obj = obj.findNext('td') if next_obj.contents[0]: return next_obj.contents[0].strip().split()[0] #.encode('ascii','ignore') else: return None except: return None def get_all_players(soup, field_name_list): ''' Will return a string containing a list of people who were in a certain role within the movie production. Currently works for: director, producer, actor, writer, cinematographer composer ''' for item in set(field_name_list): my_text = soup.find(text=item) if my_text: my_td = my_text.findNext('td').getText(separator=u',') #.encode('ascii','ignore') return my_td return None def to_date(datestring): ''' A helper function than transforms a date string into a "proper date format" ''' try: date = dateutil.parser.parse(datestring) return date except: return datestring def money_to_int(moneystring): ''' A helper function to strip out dollar signs ($) and commas leaving any dollar value as a integer ''' try: moneystring = moneystring.replace('$', '').replace(',', '') return int(moneystring) except: return moneystring def runtime_to_minutes(runtimestring): ''' A helper function that converts the run time of movies posted as hours and minutes into minutes ''' try: runtime = runtimestring.split() try: minutes = int(runtime[0])*60 + int(runtime[2]) return minutes except: return None except: return runtimestring def process_movie(url): ''' Takes a URL to a movie website on Box Office Mojo and collects all the relevant observable characteristics from the summary page. ''' headers = ['movie_id','movie_title', 'domestic_total_gross', 'foreign_total_gross', 'opening_weekend', 'opening_weekend_limited', 'opening_weekend_wide', 'release_date', 'close_date' , 'in_release_days' , 'runtime_mins', 'rating', 'genre', 'distributor', 'director', 'producer', 'production_budget', 'widest_release_theaters', 'actors', 'writers', 'cinematographers', 'composers' ] response = sess.get(url) if response.status_code != 200: return None page = response.text soup = BeautifulSoup(page,"lxml") ## --- Create a movie ID from the URL and get the title movie_id = url.rsplit('=', 1)[-1].rsplit('.', 1)[0] movie_title = get_movie_title(soup) ## --- Date Specific raw_release_date = get_movie_value(soup,'Release Date') release_date = to_date(raw_release_date) raw_close_date = get_close(soup) close_date = to_date(raw_close_date) in_release = get_inrelease(soup) ## --- Box Office raw_domestic_total_gross = get_movie_value(soup,'Domestic Total') domestic_total_gross = money_to_int(raw_domestic_total_gross) raw_foreign_total_gross = get_foreigntotal(soup) foreign_total_gross = money_to_int(raw_foreign_total_gross) raw_domestic_opening_weekend = get_openingweekend(soup) domestic_opening_weekend = money_to_int(raw_domestic_opening_weekend) raw_domestic_opening_weekend_limited = get_openingweekend_limited(soup) domestic_opening_weekend_limited = money_to_int(raw_domestic_opening_weekend_limited) raw_domestic_opening_weekend_wide = get_openingweekend_wide(soup) domestic_opening_weekend_wide = money_to_int(raw_domestic_opening_weekend_wide) ## -- remaining characteristics raw_runtime = get_movie_value(soup,'Runtime') runtime = runtime_to_minutes(raw_runtime) rating = get_movie_value(soup,'MPAA Rating') genre = get_movie_value(soup,'Genre: ') distributor = get_movie_value(soup,'Distributor: ') production_budget = get_movie_value(soup, 'Production Budget: ') widest_release_theaters = get_theaters(soup) ## --- People involved in the movie director = get_all_players(soup,['Director:','Director']) producer = get_all_players(soup,['Producer:','Producers:', 'Producer','Producers']) actors = get_all_players(soup,['Actor:','Actors:','Actor','Actors']) writers = get_all_players(soup,['Writer:','Writers:', 'Screenwriter:','Screenwriters:', 'Writer','Writers', 'Screenwriter','Screenwriters']) cinematographers = get_all_players(soup, ['Cinematographer:','Cinematographer', 'Cinematographers:','Cinematographers']) composers = get_all_players(soup, ['Composer:','Composers:', 'Composer','Composers']) ## --- Put the data collected into a pandas dataframe df_movie = pd.DataFrame([[movie_id, movie_title, domestic_total_gross, foreign_total_gross, domestic_opening_weekend, domestic_opening_weekend_limited, domestic_opening_weekend_wide, release_date, close_date, in_release, runtime, rating, genre, distributor, director, producer, production_budget, widest_release_theaters, actors, writers, cinematographers, composers ]], columns=headers) # return a line of data to the object assigned return df_movie
# Copyright (c) 2005-2017 Apple Inc. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. ## from twisted.internet.defer import inlineCallbacks, returnValue from twisted.python.failure import Failure from twext.enterprise.locking import NamedLock from twext.python.log import Logger from txweb2 import responsecode from txweb2.http import HTTPError, Response from txweb2.http_headers import MimeType from txdav.xml import element as davxml from txweb2.dav.http import messageForFailure, statusForFailure, \ ErrorResponse from twistedcaldav import caldavxml from twistedcaldav.customxml import calendarserver_namespace from twistedcaldav.accounting import accountingEnabled, emitAccounting from twistedcaldav.config import config from twistedcaldav.ical import Component from txdav.caldav.datastore.scheduling import addressmapping from txdav.caldav.datastore.scheduling.caldav.delivery import ScheduleViaCalDAV from txdav.caldav.datastore.scheduling.cuaddress import EmailCalendarUser from txdav.caldav.datastore.scheduling.cuaddress import InvalidCalendarUser, \ OtherServerCalendarUser, calendarUserFromCalendarUserAddress from txdav.caldav.datastore.scheduling.cuaddress import LocalCalendarUser from txdav.caldav.datastore.scheduling.cuaddress import RemoteCalendarUser from txdav.caldav.datastore.scheduling.imip.delivery import ScheduleViaIMip from txdav.caldav.datastore.scheduling.ischedule.delivery import ScheduleViaISchedule from txdav.caldav.datastore.scheduling.itip import iTIPRequestStatus from pycalendar.period import Period import hashlib from collections import namedtuple """ CalDAV/Server-to-Server scheduling behavior. This module handles the delivery of scheduling messages to organizer and attendees. The basic idea is to first confirm the integrity of the incoming scheduling message, check authorization. Appropriate L{DeliveryService}s are then used to deliver the message to attendees or organizer. Delivery responses are processed and returned. This takes into account podding of users by detecting the appropriate host for a calendar user and then dispatching the delivery accordingly. The L{Scheduler} class defines the basic behavior for processing deliveries. Sub-classes are defined for the different ways a deliver can be triggered. L{CalDAVScheduler} - handles deliveries for scheduling messages originating from inside the CalDAV server i.e. user PUTs or POSTs. L{IScheduleScheduler} - handles deliveries for scheduling messages being POSTed to the iSchedule inbox. L{IMIPScheduler} - handles deliveries for POSTs on the iMIP inbox (coming from the mail gateway). L{DirectScheduler} - used when doing some internal processing (e.g., inbox item processing during an upgrade. Here is a typical flow of activity for a iTIP between users on the server: iTIP PUT request \ \_L{ImplicitScheduler} - does CalDAV-schedule logic and sends iTIP message \ \_L{CalDAVScheduler} - receives iTIP message \ \_L{ScheduleViaCalDAV} - handles delivery of iTIP message \ \_L{ImplicitProcessor} - dispatches iTIP message (also auto-accept) \ \_L{iTipProcessing} - processes iTIP message Here is a typical flow of activity for a iTIP between an organizer on the server and an iMIP attendee: iTIP PUT request \ \_L{ImplicitScheduler} \ \_L{CalDAVScheduler} \ \_L{ScheduleViaIMip} Here is a typical flow of activity for a iTIP between an organizer not on the server and attendee on the server: iTIP POST on /ischedule \ \_L{IScheduleScheduler} \ \_L{ScheduleViaCalDAV} \ \_L{ImplicitProcessor} \ \_L{iTipProcessing} """ __all__ = [ "Scheduler", "RemoteScheduler", "DirectScheduler", ] log = Logger() class Scheduler(object): scheduleResponse = None errorResponse = None # The class used for generating an HTTP XML error response errorElements = { "originator-missing": (), "originator-invalid": (), "originator-denied": (), "recipient-missing": (), "recipient-invalid": (), "organizer-denied": (), "attendee-denied": (), "invalid-calendar-data-type": (), "invalid-calendar-data": (), "invalid-scheduling-message": (), "max-recipients": (), } def __init__(self, txn, originator_uid, logItems=None, noAttendeeRefresh=False): self.txn = txn self.originator_uid = originator_uid self.logItems = logItems self.noAttendeeRefresh = noAttendeeRefresh self.originator = None self.recipients = None self.recipientsNormalizationMap = {} self.calendar = None self.organizer = None self.attendee = None self.isiTIPRequest = None self.timeRange = None self.excludeUID = None self.fakeTheResult = False self.method = "Unknown" self.internal_request = False @inlineCallbacks def doSchedulingViaPOST(self, originator, recipients, calendar): """ The Scheduling POST operation on an Outbox. """ self.calendar = calendar yield self.preProcessCalendarData() if self.logItems is not None: self.logItems["recipients"] = len(recipients) self.logItems["cl"] = str(len(str(calendar))) # We might trigger an implicit scheduling operation here that will require consistency # of data for all events with the same UID. So detect this and use a lock if calendar.resourceType() != "VFREEBUSY": uid = calendar.resourceUID() yield NamedLock.acquire(self.txn, "ImplicitUIDLock:{}".format(hashlib.md5(uid).hexdigest(),)) result = (yield self.doSchedulingDirectly("POST", originator, recipients, calendar)) if self.logItems is not None: if self.checkForFreeBusy(): self.logItems["freebusy"] = "true" else: self.logItems["itip-method"] = self.calendar.propertyValue("METHOD").lower() returnValue(result) def doSchedulingViaPUT(self, originator, recipients, calendar, internal_request=False, suppress_refresh=False): """ The implicit scheduling PUT operation. """ return self.doSchedulingDirectly("PUT", originator, recipients, calendar, internal_request, suppress_refresh) def doSchedulingDirectly(self, descriptor, originator, recipients, calendar, internal_request=False, suppress_refresh=False): """ The implicit scheduling operation. """ self.method = descriptor # Load various useful bits doing some basic checks on those self.originator = originator self.recipients = recipients self.calendar = calendar self.internal_request = internal_request self.suppress_refresh = suppress_refresh # Do some extra authorization checks self.checkAuthorization() return self.doScheduling() @inlineCallbacks def doScheduling(self): # Check validity of Originator header. yield self.checkOriginator() # Get recipient details. yield self.checkRecipients() # Check calendar data. self.checkCalendarData() # Check validity of ORGANIZER yield self.checkOrganizer() # Do security checks (e.g. spoofing) yield self.securityChecks() # Generate accounting information self.doAccounting() # Do some final checks after we have gathered all our information self.finalChecks() # Do scheduling tasks result = (yield self.generateSchedulingResponse()) returnValue(result) def preProcessCalendarData(self): """ After loading calendar data from the request, do some optional processing of it. This method will be overridden by those schedulers that need to do special things to the data. """ pass def checkAuthorization(self): raise NotImplementedError def checkOriginator(self): raise NotImplementedError def checkRecipients(self): raise NotImplementedError def checkOrganizer(self): raise NotImplementedError def checkOrganizerAsOriginator(self): raise NotImplementedError def checkAttendeeAsOriginator(self): raise NotImplementedError def checkCalendarData(self): # Skip all the valid data checks for an internal request as we are going to assume all the internal # request data has been generated properly. if not self.internal_request: # Must be a valid calendar try: self.calendar.validCalendarData() except ValueError, e: log.error( "{method} request calendar component is not valid:{exc} {cal}", method=self.method, exc=e, cal=self.calendar, ) raise HTTPError(self.errorResponse( responsecode.FORBIDDEN, self.errorElements["invalid-calendar-data"], description="Calendar component is not valid" )) # Must have a METHOD if not self.calendar.isValidMethod(): log.error( "{method} request must have valid METHOD property in calendar component: {cal}", method=self.method, cal=self.calendar, ) raise HTTPError(self.errorResponse( responsecode.FORBIDDEN, self.errorElements["invalid-scheduling-message"], description="Must have valid METHOD property" )) # Verify iTIP behavior if not self.calendar.isValidITIP(): log.error( "{method} request must have a calendar component that satisfies iTIP requirements: {cal}", method=self.method, cal=self.calendar, ) raise HTTPError(self.errorResponse( responsecode.FORBIDDEN, self.errorElements["invalid-scheduling-message"], description="Must have a calendar component that satisfies iTIP requirements" )) # X-CALENDARSERVER-ACCESS is not allowed in Outbox POSTs if self.calendar.hasProperty(Component.ACCESS_PROPERTY): log.error( "X-CALENDARSERVER-ACCESS not allowed in a calendar component {method} request: {cal}", method=self.method, cal=self.calendar, ) raise HTTPError(self.errorResponse( responsecode.FORBIDDEN, (calendarserver_namespace, "no-access-restrictions"), "Private events cannot be scheduled", )) # Determine iTIP method mode if self.calendar.propertyValue("METHOD") in ("PUBLISH", "REQUEST", "ADD", "CANCEL", "DECLINECOUNTER"): self.isiTIPRequest = True elif self.calendar.propertyValue("METHOD") in ("REPLY", "COUNTER", "REFRESH"): self.isiTIPRequest = False # Verify that there is a single ATTENDEE property attendees = self.calendar.getAttendees() # Must have only one if len(attendees) != 1: log.error( "Wrong number of ATTENDEEs in calendar data: {cal}", cal=str(self.calendar), ) raise HTTPError(self.errorResponse( responsecode.FORBIDDEN, self.errorElements["invalid-scheduling-message"], "Wrong number of attendees", )) self.attendee = attendees[0] else: msg = "Unknown iTIP METHOD: {}".format(self.calendar.propertyValue("METHOD"),) log.error(msg) raise HTTPError(self.errorResponse( responsecode.FORBIDDEN, self.errorElements["invalid-scheduling-message"], description=msg )) def checkForFreeBusy(self): if not hasattr(self, "isfreebusy"): if (self.calendar.propertyValue("METHOD") == "REQUEST") and (self.calendar.mainType() == "VFREEBUSY"): # Extract time range from VFREEBUSY object vfreebusies = [v for v in self.calendar.subcomponents() if v.name() == "VFREEBUSY"] if len(vfreebusies) != 1: log.error( "iTIP data is not valid for a VFREEBUSY request: {cal}", cal=str(self.calendar), ) raise HTTPError(self.errorResponse( responsecode.FORBIDDEN, self.errorElements["invalid-scheduling-message"], "iTIP data is not valid for a VFREEBUSY request", )) dtstart = vfreebusies[0].getStartDateUTC() dtend = vfreebusies[0].getEndDateUTC() if dtstart is None or dtend is None: log.error( "VFREEBUSY start/end not valid: {cal}", cal=str(self.calendar), ) raise HTTPError(self.errorResponse( responsecode.FORBIDDEN, self.errorElements["invalid-scheduling-message"], "VFREEBUSY start/end not valid", )) # Some clients send floating instead of UTC - coerce to UTC if not dtstart.utc() or not dtend.utc(): log.error( "VFREEBUSY start or end not UTC: {cal}", cal=self.calendar, ) raise HTTPError(self.errorResponse( responsecode.FORBIDDEN, self.errorElements["invalid-scheduling-message"], "VFREEBUSY start or end not UTC", )) self.timeRange = Period(dtstart, dtend) # Look for masked UID self.excludeUID = self.calendar.getMaskUID() # Do free busy operation self.isfreebusy = True else: # Do regular invite (fan-out) self.isfreebusy = False return self.isfreebusy def securityChecks(self): raise NotImplementedError def doAccounting(self): # # Accounting # # Note that we associate logging with the organizer, not the # originator, which is good for looking for why something # shows up in a given principal's calendars, rather than # tracking the activities of a specific user. # if isinstance(self.organizer, LocalCalendarUser): accountingType = "iTIP-VFREEBUSY" if self.calendar.mainType() == "VFREEBUSY" else "iTIP" if accountingEnabled(accountingType, self.organizer.record): emitAccounting( accountingType, self.organizer.record, "Originator: {o}\nRecipients:\n{r}Method:{method}\n\n{cal}".format( o=str(self.originator), r=str("".join([" {}\n".format(recipient,) for recipient in self.recipients])), method=str(self.method), cal=str(self.calendar), ) ) def finalChecks(self): """ Final checks before doing the actual scheduling. """ pass @inlineCallbacks def generateSchedulingResponse(self): log.info( "METHOD: {method}, Component: {comp}", method=self.calendar.propertyValue("METHOD"), comp=self.calendar.mainType(), ) # For free-busy do immediate determination of iTIP result rather than fan-out freebusy = self.checkForFreeBusy() # Prepare for multiple responses responses = self.scheduleResponse(self.method, responsecode.OK, self.mapRecipientAddress) # Loop over each recipient and aggregate into lists by service types. caldav_recipients = [] otherserver_recipients = [] remote_recipients = [] imip_recipients = [] for ctr, recipient in enumerate(self.recipients): # Check for freebusy limit if freebusy and config.Scheduling.Options.LimitFreeBusyAttendees and ctr >= config.Scheduling.Options.LimitFreeBusyAttendees: err = HTTPError(self.errorResponse( responsecode.NOT_FOUND, self.errorElements["max-recipients"], "Too many attendees", )) responses.add(recipient.cuaddr, Failure(exc_value=err), reqstatus=iTIPRequestStatus.SERVICE_UNAVAILABLE) continue if self.fakeTheResult: responses.add(recipient.cuaddr, responsecode.OK, reqstatus=iTIPRequestStatus.SUCCESS if freebusy else iTIPRequestStatus.MESSAGE_DELIVERED) elif isinstance(recipient, LocalCalendarUser): caldav_recipients.append(recipient) elif isinstance(recipient, OtherServerCalendarUser): otherserver_recipients.append(recipient) elif isinstance(recipient, RemoteCalendarUser): remote_recipients.append(recipient) elif isinstance(recipient, EmailCalendarUser): imip_recipients.append(recipient) else: err = HTTPError(self.errorResponse( responsecode.NOT_FOUND, self.errorElements["recipient-invalid"], "Unknown recipient", )) responses.add(recipient.cuaddr, Failure(exc_value=err), reqstatus=iTIPRequestStatus.INVALID_CALENDAR_USER) # Now process local recipients if caldav_recipients: yield self.generateLocalSchedulingResponses(caldav_recipients, responses, freebusy) # Now process other server recipients if otherserver_recipients: yield self.generateRemoteSchedulingResponses(otherserver_recipients, responses, freebusy, getattr(self.txn, 'doing_attendee_refresh', False)) # To reduce chatter, we suppress certain messages if not self.suppress_refresh or self.calendar.mainType() == "VPOLL": # Now process remote recipients if remote_recipients: yield self.generateRemoteSchedulingResponses(remote_recipients, responses, freebusy) # Now process iMIP recipients if imip_recipients: yield self.generateIMIPSchedulingResponses(imip_recipients, responses, freebusy) # Return with final response if we are done returnValue(responses) def generateLocalSchedulingResponses(self, recipients, responses, freebusy): """ Generate scheduling responses for CalDAV recipients. """ # Create the scheduler and run it. requestor = ScheduleViaCalDAV(self, recipients, responses, freebusy) return requestor.generateSchedulingResponses() def generateRemoteSchedulingResponses(self, recipients, responses, freebusy, refreshOnly=False): """ Generate scheduling responses for remote recipients. """ # Create the scheduler and run it. requestor = ScheduleViaISchedule(self, recipients, responses, freebusy) return requestor.generateSchedulingResponses(refreshOnly) def generateIMIPSchedulingResponses(self, recipients, responses, freebusy): """ Generate scheduling responses for iMIP recipients. """ # Create the scheduler and run it. requestor = ScheduleViaIMip(self, recipients, responses, freebusy) return requestor.generateSchedulingResponses() def mapRecipientAddress(self, cuaddr): return self.recipientsNormalizationMap.get(cuaddr, cuaddr) class RemoteScheduler(Scheduler): def checkOrganizer(self): """ Delay ORGANIZER check until we know what their role is. """ pass @inlineCallbacks def checkRecipients(self): """ Check the validity of the Recipient header values. These must all be local as there is no concept of server-to-server relaying. """ results = [] for recipient in self.recipients: # Get the calendar user object for this recipient recipientAddress = yield calendarUserFromCalendarUserAddress(recipient, self.txn) # If no calendar user we may have a remote recipient but we should check whether # the address is one that ought to be on our server and treat that as a missing # user. Also if server-to-server is not enabled then remote addresses are not allowed. if not recipientAddress.hosted(): localUser = (yield addressmapping.mapper.isCalendarUserInMyDomain(recipient)) if localUser: log.error( "No record for calendar user address: {r}", r=recipient, ) else: log.error( "Unknown calendar user address: {r}", r=recipient, ) results.append(InvalidCalendarUser(recipient)) else: # Map recipient to their inbox and cache on calendar user object inbox = None if recipientAddress.validRecipient(): if isinstance(recipientAddress, LocalCalendarUser): recipient_home = yield self.txn.calendarHomeWithUID(recipientAddress.record.uid, create=True) if recipient_home: inbox = (yield recipient_home.calendarWithName("inbox")) else: inbox = "dummy" recipientAddress.inbox = inbox if inbox: results.append(recipientAddress) else: log.error( "No scheduling for calendar user: {r}", r=recipient, ) results.append(InvalidCalendarUser(recipient)) self.recipients = results class DirectScheduler(Scheduler): """ An implicit scheduler meant for use by local processes which don't need to go through all these checks. """ errorResponse = ErrorResponse def checkAuthorization(self): pass def checkOrganizer(self): pass def checkOrganizerAsOriginator(self): pass def checkAttendeeAsOriginator(self): pass def securityChecks(self): pass def checkOriginator(self): pass def checkRecipients(self): pass class ScheduleResponseResponse (Response): """ ScheduleResponse L{Response} object. Renders itself as a CalDAV:schedule-response XML document. """ def __init__(self, schedule_response_element, xml_responses, location=None): """ @param xml_responses: an iterable of davxml.Response objects. @param location: the value of the location header to return in the response, or None. """ Response.__init__(self, code=responsecode.OK, stream=schedule_response_element(*xml_responses).toxml()) self.headers.setHeader("content-type", MimeType("text", "xml")) if location is not None: self.headers.setHeader("location", location) class ScheduleResponseQueue (object): """ Stores a list of (typically error) responses for use in a L{ScheduleResponse}. """ log = Logger() schedule_response_element = caldavxml.ScheduleResponse response_element = caldavxml.Response recipient_element = caldavxml.Recipient recipient_uses_href = True request_status_element = caldavxml.RequestStatus error_element = davxml.Error response_description_element = davxml.ResponseDescription calendar_data_element = caldavxml.CalendarData ScheduleResonseDetails = namedtuple( "ScheduleResonseDetails", ["recipient", "reqstatus", "calendar", "error", "message", ] ) def __init__(self, method, success_response, recipient_mapper=None): """ @param method: the name of the method generating the queue. @param success_response: the response to return in lieu of a L{ScheduleResponse} if no responses are added to this queue. """ self.responses = [] self.method = method self.success_response = success_response self.recipient_mapper = recipient_mapper self.location = None def setLocation(self, location): """ @param location: the value of the location header to return in the response, or None. """ self.location = location def add(self, recipient, what, reqstatus=None, calendar=None, suppressErrorLog=False): """ Add a response. @param recipient: the recipient for this response. @param what: a status code or a L{Failure} for the given recipient. @param status: the iTIP request-status for the given recipient. @param calendar: the calendar data for the given recipient response. @param suppressErrorLog: whether to suppress a log message for errors; primarily this is used when trying to process a VFREEBUSY over iMIP, which isn't supported. """ if type(what) is int: code = what error = None message = responsecode.RESPONSES[code] elif isinstance(what, Failure): code = statusForFailure(what) error = self.errorForFailure(what) message = messageForFailure(what) else: raise AssertionError("Unknown data type: {}".format(what,)) if self.recipient_mapper is not None: recipient = self.recipient_mapper(recipient) if not suppressErrorLog and code > 400: # Error codes only self.log.error( "Error during {method} for {r}: {msg}", method=self.method, r=recipient, msg=message, ) details = ScheduleResponseQueue.ScheduleResonseDetails( self.recipient_element(davxml.HRef.fromString(recipient)) if self.recipient_uses_href else self.recipient_element.fromString(recipient), self.request_status_element(reqstatus), calendar, error, self.response_description_element(message) if message is not None else None, ) self.responses.append(details) def errorForFailure(self, failure): if failure.check(HTTPError) and isinstance(failure.value.response, ErrorResponse): return self.error_element(failure.value.response.error) else: return None def clone(self, recipient, request_status, calendar_data, error, desc): """ Add a response cloned from existing data. @param clone: the response to clone. """ details = ScheduleResponseQueue.ScheduleResonseDetails( self.recipient_element(davxml.HRef.fromString(recipient)) if self.recipient_uses_href else self.recipient_element.fromString(recipient), self.request_status_element.fromString(request_status), calendar_data, self.error_element(*error) if error is not None else None, self.response_description_element.fromString(desc) if desc is not None else None, ) self.responses.append(details) def response(self, format=None): """ Generate a L{ScheduleResponseResponse} with the responses contained in the queue or, if no such responses, return the C{success_response} provided to L{__init__}. @return: the response. """ if self.responses: # Convert our queue to all XML elements xml_responses = [] for response in self.responses: children = [] children.append(response.recipient) children.append(response.reqstatus) if response.calendar is not None: children.append(self.calendar_data_element.fromCalendar(response.calendar, format)) if response.error is not None: children.append(response.error) if response.message is not None: children.append(response.message) xml_responses.append(self.response_element(*children)) return ScheduleResponseResponse(self.schedule_response_element, xml_responses, self.location) else: return self.success_response
# Licensed to the Software Freedom Conservancy (SFC) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The SFC licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. """The WebDriver implementation.""" import base64 import warnings from contextlib import contextmanager from .command import Command from .webelement import WebElement from .remote_connection import RemoteConnection from .errorhandler import ErrorHandler from .switch_to import SwitchTo from .mobile import Mobile from .file_detector import FileDetector, LocalFileDetector from selenium.common.exceptions import (InvalidArgumentException, WebDriverException) from selenium.webdriver.common.by import By from selenium.webdriver.common.html5.application_cache import ApplicationCache try: str = basestring except NameError: pass class WebDriver(object): """ Controls a browser by sending commands to a remote server. This server is expected to be running the WebDriver wire protocol as defined at https://github.com/SeleniumHQ/selenium/wiki/JsonWireProtocol :Attributes: - session_id - String ID of the browser session started and controlled by this WebDriver. - capabilities - Dictionaty of effective capabilities of this browser session as returned by the remote server. See https://github.com/SeleniumHQ/selenium/wiki/DesiredCapabilities - command_executor - remote_connection.RemoteConnection object used to execute commands. - error_handler - errorhandler.ErrorHandler object used to handle errors. """ _web_element_cls = WebElement def __init__(self, command_executor='http://127.0.0.1:4444/wd/hub', desired_capabilities=None, browser_profile=None, proxy=None, keep_alive=False, file_detector=None): """ Create a new driver that will issue commands using the wire protocol. :Args: - command_executor - Either a string representing URL of the remote server or a custom remote_connection.RemoteConnection object. Defaults to 'http://127.0.0.1:4444/wd/hub'. - desired_capabilities - A dictionary of capabilities to request when starting the browser session. Required parameter. - browser_profile - A selenium.webdriver.firefox.firefox_profile.FirefoxProfile object. Only used if Firefox is requested. Optional. - proxy - A selenium.webdriver.common.proxy.Proxy object. The browser session will be started with given proxy settings, if possible. Optional. - keep_alive - Whether to configure remote_connection.RemoteConnection to use HTTP keep-alive. Defaults to False. - file_detector - Pass custom file detector object during instantiation. If None, then default LocalFileDetector() will be used. """ if desired_capabilities is None: raise WebDriverException("Desired Capabilities can't be None") if not isinstance(desired_capabilities, dict): raise WebDriverException("Desired Capabilities must be a dictionary") if proxy is not None: warnings.warn("Please use FirefoxOptions to set proxy", DeprecationWarning) proxy.add_to_capabilities(desired_capabilities) self.command_executor = command_executor if type(self.command_executor) is bytes or isinstance(self.command_executor, str): self.command_executor = RemoteConnection(command_executor, keep_alive=keep_alive) self._is_remote = True self.session_id = None self.capabilities = {} self.error_handler = ErrorHandler() self.start_client() if browser_profile is not None: warnings.warn("Please use FirefoxOptions to set browser profile", DeprecationWarning) self.start_session(desired_capabilities, browser_profile) self._switch_to = SwitchTo(self) self._mobile = Mobile(self) self.file_detector = file_detector or LocalFileDetector() def __repr__(self): return '<{0.__module__}.{0.__name__} (session="{1}")>'.format( type(self), self.session_id) @contextmanager def file_detector_context(self, file_detector_class, *args, **kwargs): """ Overrides the current file detector (if necessary) in limited context. Ensures the original file detector is set afterwards. Example: with webdriver.file_detector_context(UselessFileDetector): someinput.send_keys('/etc/hosts') :Args: - file_detector_class - Class of the desired file detector. If the class is different from the current file_detector, then the class is instantiated with args and kwargs and used as a file detector during the duration of the context manager. - args - Optional arguments that get passed to the file detector class during instantiation. - kwargs - Keyword arguments, passed the same way as args. """ last_detector = None if not isinstance(self.file_detector, file_detector_class): last_detector = self.file_detector self.file_detector = file_detector_class(*args, **kwargs) try: yield finally: if last_detector is not None: self.file_detector = last_detector @property def mobile(self): return self._mobile @property def name(self): """Returns the name of the underlying browser for this instance. :Usage: - driver.name """ if 'browserName' in self.capabilities: return self.capabilities['browserName'] else: raise KeyError('browserName not specified in session capabilities') def start_client(self): """ Called before starting a new session. This method may be overridden to define custom startup behavior. """ pass def stop_client(self): """ Called after executing a quit command. This method may be overridden to define custom shutdown behavior. """ pass def start_session(self, capabilities, browser_profile=None): """ Creates a new session with the desired capabilities. :Args: - browser_name - The name of the browser to request. - version - Which browser version to request. - platform - Which platform to request the browser on. - javascript_enabled - Whether the new session should support JavaScript. - browser_profile - A selenium.webdriver.firefox.firefox_profile.FirefoxProfile object. Only used if Firefox is requested. """ if not isinstance(capabilities, dict): raise InvalidArgumentException("Capabilities must be a dictionary") w3c_caps = {"firstMatch": [], "alwaysMatch": {}} if browser_profile: if "moz:firefoxOptions" in capabilities: capabilities["moz:firefoxOptions"]["profile"] = browser_profile.encoded else: capabilities.update({'firefox_profile': browser_profile.encoded}) w3c_caps["alwaysMatch"].update(capabilities) parameters = {"capabilities": w3c_caps, "desiredCapabilities": capabilities} response = self.execute(Command.NEW_SESSION, parameters) if 'sessionId' not in response: response = response['value'] self.session_id = response['sessionId'] self.capabilities = response.get('value') # if capabilities is none we are probably speaking to # a W3C endpoint if self.capabilities is None: self.capabilities = response.get('capabilities') # Double check to see if we have a W3C Compliant browser self.w3c = response.get('status') is None def _wrap_value(self, value): if isinstance(value, dict): converted = {} for key, val in value.items(): converted[key] = self._wrap_value(val) return converted elif isinstance(value, self._web_element_cls): return {'ELEMENT': value.id, 'element-6066-11e4-a52e-4f735466cecf': value.id} elif isinstance(value, list): return list(self._wrap_value(item) for item in value) else: return value def create_web_element(self, element_id): """Creates a web element with the specified `element_id`.""" return self._web_element_cls(self, element_id, w3c=self.w3c) def _unwrap_value(self, value): if isinstance(value, dict): if 'ELEMENT' in value or 'element-6066-11e4-a52e-4f735466cecf' in value: wrapped_id = value.get('ELEMENT', None) if wrapped_id: return self.create_web_element(value['ELEMENT']) else: return self.create_web_element(value['element-6066-11e4-a52e-4f735466cecf']) else: for key, val in value.items(): value[key] = self._unwrap_value(val) return value elif isinstance(value, list): return list(self._unwrap_value(item) for item in value) else: return value def execute(self, driver_command, params=None): """ Sends a command to be executed by a command.CommandExecutor. :Args: - driver_command: The name of the command to execute as a string. - params: A dictionary of named parameters to send with the command. :Returns: The command's JSON response loaded into a dictionary object. """ if self.session_id is not None: if not params: params = {'sessionId': self.session_id} elif 'sessionId' not in params: params['sessionId'] = self.session_id params = self._wrap_value(params) response = self.command_executor.execute(driver_command, params) if response: self.error_handler.check_response(response) response['value'] = self._unwrap_value( response.get('value', None)) return response # If the server doesn't send a response, assume the command was # a success return {'success': 0, 'value': None, 'sessionId': self.session_id} def get(self, url): """ Loads a web page in the current browser session. """ self.execute(Command.GET, {'url': url}) @property def title(self): """Returns the title of the current page. :Usage: driver.title """ resp = self.execute(Command.GET_TITLE) return resp['value'] if resp['value'] is not None else "" def find_element_by_id(self, id_): """Finds an element by id. :Args: - id\_ - The id of the element to be found. :Usage: driver.find_element_by_id('foo') """ return self.find_element(by=By.ID, value=id_) def find_elements_by_id(self, id_): """ Finds multiple elements by id. :Args: - id\_ - The id of the elements to be found. :Usage: driver.find_elements_by_id('foo') """ return self.find_elements(by=By.ID, value=id_) def find_element_by_xpath(self, xpath): """ Finds an element by xpath. :Args: - xpath - The xpath locator of the element to find. :Usage: driver.find_element_by_xpath('//div/td[1]') """ return self.find_element(by=By.XPATH, value=xpath) def find_elements_by_xpath(self, xpath): """ Finds multiple elements by xpath. :Args: - xpath - The xpath locator of the elements to be found. :Usage: driver.find_elements_by_xpath("//div[contains(@class, 'foo')]") """ return self.find_elements(by=By.XPATH, value=xpath) def find_element_by_link_text(self, link_text): """ Finds an element by link text. :Args: - link_text: The text of the element to be found. :Usage: driver.find_element_by_link_text('Sign In') """ return self.find_element(by=By.LINK_TEXT, value=link_text) def find_elements_by_link_text(self, text): """ Finds elements by link text. :Args: - link_text: The text of the elements to be found. :Usage: driver.find_elements_by_link_text('Sign In') """ return self.find_elements(by=By.LINK_TEXT, value=text) def find_element_by_partial_link_text(self, link_text): """ Finds an element by a partial match of its link text. :Args: - link_text: The text of the element to partially match on. :Usage: driver.find_element_by_partial_link_text('Sign') """ return self.find_element(by=By.PARTIAL_LINK_TEXT, value=link_text) def find_elements_by_partial_link_text(self, link_text): """ Finds elements by a partial match of their link text. :Args: - link_text: The text of the element to partial match on. :Usage: driver.find_element_by_partial_link_text('Sign') """ return self.find_elements(by=By.PARTIAL_LINK_TEXT, value=link_text) def find_element_by_name(self, name): """ Finds an element by name. :Args: - name: The name of the element to find. :Usage: driver.find_element_by_name('foo') """ return self.find_element(by=By.NAME, value=name) def find_elements_by_name(self, name): """ Finds elements by name. :Args: - name: The name of the elements to find. :Usage: driver.find_elements_by_name('foo') """ return self.find_elements(by=By.NAME, value=name) def find_element_by_tag_name(self, name): """ Finds an element by tag name. :Args: - name: The tag name of the element to find. :Usage: driver.find_element_by_tag_name('foo') """ return self.find_element(by=By.TAG_NAME, value=name) def find_elements_by_tag_name(self, name): """ Finds elements by tag name. :Args: - name: The tag name the use when finding elements. :Usage: driver.find_elements_by_tag_name('foo') """ return self.find_elements(by=By.TAG_NAME, value=name) def find_element_by_class_name(self, name): """ Finds an element by class name. :Args: - name: The class name of the element to find. :Usage: driver.find_element_by_class_name('foo') """ return self.find_element(by=By.CLASS_NAME, value=name) def find_elements_by_class_name(self, name): """ Finds elements by class name. :Args: - name: The class name of the elements to find. :Usage: driver.find_elements_by_class_name('foo') """ return self.find_elements(by=By.CLASS_NAME, value=name) def find_element_by_css_selector(self, css_selector): """ Finds an element by css selector. :Args: - css_selector: The css selector to use when finding elements. :Usage: driver.find_element_by_css_selector('#foo') """ return self.find_element(by=By.CSS_SELECTOR, value=css_selector) def find_elements_by_css_selector(self, css_selector): """ Finds elements by css selector. :Args: - css_selector: The css selector to use when finding elements. :Usage: driver.find_elements_by_css_selector('.foo') """ return self.find_elements(by=By.CSS_SELECTOR, value=css_selector) def execute_script(self, script, *args): """ Synchronously Executes JavaScript in the current window/frame. :Args: - script: The JavaScript to execute. - \*args: Any applicable arguments for your JavaScript. :Usage: driver.execute_script('document.title') """ converted_args = list(args) command = None if self.w3c: command = Command.W3C_EXECUTE_SCRIPT else: command = Command.EXECUTE_SCRIPT return self.execute(command, { 'script': script, 'args': converted_args})['value'] def execute_async_script(self, script, *args): """ Asynchronously Executes JavaScript in the current window/frame. :Args: - script: The JavaScript to execute. - \*args: Any applicable arguments for your JavaScript. :Usage: driver.execute_async_script('document.title') """ converted_args = list(args) if self.w3c: command = Command.W3C_EXECUTE_SCRIPT_ASYNC else: command = Command.EXECUTE_ASYNC_SCRIPT return self.execute(command, { 'script': script, 'args': converted_args})['value'] @property def current_url(self): """ Gets the URL of the current page. :Usage: driver.current_url """ return self.execute(Command.GET_CURRENT_URL)['value'] @property def page_source(self): """ Gets the source of the current page. :Usage: driver.page_source """ return self.execute(Command.GET_PAGE_SOURCE)['value'] def close(self): """ Closes the current window. :Usage: driver.close() """ self.execute(Command.CLOSE) def quit(self): """ Quits the driver and closes every associated window. :Usage: driver.quit() """ try: self.execute(Command.QUIT) finally: self.stop_client() @property def current_window_handle(self): """ Returns the handle of the current window. :Usage: driver.current_window_handle """ if self.w3c: return self.execute(Command.W3C_GET_CURRENT_WINDOW_HANDLE)['value'] else: return self.execute(Command.GET_CURRENT_WINDOW_HANDLE)['value'] @property def window_handles(self): """ Returns the handles of all windows within the current session. :Usage: driver.window_handles """ if self.w3c: return self.execute(Command.W3C_GET_WINDOW_HANDLES)['value'] else: return self.execute(Command.GET_WINDOW_HANDLES)['value'] def maximize_window(self): """ Maximizes the current window that webdriver is using """ command = Command.MAXIMIZE_WINDOW if self.w3c: command = Command.W3C_MAXIMIZE_WINDOW self.execute(command, {"windowHandle": "current"}) @property def switch_to(self): return self._switch_to # Target Locators def switch_to_active_element(self): """ Deprecated use driver.switch_to.active_element """ warnings.warn("use driver.switch_to.active_element instead", DeprecationWarning) return self._switch_to.active_element def switch_to_window(self, window_name): """ Deprecated use driver.switch_to.window """ warnings.warn("use driver.switch_to.window instead", DeprecationWarning) self._switch_to.window(window_name) def switch_to_frame(self, frame_reference): """ Deprecated use driver.switch_to.frame """ warnings.warn("use driver.switch_to.frame instead", DeprecationWarning) self._switch_to.frame(frame_reference) def switch_to_default_content(self): """ Deprecated use driver.switch_to.default_content """ warnings.warn("use driver.switch_to.default_content instead", DeprecationWarning) self._switch_to.default_content() def switch_to_alert(self): """ Deprecated use driver.switch_to.alert """ warnings.warn("use driver.switch_to.alert instead", DeprecationWarning) return self._switch_to.alert # Navigation def back(self): """ Goes one step backward in the browser history. :Usage: driver.back() """ self.execute(Command.GO_BACK) def forward(self): """ Goes one step forward in the browser history. :Usage: driver.forward() """ self.execute(Command.GO_FORWARD) def refresh(self): """ Refreshes the current page. :Usage: driver.refresh() """ self.execute(Command.REFRESH) # Options def get_cookies(self): """ Returns a set of dictionaries, corresponding to cookies visible in the current session. :Usage: driver.get_cookies() """ return self.execute(Command.GET_ALL_COOKIES)['value'] def get_cookie(self, name): """ Get a single cookie by name. Returns the cookie if found, None if not. :Usage: driver.get_cookie('my_cookie') """ cookies = self.get_cookies() for cookie in cookies: if cookie['name'] == name: return cookie return None def delete_cookie(self, name): """ Deletes a single cookie with the given name. :Usage: driver.delete_cookie('my_cookie') """ self.execute(Command.DELETE_COOKIE, {'name': name}) def delete_all_cookies(self): """ Delete all cookies in the scope of the session. :Usage: driver.delete_all_cookies() """ self.execute(Command.DELETE_ALL_COOKIES) def add_cookie(self, cookie_dict): """ Adds a cookie to your current session. :Args: - cookie_dict: A dictionary object, with required keys - "name" and "value"; optional keys - "path", "domain", "secure", "expiry" Usage: driver.add_cookie({'name' : 'foo', 'value' : 'bar'}) driver.add_cookie({'name' : 'foo', 'value' : 'bar', 'path' : '/'}) driver.add_cookie({'name' : 'foo', 'value' : 'bar', 'path' : '/', 'secure':True}) """ self.execute(Command.ADD_COOKIE, {'cookie': cookie_dict}) # Timeouts def implicitly_wait(self, time_to_wait): """ Sets a sticky timeout to implicitly wait for an element to be found, or a command to complete. This method only needs to be called one time per session. To set the timeout for calls to execute_async_script, see set_script_timeout. :Args: - time_to_wait: Amount of time to wait (in seconds) :Usage: driver.implicitly_wait(30) """ if self.w3c: self.execute(Command.SET_TIMEOUTS, { 'implicit': int(float(time_to_wait) * 1000)}) else: self.execute(Command.IMPLICIT_WAIT, { 'ms': float(time_to_wait) * 1000}) def set_script_timeout(self, time_to_wait): """ Set the amount of time that the script should wait during an execute_async_script call before throwing an error. :Args: - time_to_wait: The amount of time to wait (in seconds) :Usage: driver.set_script_timeout(30) """ if self.w3c: self.execute(Command.SET_TIMEOUTS, { 'script': int(float(time_to_wait) * 1000)}) else: self.execute(Command.SET_SCRIPT_TIMEOUT, { 'ms': float(time_to_wait) * 1000}) def set_page_load_timeout(self, time_to_wait): """ Set the amount of time to wait for a page load to complete before throwing an error. :Args: - time_to_wait: The amount of time to wait :Usage: driver.set_page_load_timeout(30) """ try: self.execute(Command.SET_TIMEOUTS, { 'pageLoad': int(float(time_to_wait) * 1000)}) except WebDriverException: self.execute(Command.SET_TIMEOUTS, { 'ms': float(time_to_wait) * 1000, 'type': 'page load'}) def find_element(self, by=By.ID, value=None): """ 'Private' method used by the find_element_by_* methods. :Usage: Use the corresponding find_element_by_* instead of this. :rtype: WebElement """ if self.w3c: if by == By.ID: by = By.CSS_SELECTOR value = '[id="%s"]' % value elif by == By.TAG_NAME: by = By.CSS_SELECTOR elif by == By.CLASS_NAME: by = By.CSS_SELECTOR value = ".%s" % value elif by == By.NAME: by = By.CSS_SELECTOR value = '[name="%s"]' % value return self.execute(Command.FIND_ELEMENT, { 'using': by, 'value': value})['value'] def find_elements(self, by=By.ID, value=None): """ 'Private' method used by the find_elements_by_* methods. :Usage: Use the corresponding find_elements_by_* instead of this. :rtype: list of WebElement """ if self.w3c: if by == By.ID: by = By.CSS_SELECTOR value = '[id="%s"]' % value elif by == By.TAG_NAME: by = By.CSS_SELECTOR elif by == By.CLASS_NAME: by = By.CSS_SELECTOR value = ".%s" % value elif by == By.NAME: by = By.CSS_SELECTOR value = '[name="%s"]' % value return self.execute(Command.FIND_ELEMENTS, { 'using': by, 'value': value})['value'] @property def desired_capabilities(self): """ returns the drivers current desired capabilities being used """ return self.capabilities def get_screenshot_as_file(self, filename): """ Gets the screenshot of the current window. Returns False if there is any IOError, else returns True. Use full paths in your filename. :Args: - filename: The full path you wish to save your screenshot to. :Usage: driver.get_screenshot_as_file('/Screenshots/foo.png') """ png = self.get_screenshot_as_png() try: with open(filename, 'wb') as f: f.write(png) except IOError: return False finally: del png return True def save_screenshot(self, filename): """ Gets the screenshot of the current window. Returns False if there is any IOError, else returns True. Use full paths in your filename. :Args: - filename: The full path you wish to save your screenshot to. :Usage: driver.save_screenshot('/Screenshots/foo.png') """ return self.get_screenshot_as_file(filename) def get_screenshot_as_png(self): """ Gets the screenshot of the current window as a binary data. :Usage: driver.get_screenshot_as_png() """ return base64.b64decode(self.get_screenshot_as_base64().encode('ascii')) def get_screenshot_as_base64(self): """ Gets the screenshot of the current window as a base64 encoded string which is useful in embedded images in HTML. :Usage: driver.get_screenshot_as_base64() """ return self.execute(Command.SCREENSHOT)['value'] def set_window_size(self, width, height, windowHandle='current'): """ Sets the width and height of the current window. (window.resizeTo) :Args: - width: the width in pixels to set the window to - height: the height in pixels to set the window to :Usage: driver.set_window_size(800,600) """ command = Command.SET_WINDOW_SIZE if self.w3c: command = Command.W3C_SET_WINDOW_SIZE self.execute(command, { 'width': int(width), 'height': int(height), 'windowHandle': windowHandle}) def get_window_size(self, windowHandle='current'): """ Gets the width and height of the current window. :Usage: driver.get_window_size() """ command = Command.GET_WINDOW_SIZE if self.w3c: command = Command.W3C_GET_WINDOW_SIZE size = self.execute(command, {'windowHandle': windowHandle}) if size.get('value', None) is not None: return size['value'] else: return size def set_window_position(self, x, y, windowHandle='current'): """ Sets the x,y position of the current window. (window.moveTo) :Args: - x: the x-coordinate in pixels to set the window position - y: the y-coordinate in pixels to set the window position :Usage: driver.set_window_position(0,0) """ if self.w3c: return self.execute(Command.W3C_SET_WINDOW_POSITION, { 'x': int(x), 'y': int(y) }) else: self.execute(Command.SET_WINDOW_POSITION, { 'x': int(x), 'y': int(y), 'windowHandle': windowHandle }) def get_window_position(self, windowHandle='current'): """ Gets the x,y position of the current window. :Usage: driver.get_window_position() """ if self.w3c: return self.execute(Command.W3C_GET_WINDOW_POSITION)['value'] else: return self.execute(Command.GET_WINDOW_POSITION, { 'windowHandle': windowHandle})['value'] def get_window_rect(self): """ Gets the x, y coordinates of the window as well as height and width of the current window. :Usage: driver.get_window_rect() """ return self.execute(Command.GET_WINDOW_RECT)['value'] def set_window_rect(self, x=None, y=None, width=None, height=None): """ Sets the x, y coordinates of the window as well as height and width of the current window. :Usage: driver.set_window_rect(x=10, y=10) driver.set_window_rect(width=100, height=200) driver.set_window_rect(x=10, y=10, width=100, height=200) """ if (x is None and y is None) and (height is None and width is None): raise InvalidArgumentException("x and y or height and width need values") return self.execute(Command.SET_WINDOW_RECT, {"x": x, "y": y, "width": width, "height": height})['value'] @property def file_detector(self): return self._file_detector @file_detector.setter def file_detector(self, detector): """ Set the file detector to be used when sending keyboard input. By default, this is set to a file detector that does nothing. see FileDetector see LocalFileDetector see UselessFileDetector :Args: - detector: The detector to use. Must not be None. """ if detector is None: raise WebDriverException("You may not set a file detector that is null") if not isinstance(detector, FileDetector): raise WebDriverException("Detector has to be instance of FileDetector") self._file_detector = detector @property def orientation(self): """ Gets the current orientation of the device :Usage: orientation = driver.orientation """ return self.execute(Command.GET_SCREEN_ORIENTATION)['value'] @orientation.setter def orientation(self, value): """ Sets the current orientation of the device :Args: - value: orientation to set it to. :Usage: driver.orientation = 'landscape' """ allowed_values = ['LANDSCAPE', 'PORTRAIT'] if value.upper() in allowed_values: self.execute(Command.SET_SCREEN_ORIENTATION, {'orientation': value}) else: raise WebDriverException("You can only set the orientation to 'LANDSCAPE' and 'PORTRAIT'") @property def application_cache(self): """ Returns a ApplicationCache Object to interact with the browser app cache""" return ApplicationCache(self) @property def log_types(self): """ Gets a list of the available log types :Usage: driver.log_types """ return self.execute(Command.GET_AVAILABLE_LOG_TYPES)['value'] def get_log(self, log_type): """ Gets the log for a given log type :Args: - log_type: type of log that which will be returned :Usage: driver.get_log('browser') driver.get_log('driver') driver.get_log('client') driver.get_log('server') """ return self.execute(Command.GET_LOG, {'type': log_type})['value']
import logging import random import json import time import numpy from influxdb import InfluxDBClient from influxdb.exceptions import InfluxDBClientError, InfluxDBServerError from requests.exceptions import ConnectionError from ryu.lib import hub from nsodbc import nsodbc_factory, init_switch_db, init_flow_db def watcher_factory(conf): """Return a Gauge object based on type. Arguments: gauge_conf -- a GaugeConf object with the configuration for this valve. """ WATCHER_TYPES = { 'port_state': { 'text': GaugePortStateLogger, 'influx': GaugePortStateInfluxDBLogger, }, 'port_stats': { 'text': GaugePortStatsPoller, 'influx': GaugePortStatsInfluxDBPoller, }, 'flow_table': { 'text': GaugeFlowTablePoller, 'gaugedb': GaugeFlowTableDBLogger, }, } w_type = conf.type db_type = conf.db_type if w_type in WATCHER_TYPES and db_type in WATCHER_TYPES[w_type]: return WATCHER_TYPES[w_type][db_type] else: return None def _rcv_time(rcv_time): return time.strftime('%b %d %H:%M:%S', time.localtime(rcv_time)) class InfluxShipper(object): """Convenience class for shipping values to influx db. Inheritors must have a WatcherConf object as conf. """ conf = None def ship_points(self, points): try: client = InfluxDBClient( host=self.conf.influx_host, port=self.conf.influx_port, username=self.conf.influx_user, password=self.conf.influx_pwd, database=self.conf.influx_db, timeout=self.conf.influx_timeout) return client.write_points(points=points, time_precision='s') except (ConnectionError, InfluxDBClientError, InfluxDBServerError): return False def make_point(self, dp_name, port_name, rcv_time, stat_name, stat_val): port_tags = { 'dp_name': dp_name, 'port_name': port_name, } # InfluxDB has only one integer type, int64. We are logging OF # stats that are uint64. Use float64 to prevent an overflow. # q.v. https://docs.influxdata.com/influxdb/v1.2/write_protocols/line_protocol_reference/ point = { 'measurement': stat_name, 'tags': port_tags, 'time': int(rcv_time), # pylint: disable=no-member 'fields': {'value': numpy.float64(stat_val)}} return point class GaugeDBHelper(object): """ Helper class for gaugedb operations Inheritors must have a WatcherConf object as conf. """ conf = None db_update_counter = None conn_string = None switch_database = None flow_database = None conn = None def setup(self): self.conn_string = ( 'driver={0};server={1};port={2};uid={3};pwd={4}'.format( self.conf.driver, self.conf.db_ip, self.conf.db_port, self.conf.db_username, self.conf.db_password)) nsodbc = nsodbc_factory() self.conn = nsodbc.connect(self.conn_string) self.switch_database, exists = self.conn.create(self.conf.switches_doc) if not exists: init_switch_db(self.switch_database) self.flow_database, exists = self.conn.create(self.conf.flows_doc) if not exists: init_flow_db(self.flow_database) self.db_update_counter = int(self.conf.db_update_counter) def refresh_switchdb(self): self.conn.delete(self.conf.switches_doc) self.switch_database, _ = self.conn.create(self.conf.switches_doc) init_switch_db(self.switch_database) def refresh_flowdb(self): self.conn.delete(self.conf.flows_doc) self.flow_database, _ = self.conn.create(self.conf.flows_doc) init_flow_db(self.flow_database) class GaugePortStateLogger(object): def __init__(self, conf, logname): self.dp = conf.dp self.conf = conf self.logger = logging.getLogger( logname + '.{0}'.format(self.conf.type) ) def update(self, rcv_time, msg): rcv_time_str = _rcv_time(rcv_time) reason = msg.reason port_no = msg.desc.port_no ofp = msg.datapath.ofproto log_msg = None if reason == ofp.OFPPR_ADD: log_msg = 'port %s added' % port_no elif reason == ofp.OFPPR_DELETE: log_msg = 'port %s deleted' % port_no elif reason == ofp.OFPPR_MODIFY: link_down = (msg.desc.state & ofp.OFPPS_LINK_DOWN) if link_down: log_msg = 'port %s down' % port_no else: log_msg = 'port %s up' % port_no else: log_msg = 'port %s unknown state %s' % (port_no, reason) self.logger.info(log_msg) if self.conf.file: with open(self.conf.file, 'a') as logfile: logfile.write('\t'.join((rcv_time_str, log_msg)) + '\n') def start(self, ryudp): pass def stop(self): pass class GaugePortStateInfluxDBLogger(GaugePortStateLogger, InfluxShipper): """ > use faucet Using database faucet > precision rfc3339 > select * from port_state_reason where port_name = 'port1.0.1' order by time desc limit 10; name: port_state_reason ----------------------- time dp_name port_name value 2017-02-21T02:12:29Z windscale-faucet-1 port1.0.1 2 2017-02-21T02:12:25Z windscale-faucet-1 port1.0.1 2 2016-07-27T22:05:08Z windscale-faucet-1 port1.0.1 2 2016-05-25T04:33:00Z windscale-faucet-1 port1.0.1 2 2016-05-25T04:32:57Z windscale-faucet-1 port1.0.1 2 2016-05-25T04:31:21Z windscale-faucet-1 port1.0.1 2 2016-05-25T04:31:18Z windscale-faucet-1 port1.0.1 2 2016-05-25T04:27:07Z windscale-faucet-1 port1.0.1 2 2016-05-25T04:27:04Z windscale-faucet-1 port1.0.1 2 2016-05-25T04:24:53Z windscale-faucet-1 port1.0.1 2 """ def __init__(self, conf, logname): super(GaugePortStateInfluxDBLogger, self).__init__(conf, logname) def update(self, rcv_time, msg): super(GaugePortStateInfluxDBLogger, self).update(rcv_time, msg) reason = msg.reason port_no = msg.desc.port_no if port_no in self.dp.ports: port_name = self.dp.ports[port_no].name points = [ self.make_point( self.dp.name, port_name, rcv_time, 'port_state_reason', reason)] if not self.ship_points(points): self.logger.warning('error shipping port_state_reason points') class GaugePoller(object): """A ryu thread object for sending and receiving openflow stats requests. The thread runs in a loop sending a request, sleeping then checking a response was received before sending another request. The methods send_req, update and no_response should be implemented by subclasses. """ def __init__(self, conf, logname): self.dp = conf.dp self.conf = conf self.thread = None self.reply_pending = False self.interval = self.conf.interval self.logger = logging.getLogger( logname + '.{0}'.format(self.conf.type) ) self.ryudp = None def start(self, ryudp): self.ryudp = ryudp self.stop() self.thread = hub.spawn(self) def stop(self): if self.running(): hub.kill(self.thread) hub.joinall([self.thread]) self.thread = None def __call__(self): """Send request loop. Delays the initial request for a random interval to reduce load. Then sends a request to the datapath, waits the specified interval and checks that a response has been received in a loop.""" #TODO: this should use a deterministic method instead of random hub.sleep(random.randint(1, self.conf.interval)) while True: self.send_req() self.reply_pending = True hub.sleep(self.conf.interval) if self.reply_pending: self.no_response() def running(self): return self.thread is not None def send_req(self): """Send a stats request to a datapath.""" raise NotImplementedError def update(self, rcv_time, msg): """Handle the responses to requests. Called when a reply to a stats request sent by this object is received by the controller. It should acknowledge the receipt by setting self.reply_pending to false. Arguments: rcv_time -- the time the response was received msg -- the stats reply message """ raise NotImplementedError def no_response(self): """Called when a polling cycle passes without receiving a response.""" raise NotImplementedError def _stat_port_name(self, msg, stat): if stat.port_no == msg.datapath.ofproto.OFPP_CONTROLLER: return 'CONTROLLER' elif stat.port_no == msg.datapath.ofproto.OFPP_LOCAL: return 'LOCAL' elif stat.port_no in self.dp.ports: return self.dp.ports[stat.port_no].name else: self.logger.info('stats for unknown port %u', stat.port_no) return None def _format_port_stats(self, delim, stat): formatted_port_stats = [] for stat_name_list, stat_val in ( (('packets', 'out'), stat.tx_packets), (('packets', 'in'), stat.rx_packets), (('bytes', 'out'), stat.tx_bytes), (('bytes', 'in'), stat.rx_bytes), (('dropped', 'out'), stat.tx_dropped), (('dropped', 'in'), stat.rx_dropped), (('errors', 'in'), stat.rx_errors)): # For openvswitch, unsupported statistics are set to # all-1-bits (UINT64_MAX), skip reporting them if stat_val != 2**64-1: stat_name = delim.join(stat_name_list) formatted_port_stats.append((stat_name, stat_val)) return formatted_port_stats class GaugePortStatsPoller(GaugePoller): """Periodically sends a port stats request to the datapath and parses and outputs the response. """ def __init__(self, conf, logname): super(GaugePortStatsPoller, self).__init__(conf, logname) def send_req(self): ofp = self.ryudp.ofproto ofp_parser = self.ryudp.ofproto_parser req = ofp_parser.OFPPortStatsRequest(self.ryudp, 0, ofp.OFPP_ANY) self.ryudp.send_msg(req) def _update_line(self, rcv_time_str, stat_name, stat_val): return '\t'.join((rcv_time_str, stat_name, str(stat_val))) + '\n' def update(self, rcv_time, msg): # TODO: it may be worth while verifying this is the correct stats # response before doing this rcv_time_str = _rcv_time(rcv_time) self.reply_pending = False for stat in msg.body: port_name = self._stat_port_name(msg, stat) if port_name is not None: with open(self.conf.file, 'a') as logfile: log_lines = [] for stat_name, stat_val in self._format_port_stats('-', stat): dp_port_name = '-'.join(( self.dp.name, port_name, stat_name)) log_lines.append( self._update_line( rcv_time_str, dp_port_name, stat_val)) logfile.writelines(log_lines) def no_response(self): self.logger.info( 'port stats request timed out for %s', self.dp.name) class GaugePortStatsInfluxDBPoller(GaugePoller, InfluxShipper): """Periodically sends a port stats request to the datapath and parses and outputs the response. > use faucet Using database faucet > show measurements name: measurements ------------------ bytes_in bytes_out dropped_in dropped_out errors_in packets_in packets_out port_state_reason > precision rfc3339 > select * from packets_out where port_name = 'port1.0.1' order by time desc limit 10; name: packets_out ----------------- time dp_name port_name value 2017-03-06T05:21:42Z windscale-faucet-1 port1.0.1 76083431 2017-03-06T05:21:33Z windscale-faucet-1 port1.0.1 76081172 2017-03-06T05:21:22Z windscale-faucet-1 port1.0.1 76078727 2017-03-06T05:21:12Z windscale-faucet-1 port1.0.1 76076612 2017-03-06T05:21:02Z windscale-faucet-1 port1.0.1 76074546 2017-03-06T05:20:52Z windscale-faucet-1 port1.0.1 76072730 2017-03-06T05:20:42Z windscale-faucet-1 port1.0.1 76070528 2017-03-06T05:20:32Z windscale-faucet-1 port1.0.1 76068211 2017-03-06T05:20:22Z windscale-faucet-1 port1.0.1 76065982 2017-03-06T05:20:12Z windscale-faucet-1 port1.0.1 76063941 """ def __init__(self, conf, logname): super(GaugePortStatsInfluxDBPoller, self).__init__(conf, logname) def send_req(self): ofp = self.ryudp.ofproto ofp_parser = self.ryudp.ofproto_parser req = ofp_parser.OFPPortStatsRequest(self.ryudp, 0, ofp.OFPP_ANY) self.ryudp.send_msg(req) def update(self, rcv_time, msg): # TODO: it may be worth while verifying this is the correct stats # response before doing this self.reply_pending = False points = [] for stat in msg.body: port_name = self._stat_port_name(msg, stat) for stat_name, stat_val in self._format_port_stats('_', stat): points.append( self.make_point( self.dp.name, port_name, rcv_time, stat_name, stat_val)) if not self.ship_points(points): self.logger.warn('error shipping port_stats points') def no_response(self): self.logger.info( 'port stats request timed out for %s', self.dp.name) class GaugeFlowTablePoller(GaugePoller): """Periodically dumps the current datapath flow table as a yaml object. Includes a timestamp and a reference ($DATAPATHNAME-flowtables). The flow table is dumped as an OFFlowStatsReply message (in yaml format) that matches all flows. """ def __init__(self, conf, logname): super(GaugeFlowTablePoller, self).__init__(conf, logname) def send_req(self): ofp = self.ryudp.ofproto ofp_parser = self.ryudp.ofproto_parser match = ofp_parser.OFPMatch() req = ofp_parser.OFPFlowStatsRequest( self.ryudp, 0, ofp.OFPTT_ALL, ofp.OFPP_ANY, ofp.OFPG_ANY, 0, 0, match) self.ryudp.send_msg(req) def update(self, rcv_time, msg): # TODO: it may be worth while verifying this is the correct stats # response before doing this rcv_time_str = _rcv_time(rcv_time) self.reply_pending = False jsondict = msg.to_jsondict() with open(self.conf.file, 'a') as logfile: ref = '-'.join((self.dp.name, 'flowtables')) logfile.write( '\n'.join(( '---', 'time: %s' % rcv_time_str, 'ref: %s' % ref, 'msg: %s' % json.dumps(jsondict, indent=4)))) def no_response(self): self.logger.info( 'flow dump request timed out for %s', self.dp.name) class GaugeFlowTableDBLogger(GaugePoller, GaugeDBHelper): """Periodically dumps the current datapath flow table as a yaml object. Includes a timestamp and a reference ($DATAPATHNAME-flowtables). The flow table is dumped as an OFFlowStatsReply message (in yaml format) that matches all flows. """ def __init__(self, conf, logname): super(GaugeFlowTableDBLogger, self).__init__(conf, logname) self.setup() def send_req(self): ofp = self.ryudp.ofproto ofp_parser = self.ryudp.ofproto_parser match = ofp_parser.OFPMatch() req = ofp_parser.OFPFlowStatsRequest( self.ryudp, 0, ofp.OFPTT_ALL, ofp.OFPP_ANY, ofp.OFPG_ANY, 0, 0, match) self.ryudp.send_msg(req) def update(self, rcv_time, msg): # TODO: it may be worth while verifying this is the correct stats # response before doing this self.reply_pending = False jsondict = msg.to_jsondict() if self.db_update_counter == self.conf.db_update_counter: self.refresh_switchdb() switch_object = {'_id': str(hex(self.dp.dp_id)), 'data': {'flows': []}} self.switch_database.insert_update_doc(switch_object, 'data') try: rows = self.switch_database.get_docs( self.conf.views['switch_view'], key=str(hex(self.dp.dp_id))) switch = rows[0] except IndexError: switch = None if switch: self.refresh_flowdb() for f_msg in jsondict['OFPFlowStatsReply']['body']: flow_object = {'data': f_msg, 'tags': []} flow_id = self.flow_database.insert_update_doc( flow_object, '') switch.value['data']['flows'].append(flow_id) self.switch_database.insert_update_doc( switch.value, 'data') self.db_update_counter -= 1 if not self.db_update_counter: self.db_update_counter = self.conf.db_update_counter def no_response(self): self.logger.info( 'flow dump request timed out for %s', self.dp.name)
# # Copyright (c) 2008-2015 Citrix Systems, Inc. # # Licensed under the Apache License, Version 2.0 (the "License") # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # from nssrc.com.citrix.netscaler.nitro.resource.base.base_resource import base_resource from nssrc.com.citrix.netscaler.nitro.resource.base.base_resource import base_response from nssrc.com.citrix.netscaler.nitro.service.options import options from nssrc.com.citrix.netscaler.nitro.exception.nitro_exception import nitro_exception from nssrc.com.citrix.netscaler.nitro.util.nitro_util import nitro_util class authenticationpolicylabel_authenticationpolicy_binding(base_resource) : """ Binding class showing the authenticationpolicy that can be bound to authenticationpolicylabel. """ def __init__(self) : self._policyname = "" self._priority = 0 self._gotopriorityexpression = "" self._nextfactor = "" self._labelname = "" self.___count = 0 @property def priority(self) : """Specifies the priority of the policy. """ try : return self._priority except Exception as e: raise e @priority.setter def priority(self, priority) : """Specifies the priority of the policy. """ try : self._priority = priority except Exception as e: raise e @property def nextfactor(self) : """On success invoke label. """ try : return self._nextfactor except Exception as e: raise e @nextfactor.setter def nextfactor(self, nextfactor) : """On success invoke label. """ try : self._nextfactor = nextfactor except Exception as e: raise e @property def gotopriorityexpression(self) : """Expression specifying the priority of the next policy which will get evaluated if the current policy rule evaluates to TRUE. """ try : return self._gotopriorityexpression except Exception as e: raise e @gotopriorityexpression.setter def gotopriorityexpression(self, gotopriorityexpression) : """Expression specifying the priority of the next policy which will get evaluated if the current policy rule evaluates to TRUE. """ try : self._gotopriorityexpression = gotopriorityexpression except Exception as e: raise e @property def policyname(self) : """Name of the authentication policy to bind to the policy label. """ try : return self._policyname except Exception as e: raise e @policyname.setter def policyname(self, policyname) : """Name of the authentication policy to bind to the policy label. """ try : self._policyname = policyname except Exception as e: raise e @property def labelname(self) : """Name of the authentication policy label to which to bind the policy. """ try : return self._labelname except Exception as e: raise e @labelname.setter def labelname(self, labelname) : """Name of the authentication policy label to which to bind the policy. """ try : self._labelname = labelname except Exception as e: raise e def _get_nitro_response(self, service, response) : """ converts nitro response into object and returns the object array in case of get request. """ try : result = service.payload_formatter.string_to_resource(authenticationpolicylabel_authenticationpolicy_binding_response, response, self.__class__.__name__) if(result.errorcode != 0) : if (result.errorcode == 444) : service.clear_session(self) if result.severity : if (result.severity == "ERROR") : raise nitro_exception(result.errorcode, str(result.message), str(result.severity)) else : raise nitro_exception(result.errorcode, str(result.message), str(result.severity)) return result.authenticationpolicylabel_authenticationpolicy_binding except Exception as e : raise e def _get_object_name(self) : """ Returns the value of object identifier argument """ try : if (self.labelname) : return str(self.labelname) return None except Exception as e : raise e @classmethod def add(cls, client, resource) : try : if resource and type(resource) is not list : updateresource = authenticationpolicylabel_authenticationpolicy_binding() updateresource.labelname = resource.labelname updateresource.policyname = resource.policyname updateresource.gotopriorityexpression = resource.gotopriorityexpression updateresource.nextfactor = resource.nextfactor return updateresource.update_resource(client) else : if resource and len(resource) > 0 : updateresources = [authenticationpolicylabel_authenticationpolicy_binding() for _ in range(len(resource))] for i in range(len(resource)) : updateresources[i].labelname = resource[i].labelname updateresources[i].policyname = resource[i].policyname updateresources[i].gotopriorityexpression = resource[i].gotopriorityexpression updateresources[i].nextfactor = resource[i].nextfactor return cls.update_bulk_request(client, updateresources) except Exception as e : raise e @classmethod def delete(cls, client, resource) : try : if resource and type(resource) is not list : deleteresource = authenticationpolicylabel_authenticationpolicy_binding() deleteresource.labelname = resource.labelname deleteresource.policyname = resource.policyname return deleteresource.delete_resource(client) else : if resource and len(resource) > 0 : deleteresources = [authenticationpolicylabel_authenticationpolicy_binding() for _ in range(len(resource))] for i in range(len(resource)) : deleteresources[i].labelname = resource[i].labelname deleteresources[i].policyname = resource[i].policyname return cls.delete_bulk_request(client, deleteresources) except Exception as e : raise e @classmethod def get(cls, service, labelname) : """ Use this API to fetch authenticationpolicylabel_authenticationpolicy_binding resources. """ try : obj = authenticationpolicylabel_authenticationpolicy_binding() obj.labelname = labelname response = obj.get_resources(service) return response except Exception as e: raise e @classmethod def get_filtered(cls, service, labelname, filter_) : """ Use this API to fetch filtered set of authenticationpolicylabel_authenticationpolicy_binding resources. Filter string should be in JSON format.eg: "port:80,servicetype:HTTP". """ try : obj = authenticationpolicylabel_authenticationpolicy_binding() obj.labelname = labelname option_ = options() option_.filter = filter_ response = obj.getfiltered(service, option_) return response except Exception as e: raise e @classmethod def count(cls, service, labelname) : """ Use this API to count authenticationpolicylabel_authenticationpolicy_binding resources configued on NetScaler. """ try : obj = authenticationpolicylabel_authenticationpolicy_binding() obj.labelname = labelname option_ = options() option_.count = True response = obj.get_resources(service, option_) if response : return response[0].__dict__['___count'] return 0 except Exception as e: raise e @classmethod def count_filtered(cls, service, labelname, filter_) : """ Use this API to count the filtered set of authenticationpolicylabel_authenticationpolicy_binding resources. Filter string should be in JSON format.eg: "port:80,servicetype:HTTP". """ try : obj = authenticationpolicylabel_authenticationpolicy_binding() obj.labelname = labelname option_ = options() option_.count = True option_.filter = filter_ response = obj.getfiltered(service, option_) if response : return response[0].__dict__['___count'] return 0 except Exception as e: raise e class authenticationpolicylabel_authenticationpolicy_binding_response(base_response) : def __init__(self, length=1) : self.authenticationpolicylabel_authenticationpolicy_binding = [] self.errorcode = 0 self.message = "" self.severity = "" self.sessionid = "" self.authenticationpolicylabel_authenticationpolicy_binding = [authenticationpolicylabel_authenticationpolicy_binding() for _ in range(length)]
""" read_flashes filterer.filt_ev_fl brancher(events_flashes_receiever, other_analysis_targets=timeframe_targets) ev_fl_rx -> histogrammer energy calculation plotter timeframe_targets is ev_fl_rx -> bound_filt (on time) read_flashes -> filterer.filt_ev_fl -> length_for_these_flashes -> brancher -> timeframe_targets """ from __future__ import absolute_import from __future__ import print_function import os import matplotlib.pyplot as plt from matplotlib.ticker import MultipleLocator import numpy as np from numpy.lib.recfunctions import stack_arrays #, append_fields from lmatools import coordinateSystems from lmatools.flash_stats import length_from_area, volumetric_length_from_points, vertical_length_distribution, gen_flash_events from lmatools.grid.make_grids import time_edges, seconds_since_start_of_day from stormdrain.pipeline import coroutine, Branchpoint from stormdrain.support.matplotlib.formatters import SecDayFormatter def gen_fractal_length_for_flashes(events, flashes, D, b_s, alt_bins): """ Given events and flashes, calculate the fractal length as described in Bruning and MacGorman (2015). D is the fractal dimension, and b_s is the minimum box size. This function returns a dictionary with the 2D and 3D length as well as the convex hull data """ GeoSys = coordinateSystems.GeographicSystem() for fl_srcs, fl in gen_flash_events(events, flashes): if fl_srcs.shape[0] < 5: print("Skipping flash because source count less than 5 prevents calculation of volume") continue x,y,z = GeoSys.toECEF(fl_srcs['lon'], fl_srcs['lat'], fl_srcs['alt']) x,y,z = x/1000.0, y/1000.0, z/1000.0 # These calls will fail if the chi2 and stations criteria are too stringent and reduce the number of points below the minimum needed to construct the geometry (5, according to QHULL's error) simplex_centroids, simplex_volumes, volume, L_fractal, length_weighted = volumetric_length_from_points(x,y,z,D,b_s) simplex_lon,simplex_lat,simplex_alt = GeoSys.fromECEF(simplex_centroids[:,0]*1000.0, simplex_centroids[:,1]*1000.0, simplex_centroids[:,2]*1000.0) alt_bins, bin_total_src, bin_total_length = vertical_length_distribution(fl_srcs['alt']/1000.0, simplex_alt/1000.0, length_weighted, alt_bins, norm=True) L_capacitor = length_from_area(fl['area'],D,b_s) results = {'2D':{'length':L_capacitor}, '3D':{'length':L_fractal, 'volume':volume, 'subvolumes':{'centroids':simplex_centroids, 'volumes':simplex_volumes, 'lengths':length_weighted}, 'vertical_profile':{'alt_bins':alt_bins, 'src_density':bin_total_src, 'length_density':bin_total_length} }, 'flash':fl} yield results class FractalLengthProfileCalculator(object): def __init__(self, D, b_s, alt_bins): self.alt_bins = alt_bins self.D = D self.b_s = b_s def process_events_flashes(self, events, flashes): """ Given a table of flashes and their corresponding events table, calculate the Bruning and Thomas (2015, JGR) fractal length for each flash and produce a vertical profile of flash lengths for all flashes. Returns: per_flash_data: List of dictionaries containing the flash length and triangulation geometry data, including the flash volume. IC_totals: array of summary data for each profile; see dtype below. CG_totals: as above but for CGs only. These data are not normalized by time. totals_dtype = [ ('fractal_length_2D_hull', 'f8'), ('fractal_length_3D_hull', 'f8'), ('source_density_profile', 'f8', alt_bin_shape), ('length_density_profile', 'f8', alt_bin_shape), ] """ results = [result for result in gen_fractal_length_for_flashes( events, flashes, self.D, self.b_s, self.alt_bins) ] totals_CG = self._sum_profiles(results, is_CG_flag=True) totals_IC = self._sum_profiles(results, is_CG_flag=False) # IC_totals = self._process_totals(totals_IC, duration) # CG_totals = self._process_totals(totals_CG, duration) return results, totals_IC, totals_CG def normalize_profiles(self, totals_seq, durations): """ Given a sequence of results from repeated calls to self.process_events_flashes, return profiles normalized by durations (an array of durations for each interval corresponding to the items in total_seq). also return a source density returns: lengths_2D, lengths_3D, scaled_sources, L_profile_rate, max_L_bin total 2D and 3D lengths, source and 3D length profiles, and the maximum length per unit time per km altitude across all bins. """ totals = np.asarray(list(totals_seq)) L_profile_rate = np.squeeze(totals['length_density_profile'].T/durations) max_L_bin = L_profile_rate.max() src_profile_rate = totals['source_density_profile'].T/durations scaled_sources = np.squeeze(max_L_bin * src_profile_rate / src_profile_rate.max()) lengths_2D = np.squeeze(totals['fractal_length_2D_hull'])/durations lengths_3D = np.squeeze(totals['fractal_length_3D_hull'])/durations return lengths_2D, lengths_3D, scaled_sources, L_profile_rate, max_L_bin def _sum_profiles(self, results, is_CG_flag=False): alt_bins = self.alt_bins # one fewer density value (bin interval) than bin edges. alt_bin_shape = (alt_bins.shape[0]-1,) res_dtype = [ # this the dtype of the return value, i.e., the sums ('fractal_length_2D_hull', 'f8'), ('fractal_length_3D_hull', 'f8'), ('source_density_profile', 'f8', alt_bin_shape), ('length_density_profile', 'f8', alt_bin_shape), #, (alt_bins.shape[0]-1,) ,) ] if len(results) == 0: return np.zeros((1,), dtype=res_dtype) # Check to see if there are CG flags in the flash data table # just look at the first flash and assume the rest have it if one does. if 'CG' in results[0]['flash'].dtype.names: results_iter = (ri for ri in results if (ri['flash']['CG'] == is_CG_flag) ) else: results_iter = results # def get_res_iter(): res_iter = ( ( r['2D']['length'], r['3D']['length'], tuple(r['3D']['vertical_profile']['src_density']), tuple(r['3D']['vertical_profile']['length_density']) ) for r in results_iter ) # http://stackoverflow.com/questions/19201868/how-to-set-dtype-for-nested-numpy-ndarray each_result = np.fromiter(res_iter, dtype=res_dtype) total = np.empty((1,), dtype=res_dtype) for colname in total.dtype.names: total[colname] = each_result[colname].sum(axis=0) return total def make_time_series_plot(self, basedate, t_edges, lengths_2D, lengths_3D, scaled_sources, L_profile_rate, max_L_bin, label_t_every=3600., figsize=(7.5,10)): """ Arguments: t_edges: N+1 bin boundaries corresponding to the N time series values in the other arguments. Units: seconds since start of day. lengths_2D, lengths_3D, scaled_sources, L_profile_rate, max_L_bin: The values returned by normalize_profiles label_t_every: interval in seconds at which to label the time axis figsize: (width, height) of figure in inches (passed to matplotlib.figure) """ import matplotlib.pyplot as plt cmap = 'cubehelix_r' fig = plt.figure(figsize=figsize) ax_L = fig.add_subplot(311) ax_prof_L = fig.add_subplot(312) ax_prof_src = fig.add_subplot(313) min_L_bin = 0*max_L_bin starts, ends = t_edges[:-1], t_edges[1:] t_centers = (starts+ends)/2.0 src_pm = ax_prof_src.pcolormesh(t_edges, self.alt_bins, scaled_sources, cmap=cmap, vmin=min_L_bin, vmax=max_L_bin) src_pm.set_rasterized(True) cbar_src = fig.colorbar(src_pm, ax=ax_prof_src, orientation='horizontal') cbar_src.set_label('Source count per height interval per time\n(scaled to max length, km/km/min)') L_pm = ax_prof_L.pcolormesh(t_edges, self.alt_bins, L_profile_rate, cmap=cmap, vmin=min_L_bin, vmax=max_L_bin) L_pm.set_rasterized(True) cbar_L = fig.colorbar(L_pm, ax=ax_prof_L, orientation='horizontal') cbar_L.set_label('Length per height interval per time\n(km/km/min)') for ax in (ax_prof_src, ax_prof_L): ax.set_ylabel('Altitude (km)') ax_L.plot(t_centers, lengths_2D, label='2D Hull Area') ax_L.plot(t_centers, lengths_3D, label='3D Hull Volume') ax_L.legend() ax_L.set_ylabel('Fractal Length (km/min)') for ax in (ax_L, ax_prof_L, ax_prof_src): ax.xaxis.set_major_formatter(SecDayFormatter(basedate, ax.xaxis)) ax.set_xlabel('Time (UTC)') ax.xaxis.set_major_locator(MultipleLocator(label_t_every)) return fig def write_profile_data(self, basedate, t_edge, outfilebase, lengths_2D, lengths_3D, scaled_sources, L_profile_rate, max_L_bin, partition_kind='total'): """ Arguments: outfilebase: file base name, including directory. basedate: date against which t_edge is referenced. t_edge: N+1 bin boundaries corresponding to the N time series values in the other arguments. Units: seconds since start of day given by basedate. lengths_2D, lengths_3D, scaled_sources, L_profile_rate, max_L_bin: The values returned by normalize_profiles partition_kind: one of 'total', 'IC', 'CG', or another unique tag classifying this kind of profile. Appended to filename just before. The filename is calculated as [outfile_base]_[parition_kind].txt """ starts = t_edge[:-1] ends = t_edge[1:] header = "" header += "# LMA channel length distribution\n" header += "# Base date = " + basedate.isoformat() +"\n" header += "# Altitude_bins = " + str(self.alt_bins.tolist()) +"\n" header += "# starts, ends, lengths_2D, lengths_3D, [scaled_sources x Nbins], [L_profile_rate x Nbins]\n" text_dump = open(outfilebase+'_{0}.txt'.format(partition_kind), 'w') text_dump.write(header) # shape of scaled_sources and L_profile_rate are (N_alt_bins, N_times), and loop is over the first dimension, so take transpose so loop is over N_times for s0, e1, l2, l3, Sprof, Lprof in zip(starts, ends, lengths_2D, lengths_3D, scaled_sources.T, L_profile_rate.T): text_dump.write('{0}, {1}, {2}, {3}, {4}, {5}\n'.format( s0, e1, l2, l3, str(Sprof.tolist()), str(Lprof.tolist()) )) @coroutine def length_for_these_flashes(D, b_s, alt_bins, chi2=5.0, stations=5, target=None): """ Receive events, flashes arrays. Calculate flash length using fractal dimension D and step length b_s For each flash, will send out a dictionary with: capacitor_length: total length determined from flash area volumetric_length: total length determined from flash volume """ GeoSys = coordinateSystems.GeographicSystem() while True: pts, flashes = (yield) # pts == events areas = flashes['area'] capacitor_length = length_from_area(areas,D,b_s) for L_capacitor, fl in zip(capacitor_length, flashes): fl_id=fl['flash_id'] this_flash = (pts['flash_id']==fl_id) good = (pts['stations'] >= stations) & (pts['chi2']<=chi2) fl_srcs = pts[this_flash & good] if fl_srcs.shape[0] < 5: print(("Skipping flash because original source count reduced from {0}={4} to {1} for flash {2} at {3}".format( pts[this_flash].shape[0], fl_srcs.shape[0], fl_id, fl['start'], fl['n_points'] ))) continue x,y,z = GeoSys.toECEF(fl_srcs['lon'], fl_srcs['lat'], fl_srcs['alt']) x,y,z = x/1000.0, y/1000.0, z/1000.0 # These calls will fail if the chi2 and stations criteria are too stringent and reduce the number of points below the minimum needed to construct the geometry (5, according to QHULL's error) simplex_centroids, simplex_volumes, volume, L_fractal, length_weighted = volumetric_length_from_points(x,y,z,D,b_s) simplex_lon,simplex_lat,simplex_alt = GeoSys.fromECEF(simplex_centroids[:,0]*1000.0, simplex_centroids[:,1]*1000.0, simplex_centroids[:,2]*1000.0) alt_bins, bin_total_src, bin_total_length = vertical_length_distribution(fl_srcs['alt']/1000.0, simplex_alt/1000.0, length_weighted, alt_bins, norm=True) results = {'2D':{'length':L_capacitor}, '3D':{'length':L_fractal, 'subvolumes':{'centroids':simplex_centroids, 'volumes':simplex_volumes, 'lengths':length_weighted}, 'vertical_profile':{'alt_bins':alt_bins, 'src_density':bin_total_src, 'length_density':bin_total_length} }, 'flash':fl } if target is not None: target.send(results) @coroutine def in_time_range(t_min, t_max, target): results_in_range = [] try: while True: results = (yield) start = results['flash']['start'] if (start >= t_min) & (start < t_max): results_in_range.append(results) except GeneratorExit: target.send((t_min, t_max, results_in_range)) class StatResults(object): def __init__(self, alt_bins, basedate=None): self.basedate = basedate # t_start, t_end, flashes_in_range should be equal length # and mutually indexable because of how stats_rcvr builds them self.t_start = [] self.t_end = [] self.results_in_range = [] # it's imperative this be passed in so that _sum_profiles can # return an 0-filled array of the right shape if no flashes are in # any time interal. self.alt_bins = alt_bins def _sum_profiles(self, results, is_CG_flag=False): alt_bins = self.alt_bins # one fewer density value (bin interval) than bin edges. alt_bin_shape = (alt_bins.shape[0]-1,) res_dtype = [ # this the dtype of the return value, i.e., the sums ('fractal_length_2D_hull', 'f8'), ('fractal_length_3D_hull', 'f8'), ('source_density_profile', 'f8', alt_bin_shape), ('length_density_profile', 'f8', alt_bin_shape), #, (alt_bins.shape[0]-1,) ,) ] if len(results) == 0: return np.zeros((1,), dtype=res_dtype) # def get_res_iter(): res_iter = ( ( r['2D']['length'], r['3D']['length'], tuple(r['3D']['vertical_profile']['src_density']), tuple(r['3D']['vertical_profile']['length_density']) ) for r in results if (r['flash']['CG'] == is_CG_flag) ) # return res_iter # print res_dtype # for ri in get_res_iter(): # print ri # http://stackoverflow.com/questions/19201868/how-to-set-dtype-for-nested-numpy-ndarray each_result = np.fromiter(res_iter, dtype=res_dtype) # print each_result.shape, each_result.dtype total = np.empty((1,), dtype=res_dtype) for colname in total.dtype.names: print((colname, each_result[colname].shape)) total[colname] = each_result[colname].sum(axis=0) return total def total_all_profiles(self): """ List of profiles, summed over all flashes for all times. """ total_CG = np.asarray([self._sum_profiles(r, is_CG_flag=True) for r in self.results_in_range]) total_IC = np.asarray([self._sum_profiles(r, is_CG_flag=False) for r in self.results_in_range]) # total_all = total_IC + total_CG return total_IC, total_CG def process_totals(self, totals, durations): L_profile_rate = np.squeeze(totals['length_density_profile'].T/durations) max_L_bin = L_profile_rate.max() src_profile_rate = totals['source_density_profile'].T/durations scaled_sources = np.squeeze(max_L_bin * src_profile_rate / src_profile_rate.max()) lengths_2D = np.squeeze(totals['fractal_length_2D_hull'])/durations lengths_3D = np.squeeze(totals['fractal_length_3D_hull'])/durations return lengths_2D, lengths_3D, scaled_sources, L_profile_rate, max_L_bin def plot_stats(self, outfile): outfile_base, outfile_ext = os.path.splitext(outfile) n_frames = len(self.results_in_range) starts = np.asarray(self.t_start) ends = np.asarray(self.t_end) t_edges = np.asarray(self.t_start + self.t_end[-1:]) t_centers = (starts+ends)/2.0 alt_bins = self.alt_bins durations = (t_edges[1:] - t_edges[:-1])/60.0 #minutes totals_IC, totals_CG = self.total_all_profiles() # fig_total = make_plot(totals_total) IC_totals = process_totals(totals_IC, durations) CG_totals = process_totals(totals_CG, durations) def make_plot(lengths_2D, lengths_3D, scaled_sources, L_profile_rate, max_L_bin): import matplotlib.pyplot as plt cmap = 'cubehelix_r' fig = plt.figure(figsize=(7.5,10)) ax_L = fig.add_subplot(311) ax_prof_L = fig.add_subplot(312) ax_prof_src = fig.add_subplot(313) min_L_bin = 0*max_L_bin src_pm = ax_prof_src.pcolormesh(t_edges, alt_bins, scaled_sources, cmap=cmap, vmin=min_L_bin, vmax=max_L_bin) src_pm.set_rasterized(True) cbar_src = fig.colorbar(src_pm, ax=ax_prof_src, orientation='horizontal') cbar_src.set_label('Source count per height interval per time\n(scaled to max length, km/km/min)') L_pm = ax_prof_L.pcolormesh(t_edges, alt_bins, L_profile_rate, cmap=cmap, vmin=min_L_bin, vmax=max_L_bin) L_pm.set_rasterized(True) cbar_L = fig.colorbar(L_pm, ax=ax_prof_L, orientation='horizontal') cbar_L.set_label('Length per height interval per time\n(km/km/min)') for ax in (ax_prof_src, ax_prof_L): ax.set_ylabel('Altitude (km)') ax_L.plot(t_centers, lengths_2D, label='2D Hull Area') ax_L.plot(t_centers, lengths_3D, label='3D Hull Volume') ax_L.legend() ax_L.set_ylabel('Fractal Length (km/min)') for ax in (ax_L, ax_prof_L, ax_prof_src): ax.xaxis.set_major_formatter(SecDayFormatter(self.basedate, ax.xaxis)) ax.set_xlabel('Time (UTC)') ax.xaxis.set_major_locator(MultipleLocator(3600)) return fig fig_IC = make_plot(*IC_totals) fig_CG = make_plot(*CG_totals) # fig_total.savefig(outfile_base+'_total'+outfile_ext) # fig_total.clf() fig_IC.savefig(outfile_base+'_IC'+outfile_ext) fig_IC.clf() fig_CG.savefig(outfile_base+'_CG'+outfile_ext) fig_CG.clf() for diagnose in CG_totals: print((diagnose.dtype, diagnose.shape)) for partition_kind, kind_totals in zip (('IC', 'CG'), (IC_totals, CG_totals)): lengths_2D, lengths_3D, scaled_sources, L_profile_rate, max_L_bin = kind_totals header = "" header += "# LMA channel length distribution\n" header += "# Base date = " + self.basedate.isoformat() +"\n" header += "# Altitude_bins = " + str(alt_bins.tolist()) +"\n" header += "# starts, ends, lengths_2D, lengths_3D, [scaled_sources x Nbins], [L_profile_rate x Nbins]\n" text_dump = open(outfile_base+'_{0}.txt'.format(partition_kind), 'w') text_dump.write(header) # shape of scaled_sources and L_profile_rate are (N_alt_bins, N_times), and loop is over the first dimension, so take transpose so loop is over N_times for s0, e1, l2, l3, Sprof, Lprof in zip(starts, ends, lengths_2D, lengths_3D, scaled_sources.T, L_profile_rate.T): text_dump.write('{0}, {1}, {2}, {3}, {4}, {5}\n'.format( s0, e1, l2, l3, str(Sprof.tolist()), str(Lprof.tolist()) )) text_dump.close() @coroutine def timeframe_results_rcvr(self): t_min, t_max, results_in_range = (yield) self.t_start.append(t_min) self.t_end.append(t_max) self.results_in_range.append(results_in_range) def length_stats_for_intervals(t_start, t_end, dt, D, b_s, chi2=5.0, stations=5): """ """ t_edges, duration = time_edges(t_start, t_end, dt.total_seconds()) t_ref, t_edges_seconds = seconds_since_start_of_day(t_start, t_edges) n_frames = len(t_edges)-1 max_alt, d_alt = 20.0, 0.5 alt_bins = np.arange(0.0,max_alt+d_alt, d_alt) results_aggregator = StatResults(alt_bins, basedate=t_ref) all_frame_targets = [] for n in range(n_frames): t0, t1 = t_edges_seconds[n:n+2] statframer = results_aggregator.timeframe_results_rcvr() this_frame = in_time_range(t0, t1, statframer) all_frame_targets.append(this_frame) brancher = Branchpoint(all_frame_targets) ev_fl_rcvr = length_for_these_flashes(D, b_s, alt_bins, chi2=chi2, stations=stations, target=brancher.broadcast()) return ev_fl_rcvr, all_frame_targets, results_aggregator
import sys sys.path.append('..') import matplotlib matplotlib.use('Agg') import matplotlib.pyplot as plt import random import os from time import time import numpy as np from tqdm import tqdm from sklearn.externals import joblib import theano import theano.tensor as T from lib import activations from lib import inits from lib import updates from lib.vis import grayscale_grid_vis from lib.rng import py_rng, np_rng, t_rng from lib.theano_utils import floatX, sharedX from lib.data_utils import OneHot, shuffle, iter_data from lib.ops import batchnorm, conv_cond_concat, deconv, dropout from logz.rbm_hais_logz import ais_logZ from load import mnist_with_valid_set desc = 'rbm_adv' model_dir = 'models/%s' % desc samples_dir = 'samples/%s' % desc dir_list = [model_dir, samples_dir] for dir in dir_list: if not os.path.exists(dir): os.makedirs(dir) ''' load mnist data''' trX, vaX, teX, trY, vaY, teY = mnist_with_valid_set() trX, vaX, teX = trX/255., vaX/255., teX/255. ntrain, nvalid, ntest = len(trX), len(vaX), len(teX) print ntrain, nvalid, ntest def transform(X): return (floatX(X)).reshape(-1, nc, npx, npx) def inverse_transform(X): X = X.reshape(-1, npx, npx) return X lr = 3e-4 # learning rate for model b1 = .5 l2 = 1e-5 nc = 1 # # of channels in image ny = 10 # # of classes nbatch = 100 # # of examples in batch npx = 28 # # of pixels width/height of images nz = 100 # # of dim for Z ngfc = 1024 # # of gen units for fully connected layers ndfc = 1024 # # of discrim units for fully connected layers ngf = 64 # # of gen filters in first conv layer ndf = 64 # # of discrim filters in first conv layer nx = npx*npx*nc # # of dimensions in X niter = 100 # # of iter at starting learning rate niter_decay = 100 # # of iter to linearly decay learning rate to zero n_hidden = 10 n_observe = trX.shape[1] r_gifn = inits.Uniform(scale=4*np.sqrt(6./(n_observe+n_hidden))) r_bias_fn = inits.Constant() gB = r_gifn((n_observe, n_hidden), 'gB') gb = r_bias_fn((n_observe,), 'gb') gc = r_bias_fn((n_hidden,), 'gc') rbm_params = [gB, gb, gc] relu = activations.Rectify() sigmoid = activations.Sigmoid() tanh = activations.Tanh() lrelu = activations.LeakyRectify() bce = T.nnet.binary_crossentropy gifn = inits.Normal(scale=0.02) gw = gifn((nz, ngfc), 'gw') gw2 = gifn((ngfc, ngf*2*7*7), 'gw2') gw3 = gifn((ngf*2, ngf, 5, 5), 'gw3') gwx = gifn((ngf, nc, 5, 5), 'gwx') gen_params = [gw, gw2, gw3, gwx] def gen(Z, w, w2, w3, gwx): h = relu(batchnorm(T.dot(Z, w))) h2 = relu(batchnorm(T.dot(h, w2))) h2 = h2.reshape((h2.shape[0], ngf*2, 7, 7)) h3 = relu(batchnorm(deconv(h2, w3, subsample=(2, 2), border_mode=(2, 2)))) x = sigmoid(deconv(h3, gwx, subsample=(2, 2), border_mode=(2, 2))) return x def rbf_kernel(X): XY = T.dot(X, X.T) x2 = T.sum(X**2, axis=1).dimshuffle(0, 'x') X2e = T.repeat(x2, X.shape[0], axis=1) H = X2e + X2e.T - 2. * XY V = H.flatten() # median distance h = T.switch(T.eq((V.shape[0] % 2), 0), # if even vector T.mean(T.sort(V)[ ((V.shape[0] // 2) - 1) : ((V.shape[0] // 2) + 1) ]), # if odd vector T.sort(V)[V.shape[0] // 2]) h = T.sqrt(.5 * h / T.log(H.shape[0].astype('float32') + 1.)) # compute the rbf kernel kxy = T.exp(-H / (h ** 2) / 2.0) dxkxy = -T.dot(kxy, X) sumkxy = T.sum(kxy, axis=1).dimshuffle(0, 'x') dxkxy = T.add(dxkxy, T.mul(X, sumkxy)) / (h ** 2) return kxy, dxkxy def discrim(X): return logp_rbm(X) def logp_rbm(X): y = T.dot(X, gB) + gc y_max = T.max(T.maximum(y, -y), axis=1).dimshuffle(0,'x') log_sum = y_max + T.log(T.exp(y - y_max) + T.exp(-y - y_max)) # apply the log sum trick log_sum = T.sum(log_sum, axis=1) logp = T.dot(X, gb.dimshuffle(0, 'x')).flatten() - .5 * T.sum(X*X, axis=1) + log_sum return logp def dlogp_rbm(X): y = T.dot(X, gB) + gc phi = 1. - 2. / (1+T.exp(2*y)) score = gb - X + T.dot(phi, gB.T) return score def svgd_gradient(X): grad = dlogp_rbm(X) kxy, dxkxy = rbf_kernel(X) svgd_grad = (T.dot(kxy, grad) + dxkxy) / T.sum(kxy, axis=1).dimshuffle(0, 'x') return grad, svgd_grad X = T.matrix() X0 = T.matrix() # samples # vgd gradient deltaX = T.tensor4() # random noise Z = T.matrix() f_real = discrim(X) # data f_gen = discrim(X0) # vgd particles cost_data = -1 * f_real.mean() cost_vgd = -1 * f_gen.mean() gX = gen(Z, *gen_params) g_cost = -1 * T.sum(T.sum(T.flatten(gX, 2) * T.flatten(deltaX, 2), axis=1)) #update generate models by minimize reconstruct mse balance_weight = sharedX(1.) d_cost = cost_data - balance_weight * cost_vgd # for discriminative model, minimize cost lrt = sharedX(lr) d_updater = updates.Adam(lr=lrt, b1=b1, regularizer=updates.Regularizer(l2=l2)) g_updater = updates.Adam(lr=lrt, b1=b1, regularizer=updates.Regularizer(l2=l2)) d_updates = d_updater(rbm_params, d_cost) g_updates = g_updater(gen_params, g_cost) print 'COMPILING' t = time() _train_d = theano.function([X, X0], d_cost, updates=d_updates) _train_g = theano.function([Z, deltaX], g_cost, updates=g_updates) _gen = theano.function([Z], gen(Z, *gen_params)) _logp_rbm = theano.function([X], logp_rbm(X)) _svgd_gradient = theano.function([X], svgd_gradient(X)) print '%.2f seconds to compile theano functions'%(time()-t) nbatch = 100 n_iter = 20 n_updates = 0 sample_zmb = floatX(np_rng.uniform(-1., 1., size=(200, nz))) for iter in tqdm(range(1, n_iter+1)): trX = shuffle(trX) for imb in iter_data(trX, size=nbatch): imb = floatX(imb) zmb = floatX(np_rng.uniform(-1., 1., size=(nbatch, nz))) # generate samples samples = floatX(_gen(zmb).reshape(-1, nx)) grad, svgd_grad = _svgd_gradient(samples) _train_g(zmb, floatX(svgd_grad.reshape(-1, nc, npx, npx))) # generator _train_d(imb, floatX(samples)) # discriminator n_updates += 1 if iter % 50 == 0: joblib.dump([p.get_value() for p in gen_params], 'models/%s/%d_gen_params.jl'%(desc, iter)) joblib.dump([p.get_value() for p in rbm_params], 'models/%s/%d_rbm_params.jl'%(desc, iter)) samples = np.asarray(_gen(sample_zmb)) grayscale_grid_vis(inverse_transform(samples), (10, 20), '%s/%d.png' % (samples_dir, iter)) # adversarial logz_approx = ais_logZ(gB.get_value(), gb.get_value(), gc.get_value()) ll_train = _logp_rbm(floatX(trX)) - logz_approx ll_test = _logp_rbm(floatX(teX)) - logz_approx print iter, 'train', np.mean(ll_train), 'test', ll_test.mean(), 'logz', logz_approx #np.savez('adv_ll_train.npz', ll=ll_train) #np.savez('adv_ll_test.npz', ll=ll_test) print 'DONE!'
import Tkinter from Tkinter import* def mod(a,b): return ( a % b) def StandardKnot(): global m knot = [] L = len(points) - 2 if L <= m -2 : print 'make more points than m' return [] for i in range(m - 1): knot.append(0) for i in range(L - m + 3): knot.append(i) for i in range(m): knot.append(L - m + 3) return knot def Nopen(k,m,t,knot): if m <= 1: if t < knot[k] or t >= knot[k + 1]: Sum = 0.0 else: Sum = 1.0 else: d = knot[k+m-1]-knot[k] if d <> 0: Sum = (t-knot[k])*Nopen(k,m-1,t,knot)/d else: Sum = 0.0 d = knot[k+m] - knot[k+1] if d <> 0: Sum = Sum + (knot[k+m] - t)*Nopen(k + 1,m-1,t,knot)/d return Sum def Nclosed(k,m,t,knot): L = len(points) z = mod(t-k,L) if z <= 0: z += L return Nopen(0,m,z,knot) def P(t,knot,Ncycle): L = len(points) SumX = 0.0 SumY = 0.0 for k in range(L): n = Ncycle(k,m,t,knot) SumX = SumX + n * points[k][0] SumY = SumY + n * points[k][1] return [SumX,SumY] def plot(): global m global points if lOpen: knot = StandardKnot() if len(knot) == 0: return print knot print points x = points[0][0] y = points[0][1] t = 0.0 step = 0.1 L = len(points) while t <= L - m + 1: p = P(t,knot,Nopen) C.create_line(x, y, p[0], p[1]) x = p[0] y = p[1] t = t + step else: L = len(points) knot = range(L) print knot print points p = P(0.0,knot,Nclosed) x = p[0] y = p[1] step = 0.1 t = step L = len(points) while t <= L: p = P(t,knot,Nclosed) C.create_line(x, y, p[0], p[1]) x = p[0] y = p[1] t = t + step def Spaceout(): global points newpoints = [] L = len(points) if lOpen: newpoints.append(points[0]) knot = StandardKnot() if len(knot) == 0: return for t in range( 1, L - m + 2): p = P(t - 0.5,knot,Nopen) x = points[t][0] - p[0] y = points[t][1] - p[1] newpoints.append([points[t][0] + x,points[t][1] + y]) newpoints.append(points[-1]) else: knot = range(L) for t in range(L): p = P(mod(t + 1.5,L),knot,Nclosed) x = points[t][0] - p[0] y = points[t][1] - p[1] newpoints.append([points[t][0] + x,points[t][1] + y]) points = newpoints plot() def do_mouse(eventname): def mouse_binding(event): global points if eventname == "Button-1": x = event.x y = event.y print x, y if x > 50 and y > 50: points.append([x,y]) C.create_oval(x - 6,y - 6, x + 6, y + 6) C.create_text(x, y, text = '%d' %(len(points))) fram.bind_all( '<%s>' %eventname, mouse_binding) def wipe(): global points C.delete( ALL) points = [] def fetch(): global m m = mEntry.get() m = int(m) print 'm is now %d' %m def CycleClosed(i): global lOpen lOpen = i if lOpen: print 'Cycle is open' else: print 'Cycle is closed' def Blending(): global points L = len(points) if L <= m: print 'Make some more points first!' return if lOpen: knot = StandardKnot() if len(knot) == 0: return else: knot = range(L) print knot x0 = ScreenW * 0.2 y0 = ScreenH * 0.2 scaley = ScreenH * 0.7 scalex = ScreenW / L * 0.7 for k in knot: x1 = k * scalex + x0 y1 = ScreenH - y0 C.create_line(x1, y1, x1, y1 + 20) for k in range(L): t = 0.0 step = 0.1 x1 = x0 y1 = y0 if lOpen: z = L - m + 1 else: z = L while t <= z: if lOpen: p = Nopen(k,m,t,knot) else: p = Nopen(0,m,mod(t-k,L),knot) x2 = t * scalex + x0 y2 = ScreenH - p * scaley - y0 C.create_line(x1, y1, x2, y2) x1 = x2 y1 = y2 t = t + step m = 3 lOpen = True ScreenH = 600 ScreenW = 800 root = Tk() root.title('Left click to add some points, then click [Plot] to draw the b-spline.') fram = Frame(root) rad1 = Radiobutton(fram, text = 'Open',value=1,command=(lambda : CycleClosed(True))) rad1.pack(side = LEFT) rad2 = Radiobutton(fram, text = 'Closed',value=0,command=(lambda : CycleClosed(False))) rad2.pack(side = LEFT) rad1.select() Label(fram, text = 'M:').pack(side = LEFT,padx = 20) mEntry = Entry(fram) mEntry.insert(0,m) mEntry.focus() mEntry.bind('<Return>', (lambda event: fetch())) mEntry.pack(side = LEFT) butt1 = Button(fram, text = ' Plot ',command = plot) butt1.pack(side = LEFT) butt3 = Button(fram, text = ' Wipe ',command = wipe) butt3.pack(side = LEFT) butt4 = Button(fram, text = 'Blending',command = Blending) butt4.pack(side = LEFT) butt5 = Button(fram, text = 'Spaceout',command = Spaceout) butt5.pack(side = LEFT) fram.pack(side = TOP) C = Canvas(root, width = ScreenW, height = ScreenH) C.pack() do_mouse('Button-1') do_mouse('Button-3') points = [] root.mainloop()
"""Module with main classes related to Authentication.""" import datetime import getpass import hashlib import logging import time from functools import wraps from http import HTTPStatus import jwt from flask import jsonify, request from kytos.core.config import KytosConfig from kytos.core.events import KytosEvent __all__ = ['authenticated'] LOG = logging.getLogger(__name__) def authenticated(func): """Handle tokens from requests.""" @wraps(func) def wrapper(*args, **kwargs): """Verify the requires of token.""" try: content = request.headers.get("Authorization") if content is None: raise ValueError("The attribute 'content' has an invalid " "value 'None'.") token = content.split("Bearer ")[1] jwt.decode(token, key=Auth.get_jwt_secret()) except ( ValueError, IndexError, jwt.ExpiredSignature, jwt.exceptions.DecodeError, ) as exc: msg = f"Token not sent or expired: {exc}" return jsonify({"error": msg}), HTTPStatus.UNAUTHORIZED.value return func(*args, **kwargs) return wrapper class Auth: """Module used to provide Kytos authentication routes.""" def __init__(self, controller): """Init method of Auth class takes the parameters below. Args: controller(kytos.core.controller): A Controller instance. """ self.controller = controller self.namespace = "kytos.core.auth.users" self.token_expiration_minutes = self.get_token_expiration() if self.controller.options.create_superuser is True: self._create_superuser() @staticmethod def get_token_expiration(): """Return token expiration time in minutes defined in kytos conf.""" options = KytosConfig().options['daemon'] return options.token_expiration_minutes @classmethod def get_jwt_secret(cls): """Return JWT secret defined in kytos conf.""" options = KytosConfig().options['daemon'] return options.jwt_secret @classmethod def _generate_token(cls, username, time_exp): """Generate a jwt token.""" return jwt.encode( { 'username': username, 'iss': "Kytos NApps Server", 'exp': time_exp, }, Auth.get_jwt_secret(), algorithm='HS256', ) def _create_superuser(self): """Create a superuser using Storehouse.""" def _create_superuser_callback(_event, box, error): if error: LOG.error('Superuser was not created. Error: %s', error) if box: LOG.info("Superuser successfully created") def get_username(): return input("Username: ") def get_email(): return input("Email: ") username = get_username() email = get_email() while True: password = getpass.getpass() re_password = getpass.getpass('Retype password: ') if password == re_password: break print('Passwords do not match. Try again') user = { "username": username, "email": email, "password": hashlib.sha512(password.encode()).hexdigest(), } content = { "namespace": self.namespace, "box_id": user["username"], "data": user, "callback": _create_superuser_callback, } event = KytosEvent(name="kytos.storehouse.create", content=content) self.controller.buffers.app.put(event) def register_core_auth_services(self): """ Register /kytos/core/ services over authentication. It registers create, authenticate, list all, list specific, delete and update users. """ self.controller.api_server.register_core_endpoint( "auth/login/", self._authenticate_user ) self.controller.api_server.register_core_endpoint( "auth/users/", self._list_users ) self.controller.api_server.register_core_endpoint( "auth/users/<uid>", self._list_user ) self.controller.api_server.register_core_endpoint( "auth/users/", self._create_user, methods=["POST"] ) self.controller.api_server.register_core_endpoint( "auth/users/<uid>", self._delete_user, methods=["DELETE"] ) self.controller.api_server.register_core_endpoint( "auth/users/<uid>", self._update_user, methods=["PATCH"] ) def _authenticate_user(self): """Authenticate a user using Storehouse.""" username = request.authorization["username"] password = request.authorization["password"].encode() try: user = self._find_user(username)[0].get("data") if user.get("password") != hashlib.sha512(password).hexdigest(): raise KeyError time_exp = datetime.datetime.utcnow() + datetime.timedelta( minutes=self.token_expiration_minutes ) token = self._generate_token(username, time_exp) return {"token": token.decode()}, HTTPStatus.OK.value except (AttributeError, KeyError) as exc: result = f"Incorrect username or password: {exc}" return result, HTTPStatus.UNAUTHORIZED.value def _find_user(self, uid): """Find a specific user using Storehouse.""" response = {} def _find_user_callback(_event, box, error): nonlocal response if not box: response = { "answer": f'User with uid {uid} not found', "code": HTTPStatus.NOT_FOUND.value } elif error: response = { "answer": "User data cannot be shown", "code": HTTPStatus.INTERNAL_SERVER_ERROR.value, } else: response = { "answer": {"data": box.data}, "code": HTTPStatus.OK.value, } content = { "box_id": uid, "namespace": self.namespace, "callback": _find_user_callback, } event = KytosEvent(name="kytos.storehouse.retrieve", content=content) self.controller.buffers.app.put(event) while True: time.sleep(0.1) if response: break return response["answer"], response["code"] @authenticated def _list_user(self, uid): """List a specific user using Storehouse.""" answer, code = self._find_user(uid) if code == HTTPStatus.OK.value: del answer['data']['password'] return answer, code @authenticated def _list_users(self): """List all users using Storehouse.""" response = {} def _list_users_callback(_event, boxes, error): nonlocal response if error: response = { "answer": "Users cannot be listed", "code": HTTPStatus.INTERNAL_SERVER_ERROR.value, } else: response = { "answer": {"users": boxes}, "code": HTTPStatus.OK.value, } content = { "namespace": self.namespace, "callback": _list_users_callback, } event = KytosEvent(name="kytos.storehouse.list", content=content) self.controller.buffers.app.put(event) while True: time.sleep(0.1) if response: break return response["answer"], response["code"] @authenticated def _create_user(self): """Save a user using Storehouse.""" response = {} def _create_user_callback(_event, box, error): nonlocal response if not box: response = { "answer": f'User already exists', "code": HTTPStatus.CONFLICT.value, } elif error: response = { "answer": "User has not been created", "code": HTTPStatus.INTERNAL_SERVER_ERROR.value, } else: response = { "answer": "User successfully created", "code": HTTPStatus.OK.value, } req = request.json password = req["password"].encode() data = { "username": req["username"], "email": req["email"], "password": hashlib.sha512(password).hexdigest(), } content = { "namespace": self.namespace, "box_id": data["username"], "data": data, "callback": _create_user_callback, } event = KytosEvent(name="kytos.storehouse.create", content=content) self.controller.buffers.app.put(event) while True: time.sleep(0.1) if response: break return response["answer"], response["code"] @authenticated def _delete_user(self, uid): """Delete a user using Storehouse.""" response = {} def _delete_user_callback(_event, box, error): nonlocal response if not box: response = { "answer": f'User with uid {uid} not found', "code": HTTPStatus.NOT_FOUND.value } elif error: response = { "answer": "User has not been deleted", "code": HTTPStatus.INTERNAL_SERVER_ERROR.value, } else: response = { "answer": "User successfully deleted", "code": HTTPStatus.OK.value, } content = { "box_id": uid, "namespace": self.namespace, "callback": _delete_user_callback, } event = KytosEvent(name="kytos.storehouse.delete", content=content) self.controller.buffers.app.put(event) while True: time.sleep(0.1) if response: break return response["answer"], response["code"] @authenticated def _update_user(self, uid): """Update user data using Storehouse.""" response = {} def _update_user_callback(_event, box, error): nonlocal response if not box: response = { "answer": f'User with uid {uid} not found', "code": HTTPStatus.NOT_FOUND.value } elif error: response = { "answer": "User has not been updated", "code": HTTPStatus.INTERNAL_SERVER_ERROR.value, } else: response = { "answer": "User successfully updated", "code": HTTPStatus.OK.value, } req = request.json allowed = ["username", "email", "password"] data = {} for key, value in req.items(): if key in allowed: data[key] = value content = { "namespace": self.namespace, "box_id": uid, "data": data, "callback": _update_user_callback, } event = KytosEvent(name="kytos.storehouse.update", content=content) self.controller.buffers.app.put(event) while True: time.sleep(0.1) if response: break return response["answer"], response["code"]
# This file is part of Indico. # Copyright (C) 2002 - 2021 CERN # # Indico is free software; you can redistribute it and/or # modify it under the terms of the MIT License; see the # LICENSE file for more details. from collections import defaultdict from operator import itemgetter from flask import flash, jsonify, redirect, request, session from sqlalchemy import func, inspect from sqlalchemy.orm import joinedload, lazyload from werkzeug.exceptions import BadRequest, Forbidden, NotFound from indico.core.db import db from indico.core.logger import Logger from indico.modules.events.controllers.base import RHDisplayEventBase from indico.modules.events.management.controllers import RHManageEventBase from indico.modules.vc.exceptions import VCRoomError, VCRoomNotFoundError from indico.modules.vc.forms import VCRoomListFilterForm from indico.modules.vc.models.vc_rooms import VCRoom, VCRoomEventAssociation, VCRoomLinkType, VCRoomStatus from indico.modules.vc.notifications import notify_created from indico.modules.vc.util import find_event_vc_rooms, get_managed_vc_plugins, get_vc_plugins, resolve_title from indico.modules.vc.views import WPVCEventPage, WPVCManageEvent, WPVCService from indico.util.date_time import as_utc, get_day_end, get_day_start, now_utc from indico.util.i18n import _ from indico.util.iterables import group_list from indico.web.flask.util import url_for from indico.web.forms.base import FormDefaults from indico.web.rh import RHProtected from indico.web.util import _pop_injected_js, jsonify_data, jsonify_template def process_vc_room_association(plugin, event, vc_room, form, event_vc_room=None, allow_same_room=False): # disable autoflush, so that the new event_vc_room does not influence the result with db.session.no_autoflush: if event_vc_room is None: event_vc_room = VCRoomEventAssociation() plugin.update_data_association(event, vc_room, event_vc_room, form.data) existing = set() if event_vc_room.link_object is not None: # check whether there is a room-event association already present # for the given event, room and plugin q = (VCRoomEventAssociation.query .filter(VCRoomEventAssociation.event == event, VCRoomEventAssociation.link_object == event_vc_room.link_object) .join(VCRoom)) if allow_same_room: q = q.filter(VCRoom.id != vc_room.id) existing = {x.vc_room for x in q} if event_vc_room.link_type != VCRoomLinkType.event and existing: db.session.rollback() flash(_("There is already a VC room attached to '{link_object_title}'.").format( link_object_title=resolve_title(event_vc_room.link_object)), 'error') return None elif event_vc_room.link_type == VCRoomLinkType.event and vc_room in existing: db.session.rollback() flash(_("This {plugin_name} room is already attached to the event.").format(plugin_name=plugin.friendly_name), 'error') return None else: return event_vc_room class RHVCManageEventBase(RHManageEventBase): pass class RHEventVCRoomMixin: normalize_url_spec = { 'locators': { lambda self: self.event_vc_room } } def _process_args(self): self.event_vc_room = VCRoomEventAssociation.get_or_404(request.view_args['event_vc_room_id']) self.vc_room = self.event_vc_room.vc_room class RHVCManageEvent(RHVCManageEventBase): """List the available videoconference rooms.""" def _process(self): room_event_assocs = VCRoomEventAssociation.find_for_event(self.event, include_hidden=True, include_deleted=True).all() event_vc_rooms = [event_vc_room for event_vc_room in room_event_assocs if event_vc_room.vc_room.plugin] return WPVCManageEvent.render_template('manage_event.html', self.event, event_vc_rooms=event_vc_rooms, plugins=list(get_vc_plugins().values())) class RHVCManageEventSelectService(RHVCManageEventBase): """ List available videoconference plugins to create a new videoconference room. """ def _process(self): action = request.args.get('vc_room_action', '.manage_vc_rooms_create') attach = request.args.get('attach', '') return jsonify_template('vc/manage_event_select.html', event=self.event, vc_room_action=action, plugins=list(get_vc_plugins().values()), attach=attach) class RHVCManageEventCreateBase(RHVCManageEventBase): def _process_args(self): RHVCManageEventBase._process_args(self) try: self.plugin = get_vc_plugins()[request.view_args['service']] except KeyError: raise NotFound class RHVCManageEventCreate(RHVCManageEventCreateBase): """Load the form for the selected VC plugin.""" def _process(self): if not self.plugin.can_manage_vc_rooms(session.user, self.event): flash(_('You are not allowed to create {plugin_name} rooms for this event.').format( plugin_name=self.plugin.friendly_name), 'error') raise Forbidden form = self.plugin.create_form(event=self.event) if form.validate_on_submit(): vc_room = VCRoom(created_by_user=session.user) vc_room.type = self.plugin.service_name vc_room.status = VCRoomStatus.created event_vc_room = process_vc_room_association(self.plugin, self.event, vc_room, form) if not event_vc_room: return jsonify_data(flash=False) with db.session.no_autoflush: self.plugin.update_data_vc_room(vc_room, form.data, is_new=True) try: # avoid flushing the incomplete vc room to the database with db.session.no_autoflush: self.plugin.create_room(vc_room, self.event) notify_created(self.plugin, vc_room, event_vc_room, self.event, session.user) except VCRoomError as err: if err.field is None: raise field = getattr(form, err.field) field.errors.append(str(err)) db.session.rollback() # otherwise the incomplete vc room would be added to the db! else: db.session.add(vc_room) flash(_("{plugin_name} room '{room.name}' created").format( plugin_name=self.plugin.friendly_name, room=vc_room), 'success') return jsonify_data(flash=False) form_html = self.plugin.render_form(plugin=self.plugin, event=self.event, form=form, skip_fields=form.skip_fields | {'name'}) return jsonify(html=form_html, js=_pop_injected_js()) class RHVCSystemEventBase(RHEventVCRoomMixin, RHVCManageEventBase): def _process_args(self): RHVCManageEventBase._process_args(self) RHEventVCRoomMixin._process_args(self) if self.vc_room.type != request.view_args['service']: raise NotFound self.plugin = self.vc_room.plugin class RHVCManageEventModify(RHVCSystemEventBase): """Modify an existing VC room.""" def _process(self): if not self.plugin.can_manage_vc_rooms(session.user, self.event): flash(_('You are not allowed to modify {} rooms for this event.').format(self.plugin.friendly_name), 'error') raise Forbidden form = self.plugin.create_form(self.event, existing_vc_room=self.vc_room, existing_event_vc_room=self.event_vc_room) if form.validate_on_submit(): self.plugin.update_data_vc_room(self.vc_room, form.data) event_vc_room = process_vc_room_association( self.plugin, self.event, self.vc_room, form, event_vc_room=self.event_vc_room, allow_same_room=True) if not event_vc_room: return jsonify_data(flash=False) self.vc_room.modified_dt = now_utc() try: self.plugin.update_room(self.vc_room, self.event) except VCRoomNotFoundError as err: Logger.get('modules.vc').warning("VC room %r not found. Setting it as deleted.", self.vc_room) self.vc_room.status = VCRoomStatus.deleted flash(str(err), 'error') return jsonify_data(flash=False) except VCRoomError as err: if err.field is None: raise field = getattr(form, err.field) field.errors.append(str(err)) db.session.rollback() else: # TODO # notify_modified(self.vc_room, self.event, session.user) flash(_("{plugin_name} room '{room.name}' updated").format( plugin_name=self.plugin.friendly_name, room=self.vc_room), 'success') return jsonify_data(flash=False) form_html = self.plugin.render_form(plugin=self.plugin, event=self.event, form=form, existing_vc_room=self.vc_room, skip_fields=form.skip_fields | {'name'}) return jsonify(html=form_html, js=_pop_injected_js()) class RHVCManageEventRefresh(RHVCSystemEventBase): """Refresh an existing VC room, fetching information from the VC system.""" def _process(self): if not self.plugin.can_manage_vc_rooms(session.user, self.event): flash(_('You are not allowed to refresh {plugin_name} rooms for this event.').format( plugin_name=self.plugin.friendly_name), 'error') raise Forbidden Logger.get('modules.vc').info("Refreshing VC room %r from event %r", self.vc_room, self.event) try: self.plugin.refresh_room(self.vc_room, self.event) except VCRoomNotFoundError as err: Logger.get('modules.vc').warning("VC room %r not found. Setting it as deleted.", self.vc_room) self.vc_room.status = VCRoomStatus.deleted flash(str(err), 'error') return redirect(url_for('.manage_vc_rooms', self.event)) flash(_("{plugin_name} room '{room.name}' refreshed").format( plugin_name=self.plugin.friendly_name, room=self.vc_room), 'success') return redirect(url_for('.manage_vc_rooms', self.event)) class RHVCManageEventRemove(RHVCSystemEventBase): """Remove an existing VC room.""" def _process(self): if not self.plugin.can_manage_vc_rooms(session.user, self.event): flash(_('You are not allowed to remove {} rooms from this event.').format(self.plugin.friendly_name), 'error') raise Forbidden delete_all = request.args.get('delete_all') == '1' self.event_vc_room.delete(session.user, delete_all=delete_all) flash(_("{plugin_name} room '{room.name}' removed").format( plugin_name=self.plugin.friendly_name, room=self.vc_room), 'success') return redirect(url_for('.manage_vc_rooms', self.event)) class RHVCEventPage(RHDisplayEventBase): """List the VC rooms in an event page.""" def _process(self): event_vc_rooms = [event_vc_room for event_vc_room in VCRoomEventAssociation.find_for_event(self.event).all() if event_vc_room.vc_room.plugin] vc_plugins_available = bool(get_vc_plugins()) linked_to = defaultdict(lambda: defaultdict(list)) for event_vc_room in event_vc_rooms: linked_to[event_vc_room.link_type.name][event_vc_room.link_object].append(event_vc_room) return WPVCEventPage.render_template('event_vc.html', self.event, event_vc_rooms=event_vc_rooms, linked_to=linked_to, vc_plugins_available=vc_plugins_available) class RHVCManageAttach(RHVCManageEventCreateBase): """Attach a room to the event.""" def _process(self): defaults = FormDefaults(self.plugin.get_vc_room_attach_form_defaults(self.event)) form = self.plugin.vc_room_attach_form(prefix='vc-', obj=defaults, event=self.event, service=self.plugin.service_name) if form.validate_on_submit(): vc_room = form.data['room'] if not self.plugin.can_manage_vc_rooms(session.user, self.event): flash(_("You are not allowed to attach {plugin_name} rooms to this event.").format( plugin_name=self.plugin.friendly_name), 'error') elif not self.plugin.can_manage_vc_room(session.user, vc_room): flash(_("You are not authorized to attach the room '{0}'").format(vc_room.name), 'error') else: event_vc_room = process_vc_room_association(self.plugin, self.event, vc_room, form) if event_vc_room: flash(_("The room has been attached to the event."), 'success') db.session.add(event_vc_room) return jsonify_data(flash=False) return jsonify_template('vc/attach_room.html', event=self.event, form=form, skip_fields=form.conditional_fields | {'room'}, plugin=self.plugin) class RHVCManageSearch(RHVCManageEventCreateBase): """Search for a room based on its name.""" def _process_args(self): RHVCManageEventCreateBase._process_args(self) self.query = request.args.get('q', '') if len(self.query) < 3: raise BadRequest("A query has to be provided, with at least 3 characters") def _iter_allowed_rooms(self): query = (db.session.query(VCRoom, func.count(VCRoomEventAssociation.id).label('event_count')) .filter(func.lower(VCRoom.name).contains(self.query.lower()), VCRoom.status != VCRoomStatus.deleted, VCRoom.type == self.plugin.service_name) .join(VCRoomEventAssociation) # Plugins might add eager-loaded extensions to the table - since we cannot group by them # we need to make sure everything is lazy-loaded here. .options((lazyload(r) for r in inspect(VCRoom).relationships.keys()), joinedload('events').joinedload('event').joinedload('acl_entries')) .group_by(VCRoom.id) .order_by(db.desc('event_count')) .limit(10)) return ((room, count) for room, count in query if room.plugin.can_manage_vc_room(session.user, room)) def _process(self): result = [{'id': room.id, 'name': room.name} for room, count in self._iter_allowed_rooms()] return jsonify(result) class RHVCRoomList(RHProtected): """Provide a list of videoconference rooms.""" def _check_access(self): RHProtected._check_access(self) if not get_managed_vc_plugins(session.user): raise Forbidden def _process(self): form = VCRoomListFilterForm(request.args, csrf_enabled=False) results = None if request.args and form.validate(): reverse = form.direction.data == 'desc' from_dt = as_utc(get_day_start(form.start_date.data)) if form.start_date.data else None to_dt = as_utc(get_day_end(form.end_date.data)) if form.end_date.data else None results = find_event_vc_rooms(from_dt=from_dt, to_dt=to_dt, distinct=True) results = group_list((r for r in results if r.event), key=lambda r: r.event.start_dt.date(), sort_by=lambda r: r.event.start_dt, sort_reverse=reverse) results = dict(sorted(results.items(), key=itemgetter(0), reverse=reverse)) return WPVCService.render_template('vc_room_list.html', form=form, results=results, action=url_for('.vc_room_list'))
#!/usr/bin/env python #coding=utf-8 # by Qiyuan Gong # qiyuangong@gmail.com # http://github.com/qiyuangong # http://cn.linkedin.com/pub/qiyuan-gong/6b/831/407/ import pdb from models.gentree import GenTree from models.bucket import Bucket from itertools import combinations _DEBUG = True gl_treelist = {} gl_att_tree = {} gl_treesupport = 0 gl_elementcount = 0 gl_result = [] gl_data = [] # compare fuction for sort tree node def node_cmp(node1, node2): """compare node1(str) and node2(str) Compare two nodes accroding to their support """ support1 = gl_att_tree[node1].support support2 = gl_att_tree[node2].support if support1 != support2: return cmp(support1, support2) else: return cmp(node1, node2) def list_to_str(value_list, cmpfun=node_cmp, sep=';'): """covert sorted str list (sorted by cmpfun) to str value (splited by sep). This fuction is value safe, which means value_list will not be changed. """ temp = value_list[:] temp.sort(cmp=cmpfun) return sep.join(temp) def information_gain(bucket, pick_value=''): """get information gain from bucket accroding to pick_value """ ig = 0.0 parent_value = bucket.value cover_number = 0 # Herein, all ncp will be divided by the same denominator. # So I don't computing true ncp, only use numerator part. if pick_value == '': # compute bucket's information gain for gen_value in bucket.value: if gl_att_tree[gen_value].support == 0: continue for temp in bucket.member_index: ig = ig + trans_information_gain(gl_data[temp], gen_value) else: # pick node's information gain if gl_att_tree[pick_value].support == 0: return 0 for temp in bucket.member_index: ig = ig + trans_information_gain(gl_data[temp], pick_value) return ig def trans_information_gain(tran, pick_value): """get information gain for trans accroding to pick_value """ ig = 0.0 ncp = gl_att_tree[pick_value].support for t in tran: if pick_value in gl_treelist[t]: ig += ncp return ig def pick_node(bucket): """find the split node with largest information gain. Then split bucket to buckets accroding to this node. """ buckets = {} result_list = [] max_ig = -10000 max_value = '' check_list = [t for t in bucket.value if t not in bucket.split_list] for t in check_list: if len(gl_att_tree[t].child) != 0: ig = information_gain(bucket, t) if ig > max_ig: max_ig = ig max_value = t # begin to expand node on pick_value if max_value == '': print "Error: list empty!!" return ('', {}) # get index of max_value index = bucket.value.index(max_value) child_value = [t.value for t in gl_att_tree[max_value].child] for i in range(1, len(child_value)+1): temp = combinations(child_value, i) temp = [list(t) for t in temp] result_list.extend(temp) # generate child buckets child_level = bucket.level[:] child_value = bucket.value[:] now_level = bucket.level[index] + 1 del child_level[index] del child_value[index] for temp in result_list: temp_level = child_level[:] temp_value = child_value[:] for t in temp: temp_level.insert(index, now_level) temp_value.insert(index, t) str_value = list_to_str(temp) buckets[str_value] = Bucket([], temp_value, temp_level) bucket.split_list.append(max_value) return (max_value, buckets) def distribute_data(bucket, buckets, pick_value): """distribute records from parent_bucket to buckets (splited buckets) accroding to records elements. """ if len(buckets) == 0: print "Error: buckets is empty!" return data_index = bucket.member_index[:] for temp in data_index: gen_list = [] for t in gl_data[temp]: treelist = gl_treelist[t] try: pos = treelist.index(pick_value) # if covered, then replaced with new value if pos > 0: gen_list.append(treelist[pos-1]) else: print "Error: pick node is leaf, which cannot be splited" except: continue gen_list = list(set(gen_list)) # sort to ensure the order str_value = list_to_str(gen_list) try: buckets[str_value].member_index.append(temp) except: pdb.set_trace() print "Error: Cannot find key." def balance_partitions(parent_bucket, buckets, K, pick_value): """handel buckets with less than K records """ global gl_result left_over = [] for k, t in buckets.items(): if len(t.member_index) < K: # add records of buckets with less than K elemnts # to left_over partition left_over.extend(t.member_index[:]) del buckets[k] if len(left_over) == 0: # left over bucket is empty, skip balance step return # re-distribute transactions with least information gain from # buckets over k to left_over, to enshure number of # records in left_over is larger than K # using flag to denote if re-distribute is successful or not flag = True while len(left_over) < K: # each iterator pick least information gain transaction from buckets over K check_list = [t for t in buckets.values() if len(t.member_index) > K] if len(check_list) == 0: flag = False break min_ig = 10000000000000000 min_key = (0, 0) for i, temp in enumerate(check_list): for j, t in enumerate(temp.member_index): ig = trans_information_gain(gl_data[t], pick_value) if ig < min_ig: min_ig = ig min_key = (i, j) left_over.append(check_list[min_key[0]].member_index[min_key[1]]) del check_list[min_key[0]].member_index[min_key[1]] if flag == False: # Note: if flag == False, means that split is unsuccessful. # So we need to pop a bucket from buckets to merge with left_over # The bucket poped is larger than K, so left over will larger than K parent_bucket.splitable = False try: min_ig = 10000000000000000 min_key = '' for k, t in buckets.items(): ig = information_gain(t, pick_value) if ig < min_ig: min_ig = ig min_key = k left_over.extend(buckets[min_key].member_index[:]) del buckets[min_key] except: print "Error: buckets is empty" pdb.set_trace() parent_bucket.member_index = left_over[:] str_value = list_to_str(parent_bucket.value) buckets[str_value] = parent_bucket def check_splitable(bucket, K): """check if bucket can further drill down """ if len(bucket.member_index) == K: bucket.splitable = False return False check_list = [t for t in bucket.value if t not in bucket.split_list] if bucket.splitable: for t in check_list: if len(gl_att_tree[t].child) != 0: return True bucket.splitable = False return False def anonymize(bucket, K): """recursively split dataset to create anonymization buckets """ global gl_result if check_splitable(bucket, K) == False: gl_result.append(bucket) return (pick_value, expandNode) = pick_node(bucket) distribute_data(bucket, expandNode, pick_value) balance_partitions(bucket, expandNode, K, pick_value) for t in expandNode.values(): anonymize(t, K) def iloss(tran, middle): """return iloss caused by anon tran to middle """ iloss = 0.0 for t in tran: ntemp = gl_att_tree[t] checktemp = ntemp.parent[:] checktemp.insert(0, ntemp) for ptemp in checktemp: if ptemp.value in middle: break else: print "Program Error!!!! t=%s middle=%s" % (t, middle) pdb.set_trace() if ptemp.value == t: continue iloss = iloss + ptemp.support # only one attribute is involved, so we can simplfy NCP iloss = iloss * 1.0 / gl_treesupport return iloss def setalliloss(buckets): """return iloss sum of buckets, recompute iloss foreach bucket """ alliloss = 0.0 for gtemp in buckets: gloss = 0.0 for mtemp in gtemp.member_index: gloss = gloss + iloss(gl_data[mtemp], gtemp.value) gtemp.iloss = gloss alliloss += gloss alliloss = alliloss * 1.0 / gl_elementcount return alliloss def partition(att_tree, data, K): """partition tran part of microdata """ result = [] global gl_treesupport, gl_treelist, gl_att_tree, gl_elementcount, gl_data, gl_result gl_result = [] gl_treelist = {} gl_elementcount = 0 gl_treesupport = 0 gl_data = data[:] for t in gl_data: gl_elementcount += len(t) gl_att_tree = att_tree gl_treesupport = gl_att_tree['*'].support for k, v in gl_att_tree.iteritems(): if v.support == 0: gl_treelist[k] = [t.value for t in v.parent] gl_treelist[k].insert(0, k) print '-'*30 print "K=%d" % K if _DEBUG: print "Begin Partition!" anonymize(Bucket(range(len(gl_data)), ['*'], [0]), K) print "Publishing Result Data..." # changed to percentage all_loss = 100.0 * setalliloss(gl_result) if _DEBUG: # print [len(t.member_index) for t in gl_result] print "Number of buckets %d" % len(gl_result) print "iloss = %0.2f" % all_loss + "%" # transform result result = [(t.member_index[:], t.value) for t in gl_result] return result
# Copyright 2011 OpenStack Foundation. # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """ System-level utilities and helper functions. """ import math import re import sys import unicodedata import six from octavia.openstack.common.gettextutils import _ UNIT_PREFIX_EXPONENT = { 'k': 1, 'K': 1, 'Ki': 1, 'M': 2, 'Mi': 2, 'G': 3, 'Gi': 3, 'T': 4, 'Ti': 4, } UNIT_SYSTEM_INFO = { 'IEC': (1024, re.compile(r'(^[-+]?\d*\.?\d+)([KMGT]i?)?(b|bit|B)$')), 'SI': (1000, re.compile(r'(^[-+]?\d*\.?\d+)([kMGT])?(b|bit|B)$')), } TRUE_STRINGS = ('1', 't', 'true', 'on', 'y', 'yes') FALSE_STRINGS = ('0', 'f', 'false', 'off', 'n', 'no') SLUGIFY_STRIP_RE = re.compile(r"[^\w\s-]") SLUGIFY_HYPHENATE_RE = re.compile(r"[-\s]+") # NOTE(flaper87): The following globals are used by `mask_password` _SANITIZE_KEYS = ['adminPass', 'admin_pass', 'password', 'admin_password'] # NOTE(ldbragst): Let's build a list of regex objects using the list of # _SANITIZE_KEYS we already have. This way, we only have to add the new key # to the list of _SANITIZE_KEYS and we can generate regular expressions # for XML and JSON automatically. _SANITIZE_PATTERNS_2 = [] _SANITIZE_PATTERNS_1 = [] # NOTE(amrith): Some regular expressions have only one parameter, some # have two parameters. Use different lists of patterns here. _FORMAT_PATTERNS_1 = [r'(%(key)s\s*[=]\s*)[^\s^\'^\"]+'] _FORMAT_PATTERNS_2 = [r'(%(key)s\s*[=]\s*[\"\']).*?([\"\'])', r'(%(key)s\s+[\"\']).*?([\"\'])', r'([-]{2}%(key)s\s+)[^\'^\"^=^\s]+([\s]*)', r'(<%(key)s>).*?(</%(key)s>)', r'([\"\']%(key)s[\"\']\s*:\s*[\"\']).*?([\"\'])', r'([\'"].*?%(key)s[\'"]\s*:\s*u?[\'"]).*?([\'"])', r'([\'"].*?%(key)s[\'"]\s*,\s*\'--?[A-z]+\'\s*,\s*u?' '[\'"]).*?([\'"])', r'(%(key)s\s*--?[A-z]+\s*)\S+(\s*)'] for key in _SANITIZE_KEYS: for pattern in _FORMAT_PATTERNS_2: reg_ex = re.compile(pattern % {'key': key}, re.DOTALL) _SANITIZE_PATTERNS_2.append(reg_ex) for pattern in _FORMAT_PATTERNS_1: reg_ex = re.compile(pattern % {'key': key}, re.DOTALL) _SANITIZE_PATTERNS_1.append(reg_ex) def int_from_bool_as_string(subject): """Interpret a string as a boolean and return either 1 or 0. Any string value in: ('True', 'true', 'On', 'on', '1') is interpreted as a boolean True. Useful for JSON-decoded stuff and config file parsing """ return bool_from_string(subject) and 1 or 0 def bool_from_string(subject, strict=False, default=False): """Interpret a string as a boolean. A case-insensitive match is performed such that strings matching 't', 'true', 'on', 'y', 'yes', or '1' are considered True and, when `strict=False`, anything else returns the value specified by 'default'. Useful for JSON-decoded stuff and config file parsing. If `strict=True`, unrecognized values, including None, will raise a ValueError which is useful when parsing values passed in from an API call. Strings yielding False are 'f', 'false', 'off', 'n', 'no', or '0'. """ if not isinstance(subject, six.string_types): subject = six.text_type(subject) lowered = subject.strip().lower() if lowered in TRUE_STRINGS: return True elif lowered in FALSE_STRINGS: return False elif strict: acceptable = ', '.join( "'%s'" % s for s in sorted(TRUE_STRINGS + FALSE_STRINGS)) msg = _("Unrecognized value '%(val)s', acceptable values are:" " %(acceptable)s") % {'val': subject, 'acceptable': acceptable} raise ValueError(msg) else: return default def safe_decode(text, incoming=None, errors='strict'): """Decodes incoming text/bytes string using `incoming` if they're not already unicode. :param incoming: Text's current encoding :param errors: Errors handling policy. See here for valid values http://docs.python.org/2/library/codecs.html :returns: text or a unicode `incoming` encoded representation of it. :raises TypeError: If text is not an instance of str """ if not isinstance(text, (six.string_types, six.binary_type)): raise TypeError("%s can't be decoded" % type(text)) if isinstance(text, six.text_type): return text if not incoming: incoming = (sys.stdin.encoding or sys.getdefaultencoding()) try: return text.decode(incoming, errors) except UnicodeDecodeError: # Note(flaper87) If we get here, it means that # sys.stdin.encoding / sys.getdefaultencoding # didn't return a suitable encoding to decode # text. This happens mostly when global LANG # var is not set correctly and there's no # default encoding. In this case, most likely # python will use ASCII or ANSI encoders as # default encodings but they won't be capable # of decoding non-ASCII characters. # # Also, UTF-8 is being used since it's an ASCII # extension. return text.decode('utf-8', errors) def safe_encode(text, incoming=None, encoding='utf-8', errors='strict'): """Encodes incoming text/bytes string using `encoding`. If incoming is not specified, text is expected to be encoded with current python's default encoding. (`sys.getdefaultencoding`) :param incoming: Text's current encoding :param encoding: Expected encoding for text (Default UTF-8) :param errors: Errors handling policy. See here for valid values http://docs.python.org/2/library/codecs.html :returns: text or a bytestring `encoding` encoded representation of it. :raises TypeError: If text is not an instance of str """ if not isinstance(text, (six.string_types, six.binary_type)): raise TypeError("%s can't be encoded" % type(text)) if not incoming: incoming = (sys.stdin.encoding or sys.getdefaultencoding()) if isinstance(text, six.text_type): return text.encode(encoding, errors) elif text and encoding != incoming: # Decode text before encoding it with `encoding` text = safe_decode(text, incoming, errors) return text.encode(encoding, errors) else: return text def string_to_bytes(text, unit_system='IEC', return_int=False): """Converts a string into an float representation of bytes. The units supported for IEC :: Kb(it), Kib(it), Mb(it), Mib(it), Gb(it), Gib(it), Tb(it), Tib(it) KB, KiB, MB, MiB, GB, GiB, TB, TiB The units supported for SI :: kb(it), Mb(it), Gb(it), Tb(it) kB, MB, GB, TB Note that the SI unit system does not support capital letter 'K' :param text: String input for bytes size conversion. :param unit_system: Unit system for byte size conversion. :param return_int: If True, returns integer representation of text in bytes. (default: decimal) :returns: Numerical representation of text in bytes. :raises ValueError: If text has an invalid value. """ try: base, reg_ex = UNIT_SYSTEM_INFO[unit_system] except KeyError: msg = _('Invalid unit system: "%s"') % unit_system raise ValueError(msg) match = reg_ex.match(text) if match: magnitude = float(match.group(1)) unit_prefix = match.group(2) if match.group(3) in ['b', 'bit']: magnitude /= 8 else: msg = _('Invalid string format: %s') % text raise ValueError(msg) if not unit_prefix: res = magnitude else: res = magnitude * pow(base, UNIT_PREFIX_EXPONENT[unit_prefix]) if return_int: return int(math.ceil(res)) return res def to_slug(value, incoming=None, errors="strict"): """Normalize string. Convert to lowercase, remove non-word characters, and convert spaces to hyphens. Inspired by Django's `slugify` filter. :param value: Text to slugify :param incoming: Text's current encoding :param errors: Errors handling policy. See here for valid values http://docs.python.org/2/library/codecs.html :returns: slugified unicode representation of `value` :raises TypeError: If text is not an instance of str """ value = safe_decode(value, incoming, errors) # NOTE(aababilov): no need to use safe_(encode|decode) here: # encodings are always "ascii", error handling is always "ignore" # and types are always known (first: unicode; second: str) value = unicodedata.normalize("NFKD", value).encode( "ascii", "ignore").decode("ascii") value = SLUGIFY_STRIP_RE.sub("", value).strip().lower() return SLUGIFY_HYPHENATE_RE.sub("-", value) def mask_password(message, secret="***"): """Replace password with 'secret' in message. :param message: The string which includes security information. :param secret: value with which to replace passwords. :returns: The unicode value of message with the password fields masked. For example: >>> mask_password("'adminPass' : 'aaaaa'") "'adminPass' : '***'" >>> mask_password("'admin_pass' : 'aaaaa'") "'admin_pass' : '***'" >>> mask_password('"password" : "aaaaa"') '"password" : "***"' >>> mask_password("'original_password' : 'aaaaa'") "'original_password' : '***'" >>> mask_password("u'original_password' : u'aaaaa'") "u'original_password' : u'***'" """ message = six.text_type(message) # NOTE(ldbragst): Check to see if anything in message contains any key # specified in _SANITIZE_KEYS, if not then just return the message since # we don't have to mask any passwords. if not any(key in message for key in _SANITIZE_KEYS): return message substitute = r'\g<1>' + secret + r'\g<2>' for pattern in _SANITIZE_PATTERNS_2: message = re.sub(pattern, substitute, message) substitute = r'\g<1>' + secret for pattern in _SANITIZE_PATTERNS_1: message = re.sub(pattern, substitute, message) return message
import time import datetime import requests_mock from django.conf import settings from selenium.common.exceptions import NoSuchElementException from events.models import User, Playlist from functional_tests.selenium_test_case import SeleniumTestCase from functional_tests.utils import navbar_active_element_text class PlaylistPageTests(SeleniumTestCase): @requests_mock.Mocker() def test_can_open_playlist_page(self, m): m.get(settings.API_BASE_ADDRESS + '/playlist/', json={ "response": { "status": { "version": 0.1, "code": 0, "status": "Success" }, "tracks": [ ], "pagination": { "total": 2, "offset": 0, "results": 2 } } }, status_code=200) self.browser.get(self.live_server_url + '/playlist') today = datetime.datetime.now() date_text = '%s, %s' % (today.strftime('%B'), today.strftime('%d')) self.assertIn('Playlist a day for %s' % date_text, self.browser.title) header = self.browser.find_element_by_class_name( 'page-header' ).find_element_by_tag_name('h1').text self.assertIn( 'Playlist based on the events that happened on this day in music...', header ) active_element = navbar_active_element_text(self.browser) self.assertIn("Playlist", active_element) self.assertRaises(NoSuchElementException, self.browser.find_element_by_id, 'date_picker') @requests_mock.Mocker() def test_playlist_page_shows_list_of_songs(self, m): m.get(settings.API_BASE_ADDRESS + '/playlist/', json={ "response": { "status": { "version": 0.1, "code": 0, "status": "Success" }, "tracks": [ { "name": "Zij Gelooft In Mij (2006 Digital Remaster)", "artist": "Andre Hazes", "spotifyId": "spotify-WW:track:4ZHCNqDss0HQchbrhleipg", "event": "1951-06-30 - [Birth] Andre Hazes, Dutch barkeeper/singer (We Love Orange) was born" }, { "name": "He's Got the Whole World", "artist": "Andrew Scott", "spotifyId": "spotify-WW:track:3ZQsFBQVbWD7nDKkoSKB3q", "event": "1949-06-30 - [Birth] Andrew Scott, Wales, rock guitarist (Sweet) was born" } ], "pagination": { "total": 2, "offset": 0, "results": 2 } } }, status_code=200) self.browser.get(self.live_server_url + '/playlist') track_container = self.browser.find_element_by_class_name('well') self.assertIsNotNone(track_container) tracks = track_container.find_elements_by_tag_name('li') self.assertEqual(len(tracks), 2) self.assertEqual(tracks[0].text, "1951-06-30 - [Birth] Andre Hazes, Dutch barkeeper/singer (We Love Orange) was born") self.assertEqual(tracks[1].text, "1949-06-30 - [Birth] Andrew Scott, Wales, rock guitarist (Sweet) was born") @requests_mock.Mocker() def test_playlist_page_shows_create_spotify_playlist_form_if_no_user_in_session(self, m): m.get(settings.API_BASE_ADDRESS + '/playlist/', json={ "response": { "status": { "version": 0.1, "code": 0, "status": "Success" }, "tracks": [ { "name": "Zij Gelooft In Mij (2006 Digital Remaster)", "artist": "Andre Hazes", "spotifyId": "spotify-WW:track:4ZHCNqDss0HQchbrhleipg", "event": "1951-06-30 - [Birth] Andre Hazes, Dutch barkeeper/singer (We Love Orange) was born" }, { "name": "He's Got the Whole World", "artist": "Andrew Scott", "spotifyId": "spotify-WW:track:3ZQsFBQVbWD7nDKkoSKB3q", "event": "1949-06-30 - [Birth] Andrew Scott, Wales, rock guitarist (Sweet) was born" } ], "pagination": { "total": 2, "offset": 0, "results": 2 } } }, status_code=200) self.browser.get(self.live_server_url + '/playlist') create_spotify_playlist_form = self.browser.find_element_by_id('create-playlist') self.assertIsNotNone(create_spotify_playlist_form) @requests_mock.Mocker() def test_playlist_page_shows_create_spotify_playlist_form_if_user_in_session_but_not_on_db(self, m): m.get(settings.API_BASE_ADDRESS + '/playlist/', json={ "response": { "status": { "version": 0.1, "code": 0, "status": "Success" }, "tracks": [ { "name": "Zij Gelooft In Mij (2006 Digital Remaster)", "artist": "Andre Hazes", "spotifyId": "spotify-WW:track:4ZHCNqDss0HQchbrhleipg", "event": "1951-06-30 - [Birth] Andre Hazes, Dutch barkeeper/singer (We Love Orange) was born" }, { "name": "He's Got the Whole World", "artist": "Andrew Scott", "spotifyId": "spotify-WW:track:3ZQsFBQVbWD7nDKkoSKB3q", "event": "1949-06-30 - [Birth] Andrew Scott, Wales, rock guitarist (Sweet) was born" } ], "pagination": { "total": 2, "offset": 0, "results": 2 } } }, status_code=200) session = self.client.session session.save() self.browser.get(self.live_server_url) username = 'thesearchingwanderer' self.browser.add_cookie({'name': settings.SESSION_COOKIE_NAME, 'value': session.session_key}) session['username'] = username session.save() self.browser.get(self.live_server_url + '/playlist') create_spotify_playlist_form = self.browser.find_element_by_id('create-playlist') self.assertIsNotNone(create_spotify_playlist_form) @requests_mock.Mocker() def test_playlist_page_shows_spotify_playlist(self, m): m.get(settings.API_BASE_ADDRESS + '/playlist/', json={ "response": { "status": { "version": 0.1, "code": 0, "status": "Success" }, "tracks": [ { "name": "Zij Gelooft In Mij (2006 Digital Remaster)", "artist": "Andre Hazes", "spotifyId": "spotify-WW:track:4ZHCNqDss0HQchbrhleipg", "event": "1951-06-30 - [Birth] Andre Hazes, Dutch barkeeper/singer (We Love Orange) was born" }, { "name": "He's Got the Whole World", "artist": "Andrew Scott", "spotifyId": "spotify-WW:track:3ZQsFBQVbWD7nDKkoSKB3q", "event": "1949-06-30 - [Birth] Andrew Scott, Wales, rock guitarist (Sweet) was born" } ], "pagination": { "total": 2, "offset": 0, "results": 2 } } }, status_code=200) session = self.client.session session.save() self.browser.get(self.live_server_url) username = 'thesearchingwanderer' user = User.objects.create(username=username) Playlist.objects.create( user=user, date=datetime.date.today(), url='https://open.spotify.com/embed/user/thesearchingwanderer/playlist/5jUBZBiQWmAiJaeJLYldcj?si=GgOazCjdR0uyHw6Vx9kCfQ' ) self.browser.add_cookie({'name': settings.SESSION_COOKIE_NAME, 'value': session.session_key}) session['username'] = username session['spotify_token'] = { 'access_token': 'random', 'expires_at': int(time.time()) + 3600 } session.save() self.browser.get(self.live_server_url + '/playlist') spotify_playlist = self.browser.find_element_by_id('spotify-playlist') self.assertIsNotNone(spotify_playlist)
# -*- coding: utf-8 -*- import os import time from datetime import datetime import click import pythoncom from selenium.common.exceptions import TimeoutException from selenium.webdriver.common.alert import Alert from selenium.webdriver.common.by import By from selenium.webdriver.common.keys import Keys from selenium.webdriver.support import expected_conditions as ec from selenium.webdriver.support.ui import WebDriverWait from win32com.client import Dispatch from t_infinity import driver from t_infinity.logger import logger class LogisticsCreate: days_in_field = None call_number = None def __init__(self, serial_number, product_code, inbound_repair_order_number): self.instance = driver.instance self.instance.session_id = driver.session_id self.wait = WebDriverWait(self.instance, 5) if self.check_ro_number_is_free(inbound_repair_order_number): return history = self.check_history(serial_number, product_code) if history is 1: self.in_zulu(serial_number, product_code, inbound_repair_order_number) elif history is 2: self.not_in_zulu(serial_number, product_code, inbound_repair_order_number) elif history is 3: self._add_new(serial_number, product_code, inbound_repair_order_number) self.go_to_create() self.create_welcome_fill() self.job_site_details_fill() self.ship_site_details() self.job_item_details(serial_number, product_code, inbound_repair_order_number) self.job_details() self.complete() self.print(inbound_repair_order_number, self.call_number) def check_ro_number_is_free(self, inbound_repair_order_number): logger.debug('checking for RO number') xpath_repair_order_number = ('//*[@id="scmaster_cplMainContent_grdPowerQuery_ctlPowerQueryGrid"]' '/div[1]/div[4]/div[1]/table/tbody/tr[2]/td[2]/div/input[1]') xpath_first_row = ('//*[@id="scmaster_cplMainContent_grdPowerQuery_ctlPowerQueryGrid"]' '/div[1]/div[4]/div[2]/table/tbody/tr[1]') self.instance.get('https://tesseract-cloud2.co.uk/SC51/SC_SerProd/aspx/serprod_query.aspx') elem = self.wait.until(ec.visibility_of_element_located((By.XPATH, xpath_repair_order_number))) logger.debug("Successful navigation, element marker found") elem.send_keys(inbound_repair_order_number) logger.debug('%s sent to element', inbound_repair_order_number) try: self.wait.until(ec.text_to_be_present_in_element((By.XPATH, xpath_first_row), inbound_repair_order_number)) logger.critical('repair order number exists') return True except TimeoutException: logger.debug('repair order number does not exists') return False def check_history(self, serial_number, product_code): logger.debug('Checking history for %s:%s', serial_number, product_code) # serialized product query xpath_serial_number_input = '//*[@id="scmaster_cplMainContent_grdPowerQuery_ctlPowerQueryGrid"]/div[1]/div[4]/div[1]/table/tbody/tr[2]/td[1]/div/input[1]' xpath_product_code_input = '//*[@id="scmaster_cplMainContent_grdPowerQuery_ctlPowerQueryGrid"]/div[1]/div[4]/div[1]/table/tbody/tr[2]/td[7]/div/input[1]' xpath_serial_number_first_row = '//*[@id="scmaster_cplMainContent_grdPowerQuery_ctlPowerQueryGrid"]/div[1]/div[4]/div[2]/table/tbody/tr' # serialized product modify id_site_no = 'scmaster_cplMainContent_txtSerSiteNum' self.instance.get('https://tesseract-cloud2.co.uk/SC51/SC_SerProd/aspx/serprod_query.aspx') elem = self.wait.until(ec.presence_of_element_located((By.XPATH, xpath_serial_number_input))) elem.send_keys(serial_number) elem = self.instance.find_element_by_xpath(xpath_product_code_input) elem.send_keys(product_code) try: self.wait.until(ec.text_to_be_present_in_element((By.XPATH, xpath_serial_number_first_row), serial_number)) self.instance.find_element_by_xpath(xpath_serial_number_first_row).click() element_site_no = self.wait.until(ec.visibility_of_element_located((By.ID, id_site_no))) site_no = element_site_no.get_attribute('value') logger.debug("found a site number: %s", site_no) except TimeoutException: site_no = False logger.debug('no site number found') if site_no is False: logger.debug('site_no is False') return 3 if 'ZULU' == site_no: logger.debug('Serial Number found in %s', site_no) return 1 if site_no: logger.debug('Serial Number found in %s', site_no) return 2 def in_zulu(self, serial_number, product_code, inbound_repair_order_number): logger.debug("running in_zulu flow") _ = datetime.strptime(str(datetime.utcnow()), '%Y-%m-%d %H:%M:%S.%f') today = time.mktime(_.timetuple()) id_current_ro_number = 'scmaster_cplMainContent_txtSerReference2' id_last_ro_ref = 'scmaster_cplMainContent_txtSerReference1' id_booked_in_date = 'scmaster_cplMainContent_dtpSerInstallDate' id_product = 'scmaster_cplMainContent_cboSerProdNum' id_sumbit = 'scmaster_btnSubmit' id_status = 'scmaster_cplMainContent_cboSerSeStatCode' while serial_number not in self.instance.current_url: self.check_history(serial_number, product_code) element_current_ro_ref = self.wait.until(ec.visibility_of_element_located((By.ID, id_current_ro_number))) element_last_ro_ref = self.instance.find_element_by_id(id_last_ro_ref) element_booked_in_date = self.instance.find_element_by_id(id_booked_in_date) element_product = self.instance.find_element_by_id(id_product) element_submit = self.instance.find_element_by_id(id_sumbit) element_status = self.instance.find_element_by_id(id_status) previous_product = element_product.get_attribute('value') previous_repair_order = element_current_ro_ref.get_attribute('value') if '177' not in previous_product: if not click.confirm("Tesseract product code appears incorrect, continue?"): logger.info('killing process') return if previous_product != product_code: if not click.confirm("Your product does not match what is logged on Tesseract, continue?"): logger.info('killing process') return element_last_ro_ref.clear() element_last_ro_ref.send_keys(previous_repair_order) element_current_ro_ref.clear() element_current_ro_ref.send_keys(inbound_repair_order_number) last_booked_in = element_booked_in_date.get_attribute('value') logger.debug(last_booked_in) _ = datetime.strptime(last_booked_in.strip(), '%m/%d/%Y') last_time_time_stamp = time.mktime(_.timetuple()) self.days_in_field = int(today - last_time_time_stamp) / ((60 ** 2) * 24) logger.debug(self.days_in_field) element_booked_in_date.clear() element_booked_in_date.send_keys(time.strftime("%m/%d/%Y")) element_status.clear() element_status.send_keys('REP') if click.confirm("Record ready for submission, continue?"): element_submit.click() else: return logger.debug('Submitting...') self.wait.until(ec.alert_is_present()) Alert(self.instance).accept() try: WebDriverWait(self.instance, 3).until(ec.alert_is_present()) logger.critical("Unable to submit, %s", Alert(self.instance).text) Alert(self.instance).accept() except TimeoutException: logger.debug('successfully modified product') pass def not_in_zulu(self, serial_number, product_code, inbound_repair_order_number): logger.debug("running not_in_zulu flow") xpath_query_serial_number = '//*[@id="scmaster_cplMainContent_grdPowerQuery_ctlPowerQueryGrid"]/div[1]/div[4]/div[1]/table/tbody/tr[2]/td[1]/div/input[1]' _ = datetime.strptime(str(datetime.utcnow()), '%Y-%m-%d %H:%M:%S.%f') today = time.mktime(_.timetuple()) id_delete_button = 'scmaster_btnDelete' id_last_booked_in = 'scmaster_cplMainContent_dtpSerInstallDate' while serial_number not in self.instance.current_url: self.check_history(serial_number, product_code) element_delete_button = self.wait.until(ec.visibility_of_element_located((By.ID, id_delete_button))) element_last_booked_in_date = self.instance.find_element_by_id(id_last_booked_in) last_booked_in = element_last_booked_in_date.get_attribute('value') logger.debug(last_booked_in) _ = datetime.strptime(last_booked_in.strip(), '%m/%d/%Y') last_time_time_stamp = time.mktime(_.timetuple()) self.days_in_field = int(today - last_time_time_stamp) / ((60 ** 2) * 24) logger.debug(self.days_in_field) element_delete_button.click() logger.debug(Alert(self.instance).text) Alert(self.instance).accept() try: WebDriverWait(self.instance, 3).until(ec.alert_is_present()) logger.critical("Unable to delete, %s", Alert(self.instance).text) Alert(self.instance).accept() except TimeoutException: logger.debug('product delete from installation') pass self.wait.until(ec.presence_of_element_located((By.XPATH, xpath_query_serial_number))) self._add_new(serial_number, product_code, inbound_repair_order_number) def _add_new(self, serial_number, product_code, inbound_repair_order_number): logger.debug('adding product') id_add_button = 'scmaster_tdButtonStrip2' id_serial_number = 'scmaster_cplMainContent_txtSerNum' id_booked_in_date = 'scmaster_cplMainContent_dtpSerInstallDate' id_current_ro_ref = 'scmaster_cplMainContent_txtSerReference2' id_product = 'scmaster_cplMainContent_cboSerProdNum' id_site_no = 'scmaster_cplMainContent_txtSerSiteNum' id_status = 'scmaster_cplMainContent_cboSerSeStatCode' id_submit = 'scmaster_btnSubmit' element_add_button = self.instance.find_element_by_id(id_add_button) element_add_button.click() element_serial_number = self.wait.until(ec.presence_of_element_located((By.ID, id_serial_number))) element_booked_in_date = self.instance.find_element_by_id(id_booked_in_date) element_current_ro_ref = self.instance.find_element_by_id(id_current_ro_ref) element_product = self.instance.find_element_by_id(id_product) element_site_no = self.instance.find_element_by_id(id_site_no) element_status = self.instance.find_element_by_id(id_status) element_submit = self.instance.find_element_by_id(id_submit) element_serial_number.send_keys(serial_number) element_booked_in_date.clear() element_booked_in_date.send_keys(time.strftime("%m/%d/%Y")) element_current_ro_ref.send_keys(inbound_repair_order_number) element_product.send_keys(product_code) element_site_no.send_keys('ZULU') element_status.send_keys('REP') logger.debug('submitting...') element_submit.click() logger.debug('waiting for popup') self.wait.until(ec.alert_is_present()) logger.debug(Alert(self.instance).text) Alert(self.instance).accept() def go_to_create(self): self.instance.get('https://tesseract-cloud2.co.uk/SC51/SC_RepairJob/aspx/repairjob_create_wzd.aspx') def create_welcome_fill(self): id_book_in_date = 'scmaster_cplMainContent_datBookInDate' id_next = 'scmaster_cplMainContent_cmdNext' id_workshop_site = 'scmaster_cplMainContent_cboJobWorkshopSiteNum' dt = datetime.now() script_workshop_site = 'DisplayCombo("cboJobWorkshopSiteNum", "frmRepairJobCreateWzd");' element_workshop_site = self.wait.until(ec.presence_of_element_located((By.ID, id_workshop_site))) element_workshop_site.clear() element_workshop_site.send_keys('STOWS') self.instance.execute_script(script_workshop_site) if not self._handle_modal('fraModalPopup', 'STOWS'): return logger.debug(f'{dt.month}/{dt.day}/{dt.year}') self.wait.until( ec.text_to_be_present_in_element_value((By.ID, id_book_in_date), f'{dt.month}/{dt.day}/{dt.year}')) element_next = self.instance.find_element_by_id(id_next) element_next.click() return def job_site_details_fill(self): id_site_num = 'scmaster_cplMainContent_cboCallSiteNum' id_name = 'scmaster_cplMainContent_cboCallSiteName' id_next = 'scmaster_cplMainContent_cmdNext' script_site_num = 'DisplayCombo("cboCallSiteNum", "frmRepairJobCreateWzd");' element_site_num = self.wait.until(ec.presence_of_element_located((By.ID, id_site_num))) element_site_num.send_keys('ZULU') self.instance.execute_script(script_site_num) if not self._handle_modal('fraModalPopup', 'ZULU'): return self.wait.until(ec.text_to_be_present_in_element_value((By.ID, id_name), 'Zulu Stock')) element_next = self.instance.find_element_by_id(id_next) element_next.click() return def ship_site_details(self): id_ship_site_num = 'scmaster_cplMainContent_cboShipSiteNum' id_next = 'scmaster_cplMainContent_cmdNext' self.wait.until(ec.presence_of_element_located((By.ID, id_ship_site_num))) element_next = self.instance.find_element_by_id(id_next) element_next.click() def job_item_details(self, serial_number, product_code, repair_order_number): id_serial_num = 'scmaster_cplMainContent_cboCallSerNum' id_material_number = 'scmaster_cplMainContent_cboCallProdNum' id_repair_order_number = 'scmaster_cplMainContent_txtJobRef6' id_next = 'scmaster_cplMainContent_cmdNext' script_serial_num = 'DisplayCombo(\'cboCallSerNum\', \'frmRepairJobCreateWzd\')' element_serial_num = self.wait.until(ec.presence_of_element_located((By.ID, id_serial_num))) element_serial_num.send_keys(serial_number) self.instance.execute_script(script_serial_num) if not self._handle_modal(expected_value=serial_number): return self.wait.until(ec.text_to_be_present_in_element_value((By.ID, id_material_number), product_code)) element_repair_order_number = self.instance.find_element_by_id(id_repair_order_number) element_repair_order_number.send_keys(repair_order_number) element_next = self.instance.find_element_by_id(id_next) element_next.click() def job_details(self): id_job_type = 'scmaster_cplMainContent_cboCallCalTCode' id_flow_code = 'scmaster_cplMainContent_cboJobFlowCode' id_problem = 'scmaster_cplMainContent_txtCallProblem' id_desc = 'scmaster_cplMainContent_txtCalTDesc' id_position = 'scmaster_cplMainContent_txtFlowPos' id_finsih = 'scmaster_cplMainContent_cmdFinish' script_job_type = 'DisplayCombo(\'cboCallCalTCode\', \'frmRepairJobCreateWzd\');' script_flow_code = 'DisplayCombo(\'cboJobFlowCode\', \'frmRepairJobCreateWzd\');' element_job_type = self.wait.until(ec.presence_of_element_located((By.ID, id_job_type))) element_flow_code = self.instance.find_element_by_id(id_flow_code) element_problem = self.instance.find_element_by_id(id_problem) element_job_type.send_keys('ZR1') element_flow_code.send_keys('SWBO%') problems = [] problems.append('This product has been in the filed for ' + str(self.days_in_field) + ' days') problems.append('This call was automatically generated with T-Infinity created by Kieran Wynne') for problem in problems: element_problem.send_keys(problem) element_problem.send_keys(Keys.RETURN) self.instance.execute_script(script_job_type) if not self._handle_modal(expected_value='ZR1'): return self.wait.until(ec.text_to_be_present_in_element_value((By.ID, id_desc), 'Zulu Equipment Repair')) self.instance.execute_script(script_flow_code) if not self._handle_modal(expected_value='SWBOOKIN'): return self.wait.until(ec.text_to_be_present_in_element_value((By.ID, id_position), '1')) element_finish = self.instance.find_element_by_id(id_finsih) element_finish.click() def complete(self): id_job_numbers = 'scmaster_cplMainContent_txtJobNumbers' element_job_numbers = self.wait.until(ec.presence_of_element_located((By.ID, id_job_numbers))) self.call_number = element_job_numbers.text def _handle_modal(self, frame_id='fraModalPopup', expected_value=None): wait.until(ec.frame_to_be_available_and_switch_to_it((By.ID, frame_id))) options = browser.find_elements_by_css_selector('#scmaster_cplMainContent_grdDropdown > tbody > tr') logger.debug(len(options) if not options: self.instance.switch_to_default_content() return False if len(options) is 2: logger.debug('No relevant options exist') self.instance.switch_to_default_content() return False if len(options) > 3: logger.debug('multiple options available') click.confirm('Click the option you like then confirm that you are done') self.instance.switch_to_default_content() return True if len(options) is 3: logger.debug('selecting the only available option') logger.debug(options[1].text) if expected_value in options[1].text: options[1].click() self.instance.switch_to_default_content() return True else: self.instance.switch_to_default_content() return False def print(self, repair_order_number, call_number): pythoncom.CoInitialize() labelCom = Dispatch('Dymo.DymoAddIn') labelText = Dispatch('Dymo.DymoLabels') current_path = os.path.abspath(os.path.dirname(__file__)) isOpen = labelCom.Open(os.path.join(current_path, "labels/Zulu-book-in.label")) selectPrinter = 'DYMO LabelWriter 450' labelCom.SelectPrinter(selectPrinter) labelText.SetField('RO-Number', repair_order_number) labelText.SetField('Call-Number', call_number) labelCom.StartPrintJob() labelCom.Print(1, False) labelCom.EndPrintJob()
from __future__ import unicode_literals from django import template from django.utils.html import escape from django.utils.safestring import mark_safe from .compat import parse_bits from ..cachefiles import ImageCacheFile from ..registry import generator_registry from ..lib import force_text register = template.Library() ASSIGNMENT_DELIMETER = 'as' HTML_ATTRS_DELIMITER = '--' DEFAULT_THUMBNAIL_GENERATOR = 'imagekit:thumbnail' def get_cachefile(context, generator_id, generator_kwargs, source=None): generator_id = generator_id.resolve(context) kwargs = dict((k, v.resolve(context)) for k, v in generator_kwargs.items()) generator = generator_registry.get(generator_id, **kwargs) return ImageCacheFile(generator) def parse_dimensions(dimensions): """ Parse the width and height values from a dimension string. Valid values are '1x1', '1x', and 'x1'. If one of the dimensions is omitted, the parse result will be None for that value. """ width, height = [d.strip() and int(d) or None for d in dimensions.split('x')] return dict(width=width, height=height) class GenerateImageAssignmentNode(template.Node): def __init__(self, variable_name, generator_id, generator_kwargs): self._generator_id = generator_id self._generator_kwargs = generator_kwargs self._variable_name = variable_name def get_variable_name(self, context): return force_text(self._variable_name) def render(self, context): variable_name = self.get_variable_name(context) context[variable_name] = get_cachefile(context, self._generator_id, self._generator_kwargs) return '' class GenerateImageTagNode(template.Node): def __init__(self, generator_id, generator_kwargs, html_attrs): self._generator_id = generator_id self._generator_kwargs = generator_kwargs self._html_attrs = html_attrs def render(self, context): file = get_cachefile(context, self._generator_id, self._generator_kwargs) attrs = dict((k, v.resolve(context)) for k, v in self._html_attrs.items()) # Only add width and height if neither is specified (to allow for # proportional in-browser scaling). if not 'width' in attrs and not 'height' in attrs: attrs.update(width=file.width, height=file.height) attrs['src'] = file.url attr_str = ' '.join('%s="%s"' % (escape(k), escape(v)) for k, v in attrs.items()) return mark_safe('<img %s />' % attr_str) class ThumbnailAssignmentNode(template.Node): def __init__(self, variable_name, generator_id, dimensions, source, generator_kwargs): self._variable_name = variable_name self._generator_id = generator_id self._dimensions = dimensions self._source = source self._generator_kwargs = generator_kwargs def get_variable_name(self, context): return force_text(self._variable_name) def render(self, context): variable_name = self.get_variable_name(context) generator_id = self._generator_id.resolve(context) if self._generator_id else DEFAULT_THUMBNAIL_GENERATOR kwargs = dict((k, v.resolve(context)) for k, v in self._generator_kwargs.items()) kwargs['source'] = self._source.resolve(context) kwargs.update(parse_dimensions(self._dimensions.resolve(context))) generator = generator_registry.get(generator_id, **kwargs) context[variable_name] = ImageCacheFile(generator) return '' class ThumbnailImageTagNode(template.Node): def __init__(self, generator_id, dimensions, source, generator_kwargs, html_attrs): self._generator_id = generator_id self._dimensions = dimensions self._source = source self._generator_kwargs = generator_kwargs self._html_attrs = html_attrs def render(self, context): generator_id = self._generator_id.resolve(context) if self._generator_id else DEFAULT_THUMBNAIL_GENERATOR dimensions = parse_dimensions(self._dimensions.resolve(context)) kwargs = dict((k, v.resolve(context)) for k, v in self._generator_kwargs.items()) kwargs['source'] = self._source.resolve(context) kwargs.update(dimensions) generator = generator_registry.get(generator_id, **kwargs) file = ImageCacheFile(generator) attrs = dict((k, v.resolve(context)) for k, v in self._html_attrs.items()) # Only add width and height if neither is specified (to allow for # proportional in-browser scaling). if not 'width' in attrs and not 'height' in attrs: attrs.update(width=file.width, height=file.height) attrs['src'] = file.url attr_str = ' '.join('%s="%s"' % (escape(k), escape(v)) for k, v in attrs.items()) return mark_safe('<img %s />' % attr_str) def parse_ik_tag_bits(parser, bits): """ Parses the tag name, html attributes and variable name (for assignment tags) from the provided bits. The preceding bits may vary and are left to be parsed by specific tags. """ varname = None html_attrs = {} tag_name = bits.pop(0) if len(bits) >= 2 and bits[-2] == ASSIGNMENT_DELIMETER: varname = bits[-1] bits = bits[:-2] if HTML_ATTRS_DELIMITER in bits: if varname: raise template.TemplateSyntaxError('Do not specify html attributes' ' (using "%s") when using the "%s" tag as an assignment' ' tag.' % (HTML_ATTRS_DELIMITER, tag_name)) index = bits.index(HTML_ATTRS_DELIMITER) html_bits = bits[index + 1:] bits = bits[:index] if not html_bits: raise template.TemplateSyntaxError('Don\'t use "%s" unless you\'re' ' setting html attributes.' % HTML_ATTRS_DELIMITER) args, html_attrs = parse_bits(parser, html_bits, [], 'args', 'kwargs', None, False, tag_name) if len(args): raise template.TemplateSyntaxError('All "%s" tag arguments after' ' the "%s" token must be named.' % (tag_name, HTML_ATTRS_DELIMITER)) return (tag_name, bits, html_attrs, varname) #@register.tag def generateimage(parser, token): """ Creates an image based on the provided arguments. By default:: {% generateimage 'myapp:thumbnail' source=mymodel.profile_image %} generates an ``<img>`` tag:: <img src="/path/to/34d944f200dd794bf1e6a7f37849f72b.jpg" width="100" height="100" /> You can add additional attributes to the tag using "--". For example, this:: {% generateimage 'myapp:thumbnail' source=mymodel.profile_image -- alt="Hello!" %} will result in the following markup:: <img src="/path/to/34d944f200dd794bf1e6a7f37849f72b.jpg" width="100" height="100" alt="Hello!" /> For more flexibility, ``generateimage`` also works as an assignment tag:: {% generateimage 'myapp:thumbnail' source=mymodel.profile_image as th %} <img src="{{ th.url }}" width="{{ th.width }}" height="{{ th.height }}" /> """ bits = token.split_contents() tag_name, bits, html_attrs, varname = parse_ik_tag_bits(parser, bits) args, kwargs = parse_bits(parser, bits, ['generator_id'], 'args', 'kwargs', None, False, tag_name) if len(args) != 1: raise template.TemplateSyntaxError('The "%s" tag requires exactly one' ' unnamed argument (the generator id).' % tag_name) generator_id = args[0] if varname: return GenerateImageAssignmentNode(varname, generator_id, kwargs) else: return GenerateImageTagNode(generator_id, kwargs, html_attrs) #@register.tag def thumbnail(parser, token): """ A convenient shortcut syntax for generating a thumbnail. The following:: {% thumbnail '100x100' mymodel.profile_image %} is equivalent to:: {% generateimage 'imagekit:thumbnail' source=mymodel.profile_image width=100 height=100 %} The thumbnail tag supports the "--" and "as" bits for adding html attributes and assigning to a variable, respectively. It also accepts the kwargs "anchor", and "crop". To use "smart cropping" (the ``SmartResize`` processor):: {% thumbnail '100x100' mymodel.profile_image %} To crop, anchoring the image to the top right (the ``ResizeToFill`` processor):: {% thumbnail '100x100' mymodel.profile_image anchor='tr' %} To resize without cropping (using the ``ResizeToFit`` processor):: {% thumbnail '100x100' mymodel.profile_image crop=0 %} """ bits = token.split_contents() tag_name, bits, html_attrs, varname = parse_ik_tag_bits(parser, bits) args, kwargs = parse_bits(parser, bits, [], 'args', 'kwargs', None, False, tag_name) if len(args) < 2: raise template.TemplateSyntaxError('The "%s" tag requires at least two' ' unnamed arguments: the dimensions and the source image.' % tag_name) elif len(args) > 3: raise template.TemplateSyntaxError('The "%s" tag accepts at most three' ' unnamed arguments: a generator id, the dimensions, and the' ' source image.' % tag_name) dimensions, source = args[-2:] generator_id = args[0] if len(args) > 2 else None if varname: return ThumbnailAssignmentNode(varname, generator_id, dimensions, source, kwargs) else: return ThumbnailImageTagNode(generator_id, dimensions, source, kwargs, html_attrs) generateimage = register.tag(generateimage) thumbnail = register.tag(thumbnail)
from __future__ import unicode_literals import json import sure # noqa import boto3 from moto import mock_iot @mock_iot def test_things(): client = boto3.client('iot', region_name='ap-northeast-1') name = 'my-thing' type_name = 'my-type-name' # thing type thing_type = client.create_thing_type(thingTypeName=type_name) thing_type.should.have.key('thingTypeName').which.should.equal(type_name) thing_type.should.have.key('thingTypeArn') res = client.list_thing_types() res.should.have.key('thingTypes').which.should.have.length_of(1) for thing_type in res['thingTypes']: thing_type.should.have.key('thingTypeName').which.should_not.be.none thing_type = client.describe_thing_type(thingTypeName=type_name) thing_type.should.have.key('thingTypeName').which.should.equal(type_name) thing_type.should.have.key('thingTypeProperties') thing_type.should.have.key('thingTypeMetadata') # thing thing = client.create_thing(thingName=name, thingTypeName=type_name) thing.should.have.key('thingName').which.should.equal(name) thing.should.have.key('thingArn') res = client.list_things() res.should.have.key('things').which.should.have.length_of(1) for thing in res['things']: thing.should.have.key('thingName').which.should_not.be.none thing.should.have.key('thingArn').which.should_not.be.none thing = client.update_thing(thingName=name, attributePayload={'attributes': {'k1': 'v1'}}) res = client.list_things() res.should.have.key('things').which.should.have.length_of(1) for thing in res['things']: thing.should.have.key('thingName').which.should_not.be.none thing.should.have.key('thingArn').which.should_not.be.none res['things'][0]['attributes'].should.have.key('k1').which.should.equal('v1') thing = client.describe_thing(thingName=name) thing.should.have.key('thingName').which.should.equal(name) thing.should.have.key('defaultClientId') thing.should.have.key('thingTypeName') thing.should.have.key('attributes') thing.should.have.key('version') # delete thing client.delete_thing(thingName=name) res = client.list_things() res.should.have.key('things').which.should.have.length_of(0) # delete thing type client.delete_thing_type(thingTypeName=type_name) res = client.list_thing_types() res.should.have.key('thingTypes').which.should.have.length_of(0) @mock_iot def test_list_thing_types(): client = boto3.client('iot', region_name='ap-northeast-1') for i in range(0, 100): client.create_thing_type(thingTypeName=str(i + 1)) thing_types = client.list_thing_types() thing_types.should.have.key('nextToken') thing_types.should.have.key('thingTypes').which.should.have.length_of(50) thing_types['thingTypes'][0]['thingTypeName'].should.equal('1') thing_types['thingTypes'][-1]['thingTypeName'].should.equal('50') thing_types = client.list_thing_types(nextToken=thing_types['nextToken']) thing_types.should.have.key('thingTypes').which.should.have.length_of(50) thing_types.should_not.have.key('nextToken') thing_types['thingTypes'][0]['thingTypeName'].should.equal('51') thing_types['thingTypes'][-1]['thingTypeName'].should.equal('100') @mock_iot def test_list_thing_types_with_typename_filter(): client = boto3.client('iot', region_name='ap-northeast-1') client.create_thing_type(thingTypeName='thing') client.create_thing_type(thingTypeName='thingType') client.create_thing_type(thingTypeName='thingTypeName') client.create_thing_type(thingTypeName='thingTypeNameGroup') client.create_thing_type(thingTypeName='shouldNotFind') client.create_thing_type(thingTypeName='find me it shall not') thing_types = client.list_thing_types(thingTypeName='thing') thing_types.should_not.have.key('nextToken') thing_types.should.have.key('thingTypes').which.should.have.length_of(4) thing_types['thingTypes'][0]['thingTypeName'].should.equal('thing') thing_types['thingTypes'][-1]['thingTypeName'].should.equal('thingTypeNameGroup') thing_types = client.list_thing_types(thingTypeName='thingTypeName') thing_types.should_not.have.key('nextToken') thing_types.should.have.key('thingTypes').which.should.have.length_of(2) thing_types['thingTypes'][0]['thingTypeName'].should.equal('thingTypeName') thing_types['thingTypes'][-1]['thingTypeName'].should.equal('thingTypeNameGroup') @mock_iot def test_list_things_with_next_token(): client = boto3.client('iot', region_name='ap-northeast-1') for i in range(0, 200): client.create_thing(thingName=str(i + 1)) things = client.list_things() things.should.have.key('nextToken') things.should.have.key('things').which.should.have.length_of(50) things['things'][0]['thingName'].should.equal('1') things['things'][0]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/1') things['things'][-1]['thingName'].should.equal('50') things['things'][-1]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/50') things = client.list_things(nextToken=things['nextToken']) things.should.have.key('nextToken') things.should.have.key('things').which.should.have.length_of(50) things['things'][0]['thingName'].should.equal('51') things['things'][0]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/51') things['things'][-1]['thingName'].should.equal('100') things['things'][-1]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/100') things = client.list_things(nextToken=things['nextToken']) things.should.have.key('nextToken') things.should.have.key('things').which.should.have.length_of(50) things['things'][0]['thingName'].should.equal('101') things['things'][0]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/101') things['things'][-1]['thingName'].should.equal('150') things['things'][-1]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/150') things = client.list_things(nextToken=things['nextToken']) things.should_not.have.key('nextToken') things.should.have.key('things').which.should.have.length_of(50) things['things'][0]['thingName'].should.equal('151') things['things'][0]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/151') things['things'][-1]['thingName'].should.equal('200') things['things'][-1]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/200') @mock_iot def test_list_things_with_attribute_and_thing_type_filter_and_next_token(): client = boto3.client('iot', region_name='ap-northeast-1') client.create_thing_type(thingTypeName='my-thing-type') for i in range(0, 200): if not (i + 1) % 3: attribute_payload = { 'attributes': { 'foo': 'bar' } } elif not (i + 1) % 5: attribute_payload = { 'attributes': { 'bar': 'foo' } } else: attribute_payload = {} if not (i + 1) % 2: thing_type_name = 'my-thing-type' client.create_thing(thingName=str(i + 1), thingTypeName=thing_type_name, attributePayload=attribute_payload) else: client.create_thing(thingName=str(i + 1), attributePayload=attribute_payload) # Test filter for thingTypeName things = client.list_things(thingTypeName=thing_type_name) things.should.have.key('nextToken') things.should.have.key('things').which.should.have.length_of(50) things['things'][0]['thingName'].should.equal('2') things['things'][0]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/2') things['things'][-1]['thingName'].should.equal('100') things['things'][-1]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/100') all(item['thingTypeName'] == thing_type_name for item in things['things']) things = client.list_things(nextToken=things['nextToken'], thingTypeName=thing_type_name) things.should_not.have.key('nextToken') things.should.have.key('things').which.should.have.length_of(50) things['things'][0]['thingName'].should.equal('102') things['things'][0]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/102') things['things'][-1]['thingName'].should.equal('200') things['things'][-1]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/200') all(item['thingTypeName'] == thing_type_name for item in things['things']) # Test filter for attributes things = client.list_things(attributeName='foo', attributeValue='bar') things.should.have.key('nextToken') things.should.have.key('things').which.should.have.length_of(50) things['things'][0]['thingName'].should.equal('3') things['things'][0]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/3') things['things'][-1]['thingName'].should.equal('150') things['things'][-1]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/150') all(item['attributes'] == {'foo': 'bar'} for item in things['things']) things = client.list_things(nextToken=things['nextToken'], attributeName='foo', attributeValue='bar') things.should_not.have.key('nextToken') things.should.have.key('things').which.should.have.length_of(16) things['things'][0]['thingName'].should.equal('153') things['things'][0]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/153') things['things'][-1]['thingName'].should.equal('198') things['things'][-1]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/198') all(item['attributes'] == {'foo': 'bar'} for item in things['things']) # Test filter for attributes and thingTypeName things = client.list_things(thingTypeName=thing_type_name, attributeName='foo', attributeValue='bar') things.should_not.have.key('nextToken') things.should.have.key('things').which.should.have.length_of(33) things['things'][0]['thingName'].should.equal('6') things['things'][0]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/6') things['things'][-1]['thingName'].should.equal('198') things['things'][-1]['thingArn'].should.equal('arn:aws:iot:ap-northeast-1:1:thing/198') all(item['attributes'] == {'foo': 'bar'} and item['thingTypeName'] == thing_type_name for item in things['things']) @mock_iot def test_certs(): client = boto3.client('iot', region_name='ap-northeast-1') cert = client.create_keys_and_certificate(setAsActive=True) cert.should.have.key('certificateArn').which.should_not.be.none cert.should.have.key('certificateId').which.should_not.be.none cert.should.have.key('certificatePem').which.should_not.be.none cert.should.have.key('keyPair') cert['keyPair'].should.have.key('PublicKey').which.should_not.be.none cert['keyPair'].should.have.key('PrivateKey').which.should_not.be.none cert_id = cert['certificateId'] cert = client.describe_certificate(certificateId=cert_id) cert.should.have.key('certificateDescription') cert_desc = cert['certificateDescription'] cert_desc.should.have.key('certificateArn').which.should_not.be.none cert_desc.should.have.key('certificateId').which.should_not.be.none cert_desc.should.have.key('certificatePem').which.should_not.be.none cert_desc.should.have.key('status').which.should.equal('ACTIVE') res = client.list_certificates() res.should.have.key('certificates').which.should.have.length_of(1) for cert in res['certificates']: cert.should.have.key('certificateArn').which.should_not.be.none cert.should.have.key('certificateId').which.should_not.be.none cert.should.have.key('status').which.should_not.be.none cert.should.have.key('creationDate').which.should_not.be.none client.update_certificate(certificateId=cert_id, newStatus='REVOKED') cert = client.describe_certificate(certificateId=cert_id) cert_desc.should.have.key('status').which.should.equal('ACTIVE') client.delete_certificate(certificateId=cert_id) res = client.list_certificates() res.should.have.key('certificates').which.should.have.length_of(0) @mock_iot def test_certs_create_inactive(): client = boto3.client('iot', region_name='ap-northeast-1') cert = client.create_keys_and_certificate(setAsActive=False) cert_id = cert['certificateId'] cert = client.describe_certificate(certificateId=cert_id) cert.should.have.key('certificateDescription') cert_desc = cert['certificateDescription'] cert_desc.should.have.key('status').which.should.equal('INACTIVE') client.update_certificate(certificateId=cert_id, newStatus='ACTIVE') cert = client.describe_certificate(certificateId=cert_id) cert.should.have.key('certificateDescription') cert_desc = cert['certificateDescription'] cert_desc.should.have.key('status').which.should.equal('ACTIVE') @mock_iot def test_policy(): client = boto3.client('iot', region_name='ap-northeast-1') name = 'my-policy' doc = '{}' policy = client.create_policy(policyName=name, policyDocument=doc) policy.should.have.key('policyName').which.should.equal(name) policy.should.have.key('policyArn').which.should_not.be.none policy.should.have.key('policyDocument').which.should.equal(doc) policy.should.have.key('policyVersionId').which.should.equal('1') policy = client.get_policy(policyName=name) policy.should.have.key('policyName').which.should.equal(name) policy.should.have.key('policyArn').which.should_not.be.none policy.should.have.key('policyDocument').which.should.equal(doc) policy.should.have.key('defaultVersionId').which.should.equal('1') res = client.list_policies() res.should.have.key('policies').which.should.have.length_of(1) for policy in res['policies']: policy.should.have.key('policyName').which.should_not.be.none policy.should.have.key('policyArn').which.should_not.be.none client.delete_policy(policyName=name) res = client.list_policies() res.should.have.key('policies').which.should.have.length_of(0) @mock_iot def test_principal_policy(): client = boto3.client('iot', region_name='ap-northeast-1') policy_name = 'my-policy' doc = '{}' policy = client.create_policy(policyName=policy_name, policyDocument=doc) cert = client.create_keys_and_certificate(setAsActive=True) cert_arn = cert['certificateArn'] client.attach_principal_policy(policyName=policy_name, principal=cert_arn) res = client.list_principal_policies(principal=cert_arn) res.should.have.key('policies').which.should.have.length_of(1) for policy in res['policies']: policy.should.have.key('policyName').which.should_not.be.none policy.should.have.key('policyArn').which.should_not.be.none res = client.list_policy_principals(policyName=policy_name) res.should.have.key('principals').which.should.have.length_of(1) for principal in res['principals']: principal.should_not.be.none client.detach_principal_policy(policyName=policy_name, principal=cert_arn) res = client.list_principal_policies(principal=cert_arn) res.should.have.key('policies').which.should.have.length_of(0) res = client.list_policy_principals(policyName=policy_name) res.should.have.key('principals').which.should.have.length_of(0) @mock_iot def test_principal_thing(): client = boto3.client('iot', region_name='ap-northeast-1') thing_name = 'my-thing' thing = client.create_thing(thingName=thing_name) cert = client.create_keys_and_certificate(setAsActive=True) cert_arn = cert['certificateArn'] client.attach_thing_principal(thingName=thing_name, principal=cert_arn) res = client.list_principal_things(principal=cert_arn) res.should.have.key('things').which.should.have.length_of(1) for thing in res['things']: thing.should_not.be.none res = client.list_thing_principals(thingName=thing_name) res.should.have.key('principals').which.should.have.length_of(1) for principal in res['principals']: principal.should_not.be.none client.detach_thing_principal(thingName=thing_name, principal=cert_arn) res = client.list_principal_things(principal=cert_arn) res.should.have.key('things').which.should.have.length_of(0) res = client.list_thing_principals(thingName=thing_name) res.should.have.key('principals').which.should.have.length_of(0) @mock_iot def test_thing_groups(): client = boto3.client('iot', region_name='ap-northeast-1') group_name = 'my-group-name' # thing group thing_group = client.create_thing_group(thingGroupName=group_name) thing_group.should.have.key('thingGroupName').which.should.equal(group_name) thing_group.should.have.key('thingGroupArn') res = client.list_thing_groups() res.should.have.key('thingGroups').which.should.have.length_of(1) for thing_group in res['thingGroups']: thing_group.should.have.key('groupName').which.should_not.be.none thing_group.should.have.key('groupArn').which.should_not.be.none thing_group = client.describe_thing_group(thingGroupName=group_name) thing_group.should.have.key('thingGroupName').which.should.equal(group_name) thing_group.should.have.key('thingGroupProperties') thing_group.should.have.key('thingGroupMetadata') thing_group.should.have.key('version') # delete thing group client.delete_thing_group(thingGroupName=group_name) res = client.list_thing_groups() res.should.have.key('thingGroups').which.should.have.length_of(0) # props create test props = { 'thingGroupDescription': 'my first thing group', 'attributePayload': { 'attributes': { 'key1': 'val01', 'Key02': 'VAL2' } } } thing_group = client.create_thing_group(thingGroupName=group_name, thingGroupProperties=props) thing_group.should.have.key('thingGroupName').which.should.equal(group_name) thing_group.should.have.key('thingGroupArn') thing_group = client.describe_thing_group(thingGroupName=group_name) thing_group.should.have.key('thingGroupProperties') \ .which.should.have.key('attributePayload') \ .which.should.have.key('attributes') res_props = thing_group['thingGroupProperties']['attributePayload']['attributes'] res_props.should.have.key('key1').which.should.equal('val01') res_props.should.have.key('Key02').which.should.equal('VAL2') # props update test with merge new_props = { 'attributePayload': { 'attributes': { 'k3': 'v3' }, 'merge': True } } client.update_thing_group( thingGroupName=group_name, thingGroupProperties=new_props ) thing_group = client.describe_thing_group(thingGroupName=group_name) thing_group.should.have.key('thingGroupProperties') \ .which.should.have.key('attributePayload') \ .which.should.have.key('attributes') res_props = thing_group['thingGroupProperties']['attributePayload']['attributes'] res_props.should.have.key('key1').which.should.equal('val01') res_props.should.have.key('Key02').which.should.equal('VAL2') res_props.should.have.key('k3').which.should.equal('v3') # props update test new_props = { 'attributePayload': { 'attributes': { 'k4': 'v4' } } } client.update_thing_group( thingGroupName=group_name, thingGroupProperties=new_props ) thing_group = client.describe_thing_group(thingGroupName=group_name) thing_group.should.have.key('thingGroupProperties') \ .which.should.have.key('attributePayload') \ .which.should.have.key('attributes') res_props = thing_group['thingGroupProperties']['attributePayload']['attributes'] res_props.should.have.key('k4').which.should.equal('v4') res_props.should_not.have.key('key1') @mock_iot def test_thing_group_relations(): client = boto3.client('iot', region_name='ap-northeast-1') name = 'my-thing' group_name = 'my-group-name' # thing group thing_group = client.create_thing_group(thingGroupName=group_name) thing_group.should.have.key('thingGroupName').which.should.equal(group_name) thing_group.should.have.key('thingGroupArn') # thing thing = client.create_thing(thingName=name) thing.should.have.key('thingName').which.should.equal(name) thing.should.have.key('thingArn') # add in 4 way client.add_thing_to_thing_group( thingGroupName=group_name, thingName=name ) client.add_thing_to_thing_group( thingGroupArn=thing_group['thingGroupArn'], thingArn=thing['thingArn'] ) client.add_thing_to_thing_group( thingGroupName=group_name, thingArn=thing['thingArn'] ) client.add_thing_to_thing_group( thingGroupArn=thing_group['thingGroupArn'], thingName=name ) things = client.list_things_in_thing_group( thingGroupName=group_name ) things.should.have.key('things') things['things'].should.have.length_of(1) thing_groups = client.list_thing_groups_for_thing( thingName=name ) thing_groups.should.have.key('thingGroups') thing_groups['thingGroups'].should.have.length_of(1) # remove in 4 way client.remove_thing_from_thing_group( thingGroupName=group_name, thingName=name ) client.remove_thing_from_thing_group( thingGroupArn=thing_group['thingGroupArn'], thingArn=thing['thingArn'] ) client.remove_thing_from_thing_group( thingGroupName=group_name, thingArn=thing['thingArn'] ) client.remove_thing_from_thing_group( thingGroupArn=thing_group['thingGroupArn'], thingName=name ) things = client.list_things_in_thing_group( thingGroupName=group_name ) things.should.have.key('things') things['things'].should.have.length_of(0) # update thing group for thing client.update_thing_groups_for_thing( thingName=name, thingGroupsToAdd=[ group_name ] ) things = client.list_things_in_thing_group( thingGroupName=group_name ) things.should.have.key('things') things['things'].should.have.length_of(1) client.update_thing_groups_for_thing( thingName=name, thingGroupsToRemove=[ group_name ] ) things = client.list_things_in_thing_group( thingGroupName=group_name ) things.should.have.key('things') things['things'].should.have.length_of(0) @mock_iot def test_create_job(): client = boto3.client('iot', region_name='eu-west-1') name = "my-thing" job_id = "TestJob" # thing thing = client.create_thing(thingName=name) thing.should.have.key('thingName').which.should.equal(name) thing.should.have.key('thingArn') # job document job_document = { "field": "value" } job = client.create_job( jobId=job_id, targets=[thing["thingArn"]], document=json.dumps(job_document), description="Description", presignedUrlConfig={ 'roleArn': 'arn:aws:iam::1:role/service-role/iot_job_role', 'expiresInSec': 123 }, targetSelection="CONTINUOUS", jobExecutionsRolloutConfig={ 'maximumPerMinute': 10 } ) job.should.have.key('jobId').which.should.equal(job_id) job.should.have.key('jobArn') job.should.have.key('description') @mock_iot def test_describe_job(): client = boto3.client('iot', region_name='eu-west-1') name = "my-thing" job_id = "TestJob" # thing thing = client.create_thing(thingName=name) thing.should.have.key('thingName').which.should.equal(name) thing.should.have.key('thingArn') job = client.create_job( jobId=job_id, targets=[thing["thingArn"]], documentSource="https://s3-eu-west-1.amazonaws.com/bucket-name/job_document.json", presignedUrlConfig={ 'roleArn': 'arn:aws:iam::1:role/service-role/iot_job_role', 'expiresInSec': 123 }, targetSelection="CONTINUOUS", jobExecutionsRolloutConfig={ 'maximumPerMinute': 10 } ) job.should.have.key('jobId').which.should.equal(job_id) job.should.have.key('jobArn') job = client.describe_job(jobId=job_id) job.should.have.key('documentSource') job.should.have.key('job') job.should.have.key('job').which.should.have.key("jobArn") job.should.have.key('job').which.should.have.key("jobId").which.should.equal(job_id) job.should.have.key('job').which.should.have.key("targets") job.should.have.key('job').which.should.have.key("jobProcessDetails") job.should.have.key('job').which.should.have.key("lastUpdatedAt") job.should.have.key('job').which.should.have.key("createdAt") job.should.have.key('job').which.should.have.key("jobExecutionsRolloutConfig") job.should.have.key('job').which.should.have.key("targetSelection").which.should.equal("CONTINUOUS") job.should.have.key('job').which.should.have.key("presignedUrlConfig") job.should.have.key('job').which.should.have.key("presignedUrlConfig").which.should.have.key( "roleArn").which.should.equal('arn:aws:iam::1:role/service-role/iot_job_role') job.should.have.key('job').which.should.have.key("presignedUrlConfig").which.should.have.key( "expiresInSec").which.should.equal(123) job.should.have.key('job').which.should.have.key("jobExecutionsRolloutConfig").which.should.have.key( "maximumPerMinute").which.should.equal(10) @mock_iot def test_describe_job_1(): client = boto3.client('iot', region_name='eu-west-1') name = "my-thing" job_id = "TestJob" # thing thing = client.create_thing(thingName=name) thing.should.have.key('thingName').which.should.equal(name) thing.should.have.key('thingArn') # job document job_document = { "field": "value" } job = client.create_job( jobId=job_id, targets=[thing["thingArn"]], document=json.dumps(job_document), presignedUrlConfig={ 'roleArn': 'arn:aws:iam::1:role/service-role/iot_job_role', 'expiresInSec': 123 }, targetSelection="CONTINUOUS", jobExecutionsRolloutConfig={ 'maximumPerMinute': 10 } ) job.should.have.key('jobId').which.should.equal(job_id) job.should.have.key('jobArn') job = client.describe_job(jobId=job_id) job.should.have.key('job') job.should.have.key('job').which.should.have.key("jobArn") job.should.have.key('job').which.should.have.key("jobId").which.should.equal(job_id) job.should.have.key('job').which.should.have.key("targets") job.should.have.key('job').which.should.have.key("jobProcessDetails") job.should.have.key('job').which.should.have.key("lastUpdatedAt") job.should.have.key('job').which.should.have.key("createdAt") job.should.have.key('job').which.should.have.key("jobExecutionsRolloutConfig") job.should.have.key('job').which.should.have.key("targetSelection").which.should.equal("CONTINUOUS") job.should.have.key('job').which.should.have.key("presignedUrlConfig") job.should.have.key('job').which.should.have.key("presignedUrlConfig").which.should.have.key( "roleArn").which.should.equal('arn:aws:iam::1:role/service-role/iot_job_role') job.should.have.key('job').which.should.have.key("presignedUrlConfig").which.should.have.key( "expiresInSec").which.should.equal(123) job.should.have.key('job').which.should.have.key("jobExecutionsRolloutConfig").which.should.have.key( "maximumPerMinute").which.should.equal(10)
# -*- coding: utf-8 -*- # # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. import json import unittest import requests import requests_mock import tenacity from parameterized import parameterized from airflow.exceptions import AirflowException from airflow.hooks.http_hook import HttpHook from airflow.models import Connection from tests.compat import mock def get_airflow_connection(conn_id=None): return Connection( conn_id='http_default', conn_type='http', host='test:8080/', extra='{"bareer": "test"}' ) def get_airflow_connection_with_port(conn_id=None): return Connection( conn_id='http_default', conn_type='http', host='test.com', port=1234 ) class TestHttpHook(unittest.TestCase): """Test get, post and raise_for_status""" def setUp(self): session = requests.Session() adapter = requests_mock.Adapter() session.mount('mock', adapter) self.get_hook = HttpHook(method='GET') self.get_lowercase_hook = HttpHook(method='get') self.post_hook = HttpHook(method='POST') @requests_mock.mock() def test_raise_for_status_with_200(self, m): m.get( 'http://test:8080/v1/test', status_code=200, text='{"status":{"status": 200}}', reason='OK' ) with mock.patch( 'airflow.hooks.base_hook.BaseHook.get_connection', side_effect=get_airflow_connection ): resp = self.get_hook.run('v1/test') self.assertEqual(resp.text, '{"status":{"status": 200}}') @mock.patch('requests.Session') @mock.patch('requests.Request') def test_get_request_with_port(self, request_mock, session_mock): from requests.exceptions import MissingSchema with mock.patch( 'airflow.hooks.base_hook.BaseHook.get_connection', side_effect=get_airflow_connection_with_port ): expected_url = 'http://test.com:1234/some/endpoint' for endpoint in ['some/endpoint', '/some/endpoint']: try: self.get_hook.run(endpoint) except MissingSchema: pass request_mock.assert_called_once_with( mock.ANY, expected_url, headers=mock.ANY, params=mock.ANY ) request_mock.reset_mock() session_mock.reset_mock() @requests_mock.mock() def test_get_request_do_not_raise_for_status_if_check_response_is_false(self, m): m.get( 'http://test:8080/v1/test', status_code=404, text='{"status":{"status": 404}}', reason='Bad request' ) with mock.patch( 'airflow.hooks.base_hook.BaseHook.get_connection', side_effect=get_airflow_connection ): resp = self.get_hook.run('v1/test', extra_options={'check_response': False}) self.assertEqual(resp.text, '{"status":{"status": 404}}') @requests_mock.mock() def test_hook_contains_header_from_extra_field(self, m): with mock.patch( 'airflow.hooks.base_hook.BaseHook.get_connection', side_effect=get_airflow_connection ): expected_conn = get_airflow_connection() conn = self.get_hook.get_conn() self.assertDictContainsSubset(json.loads(expected_conn.extra), conn.headers) self.assertEqual(conn.headers.get('bareer'), 'test') @requests_mock.mock() @mock.patch('requests.Request') def test_hook_with_method_in_lowercase(self, m, request_mock): from requests.exceptions import MissingSchema, InvalidURL with mock.patch( 'airflow.hooks.base_hook.BaseHook.get_connection', side_effect=get_airflow_connection_with_port ): data = "test params" try: self.get_lowercase_hook.run('v1/test', data=data) except (MissingSchema, InvalidURL): pass request_mock.assert_called_once_with( mock.ANY, mock.ANY, headers=mock.ANY, params=data ) @requests_mock.mock() def test_hook_uses_provided_header(self, m): conn = self.get_hook.get_conn(headers={"bareer": "newT0k3n"}) self.assertEqual(conn.headers.get('bareer'), "newT0k3n") @requests_mock.mock() def test_hook_has_no_header_from_extra(self, m): conn = self.get_hook.get_conn() self.assertIsNone(conn.headers.get('bareer')) @requests_mock.mock() def test_hooks_header_from_extra_is_overridden(self, m): with mock.patch( 'airflow.hooks.base_hook.BaseHook.get_connection', side_effect=get_airflow_connection ): conn = self.get_hook.get_conn(headers={"bareer": "newT0k3n"}) self.assertEqual(conn.headers.get('bareer'), 'newT0k3n') @requests_mock.mock() def test_post_request(self, m): m.post( 'http://test:8080/v1/test', status_code=200, text='{"status":{"status": 200}}', reason='OK' ) with mock.patch( 'airflow.hooks.base_hook.BaseHook.get_connection', side_effect=get_airflow_connection ): resp = self.post_hook.run('v1/test') self.assertEqual(resp.status_code, 200) @requests_mock.mock() def test_post_request_with_error_code(self, m): m.post( 'http://test:8080/v1/test', status_code=418, text='{"status":{"status": 418}}', reason='I\'m a teapot' ) with mock.patch( 'airflow.hooks.base_hook.BaseHook.get_connection', side_effect=get_airflow_connection ): with self.assertRaises(AirflowException): self.post_hook.run('v1/test') @requests_mock.mock() def test_post_request_do_not_raise_for_status_if_check_response_is_false(self, m): m.post( 'http://test:8080/v1/test', status_code=418, text='{"status":{"status": 418}}', reason='I\'m a teapot' ) with mock.patch( 'airflow.hooks.base_hook.BaseHook.get_connection', side_effect=get_airflow_connection ): resp = self.post_hook.run('v1/test', extra_options={'check_response': False}) self.assertEqual(resp.status_code, 418) @mock.patch('airflow.hooks.http_hook.requests.Session') def test_retry_on_conn_error(self, mocked_session): retry_args = dict( wait=tenacity.wait_none(), stop=tenacity.stop_after_attempt(7), retry=tenacity.retry_if_exception_type( requests.exceptions.ConnectionError ) ) def send_and_raise(request, **kwargs): raise requests.exceptions.ConnectionError mocked_session().send.side_effect = send_and_raise # The job failed for some reason with self.assertRaises(tenacity.RetryError): self.get_hook.run_with_advanced_retry( endpoint='v1/test', _retry_args=retry_args ) self.assertEqual( self.get_hook._retry_obj.stop.max_attempt_number + 1, mocked_session.call_count ) @requests_mock.mock() def test_run_with_advanced_retry(self, m): m.get( u'http://test:8080/v1/test', status_code=200, reason=u'OK' ) retry_args = dict( wait=tenacity.wait_none(), stop=tenacity.stop_after_attempt(3), retry=tenacity.retry_if_exception_type(Exception), reraise=True ) with mock.patch( 'airflow.hooks.base_hook.BaseHook.get_connection', side_effect=get_airflow_connection ): response = self.get_hook.run_with_advanced_retry( endpoint='v1/test', _retry_args=retry_args ) self.assertIsInstance(response, requests.Response) def test_header_from_extra_and_run_method_are_merged(self): def run_and_return(session, prepped_request, extra_options, **kwargs): return prepped_request # The job failed for some reason with mock.patch( 'airflow.hooks.http_hook.HttpHook.run_and_check', side_effect=run_and_return ): with mock.patch( 'airflow.hooks.base_hook.BaseHook.get_connection', side_effect=get_airflow_connection ): pr = self.get_hook.run('v1/test', headers={'some_other_header': 'test'}) actual = dict(pr.headers) self.assertEqual(actual.get('bareer'), 'test') self.assertEqual(actual.get('some_other_header'), 'test') @mock.patch('airflow.hooks.http_hook.HttpHook.get_connection') def test_http_connection(self, mock_get_connection): c = Connection(conn_id='http_default', conn_type='http', host='localhost', schema='http') mock_get_connection.return_value = c hook = HttpHook() hook.get_conn({}) self.assertEqual(hook.base_url, 'http://localhost') @mock.patch('airflow.hooks.http_hook.HttpHook.get_connection') def test_https_connection(self, mock_get_connection): c = Connection(conn_id='http_default', conn_type='http', host='localhost', schema='https') mock_get_connection.return_value = c hook = HttpHook() hook.get_conn({}) self.assertEqual(hook.base_url, 'https://localhost') @mock.patch('airflow.hooks.http_hook.HttpHook.get_connection') def test_host_encoded_http_connection(self, mock_get_connection): c = Connection(conn_id='http_default', conn_type='http', host='http://localhost') mock_get_connection.return_value = c hook = HttpHook() hook.get_conn({}) self.assertEqual(hook.base_url, 'http://localhost') @mock.patch('airflow.hooks.http_hook.HttpHook.get_connection') def test_host_encoded_https_connection(self, mock_get_connection): c = Connection(conn_id='http_default', conn_type='http', host='https://localhost') mock_get_connection.return_value = c hook = HttpHook() hook.get_conn({}) self.assertEqual(hook.base_url, 'https://localhost') def test_method_converted_to_uppercase_when_created_in_lowercase(self): self.assertEqual(self.get_lowercase_hook.method, 'GET') @mock.patch('airflow.hooks.http_hook.HttpHook.get_connection') def test_connection_without_host(self, mock_get_connection): c = Connection(conn_id='http_default', conn_type='http') mock_get_connection.return_value = c hook = HttpHook() hook.get_conn({}) self.assertEqual(hook.base_url, 'http://') @parameterized.expand([ 'GET', 'POST', ]) @requests_mock.mock() def test_json_request(self, method, mock_requests): obj1 = {'a': 1, 'b': 'abc', 'c': [1, 2, {"d": 10}]} def match_obj1(request): return request.json() == obj1 mock_requests.request( method=method, url='//test:8080/v1/test', additional_matcher=match_obj1 ) with mock.patch( 'airflow.hooks.base_hook.BaseHook.get_connection', side_effect=get_airflow_connection ): # will raise NoMockAddress exception if obj1 != request.json() HttpHook(method=method).run('v1/test', json=obj1) send_email_test = mock.Mock()
__author__ = "Mihaela Rosca" __contact__ = "mihaela.c.rosca@gmail.com" import heapq import matplotlib.pyplot as plt import numpy import os import scipy import scipy.linalg from os.path import isfile, join from scipy import misc # Import all common functions from common import * # The directory path to the images PICTURE_PATH = "/pics/cambrdige_pics/" # The current directory where the script is ran currentDir = os.path.dirname(os.path.abspath(__file__)) """ Converts the data to zero mean data. """ def convertDataToZeroMean(data): means = scipy.mean(data, axis=0) rows, cols = data.shape zeroMean = numpy.zeros((rows, cols)) for i in xrange(rows): zeroMean[i] = data[i] - means assert zeroMean.shape == data.shape return zeroMean """ Uses a heuristic to evaluate how many dimensions should the data be reduced to. Arguments: eigenValues: The eigen values of the covariance matrix, or numbers proportional to them. Should be a numpy 1-D array. Returns: The dimension the data should be reduced to. """ def dimensionFromEigenIndividualVariance(eigenValues): threshold = 0.01 dimension = 0 s = numpy.sum(eigenValues) print "sum eigen" + str(s) for eigen in eigenValues: r = eigen / s if r > threshold: dimension += 1 return dimension # requires the eigen values to be sorted before def dimensionFromEigenTotalVariance(eigenValues): threshold = 0.95 dimension = 0 s = numpy.sum(eigenValues) print "sum eigen" + str(s) current = 0 for eigen in eigenValues: r = (eigen / s) current += r if current >= threshold: break dimension += 1 return dimension """ This method uses the Karhunen Lowe transform to fastly compute the eigen vaues of the data. It is faster than the SVD method below, but can be prone to floating point errors more than the SVD one. Arguments: train: Numpy array of arrays dimension: the dimension to which to reduce the size of the data set. Returns: The principal components of the data. """ # Returns the principal components of the given training # data by commputing the principal eigen vectors of the # covariance matrix of the data def pca(train, dimension): # Use the Karhunen Lowe transform to fastly compute # the principal components. rows, cols = train.shape # Step1: Get the mean of each column of the data # Ie create the average image u = convertDataToZeroMean(train) # Step2: Compute the eigen values of the U * U^T matrix # the size of U * U^T is rows * rows (ie the number of data points you have # in your training) eigVals, eigVecs = scipy.linalg.eig(u.dot(u.T)) # Step3: Compute the eigen values of U^T*U from the eigen values of U * U^T bigEigVecs = numpy.zeros((rows, cols)) for i in xrange(rows): bigEigVecs[i] = u.T.dot(eigVecs[:, i]) # Step 4: Normalize the eigen vectors to get orthonormal components bigEigVecs = map(lambda x: x / scipy.linalg.norm(x), bigEigVecs) eigValsBigVecs = zip(eigVals, bigEigVecs) sortedEigValsBigVecs = sorted(eigValsBigVecs, key=lambda x : x[0], reverse=True) index = 0 if dimension == None: # Get the eigen values # Note that these are not the eigen values of the covariance matrix # but the eigen values of U * U ^T # however, this is fine because they just differ by a factor # so the ratio between eigen values will be preserved eigenValues = map(lambda x : x[0], sortedEigValsBigVecs) dimension = dimensionFromEigenTotalVariance(eigenValues) print "Using PCA dimension " + str(dimension) result = np.empty(rows, dimension) for eigVal, vector in sortedEigValsBigVecs: if index >= dimension: break if eigVal <=0: print "Warning: Non-positive eigen value" result[:, index] = vector index = index + 1 return result """ Arguments: train: Numpy array of arrays dimension: the dimension to which to reduce the size of the data set. Returns: The principal components of the data. This method should be preferred over the above: it is well known that the SVD methods are more stable than the ones that require the computation of the eigen values and eigen vectors. For more detail see: http://math.stackexchange.com/questions/3869/what-is-the-intuitive-relationship-between-svd-and-pca """ def pcaWithSVD(train, dimension=None): zeroMean = convertDataToZeroMean(train) # SVD guaranteed that the singular values are in non-increasing order # this means that the u's are already ordered as required, according # to the magnitute of the eigen values u, s, vh = scipy.linalg.svd(zeroMean) if dimension == None: # Get the eigen values from the singular values eigenValues = s ** 2; dimension = dimensionFromEigenTotalVariance(eigenValues) print "Using PCA dimension " + str(dimension) return vh[0:dimension-1] """ Arguments: pcaMethod: a method to use for PCA. images: A python list of images that have to be of the same size. dimension: the dimension to which to reduce the size of the data set. Returns: A tuple: The first element of the tuple is formed from the eigen faces of given images. The second element of the tuple if formed from the vector version of the eigen faces. This is kept for optimization reasons. """ def getEigenFaces(pcaMethod, images, dimension=None): imgSize = images[0].shape; # this call should not be here: the code should assume that the images have # been transofrmed to vectors before imgs = imagesToVectors(images) vectors = pcaMethod(imgs, dimension) eigenFaces = map(lambda x: vectorToImage(x, imgSize), vectors) return (eigenFaces, vectors) def reduce(principalComponents, vectors): assert len(principalComponents) > 0 print principalComponents[0].shape principalComponents = np.array(principalComponents) lowDimRepresentation = np.dot(vectors, principalComponents.T) # lowDimRepresentation = map(lambda x : vectors.dot(x), principalComponents) # sameDimRepresentation = \ # sum([ x * y for x, y in zip(principalComponents, lowDimRepresentation)]) # TODO: do this with einsum sameDimRepresentation = lowDimRepresentation[:, np.newaxis] * principalComponents.T sameDimRepresentation = sameDimRepresentation.sum(axis=2) # TODO: create the proper thing here so that you can # easily see what the ouput is return (lowDimRepresentation, sameDimRepresentation) """ Reduces a 2D image represented by a numpy 2D array of integer values(pixels) to a lower dimension, dictated by the number of principal components. """ def reduceImageToLowerDimensions(principalComponents, image2D): assert len(principalComponents) > 0 size = principalComponents[0].shape vector = vectorToImage(image2D, size) lowDimRepresentation = map(lambda x : x.T.dot(vector), principalComponents) sameDimRepresentation = \ sum([ x * y for x, y in zip(principalComponents, lowDimRepresentation)]) return (lowDimRepresentation, sameDimRepresentation) def main(): # Load all the image files in the current directory picFiles = [] path = currentDir + PICTURE_PATH for root, dirs, files in os.walk(path): if root != path: picFiles += map(lambda x: os.path.join(root, x), files) print len(picFiles) imgs = map(lambda x: misc.imread(x, flatten=True), picFiles) eigenFaces, principalComponents = getEigenFaces(pca, imgs) # plt.imshow(eigenFaces[0], cmap=plt.cm.gray) # plt.show() lowDimRepresentation, sameDimRepresentation = \ reduceImageToLowerDimensions(principalComponents, imgs[0]) plt.imshow(imgs[0], cmap=plt.cm.gray) plt.show() image2D = vectorToImage(sameDimRepresentation, imgs[0].shape) plt.imshow(image2D, cmap=plt.cm.gray) plt.show() print "done" if __name__ == '__main__': main()
#! /usr/bin/env nix-shell #! nix-shell -i python3 -p "python3.withPackages (ps: with ps; [ mypy attrs packaging rich ]) # # This script downloads Home Assistant's source tarball. # Inside the homeassistant/components directory, each integration has an associated manifest.json, # specifying required packages and other integrations it depends on: # # { # "requirements": [ "package==1.2.3" ], # "dependencies": [ "component" ] # } # # By parsing the files, a dictionary mapping integrations to requirements and dependencies is created. # For all of these requirements and the dependencies' requirements, # nixpkgs' python3Packages are searched for appropriate names. # Then, a Nix attribute set mapping integration name to dependencies is created. import json import os import pathlib import re import subprocess import sys import tarfile import tempfile from functools import reduce from io import BytesIO from typing import Dict, Optional, Set, Any from urllib.request import urlopen from packaging import version as Version from rich.console import Console from rich.table import Table COMPONENT_PREFIX = "homeassistant.components" PKG_SET = "home-assistant.python.pkgs" # If some requirements are matched by multiple or no Python packages, the # following can be used to choose the correct one PKG_PREFERENCES = { "youtube_dl": "youtube-dl-light", "tensorflow": "tensorflow", "fiblary3": "fiblary3-fork", # https://github.com/home-assistant/core/issues/66466 } def run_mypy() -> None: cmd = ["mypy", "--ignore-missing-imports", __file__] print(f"$ {' '.join(cmd)}") subprocess.run(cmd, check=True) def get_version(): with open(os.path.dirname(sys.argv[0]) + "/default.nix") as f: # A version consists of digits, dots, and possibly a "b" (for beta) m = re.search('hassVersion = "([\\d\\.b]+)";', f.read()) return m.group(1) def parse_components(version: str = "master"): components = {} components_with_tests = [] with tempfile.TemporaryDirectory() as tmp: with urlopen( f"https://github.com/home-assistant/home-assistant/archive/{version}.tar.gz" ) as response: tarfile.open(fileobj=BytesIO(response.read())).extractall(tmp) # Use part of a script from the Home Assistant codebase core_path = os.path.join(tmp, f"core-{version}") for entry in os.scandir(os.path.join(core_path, "tests/components")): if entry.is_dir(): components_with_tests.append(entry.name) sys.path.append(core_path) from script.hassfest.model import Integration integrations = Integration.load_dir( pathlib.Path( os.path.join(core_path, "homeassistant/components") ) ) for domain in sorted(integrations): integration = integrations[domain] if not integration.disabled: components[domain] = integration.manifest return components, components_with_tests # Recursively get the requirements of a component and its dependencies def get_reqs(components: Dict[str, Dict[str, Any]], component: str, processed: Set[str]) -> Set[str]: requirements = set(components[component].get("requirements", [])) deps = components[component].get("dependencies", []) deps.extend(components[component].get("after_dependencies", [])) processed.add(component) for dependency in deps: if dependency not in processed: requirements.update(get_reqs(components, dependency, processed)) return requirements def dump_packages() -> Dict[str, Dict[str, str]]: # Store a JSON dump of Nixpkgs' python3Packages output = subprocess.check_output( [ "nix-env", "-f", os.path.dirname(sys.argv[0]) + "/../../..", "-qa", "-A", PKG_SET, "--arg", "config", "{ allowAliases = false; }", "--json", ] ) return json.loads(output) def name_to_attr_path(req: str, packages: Dict[str, Dict[str, str]]) -> Optional[str]: if req in PKG_PREFERENCES: return f"{PKG_SET}.{PKG_PREFERENCES[req]}" attr_paths = [] names = [req] # E.g. python-mpd2 is actually called python3.6-mpd2 # instead of python-3.6-python-mpd2 inside Nixpkgs if req.startswith("python-") or req.startswith("python_"): names.append(req[len("python-") :]) for name in names: # treat "-" and "_" equally name = re.sub("[-_]", "[-_]", name) # python(minor).(major)-(pname)-(version or unstable-date) # we need the version qualifier, or we'll have multiple matches # (e.g. pyserial and pyserial-asyncio when looking for pyserial) pattern = re.compile(f"^python\\d\\.\\d-{name}-(?:\\d|unstable-.*)", re.I) for attr_path, package in packages.items(): if pattern.match(package["name"]): attr_paths.append(attr_path) # Let's hope there's only one derivation with a matching name assert len(attr_paths) <= 1, f"{req} matches more than one derivation: {attr_paths}" if attr_paths: return attr_paths[0] else: return None def get_pkg_version(package: str, packages: Dict[str, Dict[str, str]]) -> Optional[str]: pkg = packages.get(f"{PKG_SET}.{package}", None) if not pkg: return None return pkg["version"] def main() -> None: packages = dump_packages() version = get_version() print("Generating component-packages.nix for version {}".format(version)) components, components_with_tests = parse_components(version=version) build_inputs = {} outdated = {} for component in sorted(components.keys()): attr_paths = [] missing_reqs = [] reqs = sorted(get_reqs(components, component, set())) for req in reqs: # Some requirements are specified by url, e.g. https://example.org/foobar#xyz==1.0.0 # Therefore, if there's a "#" in the line, only take the part after it req = req[req.find("#") + 1 :] name, required_version = req.split("==", maxsplit=1) # Remove extra_require from name, e.g. samsungctl instead of # samsungctl[websocket] if name.endswith("]"): name = name[:name.find("[")] attr_path = name_to_attr_path(name, packages) if our_version := get_pkg_version(name, packages): if Version.parse(our_version) < Version.parse(required_version): outdated[name] = { 'wanted': required_version, 'current': our_version } if attr_path is not None: # Add attribute path without "python3Packages." prefix attr_paths.append(attr_path[len(PKG_SET + ".") :]) else: missing_reqs.append(name) else: build_inputs[component] = (attr_paths, missing_reqs) with open(os.path.dirname(sys.argv[0]) + "/component-packages.nix", "w") as f: f.write("# Generated by parse-requirements.py\n") f.write("# Do not edit!\n\n") f.write("{\n") f.write(f' version = "{version}";\n') f.write(" components = {\n") for component, deps in build_inputs.items(): available, missing = deps f.write(f' "{component}" = ps: with ps; [') if available: f.write(" " + " ".join(available)) f.write(" ];") if len(missing) > 0: f.write(f" # missing inputs: {' '.join(missing)}") f.write("\n") f.write(" };\n") f.write(" # components listed in tests/components for which all dependencies are packaged\n") f.write(" supportedComponentsWithTests = [\n") for component, deps in build_inputs.items(): available, missing = deps if len(missing) == 0 and component in components_with_tests: f.write(f' "{component}"' + "\n") f.write(" ];\n") f.write("}\n") supported_components = reduce(lambda n, c: n + (build_inputs[c][1] == []), components.keys(), 0) total_components = len(components) print(f"{supported_components} / {total_components} components supported, " f"i.e. {supported_components / total_components:.2%}") if outdated: table = Table(title="Outdated dependencies") table.add_column("Package") table.add_column("Current") table.add_column("Wanted") for package, version in sorted(outdated.items()): table.add_row(package, version['current'], version['wanted']) console = Console() console.print(table) if __name__ == "__main__": run_mypy() main()
# Copyright 2016 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """A library of helpers for use with SamplingDecoders. """ from __future__ import absolute_import from __future__ import division from __future__ import print_function import abc import six from tensorflow.contrib.seq2seq.python.ops import decoder from tensorflow.python.framework import dtypes from tensorflow.python.framework import ops from tensorflow.python.framework import tensor_shape from tensorflow.python.ops import array_ops from tensorflow.python.ops import control_flow_ops from tensorflow.python.ops import embedding_ops from tensorflow.python.ops import gen_array_ops from tensorflow.python.ops import math_ops from tensorflow.python.ops import tensor_array_ops from tensorflow.python.ops.distributions import bernoulli from tensorflow.python.ops.distributions import categorical from tensorflow.python.util import nest __all__ = [ "Helper", "TrainingHelper", "GreedyEmbeddingHelper", "SampleEmbeddingHelper", "CustomHelper", "ScheduledEmbeddingTrainingHelper", "ScheduledOutputTrainingHelper", "InferenceHelper", ] _transpose_batch_time = decoder._transpose_batch_time # pylint: disable=protected-access def _unstack_ta(inp): return tensor_array_ops.TensorArray( dtype=inp.dtype, size=array_ops.shape(inp)[0], element_shape=inp.get_shape()[1:]).unstack(inp) @six.add_metaclass(abc.ABCMeta) class Helper(object): """Interface for implementing sampling in seq2seq decoders. Helper instances are used by `BasicDecoder`. """ @abc.abstractproperty def batch_size(self): """Batch size of tensor returned by `sample`. Returns a scalar int32 tensor. """ raise NotImplementedError("batch_size has not been implemented") @abc.abstractproperty def sample_ids_shape(self): """Shape of tensor returned by `sample`, excluding the batch dimension. Returns a `TensorShape`. """ raise NotImplementedError("sample_ids_shape has not been implemented") @abc.abstractproperty def sample_ids_dtype(self): """DType of tensor returned by `sample`. Returns a DType. """ raise NotImplementedError("sample_ids_dtype has not been implemented") @abc.abstractmethod def initialize(self, name=None): """Returns `(initial_finished, initial_inputs)`.""" pass @abc.abstractmethod def sample(self, time, outputs, state, name=None): """Returns `sample_ids`.""" pass @abc.abstractmethod def next_inputs(self, time, outputs, state, sample_ids, name=None): """Returns `(finished, next_inputs, next_state)`.""" pass class CustomHelper(Helper): """Base abstract class that allows the user to customize sampling.""" def __init__(self, initialize_fn, sample_fn, next_inputs_fn, sample_ids_shape=None, sample_ids_dtype=None): """Initializer. Args: initialize_fn: callable that returns `(finished, next_inputs)` for the first iteration. sample_fn: callable that takes `(time, outputs, state)` and emits tensor `sample_ids`. next_inputs_fn: callable that takes `(time, outputs, state, sample_ids)` and emits `(finished, next_inputs, next_state)`. sample_ids_shape: Either a list of integers, or a 1-D Tensor of type `int32`, the shape of each value in the `sample_ids` batch. Defaults to a scalar. sample_ids_dtype: The dtype of the `sample_ids` tensor. Defaults to int32. """ self._initialize_fn = initialize_fn self._sample_fn = sample_fn self._next_inputs_fn = next_inputs_fn self._batch_size = None self._sample_ids_shape = tensor_shape.TensorShape(sample_ids_shape or []) self._sample_ids_dtype = sample_ids_dtype or dtypes.int32 @property def batch_size(self): if self._batch_size is None: raise ValueError("batch_size accessed before initialize was called") return self._batch_size @property def sample_ids_shape(self): return self._sample_ids_shape @property def sample_ids_dtype(self): return self._sample_ids_dtype def initialize(self, name=None): with ops.name_scope(name, "%sInitialize" % type(self).__name__): (finished, next_inputs) = self._initialize_fn() if self._batch_size is None: self._batch_size = array_ops.size(finished) return (finished, next_inputs) def sample(self, time, outputs, state, name=None): with ops.name_scope( name, "%sSample" % type(self).__name__, (time, outputs, state)): return self._sample_fn(time=time, outputs=outputs, state=state) def next_inputs(self, time, outputs, state, sample_ids, name=None): with ops.name_scope( name, "%sNextInputs" % type(self).__name__, (time, outputs, state)): return self._next_inputs_fn( time=time, outputs=outputs, state=state, sample_ids=sample_ids) class TrainingHelper(Helper): """A helper for use during training. Only reads inputs. Returned sample_ids are the argmax of the RNN output logits. """ def __init__(self, inputs, sequence_length, time_major=False, name=None): """Initializer. Args: inputs: A (structure of) input tensors. sequence_length: An int32 vector tensor. time_major: Python bool. Whether the tensors in `inputs` are time major. If `False` (default), they are assumed to be batch major. name: Name scope for any created operations. Raises: ValueError: if `sequence_length` is not a 1D tensor. """ with ops.name_scope(name, "TrainingHelper", [inputs, sequence_length]): inputs = ops.convert_to_tensor(inputs, name="inputs") if not time_major: inputs = nest.map_structure(_transpose_batch_time, inputs) self._input_tas = nest.map_structure(_unstack_ta, inputs) self._sequence_length = ops.convert_to_tensor( sequence_length, name="sequence_length") if self._sequence_length.get_shape().ndims != 1: raise ValueError( "Expected sequence_length to be a vector, but received shape: %s" % self._sequence_length.get_shape()) self._zero_inputs = nest.map_structure( lambda inp: array_ops.zeros_like(inp[0, :]), inputs) self._batch_size = array_ops.size(sequence_length) @property def batch_size(self): return self._batch_size @property def sample_ids_shape(self): return tensor_shape.TensorShape([]) @property def sample_ids_dtype(self): return dtypes.int32 def initialize(self, name=None): with ops.name_scope(name, "TrainingHelperInitialize"): finished = math_ops.equal(0, self._sequence_length) all_finished = math_ops.reduce_all(finished) next_inputs = control_flow_ops.cond( all_finished, lambda: self._zero_inputs, lambda: nest.map_structure(lambda inp: inp.read(0), self._input_tas)) return (finished, next_inputs) def sample(self, time, outputs, name=None, **unused_kwargs): with ops.name_scope(name, "TrainingHelperSample", [time, outputs]): sample_ids = math_ops.cast( math_ops.argmax(outputs, axis=-1), dtypes.int32) return sample_ids def next_inputs(self, time, outputs, state, name=None, **unused_kwargs): """next_inputs_fn for TrainingHelper.""" with ops.name_scope(name, "TrainingHelperNextInputs", [time, outputs, state]): next_time = time + 1 finished = (next_time >= self._sequence_length) all_finished = math_ops.reduce_all(finished) def read_from_ta(inp): return inp.read(next_time) next_inputs = control_flow_ops.cond( all_finished, lambda: self._zero_inputs, lambda: nest.map_structure(read_from_ta, self._input_tas)) return (finished, next_inputs, state) class ScheduledEmbeddingTrainingHelper(TrainingHelper): """A training helper that adds scheduled sampling. Returns -1s for sample_ids where no sampling took place; valid sample id values elsewhere. """ def __init__(self, inputs, sequence_length, embedding, sampling_probability, time_major=False, seed=None, scheduling_seed=None, name=None): """Initializer. Args: inputs: A (structure of) input tensors. sequence_length: An int32 vector tensor. embedding: A callable that takes a vector tensor of `ids` (argmax ids), or the `params` argument for `embedding_lookup`. sampling_probability: A 0D `float32` tensor: the probability of sampling categorically from the output ids instead of reading directly from the inputs. time_major: Python bool. Whether the tensors in `inputs` are time major. If `False` (default), they are assumed to be batch major. seed: The sampling seed. scheduling_seed: The schedule decision rule sampling seed. name: Name scope for any created operations. Raises: ValueError: if `sampling_probability` is not a scalar or vector. """ with ops.name_scope(name, "ScheduledEmbeddingSamplingWrapper", [embedding, sampling_probability]): if callable(embedding): self._embedding_fn = embedding else: self._embedding_fn = ( lambda ids: embedding_ops.embedding_lookup(embedding, ids)) self._sampling_probability = ops.convert_to_tensor( sampling_probability, name="sampling_probability") if self._sampling_probability.get_shape().ndims not in (0, 1): raise ValueError( "sampling_probability must be either a scalar or a vector. " "saw shape: %s" % (self._sampling_probability.get_shape())) self._seed = seed self._scheduling_seed = scheduling_seed super(ScheduledEmbeddingTrainingHelper, self).__init__( inputs=inputs, sequence_length=sequence_length, time_major=time_major, name=name) def initialize(self, name=None): return super(ScheduledEmbeddingTrainingHelper, self).initialize(name=name) def sample(self, time, outputs, state, name=None): with ops.name_scope(name, "ScheduledEmbeddingTrainingHelperSample", [time, outputs, state]): # Return -1s where we did not sample, and sample_ids elsewhere select_sampler = bernoulli.Bernoulli( probs=self._sampling_probability, dtype=dtypes.bool) select_sample = select_sampler.sample( sample_shape=self.batch_size, seed=self._scheduling_seed) sample_id_sampler = categorical.Categorical(logits=outputs) return array_ops.where( select_sample, sample_id_sampler.sample(seed=self._seed), gen_array_ops.fill([self.batch_size], -1)) def next_inputs(self, time, outputs, state, sample_ids, name=None): with ops.name_scope(name, "ScheduledEmbeddingTrainingHelperNextInputs", [time, outputs, state, sample_ids]): (finished, base_next_inputs, state) = ( super(ScheduledEmbeddingTrainingHelper, self).next_inputs( time=time, outputs=outputs, state=state, sample_ids=sample_ids, name=name)) def maybe_sample(): """Perform scheduled sampling.""" where_sampling = math_ops.cast( array_ops.where(sample_ids > -1), dtypes.int32) where_not_sampling = math_ops.cast( array_ops.where(sample_ids <= -1), dtypes.int32) sample_ids_sampling = array_ops.gather_nd(sample_ids, where_sampling) inputs_not_sampling = array_ops.gather_nd( base_next_inputs, where_not_sampling) sampled_next_inputs = self._embedding_fn(sample_ids_sampling) base_shape = array_ops.shape(base_next_inputs) return (array_ops.scatter_nd(indices=where_sampling, updates=sampled_next_inputs, shape=base_shape) + array_ops.scatter_nd(indices=where_not_sampling, updates=inputs_not_sampling, shape=base_shape)) all_finished = math_ops.reduce_all(finished) next_inputs = control_flow_ops.cond( all_finished, lambda: base_next_inputs, maybe_sample) return (finished, next_inputs, state) class ScheduledOutputTrainingHelper(TrainingHelper): """A training helper that adds scheduled sampling directly to outputs. Returns False for sample_ids where no sampling took place; True elsewhere. """ def __init__(self, inputs, sequence_length, sampling_probability, time_major=False, seed=None, next_inputs_fn=None, auxiliary_inputs=None, name=None): """Initializer. Args: inputs: A (structure) of input tensors. sequence_length: An int32 vector tensor. sampling_probability: A 0D `float32` tensor: the probability of sampling from the outputs instead of reading directly from the inputs. time_major: Python bool. Whether the tensors in `inputs` are time major. If `False` (default), they are assumed to be batch major. seed: The sampling seed. next_inputs_fn: (Optional) callable to apply to the RNN outputs to create the next input when sampling. If `None` (default), the RNN outputs will be used as the next inputs. auxiliary_inputs: An optional (structure of) auxiliary input tensors with a shape that matches `inputs` in all but (potentially) the final dimension. These tensors will be concatenated to the sampled output or the `inputs` when not sampling for use as the next input. name: Name scope for any created operations. Raises: ValueError: if `sampling_probability` is not a scalar or vector. """ with ops.name_scope(name, "ScheduledOutputTrainingHelper", [inputs, auxiliary_inputs, sampling_probability]): self._sampling_probability = ops.convert_to_tensor( sampling_probability, name="sampling_probability") if self._sampling_probability.get_shape().ndims not in (0, 1): raise ValueError( "sampling_probability must be either a scalar or a vector. " "saw shape: %s" % (self._sampling_probability.get_shape())) if auxiliary_inputs is None: maybe_concatenated_inputs = inputs else: inputs = ops.convert_to_tensor(inputs, name="inputs") auxiliary_inputs = ops.convert_to_tensor( auxiliary_inputs, name="auxiliary_inputs") maybe_concatenated_inputs = nest.map_structure( lambda x, y: array_ops.concat((x, y), -1), inputs, auxiliary_inputs) if not time_major: auxiliary_inputs = nest.map_structure( _transpose_batch_time, auxiliary_inputs) self._auxiliary_input_tas = ( nest.map_structure(_unstack_ta, auxiliary_inputs) if auxiliary_inputs is not None else None) self._seed = seed self._next_inputs_fn = next_inputs_fn super(ScheduledOutputTrainingHelper, self).__init__( inputs=maybe_concatenated_inputs, sequence_length=sequence_length, time_major=time_major, name=name) def initialize(self, name=None): return super(ScheduledOutputTrainingHelper, self).initialize(name=name) def sample(self, time, outputs, state, name=None): with ops.name_scope(name, "ScheduledOutputTrainingHelperSample", [time, outputs, state]): sampler = bernoulli.Bernoulli(probs=self._sampling_probability) return sampler.sample(sample_shape=self.batch_size, seed=self._seed) def next_inputs(self, time, outputs, state, sample_ids, name=None): with ops.name_scope(name, "ScheduledOutputTrainingHelperNextInputs", [time, outputs, state, sample_ids]): (finished, base_next_inputs, state) = ( super(ScheduledOutputTrainingHelper, self).next_inputs( time=time, outputs=outputs, state=state, sample_ids=sample_ids, name=name)) sample_ids = math_ops.cast(sample_ids, dtypes.bool) def maybe_sample(): """Perform scheduled sampling.""" def maybe_concatenate_auxiliary_inputs(outputs_, indices=None): """Concatenate outputs with auxiliary inputs, if they exist.""" if self._auxiliary_input_tas is None: return outputs_ next_time = time + 1 auxiliary_inputs = nest.map_structure( lambda ta: ta.read(next_time), self._auxiliary_input_tas) if indices is not None: auxiliary_inputs = array_ops.gather_nd(auxiliary_inputs, indices) return nest.map_structure( lambda x, y: array_ops.concat((x, y), -1), outputs_, auxiliary_inputs) if self._next_inputs_fn is None: return array_ops.where( sample_ids, maybe_concatenate_auxiliary_inputs(outputs), base_next_inputs) where_sampling = math_ops.cast( array_ops.where(sample_ids), dtypes.int32) where_not_sampling = math_ops.cast( array_ops.where(math_ops.logical_not(sample_ids)), dtypes.int32) outputs_sampling = array_ops.gather_nd(outputs, where_sampling) inputs_not_sampling = array_ops.gather_nd(base_next_inputs, where_not_sampling) sampled_next_inputs = maybe_concatenate_auxiliary_inputs( self._next_inputs_fn(outputs_sampling), where_sampling) base_shape = array_ops.shape(base_next_inputs) return (array_ops.scatter_nd(indices=where_sampling, updates=sampled_next_inputs, shape=base_shape) + array_ops.scatter_nd(indices=where_not_sampling, updates=inputs_not_sampling, shape=base_shape)) all_finished = math_ops.reduce_all(finished) no_samples = math_ops.logical_not(math_ops.reduce_any(sample_ids)) next_inputs = control_flow_ops.cond( math_ops.logical_or(all_finished, no_samples), lambda: base_next_inputs, maybe_sample) return (finished, next_inputs, state) class GreedyEmbeddingHelper(Helper): """A helper for use during inference. Uses the argmax of the output (treated as logits) and passes the result through an embedding layer to get the next input. """ def __init__(self, embedding, start_tokens, end_token): """Initializer. Args: embedding: A callable that takes a vector tensor of `ids` (argmax ids), or the `params` argument for `embedding_lookup`. The returned tensor will be passed to the decoder input. start_tokens: `int32` vector shaped `[batch_size]`, the start tokens. end_token: `int32` scalar, the token that marks end of decoding. Raises: ValueError: if `start_tokens` is not a 1D tensor or `end_token` is not a scalar. """ if callable(embedding): self._embedding_fn = embedding else: self._embedding_fn = ( lambda ids: embedding_ops.embedding_lookup(embedding, ids)) self._start_tokens = ops.convert_to_tensor( start_tokens, dtype=dtypes.int32, name="start_tokens") self._end_token = ops.convert_to_tensor( end_token, dtype=dtypes.int32, name="end_token") if self._start_tokens.get_shape().ndims != 1: raise ValueError("start_tokens must be a vector") self._batch_size = array_ops.size(start_tokens) if self._end_token.get_shape().ndims != 0: raise ValueError("end_token must be a scalar") self._start_inputs = self._embedding_fn(self._start_tokens) @property def batch_size(self): return self._batch_size @property def sample_ids_shape(self): return tensor_shape.TensorShape([]) @property def sample_ids_dtype(self): return dtypes.int32 def initialize(self, name=None): finished = array_ops.tile([False], [self._batch_size]) return (finished, self._start_inputs) def sample(self, time, outputs, state, name=None): """sample for GreedyEmbeddingHelper.""" del time, state # unused by sample_fn # Outputs are logits, use argmax to get the most probable id if not isinstance(outputs, ops.Tensor): raise TypeError("Expected outputs to be a single Tensor, got: %s" % type(outputs)) sample_ids = math_ops.argmax(outputs, axis=-1, output_type=dtypes.int32) return sample_ids def next_inputs(self, time, outputs, state, sample_ids, name=None): """next_inputs_fn for GreedyEmbeddingHelper.""" del time, outputs # unused by next_inputs_fn finished = math_ops.equal(sample_ids, self._end_token) all_finished = math_ops.reduce_all(finished) next_inputs = control_flow_ops.cond( all_finished, # If we're finished, the next_inputs value doesn't matter lambda: self._start_inputs, lambda: self._embedding_fn(sample_ids)) return (finished, next_inputs, state) class SampleEmbeddingHelper(GreedyEmbeddingHelper): """A helper for use during inference. Uses sampling (from a distribution) instead of argmax and passes the result through an embedding layer to get the next input. """ def __init__(self, embedding, start_tokens, end_token, softmax_temperature=None, seed=None): """Initializer. Args: embedding: A callable that takes a vector tensor of `ids` (argmax ids), or the `params` argument for `embedding_lookup`. The returned tensor will be passed to the decoder input. start_tokens: `int32` vector shaped `[batch_size]`, the start tokens. end_token: `int32` scalar, the token that marks end of decoding. softmax_temperature: (Optional) `float32` scalar, value to divide the logits by before computing the softmax. Larger values (above 1.0) result in more random samples, while smaller values push the sampling distribution towards the argmax. Must be strictly greater than 0. Defaults to 1.0. seed: (Optional) The sampling seed. Raises: ValueError: if `start_tokens` is not a 1D tensor or `end_token` is not a scalar. """ super(SampleEmbeddingHelper, self).__init__( embedding, start_tokens, end_token) self._softmax_temperature = softmax_temperature self._seed = seed def sample(self, time, outputs, state, name=None): """sample for SampleEmbeddingHelper.""" del time, state # unused by sample_fn # Outputs are logits, we sample instead of argmax (greedy). if not isinstance(outputs, ops.Tensor): raise TypeError("Expected outputs to be a single Tensor, got: %s" % type(outputs)) if self._softmax_temperature is None: logits = outputs else: logits = outputs / self._softmax_temperature sample_id_sampler = categorical.Categorical(logits=logits) sample_ids = sample_id_sampler.sample(seed=self._seed) return sample_ids class InferenceHelper(Helper): """A helper to use during inference with a custom sampling function.""" def __init__(self, sample_fn, sample_shape, sample_dtype, start_inputs, end_fn, next_inputs_fn=None): """Initializer. Args: sample_fn: A callable that takes `outputs` and emits tensor `sample_ids`. sample_shape: Either a list of integers, or a 1-D Tensor of type `int32`, the shape of the each sample in the batch returned by `sample_fn`. sample_dtype: the dtype of the sample returned by `sample_fn`. start_inputs: The initial batch of inputs. end_fn: A callable that takes `sample_ids` and emits a `bool` vector shaped `[batch_size]` indicating whether each sample is an end token. next_inputs_fn: (Optional) A callable that takes `sample_ids` and returns the next batch of inputs. If not provided, `sample_ids` is used as the next batch of inputs. """ self._sample_fn = sample_fn self._end_fn = end_fn self._sample_shape = tensor_shape.TensorShape(sample_shape) self._sample_dtype = sample_dtype self._next_inputs_fn = next_inputs_fn self._batch_size = array_ops.shape(start_inputs)[0] self._start_inputs = ops.convert_to_tensor( start_inputs, name="start_inputs") @property def batch_size(self): return self._batch_size @property def sample_ids_shape(self): return self._sample_shape @property def sample_ids_dtype(self): return self._sample_dtype def initialize(self, name=None): finished = array_ops.tile([False], [self._batch_size]) return (finished, self._start_inputs) def sample(self, time, outputs, state, name=None): del time, state # unused by sample return self._sample_fn(outputs) def next_inputs(self, time, outputs, state, sample_ids, name=None): del time, outputs # unused by next_inputs if self._next_inputs_fn is None: next_inputs = sample_ids else: next_inputs = self._next_inputs_fn(sample_ids) finished = self._end_fn(sample_ids) return (finished, next_inputs, state)
#!/usr/bin/env python3 # -*- coding: utf-8 -*- # vim: ts=2 sw=2 et ai ############################################################################### # Copyright (c) 2012,2013 Andreas Vogel andreas@wellenvogel.net # parts of this software are based on tiler_tools (...) # the license terms (see below) apply to the complete software the same way # ############################################################################### # Copyright (c) 2011, Vadim Shlyakhov # # Permission is hereby granted, free of charge, to any person obtaining a # copy of this software and associated documentation files (the "Software"), # to deal in the Software without restriction, including without limitation # the rights to use, copy, modify, merge, publish, distribute, sublicense, # and/or sell copies of the Software, and to permit persons to whom the # Software is furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included # in all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS # OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL # THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING # FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER # DEALINGS IN THE SOFTWARE. ############################################################################### import os import sys import xml.sax as sax from optparse import OptionParser import math import traceback info=""" parse a directory hierarchy created with mobac (output OSMTracker) and the associated mobac profile. and create an avnav.xml file The directory structure must be z/x/y.png. Tiles must be 256x256 (no check) Tile numbering is expected to be y=0 upper left. When reading the profile we try to map each of the "layers" found inside to one of our layers. This requires to be carefull when creating them, to always use the same min/max zoom for a group of them as we will directly move them into one of our layers. """ OVERVIEW="avnav.xml" #an xml description of the layers we generated - following the TMS spec overview_xml='''<?xml version="1.0" encoding="UTF-8" ?> <TileMapService version="1.0.0" > <Title>avnav tile map service</Title> <TileMaps> %(tilemaps)s </TileMaps> </TileMapService> ''' overview_tilemap_xml=''' <TileMap title="%(title)s" srs="OSGEO:41001" profile="%(profile)s" href="%(url)s" minzoom="%(minZoom)d" maxzoom="%(maxZoom)d"> %(bounding)s <TileFormat width="%(tileSize)d" height="%(tileSize)d" mime-type="x-png" extension="png" %(zoomOffset)s/> %(layerboundings)s </TileMap> ''' boundingbox_xml=''' <BoundingBox minlon="%(minlon).11G" minlat="%(minlat).11G" maxlon="%(maxlon).11G" maxlat="%(maxlat).11G" title="%(title)s"/> ''' zoom_boundings_entry=''' <BoundingBox minx="%(minx)s" maxx="%(maxx)s" miny="%(miny)s" maxy="%(maxy)s"> </BoundingBox> ''' zoom_boundings_zoom=''' <ZoomBoundings zoom="%(zoom)s"> %(boundings)s </ZoomBoundings> ''' zoom_boundings=''' <LayerZoomBoundings> %(boundings)s </LayerZoomBoundings> ''' options=None upzoom=1 #how many additional layers to be created for a single source gemf file def log(s): print("LOG: %s"%(s,)) def debug(num,txt): if (num <= options.verbose): print("DEBUG %s"%(txt,)) #convert tile numbers to lat/lon #see:http://wiki.openstreetmap.org/wiki/Slippy_map_tilenames#X_and_Y #This returns the NW-corner of the square def num2deg(xtile, ytile, zoom): n = 2.0 ** zoom lon_deg = xtile / n * 360.0 - 180.0 lat_rad = math.atan(math.sinh(math.pi * (1 - 2 * ytile / n))) lat_deg = math.degrees(lat_rad) return (lat_deg, lon_deg) class Tileset(object): def __init__(self,name,zoom,minx,miny,maxx,maxy): self.name=name self.zoom=zoom self.minx=minx self.miny=miny self.maxx=maxx self.maxy=maxy class Tilegroup(object): def __init__(self,name): self.elements=[] self.name=name self.minzoom=-1 self.maxzoom=0 #boundings is zoom,name,minx,miny,maxx,maxy (tilenumbers) def addElement(self,element): if self.minzoom == -1 or element.zoom < self.minzoom: self.minzoom=element.zoom if element.zoom > self.maxzoom: self.maxzoom=element.zoom self.elements.append(element) def getMaxZoomElements(self): rt=[] for el in self.elements: if el.zoom==self.maxzoom: rt.append(el) return rt def getZoomElements(self,zoom): rt=[] for el in self.elements: if el.zoom==zoom: rt.append(el) return rt class Layer(object): def __init__(self,name,minzoom,maxzoom,baseurl=""): self.tlist=[] self.minzoom=minzoom self.maxzoom=maxzoom self.name=name self.baseurl=baseurl #add ad group if their minzoom/maxzoom fits #return true/false def addEntry(self,tilegroup): if tilegroup.minzoom != self.minzoom: return False if tilegroup.maxzoom != self.maxzoom: return False self.tlist.append(tilegroup) return True def getMaxZoomElements(self): rt=[] for tg in self.tlist: rt+=tg.getMaxZoomElements() return rt def getZoomElements(self,zoom): rt=[] for tg in self.tlist: rt+=tg.getZoomElements(zoom) return rt def createBoundingsXml(self, useMax=False): upperOffset=0.999 #using this for the max value to avoid some rounding errors startzoom = None if useMax: startzoom = self.maxzoom else: startzoom = self.minzoom minlat=85 maxlat=-85 minlon=180 maxlon=-180 for zoom in range(startzoom, self.maxzoom + 1): mz = self.getZoomElements(zoom) for el in mz: # minx/miny: upper left corner - minlon,maxlat # maxx/maxy: lower right - maxlon,minlat # try to avoid always including the next tiles by subtracting 1/1000... elmaxlat, elminlon = num2deg(el.minx, el.miny, el.zoom) elminlat, elmaxlon = num2deg(el.maxx + upperOffset, el.maxy + upperOffset, el.zoom) if elmaxlat > maxlat: maxlat=elmaxlat if elmaxlon > maxlon: maxlon=elmaxlon if elminlat < minlat: minlat=elminlat if elminlon < minlon: minlon=elminlon boundings = {'minlon': minlon, 'minlat': minlat, 'maxlon': maxlon, 'maxlat': maxlat, 'title': 'bounding'} return boundingbox_xml % boundings #---------------------------- #sax reader for overview class ListHandler(sax.handler.ContentHandler): def __init__(self,layerlist): self.eltype=None self.layerlist=layerlist self.currentGroup=None self.startFound=False def startElement(self, name, attrs): self.eltype=name if name=="atlas": self.startFound=True return if not self.startFound: return if name == "Layer": self.currentGroup=Tilegroup(attrs['name']) elif name == "Map": assert self.currentGroup is not None, "invalid xml, missing Layer before Map" maxtile = attrs["maxTileCoordinate"] mintile = attrs["minTileCoordinate"] zoom = int(attrs["zoom"]) maxta=maxtile.split('/') minta=mintile.split('/') assert len(maxta) == 2, "invalid format for maxTile %s"%(maxtile,) assert len(minta) == 2, "invalid format for minTile %s"%(mintile,) maxx=int(maxta[0])//256 maxy=int(maxta[1])//256 minx=int(minta[0])//256 miny=int(minta[1])//256 self.currentGroup.addElement(Tileset(attrs['name'], zoom, minx, miny, maxx, maxy)) def endElement(self, name): if name == "Layer": #try to insert layer into list rt=False for layer in self.layerlist: rt=layer.addEntry(self.currentGroup) if rt: log("added entry %s to layer %s"%(self.currentGroup.name,layer.name)) break if not rt: name="Layer-%d:%d"%(self.currentGroup.minzoom,self.currentGroup.maxzoom) log("creating new layer %s for group %s (%d:%d)"%(name,self.currentGroup.name,self.currentGroup.minzoom,self.currentGroup.maxzoom)) self.layerlist.append(Layer(name,self.currentGroup.minzoom,self.currentGroup.maxzoom)) self.layerlist[-1].addEntry(self.currentGroup) self.currentGroup=None def characters(self, content): pass def createTileMapForLayer(layer,name,zOffset,tileSize,zoomBoundings): layerBoundings="" if zoomBoundings is not None: for z in list(zoomBoundings.keys()): zoomBoundingsString="" for e in zoomBoundings[z]: zoomBoundingsString+=zoom_boundings_entry % e layerBoundings+=zoom_boundings_zoom % {'zoom':z, 'boundings':zoomBoundingsString } tilemap=overview_tilemap_xml % { "profile": "zxy-mercator", "title":name, "url":layer.baseurl, "minZoom":layer.minzoom, "maxZoom":layer.maxzoom, "bounding":layer.createBoundingsXml(), "layerboundings":zoom_boundings%{'boundings':layerBoundings}, "tileSize":tileSize, "zoomOffset":'zOffset="%d"'%(zOffset,) } return tilemap def createOverview(layerlist,zoomBoundings): tilemaps="" for layer in layerlist: tilemaps+=createTileMapForLayer(layer,layer.name,256,0,zoomBoundings) overviewstr=overview_xml % { "tilemaps":tilemaps, } return overviewstr #we create n pseudo-layers #with each having an increased tile size... def createOverviewSingleLayer(layer,zoomBoundings,options): tilemaps="" boundings="" zOffset=0 tileSize=256 layerBoundings="" numupzoom=upzoom if options is not None and options.get('upzoom') is not None: numupzoom=options['upzoom'] #currently our front end does not really handle any upzoom #for idx in range(numupzoom+1): for idx in range(1): tilemaps+=createTileMapForLayer(layer,layer.name if idx == 0 else "%s-%d"%(layer.name,idx), zOffset,tileSize,zoomBoundings) zOffset+=1 tileSize*=2 overviewstr=overview_xml % { "tilemaps":tilemaps, } return overviewstr def writeOverview(overviewfname,layerlist): overviewstr=createOverview(layerlist,None) with open(overviewfname,"w",encoding='utf-8') as f: f.write(overviewstr) log(overviewfname+" written, successfully finished") #create an avnav.xml string from a GEMF file #we assume that our GEMF file is somehow complete - i.e. if there is a range #contained in a higher zoomlevel, we assume that it is also there in lower ones #so we compute the enclosing ranges only from the highest level for each source #the data is expected in the format of getSources from GemfFile (an array of sources each containing an array of ranges) #we have 2 different "styles" of a GEMF file: #multi source - we assume that we generated this and create one layer from each source, calculating # a bounding box #single source - we assume that someone else created this # we generate n "pseudo" layers - each having a different zOffset # and we directly map the ranges to layerZoomBoundings # for all the pseudo-layers they are the same... def getGemfInfo(data,options): layerlist=[] if len(data) > 1: log("creating multi source gemf overview (%d sources)"%(len(data),)) for src in data: tilegroup=Tilegroup(src['name']) zoomBoundings={} for rdata in src['ranges']: zoom=rdata['zoom'] entry={"minx":rdata['xmin'], "miny": rdata['ymin'], "maxx":rdata['xmax'], "maxy":rdata['ymax']} if zoomBoundings.get(zoom) is None: zoomBoundings[zoom]=[] zoomBoundings[zoom].append(entry) tileset=Tileset("gemfrange",rdata['zoom'],rdata['xmin'],rdata['ymin'],rdata['xmax'],rdata['ymax']) tilegroup.addElement(tileset) layer=Layer(src['name'],tilegroup.minzoom,tilegroup.maxzoom,src['name']) layer.addEntry(tilegroup) layerlist.append({'layer':layer,'zoomBoundings':zoomBoundings}) #sort layerlist (srclist) by maxzoom layerlist.sort(key=lambda x: x['layer'].maxzoom,reverse=True) tilemaps="" for l in layerlist: layer=l['layer'] zoomBoundings=l['zoomBoundings'] tilemaps+=createTileMapForLayer(layer,layer.name,0,256,zoomBoundings) return overview_xml % { "tilemaps":tilemaps, } else: #single layer log("creating single source gemf overview") src=data[0] zoomBoundings={} tilegroup=Tilegroup(src['name']) for rdata in src['ranges']: zoom=rdata['zoom'] entry={"minx":rdata['xmin'], "miny": rdata['ymin'], "maxx":rdata['xmax'], "maxy":rdata['ymax']} if zoomBoundings.get(zoom) is None: zoomBoundings[zoom]=[] zoomBoundings[zoom].append(entry) tileset=Tileset("gemfrange",rdata['zoom'],rdata['xmin'],rdata['ymin'],rdata['xmax'],rdata['ymax']) tilegroup.addElement(tileset) layer=Layer(src['name'],tilegroup.minzoom,tilegroup.maxzoom,src['name']) layer.addEntry(tilegroup) rt=createOverviewSingleLayer(layer,zoomBoundings,options) return rt #parse an overview file and return the overview as string def parseXml(xmlfile,baseurl=""): log("parsing xml file %s"%(xmlfile,)) layerlist=[] parser=sax.parse(xmlfile,ListHandler(layerlist)) if len(layerlist) > 0: if baseurl != "": for layer in layerlist: layer.baseurl=baseurl log("created %d layers from %s"%(len(layerlist),xmlfile)) layerlist.sort(key=lambda x: x.maxzoom,reverse=True) return createOverview(layerlist,None) else: log("empty layerlist for %s"%(xmlfile,)) return None def parseAndWrite(xmlfile,ovfile): log("parsing xml file %s"%(xmlfile,)) layerlist=[] parser=sax.parse(xmlfile,ListHandler(layerlist)) if len(layerlist) > 0: log("created %d layers from %s"%(len(layerlist),xmlfile)) layerlist.sort(key=lambda x: x.maxzoom,reverse=True) try: writeOverview(ovfile,layerlist) return True except: log("error while creating %s:%s"%(ovfile,traceback.format_exc())) else: log("xml file %s did not contain any layers"%(xmlfile,)) return False def main(argv): global options, layerlist usage="usage: %prog <options> basedir [mobacprofile]" parser = OptionParser( usage = usage, version="1.0", description='create overview for avnav') parser.add_option("-d", "--debug", dest="verbose") parser.add_option("-i", "--ignore", dest="ignore", action="store_const",const=1) (options, args) = parser.parse_args(argv[1:]) if options.verbose is None: options.verbose=0 else: options.verbose=int(options.verbose) assert len(args) >=1 ,usage filename=None outdir=args[0] ovfile=os.path.join(outdir,OVERVIEW) if len(args) < 2: #check for xml files in the outdir being newer as avnav.xml assert os.path.isdir(outdir), "output directory %s does not exist"%(outdir,) avnavTs=None if os.path.isfile(ovfile): avnavTs=os.stat(ovfile).st_mtime odfiles=os.listdir(outdir) foundFile=False for ofile in odfiles: if ofile == OVERVIEW: continue if ofile.lower().endswith(".xml"): xmlfile=os.path.join(outdir,ofile) xmlTs=os.stat(xmlfile).st_mtime if avnavTs is None or xmlTs > avnavTs: foundFile=True rt=parseAndWrite(xmlfile, ovfile) if rt: return 0 if foundFile or not options.ignore: log("ERROR: did not find any suitable mobac profile in %s"%(outdir,)) return 1 else: log("did not find any file to update %s"%(ovfile)) return 2 else: #filename given on commandline rt=parseAndWrite(args[1], ovfile) if rt: return 0 else: return 1 if __name__ == "__main__": sys.exit(main(sys.argv))
#!/usr/bin/env python # Licensed to Cloudera, Inc. under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. Cloudera, Inc. licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Deprecated! Use WebHdfs instead. Only some utils and Hdfs are still used. Interfaces for Hadoop filesystem access via the HADOOP-4707 Thrift APIs. """ import errno import logging import os import posixpath import random import stat as statconsts import subprocess import urlparse import threading from thrift.transport import TTransport from django.utils.encoding import smart_str, force_unicode from django.utils.translation import ugettext as _ from desktop.lib import thrift_util, i18n from desktop.lib.conf import validate_port from hadoop.api.hdfs import Namenode, Datanode from hadoop.api.hdfs.constants import QUOTA_DONT_SET, QUOTA_RESET from hadoop.api.common.ttypes import RequestContext, IOException import hadoop.conf from hadoop.fs import normpath, SEEK_SET, SEEK_CUR, SEEK_END from hadoop.fs.exceptions import PermissionDeniedException LOG = logging.getLogger(__name__) DEFAULT_USER = "webui" # The number of bytes to read if not specified DEFAULT_READ_SIZE = 1024*1024 # 1MB # The buffer size of the pipe to hdfs -put during upload WRITE_BUFFER_SIZE = 128*1024 # 128K # Class that we translate into PermissionDeniedException HADOOP_ACCESSCONTROLEXCEPTION = "org.apache.hadoop.security.AccessControlException" # Timeout for thrift calls to NameNode NN_THRIFT_TIMEOUT = 15 DN_THRIFT_TIMEOUT = 3 # Encoding used by HDFS namespace HDFS_ENCODING = 'utf-8' def encode_fs_path(path): """encode_fs_path(path) -> byte string in utf8""" return smart_str(path, HDFS_ENCODING, errors='strict') def decode_fs_path(path): """decode_fs_path(bytestring) -> unicode path""" return force_unicode(path, HDFS_ENCODING, errors='strict') def test_fs_configuration(fs_config, hadoop_bin_conf): """Test FS configuration. Returns list of (confvar, error).""" TEST_FILE = '/tmp/.hue_config_test.%s' % (random.randint(0, 9999999999)) res = [ ] res.extend(validate_port(fs_config.NN_THRIFT_PORT)) res.extend(validate_port(fs_config.NN_HDFS_PORT)) if res: return res # Check thrift plugin try: fs = HadoopFileSystem.from_config( fs_config, hadoop_bin_path=hadoop_bin_conf.get()) fs.setuser(fs.superuser) ls = fs.listdir('/') except TTransport.TTransportException: msg = 'Failed to contact Namenode plugin at %s:%s.' % \ (fs_config.NN_HOST.get(), fs_config.NN_THRIFT_PORT.get()) LOG.exception(msg) res.append((fs_config, msg)) return res except (IOError, IOException): msg = 'Failed to see HDFS root directory at %s. Please check HDFS configuration.' % (fs.uri,) LOG.exception(msg) res.append((fs_config, msg)) return res if 'tmp' not in ls: return res # Check nn port (via upload) try: w_file = fs.open(TEST_FILE, 'w') except OSError, ex: msg = 'Failed to execute Hadoop (%s)' % (hadoop_bin_conf.get(),) LOG.exception(msg) res.append((hadoop_bin_conf, msg)) return res try: try: w_file.write('hello world') w_file.close() except IOError: msg = 'Failed to upload files using %s' % (fs.uri,) LOG.exception(msg) res.append((fs_config.NN_HDFS_PORT, msg)) return res # Check dn plugin (via read) try: r_file = fs.open(TEST_FILE, 'r') r_file.read() except Exception: msg = 'Failed to read file. Are all datanodes configured with the HUE plugin?' LOG.exception(msg) res.append((fs_config, msg)) finally: # Cleanup. Ignore if file not found. try: if fs.exists(TEST_FILE): fs.remove(TEST_FILE) except Exception, ex: LOG.error('Failed to cleanup test file "%s:%s": %s' % (fs.uri, TEST_FILE, ex)) return res def _coerce_exceptions(function): """ Decorator that causes exceptions thrown by the decorated function to be coerced into generic exceptions from the hadoop.fs.exceptions module. """ def wrapper(*args, **kwargs): try: return function(*args, **kwargs) except IOException, e: e.msg = force_unicode(e.msg, errors='replace') e.stack = force_unicode(e.stack, errors='replace') LOG.exception("Exception in Hadoop FS call " + function.__name__) if e.clazz == HADOOP_ACCESSCONTROLEXCEPTION: raise PermissionDeniedException(e.msg, e) else: raise return wrapper class Hdfs(object): """ An abstract HDFS proxy """ @staticmethod def basename(path): return posixpath.basename(path) @staticmethod def dirname(path): return posixpath.dirname(path) @staticmethod def split(path): return posixpath.split(path) @staticmethod def join(first, *comp_list): return posixpath.join(first, *comp_list) @staticmethod def abspath(path): return posixpath.abspath(path) @staticmethod def normpath(path): res = posixpath.normpath(path) # Python normpath() doesn't eliminate leading double slashes if res.startswith('//'): return res[1:] return res @staticmethod def parent_path(path): return Hdfs.join(path, "..") @staticmethod def urlsplit(url): """ Take an HDFS path (hdfs://nn:port/foo) or just (/foo) and split it into the standard urlsplit's 5-tuple. """ i = url.find('://') if i == -1: # Not found. Treat the entire argument as an HDFS path return ('hdfs', '', normpath(url), '', '') schema = url[:i] if schema not in ('hdfs', 'viewfs'): # Default to standard for non-hdfs return urlparse.urlsplit(url) url = url[i+3:] i = url.find('/') if i == -1: # Everything is netloc. Assume path is root. return (schema, url, '/', '', '') netloc = url[:i] path = url[i:] return (schema, netloc, normpath(path), '', '') def listdir_recursive(self, path, glob=None): """ listdir_recursive(path, glob=None) -> [ entry names ] Get directory entry names without stats, recursively. """ paths = [path] while paths: path = paths.pop() if self.isdir(path): hdfs_paths = self.listdir_stats(path, glob) paths[:0] = [x.path for x in hdfs_paths] yield path def create_home_dir(self, home_path=None): if home_path is None: home_path = self.get_home_dir() from useradmin.conf import HOME_DIR_PERMISSIONS mode = int(HOME_DIR_PERMISSIONS.get(), 8) if not self.exists(home_path): user = self.user try: try: self.setuser(self.superuser) self.mkdir(home_path) self.chmod(home_path, mode) self.chown(home_path, user, user) except IOError: msg = 'Failed to create home dir ("%s") as superuser %s' % (home_path, self.superuser) LOG.exception(msg) raise finally: self.setuser(user) def copyFromLocal(self, local_src, remote_dst, mode=0755): remote_dst = remote_dst.endswith(posixpath.sep) and remote_dst[:-1] or remote_dst local_src = local_src.endswith(posixpath.sep) and local_src[:-1] or local_src if os.path.isdir(local_src): self._copy_dir(local_src, remote_dst, mode) else: (basename, filename) = os.path.split(local_src) self._copy_file(local_src, self.isdir(remote_dst) and self.join(remote_dst, filename) or remote_dst) def _copy_dir(self, local_dir, remote_dir, mode=0755): self.mkdir(remote_dir, mode=mode) for f in os.listdir(local_dir): local_src = os.path.join(local_dir, f) remote_dst = self.join(remote_dir, f) if os.path.isdir(local_src): self._copy_dir(local_src, remote_dst, mode) else: self._copy_file(local_src, remote_dst) def _copy_file(self, local_src, remote_dst, chunk_size=1024 * 1024 * 64): if os.path.isfile(local_src): if self.exists(remote_dst): LOG.info(_('%(remote_dst)s already exists. Skipping.') % {'remote_dst': remote_dst}) return else: LOG.info(_('%(remote_dst)s does not exist. Trying to copy.') % {'remote_dst': remote_dst}) src = file(local_src) try: try: self.create(remote_dst, permission=0755) chunk = src.read(chunk_size) while chunk: self.append(remote_dst, chunk) chunk = src.read(chunk_size) LOG.info(_('Copied %s -> %s.') % (local_src, remote_dst)) except: LOG.exception(_('Copying %s -> %s failed.') % (local_src, remote_dst)) raise finally: src.close() else: LOG.info(_('Skipping %s (not a file).') % local_src) @_coerce_exceptions def mktemp(self, subdir='', prefix='tmp', basedir=None): """ mktemp(prefix) -> <temp_dir or basedir>/<subdir>/prefix.<rand> Return a unique temporary filename with prefix in the cluster's temp dir. """ RANDOM_BITS = 64 base = self.join(basedir or self._temp_dir, subdir) if not self.isdir(base): self.mkdir(base) while True: name = prefix + '.' + str(random.getrandbits(RANDOM_BITS)) candidate = self.join(base, name) if not self.exists(candidate): return candidate def mkswap(self, filename, subdir='', suffix='swp', basedir=None): """ mkswap(filename, suffix) -> <temp_dir or basedir>/<subdir>/filename.<suffix> Return a unique temporary filename with prefix in the cluster's temp dir. """ RANDOM_BITS = 64 base = self.join(basedir or self._temp_dir, subdir) if not self.isdir(base): self.mkdir(base) candidate = self.join(base, "%s.%s" % (filename, suffix)) return candidate def exists(self): raise NotImplementedError(_("%(function)s has not been implemented.") % {'function': 'exists'}) def do_as_user(self): raise NotImplementedError(_("%(function)s has not been implemented.") % {'function': 'do_as_user'}) def create(self): raise NotImplementedError(_("%(function)s has not been implemented.") % {'function': 'exists'}) def append(self): raise NotImplementedError(_("%(function)s has not been implemented.") % {'function': 'append'}) def mkdir(self): raise NotImplementedError(_("%(function)s has not been implemented.") % {'function': 'mkdir'}) def isdir(self): raise NotImplementedError(_("%(function)s has not been implemented.") % {'function': 'isdir'}) def listdir_stats(self): raise NotImplementedError(_("%(function)s has not been implemented.") % {'function': 'listdir_stats'}) """ Deprecated! Use WebHdfs instead """ class HadoopFileSystem(Hdfs): """ Implementation of Filesystem APIs through Thrift to a Hadoop cluster. """ def __init__(self, host, thrift_port, hdfs_port=8020, nn_kerberos_principal="hdfs", dn_kerberos_principal="hdfs", security_enabled=False, hadoop_bin_path="hadoop", temp_dir='/tmp'): """ @param host hostname or IP of the namenode @param thrift_port port on which the Thrift plugin is listening @param hdfs_port port on which NameNode IPC is listening @param hadoop_bin_path path to find the hadoop wrapper script on the installed system - default is fine if it is in the user's PATH env @param temp_dir Temporary directory, for mktemp() """ self.host = host self.thrift_port = thrift_port self.hdfs_port = hdfs_port self.security_enabled = security_enabled self.nn_kerberos_principal = nn_kerberos_principal self.dn_kerberos_principal = dn_kerberos_principal self.hadoop_bin_path = hadoop_bin_path self._resolve_hadoop_path() self.security_enabled = security_enabled self._temp_dir = temp_dir self.nn_client = thrift_util.get_client( Namenode.Client, host, thrift_port, service_name="HDFS Namenode HUE Plugin", use_sasl=security_enabled, kerberos_principal=nn_kerberos_principal, timeout_seconds=NN_THRIFT_TIMEOUT) # The file systems are cached globally. We store # user information in a thread-local variable so that # safety can be preserved there. self.thread_local = threading.local() self.setuser(DEFAULT_USER) LOG.debug("Initialized HadoopFS: %s:%d (%s)", host, thrift_port, hadoop_bin_path) @classmethod def from_config(cls, fs_config, hadoop_bin_path="hadoop"): return cls(host=fs_config.NN_HOST.get(), thrift_port=fs_config.NN_THRIFT_PORT.get(), hdfs_port=fs_config.NN_HDFS_PORT.get(), security_enabled=fs_config.SECURITY_ENABLED.get(), nn_kerberos_principal=fs_config.NN_KERBEROS_PRINCIPAL.get(), dn_kerberos_principal=fs_config.DN_KERBEROS_PRINCIPAL.get(), hadoop_bin_path=hadoop_bin_path) def _get_hdfs_base(self): return "hdfs://%s:%d" % (self.host, self.hdfs_port) # TODO(todd) fetch the port from the NN thrift def _resolve_hadoop_path(self): """The hadoop_bin_path configuration may be a non-absolute path, in which case it's checked against $PATH. If the hadoop binary can't be found anywhere, raises an Exception. """ for path_dir in os.getenv("PATH", "").split(os.pathsep): path = os.path.join(path_dir, self.hadoop_bin_path) if os.path.exists(path): self.hadoop_bin_path = os.path.abspath(path) return raise OSError(errno.ENOENT, "Hadoop binary (%s) does not exist." % (self.hadoop_bin_path,)) @property def uri(self): return self._get_hdfs_base() @property def superuser(self): """ Retrieves the user that Hadoop considers as "superuser" by looking at ownership of /. This is slightly inaccurate. """ return self.stats("/")["user"] def setuser(self, user): # Hadoop determines the groups the user belongs to on the server side. self.thread_local.request_context = RequestContext() if not self.request_context.confOptions: self.request_context.confOptions = {} self.thread_local.request_context.confOptions['effective_user'] = user self.thread_local.user = user @property def user(self): return self.thread_local.user @property def groups(self): return self.thread_local.groups @property def request_context(self): return self.thread_local.request_context @_coerce_exceptions def open(self, path, mode="r", *args, **kwargs): if mode == "w": return FileUpload(self, path, mode, *args, **kwargs) return File(self, path, mode, *args, **kwargs) @_coerce_exceptions def remove(self, path): path = encode_fs_path(path) stat = self._hadoop_stat(path) if not stat: raise IOError(errno.ENOENT, "File not found: %s" % path) if stat.isDir: raise IOError(errno.EISDIR, "Is a directory: %s" % path) success = self.nn_client.unlink( self.request_context, normpath(path), recursive=False) if not success: raise IOError("Unlink failed") @_coerce_exceptions def mkdir(self, path, mode=0755): # TODO(todd) there should be a mkdir that isn't mkdirHIER # (this is mkdir -p I think) path = encode_fs_path(path) success = self.nn_client.mkdirhier(self.request_context, normpath(path), mode) if not success: raise IOError("mkdir failed") def _rmdir(self, path, recursive=False): path = encode_fs_path(path) stat = self._hadoop_stat(path) if not stat: raise IOError(errno.ENOENT, "Directory not found: %s" % (path,)) if not stat.isDir: raise IOError(errno.EISDIR, "Is not a directory: %s" % (path,)) success = self.nn_client.unlink( self.request_context, normpath(path), recursive=recursive) if not success: raise IOError("Unlink failed") @_coerce_exceptions def rmdir(self, path): return self._rmdir(path) @_coerce_exceptions def rmtree(self, path): return self._rmdir(path, True) @_coerce_exceptions def listdir(self, path): path = encode_fs_path(path) stats = self.nn_client.ls(self.request_context, normpath(path)) return [self.basename(decode_fs_path(stat.path)) for stat in stats] @_coerce_exceptions def listdir_stats(self, path): path = encode_fs_path(path) stats = self.nn_client.ls(self.request_context, normpath(path)) return [self._unpack_stat(s) for s in stats] @_coerce_exceptions def get_content_summaries(self, paths): paths = [ normpath(encode_fs_path(path)) for path in paths ] summaries = self.nn_client.multiGetContentSummary(self.request_context, paths) def _fix_summary(summary): summary.path = decode_fs_path(summary.path) return summary return [_fix_summary(s) for s in summaries] @_coerce_exceptions def rename(self, old, new): old = encode_fs_path(old) new = encode_fs_path(new) success = self.nn_client.rename( self.request_context, normpath(old), normpath(new)) if not success: #TODO(todd) these functions should just throw if failed raise IOError("Rename failed") @_coerce_exceptions def rename_star(self, old_dir, new_dir): """Equivalent to `mv old_dir/* new""" if not self.isdir(old_dir): raise IOError(errno.ENOTDIR, "'%s' is not a directory" % (old_dir,)) if not self.exists(new_dir): self.mkdir(new_dir) elif not self.isdir(new_dir): raise IOError(errno.ENOTDIR, "'%s' is not a directory" % (new_dir,)) ls = self.listdir(old_dir) for dirent in ls: self.rename(HadoopFileSystem.join(old_dir, dirent), HadoopFileSystem.join(new_dir, dirent)) @_coerce_exceptions def exists(self, path): stat = self._hadoop_stat(path) return stat is not None @_coerce_exceptions def isfile(self, path): stat = self._hadoop_stat(path) if stat is None: return False return not stat.isDir @_coerce_exceptions def isdir(self, path): stat = self._hadoop_stat(path) if stat is None: return False return stat.isDir @_coerce_exceptions def stats(self, path, raise_on_fnf=True): stat = self._hadoop_stat(path) if not stat: if raise_on_fnf: raise IOError(errno.ENOENT, "File %s not found" % (path,)) else: return None ret = self._unpack_stat(stat) return ret @_coerce_exceptions def chmod(self, path, mode): path = encode_fs_path(path) self.nn_client.chmod(self.request_context, normpath(path), mode) @_coerce_exceptions def chown(self, path, user, group): path = encode_fs_path(path) self.nn_client.chown(self.request_context, normpath(path), user, group) @_coerce_exceptions def get_namenode_info(self): (capacity, used, available) = self.nn_client.df(self.request_context) return dict( usage=dict(capacity_bytes=capacity, used_bytes=used, available_bytes=available), ) @_coerce_exceptions def _get_blocks(self, path, offset, length): """ Get block locations from the Name Node. Returns an array of Block instances that might look like: [ Block(path='/user/todd/motd', genStamp=1001, blockId=5564389078175231298, nodes=[DatanodeInfo(xceiverCount=1, capacity=37265149952, name='127.0.0.1:50010', thriftPort=53417, state=1, remaining=18987925504, host='127.0.0.1', storageID='DS-1238582576-127.0.1.1-50010-1240968238474', dfsUsed=36864)], numBytes=424)] """ path = encode_fs_path(path) blocks = self.nn_client.getBlocks(self.request_context, normpath(path), offset, length) def _fix_block(blk): blk.path = decode_fs_path(blk.path) return blk return [_fix_block(blk) for blk in blocks] def _hadoop_stat(self, path): """Returns None if file does not exist.""" path = encode_fs_path(path) try: stat = self.nn_client.stat(self.request_context, normpath(path)) stat.path = decode_fs_path(stat.path) return stat except IOException, ioe: if ioe.clazz == 'java.io.FileNotFoundException': return None raise @_coerce_exceptions def _read_block(self, block, offset, len): """ Reads a chunk of data from the given block from the first available datanode that serves it. @param block a thrift Block object @param offset offset from the beginning of the block (not file) @param len the number of bytes to read """ errs = [] unipath = block.path block.path = encode_fs_path(block.path) try: for node in block.nodes: dn_conn = self._connect_dn(node) try: try: data = dn_conn.readBlock(self.request_context, block, offset, len) return data.data except Exception, e: errs.append(e) finally: dn_conn.close() finally: block.path = unipath raise IOError("Could not read block %s from any replicas: %s" % (block, repr(errs))) @_coerce_exceptions def set_diskspace_quota(self, path, size): """ Set the diskspace quota of a given path. @param path The path to the given hdfs resource @param size The amount of bytes that a given subtree of files can grow to. """ path = encode_fs_path(path) if normpath(path) == '/': raise ValueError('Cannot set quota for "/"') if size < 0: raise ValueError("The size quota should be 0 or positive or unset") self.nn_client.setQuota(self.request_context, normpath(path), QUOTA_DONT_SET, size) @_coerce_exceptions def set_namespace_quota(self, path, num_files): """ Set the maximum number of files of a given path. @param path The path to the given hdfs resource @param num_files The amount of files that can exist within that subtree. """ path = encode_fs_path(path) if normpath(path) == '/': raise ValueError('Cannot set quota for "/"') if num_files < 0: raise ValueError("The number of files quota should be 0 or positive or unset") self.nn_client.setQuota(self.request_context, normpath(path), num_files, QUOTA_DONT_SET) @_coerce_exceptions def clear_diskspace_quota(self, path): """ Remove the diskspace quota at a given path """ path = encode_fs_path(path) self.nn_client.setQuota(self.request_context, normpath(path), QUOTA_DONT_SET, QUOTA_RESET) @_coerce_exceptions def clear_namespace_quota(self, path): """ Remove the namespace quota at a given path """ path = encode_fs_path(path) self.nn_client.setQuota(self.request_context, normpath(path), QUOTA_RESET, QUOTA_DONT_SET) @_coerce_exceptions def get_diskspace_quota(self, path): """ Get the current space quota in bytes for disk space. None if it is unset """ path = encode_fs_path(path) space_quota = self.nn_client.getContentSummary(self.request_context, normpath(path)).spaceQuota if space_quota == QUOTA_RESET or space_quota == QUOTA_DONT_SET: return None else: return space_quota @_coerce_exceptions def get_namespace_quota(self, path): """ Get the current quota in number of files. None if it is unset """ path = encode_fs_path(path) file_count_quota = self.nn_client.getContentSummary(self.request_context, normpath(path)).quota if file_count_quota == QUOTA_RESET or file_count_quota == QUOTA_DONT_SET: return None else: return file_count_quota @_coerce_exceptions def get_usage_and_quota(self, path): """ Returns a dictionary with "file_count", "file_quota", "space_used", and "space_quota". The quotas may be None. """ path = encode_fs_path(path) summary = self.nn_client.getContentSummary(self.request_context, normpath(path)) ret = dict() ret["file_count"] = summary.fileCount ret["space_used"] = summary.spaceConsumed if summary.quota in (QUOTA_RESET, QUOTA_DONT_SET): ret["file_quota"] = None else: ret["file_quota"] = summary.quota if summary.spaceQuota in (QUOTA_RESET, QUOTA_DONT_SET): ret["space_quota"] = None else: ret["space_quota"] = summary.spaceQuota return ret @_coerce_exceptions def get_delegation_token(self): # TODO(atm): The second argument here should really be the Hue kerberos # principal, which doesn't exist yet. Todd's working on that. return self.nn_client.getDelegationToken(self.request_context, 'hadoop') def _connect_dn(self, node): dn_conf = thrift_util.ConnectionConfig( Datanode.Client, node.host, node.thriftPort, "HDFS Datanode Thrift", use_sasl=self.security_enabled, kerberos_principal=self.dn_kerberos_principal, timeout_seconds=DN_THRIFT_TIMEOUT) service, protocol, transport = \ thrift_util.connect_to_thrift(dn_conf) transport.open() service.close = lambda: transport.close() return service @staticmethod def _unpack_stat(stat): """Unpack a Thrift "Stat" object into a dictionary that looks like fs.stat""" mode = stat.perms if stat.isDir: mode |= statconsts.S_IFDIR else: mode |= statconsts.S_IFREG return { 'path': decode_fs_path(stat.path), 'size': stat.length, 'mtime': stat.mtime / 1000, 'mode': mode, 'user': stat.owner, 'group': stat.group, 'atime': stat.atime } @staticmethod def urlsplit(url): """ Take an HDFS path (hdfs://nn:port/foo) or just (/foo) and split it into the standard urlsplit's 5-tuple. """ return Hdfs.urlsplit(url) def require_open(func): """ Decorator that ensures that the file instance isn't closed when the function is run. """ def wrapper(self, *args, **kwargs): if self.closed: raise IOError(errno.EBADF, "I/O operation on closed file") return func(self, *args, **kwargs) return wrapper class File(object): """ Represents an open file on HDFS. """ def __init__(self, fs, path, mode="r", buffering=False): self.fs = fs self.path = normpath(path) self.pos = 0 self.closed = False self._block_cache = BlockCache() if buffering or mode != "r": raise Exception("buffering and write support not yet implemented") # NYI stat = self._stat() if stat is None: raise IOError(errno.ENOENT, "No such file or directory: '%s'" % path) if stat.isDir: raise IOError(errno.EISDIR, "Is a directory: '%s'" % path) #TODO(todd) somehow we need to check permissions here - maybe we need an access() call? # Minimal context manager implementation. # See: http://www.python.org/doc/2.5.2/lib/typecontextmanager.html def __enter__(self): return self def __exit__(self, exc_type, exc_val, exc_tb): self.close() return False # don't supress exceptions. @require_open def seek(self, offset, whence=0): """ Set the file pointer to the given spot. @see file.seek """ if whence == SEEK_SET: self.pos = offset elif whence == SEEK_CUR: self.pos += offset elif whence == SEEK_END: self.pos = self._stat().length + offset else: raise IOError(errno.EINVAL, "Invalid argument to seek for whence") @require_open def tell(self): return self.pos def _get_block(self, pos): """Return the Block instance that contains the given offset""" cached_block = self._block_cache.find_block(pos) if cached_block: return cached_block # Cache "miss" - fetch ahead 500MB worth of blocks new_blocks = self.fs._get_blocks(self.path, pos, 500*1024*1024) self._block_cache.insert_new_blocks(new_blocks) result = self._block_cache.find_block(pos) if not result: raise IOError("No block for position %d in file %s" % (pos, self.path)) return result @require_open def _read_in_block(self, length=DEFAULT_READ_SIZE): """ Tries to read up to length bytes, but will often read fewer, since a single call will not read across a block boundary. """ end_pos = min(self.pos + length, self._stat().length) # If we're at EOF, return empty string if end_pos == self.pos: return "" block = self._get_block(self.pos) assert _block_contains_pos(block, self.pos) assert block.path == self.path in_block_pos = self.pos - block.startOffset assert in_block_pos >= 0 in_block_len = min(length, block.numBytes - in_block_pos) result = self.fs._read_block(block, in_block_pos, in_block_len) self.pos += len(result) assert self.pos <= end_pos return result @require_open def read(self, length=DEFAULT_READ_SIZE): """ Read the given number of bytes from this file. If EOF has been reached, returns the empty string. @param length the number of bytes wanted """ result = [] read_so_far = 0 while read_so_far < length: this_data = self._read_in_block(length - read_so_far) if this_data == "": # eof break read_so_far += len(this_data) result.append(this_data) return "".join(result) def close(self): self.closed = True def _stat(self): if not hasattr(self, "_stat_cache"): self._stat_cache = self.fs._hadoop_stat(self.path) return self._stat_cache class FileUpload(object): """A write-only file that supports no seeking and cannot exist prior to opening. """ def __init__(self, fs, path, mode="w", block_size=None): self.fs = fs self.closed = False assert mode == "w" extra_confs = [] if block_size: extra_confs.append("-Ddfs.block.size=%d" % block_size) self.subprocess_cmd = [self.fs.hadoop_bin_path, "jar", hadoop.conf.SUDO_SHELL_JAR.get(), self.fs.user, "-Dfs.default.name=" + self.fs.uri] + \ extra_confs + \ ["-put", "-", encode_fs_path(path)] self.subprocess_env = i18n.make_utf8_env() if self.subprocess_env.has_key('HADOOP_CLASSPATH'): self.subprocess_env['HADOOP_CLASSPATH'] += ':' + hadoop.conf.HADOOP_EXTRA_CLASSPATH_STRING.get() else: self.subprocess_env['HADOOP_CLASSPATH'] = hadoop.conf.HADOOP_EXTRA_CLASSPATH_STRING.get() if hadoop.conf.HADOOP_CONF_DIR.get(): self.subprocess_env['HADOOP_CONF_DIR'] = hadoop.conf.HADOOP_CONF_DIR.get() self.path = path self.putter = subprocess.Popen(self.subprocess_cmd, stdin=subprocess.PIPE, stdout=subprocess.PIPE, stderr=subprocess.PIPE, close_fds=True, env=self.subprocess_env, bufsize=WRITE_BUFFER_SIZE) @require_open def write(self, data): """May raise IOError, particularly EPIPE""" self.putter.stdin.write(data) @require_open def close(self): try: (stdout, stderr) = self.putter.communicate() except IOError, ioe: logging.debug("Saw IOError writing %r" % self.path, exc_info=1) if ioe.errno == errno.EPIPE: stdout, stderr = self.putter.communicate() self.closed = True if stderr: LOG.warn("HDFS FileUpload (cmd='%s', env='%s') outputted stderr:\n%s" % (repr(self.subprocess_cmd), repr(self.subprocess_env), stderr)) if stdout: LOG.info("HDFS FileUpload (cmd='%s', env='%s') outputted stdout:\n%s" % (repr(self.subprocess_cmd), repr(self.subprocess_env), stdout)) if self.putter.returncode != 0: raise IOError("hdfs put returned bad code: %d\nstderr: %s" % (self.putter.returncode, stderr)) LOG.info("Completed upload: %s" % repr(self.subprocess_cmd)) @require_open def flush(self): self.putter.stdin.flush() def _block_contains_pos(block, pos): return pos >= block.startOffset and pos < block.startOffset + block.numBytes class BlockCache(object): """ A cache of block locations used by a single HDFS input file. Essentially this keeps the blocks in sorted order and does binary search to find the block that contains a given offset. It also provides the ability to merge in the response of a NN getBlocks response to the cache. """ def __init__(self): self.blocks = [] def find_block(self, pos, _min_idx=0, _max_idx=None): """ Return the Block object that contains the specified position pos, or None if it is not in the cache. """ if _max_idx is None: _max_idx = len(self.blocks) - 1 if _max_idx < _min_idx: return None pivot_idx = (_max_idx + _min_idx) / 2 pivot_block = self.blocks[pivot_idx] if pos < pivot_block.startOffset: return self.find_block(pos, _min_idx, pivot_idx - 1) elif pos >= pivot_block.startOffset + pivot_block.numBytes: return self.find_block(pos, pivot_idx + 1, _max_idx) else: return pivot_block def insert_new_blocks(self, new_blocks): """ Merge a list of Block objects from the NN into the list of cached blocks. If the set of blocks overlaps, the new blocks take precedence. """ # We could do a more efficient merge here since both lists # are already sorted, but these data structures are small, so let's # do the easy thing. blocks_dict = dict( (b.blockId, b) for b in self.blocks ) # Merge in new data to dictionary for nb in new_blocks: blocks_dict[nb.blockId] = nb # Convert back to sorted list block_list = blocks_dict.values() block_list.sort(cmp=lambda a,b: cmp(a.startOffset, b.startOffset)) # Update cache with new data self.blocks = block_list
# # Copyright 2019 The FATE Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # import argparse from pipeline.backend.pipeline import PipeLine from pipeline.component import HeteroFeatureBinning, HeteroFeatureSelection, DataStatistics, Evaluation from pipeline.component.hetero_secureboost import HeteroSecureBoost from pipeline.component.dataio import DataIO from pipeline.component.intersection import Intersection from pipeline.component.reader import Reader from pipeline.interface.data import Data from pipeline.interface.model import Model from pipeline.utils.tools import load_job_config from pipeline.runtime.entity import JobParameters def main(config="../../config.yaml", namespace=""): # obtain config if isinstance(config, str): config = load_job_config(config) parties = config.parties guest = parties.guest[0] host = parties.host[0] guest_train_data = {"name": "breast_hetero_guest", "namespace": "experiment"} guest_test_data = {"name": "breast_hetero_guest", "namespace": "experiment"} host_train_data = {"name": "breast_hetero_host_tag_value", "namespace": "experiment"} host_test_data = {"name": "breast_hetero_host_tag_value", "namespace": "experiment"} # initialize pipeline pipeline = PipeLine() # set job initiator pipeline.set_initiator(role='guest', party_id=guest) # set participants information pipeline.set_roles(guest=guest, host=host) # define Reader components to read in data reader_0 = Reader(name="reader_0") reader_1 = Reader(name="reader_1") # configure Reader for guest reader_0.get_party_instance(role='guest', party_id=guest).component_param(table=guest_train_data) reader_1.get_party_instance(role='guest', party_id=guest).component_param(table=guest_test_data) # configure Reader for host reader_0.get_party_instance(role='host', party_id=host).component_param(table=host_train_data) reader_1.get_party_instance(role='host', party_id=host).component_param(table=host_test_data) # define DataIO components dataio_0 = DataIO(name="dataio_0") # start component numbering at 0 dataio_1 = DataIO(name="dataio_1") # start component numbering at 1 param = { "with_label": True, "label_name": "y", "label_type": "int", "output_format": "dense", "missing_fill": True, "missing_fill_method": "mean", "outlier_replace": False, "outlier_replace_method": "designated", "outlier_replace_value": 0.66, "outlier_impute": "-9999" } # get DataIO party instance of guest dataio_0_guest_party_instance = dataio_0.get_party_instance(role='guest', party_id=guest) # configure DataIO for guest dataio_0_guest_party_instance.component_param(**param) # get and configure DataIO party instance of host dataio_1.get_party_instance(role='guest', party_id=guest).component_param(**param) param = { "input_format": "tag", "with_label": False, "tag_with_value": True, "delimitor": ";", "output_format": "dense" } dataio_0.get_party_instance(role='host', party_id=host).component_param(**param) dataio_1.get_party_instance(role='host', party_id=host).component_param(**param) # define Intersection components intersection_0 = Intersection(name="intersection_0", intersect_method="raw") intersection_1 = Intersection(name="intersection_1", intersect_method="raw") param = { "name": 'hetero_feature_binning_0', "method": 'optimal', "optimal_binning_param": { "metric_method": "iv", "init_bucket_method": "quantile" }, "bin_indexes": -1 } hetero_feature_binning_0 = HeteroFeatureBinning(**param) statistic_0 = DataStatistics(name='statistic_0') param = { "name": 'hetero_feature_selection_0', "filter_methods": ["unique_value", "iv_filter", "statistic_filter"], "unique_param": { "eps": 1e-6 }, "iv_param": { "metrics": ["iv", "iv"], "filter_type": ["top_k", "threshold"], "take_high": [True, True], "threshold": [10, 0.1] }, "statistic_param": { "metrics": ["coefficient_of_variance", "skewness"], "filter_type": ["threshold", "threshold"], "take_high": [True, False], "threshold": [0.001, -0.01] }, "select_col_indexes": -1 } hetero_feature_selection_0 = HeteroFeatureSelection(**param) hetero_feature_selection_1 = HeteroFeatureSelection(name='hetero_feature_selection_1') param = { "task_type": "classification", "learning_rate": 0.1, "num_trees": 10, "subsample_feature_rate": 0.5, "n_iter_no_change": False, "tol": 0.0002, "bin_num": 50, "objective_param": { "objective": "cross_entropy" }, "encrypt_param": { "method": "paillier" }, "predict_param": { "threshold": 0.5 }, "tree_param": { "max_depth": 2 }, "cv_param": { "n_splits": 5, "shuffle": False, "random_seed": 103, "need_cv": False }, "validation_freqs": 2, "early_stopping_rounds": 5, "metrics": ["auc", "ks"] } hetero_secureboost_0 = HeteroSecureBoost(name='hetero_secureboost_0', **param) evaluation_0 = Evaluation(name='evaluation_0') # add components to pipeline, in order of task execution pipeline.add_component(reader_0) pipeline.add_component(reader_1) pipeline.add_component(dataio_0, data=Data(data=reader_0.output.data)) pipeline.add_component(dataio_1, data=Data(data=reader_1.output.data), model=Model(dataio_0.output.model)) # set data input sources of intersection components pipeline.add_component(intersection_0, data=Data(data=dataio_0.output.data)) pipeline.add_component(intersection_1, data=Data(data=dataio_1.output.data)) pipeline.add_component(hetero_feature_binning_0, data=Data(data=intersection_0.output.data)) pipeline.add_component(statistic_0, data=Data(data=intersection_0.output.data)) pipeline.add_component(hetero_feature_selection_0, data=Data(data=intersection_0.output.data), model=Model(isometric_model=[hetero_feature_binning_0.output.model, statistic_0.output.model])) pipeline.add_component(hetero_feature_selection_1, data=Data(data=intersection_1.output.data), model=Model(hetero_feature_selection_0.output.model)) # set train & validate data of hetero_secureboost_0 component pipeline.add_component(hetero_secureboost_0, data=Data(train_data=hetero_feature_selection_0.output.data, validate_data=hetero_feature_selection_1.output.data)) pipeline.add_component(evaluation_0, data=Data(data=[hetero_secureboost_0.output.data])) # compile pipeline once finished adding modules, this step will form conf and dsl files for running job pipeline.compile() # fit model pipeline.fit() # query component summary print(pipeline.get_component("hetero_secureboost_0").get_summary()) if __name__ == "__main__": parser = argparse.ArgumentParser("PIPELINE DEMO") parser.add_argument("-config", type=str, help="config file") args = parser.parse_args() if args.config is not None: main(args.config) else: main()
from numpy.distutils.core import setup, Extension import distutils.sysconfig import sys import os import os.path import re # Get BUILDTYPE for checking if this is intel-mac buildtype = os.getenv("BUILDTYPE") if buildtype: buildtype = buildtype.strip() if not buildtype: raise ValueError("Environment variable BUILDTYPE is not defined") # (Non-standard) Directories containing .h include files incdir_list = [ "pyfermod", os.path.join("fer", "common"), os.path.join("fmt", "cmn"), os.path.join("fer", "ef_utility"), os.path.join("fer", "grdel"), ] bind_and_hide_internal = os.getenv("BIND_AND_HIDE_INTERNAL") if bind_and_hide_internal: bind_and_hide_internal = bind_and_hide_internal.strip() # NETCDF_LIBDIR must be given, either for the static library or the shared-object library netcdf_libdir = os.getenv("NETCDF_LIBDIR") if netcdf_libdir: netcdf_libdir = netcdf_libdir.strip() if not netcdf_libdir: raise ValueError("Environment variable NETCDF_LIBDIR is not defined") # HDF5_LIBDIR is only given if the HDF5 and NetCDF libraries are to be statically linked hdf5_libdir = os.getenv("HDF5_LIBDIR") if hdf5_libdir: hdf5_libdir = hdf5_libdir.strip() # SZ_LIBDIR is the location of the SZ library to be linked in sz_libdir = os.getenv("SZ_LIBDIR") if sz_libdir: sz_libdir = sz_libdir.strip() # CAIRO_LIBDIR is only given if the cairo library is to be statically linked in cairo_libdir = os.getenv("CAIRO_LIBDIR") if cairo_libdir: cairo_libdir = cairo_libdir.strip() # PIXMAN_LIBDIR is only given if the pixman-1 library is to be statically linked in pixman_libdir = os.getenv("PIXMAN_LIBDIR") if pixman_libdir: pixman_libdir = pixman_libdir.strip() # PANGO_LIBDIR gives a non-standard location of the pango libraries pango_libdir = os.getenv("PANGO_LIBDIR") if pango_libdir: pango_libdir = pango_libdir.strip() # GFORTRAN_LIB gives a non-standard full-path location of the gfortran library to be used # in the linking step. If not given or empty, the -lgfortran flag is used in the linking step. gfortran_lib = os.getenv("GFORTRAN_LIB") if gfortran_lib: gfortran_lib = gfortran_lib.strip() # The location of libpythonx.x.so, in case it is not in a standard location python_libdir = os.path.split( distutils.sysconfig.get_python_lib(standard_lib=True) )[0] # The list of additional directories to examine for libraries libdir_list = [ "lib", netcdf_libdir, ] if hdf5_libdir: libdir_list.append(hdf5_libdir) if sz_libdir: libdir_list.append(sz_libdir) if cairo_libdir: libdir_list.append(cairo_libdir) if pixman_libdir: libdir_list.append(pixman_libdir) if pango_libdir: libdir_list.append(pango_libdir) libdir_list.append(python_libdir) # Get the list of ferret static libraries # Stripping off the "lib" prefix and the ".a" suffix fer_lib_list = [ ] for libname in os.listdir("lib"): if (libname[:3] == "lib") and (libname[-2:] == ".a"): fer_lib_list.append(libname[3:-2]) # Create the list of libraries to link lib_list = fer_lib_list[:] if buildtype != "intel-mac": # fer_lib_list is included multiple times to resolve interdependencies lib_list.extend(fer_lib_list) lib_list.extend(fer_lib_list) lib_list.extend(fer_lib_list) lib_list.extend(fer_lib_list) # Linking in the rest of the system libraries were moved to addn_link_flags # in order to make sure the appropriate netcdff, netcdf, hdf5_hl, hdf5, and # cairo libraries are used. addn_link_args = [ ] # Link to the appropriate netcdf libraries. # The hdf5 libraries are only used to resolve netcdf library function # calls when statically linking in the netcdf libraries. if hdf5_libdir: netcdff_lib = os.path.join(netcdf_libdir, "libnetcdff.a") addn_link_args.append(netcdff_lib) netcdf_lib = os.path.join(netcdf_libdir, "libnetcdf.a") addn_link_args.append(netcdf_lib) hdf5_hl_lib = os.path.join(hdf5_libdir, "libhdf5_hl.a") addn_link_args.append(hdf5_hl_lib) hdf5_lib = os.path.join(hdf5_libdir, "libhdf5.a") addn_link_args.append(hdf5_lib) else: addn_link_args.extend([ "-lnetcdff", "-lnetcdf" ]) # Link to the cairo library and the libraries it requires. if cairo_libdir: cairo_lib = os.path.join(cairo_libdir, "libcairo.a") addn_link_args.append(cairo_lib); if pixman_libdir: pixman_lib = os.path.join(pixman_libdir, "libpixman-1.a") else: pixman_lib = "-lpixman-1" addn_link_args.extend([ pixman_lib, "-lfreetype", "-lfontconfig", "-lpng" ]) else: addn_link_args.append("-lcairo") # The Pango-Cairo text-rendering libraries addn_link_args.append("-lpangocairo-1.0") # Link in the appropriate system libraries if hdf5_libdir: addn_link_args.append("-lcurl") if sz_libdir: addn_link_args.append("-lsz") if gfortran_lib: addn_link_args.append(gfortran_lib) else: addn_link_args.append("-lgfortran") addn_link_args.extend([ "-lz", "-ldl", "-lm", "-fPIC", ]) if bind_and_hide_internal: # Bind symbols and function symbols to any internal definitions # and do not make any of the symbols or function symbols defined # in any libraries externally visible (mainly for cairo and pixman). # Those in the object files (including those from pyfermod and # fer/ef_utility) will still be visible. addn_link_args.extend([ "-Wl,-Bsymbolic", "-Wl,--exclude-libs,ALL"]) if os.uname()[0] == 'Darwin': # For Mac OSX, leave room for library path renames addn_link_args.append("-Wl,-headerpad_max_install_names") # Get the list of C source files in pyfermod src_list = [ ] for srcname in os.listdir("pyfermod"): if srcname[-2:] == ".c": src_list.append(os.path.join("pyfermod", srcname)) # Get the list of additional objects to be linked in addnobjs_list = [ ] dirname = os.path.join("fer", "ef_utility") for srcname in os.listdir(dirname): if srcname[-2:] == ".o": addnobjs_list.append(os.path.join(dirname, srcname)) dirname = os.path.join("fer", "special") for srcname in ( "FerMem_routines.o", "fakes3.o", "ferret_dispatch.o", "gui_fakes.o", "linux_routines.o", ): addnobjs_list.append(os.path.join(dirname, srcname)) for srcname in os.listdir(dirname): if (srcname[0] == 'x') and (srcname[-7:] == "_data.o"): addnobjs_list.append(os.path.join(dirname, srcname)) if bind_and_hide_internal: # Duplicate objects in libraries to make them externally visible (e.g., for las # external functions) if the '--exclude-libs ALL' flag was passed to the linker. dirname = os.path.join("fmt", "src") addnobjs_list.append(os.path.join(dirname, "tm_lenstr.o")); addnobjs_list.append(os.path.join(dirname, "tm_fmt.o")); addnobjs_list.append(os.path.join(dirname, "tm_lefint.o")); # Create the pyferret.libpyferret Extension ext_mods = [ Extension("pyferret.libpyferret", include_dirs = incdir_list, sources = src_list, extra_objects = addnobjs_list, library_dirs = libdir_list, libraries = lib_list, extra_link_args = addn_link_args), ] pyferret_version = None xrev_name = os.path.join("fer", "dat", "xrevision_data.F") xrev_file = open(xrev_name) try: pat = re.compile('\\s+DATA\\s+revision_level\\s*/\\s*(\\S+)\\s*/\\s*', flags=re.IGNORECASE) for datlin in xrev_file: mat = re.match(pat, datlin) if mat: pyferret_version = mat.group(1) break finally: xrev_file.close() if not pyferret_version: raise ValueError('Unable to find the version number in ' + xrev_name) # Configure the setup setup(name = "pyferret", version = pyferret_version, description = "Python module providing Ferret functionality", long_description = "Python module providing Ferret functionality", author = "Karl M. Smith", author_email = "karl.smith@noaa.gov", url = "http://ferret.pmel.noaa.gov/Ferret/documentation/pyferret", license = "Public Domain", requires = [ "numpy", ], packages = [ "pyferret", "pyferret.eofanal", "pyferret.fershp", "pyferret.graphbind", "pyferret.regrid", "pyferret.stats", ], package_dir = { "pyferret":"pyfermod", }, ext_modules = ext_mods) setup(name = "pipedviewer", version = pyferret_version, description = "Graphics viewer controlled by a command pipe", long_description = "A graphics viewer application that receives its " \ "drawing and other commands primarily from another " \ "application through a pipe. A limited number of " \ "commands are provided by the viewer itself to allow " \ "saving and some manipulation of the displayed scene. " \ "The controlling application, however, will be unaware " \ "of these modifications made to the scene.", author = "Karl M. Smith", author_email = "karl.smith@noaa.gov", url = "http://ferret.pmel.noaa.gov/Ferret/documentation/pyferret", license = "Public Domain", requires = [ "multiprocessing", ], packages = [ "pipedviewer", ], package_dir = { "pipedviewer":"pviewmod", }) setup(name = "gcircle", version = pyferret_version, description = "Module of functions involving great circles with " \ "points given in longitudes and latitudes (thus " \ "assuming a spheroid model of the earth).", long_description = "Module of functions involving great circles with " \ "points given in longitudes and latitudes (thus " \ "assuming a spheroid model of the earth).", author = "Karl M. Smith", author_email = "karl.smith@noaa.gov", url = "http://ferret.pmel.noaa.gov/Ferret/documentation/pyferret", license = "Public Domain", requires = [ "numpy", ], py_modules = [ "gcircle", ])
import sqlalchemy from sqlalchemy import orm, Column, types, ForeignKey from alchy import model, query, manager, events from .base import TestQueryBase Model = model.make_declarative_base() class TestEventsBase(TestQueryBase): @classmethod def setUpClass(cls): cls.db = manager.Manager(Model=Model, config=cls.config) def setUp(self): self.db.create_all() def tearDown(self): self.db.drop_all() class TestEvents(TestEventsBase): """Test Model events""" class Huey(Model): event_tracker = {} __tablename__ = 'huey' __events__ = { 'before_insert': 'before_insert', 'after_insert': [ 'after_insert1', 'after_insert2', ('after_insert3', {'raw': True}) ], 'on_set': [('on_set_name', {'attribute': 'name'})] } _id = Column(types.Integer(), primary_key=True) name = Column(types.String()) dewey_id = Column(types.Integer(), ForeignKey('dewey._id')) def before_insert(mapper, connection, target): target.event_tracker['before_insert'] = target.query.all() target.name = 'Huey' def after_insert1(mapper, connection, target): target.event_tracker['after_insert1'] = target.query.all() target.event_tracker['after_insert2'] = 1 def after_insert2(mapper, connection, target): target.event_tracker['after_insert2'] += 1 def after_insert3(mapper, connection, target): from sqlalchemy.orm.state import InstanceState assert isinstance(target, InstanceState) def on_set_name(target, value, oldvalue, initator): target.event_tracker['set_name'] = 1 class Dewey(Model): __tablename__ = 'dewey' __events__ = None _id = Column(types.Integer(), primary_key=True) name = Column(types.String()) number = Column(types.Integer()) min_hueys = Column(types.Boolean()) hueys = orm.relationship('Huey') @events.before_insert() def before_insert(mapper, connection, target): target.name = 'Dewey' @events.on_set('name', retval=True) def on_set_name(target, value, oldvalue, initator): if oldvalue is None or ( hasattr(oldvalue, '__class__') and oldvalue.__class__.__name__ == 'symbol'): # oldvalue is a symbol for either NO_VALUE or NOT_SET so allow # update return value else: # value previously set, so prevent edit return oldvalue @events.on_append('hueys') def on_append_hueys(target, value, intiator): if len(target.hueys) >= 1: target.min_hueys = True @events.on_remove('hueys') def on_remove_hueys(target, value, initator): if not len(target.hueys) >= 1: target.min_hueys = False @events.before_insert_update() def before_edit(mapper, connection, target): target.number = (target.number or 0) + 1 def tearDown(self): super(TestEvents, self).tearDown() # clear event tracker self.Huey.event_tracker.clear() def test_events_using_class_attribute(self): h = self.Huey() self.db.add_commit(h) self.assertEqual(len(h.event_tracker['before_insert']), 0) self.assertEqual(len(h.event_tracker['after_insert1']), 1) self.assertEqual(h.name, 'Huey') self.assertEqual(h.event_tracker['after_insert2'], 2) self.assertEqual(h.event_tracker['set_name'], 1) def test_events_using_decorator(self): d = self.Dewey() self.assertIsNone(d.number) self.db.add_commit(d) self.assertEqual(d.number, 1) self.assertEqual(d.name, 'Dewey') # trigger update event d.name = 'Foo' self.db.commit() self.assertEqual(d.number, 2) def test_attribute_event_set(self): name = 'mister' d = self.Dewey() d.name = name d.name = 'no change' self.assertEqual(d.name, name) d = self.Dewey(name=name) d.name = 'no change' self.assertEqual(d.name, name) def test_attribute_event_append(self): d = self.Dewey() self.assertIsNone(d.min_hueys) d.hueys.append(self.Huey()) self.assertIsNone(d.min_hueys) d.hueys.append(self.Huey()) self.assertTrue(d.min_hueys) def test_attribute_event_remove(self): d = self.Dewey(hueys=[self.Huey(), self.Huey()]) self.assertTrue(d.min_hueys) d.hueys.remove(d.hueys[0]) self.assertTrue(d.min_hueys) d.hueys.remove(d.hueys[0]) self.assertFalse(d.min_hueys) class TestInstanceEvents(TestEventsBase): class Louie(Model): event_tracker = {} _id = Column(types.Integer(), primary_key=True) name = Column(types.String()) @events.on_expire() def on_expire(target, attrs): target.event_tracker['expire'] = True @events.on_load() def on_load(target, context): target.event_tracker['load'] = True @events.on_refresh() def on_refresh(target, context, attrs): target.event_tracker['refresh'] = True def tearDown(self): super(TestInstanceEvents, self).tearDown() # clear event tracker self.Louie.event_tracker.clear() def test_expire(self): self.db.add(self.Louie()) record = self.Louie.get(1) self.assertIsNone(record.event_tracker.get('expire')) record.expire() self.assertTrue(record.event_tracker.get('expire')) def test_load(self): self.db.add_commit(self.Louie()) record = self.Louie.get(1) self.assertTrue(record.event_tracker.get('load')) def test_refresh(self): record = self.Louie() self.db.add_commit(record) self.assertIsNone(record.event_tracker.get('refresh')) self.assertIsNone(record.event_tracker.get('refresh')) self.Louie.get(1) self.assertTrue(record.event_tracker.get('refresh'))
""" The goal is to build JSON dictionaries that can be used to search for codes in sources and map to elements in the CDM vocabulary. """ import csv import json import os import argparse import sys def open_csv_file(file_name, mode="r"): ver_info = sys.version_info[0] if ver_info == 2: return open(file_name, mode=mode + "b") else: return open(file_name, newline="", mode=mode, encoding="utf8") def main(source_vocabulary_directory, output_json_directory=None, delimiter="\t"): """Build files for needed vocabulary""" if output_json_directory is None: output_json_directory = source_vocabulary_directory concept_csv = os.path.join(source_vocabulary_directory, "CONCEPT.csv") vocabularies = [] # Determine which vocabularies are in the concept file print("Scanning '%s'" % os.path.abspath(concept_csv)) with open_csv_file(concept_csv, "r") as f: dict_reader = csv.DictReader(f, delimiter=delimiter) i = 0 for row_dict in dict_reader: vocabulary_id = row_dict["VOCABULARY_ID".lower()] if vocabulary_id not in vocabularies: vocabularies += [vocabulary_id] i += 1 print("Read %s lines" % i) print("Found %s vocabularies" % len(vocabularies)) # Generate first pass of converting concepts into a JSON lookup file # Generate one for concept_name and one for concept_code for vocabulary in vocabularies: fields_to_key_on = ["CONCEPT_CODE".lower(), "CONCEPT_NAME".lower(), "CONCEPT_ID".lower()] if vocabulary is not None: vocabulary_name = "_".join(vocabulary.split(" ")) for field_to_key_on in fields_to_key_on: file_vocabulary_name = field_to_key_on + "_" + vocabulary_name + ".json" path_vocabulary_name = os.path.join(output_json_directory, file_vocabulary_name) if not os.path.exists(path_vocabulary_name): print("Generating '%s'" % file_vocabulary_name) csv_file_name_to_keyed_json(concept_csv, path_vocabulary_name, field_to_key_on, [("VOCABULARY_ID".lower(), vocabulary), ("INVALID_REASON".lower(), "")]) concept_relationship_csv = os.path.join(source_vocabulary_directory, "CONCEPT_RELATIONSHIP.csv") concept_relationship_json = os.path.join(output_json_directory, "concept_relationship.json") # Build a master dict if not(os.path.exists(concept_relationship_json)): print("Generating '%s'" % concept_relationship_json) csv_file_name_to_keyed_json(concept_relationship_csv, concept_relationship_json, "CONCEPT_ID_1".lower(), ("RELATIONSHIP_ID".lower(), "Maps to")) with open_csv_file(concept_csv, "r") as f: dict_reader = csv.DictReader(f, delimiter=delimiter) concept_dict_vocabulary = {} for row_dict in dict_reader: concept_dict_vocabulary[row_dict["CONCEPT_ID".lower()]] = row_dict["VOCABULARY_ID".lower()] global_concept_json = os.path.join(output_json_directory, "global_concept_vocabulary.json") print("Generating '%s'" % global_concept_json) with open(global_concept_json, "w") as fw: json.dump(concept_dict_vocabulary, fw, sort_keys=True, indent=4, separators=(',', ': ')) with open_csv_file(concept_csv) as f: dict_reader = csv.DictReader(f, delimiter=delimiter) concept_dict_domain = {} for row_dict in dict_reader: concept_dict_domain[row_dict["CONCEPT_ID".lower()]] = row_dict["DOMAIN_ID".lower()] global_concept_domain_json = os.path.join(output_json_directory, "global_concept_domain.json") print("Generating '%s'" % global_concept_json) with open(global_concept_domain_json, "w") as fw: json.dump(concept_dict_vocabulary, fw, sort_keys=True, indent=4, separators=(',', ': ')) vocabularies_with_maps = ["ICD9CM", "ICD9Proc", "ICD10CM", "ICD10PCS", "Multum", "LOINC", "CPT4", "HCPCS", "NDC", "RxNorm"] for vocabulary_id in vocabularies_with_maps: print("Annotating '%s'" % vocabulary_id) vocabulary_json = os.path.join(output_json_directory, "concept_code_" + vocabulary_id + ".json") concept_with_parent_json = os.path.join(output_json_directory, vocabulary_id + "_with_parent.json") if not os.path.exists(concept_with_parent_json): with open(vocabulary_json, "r") as fj: vocabulary_dict = json.load(fj) with open(concept_relationship_json, "r") as fj: concept_rel_dict = json.load(fj) for concept_code in vocabulary_dict: concept_dict = vocabulary_dict[concept_code] concept_id = concept_dict["CONCEPT_ID".lower()] if concept_id in concept_rel_dict: try: mapped_concept_id = concept_rel_dict[concept_id]["CONCEPT_ID_2".lower()] except TypeError: # Filter out OMOP Extension # If only OMOP Extension then include multiple_concepts = concept_rel_dict[concept_id] omop_extensions = [] everything_else = [] for concept_rel in multiple_concepts: concept_id = concept_rel["concept_id_2"] vocabulary = concept_dict_vocabulary[concept_id] if vocabulary == "OMOP Extension": omop_extensions += [concept_rel] else: everything_else += [concept_rel] omop_extensions.sort(key=lambda x: x["VALID_END_DATE".lower()], reverse=True) everything_else.sort(key=lambda x: x["VALID_END_DATE".lower()], reverse=True) sorted_multiple_concepts = everything_else + omop_extensions mapped_concept_id = sorted_multiple_concepts[0]["CONCEPT_ID_2".lower()] concept_dict["MAPPED_CONCEPT_ID".lower()] = mapped_concept_id if mapped_concept_id in concept_dict_vocabulary: concept_dict["MAPPED_CONCEPT_VOCAB".lower()] = concept_dict_vocabulary[mapped_concept_id] else: concept_dict["MAPPED_CONCEPT_VOCAB".lower()] = None if mapped_concept_id in concept_dict_domain: concept_dict["MAPPED_CONCEPT_DOMAIN".lower()] = concept_dict_domain[mapped_concept_id] else: concept_dict["MAPPED_CONCEPT_DOMAIN".lower()] = None else: concept_dict["MAPPED_CONCEPT_ID".lower()] = None with open(concept_with_parent_json, "w") as fw: json.dump(vocabulary_dict, fw, sort_keys=True, indent=4, separators=(',', ': ')) def csv_file_name_to_keyed_json(csv_file_name, json_file_name, field_to_key_on, filter_pairs=None, delimiter="\t"): """Create a keyed JSON file""" with open_csv_file(csv_file_name, "r") as fd: dict_reader = csv.DictReader(fd, delimiter=delimiter) result_dict = {} include_row = True filter_value = None field = None if filter_pairs is not None: if filter_pairs.__class__ != [].__class__: filter_pairs = [filter_pairs] include_row = False for row_dict in dict_reader: if filter_pairs is not None: for filter_pair in filter_pairs: field, filter_value = filter_pair field_value = row_dict[field] if field_value == filter_value: include_row = True else: include_row = False break if include_row: key = row_dict[field_to_key_on] if key in result_dict: if result_dict[key].__class__ == [].__class__: result_dict[key] += [row_dict] else: result_dict[key] = [result_dict[key], row_dict] else: result_dict[key] = row_dict with open(json_file_name, "w") as fw: json.dump(result_dict, fw, sort_keys=True, indent=4, separators=(',', ': ')) if __name__ == "__main__": arg_parse_obj = argparse.ArgumentParser( description="Transform Athena vocabulary files into JSON map files for mapping scripts") arg_parse_obj.add_argument("-c", "--config-file-name", dest="config_file_name", help="JSON config file", default="cdm_config.json") arg_obj = arg_parse_obj.parse_args() print("Reading config file '%s'" % arg_obj.config_file_name) with open(arg_obj.config_file_name, "r") as fc: config_dict = json.load(fc) main(config_dict["json_map_directory"])
import gdb import sys import os import omniplay.gdbscripts import ctypes counter = 1 def exitHandler(event): pid = event.inferior.pid print "Goodbye! Pid %d exited" % pid def grabParameterRegs(): eax = gdb.parse_and_eval("$eax") ebx = gdb.parse_and_eval("$ebx") ecx = gdb.parse_and_eval("$ecx") edx = gdb.parse_and_eval("$edx") esi = gdb.parse_and_eval("$esi") edi = gdb.parse_and_eval("$edi") ebp = gdb.parse_and_eval("$ebp") return eax, ebx, ecx, edx, esi, edi, ebp def getIovecPtr(): iovecType = gdb.lookup_type("struct iovec").pointer() return iovecType def getRecordPid(pid): if not pid in getRecordPid.pids: global utils newpid = utils.get_current_record_pid(pid) getRecordPid.pids[pid] = newpid return getRecordPid.pids[pid] getRecordPid.pids = {} def getPC(): pc = gdb.parse_and_eval("$pc") pcint = pc.cast(gdbTypes.inttype) uint = ctypes.c_uint(int(pcint)) return uint.value class PreLoadHandler: def __init__(self): self.syscallReturn = False self.sawVsyscall = False self.needsLoad = False self.currentSyscall = -1 self.basePC = getPC() #This maps address offsets to the correct system calls when in ld! self.offsetMap = { 84164 : 45, 91795 : 192, 91617 : 33, 91300 : 5, 91117 : 195, 91428 : 3, 91181 : 197, 91357 : 6, -1011 : 243, 91924 : 125 } def switchOver(self): return self.needsLoad def handleCatchpoint(self, pid): regs = grabParameterRegs() if self.syscallReturn: self.syscallReturn = False syscallExit(self.currentSyscall, regs, pid) return self.syscallReturn = True #If the breakpoint handled it, don't do anything if self.sawVsyscall: self.sawVsyscall = False else: pc = getPC() offset = pc - self.basePC if offset in self.offsetMap: syscall = self.offsetMap[offset] else: syscall = -1 self.currentSyscall = syscall syscallEnter(syscall, regs, pid) if syscall == -1: print "\tPC:", format(pc, '#x') print "\tOffset:", offset def handleBreakpoint(self, pid, breakpoint): if breakpoint.location == "__libc_start_main": print "---- Detected libc available ----" self.needsLoad = True return self.sawVsyscall = True regs = grabParameterRegs() syscall = int(regs[0]) self.currentSyscall = syscall syscallEnter(syscall, regs, pid) return def handle(self, event): pid = gdb.selected_inferior().pid isBreakpoint = isinstance(event, gdb.BreakpointEvent) if isBreakpoint: breakpoint = event.breakpoints[0] self.handleBreakpoint(pid, breakpoint) else: self.handleCatchpoint(pid) def onActualStop(self): if self.switchOver(): print "---- Reading libc symbols ----" gdb.execute("sharedlibrary libc.so") gdb.execute("delete") global handler handler = PostLoadHandler() gdb.execute("continue") return gdb.execute("continue") return False class PostLoadHandler: def __init__(self): self.count = 0 self.beginOfCall = True self.currentSyscall = -1 self.cstr = gdb.lookup_type("char").pointer() self.voidptr = gdb.lookup_type("void").pointer() self.recordPid = None gdb.Breakpoint("__kernel_vsyscall") def handle(self, event): regs = grabParameterRegs() pid = gdb.selected_inferior().pid if self.beginOfCall: syscall = int(regs[0]) self.currentSyscall = syscall syscallEnter(syscall, regs, pid) else: syscallExit(self.currentSyscall, regs, pid) self.currentSyscall = -1 self.beginOfCall = not self.beginOfCall def onActualStop(self): if not self.beginOfCall: gdb.execute("finish") else: gdb.execute("continue") return False def syscallEnter(syscall, regs, pid): global counter recordpid = getRecordPid(pid) if syscall == -1: outstr = "%i Pid %i (record pid %i), could not determine syscall number" print outstr % ( counter, pid, recordpid ) counter += 1 return else: outstr = "%i Pid %i (record pid %i), Syscall Number %i" print outstr % ( counter, pid, recordpid, syscall ) printArgs(syscall, regs) printSyscallEnterData(syscall, regs, recordpid) def syscallExit(syscall, regs, pid): if syscall == -1: return notrecorded = [ 243, 244, 56, 31, 98, 137, 17, 35, 188, 32, 53, 219, 44, 189, 58, 273 ] if syscall in notrecorded: return recordpid = getRecordPid(pid) printSyscallExitData(syscall, regs, recordpid) printReturnValue(syscall, regs) global counter counter += 1 def printArgs(sysnum, regs): watchedCalls = [ 3, 4, 5, 6, 90, 145, 146, 180, 181, 192, 333, 334 ] if not sysnum in watchedCalls: return outputs = { 3 : "read ( fd = %i, buf = %s, count = %i )", 4 : "write ( fd = %i, buf = %s, count = %i )", 5 : "open ( pathname = %s, flags = %i )", 6 : "close ( fd = %i )", 90 : "mmap ( addr = %s, length = %i, prot = %i, flags = %i, fd = %i, offset = %i )", 145 : "readv ( fd = %i, iovec = %s, iovcnt = %i )", 146 : "writev ( fd = %i, iovec = %s, iovcnt = %i )", 180 : "pread ( fd = %i, buf = %s, count = %i, offset = %i )", 181 : "pwrite ( fd = %i, buf = %s, count = %i, offset = %i )", 192 : "mmap2 ( addr = %s, length = %i, prot = %i, flags = %i, fd = %i, offset = %i )", 333 : "preadv ( fd = %i, iovec = %s, iovcnt = %i, offset = %i )", 334 : "pwritev ( fd = %i, iovec = %s, iovcnt = %i, offset = %i )" } #calls that look like "fd, address, count" if sysnum == 3 or sysnum == 4 or sysnum == 145 or sysnum == 146: buf = regs[2].cast(gdbTypes.voidptr) formats = ( int(regs[1]), str(buf), int(regs[3]) ) elif sysnum == 5: buf = regs[1].cast(gdbTypes.cstr) formats = ( str(buf), int(regs[2]) ) elif sysnum == 6: formats = int(regs[1]) #the mmaps elif sysnum == 90 or sysnum == 192: addr = regs[1].cast(gdbTypes.voidptr) offset = regs[6].cast(gdbTypes.inttype) formats = ( str(addr), int(regs[2]), int(regs[3]), int(regs[4]), int(regs[5]), int(offset) ) else: buf = regs[2].cast(gdbTypes.voidptr) formats = ( int(regs[1]), str(buf), int(regs[3]), int(regs[4]) ) outstr = outputs[sysnum] % formats print "\t" + outstr def printSyscallEnterData(syscall, regs, pid): watchedCalls = [ 4, 146, 181, 334 ] if syscall not in watchedCalls: return printer = Printer() try: if syscall == 4 or syscall == 181: buf = regs[2].cast(gdbTypes.cstr) count = int(regs[3]) printer.printWrite(pid, buf, count) else: iovec = regs[2].cast(getIovecPtr()) count = int(regs[3]) printer.printWriteIovec(pid, iovec, count) except gdb.MemoryError: print "\t<invalid memory address>" def printSyscallExitData(syscall, regs, pid): watchedCalls = [ 3, 90, 145, 180, 192, 333 ] if syscall not in watchedCalls: return printer = Printer() retval = int(regs[0]) if retval == -1: return try: if syscall == 3 or syscall == 180: buf = regs[2].cast(gdbTypes.cstr) printer.printRead(pid, buf, retval) elif syscall == 90 or syscall == 192: fd = int(regs[5]) if fd == -1: return buf = regs[0].cast(gdbTypes.cstr) length = int(regs[2]) printer.printRead(pid, buf, length) else: iovec = regs[2].cast(getIovecPtr()) count = int(regs[3]) printer.printReadIovec(pid, iovec, count, retval) except gdb.MemoryError: print "\t<invalid memory address>" def printReturnValue(syscall, regs): watchedCalls = [ 3, 4, 5, 6, 90, 145, 146, 180, 181, 192, 333, 334 ] if syscall not in watchedCalls: return returnVal = regs[0] #mmap returns a pointer if syscall == 90 or syscall == 192: intval = returnVal.cast(gdbTypes.inttype) if intval == -1: val = -1 else: val = returnVal.cast(gdbTypes.voidptr) print "\tReturned: %s" % str(val) else: print "\tReturned: %i" % int(returnVal) class Printer(): def init(self, group): Printer.group = group Printer.root = "/tmp/io_%i" % group Printer.reads = '/'.join([Printer.root, "reads"]) Printer.writes = '/'.join([Printer.root, "writes"]) def setup_files(self): if not os.path.isdir(Printer.root): os.mkdir(Printer.root) if not os.path.isdir(Printer.reads): os.mkdir(Printer.reads) if not os.path.isdir(Printer.writes): os.mkdir(Printer.writes) def printRead(self, pid, buf, length): totalValues.bytesRead += length self._doRead(pid, Printer._printMemRaw, buf, length) def printWrite(self, pid, buf, length): totalValues.bytesWritten += length self._doWrite(pid, Printer._printMemRaw, buf, length) def printReadIovec(self, pid, iovec, count, length): totalValues.bytesRead += length self._doRead(pid, Printer._printIovecRaw, iovec, count, length) def printWriteIovec(self, pid, iovec, count): self._doWrite(pid, Printer._printIovecRaw, iovec, count, None) def _doRead(self, pid, func, *args): outfile = self._getFile(True, pid) func(self, outfile, *args, newLine=False) print "\tCreated out file", outfile.name outfile.close() def _doWrite(self, pid, func, *args): outfile = self._getFile(False, pid) print "\tData ***" func(self, sys.stdout, *args, newLine=True) print "\t***" func(self, outfile, *args, newLine=False) print "\tCreated out file", outfile.name outfile.close() def _getFile(self, isRead, pid): folder = Printer.reads if isRead else Printer.writes global counter filename = "%s/%i_%i_%i" % ( folder, Printer.group, pid, counter ) outfile = open(filename, 'w') return outfile def _printMemRaw(self, ostream, buf, length, newLine=True): try: sval = buf.string('ascii', 'ignore', length) except UnicodeError: sval = "<***contained unprintable characters***>" if newLine: print >>ostream, sval else: print >>ostream, sval, def _printIovecRaw(self, ostream, iovecArr, count, length, newLine=False): vecarr = [ iovecArr[i] for i in xrange(count) ] if length == None: length = sum([ int(vec['iov_len']) for vec in vecarr ]) #TODO: This really really really needs to go somewhere else totalValues.bytesWritten += length for vec in vecarr: buf = vec['iov_base'].cast(gdbTypes.cstr) vlength = int(vec['iov_len']) if vlength > length: vlength = length length -= vlength self._printMemRaw(ostream, buf, vlength, newLine=False) if newLine: print >>ostream, '' #This is pretty hacky but oh well class gdbTypes: cstr = gdb.lookup_type("char").pointer() voidptr = gdb.lookup_type("void").pointer() inttype = gdb.lookup_type("int") #TODO: find a better way to do this class totalValues: bytesRead = 0 bytesWritten = 0 handler = None utils = None def stopHandler(event): global handler handler.handle(event) def main(): global utils utils = omniplay.gdbscripts.ScriptUtilities() group = utils.get_replay_group() printer = Printer() printer.init(group) printer.setup_files() print "Replay Group is", group global handler handler = PreLoadHandler() gdb.events.exited.connect(exitHandler) gdb.events.stop.connect(stopHandler) #This line is a performance booster potentially -> makes it so it doesn't # remove and reinsert breakpoints everytime it stops #gdb.execute("set breakpoint always-inserted on") #Temp gdb.execute("catch syscall") gdb.execute("break __kernel_vsyscall") gdb.execute("break __libc_start_main") while True: try: if handler.onActualStop(): break except gdb.error: break print "Total Bytes Read:", totalValues.bytesRead print "Total Bytes Written:", totalValues.bytesWritten main()
import os import re import subprocess from collections import namedtuple import logging import bisect from common import SushiError, get_extension import chapters MediaStreamInfo = namedtuple('MediaStreamInfo', ['id', 'info', 'default', 'title']) SubtitlesStreamInfo = namedtuple('SubtitlesStreamInfo', ['id', 'info', 'type', 'default', 'title']) MediaInfo = namedtuple('MediaInfo', ['video', 'audio', 'subtitles', 'chapters']) class FFmpeg(object): @staticmethod def get_info(path): try: process = subprocess.Popen(['ffmpeg', '-hide_banner', '-i', path], stderr=subprocess.PIPE) out, err = process.communicate() process.wait() return err except OSError as e: if e.errno == 2: raise SushiError("Couldn't invoke ffmpeg, check that it's installed") raise @staticmethod def demux_file(input_path, **kwargs): args = ['ffmpeg', '-hide_banner', '-i', input_path, '-y'] audio_stream = kwargs.get('audio_stream', None) audio_path = kwargs.get('audio_path', None) audio_rate = kwargs.get('audio_rate', None) if audio_stream is not None: args.extend(('-map', '0:{0}'.format(audio_stream))) if audio_rate: args.extend(('-ar', str(audio_rate))) args.extend(('-ac', '1', '-acodec', 'pcm_s16le', audio_path)) script_stream = kwargs.get('script_stream', None) script_path = kwargs.get('script_path', None) if script_stream is not None: args.extend(('-map', '0:{0}'.format(script_stream), script_path)) video_stream = kwargs.get('video_stream', None) timecodes_path = kwargs.get('timecodes_path', None) if timecodes_path is not None: args.extend(('-map', '0:{0}'.format(video_stream), '-f', 'mkvtimestamp_v2', timecodes_path)) logging.info('ffmpeg args: {0}'.format(' '.join(('"{0}"' if ' ' in a else '{0}').format(a) for a in args))) try: subprocess.call(args) except OSError as e: if e.errno == 2: raise SushiError("Couldn't invoke ffmpeg, check that it's installed") raise @staticmethod def _get_audio_streams(info): streams = re.findall(r'Stream\s\#0:(\d+).*?Audio:\s*(.*?(?:\((default)\))?)\s*?(?:\(forced\))?\r?\n' r'(?:\s*Metadata:\s*\r?\n' r'\s*title\s*:\s*(.*?)\r?\n)?', info, flags=re.VERBOSE) return [MediaStreamInfo(int(x[0]), x[1], x[2] != '', x[3]) for x in streams] @staticmethod def _get_video_streams(info): streams = re.findall(r'Stream\s\#0:(\d+).*?Video:\s*(.*?(?:\((default)\))?)\s*?(?:\(forced\))?\r?\n' r'(?:\s*Metadata:\s*\r?\n' r'\s*title\s*:\s*(.*?)\r?\n)?', info, flags=re.VERBOSE) return [MediaStreamInfo(int(x[0]), x[1], x[2] != '', x[3]) for x in streams] @staticmethod def _get_chapters_times(info): return map(float, re.findall(r'Chapter #0.\d+: start (\d+\.\d+)', info)) @staticmethod def _get_subtitles_streams(info): maps = { 'ssa': '.ass', 'ass': '.ass', 'subrip': '.srt' } streams = re.findall(r'Stream\s\#0:(\d+).*?Subtitle:\s*((\w*)\s*?(?:\((default)\))?\s*?(?:\(forced\))?)\r?\n' r'(?:\s*Metadata:\s*\r?\n' r'\s*title\s*:\s*(.*?)\r?\n)?', info, flags=re.VERBOSE) return [SubtitlesStreamInfo(int(x[0]), x[1], maps.get(x[2], x[2]), x[3] != '', x[4].strip()) for x in streams] @classmethod def get_media_info(cls, path): info = cls.get_info(path) video_streams = cls._get_video_streams(info) audio_streams = cls._get_audio_streams(info) subs_streams = cls._get_subtitles_streams(info) chapter_times = cls._get_chapters_times(info) return MediaInfo(video_streams, audio_streams, subs_streams, chapter_times) class MkvToolnix(object): @classmethod def extract_timecodes(cls, mkv_path, stream_idx, output_path): args = ['mkvextract', 'timecodes_v2', mkv_path, '{0}:{1}'.format(stream_idx, output_path)] subprocess.call(args) class SCXviD(object): @classmethod def make_keyframes(cls, video_path, log_path): try: ffmpeg_process = subprocess.Popen(['ffmpeg', '-i', video_path, '-f', 'yuv4mpegpipe', '-vf', 'scale=640:360', '-pix_fmt', 'yuv420p', '-vsync', 'drop', '-'], stdout=subprocess.PIPE) except OSError as e: if e.errno == 2: raise SushiError("Couldn't invoke ffmpeg, check that it's installed") raise try: scxvid_process = subprocess.Popen(['SCXvid', log_path], stdin=ffmpeg_process.stdout) except OSError as e: ffmpeg_process.kill() if e.errno == 2: raise SushiError("Couldn't invoke scxvid, check that it's installed") raise scxvid_process.wait() class Timecodes(object): def __init__(self, times, default_fps): super(Timecodes, self).__init__() self.times = times self.default_frame_duration = 1.0 / default_fps if default_fps else None def get_frame_time(self, number): try: return self.times[number] except IndexError: if not self.default_frame_duration: return self.get_frame_time(len(self.times)-1) if self.times: return self.times[-1] + (self.default_frame_duration) * (number - len(self.times) + 1) else: return number * self.default_frame_duration def get_frame_number(self, timestamp): if (not self.times or self.times[-1] < timestamp) and self.default_frame_duration: return int((timestamp - sum(self.times)) / self.default_frame_duration) return bisect.bisect_left(self.times, timestamp) def get_frame_size(self, timestamp): try: number = bisect.bisect_left(self.times, timestamp) except: return self.default_frame_duration c = self.get_frame_time(number) if number == len(self.times): p = self.get_frame_time(number - 1) return c - p else: n = self.get_frame_time(number + 1) return n - c @classmethod def _convert_v1_to_v2(cls, default_fps, overrides): # start, end, fps overrides = [(int(x[0]), int(x[1]), float(x[2])) for x in overrides] if not overrides: return [] fps = [default_fps] * (overrides[-1][1] + 1) for o in overrides: fps[o[0]:o[1] + 1] = [o[2]] * (o[1] - o[0] + 1) v2 = [0] for d in (1.0 / f for f in fps): v2.append(v2[-1] + d) return v2 @classmethod def parse(cls, text): lines = text.splitlines() if not lines: return [] first = lines[0].lower().lstrip() if first.startswith('# timecode format v2') or first.startswith('# timestamp format v2'): tcs = [float(x) / 1000.0 for x in lines[1:]] return Timecodes(tcs, None) elif first.startswith('# timecode format v1'): default = float(lines[1].lower().replace('assume ', "")) overrides = (x.split(',') for x in lines[2:]) return Timecodes(cls._convert_v1_to_v2(default, overrides), default) else: raise SushiError('This timecodes format is not supported') @classmethod def from_file(cls, path): with open(path) as file: return cls.parse(file.read()) @classmethod def cfr(cls, fps): class CfrTimecodes(object): def __init__(self, fps): self.frame_duration = 1.0 / fps def get_frame_time(self, number): return number * self.frame_duration def get_frame_size(self, timestamp): return self.frame_duration def get_frame_number(self, timestamp): return int(timestamp / self.frame_duration) return CfrTimecodes(fps) class Demuxer(object): def __init__(self, path): super(Demuxer, self).__init__() self._path = path self._is_wav = get_extension(self._path) == '.wav' self._mi = None if self._is_wav else FFmpeg.get_media_info(self._path) self._demux_audio = self._demux_subs = self._make_timecodes = self._make_keyframes = self._write_chapters = False @property def is_wav(self): return self._is_wav @property def path(self): return self._path @property def chapters(self): if self.is_wav: return [] return self._mi.chapters @property def has_video(self): return not self.is_wav and self._mi.video def set_audio(self, stream_idx, output_path, sample_rate): self._audio_stream = self._select_stream(self._mi.audio, stream_idx, 'audio') self._audio_output_path = output_path self._audio_sample_rate = sample_rate self._demux_audio = True def set_script(self, stream_idx, output_path): self._script_stream = self._select_stream(self._mi.subtitles, stream_idx, 'subtitles') self._script_output_path = output_path self._demux_subs = True def set_timecodes(self, output_path): self._timecodes_output_path = output_path self._make_timecodes = True def set_chapters(self, output_path): self._write_chapters = True self._chapters_output_path = output_path def set_keyframes(self, output_path): self._keyframes_output_path = output_path self._make_keyframes = True def get_subs_type(self, stream_idx): return self._select_stream(self._mi.subtitles, stream_idx, 'subtitles').type def demux(self): if self._write_chapters: with open(self._chapters_output_path, "w") as output_file: output_file.write(chapters.format_ogm_chapters(self.chapters)) if self._make_keyframes: SCXviD.make_keyframes(self._path, self._keyframes_output_path) ffargs = {} if self._demux_audio: ffargs['audio_stream'] = self._audio_stream.id ffargs['audio_path'] = self._audio_output_path ffargs['audio_rate'] = self._audio_sample_rate if self._demux_subs: ffargs['script_stream'] = self._script_stream.id ffargs['script_path'] = self._script_output_path if self._make_timecodes: def set_ffmpeg_timecodes(): ffargs['video_stream'] = self._mi.video[0].id ffargs['timecodes_path'] = self._timecodes_output_path if get_extension(self._path).lower() == '.mkv': try: MkvToolnix.extract_timecodes(self._path, stream_idx=self._mi.video[0].id, output_path=self._timecodes_output_path) except OSError as e: if e.errno == 2: set_ffmpeg_timecodes() else: raise else: set_ffmpeg_timecodes() if ffargs: FFmpeg.demux_file(self._path, **ffargs) def cleanup(self): if self._demux_audio: os.remove(self._audio_output_path) if self._demux_subs: os.remove(self._script_output_path) if self._make_timecodes: os.remove(self._timecodes_output_path) if self._write_chapters: os.remove(self._chapters_output_path) @classmethod def _format_stream(cls, stream): return '{0}{1}: {2}'.format(stream.id, ' (%s)' % stream.title if stream.title else '', stream.info) @classmethod def _format_streams_list(cls, streams): return '\n'.join(map(cls._format_stream, streams)) def _select_stream(self, streams, chosen_idx, name): if not streams: raise SushiError('No {0} streams found in {1}'.format(name, self._path)) if chosen_idx is None: if len(streams) > 1: default_track = next((s for s in streams if s.default), None) if default_track: logging.warning('Using default track {0} in {1} because there are multiple candidates' .format(self._format_stream(default_track), self._path)) return default_track raise SushiError('More than one {0} stream found in {1}.' 'You need to specify the exact one to demux. Here are all candidates:\n' '{2}'.format(name, self._path, self._format_streams_list(streams))) return streams[0] try: return next(x for x in streams if x.id == chosen_idx) except StopIteration: raise SushiError("Stream with index {0} doesn't exist in {1}.\n" "Here are all that do:\n" "{2}".format(chosen_idx, self._path, self._format_streams_list(streams)))
# Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. # isort:skip_file """Unit tests for Superset""" import json import unittest from datetime import datetime from unittest.mock import Mock, patch from tests.integration_tests.test_app import app from superset import db, security_manager from superset.connectors.druid.views import ( Druid, DruidClusterModelView, DruidColumnInlineView, DruidDatasourceModelView, DruidMetricInlineView, ) from .base_tests import SupersetTestCase try: from superset.connectors.druid.models import ( DruidCluster, DruidColumn, DruidDatasource, DruidMetric, ) except ImportError: pass class PickableMock(Mock): def __reduce__(self): return (Mock, ()) SEGMENT_METADATA = [ { "id": "some_id", "intervals": ["2013-05-13T00:00:00.000Z/2013-05-14T00:00:00.000Z"], "columns": { "__time": { "type": "LONG", "hasMultipleValues": False, "size": 407240380, "cardinality": None, "errorMessage": None, }, "dim1": { "type": "STRING", "hasMultipleValues": False, "size": 100000, "cardinality": 1944, "errorMessage": None, }, "dim2": { "type": "STRING", "hasMultipleValues": True, "size": 100000, "cardinality": 1504, "errorMessage": None, }, "metric1": { "type": "FLOAT", "hasMultipleValues": False, "size": 100000, "cardinality": None, "errorMessage": None, }, }, "aggregators": { "metric1": {"type": "longSum", "name": "metric1", "fieldName": "metric1"} }, "size": 300000, "numRows": 5000000, } ] GB_RESULT_SET = [ { "version": "v1", "timestamp": "2012-01-01T00:00:00.000Z", "event": {"dim1": "Canada", "dim2": "boy", "count": 12345678}, }, { "version": "v1", "timestamp": "2012-01-01T00:00:00.000Z", "event": {"dim1": "USA", "dim2": "girl", "count": 12345678 / 2}, }, ] DruidCluster.get_druid_version = lambda _: "0.9.1" # type: ignore class TestDruid(SupersetTestCase): """Testing interactions with Druid""" @classmethod def setUpClass(cls): cls.create_druid_test_objects() def get_test_cluster_obj(self): return DruidCluster( cluster_name="test_cluster", broker_host="localhost", broker_port=7980, broker_endpoint="druid/v2", metadata_last_refreshed=datetime.now(), ) def get_cluster(self, PyDruid): instance = PyDruid.return_value instance.time_boundary.return_value = [{"result": {"maxTime": "2016-01-01"}}] instance.segment_metadata.return_value = SEGMENT_METADATA cluster = ( db.session.query(DruidCluster) .filter_by(cluster_name="test_cluster") .first() ) if cluster: for datasource in ( db.session.query(DruidDatasource).filter_by(cluster_id=cluster.id).all() ): db.session.delete(datasource) db.session.delete(cluster) db.session.commit() cluster = self.get_test_cluster_obj() db.session.add(cluster) cluster.get_datasources = PickableMock(return_value=["test_datasource"]) return cluster @unittest.skipUnless( SupersetTestCase.is_module_installed("pydruid"), "pydruid not installed" ) @patch("superset.connectors.druid.models.PyDruid") def test_client(self, PyDruid): self.login(username="admin") cluster = self.get_cluster(PyDruid) cluster.refresh_datasources() cluster.refresh_datasources(merge_flag=True) datasource_id = cluster.datasources[0].id db.session.commit() nres = [ list(v["event"].items()) + [("timestamp", v["timestamp"])] for v in GB_RESULT_SET ] nres = [dict(v) for v in nres] import pandas as pd df = pd.DataFrame(nres) instance = PyDruid.return_value instance.export_pandas.return_value = df instance.query_dict = {} instance.query_builder.last_query.query_dict = {} resp = self.get_resp("/superset/explore/druid/{}/".format(datasource_id)) self.assertIn("test_datasource", resp) form_data = { "viz_type": "table", "granularity": "one+day", "druid_time_origin": "", "since": "7 days ago", "until": "now", "row_limit": 5000, "include_search": "false", "metrics": ["count"], "groupby": ["dim1"], "force": "true", } # One groupby url = "/superset/explore_json/druid/{}/".format(datasource_id) resp = self.get_json_resp(url, {"form_data": json.dumps(form_data)}) self.assertEqual("Canada", resp["data"]["records"][0]["dim1"]) form_data = { "viz_type": "table", "granularity": "one+day", "druid_time_origin": "", "since": "7 days ago", "until": "now", "row_limit": 5000, "include_search": "false", "metrics": ["count"], "groupby": ["dim1", "dim2"], "force": "true", } # two groupby url = "/superset/explore_json/druid/{}/".format(datasource_id) resp = self.get_json_resp(url, {"form_data": json.dumps(form_data)}) self.assertEqual("Canada", resp["data"]["records"][0]["dim1"]) @unittest.skipUnless( SupersetTestCase.is_module_installed("pydruid"), "pydruid not installed" ) def test_druid_sync_from_config(self): CLUSTER_NAME = "new_druid" self.login() cluster = self.get_or_create( DruidCluster, {"cluster_name": CLUSTER_NAME}, db.session ) db.session.merge(cluster) db.session.commit() ds = ( db.session.query(DruidDatasource) .filter_by(datasource_name="test_click") .first() ) if ds: db.session.delete(ds) db.session.commit() cfg = { "user": "admin", "cluster": CLUSTER_NAME, "config": { "name": "test_click", "dimensions": ["affiliate_id", "campaign", "first_seen"], "metrics_spec": [ {"type": "count", "name": "count"}, {"type": "sum", "name": "sum"}, ], "batch_ingestion": { "sql": "SELECT * FROM clicks WHERE d='{{ ds }}'", "ts_column": "d", "sources": [{"table": "clicks", "partition": "d='{{ ds }}'"}], }, }, } def check(): resp = self.client.post("/superset/sync_druid/", data=json.dumps(cfg)) druid_ds = ( db.session.query(DruidDatasource) .filter_by(datasource_name="test_click") .one() ) col_names = set([c.column_name for c in druid_ds.columns]) assert {"affiliate_id", "campaign", "first_seen"} == col_names metric_names = {m.metric_name for m in druid_ds.metrics} assert {"count", "sum"} == metric_names assert resp.status_code == 201 check() # checking twice to make sure a second sync yields the same results check() # datasource exists, add new metrics and dimensions cfg = { "user": "admin", "cluster": CLUSTER_NAME, "config": { "name": "test_click", "dimensions": ["affiliate_id", "second_seen"], "metrics_spec": [ {"type": "bla", "name": "sum"}, {"type": "unique", "name": "unique"}, ], }, } resp = self.client.post("/superset/sync_druid/", data=json.dumps(cfg)) druid_ds = ( db.session.query(DruidDatasource) .filter_by(datasource_name="test_click") .one() ) # columns and metrics are not deleted if config is changed as # user could define his own dimensions / metrics and want to keep them assert set([c.column_name for c in druid_ds.columns]) == set( ["affiliate_id", "campaign", "first_seen", "second_seen"] ) assert set([m.metric_name for m in druid_ds.metrics]) == set( ["count", "sum", "unique"] ) # metric type will not be overridden, sum stays instead of bla assert set([m.metric_type for m in druid_ds.metrics]) == set( ["longSum", "sum", "unique"] ) assert resp.status_code == 201 @unittest.skipUnless( SupersetTestCase.is_module_installed("pydruid"), "pydruid not installed" ) @unittest.skipUnless(app.config["DRUID_IS_ACTIVE"], "DRUID_IS_ACTIVE is false") def test_filter_druid_datasource(self): CLUSTER_NAME = "new_druid" cluster = self.get_or_create( DruidCluster, {"cluster_name": CLUSTER_NAME}, db.session ) db.session.merge(cluster) gamma_ds = self.get_or_create( DruidDatasource, {"datasource_name": "datasource_for_gamma", "cluster": cluster}, db.session, ) gamma_ds.cluster = cluster db.session.merge(gamma_ds) no_gamma_ds = self.get_or_create( DruidDatasource, {"datasource_name": "datasource_not_for_gamma", "cluster": cluster}, db.session, ) no_gamma_ds.cluster = cluster db.session.merge(no_gamma_ds) db.session.commit() security_manager.add_permission_view_menu("datasource_access", gamma_ds.perm) security_manager.add_permission_view_menu("datasource_access", no_gamma_ds.perm) perm = security_manager.find_permission_view_menu( "datasource_access", gamma_ds.get_perm() ) security_manager.add_permission_role(security_manager.find_role("Gamma"), perm) security_manager.get_session.commit() self.login(username="gamma") url = "/druiddatasourcemodelview/list/" resp = self.get_resp(url) self.assertIn("datasource_for_gamma", resp) self.assertNotIn("datasource_not_for_gamma", resp) @unittest.skipUnless( SupersetTestCase.is_module_installed("pydruid"), "pydruid not installed" ) @patch("superset.connectors.druid.models.PyDruid") def test_sync_druid_perm(self, PyDruid): self.login(username="admin") instance = PyDruid.return_value instance.time_boundary.return_value = [{"result": {"maxTime": "2016-01-01"}}] instance.segment_metadata.return_value = SEGMENT_METADATA cluster = ( db.session.query(DruidCluster) .filter_by(cluster_name="test_cluster") .first() ) if cluster: for datasource in ( db.session.query(DruidDatasource).filter_by(cluster_id=cluster.id).all() ): db.session.delete(datasource) db.session.delete(cluster) db.session.commit() cluster = DruidCluster( cluster_name="test_cluster", broker_host="localhost", broker_port=7980, metadata_last_refreshed=datetime.now(), ) db.session.add(cluster) cluster.get_datasources = PickableMock(return_value=["test_datasource"]) cluster.refresh_datasources() cluster.datasources[0].merge_flag = True metadata = cluster.datasources[0].latest_metadata() self.assertEqual(len(metadata), 4) db.session.commit() view_menu_name = cluster.datasources[0].get_perm() view_menu = security_manager.find_view_menu(view_menu_name) permission = security_manager.find_permission("datasource_access") pv = ( security_manager.get_session.query(security_manager.permissionview_model) .filter_by(permission=permission, view_menu=view_menu) .first() ) assert pv is not None @unittest.skipUnless( SupersetTestCase.is_module_installed("pydruid"), "pydruid not installed" ) @patch("superset.connectors.druid.models.PyDruid") def test_refresh_metadata(self, PyDruid): self.login(username="admin") cluster = self.get_cluster(PyDruid) cluster.refresh_datasources() datasource = cluster.datasources[0] cols = db.session.query(DruidColumn).filter( DruidColumn.datasource_id == datasource.id ) for col in cols: self.assertIn(col.column_name, SEGMENT_METADATA[0]["columns"].keys()) metrics = ( db.session.query(DruidMetric) .filter(DruidMetric.datasource_id == datasource.id) .filter(DruidMetric.metric_name.like("%__metric1")) ) for metric in metrics: agg, _ = metric.metric_name.split("__") self.assertEqual( json.loads(metric.json)["type"], "double{}".format(agg.capitalize()) ) @unittest.skipUnless( SupersetTestCase.is_module_installed("pydruid"), "pydruid not installed" ) @patch("superset.connectors.druid.models.PyDruid") def test_refresh_metadata_augment_type(self, PyDruid): self.login(username="admin") cluster = self.get_cluster(PyDruid) cluster.refresh_datasources() metadata = SEGMENT_METADATA[:] metadata[0]["columns"]["metric1"]["type"] = "LONG" instance = PyDruid.return_value instance.segment_metadata.return_value = metadata cluster.refresh_datasources() datasource = cluster.datasources[0] column = ( db.session.query(DruidColumn) .filter(DruidColumn.datasource_id == datasource.id) .filter(DruidColumn.column_name == "metric1") ).one() self.assertEqual(column.type, "LONG") metrics = ( db.session.query(DruidMetric) .filter(DruidMetric.datasource_id == datasource.id) .filter(DruidMetric.metric_name.like("%__metric1")) ) for metric in metrics: agg, _ = metric.metric_name.split("__") self.assertEqual(metric.json_obj["type"], "long{}".format(agg.capitalize())) @unittest.skipUnless( SupersetTestCase.is_module_installed("pydruid"), "pydruid not installed" ) @patch("superset.connectors.druid.models.PyDruid") def test_refresh_metadata_augment_verbose_name(self, PyDruid): self.login(username="admin") cluster = self.get_cluster(PyDruid) cluster.refresh_datasources() datasource = cluster.datasources[0] metrics = ( db.session.query(DruidMetric) .filter(DruidMetric.datasource_id == datasource.id) .filter(DruidMetric.metric_name.like("%__metric1")) ) for metric in metrics: metric.verbose_name = metric.metric_name db.session.commit() # The verbose name should not change during a refresh. cluster.refresh_datasources() datasource = cluster.datasources[0] metrics = ( db.session.query(DruidMetric) .filter(DruidMetric.datasource_id == datasource.id) .filter(DruidMetric.metric_name.like("%__metric1")) ) for metric in metrics: self.assertEqual(metric.verbose_name, metric.metric_name) @unittest.skipUnless( SupersetTestCase.is_module_installed("pydruid"), "pydruid not installed" ) def test_urls(self): cluster = self.get_test_cluster_obj() self.assertEqual( cluster.get_base_url("localhost", "9999"), "http://localhost:9999" ) self.assertEqual( cluster.get_base_url("http://localhost", "9999"), "http://localhost:9999" ) self.assertEqual( cluster.get_base_url("https://localhost", "9999"), "https://localhost:9999" ) self.assertEqual( cluster.get_base_broker_url(), "http://localhost:7980/druid/v2" ) @unittest.skipUnless( SupersetTestCase.is_module_installed("pydruid"), "pydruid not installed" ) @patch("superset.connectors.druid.models.PyDruid") def test_druid_time_granularities(self, PyDruid): self.login(username="admin") cluster = self.get_cluster(PyDruid) cluster.refresh_datasources() cluster.refresh_datasources(merge_flag=True) datasource_id = cluster.datasources[0].id db.session.commit() nres = [ list(v["event"].items()) + [("timestamp", v["timestamp"])] for v in GB_RESULT_SET ] nres = [dict(v) for v in nres] import pandas as pd df = pd.DataFrame(nres) instance = PyDruid.return_value instance.export_pandas.return_value = df instance.query_dict = {} instance.query_builder.last_query.query_dict = {} form_data = { "viz_type": "table", "since": "7 days ago", "until": "now", "metrics": ["count"], "groupby": [], "include_time": "true", } granularity_map = { "5 seconds": "PT5S", "30 seconds": "PT30S", "1 minute": "PT1M", "5 minutes": "PT5M", "1 hour": "PT1H", "6 hour": "PT6H", "one day": "P1D", "1 day": "P1D", "7 days": "P7D", "week": "P1W", "week_starting_sunday": "P1W", "week_ending_saturday": "P1W", "month": "P1M", "quarter": "P3M", "year": "P1Y", } url = "/superset/explore_json/druid/{}/".format(datasource_id) for granularity_mapping in granularity_map: form_data["granularity"] = granularity_mapping self.get_json_resp(url, {"form_data": json.dumps(form_data)}) self.assertEqual( granularity_map[granularity_mapping], instance.timeseries.call_args[1]["granularity"]["period"], ) @unittest.skipUnless( SupersetTestCase.is_module_installed("pydruid"), "pydruid not installed" ) @patch("superset.connectors.druid.models.PyDruid") def test_external_metadata(self, PyDruid): self.login(username="admin") self.login(username="admin") cluster = self.get_cluster(PyDruid) cluster.refresh_datasources() datasource = cluster.datasources[0] url = "/datasource/external_metadata/druid/{}/".format(datasource.id) resp = self.get_json_resp(url) col_names = {o.get("name") for o in resp} self.assertEqual(col_names, {"__time", "dim1", "dim2", "metric1"}) class TestDruidViewEnabling(SupersetTestCase): def test_druid_disabled(self): with patch.object(Druid, "is_enabled", return_value=False): self.login("admin") uri = "/druid/refresh_datasources/" rv = self.client.get(uri) self.assertEqual(rv.status_code, 404) def test_druid_enabled(self): with patch.object(Druid, "is_enabled", return_value=True): self.login("admin") uri = "/druid/refresh_datasources/" rv = self.client.get(uri) self.assertLess(rv.status_code, 400) def test_druid_cluster_disabled(self): with patch.object(DruidClusterModelView, "is_enabled", return_value=False): self.login("admin") uri = "/druidclustermodelview/list/" rv = self.client.get(uri) self.assertEqual(rv.status_code, 404) def test_druid_cluster_enabled(self): with patch.object(DruidClusterModelView, "is_enabled", return_value=True): self.login("admin") uri = "/druidclustermodelview/list/" rv = self.client.get(uri) self.assertLess(rv.status_code, 400) def test_druid_column_disabled(self): with patch.object(DruidColumnInlineView, "is_enabled", return_value=False): self.login("admin") uri = "/druidcolumninlineview/list/" rv = self.client.get(uri) self.assertEqual(rv.status_code, 404) def test_druid_column_enabled(self): with patch.object(DruidColumnInlineView, "is_enabled", return_value=True): self.login("admin") uri = "/druidcolumninlineview/list/" rv = self.client.get(uri) self.assertLess(rv.status_code, 400) def test_druid_datasource_disabled(self): with patch.object(DruidDatasourceModelView, "is_enabled", return_value=False): self.login("admin") uri = "/druiddatasourcemodelview/list/" rv = self.client.get(uri) self.assertEqual(rv.status_code, 404) def test_druid_datasource_enabled(self): with patch.object(DruidDatasourceModelView, "is_enabled", return_value=True): self.login("admin") uri = "/druiddatasourcemodelview/list/" rv = self.client.get(uri) self.assertLess(rv.status_code, 400) def test_druid_metric_disabled(self): with patch.object(DruidMetricInlineView, "is_enabled", return_value=False): self.login("admin") uri = "/druidmetricinlineview/list/" rv = self.client.get(uri) self.assertEqual(rv.status_code, 404) def test_druid_metric_enabled(self): with patch.object(DruidMetricInlineView, "is_enabled", return_value=True): self.login("admin") uri = "/druidmetricinlineview/list/" rv = self.client.get(uri) self.assertLess(rv.status_code, 400) if __name__ == "__main__": unittest.main()
# vim: tabstop=4 shiftwidth=4 softtabstop=4 # Copyright 2010 United States Government as represented by the # Administrator of the National Aeronautics and Space Administration. # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """ Starting point for routing EC2 requests. """ import urlparse from eventlet.green import httplib from oslo.config import cfg import webob import webob.dec import webob.exc from nova.api.ec2 import apirequest from nova.api.ec2 import ec2utils from nova.api.ec2 import faults from nova.api import validator from nova import context from nova import exception from nova.openstack.common.gettextutils import _ from nova.openstack.common import importutils from nova.openstack.common import jsonutils from nova.openstack.common import log as logging from nova.openstack.common import memorycache from nova.openstack.common import timeutils from nova import utils from nova import wsgi LOG = logging.getLogger(__name__) ec2_opts = [ cfg.IntOpt('lockout_attempts', default=5, help='Number of failed auths before lockout.'), cfg.IntOpt('lockout_minutes', default=15, help='Number of minutes to lockout if triggered.'), cfg.IntOpt('lockout_window', default=15, help='Number of minutes for lockout window.'), cfg.StrOpt('keystone_ec2_url', default='http://localhost:5000/v2.0/ec2tokens', help='URL to get token from ec2 request.'), cfg.BoolOpt('ec2_private_dns_show_ip', default=False, help='Return the IP address as private dns hostname in ' 'describe instances'), cfg.BoolOpt('ec2_strict_validation', default=True, help='Validate security group names' ' according to EC2 specification'), cfg.IntOpt('ec2_timestamp_expiry', default=300, help='Time in seconds before ec2 timestamp expires'), ] CONF = cfg.CONF CONF.register_opts(ec2_opts) CONF.import_opt('use_forwarded_for', 'nova.api.auth') ## Fault Wrapper around all EC2 requests ## class FaultWrapper(wsgi.Middleware): """Calls the middleware stack, captures any exceptions into faults.""" @webob.dec.wsgify(RequestClass=wsgi.Request) def __call__(self, req): try: return req.get_response(self.application) except Exception as ex: LOG.exception(_("FaultWrapper: %s"), unicode(ex)) return faults.Fault(webob.exc.HTTPInternalServerError()) class RequestLogging(wsgi.Middleware): """Access-Log akin logging for all EC2 API requests.""" @webob.dec.wsgify(RequestClass=wsgi.Request) def __call__(self, req): start = timeutils.utcnow() rv = req.get_response(self.application) self.log_request_completion(rv, req, start) return rv def log_request_completion(self, response, request, start): apireq = request.environ.get('ec2.request', None) if apireq: controller = apireq.controller action = apireq.action else: controller = None action = None ctxt = request.environ.get('nova.context', None) delta = timeutils.utcnow() - start seconds = delta.seconds microseconds = delta.microseconds LOG.info( "%s.%ss %s %s %s %s:%s %s [%s] %s %s", seconds, microseconds, request.remote_addr, request.method, "%s%s" % (request.script_name, request.path_info), controller, action, response.status_int, request.user_agent, request.content_type, response.content_type, context=ctxt) class Lockout(wsgi.Middleware): """Lockout for x minutes on y failed auths in a z minute period. x = lockout_timeout flag y = lockout_window flag z = lockout_attempts flag Uses memcached if lockout_memcached_servers flag is set, otherwise it uses a very simple in-process cache. Due to the simplicity of the implementation, the timeout window is started with the first failed request, so it will block if there are x failed logins within that period. There is a possible race condition where simultaneous requests could sneak in before the lockout hits, but this is extremely rare and would only result in a couple of extra failed attempts. """ def __init__(self, application): """middleware can use fake for testing.""" self.mc = memorycache.get_client() super(Lockout, self).__init__(application) @webob.dec.wsgify(RequestClass=wsgi.Request) def __call__(self, req): access_key = str(req.params['AWSAccessKeyId']) failures_key = "authfailures-%s" % access_key failures = int(self.mc.get(failures_key) or 0) if failures >= CONF.lockout_attempts: detail = _("Too many failed authentications.") raise webob.exc.HTTPForbidden(detail=detail) res = req.get_response(self.application) if res.status_int == 403: failures = self.mc.incr(failures_key) if failures is None: # NOTE(vish): To use incr, failures has to be a string. self.mc.set(failures_key, '1', time=CONF.lockout_window * 60) elif failures >= CONF.lockout_attempts: LOG.warn(_('Access key %(access_key)s has had %(failures)d ' 'failed authentications and will be locked out ' 'for %(lock_mins)d minutes.'), {'access_key': access_key, 'failures': failures, 'lock_mins': CONF.lockout_minutes}) self.mc.set(failures_key, str(failures), time=CONF.lockout_minutes * 60) return res class EC2KeystoneAuth(wsgi.Middleware): """Authenticate an EC2 request with keystone and convert to context.""" @webob.dec.wsgify(RequestClass=wsgi.Request) def __call__(self, req): request_id = context.generate_request_id() signature = req.params.get('Signature') if not signature: msg = _("Signature not provided") return faults.ec2_error_response(request_id, "AuthFailure", msg, status=400) access = req.params.get('AWSAccessKeyId') if not access: msg = _("Access key not provided") return faults.ec2_error_response(request_id, "AuthFailure", msg, status=400) # Make a copy of args for authentication and signature verification. auth_params = dict(req.params) # Not part of authentication args auth_params.pop('Signature') cred_dict = { 'access': access, 'signature': signature, 'host': req.host, 'verb': req.method, 'path': req.path, 'params': auth_params, } if "ec2" in CONF.keystone_ec2_url: creds = {'ec2Credentials': cred_dict} else: creds = {'auth': {'OS-KSEC2:ec2Credentials': cred_dict}} creds_json = jsonutils.dumps(creds) headers = {'Content-Type': 'application/json'} o = urlparse.urlparse(CONF.keystone_ec2_url) if o.scheme == "http": conn = httplib.HTTPConnection(o.netloc) else: conn = httplib.HTTPSConnection(o.netloc) conn.request('POST', o.path, body=creds_json, headers=headers) response = conn.getresponse() data = response.read() if response.status != 200: if response.status == 401: msg = response.reason else: msg = _("Failure communicating with keystone") return faults.ec2_error_response(request_id, "AuthFailure", msg, status=response.status) result = jsonutils.loads(data) conn.close() try: token_id = result['access']['token']['id'] user_id = result['access']['user']['id'] project_id = result['access']['token']['tenant']['id'] user_name = result['access']['user'].get('name') project_name = result['access']['token']['tenant'].get('name') roles = [role['name'] for role in result['access']['user']['roles']] except (AttributeError, KeyError) as e: LOG.exception(_("Keystone failure: %s") % e) msg = _("Failure communicating with keystone") return faults.ec2_error_response(request_id, "AuthFailure", msg, status=400) remote_address = req.remote_addr if CONF.use_forwarded_for: remote_address = req.headers.get('X-Forwarded-For', remote_address) catalog = result['access']['serviceCatalog'] ctxt = context.RequestContext(user_id, project_id, user_name=user_name, project_name=project_name, roles=roles, auth_token=token_id, remote_address=remote_address, service_catalog=catalog) req.environ['nova.context'] = ctxt return self.application class NoAuth(wsgi.Middleware): """Add user:project as 'nova.context' to WSGI environ.""" @webob.dec.wsgify(RequestClass=wsgi.Request) def __call__(self, req): if 'AWSAccessKeyId' not in req.params: raise webob.exc.HTTPBadRequest() user_id, _sep, project_id = req.params['AWSAccessKeyId'].partition(':') project_id = project_id or user_id remote_address = req.remote_addr if CONF.use_forwarded_for: remote_address = req.headers.get('X-Forwarded-For', remote_address) ctx = context.RequestContext(user_id, project_id, is_admin=True, remote_address=remote_address) req.environ['nova.context'] = ctx return self.application class Requestify(wsgi.Middleware): def __init__(self, app, controller): super(Requestify, self).__init__(app) self.controller = importutils.import_object(controller) @webob.dec.wsgify(RequestClass=wsgi.Request) def __call__(self, req): non_args = ['Action', 'Signature', 'AWSAccessKeyId', 'SignatureMethod', 'SignatureVersion', 'Version', 'Timestamp'] args = dict(req.params) try: expired = ec2utils.is_ec2_timestamp_expired(req.params, expires=CONF.ec2_timestamp_expiry) if expired: msg = _("Timestamp failed validation.") LOG.exception(msg) raise webob.exc.HTTPForbidden(detail=msg) # Raise KeyError if omitted action = req.params['Action'] # Fix bug lp:720157 for older (version 1) clients version = req.params['SignatureVersion'] if int(version) == 1: non_args.remove('SignatureMethod') if 'SignatureMethod' in args: args.pop('SignatureMethod') for non_arg in non_args: # Remove, but raise KeyError if omitted args.pop(non_arg) except KeyError: raise webob.exc.HTTPBadRequest() except exception.InvalidRequest as err: raise webob.exc.HTTPBadRequest(explanation=unicode(err)) LOG.debug(_('action: %s'), action) for key, value in args.items(): LOG.debug(_('arg: %(key)s\t\tval: %(value)s'), {'key': key, 'value': value}) # Success! api_request = apirequest.APIRequest(self.controller, action, req.params['Version'], args) req.environ['ec2.request'] = api_request return self.application class Authorizer(wsgi.Middleware): """Authorize an EC2 API request. Return a 401 if ec2.controller and ec2.action in WSGI environ may not be executed in nova.context. """ def __init__(self, application): super(Authorizer, self).__init__(application) self.action_roles = { 'CloudController': { 'DescribeAvailabilityZones': ['all'], 'DescribeRegions': ['all'], 'DescribeSnapshots': ['all'], 'DescribeKeyPairs': ['all'], 'CreateKeyPair': ['all'], 'DeleteKeyPair': ['all'], 'DescribeSecurityGroups': ['all'], 'ImportKeyPair': ['all'], 'AuthorizeSecurityGroupIngress': ['netadmin'], 'RevokeSecurityGroupIngress': ['netadmin'], 'CreateSecurityGroup': ['netadmin'], 'DeleteSecurityGroup': ['netadmin'], 'GetConsoleOutput': ['projectmanager', 'sysadmin'], 'DescribeVolumes': ['projectmanager', 'sysadmin'], 'CreateVolume': ['projectmanager', 'sysadmin'], 'AttachVolume': ['projectmanager', 'sysadmin'], 'DetachVolume': ['projectmanager', 'sysadmin'], 'DescribeInstances': ['all'], 'DescribeAddresses': ['all'], 'AllocateAddress': ['netadmin'], 'ReleaseAddress': ['netadmin'], 'AssociateAddress': ['netadmin'], 'DisassociateAddress': ['netadmin'], 'RunInstances': ['projectmanager', 'sysadmin'], 'TerminateInstances': ['projectmanager', 'sysadmin'], 'RebootInstances': ['projectmanager', 'sysadmin'], 'UpdateInstance': ['projectmanager', 'sysadmin'], 'StartInstances': ['projectmanager', 'sysadmin'], 'StopInstances': ['projectmanager', 'sysadmin'], 'DeleteVolume': ['projectmanager', 'sysadmin'], 'DescribeImages': ['all'], 'DeregisterImage': ['projectmanager', 'sysadmin'], 'RegisterImage': ['projectmanager', 'sysadmin'], 'DescribeImageAttribute': ['all'], 'ModifyImageAttribute': ['projectmanager', 'sysadmin'], 'UpdateImage': ['projectmanager', 'sysadmin'], 'CreateImage': ['projectmanager', 'sysadmin'], }, 'AdminController': { # All actions have the same permission: ['none'] (the default) # superusers will be allowed to run them # all others will get HTTPUnauthorized. }, } @webob.dec.wsgify(RequestClass=wsgi.Request) def __call__(self, req): context = req.environ['nova.context'] controller = req.environ['ec2.request'].controller.__class__.__name__ action = req.environ['ec2.request'].action allowed_roles = self.action_roles[controller].get(action, ['none']) if self._matches_any_role(context, allowed_roles): return self.application else: LOG.audit(_('Unauthorized request for controller=%(controller)s ' 'and action=%(action)s'), {'controller': controller, 'action': action}, context=context) raise webob.exc.HTTPUnauthorized() def _matches_any_role(self, context, roles): """Return True if any role in roles is allowed in context.""" if context.is_admin: return True if 'all' in roles: return True if 'none' in roles: return False return any(role in context.roles for role in roles) class Validator(wsgi.Middleware): def validate_ec2_id(val): if not validator.validate_str()(val): return False try: ec2utils.ec2_id_to_id(val) except exception.InvalidEc2Id: return False return True validator.validate_ec2_id = validate_ec2_id validator.DEFAULT_VALIDATOR = { 'instance_id': validator.validate_ec2_id, 'volume_id': validator.validate_ec2_id, 'image_id': validator.validate_ec2_id, 'attribute': validator.validate_str(), 'image_location': validator.validate_image_path, 'public_ip': utils.is_valid_ipv4, 'region_name': validator.validate_str(), 'group_name': validator.validate_str(max_length=255), 'group_description': validator.validate_str(max_length=255), 'size': validator.validate_int(), 'user_data': validator.validate_user_data } def __init__(self, application): super(Validator, self).__init__(application) @webob.dec.wsgify(RequestClass=wsgi.Request) def __call__(self, req): if validator.validate(req.environ['ec2.request'].args, validator.DEFAULT_VALIDATOR): return self.application else: raise webob.exc.HTTPBadRequest() def exception_to_ec2code(ex): """Helper to extract EC2 error code from exception. For other than EC2 exceptions (those without ec2_code attribute), use exception name. """ if hasattr(ex, 'ec2_code'): code = ex.ec2_code else: code = type(ex).__name__ return code def ec2_error_ex(ex, req, code=None, message=None, unexpected=False): """ Return an EC2 error response based on passed exception and log the exception on an appropriate log level: * DEBUG: expected errors * ERROR: unexpected errors All expected errors are treated as client errors and 4xx HTTP status codes are always returned for them. Unexpected 5xx errors may contain sensitive information, supress their messages for security. """ if not code: code = exception_to_ec2code(ex) status = getattr(ex, 'code', None) if not status: status = 500 if unexpected: log_fun = LOG.error if ex.args and status < 500: log_msg = _("Unexpected %(ex_name)s raised: %(ex_str)s") else: log_msg = _("Unexpected %(ex_name)s raised") else: log_fun = LOG.debug if ex.args: log_msg = _("%(ex_name)s raised: %(ex_str)s") else: log_msg = _("%(ex_name)s raised") # NOTE(jruzicka): For compatibility with EC2 API, treat expected # exceptions as client (4xx) errors. The exception error code is 500 # by default and most exceptions inherit this from NovaException even # though they are actually client errors in most cases. if status >= 500: status = 400 context = req.environ['nova.context'] request_id = context.request_id log_msg_args = { 'ex_name': type(ex).__name__, 'ex_str': unicode(ex) } log_fun(log_msg % log_msg_args, context=context) if ex.args and not message and (not unexpected or status < 500): message = unicode(ex.args[0]) if unexpected: # Log filtered environment for unexpected errors. env = req.environ.copy() for k in env.keys(): if not isinstance(env[k], basestring): env.pop(k) log_fun(_('Environment: %s') % jsonutils.dumps(env)) if not message: message = _('Unknown error occurred.') return faults.ec2_error_response(request_id, code, message, status=status) class Executor(wsgi.Application): """Execute an EC2 API request. Executes 'ec2.action' upon 'ec2.controller', passing 'nova.context' and 'ec2.action_args' (all variables in WSGI environ.) Returns an XML response, or a 400 upon failure. """ @webob.dec.wsgify(RequestClass=wsgi.Request) def __call__(self, req): context = req.environ['nova.context'] api_request = req.environ['ec2.request'] result = None try: result = api_request.invoke(context) except exception.InstanceNotFound as ex: ec2_id = ec2utils.id_to_ec2_inst_id(ex.kwargs['instance_id']) message = ex.msg_fmt % {'instance_id': ec2_id} return ec2_error_ex(ex, req, message=message) except exception.VolumeNotFound as ex: ec2_id = ec2utils.id_to_ec2_vol_id(ex.kwargs['volume_id']) message = ex.msg_fmt % {'volume_id': ec2_id} return ec2_error_ex(ex, req, message=message) except exception.SnapshotNotFound as ex: ec2_id = ec2utils.id_to_ec2_snap_id(ex.kwargs['snapshot_id']) message = ex.msg_fmt % {'snapshot_id': ec2_id} return ec2_error_ex(ex, req, message=message) except (exception.CannotDisassociateAutoAssignedFloatingIP, exception.FloatingIpAssociated, exception.FloatingIpNotFound, exception.ImageNotActive, exception.InvalidInstanceIDMalformed, exception.InvalidKeypair, exception.InvalidParameterValue, exception.InvalidPortRange, exception.InvalidVolume, exception.KeyPairExists, exception.KeypairNotFound, exception.MissingParameter, exception.NoFloatingIpInterface, exception.NoMoreFixedIps, exception.NotAuthorized, exception.QuotaError, exception.QuotaError, exception.SecurityGroupExists, exception.SecurityGroupLimitExceeded, exception.SecurityGroupLimitExceeded, exception.SecurityGroupRuleExists, exception.VolumeUnattached, # Following aren't translated to valid EC2 errors. exception.ImageNotFound, exception.ImageNotFoundEC2, exception.InvalidAttribute, exception.InvalidRequest, exception.NotFound) as ex: return ec2_error_ex(ex, req) except Exception as ex: return ec2_error_ex(ex, req, unexpected=True) else: resp = webob.Response() resp.status = 200 resp.headers['Content-Type'] = 'text/xml' resp.body = str(result) return resp
#!/usr/bin/env python # encoding: utf-8 class Stack(object): """Docstring for Stack """ def __init__(self): """@todo: to be defined1 """ self.items = [] def pushFromList(self, list): """Push the list in the stack :param list: a list """ for i in list[::-1]: self.push(i) def isEmpty(self): """ Says if the stack is empty :returns: @todo """ return self.items == [] def push(self, item): """Push an item in the stack :param item: @todo :returns: @todo """ self.items.append(item) def pop(self): """Getting the last item and remove it :returns: last item """ return self.items.pop() def peek(self, posi = 0): """Getting the last item :param posi: which item to peek 0 (last) 1 (the onebefore the last)... :returns: the item """ return self.items[-1 - posi] def __len__(self): return len(self.items) def __str__(self): return str(self.items) + " -> " def __add__(self, addList): return self.items + addList def flatten_list(a, result=None): """Flattens a nested list. >>> flatten_list([ [1, 2, [3, 4] ], [5, 6], 7]) [1, 2, 3, 4, 5, 6, 7] """ if result is None: result = [] for x in a: if isinstance(x, list): flatten_list(x, result) else: result.append(x) return result def first_elem(ll): """Get the first element in imbricates lists # TODO: Fonction pourrie mais j'ai pas le temps de faire mieux! |mar. janv. 28 22:32:22 CET 2014 :param list: list of lists of lists... :returns: the first element >>> first_elem(1) 1 >>> first_elem([1,2]) 1 >>> first_elem([["abc"]]) 'a' >>> first_elem("abc") 'a' >>> first_elem([[[1,2],[3,4]], [5,6]]) 1 >>> first_elem([[["ab",2],[3,4]], [5,6]]) 'a' """ if hasattr(ll, '__contains__'): if len(ll) == 1 and type(ll) == str: return ll[0] else: return first_elem(ll[0]) else: return ll def last_elem(ll): """Get the last element in imbricates lists # TODO: Fonction pourrie mais j'ai pas le temps de faire mieux! |mar. janv. 28 22:32:22 CET 2014 :param list: list of lists of lists... :returns: the last element >>> last_elem(1) 1 >>> last_elem([1,2]) 2 >>> last_elem([["abc"]]) 'c' >>> last_elem("abc") 'c' >>> last_elem([[[1,2],[3,4]], [5,6]]) 6 >>> last_elem([[["ab",2],[3,4]], [5,6]]) 6 """ if hasattr(ll, '__contains__'): if len(ll) == 1 and type(ll) == str: return ll[-1] else: return last_elem(ll[-1]) else: return ll def expand_list(list_list): """Expand list of list >>> expand_list([1,2,[3,4],5,[6,7,8]]) [[1, 2, 3, 5, 6], [1, 2, 4, 5, 7], [1, 2, 4, 5, 8]] >>> expand_list([1,2,4,5,6,7,8]) [[1, 2, 4, 5, 6, 7, 8]] """ list_in_list = [i for i in list_list if type(i) == list].copy() try: nbr_ans_list = max([len(i) for i in list_in_list]) ans = [list_list.copy() for i in range(nbr_ans_list)] for (i,l) in enumerate(ans): for (j,e) in enumerate(l): if type(e) == list: ans[i][j] = e[min(i,len(e)-1)] # S'il n'y a pas de liste dans la liste (2e exemple) except ValueError: ans = [list_list] return ans def add_in_dict(dict1, dict2): """Merge dictionary keys and add the content from dict1 and dict2 :param dict1: first dictionary :param dict2: second dictionary :returns: merged and added dictionary >>> add_in_dict({'a':1, 'b':2}, {'c':3, 'd': 4}) == {'d': 4, 'a': 1, 'c': 3, 'b': 2} True >>> add_in_dict({'a':1, 'b':2}, {'a':3, 'b': 4}) == {'a': 4, 'b': 6} True >>> add_in_dict({'a':1, 'b':2}, {'a':3, 'c': 4}) == {'a': 4, 'b': 2, 'c': 4} True """ new_dict = {} new_dict.update(dict1) for (k,v) in dict2.items(): if k in new_dict.keys(): new_dict[k] += v else: new_dict[k] = v return new_dict def remove_in_dict(d, value = 0): """ In a dictionary, remove keys which have certain value :param d: the dictionary :param value: value to remove :returns: new dictionary whithout unwanted value >>> remove_in_dict({'b': 1, 'a': 0}) == {'b': 1} True >>> remove_in_dict({'b': 1, 'a': 0}, 1) == {'a': 0} True """ new_dict = {} for (k,v) in d.items(): if v != value: new_dict[k] = v return new_dict def convolution_dict(D1, D2, op = lambda x,y:x*y,\ op_key = lambda x,y: x + y, \ commutative = True, op_twice = lambda x,y: x + y): """Convolution of two dictionaries :param D1: First dictionary :param D2: Second dictionary :param op: Operation of perform in value :param commutative: keys are commutative? :param op_twice: operation on value if the key appear twice >>> convolution_dict({"a": 1, "b":3}, {"a":2, "":4}) == {"aa":2, "a": 4, "ba":6, "b":12} True >>> convolution_dict({"a": 1, "b":3}, {"a":2, "b":4}) == {"aa":2, "ab":10, "bb":12} True >>> convolution_dict({"a": 1, "b":3}, {"a":2, "b":4}, commutative = False) == {"aa":2, "ab":10, "bb":12} False >>> convolution_dict({"a": 1, "b":3}, {"a":2, "b":4}, commutative = False) == {"aa":2, "ab":4,"ba":6, "bb":12} True >>> convolution_dict({"a": 1, "b":3}, {"a":2, "b":4}, \ op_twice = lambda x,y:[x,y]) == {"aa":2, "ab":[4,6], "bb":12} True """ new_dict = {} for k1 in sorted(D1.keys()): for k2 in sorted(D2.keys()): if op_key(k1,k2) in new_dict.keys(): key = op_key(k1,k2) new_dict[key] = op_twice(new_dict[key], op(D1[k1],D2[k2])) elif op_key(k2,k1) in new_dict.keys() and commutative: key = op_key(k2,k1) new_dict[key] = op_twice(new_dict[key], op(D1[k1],D2[k2])) else: key = op_key(k1,k2) new_dict[key] = op(D1[k1],D2[k2]) return new_dict if __name__ == '__main__': import doctest doctest.testmod() # ----------------------------- # Reglages pour 'vim' # vim:set autoindent expandtab tabstop=4 shiftwidth=4: # cursor: 16 del
# Copyright (c) 2013 OpenStack Foundation # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """ Helpers for comparing version strings. """ import functools import inspect import pkg_resources import six from trove.openstack.common._i18n import _ from trove.openstack.common import log as logging LOG = logging.getLogger(__name__) class deprecated(object): """A decorator to mark callables as deprecated. This decorator logs a deprecation message when the callable it decorates is used. The message will include the release where the callable was deprecated, the release where it may be removed and possibly an optional replacement. Examples: 1. Specifying the required deprecated release >>> @deprecated(as_of=deprecated.ICEHOUSE) ... def a(): pass 2. Specifying a replacement: >>> @deprecated(as_of=deprecated.ICEHOUSE, in_favor_of='f()') ... def b(): pass 3. Specifying the release where the functionality may be removed: >>> @deprecated(as_of=deprecated.ICEHOUSE, remove_in=+1) ... def c(): pass 4. Specifying the deprecated functionality will not be removed: >>> @deprecated(as_of=deprecated.ICEHOUSE, remove_in=0) ... def d(): pass 5. Specifying a replacement, deprecated functionality will not be removed: >>> @deprecated(as_of=deprecated.ICEHOUSE, in_favor_of='f()', remove_in=0) ... def e(): pass """ # NOTE(morganfainberg): Bexar is used for unit test purposes, it is # expected we maintain a gap between Bexar and Folsom in this list. BEXAR = 'B' FOLSOM = 'F' GRIZZLY = 'G' HAVANA = 'H' ICEHOUSE = 'I' JUNO = 'J' KILO = 'K' _RELEASES = { # NOTE(morganfainberg): Bexar is used for unit test purposes, it is # expected we maintain a gap between Bexar and Folsom in this list. 'B': 'Bexar', 'F': 'Folsom', 'G': 'Grizzly', 'H': 'Havana', 'I': 'Icehouse', 'J': 'Juno', 'K': 'Kilo', } _deprecated_msg_with_alternative = _( '%(what)s is deprecated as of %(as_of)s in favor of ' '%(in_favor_of)s and may be removed in %(remove_in)s.') _deprecated_msg_no_alternative = _( '%(what)s is deprecated as of %(as_of)s and may be ' 'removed in %(remove_in)s. It will not be superseded.') _deprecated_msg_with_alternative_no_removal = _( '%(what)s is deprecated as of %(as_of)s in favor of %(in_favor_of)s.') _deprecated_msg_with_no_alternative_no_removal = _( '%(what)s is deprecated as of %(as_of)s. It will not be superseded.') def __init__(self, as_of, in_favor_of=None, remove_in=2, what=None): """Initialize decorator :param as_of: the release deprecating the callable. Constants are define in this class for convenience. :param in_favor_of: the replacement for the callable (optional) :param remove_in: an integer specifying how many releases to wait before removing (default: 2) :param what: name of the thing being deprecated (default: the callable's name) """ self.as_of = as_of self.in_favor_of = in_favor_of self.remove_in = remove_in self.what = what def __call__(self, func_or_cls): if not self.what: self.what = func_or_cls.__name__ + '()' msg, details = self._build_message() if inspect.isfunction(func_or_cls): @six.wraps(func_or_cls) def wrapped(*args, **kwargs): LOG.deprecated(msg, details) return func_or_cls(*args, **kwargs) return wrapped elif inspect.isclass(func_or_cls): orig_init = func_or_cls.__init__ # TODO(tsufiev): change `functools` module to `six` as # soon as six 1.7.4 (with fix for passing `assigned` # argument to underlying `functools.wraps`) is released # and added to the trove-incubator requrements @functools.wraps(orig_init, assigned=('__name__', '__doc__')) def new_init(self, *args, **kwargs): LOG.deprecated(msg, details) orig_init(self, *args, **kwargs) func_or_cls.__init__ = new_init return func_or_cls else: raise TypeError('deprecated can be used only with functions or ' 'classes') def _get_safe_to_remove_release(self, release): # TODO(dstanek): this method will have to be reimplemented once # when we get to the X release because once we get to the Y # release, what is Y+2? new_release = chr(ord(release) + self.remove_in) if new_release in self._RELEASES: return self._RELEASES[new_release] else: return new_release def _build_message(self): details = dict(what=self.what, as_of=self._RELEASES[self.as_of], remove_in=self._get_safe_to_remove_release(self.as_of)) if self.in_favor_of: details['in_favor_of'] = self.in_favor_of if self.remove_in > 0: msg = self._deprecated_msg_with_alternative else: # There are no plans to remove this function, but it is # now deprecated. msg = self._deprecated_msg_with_alternative_no_removal else: if self.remove_in > 0: msg = self._deprecated_msg_no_alternative else: # There are no plans to remove this function, but it is # now deprecated. msg = self._deprecated_msg_with_no_alternative_no_removal return msg, details def is_compatible(requested_version, current_version, same_major=True): """Determine whether `requested_version` is satisfied by `current_version`; in other words, `current_version` is >= `requested_version`. :param requested_version: version to check for compatibility :param current_version: version to check against :param same_major: if True, the major version must be identical between `requested_version` and `current_version`. This is used when a major-version difference indicates incompatibility between the two versions. Since this is the common-case in practice, the default is True. :returns: True if compatible, False if not """ requested_parts = pkg_resources.parse_version(requested_version) current_parts = pkg_resources.parse_version(current_version) if same_major and (requested_parts[0] != current_parts[0]): return False return current_parts >= requested_parts
## IAN with randomized IAF from math import sqrt import os import sys import numpy as np import lasagne import lasagne.layers import lasagne.layers.dnn from lasagne.layers import SliceLayer as SL from lasagne.layers import batch_norm as BN from lasagne.layers import ElemwiseSumLayer as ESL from lasagne.layers import ElemwiseMergeLayer as EML from lasagne.layers import NonlinearityLayer as NL from lasagne.layers import DenseLayer as DL from lasagne.layers import Upscale2DLayer from lasagne.init import Normal as initmethod from lasagne.init import Orthogonal from lasagne.nonlinearities import elu from lasagne.nonlinearities import rectify as relu from lasagne.nonlinearities import LeakyRectify as lrelu from lasagne.nonlinearities import sigmoid from lasagne.layers.dnn import Conv2DDNNLayer as C2D from lasagne.layers.dnn import Pool2DDNNLayer as P2D from lasagne.layers import TransposedConv2DLayer as TC2D from lasagne.layers import ConcatLayer as CL from theano import tensor as T from theano.sandbox.cuda.basic_ops import ( as_cuda_ndarray_variable, host_from_gpu, gpu_contiguous, HostFromGpu, gpu_alloc_empty, ) from theano.sandbox.cuda.dnn import ( GpuDnnConvDesc, GpuDnnConv, GpuDnnConvGradI, dnn_conv, dnn_pool, ) from theano.sandbox.rng_mrg import MRG_RandomStreams as RandomStreams from gan.util.layers import ( MDBLOCK, DeconvLayer, MinibatchLayer, beta_layer, MADE, IAFLayer, GaussianSampleLayer, MDCL, ) CFG = { 'batch_size': 16, 'learning_rate': { 0: 0.0002, 25: 0.0001, 50: 0.00005, 75: 0.00001, }, 'optimizer': 'Adam', 'beta1': 0.5, 'update_ratio': 1, 'decay_rate': 0, 'reg': 1e-5, 'momentum': 0.9, 'shuffle': True, 'dims': (64,64), 'n_channels': 3, 'batches_per_chunk': 64, 'max_epochs': 80, 'checkpoint_every_nth': 1, 'num_latents': 100, 'recon_weight': 3.0, 'feature_weight': 1.0, 'dg_weight': 1.0, 'dd_weight': 1.0, 'agr_weight': 1.0, 'ags_weight': 1.0, 'n_shuffles': 1, 'ortho': 1e-3, } def get_model(interp=False, dnn=True): dims, n_channels = tuple(CFG['dims']), CFG['n_channels'] shape = (None, n_channels)+dims l_in = lasagne.layers.InputLayer(shape=shape) l_enc_conv1 = C2D( incoming = l_in, num_filters = 128, filter_size = [5,5], stride = [2,2], pad = (2,2), W = initmethod(0.02), nonlinearity = lrelu(0.2), name = 'enc_conv1' ) l_enc_conv2 = BN(C2D( incoming = l_enc_conv1, num_filters = 256, filter_size = [5,5], stride = [2,2], pad = (2,2), W = initmethod(0.02), nonlinearity = lrelu(0.2), name = 'enc_conv2' ),name = 'bnorm2') l_enc_conv3 = BN(C2D( incoming = l_enc_conv2, num_filters = 512, filter_size = [5,5], stride = [2,2], pad = (2,2), W = initmethod(0.02), nonlinearity = lrelu(0.2), name = 'enc_conv3' ),name = 'bnorm3') l_enc_conv4 = BN(C2D( incoming = l_enc_conv3, num_filters = 1024, filter_size = [5,5], stride = [2,2], pad = (2,2), W = initmethod(0.02), nonlinearity = lrelu(0.2), name = 'enc_conv4' ),name = 'bnorm4') l_enc_fc1 = BN(DL( incoming = l_enc_conv4, num_units = 1000, W = initmethod(0.02), nonlinearity = relu, name = 'enc_fc1' ), name = 'bnorm_enc_fc1') # Define latent values l_enc_mu,l_enc_logsigma = [BN(DL(incoming = l_enc_fc1,num_units=CFG['num_latents'],nonlinearity = None,name='enc_mu'),name='mu_bnorm'), BN(DL(incoming = l_enc_fc1,num_units=CFG['num_latents'],nonlinearity = None,name='enc_logsigma'),name='ls_bnorm')] l_Z_IAF = GaussianSampleLayer(l_enc_mu, l_enc_logsigma, name='l_Z_IAF') l_IAF_mu,l_IAF_logsigma = [MADE(l_Z_IAF,[CFG['num_latents']],'l_IAF_mu'),MADE(l_Z_IAF,[CFG['num_latents']],'l_IAF_ls')] l_Z = IAFLayer(l_Z_IAF,l_IAF_mu,l_IAF_logsigma,name='l_Z') l_dec_fc2 = DL( incoming = l_Z, num_units = 512*16, nonlinearity = lrelu(0.2), W=initmethod(0.02), name='l_dec_fc2') l_unflatten = lasagne.layers.ReshapeLayer( incoming = l_dec_fc2, shape = ([0],512,4,4), ) l_dec_conv1 = DeconvLayer( incoming = l_unflatten, num_filters = 512, filter_size = [5,5], stride = [2,2], crop = (2,2), W = initmethod(0.02), nonlinearity = None, name = 'dec_conv1' ) l_dec_conv2a = MDBLOCK(incoming=l_dec_conv1,num_filters=512,scales=[0,2],name='dec_conv2a',nonlinearity=lrelu(0.2)) l_dec_conv2 = DeconvLayer( incoming = l_dec_conv2a, num_filters = 256, filter_size = [5,5], stride = [2,2], crop = (2,2), W = initmethod(0.02), nonlinearity = None, name = 'dec_conv2' ) l_dec_conv3a = MDBLOCK(incoming=l_dec_conv2,num_filters=256,scales=[0,2,3],name='dec_conv3a',nonlinearity=lrelu(0.2)) l_dec_conv3 = DeconvLayer( incoming = l_dec_conv3a, num_filters = 128, filter_size = [5,5], stride = [2,2], crop = (2,2), W = initmethod(0.02), nonlinearity = None, name = 'dec_conv3' ) l_dec_conv4a = MDBLOCK(incoming=l_dec_conv3,num_filters=128,scales=[0,2,3],name='dec_conv4a',nonlinearity=lrelu(0.2)) l_dec_conv4 = BN(DeconvLayer( incoming = l_dec_conv4a, num_filters = 128, filter_size = [5,5], stride = [2,2], crop = (2,2), W = initmethod(0.02), nonlinearity = lrelu(0.2), name = 'dec_conv4' ),name = 'bnorm_dc4') R = NL(MDCL(l_dec_conv4, num_filters=2, scales = [2,3,4], name = 'R'),sigmoid) G = NL(ESL([MDCL(l_dec_conv4, num_filters=2, scales = [2,3,4], name = 'G_a' ), MDCL(R, num_filters=2, scales = [2,3,4], name = 'G_b' )]),sigmoid) B = NL(ESL([MDCL(l_dec_conv4, num_filters=2, scales = [2,3,4], name = 'B_a' ), MDCL(CL([R,G]), num_filters=2, scales = [2,3,4], name = 'B_b' )]),sigmoid) l_out=CL([beta_layer(SL(R,slice(0,1),1),SL(R,slice(1,2),1)),beta_layer(SL(G,slice(0,1),1),SL(G,slice(1,2),1)),beta_layer(SL(B,slice(0,1),1),SL(B,slice(1,2),1))]) minibatch_discrim = MinibatchLayer(lasagne.layers.GlobalPoolLayer(l_enc_conv4), num_kernels=500,name='minibatch_discrim') l_discrim = DL(incoming = minibatch_discrim, num_units = 3, nonlinearity = lasagne.nonlinearities.softmax, b = None, W=initmethod(0.02), name = 'discrimi') return {'l_in': l_in, 'l_out': l_out, 'l_mu': l_enc_mu, 'l_ls': l_enc_logsigma, 'l_Z': l_Z, 'l_Z_IAF': l_Z_IAF, 'l_IAF_mu': l_IAF_mu, 'l_IAF_ls': l_IAF_logsigma, 'l_introspect': [l_enc_conv1, l_enc_conv2,l_enc_conv3,l_enc_conv4], 'l_discrim': l_discrim}