Search is not available for this dataset
repo
stringlengths
2
152
file
stringlengths
15
239
code
stringlengths
0
58.4M
file_length
int64
0
58.4M
avg_line_length
float64
0
1.81M
max_line_length
int64
0
12.7M
extension_type
stringclasses
364 values
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/gym/utils/ezpickle.py
class EzPickle(object): """Objects that are pickled and unpickled via their constructor arguments. Example usage: class Dog(Animal, EzPickle): def __init__(self, furcolor, tailkind="bushy"): Animal.__init__() EzPickle.__init__(furcolor, tailkind) ... When this object is unpickled, a new Dog will be constructed by passing the provided furcolor and tailkind into the constructor. However, philosophers are still not sure whether it is still the same dog. This is generally needed only for environments which wrap C/C++ code, such as MuJoCo and Atari. """ def __init__(self, *args, **kwargs): self._ezpickle_args = args self._ezpickle_kwargs = kwargs def __getstate__(self): return {"_ezpickle_args" : self._ezpickle_args, "_ezpickle_kwargs": self._ezpickle_kwargs} def __setstate__(self, d): out = type(self)(*d["_ezpickle_args"], **d["_ezpickle_kwargs"]) self.__dict__.update(out.__dict__)
1,051
36.571429
98
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/gym/utils/reraise.py
import sys # We keep the actual reraising in different modules, since the # reraising code uses syntax mutually exclusive to Python 2/3. if sys.version_info[0] < 3: from .reraise_impl_py2 import reraise_impl #pylint: disable=E0401 else: from .reraise_impl_py3 import reraise_impl def reraise(prefix=None, suffix=None): old_exc_type, old_exc_value, traceback = sys.exc_info() if old_exc_value is None: old_exc_value = old_exc_type() e = ReraisedException(old_exc_value, prefix, suffix) reraise_impl(e, traceback) # http://stackoverflow.com/a/13653312 def full_class_name(o): module = o.__class__.__module__ if module is None or module == str.__class__.__module__: return o.__class__.__name__ return module + '.' + o.__class__.__name__ class ReraisedException(Exception): def __init__(self, old_exc, prefix, suffix): self.old_exc = old_exc self.prefix = prefix self.suffix = suffix def __str__(self): klass = self.old_exc.__class__ orig = "%s: %s" % (full_class_name(self.old_exc), klass.__str__(self.old_exc)) prefixpart = suffixpart = '' if self.prefix is not None: prefixpart = self.prefix + "\n" if self.suffix is not None: suffixpart = "\n\n" + self.suffix return "%sThe original exception was:\n\n%s%s" % (prefixpart, orig, suffixpart)
1,404
32.452381
87
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/gym/utils/play.py
import gym import pygame import sys import time import matplotlib try: matplotlib.use('GTK3Agg') import matplotlib.pyplot as plt except Exception: pass import pyglet.window as pw from collections import deque from pygame.locals import HWSURFACE, DOUBLEBUF, RESIZABLE, VIDEORESIZE from threading import Thread def display_arr(screen, arr, video_size, transpose): arr_min, arr_max = arr.min(), arr.max() arr = 255.0 * (arr - arr_min) / (arr_max - arr_min) pyg_img = pygame.surfarray.make_surface(arr.swapaxes(0, 1) if transpose else arr) pyg_img = pygame.transform.scale(pyg_img, video_size) screen.blit(pyg_img, (0,0)) def play(env, transpose=True, fps=30, zoom=None, callback=None, keys_to_action=None): """Allows one to play the game using keyboard. To simply play the game use: play(gym.make("Pong-v3")) Above code works also if env is wrapped, so it's particularly useful in verifying that the frame-level preprocessing does not render the game unplayable. If you wish to plot real time statistics as you play, you can use gym.utils.play.PlayPlot. Here's a sample code for plotting the reward for last 5 second of gameplay. def callback(obs_t, obs_tp1, rew, done, info): return [rew,] env_plotter = EnvPlotter(callback, 30 * 5, ["reward"]) env = gym.make("Pong-v3") play(env, callback=env_plotter.callback) Arguments --------- env: gym.Env Environment to use for playing. transpose: bool If True the output of observation is transposed. Defaults to true. fps: int Maximum number of steps of the environment to execute every second. Defaults to 30. zoom: float Make screen edge this many times bigger callback: lambda or None Callback if a callback is provided it will be executed after every step. It takes the following input: obs_t: observation before performing action obs_tp1: observation after performing action action: action that was executed rew: reward that was received done: whether the environemnt is done or not info: debug info keys_to_action: dict: tuple(int) -> int or None Mapping from keys pressed to action performed. For example if pressed 'w' and space at the same time is supposed to trigger action number 2 then key_to_action dict would look like this: { # ... sorted(ord('w'), ord(' ')) -> 2 # ... } If None, default key_to_action mapping for that env is used, if provided. """ obs_s = env.observation_space assert type(obs_s) == gym.spaces.box.Box assert len(obs_s.shape) == 2 or (len(obs_s.shape) == 3 and obs_s.shape[2] in [1,3]) if keys_to_action is None: if hasattr(env, 'get_keys_to_action'): keys_to_action = env.get_keys_to_action() elif hasattr(env.unwrapped, 'get_keys_to_action'): keys_to_action = env.unwrapped.get_keys_to_action() else: assert False, env.spec.id + " does not have explicit key to action mapping, " + \ "please specify one manually" relevant_keys = set(sum(map(list, keys_to_action.keys()),[])) if transpose: video_size = env.observation_space.shape[1], env.observation_space.shape[0] else: video_size = env.observation_space.shape[0], env.observation_space.shape[1] if zoom is not None: video_size = int(video_size[0] * zoom), int(video_size[1] * zoom) pressed_keys = [] running = True env_done = True screen = pygame.display.set_mode(video_size) clock = pygame.time.Clock() while running: if env_done: env_done = False obs = env.reset() else: action = keys_to_action[tuple(sorted(pressed_keys))] prev_obs = obs obs, rew, env_done, info = env.step(action) if callback is not None: callback(prev_obs, obs, action, rew, env_done, info) if obs is not None: if len(obs.shape) == 2: obs = obs[:, :, None] if obs.shape[2] == 1: obs = obs.repeat(3, axis=2) display_arr(screen, obs, transpose=transpose, video_size=video_size) # process pygame events for event in pygame.event.get(): # test events, set key states if event.type == pygame.KEYDOWN: if event.key in relevant_keys: pressed_keys.append(event.key) elif event.key == 27: running = False elif event.type == pygame.KEYUP: if event.key in relevant_keys: pressed_keys.remove(event.key) elif event.type == pygame.QUIT: running = False elif event.type == VIDEORESIZE: video_size = event.size screen = pygame.display.set_mode(video_size) print(video_size) pygame.display.flip() clock.tick(fps) pygame.quit() class PlayPlot(object): def __init__(self, callback, horizon_timesteps, plot_names): self.data_callback = callback self.horizon_timesteps = horizon_timesteps self.plot_names = plot_names num_plots = len(self.plot_names) self.fig, self.ax = plt.subplots(num_plots) if num_plots == 1: self.ax = [self.ax] for axis, name in zip(self.ax, plot_names): axis.set_title(name) self.t = 0 self.cur_plot = [None for _ in range(num_plots)] self.data = [deque(maxlen=horizon_timesteps) for _ in range(num_plots)] def callback(self, obs_t, obs_tp1, action, rew, done, info): points = self.data_callback(obs_t, obs_tp1, action, rew, done, info) for point, data_series in zip(points, self.data): data_series.append(point) self.t += 1 xmin, xmax = max(0, self.t - self.horizon_timesteps), self.t for i, plot in enumerate(self.cur_plot): if plot is not None: plot.remove() self.cur_plot[i] = self.ax[i].scatter(range(xmin, xmax), list(self.data[i])) self.ax[i].set_xlim(xmin, xmax) plt.pause(0.000001) if __name__ == '__main__': env = gym.make("MontezumaRevengeNoFrameskip-v4") play(env, zoom=4, fps=60)
6,569
34.13369
93
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/gym/utils/closer.py
import atexit import threading import weakref class Closer(object): """A registry that ensures your objects get closed, whether manually, upon garbage collection, or upon exit. To work properly, your objects need to cooperate and do something like the following: ``` closer = Closer() class Example(object): def __init__(self): self._id = closer.register(self) def close(self): # Probably worth making idempotent too! ... closer.unregister(self._id) def __del__(self): self.close() ``` That is, your objects should: - register() themselves and save the returned ID - unregister() themselves upon close() - include a __del__ method which close()'s the object """ def __init__(self, atexit_register=True): self.lock = threading.Lock() self.next_id = -1 self.closeables = weakref.WeakValueDictionary() if atexit_register: atexit.register(self.close) def generate_next_id(self): with self.lock: self.next_id += 1 return self.next_id def register(self, closeable): """Registers an object with a 'close' method. Returns: int: The registration ID of this object. It is the caller's responsibility to save this ID if early closing is desired. """ assert hasattr(closeable, 'close'), 'No close method for {}'.format(closeable) next_id = self.generate_next_id() self.closeables[next_id] = closeable return next_id def unregister(self, id): assert id is not None if id in self.closeables: del self.closeables[id] def close(self): # Explicitly fetch all monitors first so that they can't disappear while # we iterate. cf. http://stackoverflow.com/a/12429620 closeables = list(self.closeables.values()) for closeable in closeables: closeable.close()
2,019
28.705882
131
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/gym/utils/reraise_impl_py3.py
# http://stackoverflow.com/a/33822606 -- `from None` disables Python 3' # semi-smart exception chaining, which we don't want in this case. def reraise_impl(e, traceback): raise e.with_traceback(traceback) from None
219
43
71
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/gym/utils/reraise_impl_py2.py
def reraise_impl(e, traceback): raise e.__class__, e, traceback
68
22
35
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/gym/utils/seeding.py
import hashlib import numpy as np import os import random as _random from six import integer_types import struct import sys from gym import error def np_random(seed=None): if seed is not None and not (isinstance(seed, integer_types) and 0 <= seed): raise error.Error('Seed must be a non-negative integer or omitted, not {}'.format(seed)) seed = create_seed(seed) rng = np.random.RandomState() rng.seed(_int_list_from_bigint(hash_seed(seed))) return rng, seed def hash_seed(seed=None, max_bytes=8): """Any given evaluation is likely to have many PRNG's active at once. (Most commonly, because the environment is running in multiple processes.) There's literature indicating that having linear correlations between seeds of multiple PRNG's can correlate the outputs: http://blogs.unity3d.com/2015/01/07/a-primer-on-repeatable-random-numbers/ http://stackoverflow.com/questions/1554958/how-different-do-random-seeds-need-to-be http://dl.acm.org/citation.cfm?id=1276928 Thus, for sanity we hash the seeds before using them. (This scheme is likely not crypto-strength, but it should be good enough to get rid of simple correlations.) Args: seed (Optional[int]): None seeds from an operating system specific randomness source. max_bytes: Maximum number of bytes to use in the hashed seed. """ if seed is None: seed = create_seed(max_bytes=max_bytes) hash = hashlib.sha512(str(seed).encode('utf8')).digest() return _bigint_from_bytes(hash[:max_bytes]) def create_seed(a=None, max_bytes=8): """Create a strong random seed. Otherwise, Python 2 would seed using the system time, which might be non-robust especially in the presence of concurrency. Args: a (Optional[int, str]): None seeds from an operating system specific randomness source. max_bytes: Maximum number of bytes to use in the seed. """ # Adapted from https://svn.python.org/projects/python/tags/r32/Lib/random.py if a is None: a = _bigint_from_bytes(os.urandom(max_bytes)) elif isinstance(a, str): a = a.encode('utf8') a += hashlib.sha512(a).digest() a = _bigint_from_bytes(a[:max_bytes]) elif isinstance(a, integer_types): a = a % 2**(8 * max_bytes) else: raise error.Error('Invalid type for seed: {} ({})'.format(type(a), a)) return a # TODO: don't hardcode sizeof_int here def _bigint_from_bytes(bytes): sizeof_int = 4 padding = sizeof_int - len(bytes) % sizeof_int bytes += b'\0' * padding int_count = int(len(bytes) / sizeof_int) unpacked = struct.unpack("{}I".format(int_count), bytes) accum = 0 for i, val in enumerate(unpacked): accum += 2 ** (sizeof_int * 8 * i) * val return accum def _int_list_from_bigint(bigint): # Special case 0 if bigint < 0: raise error.Error('Seed must be non-negative, not {}'.format(bigint)) elif bigint == 0: return [0] ints = [] while bigint > 0: bigint, mod = divmod(bigint, 2 ** 32) ints.append(mod) return ints
3,141
33.152174
96
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/gym/utils/atomic_write.py
# Based on http://stackoverflow.com/questions/2333872/atomic-writing-to-file-with-python import os from contextlib import contextmanager # We would ideally atomically replace any existing file with the new # version. However, on Windows there's no Python-only solution prior # to Python 3.3. (This library includes a C extension to do so: # https://pypi.python.org/pypi/pyosreplace/0.1.) # # Correspondingly, we make a best effort, but on Python < 3.3 use a # replace method which could result in the file temporarily # disappearing. import sys if sys.version_info >= (3, 3): # Python 3.3 and up have a native `replace` method from os import replace elif sys.platform.startswith("win"): def replace(src, dst): # TODO: on Windows, this will raise if the file is in use, # which is possible. We'll need to make this more robust over # time. try: os.remove(dst) except OSError: pass os.rename(src, dst) else: # POSIX rename() is always atomic from os import rename as replace @contextmanager def atomic_write(filepath, binary=False, fsync=False): """ Writeable file object that atomically updates a file (using a temporary file). In some cases (namely Python < 3.3 on Windows), this could result in an existing file being temporarily unlinked. :param filepath: the file path to be opened :param binary: whether to open the file in a binary mode instead of textual :param fsync: whether to force write the file to disk """ tmppath = filepath + '~' while os.path.isfile(tmppath): tmppath += '~' try: with open(tmppath, 'wb' if binary else 'w') as file: yield file if fsync: file.flush() os.fsync(file.fileno()) replace(tmppath, filepath) finally: try: os.remove(tmppath) except (IOError, OSError): pass
1,951
33.857143
200
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/gym/utils/__init__.py
"""A set of common utilities used within the environments. These are not intended as API functions, and will not remain stable over time. """ # These submodules should not have any import-time dependencies. # We want this since we use `utils` during our import-time sanity checks # that verify that our dependencies are actually present. from .colorize import colorize from .ezpickle import EzPickle from .reraise import reraise
430
38.181818
72
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/gym/utils/colorize.py
"""A set of common utilities used within the environments. These are not intended as API functions, and will not remain stable over time. """ color2num = dict( gray=30, red=31, green=32, yellow=33, blue=34, magenta=35, cyan=36, white=37, crimson=38 ) def colorize(string, color, bold=False, highlight = False): """Return string surrounded by appropriate terminal color codes to print colorized text. Valid colors: gray, red, green, yellow, blue, magenta, cyan, white, crimson """ # Import six here so that `utils` has no import-time dependencies. # We want this since we use `utils` during our import-time sanity checks # that verify that our dependencies (including six) are actually present. import six attr = [] num = color2num[color] if highlight: num += 10 attr.append(six.u(str(num))) if bold: attr.append(six.u('1')) attrs = six.u(';').join(attr) return six.u('\x1b[%sm%s\x1b[0m') % (attrs, string)
1,008
27.027778
77
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/pytz/exceptions.py
''' Custom exceptions raised by pytz. ''' __all__ = [ 'UnknownTimeZoneError', 'InvalidTimeError', 'AmbiguousTimeError', 'NonExistentTimeError', ] class UnknownTimeZoneError(KeyError): '''Exception raised when pytz is passed an unknown timezone. >>> isinstance(UnknownTimeZoneError(), LookupError) True This class is actually a subclass of KeyError to provide backwards compatibility with code relying on the undocumented behavior of earlier pytz releases. >>> isinstance(UnknownTimeZoneError(), KeyError) True ''' pass class InvalidTimeError(Exception): '''Base class for invalid time exceptions.''' class AmbiguousTimeError(InvalidTimeError): '''Exception raised when attempting to create an ambiguous wallclock time. At the end of a DST transition period, a particular wallclock time will occur twice (once before the clocks are set back, once after). Both possibilities may be correct, unless further information is supplied. See DstTzInfo.normalize() for more info ''' class NonExistentTimeError(InvalidTimeError): '''Exception raised when attempting to create a wallclock time that cannot exist. At the start of a DST transition period, the wallclock time jumps forward. The instants jumped over never occur. '''
1,329
26.142857
78
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/pytz/tzfile.py
#!/usr/bin/env python ''' $Id: tzfile.py,v 1.8 2004/06/03 00:15:24 zenzen Exp $ ''' from datetime import datetime from struct import unpack, calcsize from pytz.tzinfo import StaticTzInfo, DstTzInfo, memorized_ttinfo from pytz.tzinfo import memorized_datetime, memorized_timedelta def _byte_string(s): """Cast a string or byte string to an ASCII byte string.""" return s.encode('ASCII') _NULL = _byte_string('\0') def _std_string(s): """Cast a string or byte string to an ASCII string.""" return str(s.decode('ASCII')) def build_tzinfo(zone, fp): head_fmt = '>4s c 15x 6l' head_size = calcsize(head_fmt) (magic, format, ttisgmtcnt, ttisstdcnt, leapcnt, timecnt, typecnt, charcnt) = unpack(head_fmt, fp.read(head_size)) # Make sure it is a tzfile(5) file assert magic == _byte_string('TZif'), 'Got magic %s' % repr(magic) # Read out the transition times, localtime indices and ttinfo structures. data_fmt = '>%(timecnt)dl %(timecnt)dB %(ttinfo)s %(charcnt)ds' % dict( timecnt=timecnt, ttinfo='lBB' * typecnt, charcnt=charcnt) data_size = calcsize(data_fmt) data = unpack(data_fmt, fp.read(data_size)) # make sure we unpacked the right number of values assert len(data) == 2 * timecnt + 3 * typecnt + 1 transitions = [memorized_datetime(trans) for trans in data[:timecnt]] lindexes = list(data[timecnt:2 * timecnt]) ttinfo_raw = data[2 * timecnt:-1] tznames_raw = data[-1] del data # Process ttinfo into separate structs ttinfo = [] tznames = {} i = 0 while i < len(ttinfo_raw): # have we looked up this timezone name yet? tzname_offset = ttinfo_raw[i + 2] if tzname_offset not in tznames: nul = tznames_raw.find(_NULL, tzname_offset) if nul < 0: nul = len(tznames_raw) tznames[tzname_offset] = _std_string( tznames_raw[tzname_offset:nul]) ttinfo.append((ttinfo_raw[i], bool(ttinfo_raw[i + 1]), tznames[tzname_offset])) i += 3 # Now build the timezone object if len(ttinfo) == 1 or len(transitions) == 0: ttinfo[0][0], ttinfo[0][2] cls = type(zone, (StaticTzInfo,), dict( zone=zone, _utcoffset=memorized_timedelta(ttinfo[0][0]), _tzname=ttinfo[0][2])) else: # Early dates use the first standard time ttinfo i = 0 while ttinfo[i][1]: i += 1 if ttinfo[i] == ttinfo[lindexes[0]]: transitions[0] = datetime.min else: transitions.insert(0, datetime.min) lindexes.insert(0, i) # calculate transition info transition_info = [] for i in range(len(transitions)): inf = ttinfo[lindexes[i]] utcoffset = inf[0] if not inf[1]: dst = 0 else: for j in range(i - 1, -1, -1): prev_inf = ttinfo[lindexes[j]] if not prev_inf[1]: break dst = inf[0] - prev_inf[0] # dst offset # Bad dst? Look further. DST > 24 hours happens when # a timzone has moved across the international dateline. if dst <= 0 or dst > 3600 * 3: for j in range(i + 1, len(transitions)): stdinf = ttinfo[lindexes[j]] if not stdinf[1]: dst = inf[0] - stdinf[0] if dst > 0: break # Found a useful std time. tzname = inf[2] # Round utcoffset and dst to the nearest minute or the # datetime library will complain. Conversions to these timezones # might be up to plus or minus 30 seconds out, but it is # the best we can do. utcoffset = int((utcoffset + 30) // 60) * 60 dst = int((dst + 30) // 60) * 60 transition_info.append(memorized_ttinfo(utcoffset, dst, tzname)) cls = type(zone, (DstTzInfo,), dict( zone=zone, _utc_transition_times=transitions, _transition_info=transition_info)) return cls() if __name__ == '__main__': import os.path from pprint import pprint base = os.path.join(os.path.dirname(__file__), 'zoneinfo') tz = build_tzinfo('Australia/Melbourne', open(os.path.join(base, 'Australia', 'Melbourne'), 'rb')) tz = build_tzinfo('US/Eastern', open(os.path.join(base, 'US', 'Eastern'), 'rb')) pprint(tz._utc_transition_times)
4,745
34.155556
79
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/pytz/__init__.py
''' datetime.tzinfo timezone definitions generated from the Olson timezone database: ftp://elsie.nci.nih.gov/pub/tz*.tar.gz See the datetime section of the Python Library Reference for information on how to use these modules. ''' import sys import datetime import os.path from pytz.exceptions import AmbiguousTimeError from pytz.exceptions import InvalidTimeError from pytz.exceptions import NonExistentTimeError from pytz.exceptions import UnknownTimeZoneError from pytz.lazy import LazyDict, LazyList, LazySet from pytz.tzinfo import unpickler, BaseTzInfo from pytz.tzfile import build_tzinfo # The IANA (nee Olson) database is updated several times a year. OLSON_VERSION = '2018d' VERSION = '2018.4' # pip compatible version number. __version__ = VERSION OLSEN_VERSION = OLSON_VERSION # Old releases had this misspelling __all__ = [ 'timezone', 'utc', 'country_timezones', 'country_names', 'AmbiguousTimeError', 'InvalidTimeError', 'NonExistentTimeError', 'UnknownTimeZoneError', 'all_timezones', 'all_timezones_set', 'common_timezones', 'common_timezones_set', ] if sys.version_info[0] > 2: # Python 3.x # Python 3.x doesn't have unicode(), making writing code # for Python 2.3 and Python 3.x a pain. unicode = str def ascii(s): r""" >>> ascii('Hello') 'Hello' >>> ascii('\N{TRADE MARK SIGN}') #doctest: +IGNORE_EXCEPTION_DETAIL Traceback (most recent call last): ... UnicodeEncodeError: ... """ if type(s) == bytes: s = s.decode('ASCII') else: s.encode('ASCII') # Raise an exception if not ASCII return s # But the string - not a byte string. else: # Python 2.x def ascii(s): r""" >>> ascii('Hello') 'Hello' >>> ascii(u'Hello') 'Hello' >>> ascii(u'\N{TRADE MARK SIGN}') #doctest: +IGNORE_EXCEPTION_DETAIL Traceback (most recent call last): ... UnicodeEncodeError: ... """ return s.encode('ASCII') def open_resource(name): """Open a resource from the zoneinfo subdir for reading. Uses the pkg_resources module if available and no standard file found at the calculated location. It is possible to specify different location for zoneinfo subdir by using the PYTZ_TZDATADIR environment variable. """ name_parts = name.lstrip('/').split('/') for part in name_parts: if part == os.path.pardir or os.path.sep in part: raise ValueError('Bad path segment: %r' % part) zoneinfo_dir = os.environ.get('PYTZ_TZDATADIR', None) if zoneinfo_dir is not None: filename = os.path.join(zoneinfo_dir, *name_parts) else: filename = os.path.join(os.path.dirname(__file__), 'zoneinfo', *name_parts) if not os.path.exists(filename): # http://bugs.launchpad.net/bugs/383171 - we avoid using this # unless absolutely necessary to help when a broken version of # pkg_resources is installed. try: from pkg_resources import resource_stream except ImportError: resource_stream = None if resource_stream is not None: return resource_stream(__name__, 'zoneinfo/' + name) return open(filename, 'rb') def resource_exists(name): """Return true if the given resource exists""" try: open_resource(name).close() return True except IOError: return False _tzinfo_cache = {} def timezone(zone): r''' Return a datetime.tzinfo implementation for the given timezone >>> from datetime import datetime, timedelta >>> utc = timezone('UTC') >>> eastern = timezone('US/Eastern') >>> eastern.zone 'US/Eastern' >>> timezone(unicode('US/Eastern')) is eastern True >>> utc_dt = datetime(2002, 10, 27, 6, 0, 0, tzinfo=utc) >>> loc_dt = utc_dt.astimezone(eastern) >>> fmt = '%Y-%m-%d %H:%M:%S %Z (%z)' >>> loc_dt.strftime(fmt) '2002-10-27 01:00:00 EST (-0500)' >>> (loc_dt - timedelta(minutes=10)).strftime(fmt) '2002-10-27 00:50:00 EST (-0500)' >>> eastern.normalize(loc_dt - timedelta(minutes=10)).strftime(fmt) '2002-10-27 01:50:00 EDT (-0400)' >>> (loc_dt + timedelta(minutes=10)).strftime(fmt) '2002-10-27 01:10:00 EST (-0500)' Raises UnknownTimeZoneError if passed an unknown zone. >>> try: ... timezone('Asia/Shangri-La') ... except UnknownTimeZoneError: ... print('Unknown') Unknown >>> try: ... timezone(unicode('\N{TRADE MARK SIGN}')) ... except UnknownTimeZoneError: ... print('Unknown') Unknown ''' if zone.upper() == 'UTC': return utc try: zone = ascii(zone) except UnicodeEncodeError: # All valid timezones are ASCII raise UnknownTimeZoneError(zone) zone = _unmunge_zone(zone) if zone not in _tzinfo_cache: if zone in all_timezones_set: fp = open_resource(zone) try: _tzinfo_cache[zone] = build_tzinfo(zone, fp) finally: fp.close() else: raise UnknownTimeZoneError(zone) return _tzinfo_cache[zone] def _unmunge_zone(zone): """Undo the time zone name munging done by older versions of pytz.""" return zone.replace('_plus_', '+').replace('_minus_', '-') ZERO = datetime.timedelta(0) HOUR = datetime.timedelta(hours=1) class UTC(BaseTzInfo): """UTC Optimized UTC implementation. It unpickles using the single module global instance defined beneath this class declaration. """ zone = "UTC" _utcoffset = ZERO _dst = ZERO _tzname = zone def fromutc(self, dt): if dt.tzinfo is None: return self.localize(dt) return super(utc.__class__, self).fromutc(dt) def utcoffset(self, dt): return ZERO def tzname(self, dt): return "UTC" def dst(self, dt): return ZERO def __reduce__(self): return _UTC, () def localize(self, dt, is_dst=False): '''Convert naive time to local time''' if dt.tzinfo is not None: raise ValueError('Not naive datetime (tzinfo is already set)') return dt.replace(tzinfo=self) def normalize(self, dt, is_dst=False): '''Correct the timezone information on the given datetime''' if dt.tzinfo is self: return dt if dt.tzinfo is None: raise ValueError('Naive time - no tzinfo set') return dt.astimezone(self) def __repr__(self): return "<UTC>" def __str__(self): return "UTC" UTC = utc = UTC() # UTC is a singleton def _UTC(): """Factory function for utc unpickling. Makes sure that unpickling a utc instance always returns the same module global. These examples belong in the UTC class above, but it is obscured; or in the README.txt, but we are not depending on Python 2.4 so integrating the README.txt examples with the unit tests is not trivial. >>> import datetime, pickle >>> dt = datetime.datetime(2005, 3, 1, 14, 13, 21, tzinfo=utc) >>> naive = dt.replace(tzinfo=None) >>> p = pickle.dumps(dt, 1) >>> naive_p = pickle.dumps(naive, 1) >>> len(p) - len(naive_p) 17 >>> new = pickle.loads(p) >>> new == dt True >>> new is dt False >>> new.tzinfo is dt.tzinfo True >>> utc is UTC is timezone('UTC') True >>> utc is timezone('GMT') False """ return utc _UTC.__safe_for_unpickling__ = True def _p(*args): """Factory function for unpickling pytz tzinfo instances. Just a wrapper around tzinfo.unpickler to save a few bytes in each pickle by shortening the path. """ return unpickler(*args) _p.__safe_for_unpickling__ = True class _CountryTimezoneDict(LazyDict): """Map ISO 3166 country code to a list of timezone names commonly used in that country. iso3166_code is the two letter code used to identify the country. >>> def print_list(list_of_strings): ... 'We use a helper so doctests work under Python 2.3 -> 3.x' ... for s in list_of_strings: ... print(s) >>> print_list(country_timezones['nz']) Pacific/Auckland Pacific/Chatham >>> print_list(country_timezones['ch']) Europe/Zurich >>> print_list(country_timezones['CH']) Europe/Zurich >>> print_list(country_timezones[unicode('ch')]) Europe/Zurich >>> print_list(country_timezones['XXX']) Traceback (most recent call last): ... KeyError: 'XXX' Previously, this information was exposed as a function rather than a dictionary. This is still supported:: >>> print_list(country_timezones('nz')) Pacific/Auckland Pacific/Chatham """ def __call__(self, iso3166_code): """Backwards compatibility.""" return self[iso3166_code] def _fill(self): data = {} zone_tab = open_resource('zone.tab') try: for line in zone_tab: line = line.decode('UTF-8') if line.startswith('#'): continue code, coordinates, zone = line.split(None, 4)[:3] if zone not in all_timezones_set: continue try: data[code].append(zone) except KeyError: data[code] = [zone] self.data = data finally: zone_tab.close() country_timezones = _CountryTimezoneDict() class _CountryNameDict(LazyDict): '''Dictionary proving ISO3166 code -> English name. >>> print(country_names['au']) Australia ''' def _fill(self): data = {} zone_tab = open_resource('iso3166.tab') try: for line in zone_tab.readlines(): line = line.decode('UTF-8') if line.startswith('#'): continue code, name = line.split(None, 1) data[code] = name.strip() self.data = data finally: zone_tab.close() country_names = _CountryNameDict() # Time-zone info based solely on fixed offsets class _FixedOffset(datetime.tzinfo): zone = None # to match the standard pytz API def __init__(self, minutes): if abs(minutes) >= 1440: raise ValueError("absolute offset is too large", minutes) self._minutes = minutes self._offset = datetime.timedelta(minutes=minutes) def utcoffset(self, dt): return self._offset def __reduce__(self): return FixedOffset, (self._minutes, ) def dst(self, dt): return ZERO def tzname(self, dt): return None def __repr__(self): return 'pytz.FixedOffset(%d)' % self._minutes def localize(self, dt, is_dst=False): '''Convert naive time to local time''' if dt.tzinfo is not None: raise ValueError('Not naive datetime (tzinfo is already set)') return dt.replace(tzinfo=self) def normalize(self, dt, is_dst=False): '''Correct the timezone information on the given datetime''' if dt.tzinfo is self: return dt if dt.tzinfo is None: raise ValueError('Naive time - no tzinfo set') return dt.astimezone(self) def FixedOffset(offset, _tzinfos={}): """return a fixed-offset timezone based off a number of minutes. >>> one = FixedOffset(-330) >>> one pytz.FixedOffset(-330) >>> str(one.utcoffset(datetime.datetime.now())) '-1 day, 18:30:00' >>> str(one.dst(datetime.datetime.now())) '0:00:00' >>> two = FixedOffset(1380) >>> two pytz.FixedOffset(1380) >>> str(two.utcoffset(datetime.datetime.now())) '23:00:00' >>> str(two.dst(datetime.datetime.now())) '0:00:00' The datetime.timedelta must be between the range of -1 and 1 day, non-inclusive. >>> FixedOffset(1440) Traceback (most recent call last): ... ValueError: ('absolute offset is too large', 1440) >>> FixedOffset(-1440) Traceback (most recent call last): ... ValueError: ('absolute offset is too large', -1440) An offset of 0 is special-cased to return UTC. >>> FixedOffset(0) is UTC True There should always be only one instance of a FixedOffset per timedelta. This should be true for multiple creation calls. >>> FixedOffset(-330) is one True >>> FixedOffset(1380) is two True It should also be true for pickling. >>> import pickle >>> pickle.loads(pickle.dumps(one)) is one True >>> pickle.loads(pickle.dumps(two)) is two True """ if offset == 0: return UTC info = _tzinfos.get(offset) if info is None: # We haven't seen this one before. we need to save it. # Use setdefault to avoid a race condition and make sure we have # only one info = _tzinfos.setdefault(offset, _FixedOffset(offset)) return info FixedOffset.__safe_for_unpickling__ = True def _test(): import doctest sys.path.insert(0, os.pardir) import pytz return doctest.testmod(pytz) if __name__ == '__main__': _test() all_timezones = \ ['Africa/Abidjan', 'Africa/Accra', 'Africa/Addis_Ababa', 'Africa/Algiers', 'Africa/Asmara', 'Africa/Asmera', 'Africa/Bamako', 'Africa/Bangui', 'Africa/Banjul', 'Africa/Bissau', 'Africa/Blantyre', 'Africa/Brazzaville', 'Africa/Bujumbura', 'Africa/Cairo', 'Africa/Casablanca', 'Africa/Ceuta', 'Africa/Conakry', 'Africa/Dakar', 'Africa/Dar_es_Salaam', 'Africa/Djibouti', 'Africa/Douala', 'Africa/El_Aaiun', 'Africa/Freetown', 'Africa/Gaborone', 'Africa/Harare', 'Africa/Johannesburg', 'Africa/Juba', 'Africa/Kampala', 'Africa/Khartoum', 'Africa/Kigali', 'Africa/Kinshasa', 'Africa/Lagos', 'Africa/Libreville', 'Africa/Lome', 'Africa/Luanda', 'Africa/Lubumbashi', 'Africa/Lusaka', 'Africa/Malabo', 'Africa/Maputo', 'Africa/Maseru', 'Africa/Mbabane', 'Africa/Mogadishu', 'Africa/Monrovia', 'Africa/Nairobi', 'Africa/Ndjamena', 'Africa/Niamey', 'Africa/Nouakchott', 'Africa/Ouagadougou', 'Africa/Porto-Novo', 'Africa/Sao_Tome', 'Africa/Timbuktu', 'Africa/Tripoli', 'Africa/Tunis', 'Africa/Windhoek', 'America/Adak', 'America/Anchorage', 'America/Anguilla', 'America/Antigua', 'America/Araguaina', 'America/Argentina/Buenos_Aires', 'America/Argentina/Catamarca', 'America/Argentina/ComodRivadavia', 'America/Argentina/Cordoba', 'America/Argentina/Jujuy', 'America/Argentina/La_Rioja', 'America/Argentina/Mendoza', 'America/Argentina/Rio_Gallegos', 'America/Argentina/Salta', 'America/Argentina/San_Juan', 'America/Argentina/San_Luis', 'America/Argentina/Tucuman', 'America/Argentina/Ushuaia', 'America/Aruba', 'America/Asuncion', 'America/Atikokan', 'America/Atka', 'America/Bahia', 'America/Bahia_Banderas', 'America/Barbados', 'America/Belem', 'America/Belize', 'America/Blanc-Sablon', 'America/Boa_Vista', 'America/Bogota', 'America/Boise', 'America/Buenos_Aires', 'America/Cambridge_Bay', 'America/Campo_Grande', 'America/Cancun', 'America/Caracas', 'America/Catamarca', 'America/Cayenne', 'America/Cayman', 'America/Chicago', 'America/Chihuahua', 'America/Coral_Harbour', 'America/Cordoba', 'America/Costa_Rica', 'America/Creston', 'America/Cuiaba', 'America/Curacao', 'America/Danmarkshavn', 'America/Dawson', 'America/Dawson_Creek', 'America/Denver', 'America/Detroit', 'America/Dominica', 'America/Edmonton', 'America/Eirunepe', 'America/El_Salvador', 'America/Ensenada', 'America/Fort_Nelson', 'America/Fort_Wayne', 'America/Fortaleza', 'America/Glace_Bay', 'America/Godthab', 'America/Goose_Bay', 'America/Grand_Turk', 'America/Grenada', 'America/Guadeloupe', 'America/Guatemala', 'America/Guayaquil', 'America/Guyana', 'America/Halifax', 'America/Havana', 'America/Hermosillo', 'America/Indiana/Indianapolis', 'America/Indiana/Knox', 'America/Indiana/Marengo', 'America/Indiana/Petersburg', 'America/Indiana/Tell_City', 'America/Indiana/Vevay', 'America/Indiana/Vincennes', 'America/Indiana/Winamac', 'America/Indianapolis', 'America/Inuvik', 'America/Iqaluit', 'America/Jamaica', 'America/Jujuy', 'America/Juneau', 'America/Kentucky/Louisville', 'America/Kentucky/Monticello', 'America/Knox_IN', 'America/Kralendijk', 'America/La_Paz', 'America/Lima', 'America/Los_Angeles', 'America/Louisville', 'America/Lower_Princes', 'America/Maceio', 'America/Managua', 'America/Manaus', 'America/Marigot', 'America/Martinique', 'America/Matamoros', 'America/Mazatlan', 'America/Mendoza', 'America/Menominee', 'America/Merida', 'America/Metlakatla', 'America/Mexico_City', 'America/Miquelon', 'America/Moncton', 'America/Monterrey', 'America/Montevideo', 'America/Montreal', 'America/Montserrat', 'America/Nassau', 'America/New_York', 'America/Nipigon', 'America/Nome', 'America/Noronha', 'America/North_Dakota/Beulah', 'America/North_Dakota/Center', 'America/North_Dakota/New_Salem', 'America/Ojinaga', 'America/Panama', 'America/Pangnirtung', 'America/Paramaribo', 'America/Phoenix', 'America/Port-au-Prince', 'America/Port_of_Spain', 'America/Porto_Acre', 'America/Porto_Velho', 'America/Puerto_Rico', 'America/Punta_Arenas', 'America/Rainy_River', 'America/Rankin_Inlet', 'America/Recife', 'America/Regina', 'America/Resolute', 'America/Rio_Branco', 'America/Rosario', 'America/Santa_Isabel', 'America/Santarem', 'America/Santiago', 'America/Santo_Domingo', 'America/Sao_Paulo', 'America/Scoresbysund', 'America/Shiprock', 'America/Sitka', 'America/St_Barthelemy', 'America/St_Johns', 'America/St_Kitts', 'America/St_Lucia', 'America/St_Thomas', 'America/St_Vincent', 'America/Swift_Current', 'America/Tegucigalpa', 'America/Thule', 'America/Thunder_Bay', 'America/Tijuana', 'America/Toronto', 'America/Tortola', 'America/Vancouver', 'America/Virgin', 'America/Whitehorse', 'America/Winnipeg', 'America/Yakutat', 'America/Yellowknife', 'Antarctica/Casey', 'Antarctica/Davis', 'Antarctica/DumontDUrville', 'Antarctica/Macquarie', 'Antarctica/Mawson', 'Antarctica/McMurdo', 'Antarctica/Palmer', 'Antarctica/Rothera', 'Antarctica/South_Pole', 'Antarctica/Syowa', 'Antarctica/Troll', 'Antarctica/Vostok', 'Arctic/Longyearbyen', 'Asia/Aden', 'Asia/Almaty', 'Asia/Amman', 'Asia/Anadyr', 'Asia/Aqtau', 'Asia/Aqtobe', 'Asia/Ashgabat', 'Asia/Ashkhabad', 'Asia/Atyrau', 'Asia/Baghdad', 'Asia/Bahrain', 'Asia/Baku', 'Asia/Bangkok', 'Asia/Barnaul', 'Asia/Beirut', 'Asia/Bishkek', 'Asia/Brunei', 'Asia/Calcutta', 'Asia/Chita', 'Asia/Choibalsan', 'Asia/Chongqing', 'Asia/Chungking', 'Asia/Colombo', 'Asia/Dacca', 'Asia/Damascus', 'Asia/Dhaka', 'Asia/Dili', 'Asia/Dubai', 'Asia/Dushanbe', 'Asia/Famagusta', 'Asia/Gaza', 'Asia/Harbin', 'Asia/Hebron', 'Asia/Ho_Chi_Minh', 'Asia/Hong_Kong', 'Asia/Hovd', 'Asia/Irkutsk', 'Asia/Istanbul', 'Asia/Jakarta', 'Asia/Jayapura', 'Asia/Jerusalem', 'Asia/Kabul', 'Asia/Kamchatka', 'Asia/Karachi', 'Asia/Kashgar', 'Asia/Kathmandu', 'Asia/Katmandu', 'Asia/Khandyga', 'Asia/Kolkata', 'Asia/Krasnoyarsk', 'Asia/Kuala_Lumpur', 'Asia/Kuching', 'Asia/Kuwait', 'Asia/Macao', 'Asia/Macau', 'Asia/Magadan', 'Asia/Makassar', 'Asia/Manila', 'Asia/Muscat', 'Asia/Nicosia', 'Asia/Novokuznetsk', 'Asia/Novosibirsk', 'Asia/Omsk', 'Asia/Oral', 'Asia/Phnom_Penh', 'Asia/Pontianak', 'Asia/Pyongyang', 'Asia/Qatar', 'Asia/Qyzylorda', 'Asia/Rangoon', 'Asia/Riyadh', 'Asia/Saigon', 'Asia/Sakhalin', 'Asia/Samarkand', 'Asia/Seoul', 'Asia/Shanghai', 'Asia/Singapore', 'Asia/Srednekolymsk', 'Asia/Taipei', 'Asia/Tashkent', 'Asia/Tbilisi', 'Asia/Tehran', 'Asia/Tel_Aviv', 'Asia/Thimbu', 'Asia/Thimphu', 'Asia/Tokyo', 'Asia/Tomsk', 'Asia/Ujung_Pandang', 'Asia/Ulaanbaatar', 'Asia/Ulan_Bator', 'Asia/Urumqi', 'Asia/Ust-Nera', 'Asia/Vientiane', 'Asia/Vladivostok', 'Asia/Yakutsk', 'Asia/Yangon', 'Asia/Yekaterinburg', 'Asia/Yerevan', 'Atlantic/Azores', 'Atlantic/Bermuda', 'Atlantic/Canary', 'Atlantic/Cape_Verde', 'Atlantic/Faeroe', 'Atlantic/Faroe', 'Atlantic/Jan_Mayen', 'Atlantic/Madeira', 'Atlantic/Reykjavik', 'Atlantic/South_Georgia', 'Atlantic/St_Helena', 'Atlantic/Stanley', 'Australia/ACT', 'Australia/Adelaide', 'Australia/Brisbane', 'Australia/Broken_Hill', 'Australia/Canberra', 'Australia/Currie', 'Australia/Darwin', 'Australia/Eucla', 'Australia/Hobart', 'Australia/LHI', 'Australia/Lindeman', 'Australia/Lord_Howe', 'Australia/Melbourne', 'Australia/NSW', 'Australia/North', 'Australia/Perth', 'Australia/Queensland', 'Australia/South', 'Australia/Sydney', 'Australia/Tasmania', 'Australia/Victoria', 'Australia/West', 'Australia/Yancowinna', 'Brazil/Acre', 'Brazil/DeNoronha', 'Brazil/East', 'Brazil/West', 'CET', 'CST6CDT', 'Canada/Atlantic', 'Canada/Central', 'Canada/Eastern', 'Canada/Mountain', 'Canada/Newfoundland', 'Canada/Pacific', 'Canada/Saskatchewan', 'Canada/Yukon', 'Chile/Continental', 'Chile/EasterIsland', 'Cuba', 'EET', 'EST', 'EST5EDT', 'Egypt', 'Eire', 'Etc/GMT', 'Etc/GMT+0', 'Etc/GMT+1', 'Etc/GMT+10', 'Etc/GMT+11', 'Etc/GMT+12', 'Etc/GMT+2', 'Etc/GMT+3', 'Etc/GMT+4', 'Etc/GMT+5', 'Etc/GMT+6', 'Etc/GMT+7', 'Etc/GMT+8', 'Etc/GMT+9', 'Etc/GMT-0', 'Etc/GMT-1', 'Etc/GMT-10', 'Etc/GMT-11', 'Etc/GMT-12', 'Etc/GMT-13', 'Etc/GMT-14', 'Etc/GMT-2', 'Etc/GMT-3', 'Etc/GMT-4', 'Etc/GMT-5', 'Etc/GMT-6', 'Etc/GMT-7', 'Etc/GMT-8', 'Etc/GMT-9', 'Etc/GMT0', 'Etc/Greenwich', 'Etc/UCT', 'Etc/UTC', 'Etc/Universal', 'Etc/Zulu', 'Europe/Amsterdam', 'Europe/Andorra', 'Europe/Astrakhan', 'Europe/Athens', 'Europe/Belfast', 'Europe/Belgrade', 'Europe/Berlin', 'Europe/Bratislava', 'Europe/Brussels', 'Europe/Bucharest', 'Europe/Budapest', 'Europe/Busingen', 'Europe/Chisinau', 'Europe/Copenhagen', 'Europe/Dublin', 'Europe/Gibraltar', 'Europe/Guernsey', 'Europe/Helsinki', 'Europe/Isle_of_Man', 'Europe/Istanbul', 'Europe/Jersey', 'Europe/Kaliningrad', 'Europe/Kiev', 'Europe/Kirov', 'Europe/Lisbon', 'Europe/Ljubljana', 'Europe/London', 'Europe/Luxembourg', 'Europe/Madrid', 'Europe/Malta', 'Europe/Mariehamn', 'Europe/Minsk', 'Europe/Monaco', 'Europe/Moscow', 'Europe/Nicosia', 'Europe/Oslo', 'Europe/Paris', 'Europe/Podgorica', 'Europe/Prague', 'Europe/Riga', 'Europe/Rome', 'Europe/Samara', 'Europe/San_Marino', 'Europe/Sarajevo', 'Europe/Saratov', 'Europe/Simferopol', 'Europe/Skopje', 'Europe/Sofia', 'Europe/Stockholm', 'Europe/Tallinn', 'Europe/Tirane', 'Europe/Tiraspol', 'Europe/Ulyanovsk', 'Europe/Uzhgorod', 'Europe/Vaduz', 'Europe/Vatican', 'Europe/Vienna', 'Europe/Vilnius', 'Europe/Volgograd', 'Europe/Warsaw', 'Europe/Zagreb', 'Europe/Zaporozhye', 'Europe/Zurich', 'GB', 'GB-Eire', 'GMT', 'GMT+0', 'GMT-0', 'GMT0', 'Greenwich', 'HST', 'Hongkong', 'Iceland', 'Indian/Antananarivo', 'Indian/Chagos', 'Indian/Christmas', 'Indian/Cocos', 'Indian/Comoro', 'Indian/Kerguelen', 'Indian/Mahe', 'Indian/Maldives', 'Indian/Mauritius', 'Indian/Mayotte', 'Indian/Reunion', 'Iran', 'Israel', 'Jamaica', 'Japan', 'Kwajalein', 'Libya', 'MET', 'MST', 'MST7MDT', 'Mexico/BajaNorte', 'Mexico/BajaSur', 'Mexico/General', 'NZ', 'NZ-CHAT', 'Navajo', 'PRC', 'PST8PDT', 'Pacific/Apia', 'Pacific/Auckland', 'Pacific/Bougainville', 'Pacific/Chatham', 'Pacific/Chuuk', 'Pacific/Easter', 'Pacific/Efate', 'Pacific/Enderbury', 'Pacific/Fakaofo', 'Pacific/Fiji', 'Pacific/Funafuti', 'Pacific/Galapagos', 'Pacific/Gambier', 'Pacific/Guadalcanal', 'Pacific/Guam', 'Pacific/Honolulu', 'Pacific/Johnston', 'Pacific/Kiritimati', 'Pacific/Kosrae', 'Pacific/Kwajalein', 'Pacific/Majuro', 'Pacific/Marquesas', 'Pacific/Midway', 'Pacific/Nauru', 'Pacific/Niue', 'Pacific/Norfolk', 'Pacific/Noumea', 'Pacific/Pago_Pago', 'Pacific/Palau', 'Pacific/Pitcairn', 'Pacific/Pohnpei', 'Pacific/Ponape', 'Pacific/Port_Moresby', 'Pacific/Rarotonga', 'Pacific/Saipan', 'Pacific/Samoa', 'Pacific/Tahiti', 'Pacific/Tarawa', 'Pacific/Tongatapu', 'Pacific/Truk', 'Pacific/Wake', 'Pacific/Wallis', 'Pacific/Yap', 'Poland', 'Portugal', 'ROC', 'ROK', 'Singapore', 'Turkey', 'UCT', 'US/Alaska', 'US/Aleutian', 'US/Arizona', 'US/Central', 'US/East-Indiana', 'US/Eastern', 'US/Hawaii', 'US/Indiana-Starke', 'US/Michigan', 'US/Mountain', 'US/Pacific', 'US/Samoa', 'UTC', 'Universal', 'W-SU', 'WET', 'Zulu'] all_timezones = LazyList( tz for tz in all_timezones if resource_exists(tz)) all_timezones_set = LazySet(all_timezones) common_timezones = \ ['Africa/Abidjan', 'Africa/Accra', 'Africa/Addis_Ababa', 'Africa/Algiers', 'Africa/Asmara', 'Africa/Bamako', 'Africa/Bangui', 'Africa/Banjul', 'Africa/Bissau', 'Africa/Blantyre', 'Africa/Brazzaville', 'Africa/Bujumbura', 'Africa/Cairo', 'Africa/Casablanca', 'Africa/Ceuta', 'Africa/Conakry', 'Africa/Dakar', 'Africa/Dar_es_Salaam', 'Africa/Djibouti', 'Africa/Douala', 'Africa/El_Aaiun', 'Africa/Freetown', 'Africa/Gaborone', 'Africa/Harare', 'Africa/Johannesburg', 'Africa/Juba', 'Africa/Kampala', 'Africa/Khartoum', 'Africa/Kigali', 'Africa/Kinshasa', 'Africa/Lagos', 'Africa/Libreville', 'Africa/Lome', 'Africa/Luanda', 'Africa/Lubumbashi', 'Africa/Lusaka', 'Africa/Malabo', 'Africa/Maputo', 'Africa/Maseru', 'Africa/Mbabane', 'Africa/Mogadishu', 'Africa/Monrovia', 'Africa/Nairobi', 'Africa/Ndjamena', 'Africa/Niamey', 'Africa/Nouakchott', 'Africa/Ouagadougou', 'Africa/Porto-Novo', 'Africa/Sao_Tome', 'Africa/Tripoli', 'Africa/Tunis', 'Africa/Windhoek', 'America/Adak', 'America/Anchorage', 'America/Anguilla', 'America/Antigua', 'America/Araguaina', 'America/Argentina/Buenos_Aires', 'America/Argentina/Catamarca', 'America/Argentina/Cordoba', 'America/Argentina/Jujuy', 'America/Argentina/La_Rioja', 'America/Argentina/Mendoza', 'America/Argentina/Rio_Gallegos', 'America/Argentina/Salta', 'America/Argentina/San_Juan', 'America/Argentina/San_Luis', 'America/Argentina/Tucuman', 'America/Argentina/Ushuaia', 'America/Aruba', 'America/Asuncion', 'America/Atikokan', 'America/Bahia', 'America/Bahia_Banderas', 'America/Barbados', 'America/Belem', 'America/Belize', 'America/Blanc-Sablon', 'America/Boa_Vista', 'America/Bogota', 'America/Boise', 'America/Cambridge_Bay', 'America/Campo_Grande', 'America/Cancun', 'America/Caracas', 'America/Cayenne', 'America/Cayman', 'America/Chicago', 'America/Chihuahua', 'America/Costa_Rica', 'America/Creston', 'America/Cuiaba', 'America/Curacao', 'America/Danmarkshavn', 'America/Dawson', 'America/Dawson_Creek', 'America/Denver', 'America/Detroit', 'America/Dominica', 'America/Edmonton', 'America/Eirunepe', 'America/El_Salvador', 'America/Fort_Nelson', 'America/Fortaleza', 'America/Glace_Bay', 'America/Godthab', 'America/Goose_Bay', 'America/Grand_Turk', 'America/Grenada', 'America/Guadeloupe', 'America/Guatemala', 'America/Guayaquil', 'America/Guyana', 'America/Halifax', 'America/Havana', 'America/Hermosillo', 'America/Indiana/Indianapolis', 'America/Indiana/Knox', 'America/Indiana/Marengo', 'America/Indiana/Petersburg', 'America/Indiana/Tell_City', 'America/Indiana/Vevay', 'America/Indiana/Vincennes', 'America/Indiana/Winamac', 'America/Inuvik', 'America/Iqaluit', 'America/Jamaica', 'America/Juneau', 'America/Kentucky/Louisville', 'America/Kentucky/Monticello', 'America/Kralendijk', 'America/La_Paz', 'America/Lima', 'America/Los_Angeles', 'America/Lower_Princes', 'America/Maceio', 'America/Managua', 'America/Manaus', 'America/Marigot', 'America/Martinique', 'America/Matamoros', 'America/Mazatlan', 'America/Menominee', 'America/Merida', 'America/Metlakatla', 'America/Mexico_City', 'America/Miquelon', 'America/Moncton', 'America/Monterrey', 'America/Montevideo', 'America/Montserrat', 'America/Nassau', 'America/New_York', 'America/Nipigon', 'America/Nome', 'America/Noronha', 'America/North_Dakota/Beulah', 'America/North_Dakota/Center', 'America/North_Dakota/New_Salem', 'America/Ojinaga', 'America/Panama', 'America/Pangnirtung', 'America/Paramaribo', 'America/Phoenix', 'America/Port-au-Prince', 'America/Port_of_Spain', 'America/Porto_Velho', 'America/Puerto_Rico', 'America/Punta_Arenas', 'America/Rainy_River', 'America/Rankin_Inlet', 'America/Recife', 'America/Regina', 'America/Resolute', 'America/Rio_Branco', 'America/Santarem', 'America/Santiago', 'America/Santo_Domingo', 'America/Sao_Paulo', 'America/Scoresbysund', 'America/Sitka', 'America/St_Barthelemy', 'America/St_Johns', 'America/St_Kitts', 'America/St_Lucia', 'America/St_Thomas', 'America/St_Vincent', 'America/Swift_Current', 'America/Tegucigalpa', 'America/Thule', 'America/Thunder_Bay', 'America/Tijuana', 'America/Toronto', 'America/Tortola', 'America/Vancouver', 'America/Whitehorse', 'America/Winnipeg', 'America/Yakutat', 'America/Yellowknife', 'Antarctica/Casey', 'Antarctica/Davis', 'Antarctica/DumontDUrville', 'Antarctica/Macquarie', 'Antarctica/Mawson', 'Antarctica/McMurdo', 'Antarctica/Palmer', 'Antarctica/Rothera', 'Antarctica/Syowa', 'Antarctica/Troll', 'Antarctica/Vostok', 'Arctic/Longyearbyen', 'Asia/Aden', 'Asia/Almaty', 'Asia/Amman', 'Asia/Anadyr', 'Asia/Aqtau', 'Asia/Aqtobe', 'Asia/Ashgabat', 'Asia/Atyrau', 'Asia/Baghdad', 'Asia/Bahrain', 'Asia/Baku', 'Asia/Bangkok', 'Asia/Barnaul', 'Asia/Beirut', 'Asia/Bishkek', 'Asia/Brunei', 'Asia/Chita', 'Asia/Choibalsan', 'Asia/Colombo', 'Asia/Damascus', 'Asia/Dhaka', 'Asia/Dili', 'Asia/Dubai', 'Asia/Dushanbe', 'Asia/Famagusta', 'Asia/Gaza', 'Asia/Hebron', 'Asia/Ho_Chi_Minh', 'Asia/Hong_Kong', 'Asia/Hovd', 'Asia/Irkutsk', 'Asia/Jakarta', 'Asia/Jayapura', 'Asia/Jerusalem', 'Asia/Kabul', 'Asia/Kamchatka', 'Asia/Karachi', 'Asia/Kathmandu', 'Asia/Khandyga', 'Asia/Kolkata', 'Asia/Krasnoyarsk', 'Asia/Kuala_Lumpur', 'Asia/Kuching', 'Asia/Kuwait', 'Asia/Macau', 'Asia/Magadan', 'Asia/Makassar', 'Asia/Manila', 'Asia/Muscat', 'Asia/Nicosia', 'Asia/Novokuznetsk', 'Asia/Novosibirsk', 'Asia/Omsk', 'Asia/Oral', 'Asia/Phnom_Penh', 'Asia/Pontianak', 'Asia/Pyongyang', 'Asia/Qatar', 'Asia/Qyzylorda', 'Asia/Riyadh', 'Asia/Sakhalin', 'Asia/Samarkand', 'Asia/Seoul', 'Asia/Shanghai', 'Asia/Singapore', 'Asia/Srednekolymsk', 'Asia/Taipei', 'Asia/Tashkent', 'Asia/Tbilisi', 'Asia/Tehran', 'Asia/Thimphu', 'Asia/Tokyo', 'Asia/Tomsk', 'Asia/Ulaanbaatar', 'Asia/Urumqi', 'Asia/Ust-Nera', 'Asia/Vientiane', 'Asia/Vladivostok', 'Asia/Yakutsk', 'Asia/Yangon', 'Asia/Yekaterinburg', 'Asia/Yerevan', 'Atlantic/Azores', 'Atlantic/Bermuda', 'Atlantic/Canary', 'Atlantic/Cape_Verde', 'Atlantic/Faroe', 'Atlantic/Madeira', 'Atlantic/Reykjavik', 'Atlantic/South_Georgia', 'Atlantic/St_Helena', 'Atlantic/Stanley', 'Australia/Adelaide', 'Australia/Brisbane', 'Australia/Broken_Hill', 'Australia/Currie', 'Australia/Darwin', 'Australia/Eucla', 'Australia/Hobart', 'Australia/Lindeman', 'Australia/Lord_Howe', 'Australia/Melbourne', 'Australia/Perth', 'Australia/Sydney', 'Canada/Atlantic', 'Canada/Central', 'Canada/Eastern', 'Canada/Mountain', 'Canada/Newfoundland', 'Canada/Pacific', 'Europe/Amsterdam', 'Europe/Andorra', 'Europe/Astrakhan', 'Europe/Athens', 'Europe/Belgrade', 'Europe/Berlin', 'Europe/Bratislava', 'Europe/Brussels', 'Europe/Bucharest', 'Europe/Budapest', 'Europe/Busingen', 'Europe/Chisinau', 'Europe/Copenhagen', 'Europe/Dublin', 'Europe/Gibraltar', 'Europe/Guernsey', 'Europe/Helsinki', 'Europe/Isle_of_Man', 'Europe/Istanbul', 'Europe/Jersey', 'Europe/Kaliningrad', 'Europe/Kiev', 'Europe/Kirov', 'Europe/Lisbon', 'Europe/Ljubljana', 'Europe/London', 'Europe/Luxembourg', 'Europe/Madrid', 'Europe/Malta', 'Europe/Mariehamn', 'Europe/Minsk', 'Europe/Monaco', 'Europe/Moscow', 'Europe/Oslo', 'Europe/Paris', 'Europe/Podgorica', 'Europe/Prague', 'Europe/Riga', 'Europe/Rome', 'Europe/Samara', 'Europe/San_Marino', 'Europe/Sarajevo', 'Europe/Saratov', 'Europe/Simferopol', 'Europe/Skopje', 'Europe/Sofia', 'Europe/Stockholm', 'Europe/Tallinn', 'Europe/Tirane', 'Europe/Ulyanovsk', 'Europe/Uzhgorod', 'Europe/Vaduz', 'Europe/Vatican', 'Europe/Vienna', 'Europe/Vilnius', 'Europe/Volgograd', 'Europe/Warsaw', 'Europe/Zagreb', 'Europe/Zaporozhye', 'Europe/Zurich', 'GMT', 'Indian/Antananarivo', 'Indian/Chagos', 'Indian/Christmas', 'Indian/Cocos', 'Indian/Comoro', 'Indian/Kerguelen', 'Indian/Mahe', 'Indian/Maldives', 'Indian/Mauritius', 'Indian/Mayotte', 'Indian/Reunion', 'Pacific/Apia', 'Pacific/Auckland', 'Pacific/Bougainville', 'Pacific/Chatham', 'Pacific/Chuuk', 'Pacific/Easter', 'Pacific/Efate', 'Pacific/Enderbury', 'Pacific/Fakaofo', 'Pacific/Fiji', 'Pacific/Funafuti', 'Pacific/Galapagos', 'Pacific/Gambier', 'Pacific/Guadalcanal', 'Pacific/Guam', 'Pacific/Honolulu', 'Pacific/Kiritimati', 'Pacific/Kosrae', 'Pacific/Kwajalein', 'Pacific/Majuro', 'Pacific/Marquesas', 'Pacific/Midway', 'Pacific/Nauru', 'Pacific/Niue', 'Pacific/Norfolk', 'Pacific/Noumea', 'Pacific/Pago_Pago', 'Pacific/Palau', 'Pacific/Pitcairn', 'Pacific/Pohnpei', 'Pacific/Port_Moresby', 'Pacific/Rarotonga', 'Pacific/Saipan', 'Pacific/Tahiti', 'Pacific/Tarawa', 'Pacific/Tongatapu', 'Pacific/Wake', 'Pacific/Wallis', 'US/Alaska', 'US/Arizona', 'US/Central', 'US/Eastern', 'US/Hawaii', 'US/Mountain', 'US/Pacific', 'UTC'] common_timezones = LazyList( tz for tz in common_timezones if tz in all_timezones) common_timezones_set = LazySet(common_timezones)
34,156
21.368697
77
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/pytz/tzinfo.py
'''Base classes and helpers for building zone specific tzinfo classes''' from datetime import datetime, timedelta, tzinfo from bisect import bisect_right try: set except NameError: from sets import Set as set import pytz from pytz.exceptions import AmbiguousTimeError, NonExistentTimeError __all__ = [] _timedelta_cache = {} def memorized_timedelta(seconds): '''Create only one instance of each distinct timedelta''' try: return _timedelta_cache[seconds] except KeyError: delta = timedelta(seconds=seconds) _timedelta_cache[seconds] = delta return delta _epoch = datetime.utcfromtimestamp(0) _datetime_cache = {0: _epoch} def memorized_datetime(seconds): '''Create only one instance of each distinct datetime''' try: return _datetime_cache[seconds] except KeyError: # NB. We can't just do datetime.utcfromtimestamp(seconds) as this # fails with negative values under Windows (Bug #90096) dt = _epoch + timedelta(seconds=seconds) _datetime_cache[seconds] = dt return dt _ttinfo_cache = {} def memorized_ttinfo(*args): '''Create only one instance of each distinct tuple''' try: return _ttinfo_cache[args] except KeyError: ttinfo = ( memorized_timedelta(args[0]), memorized_timedelta(args[1]), args[2] ) _ttinfo_cache[args] = ttinfo return ttinfo _notime = memorized_timedelta(0) def _to_seconds(td): '''Convert a timedelta to seconds''' return td.seconds + td.days * 24 * 60 * 60 class BaseTzInfo(tzinfo): # Overridden in subclass _utcoffset = None _tzname = None zone = None def __str__(self): return self.zone class StaticTzInfo(BaseTzInfo): '''A timezone that has a constant offset from UTC These timezones are rare, as most locations have changed their offset at some point in their history ''' def fromutc(self, dt): '''See datetime.tzinfo.fromutc''' if dt.tzinfo is not None and dt.tzinfo is not self: raise ValueError('fromutc: dt.tzinfo is not self') return (dt + self._utcoffset).replace(tzinfo=self) def utcoffset(self, dt, is_dst=None): '''See datetime.tzinfo.utcoffset is_dst is ignored for StaticTzInfo, and exists only to retain compatibility with DstTzInfo. ''' return self._utcoffset def dst(self, dt, is_dst=None): '''See datetime.tzinfo.dst is_dst is ignored for StaticTzInfo, and exists only to retain compatibility with DstTzInfo. ''' return _notime def tzname(self, dt, is_dst=None): '''See datetime.tzinfo.tzname is_dst is ignored for StaticTzInfo, and exists only to retain compatibility with DstTzInfo. ''' return self._tzname def localize(self, dt, is_dst=False): '''Convert naive time to local time''' if dt.tzinfo is not None: raise ValueError('Not naive datetime (tzinfo is already set)') return dt.replace(tzinfo=self) def normalize(self, dt, is_dst=False): '''Correct the timezone information on the given datetime. This is normally a no-op, as StaticTzInfo timezones never have ambiguous cases to correct: >>> from pytz import timezone >>> gmt = timezone('GMT') >>> isinstance(gmt, StaticTzInfo) True >>> dt = datetime(2011, 5, 8, 1, 2, 3, tzinfo=gmt) >>> gmt.normalize(dt) is dt True The supported method of converting between timezones is to use datetime.astimezone(). Currently normalize() also works: >>> la = timezone('America/Los_Angeles') >>> dt = la.localize(datetime(2011, 5, 7, 1, 2, 3)) >>> fmt = '%Y-%m-%d %H:%M:%S %Z (%z)' >>> gmt.normalize(dt).strftime(fmt) '2011-05-07 08:02:03 GMT (+0000)' ''' if dt.tzinfo is self: return dt if dt.tzinfo is None: raise ValueError('Naive time - no tzinfo set') return dt.astimezone(self) def __repr__(self): return '<StaticTzInfo %r>' % (self.zone,) def __reduce__(self): # Special pickle to zone remains a singleton and to cope with # database changes. return pytz._p, (self.zone,) class DstTzInfo(BaseTzInfo): '''A timezone that has a variable offset from UTC The offset might change if daylight saving time comes into effect, or at a point in history when the region decides to change their timezone definition. ''' # Overridden in subclass # Sorted list of DST transition times, UTC _utc_transition_times = None # [(utcoffset, dstoffset, tzname)] corresponding to # _utc_transition_times entries _transition_info = None zone = None # Set in __init__ _tzinfos = None _dst = None # DST offset def __init__(self, _inf=None, _tzinfos=None): if _inf: self._tzinfos = _tzinfos self._utcoffset, self._dst, self._tzname = _inf else: _tzinfos = {} self._tzinfos = _tzinfos self._utcoffset, self._dst, self._tzname = ( self._transition_info[0]) _tzinfos[self._transition_info[0]] = self for inf in self._transition_info[1:]: if inf not in _tzinfos: _tzinfos[inf] = self.__class__(inf, _tzinfos) def fromutc(self, dt): '''See datetime.tzinfo.fromutc''' if (dt.tzinfo is not None and getattr(dt.tzinfo, '_tzinfos', None) is not self._tzinfos): raise ValueError('fromutc: dt.tzinfo is not self') dt = dt.replace(tzinfo=None) idx = max(0, bisect_right(self._utc_transition_times, dt) - 1) inf = self._transition_info[idx] return (dt + inf[0]).replace(tzinfo=self._tzinfos[inf]) def normalize(self, dt): '''Correct the timezone information on the given datetime If date arithmetic crosses DST boundaries, the tzinfo is not magically adjusted. This method normalizes the tzinfo to the correct one. To test, first we need to do some setup >>> from pytz import timezone >>> utc = timezone('UTC') >>> eastern = timezone('US/Eastern') >>> fmt = '%Y-%m-%d %H:%M:%S %Z (%z)' We next create a datetime right on an end-of-DST transition point, the instant when the wallclocks are wound back one hour. >>> utc_dt = datetime(2002, 10, 27, 6, 0, 0, tzinfo=utc) >>> loc_dt = utc_dt.astimezone(eastern) >>> loc_dt.strftime(fmt) '2002-10-27 01:00:00 EST (-0500)' Now, if we subtract a few minutes from it, note that the timezone information has not changed. >>> before = loc_dt - timedelta(minutes=10) >>> before.strftime(fmt) '2002-10-27 00:50:00 EST (-0500)' But we can fix that by calling the normalize method >>> before = eastern.normalize(before) >>> before.strftime(fmt) '2002-10-27 01:50:00 EDT (-0400)' The supported method of converting between timezones is to use datetime.astimezone(). Currently, normalize() also works: >>> th = timezone('Asia/Bangkok') >>> am = timezone('Europe/Amsterdam') >>> dt = th.localize(datetime(2011, 5, 7, 1, 2, 3)) >>> fmt = '%Y-%m-%d %H:%M:%S %Z (%z)' >>> am.normalize(dt).strftime(fmt) '2011-05-06 20:02:03 CEST (+0200)' ''' if dt.tzinfo is None: raise ValueError('Naive time - no tzinfo set') # Convert dt in localtime to UTC offset = dt.tzinfo._utcoffset dt = dt.replace(tzinfo=None) dt = dt - offset # convert it back, and return it return self.fromutc(dt) def localize(self, dt, is_dst=False): '''Convert naive time to local time. This method should be used to construct localtimes, rather than passing a tzinfo argument to a datetime constructor. is_dst is used to determine the correct timezone in the ambigous period at the end of daylight saving time. >>> from pytz import timezone >>> fmt = '%Y-%m-%d %H:%M:%S %Z (%z)' >>> amdam = timezone('Europe/Amsterdam') >>> dt = datetime(2004, 10, 31, 2, 0, 0) >>> loc_dt1 = amdam.localize(dt, is_dst=True) >>> loc_dt2 = amdam.localize(dt, is_dst=False) >>> loc_dt1.strftime(fmt) '2004-10-31 02:00:00 CEST (+0200)' >>> loc_dt2.strftime(fmt) '2004-10-31 02:00:00 CET (+0100)' >>> str(loc_dt2 - loc_dt1) '1:00:00' Use is_dst=None to raise an AmbiguousTimeError for ambiguous times at the end of daylight saving time >>> try: ... loc_dt1 = amdam.localize(dt, is_dst=None) ... except AmbiguousTimeError: ... print('Ambiguous') Ambiguous is_dst defaults to False >>> amdam.localize(dt) == amdam.localize(dt, False) True is_dst is also used to determine the correct timezone in the wallclock times jumped over at the start of daylight saving time. >>> pacific = timezone('US/Pacific') >>> dt = datetime(2008, 3, 9, 2, 0, 0) >>> ploc_dt1 = pacific.localize(dt, is_dst=True) >>> ploc_dt2 = pacific.localize(dt, is_dst=False) >>> ploc_dt1.strftime(fmt) '2008-03-09 02:00:00 PDT (-0700)' >>> ploc_dt2.strftime(fmt) '2008-03-09 02:00:00 PST (-0800)' >>> str(ploc_dt2 - ploc_dt1) '1:00:00' Use is_dst=None to raise a NonExistentTimeError for these skipped times. >>> try: ... loc_dt1 = pacific.localize(dt, is_dst=None) ... except NonExistentTimeError: ... print('Non-existent') Non-existent ''' if dt.tzinfo is not None: raise ValueError('Not naive datetime (tzinfo is already set)') # Find the two best possibilities. possible_loc_dt = set() for delta in [timedelta(days=-1), timedelta(days=1)]: loc_dt = dt + delta idx = max(0, bisect_right( self._utc_transition_times, loc_dt) - 1) inf = self._transition_info[idx] tzinfo = self._tzinfos[inf] loc_dt = tzinfo.normalize(dt.replace(tzinfo=tzinfo)) if loc_dt.replace(tzinfo=None) == dt: possible_loc_dt.add(loc_dt) if len(possible_loc_dt) == 1: return possible_loc_dt.pop() # If there are no possibly correct timezones, we are attempting # to convert a time that never happened - the time period jumped # during the start-of-DST transition period. if len(possible_loc_dt) == 0: # If we refuse to guess, raise an exception. if is_dst is None: raise NonExistentTimeError(dt) # If we are forcing the pre-DST side of the DST transition, we # obtain the correct timezone by winding the clock forward a few # hours. elif is_dst: return self.localize( dt + timedelta(hours=6), is_dst=True) - timedelta(hours=6) # If we are forcing the post-DST side of the DST transition, we # obtain the correct timezone by winding the clock back. else: return self.localize( dt - timedelta(hours=6), is_dst=False) + timedelta(hours=6) # If we get this far, we have multiple possible timezones - this # is an ambiguous case occuring during the end-of-DST transition. # If told to be strict, raise an exception since we have an # ambiguous case if is_dst is None: raise AmbiguousTimeError(dt) # Filter out the possiblilities that don't match the requested # is_dst filtered_possible_loc_dt = [ p for p in possible_loc_dt if bool(p.tzinfo._dst) == is_dst ] # Hopefully we only have one possibility left. Return it. if len(filtered_possible_loc_dt) == 1: return filtered_possible_loc_dt[0] if len(filtered_possible_loc_dt) == 0: filtered_possible_loc_dt = list(possible_loc_dt) # If we get this far, we have in a wierd timezone transition # where the clocks have been wound back but is_dst is the same # in both (eg. Europe/Warsaw 1915 when they switched to CET). # At this point, we just have to guess unless we allow more # hints to be passed in (such as the UTC offset or abbreviation), # but that is just getting silly. # # Choose the earliest (by UTC) applicable timezone if is_dst=True # Choose the latest (by UTC) applicable timezone if is_dst=False # i.e., behave like end-of-DST transition dates = {} # utc -> local for local_dt in filtered_possible_loc_dt: utc_time = ( local_dt.replace(tzinfo=None) - local_dt.tzinfo._utcoffset) assert utc_time not in dates dates[utc_time] = local_dt return dates[[min, max][not is_dst](dates)] def utcoffset(self, dt, is_dst=None): '''See datetime.tzinfo.utcoffset The is_dst parameter may be used to remove ambiguity during DST transitions. >>> from pytz import timezone >>> tz = timezone('America/St_Johns') >>> ambiguous = datetime(2009, 10, 31, 23, 30) >>> str(tz.utcoffset(ambiguous, is_dst=False)) '-1 day, 20:30:00' >>> str(tz.utcoffset(ambiguous, is_dst=True)) '-1 day, 21:30:00' >>> try: ... tz.utcoffset(ambiguous) ... except AmbiguousTimeError: ... print('Ambiguous') Ambiguous ''' if dt is None: return None elif dt.tzinfo is not self: dt = self.localize(dt, is_dst) return dt.tzinfo._utcoffset else: return self._utcoffset def dst(self, dt, is_dst=None): '''See datetime.tzinfo.dst The is_dst parameter may be used to remove ambiguity during DST transitions. >>> from pytz import timezone >>> tz = timezone('America/St_Johns') >>> normal = datetime(2009, 9, 1) >>> str(tz.dst(normal)) '1:00:00' >>> str(tz.dst(normal, is_dst=False)) '1:00:00' >>> str(tz.dst(normal, is_dst=True)) '1:00:00' >>> ambiguous = datetime(2009, 10, 31, 23, 30) >>> str(tz.dst(ambiguous, is_dst=False)) '0:00:00' >>> str(tz.dst(ambiguous, is_dst=True)) '1:00:00' >>> try: ... tz.dst(ambiguous) ... except AmbiguousTimeError: ... print('Ambiguous') Ambiguous ''' if dt is None: return None elif dt.tzinfo is not self: dt = self.localize(dt, is_dst) return dt.tzinfo._dst else: return self._dst def tzname(self, dt, is_dst=None): '''See datetime.tzinfo.tzname The is_dst parameter may be used to remove ambiguity during DST transitions. >>> from pytz import timezone >>> tz = timezone('America/St_Johns') >>> normal = datetime(2009, 9, 1) >>> tz.tzname(normal) 'NDT' >>> tz.tzname(normal, is_dst=False) 'NDT' >>> tz.tzname(normal, is_dst=True) 'NDT' >>> ambiguous = datetime(2009, 10, 31, 23, 30) >>> tz.tzname(ambiguous, is_dst=False) 'NST' >>> tz.tzname(ambiguous, is_dst=True) 'NDT' >>> try: ... tz.tzname(ambiguous) ... except AmbiguousTimeError: ... print('Ambiguous') Ambiguous ''' if dt is None: return self.zone elif dt.tzinfo is not self: dt = self.localize(dt, is_dst) return dt.tzinfo._tzname else: return self._tzname def __repr__(self): if self._dst: dst = 'DST' else: dst = 'STD' if self._utcoffset > _notime: return '<DstTzInfo %r %s+%s %s>' % ( self.zone, self._tzname, self._utcoffset, dst ) else: return '<DstTzInfo %r %s%s %s>' % ( self.zone, self._tzname, self._utcoffset, dst ) def __reduce__(self): # Special pickle to zone remains a singleton and to cope with # database changes. return pytz._p, ( self.zone, _to_seconds(self._utcoffset), _to_seconds(self._dst), self._tzname ) def unpickler(zone, utcoffset=None, dstoffset=None, tzname=None): """Factory function for unpickling pytz tzinfo instances. This is shared for both StaticTzInfo and DstTzInfo instances, because database changes could cause a zones implementation to switch between these two base classes and we can't break pickles on a pytz version upgrade. """ # Raises a KeyError if zone no longer exists, which should never happen # and would be a bug. tz = pytz.timezone(zone) # A StaticTzInfo - just return it if utcoffset is None: return tz # This pickle was created from a DstTzInfo. We need to # determine which of the list of tzinfo instances for this zone # to use in order to restore the state of any datetime instances using # it correctly. utcoffset = memorized_timedelta(utcoffset) dstoffset = memorized_timedelta(dstoffset) try: return tz._tzinfos[(utcoffset, dstoffset, tzname)] except KeyError: # The particular state requested in this timezone no longer exists. # This indicates a corrupt pickle, or the timezone database has been # corrected violently enough to make this particular # (utcoffset,dstoffset) no longer exist in the zone, or the # abbreviation has been changed. pass # See if we can find an entry differing only by tzname. Abbreviations # get changed from the initial guess by the database maintainers to # match reality when this information is discovered. for localized_tz in tz._tzinfos.values(): if (localized_tz._utcoffset == utcoffset and localized_tz._dst == dstoffset): return localized_tz # This (utcoffset, dstoffset) information has been removed from the # zone. Add it back. This might occur when the database maintainers have # corrected incorrect information. datetime instances using this # incorrect information will continue to do so, exactly as they were # before being pickled. This is purely an overly paranoid safety net - I # doubt this will ever been needed in real life. inf = (utcoffset, dstoffset, tzname) tz._tzinfos[inf] = tz.__class__(inf, tz._tzinfos) return tz._tzinfos[inf]
19,272
32.344291
78
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/pytz/lazy.py
from threading import RLock try: from collections.abc import Mapping as DictMixin except ImportError: # Python < 3.3 try: from UserDict import DictMixin # Python 2 except ImportError: # Python 3.0-3.3 from collections import Mapping as DictMixin # With lazy loading, we might end up with multiple threads triggering # it at the same time. We need a lock. _fill_lock = RLock() class LazyDict(DictMixin): """Dictionary populated on first use.""" data = None def __getitem__(self, key): if self.data is None: _fill_lock.acquire() try: if self.data is None: self._fill() finally: _fill_lock.release() return self.data[key.upper()] def __contains__(self, key): if self.data is None: _fill_lock.acquire() try: if self.data is None: self._fill() finally: _fill_lock.release() return key in self.data def __iter__(self): if self.data is None: _fill_lock.acquire() try: if self.data is None: self._fill() finally: _fill_lock.release() return iter(self.data) def __len__(self): if self.data is None: _fill_lock.acquire() try: if self.data is None: self._fill() finally: _fill_lock.release() return len(self.data) def keys(self): if self.data is None: _fill_lock.acquire() try: if self.data is None: self._fill() finally: _fill_lock.release() return self.data.keys() class LazyList(list): """List populated on first use.""" _props = [ '__str__', '__repr__', '__unicode__', '__hash__', '__sizeof__', '__cmp__', '__lt__', '__le__', '__eq__', '__ne__', '__gt__', '__ge__', 'append', 'count', 'index', 'extend', 'insert', 'pop', 'remove', 'reverse', 'sort', '__add__', '__radd__', '__iadd__', '__mul__', '__rmul__', '__imul__', '__contains__', '__len__', '__nonzero__', '__getitem__', '__setitem__', '__delitem__', '__iter__', '__reversed__', '__getslice__', '__setslice__', '__delslice__'] def __new__(cls, fill_iter=None): if fill_iter is None: return list() # We need a new class as we will be dynamically messing with its # methods. class LazyList(list): pass fill_iter = [fill_iter] def lazy(name): def _lazy(self, *args, **kw): _fill_lock.acquire() try: if len(fill_iter) > 0: list.extend(self, fill_iter.pop()) for method_name in cls._props: delattr(LazyList, method_name) finally: _fill_lock.release() return getattr(list, name)(self, *args, **kw) return _lazy for name in cls._props: setattr(LazyList, name, lazy(name)) new_list = LazyList() return new_list # Not all versions of Python declare the same magic methods. # Filter out properties that don't exist in this version of Python # from the list. LazyList._props = [prop for prop in LazyList._props if hasattr(list, prop)] class LazySet(set): """Set populated on first use.""" _props = ( '__str__', '__repr__', '__unicode__', '__hash__', '__sizeof__', '__cmp__', '__lt__', '__le__', '__eq__', '__ne__', '__gt__', '__ge__', '__contains__', '__len__', '__nonzero__', '__getitem__', '__setitem__', '__delitem__', '__iter__', '__sub__', '__and__', '__xor__', '__or__', '__rsub__', '__rand__', '__rxor__', '__ror__', '__isub__', '__iand__', '__ixor__', '__ior__', 'add', 'clear', 'copy', 'difference', 'difference_update', 'discard', 'intersection', 'intersection_update', 'isdisjoint', 'issubset', 'issuperset', 'pop', 'remove', 'symmetric_difference', 'symmetric_difference_update', 'union', 'update') def __new__(cls, fill_iter=None): if fill_iter is None: return set() class LazySet(set): pass fill_iter = [fill_iter] def lazy(name): def _lazy(self, *args, **kw): _fill_lock.acquire() try: if len(fill_iter) > 0: for i in fill_iter.pop(): set.add(self, i) for method_name in cls._props: delattr(LazySet, method_name) finally: _fill_lock.release() return getattr(set, name)(self, *args, **kw) return _lazy for name in cls._props: setattr(LazySet, name, lazy(name)) new_set = LazySet() return new_set # Not all versions of Python declare the same magic methods. # Filter out properties that don't exist in this version of Python # from the list. LazySet._props = [prop for prop in LazySet._props if hasattr(set, prop)]
5,404
30.242775
75
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/pytz/reference.py
''' Reference tzinfo implementations from the Python docs. Used for testing against as they are only correct for the years 1987 to 2006. Do not use these for real code. ''' from datetime import tzinfo, timedelta, datetime from pytz import HOUR, ZERO, UTC __all__ = [ 'FixedOffset', 'LocalTimezone', 'USTimeZone', 'Eastern', 'Central', 'Mountain', 'Pacific', 'UTC' ] # A class building tzinfo objects for fixed-offset time zones. # Note that FixedOffset(0, "UTC") is a different way to build a # UTC tzinfo object. class FixedOffset(tzinfo): """Fixed offset in minutes east from UTC.""" def __init__(self, offset, name): self.__offset = timedelta(minutes=offset) self.__name = name def utcoffset(self, dt): return self.__offset def tzname(self, dt): return self.__name def dst(self, dt): return ZERO import time as _time STDOFFSET = timedelta(seconds=-_time.timezone) if _time.daylight: DSTOFFSET = timedelta(seconds=-_time.altzone) else: DSTOFFSET = STDOFFSET DSTDIFF = DSTOFFSET - STDOFFSET # A class capturing the platform's idea of local time. class LocalTimezone(tzinfo): def utcoffset(self, dt): if self._isdst(dt): return DSTOFFSET else: return STDOFFSET def dst(self, dt): if self._isdst(dt): return DSTDIFF else: return ZERO def tzname(self, dt): return _time.tzname[self._isdst(dt)] def _isdst(self, dt): tt = (dt.year, dt.month, dt.day, dt.hour, dt.minute, dt.second, dt.weekday(), 0, -1) stamp = _time.mktime(tt) tt = _time.localtime(stamp) return tt.tm_isdst > 0 Local = LocalTimezone() def first_sunday_on_or_after(dt): days_to_go = 6 - dt.weekday() if days_to_go: dt += timedelta(days_to_go) return dt # In the US, DST starts at 2am (standard time) on the first Sunday in April. DSTSTART = datetime(1, 4, 1, 2) # and ends at 2am (DST time; 1am standard time) on the last Sunday of Oct. # which is the first Sunday on or after Oct 25. DSTEND = datetime(1, 10, 25, 1) # A complete implementation of current DST rules for major US time zones. class USTimeZone(tzinfo): def __init__(self, hours, reprname, stdname, dstname): self.stdoffset = timedelta(hours=hours) self.reprname = reprname self.stdname = stdname self.dstname = dstname def __repr__(self): return self.reprname def tzname(self, dt): if self.dst(dt): return self.dstname else: return self.stdname def utcoffset(self, dt): return self.stdoffset + self.dst(dt) def dst(self, dt): if dt is None or dt.tzinfo is None: # An exception may be sensible here, in one or both cases. # It depends on how you want to treat them. The default # fromutc() implementation (called by the default astimezone() # implementation) passes a datetime with dt.tzinfo is self. return ZERO assert dt.tzinfo is self # Find first Sunday in April & the last in October. start = first_sunday_on_or_after(DSTSTART.replace(year=dt.year)) end = first_sunday_on_or_after(DSTEND.replace(year=dt.year)) # Can't compare naive to aware objects, so strip the timezone from # dt first. if start <= dt.replace(tzinfo=None) < end: return HOUR else: return ZERO Eastern = USTimeZone(-5, "Eastern", "EST", "EDT") Central = USTimeZone(-6, "Central", "CST", "CDT") Mountain = USTimeZone(-7, "Mountain", "MST", "MDT") Pacific = USTimeZone(-8, "Pacific", "PST", "PDT")
3,778
25.801418
76
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/past/__init__.py
# coding=utf-8 """ past: compatibility with Python 2 from Python 3 =============================================== ``past`` is a package to aid with Python 2/3 compatibility. Whereas ``future`` contains backports of Python 3 constructs to Python 2, ``past`` provides implementations of some Python 2 constructs in Python 3 and tools to import and run Python 2 code in Python 3. It is intended to be used sparingly, as a way of running old Python 2 code from Python 3 until the code is ported properly. Potential uses for libraries: - as a step in porting a Python 2 codebase to Python 3 (e.g. with the ``futurize`` script) - to provide Python 3 support for previously Python 2-only libraries with the same APIs as on Python 2 -- particularly with regard to 8-bit strings (the ``past.builtins.str`` type). - to aid in providing minimal-effort Python 3 support for applications using libraries that do not yet wish to upgrade their code properly to Python 3, or wish to upgrade it gradually to Python 3 style. Here are some code examples that run identically on Python 3 and 2:: >>> from past.builtins import str as oldstr >>> philosopher = oldstr(u'\u5b54\u5b50'.encode('utf-8')) >>> # This now behaves like a Py2 byte-string on both Py2 and Py3. >>> # For example, indexing returns a Python 2-like string object, not >>> # an integer: >>> philosopher[0] '\xe5' >>> type(philosopher[0]) <past.builtins.oldstr> >>> # List-producing versions of range, reduce, map, filter >>> from past.builtins import range, reduce >>> range(10) [0, 1, 2, 3, 4, 5, 6, 7, 8, 9] >>> reduce(lambda x, y: x+y, [1, 2, 3, 4, 5]) 15 >>> # Other functions removed in Python 3 are resurrected ... >>> from past.builtins import execfile >>> execfile('myfile.py') >>> from past.builtins import raw_input >>> name = raw_input('What is your name? ') What is your name? [cursor] >>> from past.builtins import reload >>> reload(mymodule) # equivalent to imp.reload(mymodule) in Python 3 >>> from past.builtins import xrange >>> for i in xrange(10): ... pass It also provides import hooks so you can import and use Python 2 modules like this:: $ python3 >>> from past import autotranslate >>> authotranslate('mypy2module') >>> import mypy2module until the authors of the Python 2 modules have upgraded their code. Then, for example:: >>> mypy2module.func_taking_py2_string(oldstr(b'abcd')) Credits ------- :Author: Ed Schofield :Sponsor: Python Charmers Pty Ltd, Australia: http://pythoncharmers.com Licensing --------- Copyright 2013-2016 Python Charmers Pty Ltd, Australia. The software is distributed under an MIT licence. See LICENSE.txt. """ from past.translation import install_hooks as autotranslate from future import __version__, __copyright__, __license__ __title__ = 'past' __author__ = 'Ed Schofield'
2,948
30.37234
90
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/past/builtins/noniterators.py
""" This module is designed to be used as follows:: from past.builtins.noniterators import filter, map, range, reduce, zip And then, for example:: assert isinstance(range(5), list) The list-producing functions this brings in are:: - ``filter`` - ``map`` - ``range`` - ``reduce`` - ``zip`` """ from __future__ import division, absolute_import, print_function from itertools import chain, starmap import itertools # since zip_longest doesn't exist on Py2 from past.types import basestring from past.utils import PY3 def flatmap(f, items): return chain.from_iterable(map(f, items)) if PY3: import builtins # list-producing versions of the major Python iterating functions def oldfilter(*args): """ filter(function or None, sequence) -> list, tuple, or string Return those items of sequence for which function(item) is true. If function is None, return the items that are true. If sequence is a tuple or string, return the same type, else return a list. """ mytype = type(args[1]) if isinstance(args[1], basestring): return mytype().join(builtins.filter(*args)) elif isinstance(args[1], (tuple, list)): return mytype(builtins.filter(*args)) else: # Fall back to list. Is this the right thing to do? return list(builtins.filter(*args)) # This is surprisingly difficult to get right. For example, the # solutions here fail with the test cases in the docstring below: # http://stackoverflow.com/questions/8072755/ def oldmap(func, *iterables): """ map(function, sequence[, sequence, ...]) -> list Return a list of the results of applying the function to the items of the argument sequence(s). If more than one sequence is given, the function is called with an argument list consisting of the corresponding item of each sequence, substituting None for missing values when not all sequences have the same length. If the function is None, return a list of the items of the sequence (or a list of tuples if more than one sequence). Test cases: >>> oldmap(None, 'hello world') ['h', 'e', 'l', 'l', 'o', ' ', 'w', 'o', 'r', 'l', 'd'] >>> oldmap(None, range(4)) [0, 1, 2, 3] More test cases are in past.tests.test_builtins. """ zipped = itertools.zip_longest(*iterables) l = list(zipped) if len(l) == 0: return [] if func is None: result = l else: result = list(starmap(func, l)) # Inspect to see whether it's a simple sequence of tuples try: if max([len(item) for item in result]) == 1: return list(chain.from_iterable(result)) # return list(flatmap(func, result)) except TypeError as e: # Simple objects like ints have no len() pass return result ############################ ### For reference, the source code for Py2.7 map function: # static PyObject * # builtin_map(PyObject *self, PyObject *args) # { # typedef struct { # PyObject *it; /* the iterator object */ # int saw_StopIteration; /* bool: did the iterator end? */ # } sequence; # # PyObject *func, *result; # sequence *seqs = NULL, *sqp; # Py_ssize_t n, len; # register int i, j; # # n = PyTuple_Size(args); # if (n < 2) { # PyErr_SetString(PyExc_TypeError, # "map() requires at least two args"); # return NULL; # } # # func = PyTuple_GetItem(args, 0); # n--; # # if (func == Py_None) { # if (PyErr_WarnPy3k("map(None, ...) not supported in 3.x; " # "use list(...)", 1) < 0) # return NULL; # if (n == 1) { # /* map(None, S) is the same as list(S). */ # return PySequence_List(PyTuple_GetItem(args, 1)); # } # } # # /* Get space for sequence descriptors. Must NULL out the iterator # * pointers so that jumping to Fail_2 later doesn't see trash. # */ # if ((seqs = PyMem_NEW(sequence, n)) == NULL) { # PyErr_NoMemory(); # return NULL; # } # for (i = 0; i < n; ++i) { # seqs[i].it = (PyObject*)NULL; # seqs[i].saw_StopIteration = 0; # } # # /* Do a first pass to obtain iterators for the arguments, and set len # * to the largest of their lengths. # */ # len = 0; # for (i = 0, sqp = seqs; i < n; ++i, ++sqp) { # PyObject *curseq; # Py_ssize_t curlen; # # /* Get iterator. */ # curseq = PyTuple_GetItem(args, i+1); # sqp->it = PyObject_GetIter(curseq); # if (sqp->it == NULL) { # static char errmsg[] = # "argument %d to map() must support iteration"; # char errbuf[sizeof(errmsg) + 25]; # PyOS_snprintf(errbuf, sizeof(errbuf), errmsg, i+2); # PyErr_SetString(PyExc_TypeError, errbuf); # goto Fail_2; # } # # /* Update len. */ # curlen = _PyObject_LengthHint(curseq, 8); # if (curlen > len) # len = curlen; # } # # /* Get space for the result list. */ # if ((result = (PyObject *) PyList_New(len)) == NULL) # goto Fail_2; # # /* Iterate over the sequences until all have stopped. */ # for (i = 0; ; ++i) { # PyObject *alist, *item=NULL, *value; # int numactive = 0; # # if (func == Py_None && n == 1) # alist = NULL; # else if ((alist = PyTuple_New(n)) == NULL) # goto Fail_1; # # for (j = 0, sqp = seqs; j < n; ++j, ++sqp) { # if (sqp->saw_StopIteration) { # Py_INCREF(Py_None); # item = Py_None; # } # else { # item = PyIter_Next(sqp->it); # if (item) # ++numactive; # else { # if (PyErr_Occurred()) { # Py_XDECREF(alist); # goto Fail_1; # } # Py_INCREF(Py_None); # item = Py_None; # sqp->saw_StopIteration = 1; # } # } # if (alist) # PyTuple_SET_ITEM(alist, j, item); # else # break; # } # # if (!alist) # alist = item; # # if (numactive == 0) { # Py_DECREF(alist); # break; # } # # if (func == Py_None) # value = alist; # else { # value = PyEval_CallObject(func, alist); # Py_DECREF(alist); # if (value == NULL) # goto Fail_1; # } # if (i >= len) { # int status = PyList_Append(result, value); # Py_DECREF(value); # if (status < 0) # goto Fail_1; # } # else if (PyList_SetItem(result, i, value) < 0) # goto Fail_1; # } # # if (i < len && PyList_SetSlice(result, i, len, NULL) < 0) # goto Fail_1; # # goto Succeed; # # Fail_1: # Py_DECREF(result); # Fail_2: # result = NULL; # Succeed: # assert(seqs); # for (i = 0; i < n; ++i) # Py_XDECREF(seqs[i].it); # PyMem_DEL(seqs); # return result; # } def oldrange(*args, **kwargs): return list(builtins.range(*args, **kwargs)) def oldzip(*args, **kwargs): return list(builtins.zip(*args, **kwargs)) filter = oldfilter map = oldmap range = oldrange from functools import reduce zip = oldzip __all__ = ['filter', 'map', 'range', 'reduce', 'zip'] else: import __builtin__ # Python 2-builtin ranges produce lists filter = __builtin__.filter map = __builtin__.map range = __builtin__.range reduce = __builtin__.reduce zip = __builtin__.zip __all__ = []
9,422
33.390511
83
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/past/builtins/misc.py
from __future__ import unicode_literals import sys import inspect from collections import Mapping from future.utils import PY3, exec_ if PY3: import builtins def apply(f, *args, **kw): return f(*args, **kw) from past.builtins import str as oldstr def chr(i): """ Return a byte-string of one character with ordinal i; 0 <= i <= 256 """ return oldstr(bytes((i,))) def cmp(x, y): """ cmp(x, y) -> integer Return negative if x<y, zero if x==y, positive if x>y. """ return (x > y) - (x < y) from sys import intern def oct(number): """oct(number) -> string Return the octal representation of an integer """ return '0' + builtins.oct(number)[2:] raw_input = input from imp import reload unicode = str unichr = chr xrange = range else: import __builtin__ apply = __builtin__.apply chr = __builtin__.chr cmp = __builtin__.cmp execfile = __builtin__.execfile intern = __builtin__.intern oct = __builtin__.oct raw_input = __builtin__.raw_input reload = __builtin__.reload unicode = __builtin__.unicode unichr = __builtin__.unichr xrange = __builtin__.xrange if PY3: def execfile(filename, myglobals=None, mylocals=None): """ Read and execute a Python script from a file in the given namespaces. The globals and locals are dictionaries, defaulting to the current globals and locals. If only globals is given, locals defaults to it. """ if myglobals is None: # There seems to be no alternative to frame hacking here. caller_frame = inspect.stack()[1] myglobals = caller_frame[0].f_globals mylocals = caller_frame[0].f_locals elif mylocals is None: # Only if myglobals is given do we set mylocals to it. mylocals = myglobals if not isinstance(myglobals, Mapping): raise TypeError('globals must be a mapping') if not isinstance(mylocals, Mapping): raise TypeError('locals must be a mapping') with open(filename, "rbU") as fin: source = fin.read() code = compile(source, filename, "exec") exec_(code, myglobals, mylocals) if PY3: __all__ = ['apply', 'chr', 'cmp', 'execfile', 'intern', 'raw_input', 'reload', 'unichr', 'unicode', 'xrange'] else: __all__ = []
2,500
26.483516
77
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/past/builtins/__init__.py
""" A resurrection of some old functions from Python 2 for use in Python 3. These should be used sparingly, to help with porting efforts, since code using them is no longer standard Python 3 code. This module provides the following: 1. Implementations of these builtin functions which have no equivalent on Py3: - apply - chr - cmp - execfile 2. Aliases: - intern <- sys.intern - raw_input <- input - reduce <- functools.reduce - reload <- imp.reload - unichr <- chr - unicode <- str - xrange <- range 3. List-producing versions of the corresponding Python 3 iterator-producing functions: - filter - map - range - zip 4. Forward-ported Py2 types: - basestring - dict - str - long - unicode """ from future.utils import PY3 from past.builtins.noniterators import (filter, map, range, reduce, zip) # from past.builtins.misc import (ascii, hex, input, oct, open) if PY3: from past.types import (basestring, olddict as dict, oldstr as str, long, unicode) else: from __builtin__ import (basestring, dict, str, long, unicode) from past.builtins.misc import (apply, chr, cmp, execfile, intern, oct, raw_input, reload, unichr, unicode, xrange) from past import utils if utils.PY3: # We only import names that shadow the builtins on Py3. No other namespace # pollution on Py3. # Only shadow builtins on Py3; no new names __all__ = ['filter', 'map', 'range', 'reduce', 'zip', 'basestring', 'dict', 'str', 'long', 'unicode', 'apply', 'chr', 'cmp', 'execfile', 'intern', 'raw_input', 'reload', 'unichr', 'xrange' ] else: # No namespace pollution on Py2 __all__ = []
1,810
23.808219
86
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/past/tests/__init__.py
0
0
0
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/past/types/oldstr.py
""" Pure-Python implementation of a Python 2-like str object for Python 3. """ from collections import Iterable from numbers import Integral from past.utils import PY2, with_metaclass _builtin_bytes = bytes class BaseOldStr(type): def __instancecheck__(cls, instance): return isinstance(instance, _builtin_bytes) def unescape(s): """ Interprets strings with escape sequences Example: >>> s = unescape(r'abc\\def') # i.e. 'abc\\\\def' >>> print(s) 'abc\def' >>> s2 = unescape('abc\\ndef') >>> len(s2) 8 >>> print(s2) abc def """ return s.encode().decode('unicode_escape') class oldstr(with_metaclass(BaseOldStr, _builtin_bytes)): """ A forward port of the Python 2 8-bit string object to Py3 """ # Python 2 strings have no __iter__ method: @property def __iter__(self): raise AttributeError def __dir__(self): return [thing for thing in dir(_builtin_bytes) if thing != '__iter__'] # def __new__(cls, *args, **kwargs): # """ # From the Py3 bytes docstring: # bytes(iterable_of_ints) -> bytes # bytes(string, encoding[, errors]) -> bytes # bytes(bytes_or_buffer) -> immutable copy of bytes_or_buffer # bytes(int) -> bytes object of size given by the parameter initialized with null bytes # bytes() -> empty bytes object # # Construct an immutable array of bytes from: # - an iterable yielding integers in range(256) # - a text string encoded using the specified encoding # - any object implementing the buffer API. # - an integer # """ # # if len(args) == 0: # return super(newbytes, cls).__new__(cls) # # Was: elif isinstance(args[0], newbytes): # # We use type() instead of the above because we're redefining # # this to be True for all unicode string subclasses. Warning: # # This may render newstr un-subclassable. # elif type(args[0]) == newbytes: # return args[0] # elif isinstance(args[0], _builtin_bytes): # value = args[0] # elif isinstance(args[0], unicode): # if 'encoding' not in kwargs: # raise TypeError('unicode string argument without an encoding') # ### # # Was: value = args[0].encode(**kwargs) # # Python 2.6 string encode() method doesn't take kwargs: # # Use this instead: # newargs = [kwargs['encoding']] # if 'errors' in kwargs: # newargs.append(kwargs['errors']) # value = args[0].encode(*newargs) # ### # elif isinstance(args[0], Iterable): # if len(args[0]) == 0: # # What is this? # raise ValueError('unknown argument type') # elif len(args[0]) > 0 and isinstance(args[0][0], Integral): # # It's a list of integers # value = b''.join([chr(x) for x in args[0]]) # else: # raise ValueError('item cannot be interpreted as an integer') # elif isinstance(args[0], Integral): # if args[0] < 0: # raise ValueError('negative count') # value = b'\x00' * args[0] # else: # value = args[0] # return super(newbytes, cls).__new__(cls, value) def __repr__(self): s = super(oldstr, self).__repr__() # e.g. b'abc' on Py3, b'abc' on Py3 return s[1:] def __str__(self): s = super(oldstr, self).__str__() # e.g. "b'abc'" or "b'abc\\ndef' # TODO: fix this: assert s[:2] == "b'" and s[-1] == "'" return unescape(s[2:-1]) # e.g. 'abc' or 'abc\ndef' def __getitem__(self, y): if isinstance(y, Integral): return super(oldstr, self).__getitem__(slice(y, y+1)) else: return super(oldstr, self).__getitem__(y) def __getslice__(self, *args): return self.__getitem__(slice(*args)) def __contains__(self, key): if isinstance(key, int): return False def __native__(self): return bytes(self) __all__ = ['oldstr']
4,300
31.338346
95
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/past/types/olddict.py
""" A dict subclass for Python 3 that behaves like Python 2's dict Example use: >>> from past.builtins import dict >>> d1 = dict() # instead of {} for an empty dict >>> d2 = dict(key1='value1', key2='value2') The keys, values and items methods now return lists on Python 3.x and there are methods for iterkeys, itervalues, iteritems, and viewkeys etc. >>> for d in (d1, d2): ... assert isinstance(d.keys(), list) ... assert isinstance(d.values(), list) ... assert isinstance(d.items(), list) """ import sys from past.utils import with_metaclass _builtin_dict = dict ver = sys.version_info[:2] class BaseOldDict(type): def __instancecheck__(cls, instance): return isinstance(instance, _builtin_dict) class olddict(with_metaclass(BaseOldDict, _builtin_dict)): """ A backport of the Python 3 dict object to Py2 """ iterkeys = _builtin_dict.keys viewkeys = _builtin_dict.keys def keys(self): return list(super(olddict, self).keys()) itervalues = _builtin_dict.values viewvalues = _builtin_dict.values def values(self): return list(super(olddict, self).values()) iteritems = _builtin_dict.items viewitems = _builtin_dict.items def items(self): return list(super(olddict, self).items()) def has_key(self, k): """ D.has_key(k) -> True if D has a key k, else False """ return k in self # def __new__(cls, *args, **kwargs): # """ # dict() -> new empty dictionary # dict(mapping) -> new dictionary initialized from a mapping object's # (key, value) pairs # dict(iterable) -> new dictionary initialized as if via: # d = {} # for k, v in iterable: # d[k] = v # dict(**kwargs) -> new dictionary initialized with the name=value pairs # in the keyword argument list. For example: dict(one=1, two=2) # """ # # if len(args) == 0: # return super(olddict, cls).__new__(cls) # # Was: elif isinstance(args[0], newbytes): # # We use type() instead of the above because we're redefining # # this to be True for all unicode string subclasses. Warning: # # This may render newstr un-subclassable. # elif type(args[0]) == olddict: # return args[0] # # elif isinstance(args[0], _builtin_dict): # # value = args[0] # else: # value = args[0] # return super(olddict, cls).__new__(cls, value) def __native__(self): """ Hook for the past.utils.native() function """ return super(oldbytes, self) __all__ = ['olddict']
2,735
26.918367
80
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/past/types/__init__.py
""" Forward-ports of types from Python 2 for use with Python 3: - ``basestring``: equivalent to ``(str, bytes)`` in ``isinstance`` checks - ``dict``: with list-producing .keys() etc. methods - ``str``: bytes-like, but iterating over them doesn't product integers - ``long``: alias of Py3 int with ``L`` suffix in the ``repr`` - ``unicode``: alias of Py3 str with ``u`` prefix in the ``repr`` """ from past import utils if utils.PY2: import __builtin__ basestring = __builtin__.basestring dict = __builtin__.dict str = __builtin__.str long = __builtin__.long unicode = __builtin__.unicode __all__ = [] else: from .basestring import basestring from .olddict import olddict from .oldstr import oldstr long = int unicode = str # from .unicode import unicode __all__ = ['basestring', 'olddict', 'oldstr', 'long', 'unicode']
880
27.419355
73
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/past/types/basestring.py
""" An implementation of the basestring type for Python 3 Example use: >>> s = b'abc' >>> assert isinstance(s, basestring) >>> from past.types import str as oldstr >>> s2 = oldstr(b'abc') >>> assert isinstance(s2, basestring) """ import sys from past.utils import with_metaclass, PY2 if PY2: str = unicode ver = sys.version_info[:2] class BaseBaseString(type): def __instancecheck__(cls, instance): return isinstance(instance, (bytes, str)) def __subclasshook__(cls, thing): # TODO: What should go here? raise NotImplemented class basestring(with_metaclass(BaseBaseString)): """ A minimal backport of the Python 2 basestring type to Py3 """ __all__ = ['basestring']
729
16.804878
61
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/past/utils/__init__.py
""" Various non-built-in utility functions and definitions for Py2 compatibility in Py3. For example: >>> # The old_div() function behaves like Python 2's / operator >>> # without "from __future__ import division" >>> from past.utils import old_div >>> old_div(3, 2) # like 3/2 in Py2 0 >>> old_div(3, 2.0) # like 3/2.0 in Py2 1.5 """ import sys import numbers PY3 = sys.version_info[0] == 3 PY2 = sys.version_info[0] == 2 PYPY = hasattr(sys, 'pypy_translation_info') def with_metaclass(meta, *bases): """ Function from jinja2/_compat.py. License: BSD. Use it like this:: class BaseForm(object): pass class FormType(type): pass class Form(with_metaclass(FormType, BaseForm)): pass This requires a bit of explanation: the basic idea is to make a dummy metaclass for one level of class instantiation that replaces itself with the actual metaclass. Because of internal type checks we also need to make sure that we downgrade the custom metaclass for one level to something closer to type (that's why __call__ and __init__ comes back from type etc.). This has the advantage over six.with_metaclass of not introducing dummy classes into the final MRO. """ class metaclass(meta): __call__ = type.__call__ __init__ = type.__init__ def __new__(cls, name, this_bases, d): if this_bases is None: return type.__new__(cls, name, (), d) return meta(name, bases, d) return metaclass('temporary_class', None, {}) def native(obj): """ On Py2, this is a no-op: native(obj) -> obj On Py3, returns the corresponding native Py3 types that are superclasses for forward-ported objects from Py2: >>> from past.builtins import str, dict >>> native(str(b'ABC')) # Output on Py3 follows. On Py2, output is 'ABC' b'ABC' >>> type(native(str(b'ABC'))) bytes Existing native types on Py3 will be returned unchanged: >>> type(native(b'ABC')) bytes """ if hasattr(obj, '__native__'): return obj.__native__() else: return obj # An alias for future.utils.old_div(): def old_div(a, b): """ Equivalent to ``a / b`` on Python 2 without ``from __future__ import division``. TODO: generalize this to other objects (like arrays etc.) """ if isinstance(a, numbers.Integral) and isinstance(b, numbers.Integral): return a // b else: return a / b __all__ = ['PY3', 'PY2', 'PYPY', 'with_metaclass', 'native', 'old_div']
2,665
26.204082
78
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/past/translation/__init__.py
# -*- coding: utf-8 -*- """ past.translation ================== The ``past.translation`` package provides an import hook for Python 3 which transparently runs ``futurize`` fixers over Python 2 code on import to convert print statements into functions, etc. It is intended to assist users in migrating to Python 3.x even if some dependencies still only support Python 2.x. Usage ----- Once your Py2 package is installed in the usual module search path, the import hook is invoked as follows: >>> from past import autotranslate >>> autotranslate('mypackagename') Or: >>> autotranslate(['mypackage1', 'mypackage2']) You can unregister the hook using:: >>> from past.translation import remove_hooks >>> remove_hooks() Author: Ed Schofield. Inspired by and based on ``uprefix`` by Vinay M. Sajip. """ import imp import logging import marshal import os import sys import copy from lib2to3.pgen2.parse import ParseError from lib2to3.refactor import RefactoringTool from libfuturize import fixes logger = logging.getLogger(__name__) logger.setLevel(logging.DEBUG) myfixes = (list(fixes.libfuturize_fix_names_stage1) + list(fixes.lib2to3_fix_names_stage1) + list(fixes.libfuturize_fix_names_stage2) + list(fixes.lib2to3_fix_names_stage2)) # We detect whether the code is Py2 or Py3 by applying certain lib2to3 fixers # to it. If the diff is empty, it's Python 3 code. py2_detect_fixers = [ # From stage 1: 'lib2to3.fixes.fix_apply', # 'lib2to3.fixes.fix_dict', # TODO: add support for utils.viewitems() etc. and move to stage2 'lib2to3.fixes.fix_except', 'lib2to3.fixes.fix_execfile', 'lib2to3.fixes.fix_exitfunc', 'lib2to3.fixes.fix_funcattrs', 'lib2to3.fixes.fix_filter', 'lib2to3.fixes.fix_has_key', 'lib2to3.fixes.fix_idioms', 'lib2to3.fixes.fix_import', # makes any implicit relative imports explicit. (Use with ``from __future__ import absolute_import) 'lib2to3.fixes.fix_intern', 'lib2to3.fixes.fix_isinstance', 'lib2to3.fixes.fix_methodattrs', 'lib2to3.fixes.fix_ne', 'lib2to3.fixes.fix_numliterals', # turns 1L into 1, 0755 into 0o755 'lib2to3.fixes.fix_paren', 'lib2to3.fixes.fix_print', 'lib2to3.fixes.fix_raise', # uses incompatible with_traceback() method on exceptions 'lib2to3.fixes.fix_renames', 'lib2to3.fixes.fix_reduce', # 'lib2to3.fixes.fix_set_literal', # this is unnecessary and breaks Py2.6 support 'lib2to3.fixes.fix_repr', 'lib2to3.fixes.fix_standarderror', 'lib2to3.fixes.fix_sys_exc', 'lib2to3.fixes.fix_throw', 'lib2to3.fixes.fix_tuple_params', 'lib2to3.fixes.fix_types', 'lib2to3.fixes.fix_ws_comma', 'lib2to3.fixes.fix_xreadlines', # From stage 2: 'lib2to3.fixes.fix_basestring', # 'lib2to3.fixes.fix_buffer', # perhaps not safe. Test this. # 'lib2to3.fixes.fix_callable', # not needed in Py3.2+ # 'lib2to3.fixes.fix_dict', # TODO: add support for utils.viewitems() etc. 'lib2to3.fixes.fix_exec', # 'lib2to3.fixes.fix_future', # we don't want to remove __future__ imports 'lib2to3.fixes.fix_getcwdu', # 'lib2to3.fixes.fix_imports', # called by libfuturize.fixes.fix_future_standard_library # 'lib2to3.fixes.fix_imports2', # we don't handle this yet (dbm) # 'lib2to3.fixes.fix_input', # 'lib2to3.fixes.fix_itertools', # 'lib2to3.fixes.fix_itertools_imports', 'lib2to3.fixes.fix_long', # 'lib2to3.fixes.fix_map', # 'lib2to3.fixes.fix_metaclass', # causes SyntaxError in Py2! Use the one from ``six`` instead 'lib2to3.fixes.fix_next', 'lib2to3.fixes.fix_nonzero', # TODO: add a decorator for mapping __bool__ to __nonzero__ # 'lib2to3.fixes.fix_operator', # we will need support for this by e.g. extending the Py2 operator module to provide those functions in Py3 'lib2to3.fixes.fix_raw_input', # 'lib2to3.fixes.fix_unicode', # strips off the u'' prefix, which removes a potentially helpful source of information for disambiguating unicode/byte strings # 'lib2to3.fixes.fix_urllib', 'lib2to3.fixes.fix_xrange', # 'lib2to3.fixes.fix_zip', ] class RTs: """ A namespace for the refactoring tools. This avoids creating these at the module level, which slows down the module import. (See issue #117). There are two possible grammars: with or without the print statement. Hence we have two possible refactoring tool implementations. """ _rt = None _rtp = None _rt_py2_detect = None _rtp_py2_detect = None @staticmethod def setup(): """ Call this before using the refactoring tools to create them on demand if needed. """ if None in [RTs._rt, RTs._rtp]: RTs._rt = RefactoringTool(myfixes) RTs._rtp = RefactoringTool(myfixes, {'print_function': True}) @staticmethod def setup_detect_python2(): """ Call this before using the refactoring tools to create them on demand if needed. """ if None in [RTs._rt_py2_detect, RTs._rtp_py2_detect]: RTs._rt_py2_detect = RefactoringTool(py2_detect_fixers) RTs._rtp_py2_detect = RefactoringTool(py2_detect_fixers, {'print_function': True}) # We need to find a prefix for the standard library, as we don't want to # process any files there (they will already be Python 3). # # The following method is used by Sanjay Vinip in uprefix. This fails for # ``conda`` environments: # # In a non-pythonv virtualenv, sys.real_prefix points to the installed Python. # # In a pythonv venv, sys.base_prefix points to the installed Python. # # Outside a virtual environment, sys.prefix points to the installed Python. # if hasattr(sys, 'real_prefix'): # _syslibprefix = sys.real_prefix # else: # _syslibprefix = getattr(sys, 'base_prefix', sys.prefix) # Instead, we use the portion of the path common to both the stdlib modules # ``math`` and ``urllib``. def splitall(path): """ Split a path into all components. From Python Cookbook. """ allparts = [] while True: parts = os.path.split(path) if parts[0] == path: # sentinel for absolute paths allparts.insert(0, parts[0]) break elif parts[1] == path: # sentinel for relative paths allparts.insert(0, parts[1]) break else: path = parts[0] allparts.insert(0, parts[1]) return allparts def common_substring(s1, s2): """ Returns the longest common substring to the two strings, starting from the left. """ chunks = [] path1 = splitall(s1) path2 = splitall(s2) for (dir1, dir2) in zip(path1, path2): if dir1 != dir2: break chunks.append(dir1) return os.path.join(*chunks) # _stdlibprefix = common_substring(math.__file__, urllib.__file__) def detect_python2(source, pathname): """ Returns a bool indicating whether we think the code is Py2 """ RTs.setup_detect_python2() try: tree = RTs._rt_py2_detect.refactor_string(source, pathname) except ParseError as e: if e.msg != 'bad input' or e.value != '=': raise tree = RTs._rtp.refactor_string(source, pathname) if source != str(tree)[:-1]: # remove added newline # The above fixers made changes, so we conclude it's Python 2 code logger.debug('Detected Python 2 code: {0}'.format(pathname)) with open('/tmp/original_code.py', 'w') as f: f.write('### Original code (detected as py2): %s\n%s' % (pathname, source)) with open('/tmp/py2_detection_code.py', 'w') as f: f.write('### Code after running py3 detection (from %s)\n%s' % (pathname, str(tree)[:-1])) return True else: logger.debug('Detected Python 3 code: {0}'.format(pathname)) with open('/tmp/original_code.py', 'w') as f: f.write('### Original code (detected as py3): %s\n%s' % (pathname, source)) try: os.remove('/tmp/futurize_code.py') except OSError: pass return False class Py2Fixer(object): """ An import hook class that uses lib2to3 for source-to-source translation of Py2 code to Py3. """ # See the comments on :class:future.standard_library.RenameImport. # We add this attribute here so remove_hooks() and install_hooks() can # unambiguously detect whether the import hook is installed: PY2FIXER = True def __init__(self): self.found = None self.base_exclude_paths = ['future', 'past'] self.exclude_paths = copy.copy(self.base_exclude_paths) self.include_paths = [] def include(self, paths): """ Pass in a sequence of module names such as 'plotrique.plotting' that, if present at the leftmost side of the full package name, would specify the module to be transformed from Py2 to Py3. """ self.include_paths += paths def exclude(self, paths): """ Pass in a sequence of strings such as 'mymodule' that, if present at the leftmost side of the full package name, would cause the module not to undergo any source transformation. """ self.exclude_paths += paths def find_module(self, fullname, path=None): logger.debug('Running find_module: {0}...'.format(fullname)) if '.' in fullname: parent, child = fullname.rsplit('.', 1) if path is None: loader = self.find_module(parent, path) mod = loader.load_module(parent) path = mod.__path__ fullname = child # Perhaps we should try using the new importlib functionality in Python # 3.3: something like this? # thing = importlib.machinery.PathFinder.find_module(fullname, path) try: self.found = imp.find_module(fullname, path) except Exception as e: logger.debug('Py2Fixer could not find {0}') logger.debug('Exception was: {0})'.format(fullname, e)) return None self.kind = self.found[-1][-1] if self.kind == imp.PKG_DIRECTORY: self.pathname = os.path.join(self.found[1], '__init__.py') elif self.kind == imp.PY_SOURCE: self.pathname = self.found[1] return self def transform(self, source): # This implementation uses lib2to3, # you can override and use something else # if that's better for you # lib2to3 likes a newline at the end RTs.setup() source += '\n' try: tree = RTs._rt.refactor_string(source, self.pathname) except ParseError as e: if e.msg != 'bad input' or e.value != '=': raise tree = RTs._rtp.refactor_string(source, self.pathname) # could optimise a bit for only doing str(tree) if # getattr(tree, 'was_changed', False) returns True return str(tree)[:-1] # remove added newline def load_module(self, fullname): logger.debug('Running load_module for {0}...'.format(fullname)) if fullname in sys.modules: mod = sys.modules[fullname] else: if self.kind in (imp.PY_COMPILED, imp.C_EXTENSION, imp.C_BUILTIN, imp.PY_FROZEN): convert = False # elif (self.pathname.startswith(_stdlibprefix) # and 'site-packages' not in self.pathname): # # We assume it's a stdlib package in this case. Is this too brittle? # # Please file a bug report at https://github.com/PythonCharmers/python-future # # if so. # convert = False # in theory, other paths could be configured to be excluded here too elif any([fullname.startswith(path) for path in self.exclude_paths]): convert = False elif any([fullname.startswith(path) for path in self.include_paths]): convert = True else: convert = False if not convert: logger.debug('Excluded {0} from translation'.format(fullname)) mod = imp.load_module(fullname, *self.found) else: logger.debug('Autoconverting {0} ...'.format(fullname)) mod = imp.new_module(fullname) sys.modules[fullname] = mod # required by PEP 302 mod.__file__ = self.pathname mod.__name__ = fullname mod.__loader__ = self # This: # mod.__package__ = '.'.join(fullname.split('.')[:-1]) # seems to result in "SystemError: Parent module '' not loaded, # cannot perform relative import" for a package's __init__.py # file. We use the approach below. Another option to try is the # minimal load_module pattern from the PEP 302 text instead. # Is the test in the next line more or less robust than the # following one? Presumably less ... # ispkg = self.pathname.endswith('__init__.py') if self.kind == imp.PKG_DIRECTORY: mod.__path__ = [ os.path.dirname(self.pathname) ] mod.__package__ = fullname else: #else, regular module mod.__path__ = [] mod.__package__ = fullname.rpartition('.')[0] try: cachename = imp.cache_from_source(self.pathname) if not os.path.exists(cachename): update_cache = True else: sourcetime = os.stat(self.pathname).st_mtime cachetime = os.stat(cachename).st_mtime update_cache = cachetime < sourcetime # # Force update_cache to work around a problem with it being treated as Py3 code??? # update_cache = True if not update_cache: with open(cachename, 'rb') as f: data = f.read() try: code = marshal.loads(data) except Exception: # pyc could be corrupt. Regenerate it update_cache = True if update_cache: if self.found[0]: source = self.found[0].read() elif self.kind == imp.PKG_DIRECTORY: with open(self.pathname) as f: source = f.read() if detect_python2(source, self.pathname): source = self.transform(source) with open('/tmp/futurized_code.py', 'w') as f: f.write('### Futurized code (from %s)\n%s' % (self.pathname, source)) code = compile(source, self.pathname, 'exec') dirname = os.path.dirname(cachename) if not os.path.exists(dirname): os.makedirs(dirname) try: with open(cachename, 'wb') as f: data = marshal.dumps(code) f.write(data) except Exception: # could be write-protected pass exec(code, mod.__dict__) except Exception as e: # must remove module from sys.modules del sys.modules[fullname] raise # keep it simple if self.found[0]: self.found[0].close() return mod _hook = Py2Fixer() def install_hooks(include_paths=(), exclude_paths=()): if isinstance(include_paths, str): include_paths = (include_paths,) if isinstance(exclude_paths, str): exclude_paths = (exclude_paths,) assert len(include_paths) + len(exclude_paths) > 0, 'Pass at least one argument' _hook.include(include_paths) _hook.exclude(exclude_paths) # _hook.debug = debug enable = sys.version_info[0] >= 3 # enabled for all 3.x if enable and _hook not in sys.meta_path: sys.meta_path.insert(0, _hook) # insert at beginning. This could be made a parameter # We could return the hook when there are ways of configuring it #return _hook def remove_hooks(): if _hook in sys.meta_path: sys.meta_path.remove(_hook) def detect_hooks(): """ Returns True if the import hooks are installed, False if not. """ return _hook in sys.meta_path # present = any([hasattr(hook, 'PY2FIXER') for hook in sys.meta_path]) # return present class hooks(object): """ Acts as a context manager. Use like this: >>> from past import translation >>> with translation.hooks(): ... import mypy2module >>> import requests # py2/3 compatible anyway >>> # etc. """ def __enter__(self): self.hooks_were_installed = detect_hooks() install_hooks() return self def __exit__(self, *args): if not self.hooks_were_installed: remove_hooks() class suspend_hooks(object): """ Acts as a context manager. Use like this: >>> from past import translation >>> translation.install_hooks() >>> import http.client >>> # ... >>> with translation.suspend_hooks(): >>> import requests # or others that support Py2/3 If the hooks were disabled before the context, they are not installed when the context is left. """ def __enter__(self): self.hooks_were_installed = detect_hooks() remove_hooks() return self def __exit__(self, *args): if self.hooks_were_installed: install_hooks()
18,459
35.993988
163
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/conftest.py
""" Pytest configuration and fixtures for the Numpy test suite. """ from __future__ import division, absolute_import, print_function import warnings import pytest from numpy.core.multiarray_tests import get_fpu_mode _old_fpu_mode = None _collect_results = {} @pytest.hookimpl() def pytest_itemcollected(item): """ Check FPU precision mode was not changed during test collection. The clumsy way we do it here is mainly necessary because numpy still uses yield tests, which can execute code at test collection time. """ global _old_fpu_mode mode = get_fpu_mode() if _old_fpu_mode is None: _old_fpu_mode = mode elif mode != _old_fpu_mode: _collect_results[item] = (_old_fpu_mode, mode) _old_fpu_mode = mode @pytest.fixture(scope="function", autouse=True) def check_fpu_mode(request): """ Check FPU precision mode was not changed during the test. """ old_mode = get_fpu_mode() yield new_mode = get_fpu_mode() if old_mode != new_mode: raise AssertionError("FPU precision mode changed from {0:#x} to {1:#x}" " during the test".format(old_mode, new_mode)) collect_result = _collect_results.get(request.node) if collect_result is not None: old_mode, new_mode = collect_result raise AssertionError("FPU precision mode changed from {0:#x} to {1:#x}" " when collecting the test".format(old_mode, new_mode))
1,557
27.327273
79
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/setup.py
#!/usr/bin/env python from __future__ import division, print_function def configuration(parent_package='',top_path=None): from numpy.distutils.misc_util import Configuration config = Configuration('numpy', parent_package, top_path) config.add_subpackage('compat') config.add_subpackage('core') config.add_subpackage('distutils') config.add_subpackage('doc') config.add_subpackage('f2py') config.add_subpackage('fft') config.add_subpackage('lib') config.add_subpackage('linalg') config.add_subpackage('ma') config.add_subpackage('matrixlib') config.add_subpackage('polynomial') config.add_subpackage('random') config.add_subpackage('testing') config.add_data_dir('doc') config.add_data_dir('tests') config.make_config_py() # installs __config__.py return config if __name__ == '__main__': print('This is the wrong setup.py file to run')
920
30.758621
61
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/_import_tools.py
from __future__ import division, absolute_import, print_function import os import sys import warnings __all__ = ['PackageLoader'] class PackageLoader(object): def __init__(self, verbose=False, infunc=False): """ Manages loading packages. """ if infunc: _level = 2 else: _level = 1 self.parent_frame = frame = sys._getframe(_level) self.parent_name = eval('__name__', frame.f_globals, frame.f_locals) parent_path = eval('__path__', frame.f_globals, frame.f_locals) if isinstance(parent_path, str): parent_path = [parent_path] self.parent_path = parent_path if '__all__' not in frame.f_locals: exec('__all__ = []', frame.f_globals, frame.f_locals) self.parent_export_names = eval('__all__', frame.f_globals, frame.f_locals) self.info_modules = {} self.imported_packages = [] self.verbose = None def _get_info_files(self, package_dir, parent_path, parent_package=None): """ Return list of (package name,info.py file) from parent_path subdirectories. """ from glob import glob files = glob(os.path.join(parent_path, package_dir, 'info.py')) for info_file in glob(os.path.join(parent_path, package_dir, 'info.pyc')): if info_file[:-1] not in files: files.append(info_file) info_files = [] for info_file in files: package_name = os.path.dirname(info_file[len(parent_path)+1:])\ .replace(os.sep, '.') if parent_package: package_name = parent_package + '.' + package_name info_files.append((package_name, info_file)) info_files.extend(self._get_info_files('*', os.path.dirname(info_file), package_name)) return info_files def _init_info_modules(self, packages=None): """Initialize info_modules = {<package_name>: <package info.py module>}. """ from numpy.compat import npy_load_module info_files = [] info_modules = self.info_modules if packages is None: for path in self.parent_path: info_files.extend(self._get_info_files('*', path)) else: for package_name in packages: package_dir = os.path.join(*package_name.split('.')) for path in self.parent_path: names_files = self._get_info_files(package_dir, path) if names_files: info_files.extend(names_files) break else: try: exec('import %s.info as info' % (package_name)) info_modules[package_name] = info except ImportError as msg: self.warn('No scipy-style subpackage %r found in %s. '\ 'Ignoring: %s'\ % (package_name, ':'.join(self.parent_path), msg)) for package_name, info_file in info_files: if package_name in info_modules: continue fullname = self.parent_name +'.'+ package_name if info_file[-1]=='c': filedescriptor = ('.pyc', 'rb', 2) else: filedescriptor = ('.py', 'U', 1) try: info_module = npy_load_module(fullname + '.info', info_file, filedescriptor) except Exception as msg: self.error(msg) info_module = None if info_module is None or getattr(info_module, 'ignore', False): info_modules.pop(package_name, None) else: self._init_info_modules(getattr(info_module, 'depends', [])) info_modules[package_name] = info_module return def _get_sorted_names(self): """ Return package names sorted in the order as they should be imported due to dependence relations between packages. """ depend_dict = {} for name, info_module in self.info_modules.items(): depend_dict[name] = getattr(info_module, 'depends', []) package_names = [] for name in list(depend_dict.keys()): if not depend_dict[name]: package_names.append(name) del depend_dict[name] while depend_dict: for name, lst in list(depend_dict.items()): new_lst = [n for n in lst if n in depend_dict] if not new_lst: package_names.append(name) del depend_dict[name] else: depend_dict[name] = new_lst return package_names def __call__(self,*packages, **options): """Load one or more packages into parent package top-level namespace. This function is intended to shorten the need to import many subpackages, say of scipy, constantly with statements such as import scipy.linalg, scipy.fftpack, scipy.etc... Instead, you can say: import scipy scipy.pkgload('linalg','fftpack',...) or scipy.pkgload() to load all of them in one call. If a name which doesn't exist in scipy's namespace is given, a warning is shown. Parameters ---------- *packages : arg-tuple the names (one or more strings) of all the modules one wishes to load into the top-level namespace. verbose= : integer verbosity level [default: -1]. verbose=-1 will suspend also warnings. force= : bool when True, force reloading loaded packages [default: False]. postpone= : bool when True, don't load packages [default: False] """ # 2014-10-29, 1.10 warnings.warn('pkgload and PackageLoader are obsolete ' 'and will be removed in a future version of numpy', DeprecationWarning, stacklevel=2) frame = self.parent_frame self.info_modules = {} if options.get('force', False): self.imported_packages = [] self.verbose = verbose = options.get('verbose', -1) postpone = options.get('postpone', None) self._init_info_modules(packages or None) self.log('Imports to %r namespace\n----------------------------'\ % self.parent_name) for package_name in self._get_sorted_names(): if package_name in self.imported_packages: continue info_module = self.info_modules[package_name] global_symbols = getattr(info_module, 'global_symbols', []) postpone_import = getattr(info_module, 'postpone_import', False) if (postpone and not global_symbols) \ or (postpone_import and postpone is not None): continue old_object = frame.f_locals.get(package_name, None) cmdstr = 'import '+package_name if self._execcmd(cmdstr): continue self.imported_packages.append(package_name) if verbose!=-1: new_object = frame.f_locals.get(package_name) if old_object is not None and old_object is not new_object: self.warn('Overwriting %s=%s (was %s)' \ % (package_name, self._obj2repr(new_object), self._obj2repr(old_object))) if '.' not in package_name: self.parent_export_names.append(package_name) for symbol in global_symbols: if symbol=='*': symbols = eval('getattr(%s,"__all__",None)'\ % (package_name), frame.f_globals, frame.f_locals) if symbols is None: symbols = eval('dir(%s)' % (package_name), frame.f_globals, frame.f_locals) symbols = [s for s in symbols if not s.startswith('_')] else: symbols = [symbol] if verbose!=-1: old_objects = {} for s in symbols: if s in frame.f_locals: old_objects[s] = frame.f_locals[s] cmdstr = 'from '+package_name+' import '+symbol if self._execcmd(cmdstr): continue if verbose!=-1: for s, old_object in old_objects.items(): new_object = frame.f_locals[s] if new_object is not old_object: self.warn('Overwriting %s=%s (was %s)' \ % (s, self._obj2repr(new_object), self._obj2repr(old_object))) if symbol=='*': self.parent_export_names.extend(symbols) else: self.parent_export_names.append(symbol) return def _execcmd(self, cmdstr): """ Execute command in parent_frame.""" frame = self.parent_frame try: exec (cmdstr, frame.f_globals, frame.f_locals) except Exception as msg: self.error('%s -> failed: %s' % (cmdstr, msg)) return True else: self.log('%s -> success' % (cmdstr)) return def _obj2repr(self, obj): """ Return repr(obj) with""" module = getattr(obj, '__module__', None) file = getattr(obj, '__file__', None) if module is not None: return repr(obj) + ' from ' + module if file is not None: return repr(obj) + ' from ' + file return repr(obj) def log(self, mess): if self.verbose>1: print(str(mess), file=sys.stderr) def warn(self, mess): if self.verbose>=0: print(str(mess), file=sys.stderr) def error(self, mess): if self.verbose!=-1: print(str(mess), file=sys.stderr) def _get_doc_title(self, info_module): """ Get the title from a package info.py file. """ title = getattr(info_module, '__doc_title__', None) if title is not None: return title title = getattr(info_module, '__doc__', None) if title is not None: title = title.lstrip().split('\n', 1)[0] return title return '* Not Available *' def _format_titles(self,titles,colsep='---'): display_window_width = 70 # How to determine the correct value in runtime?? lengths = [len(name)-name.find('.')-1 for (name, title) in titles]+[0] max_length = max(lengths) lines = [] for (name, title) in titles: name = name[name.find('.')+1:] w = max_length - len(name) words = title.split() line = '%s%s %s' % (name, w*' ', colsep) tab = len(line) * ' ' while words: word = words.pop(0) if len(line)+len(word)>display_window_width: lines.append(line) line = tab line += ' ' + word lines.append(line) return '\n'.join(lines) def get_pkgdocs(self): """ Return documentation summary of subpackages. """ import sys self.info_modules = {} self._init_info_modules(None) titles = [] symbols = [] for package_name, info_module in self.info_modules.items(): global_symbols = getattr(info_module, 'global_symbols', []) fullname = self.parent_name +'.'+ package_name note = '' if fullname not in sys.modules: note = ' [*]' titles.append((fullname, self._get_doc_title(info_module) + note)) if global_symbols: symbols.append((package_name, ', '.join(global_symbols))) retstr = self._format_titles(titles) +\ '\n [*] - using a package requires explicit import (see pkgload)' if symbols: retstr += """\n\nGlobal symbols from subpackages"""\ """\n-------------------------------\n""" +\ self._format_titles(symbols, '-->') return retstr class PackageLoaderDebug(PackageLoader): def _execcmd(self, cmdstr): """ Execute command in parent_frame.""" frame = self.parent_frame print('Executing', repr(cmdstr), '...', end=' ') sys.stdout.flush() exec (cmdstr, frame.f_globals, frame.f_locals) print('ok') sys.stdout.flush() return if int(os.environ.get('NUMPY_IMPORT_DEBUG', '0')): PackageLoader = PackageLoaderDebug
13,234
36.599432
87
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/_distributor_init.py
""" Distributor init file Distributors: you can add custom code here to support particular distributions of numpy. For example, this is a good place to put any checks for hardware requirements. The numpy standard source distribution will not put code in this file, so you can safely replace this file with your own version. """
331
29.181818
78
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/dual.py
""" Aliases for functions which may be accelerated by Scipy. Scipy_ can be built to use accelerated or otherwise improved libraries for FFTs, linear algebra, and special functions. This module allows developers to transparently support these accelerated functions when scipy is available but still support users who have only installed NumPy. .. _Scipy : http://www.scipy.org """ from __future__ import division, absolute_import, print_function # This module should be used for functions both in numpy and scipy if # you want to use the numpy version if available but the scipy version # otherwise. # Usage --- from numpy.dual import fft, inv __all__ = ['fft', 'ifft', 'fftn', 'ifftn', 'fft2', 'ifft2', 'norm', 'inv', 'svd', 'solve', 'det', 'eig', 'eigvals', 'eigh', 'eigvalsh', 'lstsq', 'pinv', 'cholesky', 'i0'] import numpy.linalg as linpkg import numpy.fft as fftpkg from numpy.lib import i0 import sys fft = fftpkg.fft ifft = fftpkg.ifft fftn = fftpkg.fftn ifftn = fftpkg.ifftn fft2 = fftpkg.fft2 ifft2 = fftpkg.ifft2 norm = linpkg.norm inv = linpkg.inv svd = linpkg.svd solve = linpkg.solve det = linpkg.det eig = linpkg.eig eigvals = linpkg.eigvals eigh = linpkg.eigh eigvalsh = linpkg.eigvalsh lstsq = linpkg.lstsq pinv = linpkg.pinv cholesky = linpkg.cholesky _restore_dict = {} def register_func(name, func): if name not in __all__: raise ValueError("%s not a dual function." % name) f = sys._getframe(0).f_globals _restore_dict[name] = f[name] f[name] = func def restore_func(name): if name not in __all__: raise ValueError("%s not a dual function." % name) try: val = _restore_dict[name] except KeyError: return else: sys._getframe(0).f_globals[name] = val def restore_all(): for name in _restore_dict.keys(): restore_func(name)
1,864
24.902778
71
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/ctypeslib.py
""" ============================ ``ctypes`` Utility Functions ============================ See Also --------- load_library : Load a C library. ndpointer : Array restype/argtype with verification. as_ctypes : Create a ctypes array from an ndarray. as_array : Create an ndarray from a ctypes array. References ---------- .. [1] "SciPy Cookbook: ctypes", http://www.scipy.org/Cookbook/Ctypes Examples -------- Load the C library: >>> _lib = np.ctypeslib.load_library('libmystuff', '.') #doctest: +SKIP Our result type, an ndarray that must be of type double, be 1-dimensional and is C-contiguous in memory: >>> array_1d_double = np.ctypeslib.ndpointer( ... dtype=np.double, ... ndim=1, flags='CONTIGUOUS') #doctest: +SKIP Our C-function typically takes an array and updates its values in-place. For example:: void foo_func(double* x, int length) { int i; for (i = 0; i < length; i++) { x[i] = i*i; } } We wrap it using: >>> _lib.foo_func.restype = None #doctest: +SKIP >>> _lib.foo_func.argtypes = [array_1d_double, c_int] #doctest: +SKIP Then, we're ready to call ``foo_func``: >>> out = np.empty(15, dtype=np.double) >>> _lib.foo_func(out, len(out)) #doctest: +SKIP """ from __future__ import division, absolute_import, print_function __all__ = ['load_library', 'ndpointer', 'test', 'ctypes_load_library', 'c_intp', 'as_ctypes', 'as_array'] import sys, os from numpy import integer, ndarray, dtype as _dtype, deprecate, array from numpy.core.multiarray import _flagdict, flagsobj try: import ctypes except ImportError: ctypes = None if ctypes is None: def _dummy(*args, **kwds): """ Dummy object that raises an ImportError if ctypes is not available. Raises ------ ImportError If ctypes is not available. """ raise ImportError("ctypes is not available.") ctypes_load_library = _dummy load_library = _dummy as_ctypes = _dummy as_array = _dummy from numpy import intp as c_intp _ndptr_base = object else: import numpy.core._internal as nic c_intp = nic._getintp_ctype() del nic _ndptr_base = ctypes.c_void_p # Adapted from Albert Strasheim def load_library(libname, loader_path): """ It is possible to load a library using >>> lib = ctypes.cdll[<full_path_name>] But there are cross-platform considerations, such as library file extensions, plus the fact Windows will just load the first library it finds with that name. NumPy supplies the load_library function as a convenience. Parameters ---------- libname : str Name of the library, which can have 'lib' as a prefix, but without an extension. loader_path : str Where the library can be found. Returns ------- ctypes.cdll[libpath] : library object A ctypes library object Raises ------ OSError If there is no library with the expected extension, or the library is defective and cannot be loaded. """ if ctypes.__version__ < '1.0.1': import warnings warnings.warn("All features of ctypes interface may not work " \ "with ctypes < 1.0.1", stacklevel=2) ext = os.path.splitext(libname)[1] if not ext: # Try to load library with platform-specific name, otherwise # default to libname.[so|pyd]. Sometimes, these files are built # erroneously on non-linux platforms. from numpy.distutils.misc_util import get_shared_lib_extension so_ext = get_shared_lib_extension() libname_ext = [libname + so_ext] # mac, windows and linux >= py3.2 shared library and loadable # module have different extensions so try both so_ext2 = get_shared_lib_extension(is_python_ext=True) if not so_ext2 == so_ext: libname_ext.insert(0, libname + so_ext2) else: libname_ext = [libname] loader_path = os.path.abspath(loader_path) if not os.path.isdir(loader_path): libdir = os.path.dirname(loader_path) else: libdir = loader_path for ln in libname_ext: libpath = os.path.join(libdir, ln) if os.path.exists(libpath): try: return ctypes.cdll[libpath] except OSError: ## defective lib file raise ## if no successful return in the libname_ext loop: raise OSError("no file with expected extension") ctypes_load_library = deprecate(load_library, 'ctypes_load_library', 'load_library') def _num_fromflags(flaglist): num = 0 for val in flaglist: num += _flagdict[val] return num _flagnames = ['C_CONTIGUOUS', 'F_CONTIGUOUS', 'ALIGNED', 'WRITEABLE', 'OWNDATA', 'UPDATEIFCOPY', 'WRITEBACKIFCOPY'] def _flags_fromnum(num): res = [] for key in _flagnames: value = _flagdict[key] if (num & value): res.append(key) return res class _ndptr(_ndptr_base): def _check_retval_(self): """This method is called when this class is used as the .restype attribute for a shared-library function. It constructs a numpy array from a void pointer.""" return array(self) @property def __array_interface__(self): return {'descr': self._dtype_.descr, '__ref': self, 'strides': None, 'shape': self._shape_, 'version': 3, 'typestr': self._dtype_.descr[0][1], 'data': (self.value, False), } @classmethod def from_param(cls, obj): if not isinstance(obj, ndarray): raise TypeError("argument must be an ndarray") if cls._dtype_ is not None \ and obj.dtype != cls._dtype_: raise TypeError("array must have data type %s" % cls._dtype_) if cls._ndim_ is not None \ and obj.ndim != cls._ndim_: raise TypeError("array must have %d dimension(s)" % cls._ndim_) if cls._shape_ is not None \ and obj.shape != cls._shape_: raise TypeError("array must have shape %s" % str(cls._shape_)) if cls._flags_ is not None \ and ((obj.flags.num & cls._flags_) != cls._flags_): raise TypeError("array must have flags %s" % _flags_fromnum(cls._flags_)) return obj.ctypes # Factory for an array-checking class with from_param defined for # use with ctypes argtypes mechanism _pointer_type_cache = {} def ndpointer(dtype=None, ndim=None, shape=None, flags=None): """ Array-checking restype/argtypes. An ndpointer instance is used to describe an ndarray in restypes and argtypes specifications. This approach is more flexible than using, for example, ``POINTER(c_double)``, since several restrictions can be specified, which are verified upon calling the ctypes function. These include data type, number of dimensions, shape and flags. If a given array does not satisfy the specified restrictions, a ``TypeError`` is raised. Parameters ---------- dtype : data-type, optional Array data-type. ndim : int, optional Number of array dimensions. shape : tuple of ints, optional Array shape. flags : str or tuple of str Array flags; may be one or more of: - C_CONTIGUOUS / C / CONTIGUOUS - F_CONTIGUOUS / F / FORTRAN - OWNDATA / O - WRITEABLE / W - ALIGNED / A - WRITEBACKIFCOPY / X - UPDATEIFCOPY / U Returns ------- klass : ndpointer type object A type object, which is an ``_ndtpr`` instance containing dtype, ndim, shape and flags information. Raises ------ TypeError If a given array does not satisfy the specified restrictions. Examples -------- >>> clib.somefunc.argtypes = [np.ctypeslib.ndpointer(dtype=np.float64, ... ndim=1, ... flags='C_CONTIGUOUS')] ... #doctest: +SKIP >>> clib.somefunc(np.array([1, 2, 3], dtype=np.float64)) ... #doctest: +SKIP """ if dtype is not None: dtype = _dtype(dtype) num = None if flags is not None: if isinstance(flags, str): flags = flags.split(',') elif isinstance(flags, (int, integer)): num = flags flags = _flags_fromnum(num) elif isinstance(flags, flagsobj): num = flags.num flags = _flags_fromnum(num) if num is None: try: flags = [x.strip().upper() for x in flags] except Exception: raise TypeError("invalid flags specification") num = _num_fromflags(flags) try: return _pointer_type_cache[(dtype, ndim, shape, num)] except KeyError: pass if dtype is None: name = 'any' elif dtype.names: name = str(id(dtype)) else: name = dtype.str if ndim is not None: name += "_%dd" % ndim if shape is not None: try: strshape = [str(x) for x in shape] except TypeError: strshape = [str(shape)] shape = (shape,) shape = tuple(shape) name += "_"+"x".join(strshape) if flags is not None: name += "_"+"_".join(flags) else: flags = [] klass = type("ndpointer_%s"%name, (_ndptr,), {"_dtype_": dtype, "_shape_" : shape, "_ndim_" : ndim, "_flags_" : num}) _pointer_type_cache[(dtype, shape, ndim, num)] = klass return klass if ctypes is not None: ct = ctypes ################################################################ # simple types # maps the numpy typecodes like '<f8' to simple ctypes types like # c_double. Filled in by prep_simple. _typecodes = {} def prep_simple(simple_type, dtype): """Given a ctypes simple type, construct and attach an __array_interface__ property to it if it does not yet have one. """ try: simple_type.__array_interface__ except AttributeError: pass else: return typestr = _dtype(dtype).str _typecodes[typestr] = simple_type def __array_interface__(self): return {'descr': [('', typestr)], '__ref': self, 'strides': None, 'shape': (), 'version': 3, 'typestr': typestr, 'data': (ct.addressof(self), False), } simple_type.__array_interface__ = property(__array_interface__) simple_types = [ ((ct.c_byte, ct.c_short, ct.c_int, ct.c_long, ct.c_longlong), "i"), ((ct.c_ubyte, ct.c_ushort, ct.c_uint, ct.c_ulong, ct.c_ulonglong), "u"), ((ct.c_float, ct.c_double), "f"), ] # Prep that numerical ctypes types: for types, code in simple_types: for tp in types: prep_simple(tp, "%c%d" % (code, ct.sizeof(tp))) ################################################################ # array types _ARRAY_TYPE = type(ct.c_int * 1) def prep_array(array_type): """Given a ctypes array type, construct and attach an __array_interface__ property to it if it does not yet have one. """ try: array_type.__array_interface__ except AttributeError: pass else: return shape = [] ob = array_type while type(ob) is _ARRAY_TYPE: shape.append(ob._length_) ob = ob._type_ shape = tuple(shape) ai = ob().__array_interface__ descr = ai['descr'] typestr = ai['typestr'] def __array_interface__(self): return {'descr': descr, '__ref': self, 'strides': None, 'shape': shape, 'version': 3, 'typestr': typestr, 'data': (ct.addressof(self), False), } array_type.__array_interface__ = property(__array_interface__) def prep_pointer(pointer_obj, shape): """Given a ctypes pointer object, construct and attach an __array_interface__ property to it if it does not yet have one. """ try: pointer_obj.__array_interface__ except AttributeError: pass else: return contents = pointer_obj.contents dtype = _dtype(type(contents)) inter = {'version': 3, 'typestr': dtype.str, 'data': (ct.addressof(contents), False), 'shape': shape} pointer_obj.__array_interface__ = inter ################################################################ # public functions def as_array(obj, shape=None): """Create a numpy array from a ctypes array or a ctypes POINTER. The numpy array shares the memory with the ctypes object. The size parameter must be given if converting from a ctypes POINTER. The size parameter is ignored if converting from a ctypes array """ tp = type(obj) try: tp.__array_interface__ except AttributeError: if hasattr(obj, 'contents'): prep_pointer(obj, shape) else: prep_array(tp) return array(obj, copy=False) def as_ctypes(obj): """Create and return a ctypes object from a numpy array. Actually anything that exposes the __array_interface__ is accepted.""" ai = obj.__array_interface__ if ai["strides"]: raise TypeError("strided arrays not supported") if ai["version"] != 3: raise TypeError("only __array_interface__ version 3 supported") addr, readonly = ai["data"] if readonly: raise TypeError("readonly arrays unsupported") tp = _typecodes[ai["typestr"]] for dim in ai["shape"][::-1]: tp = tp * dim result = tp.from_address(addr) result.__keep = ai return result
14,730
31.375824
89
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/version.py
# THIS FILE IS GENERATED FROM NUMPY SETUP.PY # # To compare versions robustly, use `numpy.lib.NumpyVersion` short_version = '1.14.5' version = '1.14.5' full_version = '1.14.5' git_revision = 'd3348c1123d3862a42d50a7fee14e50b268944a4' release = True if not release: version = full_version
294
21.692308
60
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/add_newdocs.py
""" This is only meant to add docs to objects defined in C-extension modules. The purpose is to allow easier editing of the docstrings without requiring a re-compile. NOTE: Many of the methods of ndarray have corresponding functions. If you update these docstrings, please keep also the ones in core/fromnumeric.py, core/defmatrix.py up-to-date. """ from __future__ import division, absolute_import, print_function from numpy.lib import add_newdoc ############################################################################### # # flatiter # # flatiter needs a toplevel description # ############################################################################### add_newdoc('numpy.core', 'flatiter', """ Flat iterator object to iterate over arrays. A `flatiter` iterator is returned by ``x.flat`` for any array `x`. It allows iterating over the array as if it were a 1-D array, either in a for-loop or by calling its `next` method. Iteration is done in row-major, C-style order (the last index varying the fastest). The iterator can also be indexed using basic slicing or advanced indexing. See Also -------- ndarray.flat : Return a flat iterator over an array. ndarray.flatten : Returns a flattened copy of an array. Notes ----- A `flatiter` iterator can not be constructed directly from Python code by calling the `flatiter` constructor. Examples -------- >>> x = np.arange(6).reshape(2, 3) >>> fl = x.flat >>> type(fl) <type 'numpy.flatiter'> >>> for item in fl: ... print(item) ... 0 1 2 3 4 5 >>> fl[2:4] array([2, 3]) """) # flatiter attributes add_newdoc('numpy.core', 'flatiter', ('base', """ A reference to the array that is iterated over. Examples -------- >>> x = np.arange(5) >>> fl = x.flat >>> fl.base is x True """)) add_newdoc('numpy.core', 'flatiter', ('coords', """ An N-dimensional tuple of current coordinates. Examples -------- >>> x = np.arange(6).reshape(2, 3) >>> fl = x.flat >>> fl.coords (0, 0) >>> fl.next() 0 >>> fl.coords (0, 1) """)) add_newdoc('numpy.core', 'flatiter', ('index', """ Current flat index into the array. Examples -------- >>> x = np.arange(6).reshape(2, 3) >>> fl = x.flat >>> fl.index 0 >>> fl.next() 0 >>> fl.index 1 """)) # flatiter functions add_newdoc('numpy.core', 'flatiter', ('__array__', """__array__(type=None) Get array from iterator """)) add_newdoc('numpy.core', 'flatiter', ('copy', """ copy() Get a copy of the iterator as a 1-D array. Examples -------- >>> x = np.arange(6).reshape(2, 3) >>> x array([[0, 1, 2], [3, 4, 5]]) >>> fl = x.flat >>> fl.copy() array([0, 1, 2, 3, 4, 5]) """)) ############################################################################### # # nditer # ############################################################################### add_newdoc('numpy.core', 'nditer', """ Efficient multi-dimensional iterator object to iterate over arrays. To get started using this object, see the :ref:`introductory guide to array iteration <arrays.nditer>`. Parameters ---------- op : ndarray or sequence of array_like The array(s) to iterate over. flags : sequence of str, optional Flags to control the behavior of the iterator. * "buffered" enables buffering when required. * "c_index" causes a C-order index to be tracked. * "f_index" causes a Fortran-order index to be tracked. * "multi_index" causes a multi-index, or a tuple of indices with one per iteration dimension, to be tracked. * "common_dtype" causes all the operands to be converted to a common data type, with copying or buffering as necessary. * "copy_if_overlap" causes the iterator to determine if read operands have overlap with write operands, and make temporary copies as necessary to avoid overlap. False positives (needless copying) are possible in some cases. * "delay_bufalloc" delays allocation of the buffers until a reset() call is made. Allows "allocate" operands to be initialized before their values are copied into the buffers. * "external_loop" causes the `values` given to be one-dimensional arrays with multiple values instead of zero-dimensional arrays. * "grow_inner" allows the `value` array sizes to be made larger than the buffer size when both "buffered" and "external_loop" is used. * "ranged" allows the iterator to be restricted to a sub-range of the iterindex values. * "refs_ok" enables iteration of reference types, such as object arrays. * "reduce_ok" enables iteration of "readwrite" operands which are broadcasted, also known as reduction operands. * "zerosize_ok" allows `itersize` to be zero. op_flags : list of list of str, optional This is a list of flags for each operand. At minimum, one of "readonly", "readwrite", or "writeonly" must be specified. * "readonly" indicates the operand will only be read from. * "readwrite" indicates the operand will be read from and written to. * "writeonly" indicates the operand will only be written to. * "no_broadcast" prevents the operand from being broadcasted. * "contig" forces the operand data to be contiguous. * "aligned" forces the operand data to be aligned. * "nbo" forces the operand data to be in native byte order. * "copy" allows a temporary read-only copy if required. * "updateifcopy" allows a temporary read-write copy if required. * "allocate" causes the array to be allocated if it is None in the `op` parameter. * "no_subtype" prevents an "allocate" operand from using a subtype. * "arraymask" indicates that this operand is the mask to use for selecting elements when writing to operands with the 'writemasked' flag set. The iterator does not enforce this, but when writing from a buffer back to the array, it only copies those elements indicated by this mask. * 'writemasked' indicates that only elements where the chosen 'arraymask' operand is True will be written to. * "overlap_assume_elementwise" can be used to mark operands that are accessed only in the iterator order, to allow less conservative copying when "copy_if_overlap" is present. op_dtypes : dtype or tuple of dtype(s), optional The required data type(s) of the operands. If copying or buffering is enabled, the data will be converted to/from their original types. order : {'C', 'F', 'A', 'K'}, optional Controls the iteration order. 'C' means C order, 'F' means Fortran order, 'A' means 'F' order if all the arrays are Fortran contiguous, 'C' order otherwise, and 'K' means as close to the order the array elements appear in memory as possible. This also affects the element memory order of "allocate" operands, as they are allocated to be compatible with iteration order. Default is 'K'. casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional Controls what kind of data casting may occur when making a copy or buffering. Setting this to 'unsafe' is not recommended, as it can adversely affect accumulations. * 'no' means the data types should not be cast at all. * 'equiv' means only byte-order changes are allowed. * 'safe' means only casts which can preserve values are allowed. * 'same_kind' means only safe casts or casts within a kind, like float64 to float32, are allowed. * 'unsafe' means any data conversions may be done. op_axes : list of list of ints, optional If provided, is a list of ints or None for each operands. The list of axes for an operand is a mapping from the dimensions of the iterator to the dimensions of the operand. A value of -1 can be placed for entries, causing that dimension to be treated as "newaxis". itershape : tuple of ints, optional The desired shape of the iterator. This allows "allocate" operands with a dimension mapped by op_axes not corresponding to a dimension of a different operand to get a value not equal to 1 for that dimension. buffersize : int, optional When buffering is enabled, controls the size of the temporary buffers. Set to 0 for the default value. Attributes ---------- dtypes : tuple of dtype(s) The data types of the values provided in `value`. This may be different from the operand data types if buffering is enabled. finished : bool Whether the iteration over the operands is finished or not. has_delayed_bufalloc : bool If True, the iterator was created with the "delay_bufalloc" flag, and no reset() function was called on it yet. has_index : bool If True, the iterator was created with either the "c_index" or the "f_index" flag, and the property `index` can be used to retrieve it. has_multi_index : bool If True, the iterator was created with the "multi_index" flag, and the property `multi_index` can be used to retrieve it. index When the "c_index" or "f_index" flag was used, this property provides access to the index. Raises a ValueError if accessed and `has_index` is False. iterationneedsapi : bool Whether iteration requires access to the Python API, for example if one of the operands is an object array. iterindex : int An index which matches the order of iteration. itersize : int Size of the iterator. itviews Structured view(s) of `operands` in memory, matching the reordered and optimized iterator access pattern. multi_index When the "multi_index" flag was used, this property provides access to the index. Raises a ValueError if accessed accessed and `has_multi_index` is False. ndim : int The iterator's dimension. nop : int The number of iterator operands. operands : tuple of operand(s) The array(s) to be iterated over. shape : tuple of ints Shape tuple, the shape of the iterator. value Value of `operands` at current iteration. Normally, this is a tuple of array scalars, but if the flag "external_loop" is used, it is a tuple of one dimensional arrays. Notes ----- `nditer` supersedes `flatiter`. The iterator implementation behind `nditer` is also exposed by the NumPy C API. The Python exposure supplies two iteration interfaces, one which follows the Python iterator protocol, and another which mirrors the C-style do-while pattern. The native Python approach is better in most cases, but if you need the iterator's coordinates or index, use the C-style pattern. Examples -------- Here is how we might write an ``iter_add`` function, using the Python iterator protocol:: def iter_add_py(x, y, out=None): addop = np.add it = np.nditer([x, y, out], [], [['readonly'], ['readonly'], ['writeonly','allocate']]) for (a, b, c) in it: addop(a, b, out=c) return it.operands[2] Here is the same function, but following the C-style pattern:: def iter_add(x, y, out=None): addop = np.add it = np.nditer([x, y, out], [], [['readonly'], ['readonly'], ['writeonly','allocate']]) while not it.finished: addop(it[0], it[1], out=it[2]) it.iternext() return it.operands[2] Here is an example outer product function:: def outer_it(x, y, out=None): mulop = np.multiply it = np.nditer([x, y, out], ['external_loop'], [['readonly'], ['readonly'], ['writeonly', 'allocate']], op_axes=[range(x.ndim)+[-1]*y.ndim, [-1]*x.ndim+range(y.ndim), None]) for (a, b, c) in it: mulop(a, b, out=c) return it.operands[2] >>> a = np.arange(2)+1 >>> b = np.arange(3)+1 >>> outer_it(a,b) array([[1, 2, 3], [2, 4, 6]]) Here is an example function which operates like a "lambda" ufunc:: def luf(lamdaexpr, *args, **kwargs): "luf(lambdaexpr, op1, ..., opn, out=None, order='K', casting='safe', buffersize=0)" nargs = len(args) op = (kwargs.get('out',None),) + args it = np.nditer(op, ['buffered','external_loop'], [['writeonly','allocate','no_broadcast']] + [['readonly','nbo','aligned']]*nargs, order=kwargs.get('order','K'), casting=kwargs.get('casting','safe'), buffersize=kwargs.get('buffersize',0)) while not it.finished: it[0] = lamdaexpr(*it[1:]) it.iternext() return it.operands[0] >>> a = np.arange(5) >>> b = np.ones(5) >>> luf(lambda i,j:i*i + j/2, a, b) array([ 0.5, 1.5, 4.5, 9.5, 16.5]) """) # nditer methods add_newdoc('numpy.core', 'nditer', ('copy', """ copy() Get a copy of the iterator in its current state. Examples -------- >>> x = np.arange(10) >>> y = x + 1 >>> it = np.nditer([x, y]) >>> it.next() (array(0), array(1)) >>> it2 = it.copy() >>> it2.next() (array(1), array(2)) """)) add_newdoc('numpy.core', 'nditer', ('debug_print', """ debug_print() Print the current state of the `nditer` instance and debug info to stdout. """)) add_newdoc('numpy.core', 'nditer', ('enable_external_loop', """ enable_external_loop() When the "external_loop" was not used during construction, but is desired, this modifies the iterator to behave as if the flag was specified. """)) add_newdoc('numpy.core', 'nditer', ('iternext', """ iternext() Check whether iterations are left, and perform a single internal iteration without returning the result. Used in the C-style pattern do-while pattern. For an example, see `nditer`. Returns ------- iternext : bool Whether or not there are iterations left. """)) add_newdoc('numpy.core', 'nditer', ('remove_axis', """ remove_axis(i) Removes axis `i` from the iterator. Requires that the flag "multi_index" be enabled. """)) add_newdoc('numpy.core', 'nditer', ('remove_multi_index', """ remove_multi_index() When the "multi_index" flag was specified, this removes it, allowing the internal iteration structure to be optimized further. """)) add_newdoc('numpy.core', 'nditer', ('reset', """ reset() Reset the iterator to its initial state. """)) ############################################################################### # # broadcast # ############################################################################### add_newdoc('numpy.core', 'broadcast', """ Produce an object that mimics broadcasting. Parameters ---------- in1, in2, ... : array_like Input parameters. Returns ------- b : broadcast object Broadcast the input parameters against one another, and return an object that encapsulates the result. Amongst others, it has ``shape`` and ``nd`` properties, and may be used as an iterator. See Also -------- broadcast_arrays broadcast_to Examples -------- Manually adding two vectors, using broadcasting: >>> x = np.array([[1], [2], [3]]) >>> y = np.array([4, 5, 6]) >>> b = np.broadcast(x, y) >>> out = np.empty(b.shape) >>> out.flat = [u+v for (u,v) in b] >>> out array([[ 5., 6., 7.], [ 6., 7., 8.], [ 7., 8., 9.]]) Compare against built-in broadcasting: >>> x + y array([[5, 6, 7], [6, 7, 8], [7, 8, 9]]) """) # attributes add_newdoc('numpy.core', 'broadcast', ('index', """ current index in broadcasted result Examples -------- >>> x = np.array([[1], [2], [3]]) >>> y = np.array([4, 5, 6]) >>> b = np.broadcast(x, y) >>> b.index 0 >>> b.next(), b.next(), b.next() ((1, 4), (1, 5), (1, 6)) >>> b.index 3 """)) add_newdoc('numpy.core', 'broadcast', ('iters', """ tuple of iterators along ``self``'s "components." Returns a tuple of `numpy.flatiter` objects, one for each "component" of ``self``. See Also -------- numpy.flatiter Examples -------- >>> x = np.array([1, 2, 3]) >>> y = np.array([[4], [5], [6]]) >>> b = np.broadcast(x, y) >>> row, col = b.iters >>> row.next(), col.next() (1, 4) """)) add_newdoc('numpy.core', 'broadcast', ('ndim', """ Number of dimensions of broadcasted result. Alias for `nd`. .. versionadded:: 1.12.0 Examples -------- >>> x = np.array([1, 2, 3]) >>> y = np.array([[4], [5], [6]]) >>> b = np.broadcast(x, y) >>> b.ndim 2 """)) add_newdoc('numpy.core', 'broadcast', ('nd', """ Number of dimensions of broadcasted result. For code intended for NumPy 1.12.0 and later the more consistent `ndim` is preferred. Examples -------- >>> x = np.array([1, 2, 3]) >>> y = np.array([[4], [5], [6]]) >>> b = np.broadcast(x, y) >>> b.nd 2 """)) add_newdoc('numpy.core', 'broadcast', ('numiter', """ Number of iterators possessed by the broadcasted result. Examples -------- >>> x = np.array([1, 2, 3]) >>> y = np.array([[4], [5], [6]]) >>> b = np.broadcast(x, y) >>> b.numiter 2 """)) add_newdoc('numpy.core', 'broadcast', ('shape', """ Shape of broadcasted result. Examples -------- >>> x = np.array([1, 2, 3]) >>> y = np.array([[4], [5], [6]]) >>> b = np.broadcast(x, y) >>> b.shape (3, 3) """)) add_newdoc('numpy.core', 'broadcast', ('size', """ Total size of broadcasted result. Examples -------- >>> x = np.array([1, 2, 3]) >>> y = np.array([[4], [5], [6]]) >>> b = np.broadcast(x, y) >>> b.size 9 """)) add_newdoc('numpy.core', 'broadcast', ('reset', """ reset() Reset the broadcasted result's iterator(s). Parameters ---------- None Returns ------- None Examples -------- >>> x = np.array([1, 2, 3]) >>> y = np.array([[4], [5], [6]] >>> b = np.broadcast(x, y) >>> b.index 0 >>> b.next(), b.next(), b.next() ((1, 4), (2, 4), (3, 4)) >>> b.index 3 >>> b.reset() >>> b.index 0 """)) ############################################################################### # # numpy functions # ############################################################################### add_newdoc('numpy.core.multiarray', 'array', """ array(object, dtype=None, copy=True, order='K', subok=False, ndmin=0) Create an array. Parameters ---------- object : array_like An array, any object exposing the array interface, an object whose __array__ method returns an array, or any (nested) sequence. dtype : data-type, optional The desired data-type for the array. If not given, then the type will be determined as the minimum type required to hold the objects in the sequence. This argument can only be used to 'upcast' the array. For downcasting, use the .astype(t) method. copy : bool, optional If true (default), then the object is copied. Otherwise, a copy will only be made if __array__ returns a copy, if obj is a nested sequence, or if a copy is needed to satisfy any of the other requirements (`dtype`, `order`, etc.). order : {'K', 'A', 'C', 'F'}, optional Specify the memory layout of the array. If object is not an array, the newly created array will be in C order (row major) unless 'F' is specified, in which case it will be in Fortran order (column major). If object is an array the following holds. ===== ========= =================================================== order no copy copy=True ===== ========= =================================================== 'K' unchanged F & C order preserved, otherwise most similar order 'A' unchanged F order if input is F and not C, otherwise C order 'C' C order C order 'F' F order F order ===== ========= =================================================== When ``copy=False`` and a copy is made for other reasons, the result is the same as if ``copy=True``, with some exceptions for `A`, see the Notes section. The default order is 'K'. subok : bool, optional If True, then sub-classes will be passed-through, otherwise the returned array will be forced to be a base-class array (default). ndmin : int, optional Specifies the minimum number of dimensions that the resulting array should have. Ones will be pre-pended to the shape as needed to meet this requirement. Returns ------- out : ndarray An array object satisfying the specified requirements. See Also -------- empty, empty_like, zeros, zeros_like, ones, ones_like, full, full_like Notes ----- When order is 'A' and `object` is an array in neither 'C' nor 'F' order, and a copy is forced by a change in dtype, then the order of the result is not necessarily 'C' as expected. This is likely a bug. Examples -------- >>> np.array([1, 2, 3]) array([1, 2, 3]) Upcasting: >>> np.array([1, 2, 3.0]) array([ 1., 2., 3.]) More than one dimension: >>> np.array([[1, 2], [3, 4]]) array([[1, 2], [3, 4]]) Minimum dimensions 2: >>> np.array([1, 2, 3], ndmin=2) array([[1, 2, 3]]) Type provided: >>> np.array([1, 2, 3], dtype=complex) array([ 1.+0.j, 2.+0.j, 3.+0.j]) Data-type consisting of more than one element: >>> x = np.array([(1,2),(3,4)],dtype=[('a','<i4'),('b','<i4')]) >>> x['a'] array([1, 3]) Creating an array from sub-classes: >>> np.array(np.mat('1 2; 3 4')) array([[1, 2], [3, 4]]) >>> np.array(np.mat('1 2; 3 4'), subok=True) matrix([[1, 2], [3, 4]]) """) add_newdoc('numpy.core.multiarray', 'empty', """ empty(shape, dtype=float, order='C') Return a new array of given shape and type, without initializing entries. Parameters ---------- shape : int or tuple of int Shape of the empty array dtype : data-type, optional Desired output data-type. order : {'C', 'F'}, optional Whether to store multi-dimensional data in row-major (C-style) or column-major (Fortran-style) order in memory. Returns ------- out : ndarray Array of uninitialized (arbitrary) data of the given shape, dtype, and order. Object arrays will be initialized to None. See Also -------- empty_like, zeros, ones Notes ----- `empty`, unlike `zeros`, does not set the array values to zero, and may therefore be marginally faster. On the other hand, it requires the user to manually set all the values in the array, and should be used with caution. Examples -------- >>> np.empty([2, 2]) array([[ -9.74499359e+001, 6.69583040e-309], [ 2.13182611e-314, 3.06959433e-309]]) #random >>> np.empty([2, 2], dtype=int) array([[-1073741821, -1067949133], [ 496041986, 19249760]]) #random """) add_newdoc('numpy.core.multiarray', 'empty_like', """ empty_like(a, dtype=None, order='K', subok=True) Return a new array with the same shape and type as a given array. Parameters ---------- a : array_like The shape and data-type of `a` define these same attributes of the returned array. dtype : data-type, optional Overrides the data type of the result. .. versionadded:: 1.6.0 order : {'C', 'F', 'A', or 'K'}, optional Overrides the memory layout of the result. 'C' means C-order, 'F' means F-order, 'A' means 'F' if ``a`` is Fortran contiguous, 'C' otherwise. 'K' means match the layout of ``a`` as closely as possible. .. versionadded:: 1.6.0 subok : bool, optional. If True, then the newly created array will use the sub-class type of 'a', otherwise it will be a base-class array. Defaults to True. Returns ------- out : ndarray Array of uninitialized (arbitrary) data with the same shape and type as `a`. See Also -------- ones_like : Return an array of ones with shape and type of input. zeros_like : Return an array of zeros with shape and type of input. empty : Return a new uninitialized array. ones : Return a new array setting values to one. zeros : Return a new array setting values to zero. Notes ----- This function does *not* initialize the returned array; to do that use `zeros_like` or `ones_like` instead. It may be marginally faster than the functions that do set the array values. Examples -------- >>> a = ([1,2,3], [4,5,6]) # a is array-like >>> np.empty_like(a) array([[-1073741821, -1073741821, 3], #random [ 0, 0, -1073741821]]) >>> a = np.array([[1., 2., 3.],[4.,5.,6.]]) >>> np.empty_like(a) array([[ -2.00000715e+000, 1.48219694e-323, -2.00000572e+000],#random [ 4.38791518e-305, -2.00000715e+000, 4.17269252e-309]]) """) add_newdoc('numpy.core.multiarray', 'scalar', """ scalar(dtype, obj) Return a new scalar array of the given type initialized with obj. This function is meant mainly for pickle support. `dtype` must be a valid data-type descriptor. If `dtype` corresponds to an object descriptor, then `obj` can be any object, otherwise `obj` must be a string. If `obj` is not given, it will be interpreted as None for object type and as zeros for all other types. """) add_newdoc('numpy.core.multiarray', 'zeros', """ zeros(shape, dtype=float, order='C') Return a new array of given shape and type, filled with zeros. Parameters ---------- shape : int or sequence of ints Shape of the new array, e.g., ``(2, 3)`` or ``2``. dtype : data-type, optional The desired data-type for the array, e.g., `numpy.int8`. Default is `numpy.float64`. order : {'C', 'F'}, optional Whether to store multidimensional data in C- or Fortran-contiguous (row- or column-wise) order in memory. Returns ------- out : ndarray Array of zeros with the given shape, dtype, and order. See Also -------- zeros_like : Return an array of zeros with shape and type of input. ones_like : Return an array of ones with shape and type of input. empty_like : Return an empty array with shape and type of input. ones : Return a new array setting values to one. empty : Return a new uninitialized array. Examples -------- >>> np.zeros(5) array([ 0., 0., 0., 0., 0.]) >>> np.zeros((5,), dtype=int) array([0, 0, 0, 0, 0]) >>> np.zeros((2, 1)) array([[ 0.], [ 0.]]) >>> s = (2,2) >>> np.zeros(s) array([[ 0., 0.], [ 0., 0.]]) >>> np.zeros((2,), dtype=[('x', 'i4'), ('y', 'i4')]) # custom dtype array([(0, 0), (0, 0)], dtype=[('x', '<i4'), ('y', '<i4')]) """) add_newdoc('numpy.core.multiarray', 'set_typeDict', """set_typeDict(dict) Set the internal dictionary that can look up an array type using a registered code. """) add_newdoc('numpy.core.multiarray', 'fromstring', """ fromstring(string, dtype=float, count=-1, sep='') A new 1-D array initialized from text data in a string. Parameters ---------- string : str A string containing the data. dtype : data-type, optional The data type of the array; default: float. For binary input data, the data must be in exactly this format. count : int, optional Read this number of `dtype` elements from the data. If this is negative (the default), the count will be determined from the length of the data. sep : str, optional The string separating numbers in the data; extra whitespace between elements is also ignored. .. deprecated:: 1.14 If this argument is not provided, `fromstring` falls back on the behaviour of `frombuffer` after encoding unicode string inputs as either utf-8 (python 3), or the default encoding (python 2). Returns ------- arr : ndarray The constructed array. Raises ------ ValueError If the string is not the correct size to satisfy the requested `dtype` and `count`. See Also -------- frombuffer, fromfile, fromiter Examples -------- >>> np.fromstring('1 2', dtype=int, sep=' ') array([1, 2]) >>> np.fromstring('1, 2', dtype=int, sep=',') array([1, 2]) """) add_newdoc('numpy.core.multiarray', 'fromiter', """ fromiter(iterable, dtype, count=-1) Create a new 1-dimensional array from an iterable object. Parameters ---------- iterable : iterable object An iterable object providing data for the array. dtype : data-type The data-type of the returned array. count : int, optional The number of items to read from *iterable*. The default is -1, which means all data is read. Returns ------- out : ndarray The output array. Notes ----- Specify `count` to improve performance. It allows ``fromiter`` to pre-allocate the output array, instead of resizing it on demand. Examples -------- >>> iterable = (x*x for x in range(5)) >>> np.fromiter(iterable, float) array([ 0., 1., 4., 9., 16.]) """) add_newdoc('numpy.core.multiarray', 'fromfile', """ fromfile(file, dtype=float, count=-1, sep='') Construct an array from data in a text or binary file. A highly efficient way of reading binary data with a known data-type, as well as parsing simply formatted text files. Data written using the `tofile` method can be read using this function. Parameters ---------- file : file or str Open file object or filename. dtype : data-type Data type of the returned array. For binary files, it is used to determine the size and byte-order of the items in the file. count : int Number of items to read. ``-1`` means all items (i.e., the complete file). sep : str Separator between items if file is a text file. Empty ("") separator means the file should be treated as binary. Spaces (" ") in the separator match zero or more whitespace characters. A separator consisting only of spaces must match at least one whitespace. See also -------- load, save ndarray.tofile loadtxt : More flexible way of loading data from a text file. Notes ----- Do not rely on the combination of `tofile` and `fromfile` for data storage, as the binary files generated are are not platform independent. In particular, no byte-order or data-type information is saved. Data can be stored in the platform independent ``.npy`` format using `save` and `load` instead. Examples -------- Construct an ndarray: >>> dt = np.dtype([('time', [('min', int), ('sec', int)]), ... ('temp', float)]) >>> x = np.zeros((1,), dtype=dt) >>> x['time']['min'] = 10; x['temp'] = 98.25 >>> x array([((10, 0), 98.25)], dtype=[('time', [('min', '<i4'), ('sec', '<i4')]), ('temp', '<f8')]) Save the raw data to disk: >>> import os >>> fname = os.tmpnam() >>> x.tofile(fname) Read the raw data from disk: >>> np.fromfile(fname, dtype=dt) array([((10, 0), 98.25)], dtype=[('time', [('min', '<i4'), ('sec', '<i4')]), ('temp', '<f8')]) The recommended way to store and load data: >>> np.save(fname, x) >>> np.load(fname + '.npy') array([((10, 0), 98.25)], dtype=[('time', [('min', '<i4'), ('sec', '<i4')]), ('temp', '<f8')]) """) add_newdoc('numpy.core.multiarray', 'frombuffer', """ frombuffer(buffer, dtype=float, count=-1, offset=0) Interpret a buffer as a 1-dimensional array. Parameters ---------- buffer : buffer_like An object that exposes the buffer interface. dtype : data-type, optional Data-type of the returned array; default: float. count : int, optional Number of items to read. ``-1`` means all data in the buffer. offset : int, optional Start reading the buffer from this offset (in bytes); default: 0. Notes ----- If the buffer has data that is not in machine byte-order, this should be specified as part of the data-type, e.g.:: >>> dt = np.dtype(int) >>> dt = dt.newbyteorder('>') >>> np.frombuffer(buf, dtype=dt) The data of the resulting array will not be byteswapped, but will be interpreted correctly. Examples -------- >>> s = 'hello world' >>> np.frombuffer(s, dtype='S1', count=5, offset=6) array(['w', 'o', 'r', 'l', 'd'], dtype='|S1') >>> np.frombuffer(b'\\x01\\x02', dtype=np.uint8) array([1, 2], dtype=uint8) >>> np.frombuffer(b'\\x01\\x02\\x03\\x04\\x05', dtype=np.uint8, count=3) array([1, 2, 3], dtype=uint8) """) add_newdoc('numpy.core.multiarray', 'concatenate', """ concatenate((a1, a2, ...), axis=0, out=None) Join a sequence of arrays along an existing axis. Parameters ---------- a1, a2, ... : sequence of array_like The arrays must have the same shape, except in the dimension corresponding to `axis` (the first, by default). axis : int, optional The axis along which the arrays will be joined. Default is 0. out : ndarray, optional If provided, the destination to place the result. The shape must be correct, matching that of what concatenate would have returned if no out argument were specified. Returns ------- res : ndarray The concatenated array. See Also -------- ma.concatenate : Concatenate function that preserves input masks. array_split : Split an array into multiple sub-arrays of equal or near-equal size. split : Split array into a list of multiple sub-arrays of equal size. hsplit : Split array into multiple sub-arrays horizontally (column wise) vsplit : Split array into multiple sub-arrays vertically (row wise) dsplit : Split array into multiple sub-arrays along the 3rd axis (depth). stack : Stack a sequence of arrays along a new axis. hstack : Stack arrays in sequence horizontally (column wise) vstack : Stack arrays in sequence vertically (row wise) dstack : Stack arrays in sequence depth wise (along third dimension) Notes ----- When one or more of the arrays to be concatenated is a MaskedArray, this function will return a MaskedArray object instead of an ndarray, but the input masks are *not* preserved. In cases where a MaskedArray is expected as input, use the ma.concatenate function from the masked array module instead. Examples -------- >>> a = np.array([[1, 2], [3, 4]]) >>> b = np.array([[5, 6]]) >>> np.concatenate((a, b), axis=0) array([[1, 2], [3, 4], [5, 6]]) >>> np.concatenate((a, b.T), axis=1) array([[1, 2, 5], [3, 4, 6]]) This function will not preserve masking of MaskedArray inputs. >>> a = np.ma.arange(3) >>> a[1] = np.ma.masked >>> b = np.arange(2, 5) >>> a masked_array(data = [0 -- 2], mask = [False True False], fill_value = 999999) >>> b array([2, 3, 4]) >>> np.concatenate([a, b]) masked_array(data = [0 1 2 2 3 4], mask = False, fill_value = 999999) >>> np.ma.concatenate([a, b]) masked_array(data = [0 -- 2 2 3 4], mask = [False True False False False False], fill_value = 999999) """) add_newdoc('numpy.core', 'inner', """ inner(a, b) Inner product of two arrays. Ordinary inner product of vectors for 1-D arrays (without complex conjugation), in higher dimensions a sum product over the last axes. Parameters ---------- a, b : array_like If `a` and `b` are nonscalar, their last dimensions must match. Returns ------- out : ndarray `out.shape = a.shape[:-1] + b.shape[:-1]` Raises ------ ValueError If the last dimension of `a` and `b` has different size. See Also -------- tensordot : Sum products over arbitrary axes. dot : Generalised matrix product, using second last dimension of `b`. einsum : Einstein summation convention. Notes ----- For vectors (1-D arrays) it computes the ordinary inner-product:: np.inner(a, b) = sum(a[:]*b[:]) More generally, if `ndim(a) = r > 0` and `ndim(b) = s > 0`:: np.inner(a, b) = np.tensordot(a, b, axes=(-1,-1)) or explicitly:: np.inner(a, b)[i0,...,ir-1,j0,...,js-1] = sum(a[i0,...,ir-1,:]*b[j0,...,js-1,:]) In addition `a` or `b` may be scalars, in which case:: np.inner(a,b) = a*b Examples -------- Ordinary inner product for vectors: >>> a = np.array([1,2,3]) >>> b = np.array([0,1,0]) >>> np.inner(a, b) 2 A multidimensional example: >>> a = np.arange(24).reshape((2,3,4)) >>> b = np.arange(4) >>> np.inner(a, b) array([[ 14, 38, 62], [ 86, 110, 134]]) An example where `b` is a scalar: >>> np.inner(np.eye(2), 7) array([[ 7., 0.], [ 0., 7.]]) """) add_newdoc('numpy.core', 'fastCopyAndTranspose', """_fastCopyAndTranspose(a)""") add_newdoc('numpy.core.multiarray', 'correlate', """cross_correlate(a,v, mode=0)""") add_newdoc('numpy.core.multiarray', 'arange', """ arange([start,] stop[, step,], dtype=None) Return evenly spaced values within a given interval. Values are generated within the half-open interval ``[start, stop)`` (in other words, the interval including `start` but excluding `stop`). For integer arguments the function is equivalent to the Python built-in `range <http://docs.python.org/lib/built-in-funcs.html>`_ function, but returns an ndarray rather than a list. When using a non-integer step, such as 0.1, the results will often not be consistent. It is better to use ``linspace`` for these cases. Parameters ---------- start : number, optional Start of interval. The interval includes this value. The default start value is 0. stop : number End of interval. The interval does not include this value, except in some cases where `step` is not an integer and floating point round-off affects the length of `out`. step : number, optional Spacing between values. For any output `out`, this is the distance between two adjacent values, ``out[i+1] - out[i]``. The default step size is 1. If `step` is specified as a position argument, `start` must also be given. dtype : dtype The type of the output array. If `dtype` is not given, infer the data type from the other input arguments. Returns ------- arange : ndarray Array of evenly spaced values. For floating point arguments, the length of the result is ``ceil((stop - start)/step)``. Because of floating point overflow, this rule may result in the last element of `out` being greater than `stop`. See Also -------- linspace : Evenly spaced numbers with careful handling of endpoints. ogrid: Arrays of evenly spaced numbers in N-dimensions. mgrid: Grid-shaped arrays of evenly spaced numbers in N-dimensions. Examples -------- >>> np.arange(3) array([0, 1, 2]) >>> np.arange(3.0) array([ 0., 1., 2.]) >>> np.arange(3,7) array([3, 4, 5, 6]) >>> np.arange(3,7,2) array([3, 5]) """) add_newdoc('numpy.core.multiarray', '_get_ndarray_c_version', """_get_ndarray_c_version() Return the compile time NDARRAY_VERSION number. """) add_newdoc('numpy.core.multiarray', '_reconstruct', """_reconstruct(subtype, shape, dtype) Construct an empty array. Used by Pickles. """) add_newdoc('numpy.core.multiarray', 'set_string_function', """ set_string_function(f, repr=1) Internal method to set a function to be used when pretty printing arrays. """) add_newdoc('numpy.core.multiarray', 'set_numeric_ops', """ set_numeric_ops(op1=func1, op2=func2, ...) Set numerical operators for array objects. Parameters ---------- op1, op2, ... : callable Each ``op = func`` pair describes an operator to be replaced. For example, ``add = lambda x, y: np.add(x, y) % 5`` would replace addition by modulus 5 addition. Returns ------- saved_ops : list of callables A list of all operators, stored before making replacements. Notes ----- .. WARNING:: Use with care! Incorrect usage may lead to memory errors. A function replacing an operator cannot make use of that operator. For example, when replacing add, you may not use ``+``. Instead, directly call ufuncs. Examples -------- >>> def add_mod5(x, y): ... return np.add(x, y) % 5 ... >>> old_funcs = np.set_numeric_ops(add=add_mod5) >>> x = np.arange(12).reshape((3, 4)) >>> x + x array([[0, 2, 4, 1], [3, 0, 2, 4], [1, 3, 0, 2]]) >>> ignore = np.set_numeric_ops(**old_funcs) # restore operators """) add_newdoc('numpy.core.multiarray', 'where', """ where(condition, [x, y]) Return elements, either from `x` or `y`, depending on `condition`. If only `condition` is given, return ``condition.nonzero()``. Parameters ---------- condition : array_like, bool When True, yield `x`, otherwise yield `y`. x, y : array_like, optional Values from which to choose. `x`, `y` and `condition` need to be broadcastable to some shape. Returns ------- out : ndarray or tuple of ndarrays If both `x` and `y` are specified, the output array contains elements of `x` where `condition` is True, and elements from `y` elsewhere. If only `condition` is given, return the tuple ``condition.nonzero()``, the indices where `condition` is True. See Also -------- nonzero, choose Notes ----- If `x` and `y` are given and input arrays are 1-D, `where` is equivalent to:: [xv if c else yv for (c,xv,yv) in zip(condition,x,y)] Examples -------- >>> np.where([[True, False], [True, True]], ... [[1, 2], [3, 4]], ... [[9, 8], [7, 6]]) array([[1, 8], [3, 4]]) >>> np.where([[0, 1], [1, 0]]) (array([0, 1]), array([1, 0])) >>> x = np.arange(9.).reshape(3, 3) >>> np.where( x > 5 ) (array([2, 2, 2]), array([0, 1, 2])) >>> x[np.where( x > 3.0 )] # Note: result is 1D. array([ 4., 5., 6., 7., 8.]) >>> np.where(x < 5, x, -1) # Note: broadcasting. array([[ 0., 1., 2.], [ 3., 4., -1.], [-1., -1., -1.]]) Find the indices of elements of `x` that are in `goodvalues`. >>> goodvalues = [3, 4, 7] >>> ix = np.isin(x, goodvalues) >>> ix array([[False, False, False], [ True, True, False], [False, True, False]]) >>> np.where(ix) (array([1, 1, 2]), array([0, 1, 1])) """) add_newdoc('numpy.core.multiarray', 'lexsort', """ lexsort(keys, axis=-1) Perform an indirect sort using a sequence of keys. Given multiple sorting keys, which can be interpreted as columns in a spreadsheet, lexsort returns an array of integer indices that describes the sort order by multiple columns. The last key in the sequence is used for the primary sort order, the second-to-last key for the secondary sort order, and so on. The keys argument must be a sequence of objects that can be converted to arrays of the same shape. If a 2D array is provided for the keys argument, it's rows are interpreted as the sorting keys and sorting is according to the last row, second last row etc. Parameters ---------- keys : (k, N) array or tuple containing k (N,)-shaped sequences The `k` different "columns" to be sorted. The last column (or row if `keys` is a 2D array) is the primary sort key. axis : int, optional Axis to be indirectly sorted. By default, sort over the last axis. Returns ------- indices : (N,) ndarray of ints Array of indices that sort the keys along the specified axis. See Also -------- argsort : Indirect sort. ndarray.sort : In-place sort. sort : Return a sorted copy of an array. Examples -------- Sort names: first by surname, then by name. >>> surnames = ('Hertz', 'Galilei', 'Hertz') >>> first_names = ('Heinrich', 'Galileo', 'Gustav') >>> ind = np.lexsort((first_names, surnames)) >>> ind array([1, 2, 0]) >>> [surnames[i] + ", " + first_names[i] for i in ind] ['Galilei, Galileo', 'Hertz, Gustav', 'Hertz, Heinrich'] Sort two columns of numbers: >>> a = [1,5,1,4,3,4,4] # First column >>> b = [9,4,0,4,0,2,1] # Second column >>> ind = np.lexsort((b,a)) # Sort by a, then by b >>> print(ind) [2 0 4 6 5 3 1] >>> [(a[i],b[i]) for i in ind] [(1, 0), (1, 9), (3, 0), (4, 1), (4, 2), (4, 4), (5, 4)] Note that sorting is first according to the elements of ``a``. Secondary sorting is according to the elements of ``b``. A normal ``argsort`` would have yielded: >>> [(a[i],b[i]) for i in np.argsort(a)] [(1, 9), (1, 0), (3, 0), (4, 4), (4, 2), (4, 1), (5, 4)] Structured arrays are sorted lexically by ``argsort``: >>> x = np.array([(1,9), (5,4), (1,0), (4,4), (3,0), (4,2), (4,1)], ... dtype=np.dtype([('x', int), ('y', int)])) >>> np.argsort(x) # or np.argsort(x, order=('x', 'y')) array([2, 0, 4, 6, 5, 3, 1]) """) add_newdoc('numpy.core.multiarray', 'can_cast', """ can_cast(from_, to, casting='safe') Returns True if cast between data types can occur according to the casting rule. If from is a scalar or array scalar, also returns True if the scalar value can be cast without overflow or truncation to an integer. Parameters ---------- from_ : dtype, dtype specifier, scalar, or array Data type, scalar, or array to cast from. to : dtype or dtype specifier Data type to cast to. casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional Controls what kind of data casting may occur. * 'no' means the data types should not be cast at all. * 'equiv' means only byte-order changes are allowed. * 'safe' means only casts which can preserve values are allowed. * 'same_kind' means only safe casts or casts within a kind, like float64 to float32, are allowed. * 'unsafe' means any data conversions may be done. Returns ------- out : bool True if cast can occur according to the casting rule. Notes ----- Starting in NumPy 1.9, can_cast function now returns False in 'safe' casting mode for integer/float dtype and string dtype if the string dtype length is not long enough to store the max integer/float value converted to a string. Previously can_cast in 'safe' mode returned True for integer/float dtype and a string dtype of any length. See also -------- dtype, result_type Examples -------- Basic examples >>> np.can_cast(np.int32, np.int64) True >>> np.can_cast(np.float64, complex) True >>> np.can_cast(complex, float) False >>> np.can_cast('i8', 'f8') True >>> np.can_cast('i8', 'f4') False >>> np.can_cast('i4', 'S4') False Casting scalars >>> np.can_cast(100, 'i1') True >>> np.can_cast(150, 'i1') False >>> np.can_cast(150, 'u1') True >>> np.can_cast(3.5e100, np.float32) False >>> np.can_cast(1000.0, np.float32) True Array scalar checks the value, array does not >>> np.can_cast(np.array(1000.0), np.float32) True >>> np.can_cast(np.array([1000.0]), np.float32) False Using the casting rules >>> np.can_cast('i8', 'i8', 'no') True >>> np.can_cast('<i8', '>i8', 'no') False >>> np.can_cast('<i8', '>i8', 'equiv') True >>> np.can_cast('<i4', '>i8', 'equiv') False >>> np.can_cast('<i4', '>i8', 'safe') True >>> np.can_cast('<i8', '>i4', 'safe') False >>> np.can_cast('<i8', '>i4', 'same_kind') True >>> np.can_cast('<i8', '>u4', 'same_kind') False >>> np.can_cast('<i8', '>u4', 'unsafe') True """) add_newdoc('numpy.core.multiarray', 'promote_types', """ promote_types(type1, type2) Returns the data type with the smallest size and smallest scalar kind to which both ``type1`` and ``type2`` may be safely cast. The returned data type is always in native byte order. This function is symmetric and associative. Parameters ---------- type1 : dtype or dtype specifier First data type. type2 : dtype or dtype specifier Second data type. Returns ------- out : dtype The promoted data type. Notes ----- .. versionadded:: 1.6.0 Starting in NumPy 1.9, promote_types function now returns a valid string length when given an integer or float dtype as one argument and a string dtype as another argument. Previously it always returned the input string dtype, even if it wasn't long enough to store the max integer/float value converted to a string. See Also -------- result_type, dtype, can_cast Examples -------- >>> np.promote_types('f4', 'f8') dtype('float64') >>> np.promote_types('i8', 'f4') dtype('float64') >>> np.promote_types('>i8', '<c8') dtype('complex128') >>> np.promote_types('i4', 'S8') dtype('S11') """) add_newdoc('numpy.core.multiarray', 'min_scalar_type', """ min_scalar_type(a) For scalar ``a``, returns the data type with the smallest size and smallest scalar kind which can hold its value. For non-scalar array ``a``, returns the vector's dtype unmodified. Floating point values are not demoted to integers, and complex values are not demoted to floats. Parameters ---------- a : scalar or array_like The value whose minimal data type is to be found. Returns ------- out : dtype The minimal data type. Notes ----- .. versionadded:: 1.6.0 See Also -------- result_type, promote_types, dtype, can_cast Examples -------- >>> np.min_scalar_type(10) dtype('uint8') >>> np.min_scalar_type(-260) dtype('int16') >>> np.min_scalar_type(3.1) dtype('float16') >>> np.min_scalar_type(1e50) dtype('float64') >>> np.min_scalar_type(np.arange(4,dtype='f8')) dtype('float64') """) add_newdoc('numpy.core.multiarray', 'result_type', """ result_type(*arrays_and_dtypes) Returns the type that results from applying the NumPy type promotion rules to the arguments. Type promotion in NumPy works similarly to the rules in languages like C++, with some slight differences. When both scalars and arrays are used, the array's type takes precedence and the actual value of the scalar is taken into account. For example, calculating 3*a, where a is an array of 32-bit floats, intuitively should result in a 32-bit float output. If the 3 is a 32-bit integer, the NumPy rules indicate it can't convert losslessly into a 32-bit float, so a 64-bit float should be the result type. By examining the value of the constant, '3', we see that it fits in an 8-bit integer, which can be cast losslessly into the 32-bit float. Parameters ---------- arrays_and_dtypes : list of arrays and dtypes The operands of some operation whose result type is needed. Returns ------- out : dtype The result type. See also -------- dtype, promote_types, min_scalar_type, can_cast Notes ----- .. versionadded:: 1.6.0 The specific algorithm used is as follows. Categories are determined by first checking which of boolean, integer (int/uint), or floating point (float/complex) the maximum kind of all the arrays and the scalars are. If there are only scalars or the maximum category of the scalars is higher than the maximum category of the arrays, the data types are combined with :func:`promote_types` to produce the return value. Otherwise, `min_scalar_type` is called on each array, and the resulting data types are all combined with :func:`promote_types` to produce the return value. The set of int values is not a subset of the uint values for types with the same number of bits, something not reflected in :func:`min_scalar_type`, but handled as a special case in `result_type`. Examples -------- >>> np.result_type(3, np.arange(7, dtype='i1')) dtype('int8') >>> np.result_type('i4', 'c8') dtype('complex128') >>> np.result_type(3.0, -2) dtype('float64') """) add_newdoc('numpy.core.multiarray', 'newbuffer', """ newbuffer(size) Return a new uninitialized buffer object. Parameters ---------- size : int Size in bytes of returned buffer object. Returns ------- newbuffer : buffer object Returned, uninitialized buffer object of `size` bytes. """) add_newdoc('numpy.core.multiarray', 'getbuffer', """ getbuffer(obj [,offset[, size]]) Create a buffer object from the given object referencing a slice of length size starting at offset. Default is the entire buffer. A read-write buffer is attempted followed by a read-only buffer. Parameters ---------- obj : object offset : int, optional size : int, optional Returns ------- buffer_obj : buffer Examples -------- >>> buf = np.getbuffer(np.ones(5), 1, 3) >>> len(buf) 3 >>> buf[0] '\\x00' >>> buf <read-write buffer for 0x8af1e70, size 3, offset 1 at 0x8ba4ec0> """) add_newdoc('numpy.core', 'dot', """ dot(a, b, out=None) Dot product of two arrays. Specifically, - If both `a` and `b` are 1-D arrays, it is inner product of vectors (without complex conjugation). - If both `a` and `b` are 2-D arrays, it is matrix multiplication, but using :func:`matmul` or ``a @ b`` is preferred. - If either `a` or `b` is 0-D (scalar), it is equivalent to :func:`multiply` and using ``numpy.multiply(a, b)`` or ``a * b`` is preferred. - If `a` is an N-D array and `b` is a 1-D array, it is a sum product over the last axis of `a` and `b`. - If `a` is an N-D array and `b` is an M-D array (where ``M>=2``), it is a sum product over the last axis of `a` and the second-to-last axis of `b`:: dot(a, b)[i,j,k,m] = sum(a[i,j,:] * b[k,:,m]) Parameters ---------- a : array_like First argument. b : array_like Second argument. out : ndarray, optional Output argument. This must have the exact kind that would be returned if it was not used. In particular, it must have the right type, must be C-contiguous, and its dtype must be the dtype that would be returned for `dot(a,b)`. This is a performance feature. Therefore, if these conditions are not met, an exception is raised, instead of attempting to be flexible. Returns ------- output : ndarray Returns the dot product of `a` and `b`. If `a` and `b` are both scalars or both 1-D arrays then a scalar is returned; otherwise an array is returned. If `out` is given, then it is returned. Raises ------ ValueError If the last dimension of `a` is not the same size as the second-to-last dimension of `b`. See Also -------- vdot : Complex-conjugating dot product. tensordot : Sum products over arbitrary axes. einsum : Einstein summation convention. matmul : '@' operator as method with out parameter. Examples -------- >>> np.dot(3, 4) 12 Neither argument is complex-conjugated: >>> np.dot([2j, 3j], [2j, 3j]) (-13+0j) For 2-D arrays it is the matrix product: >>> a = [[1, 0], [0, 1]] >>> b = [[4, 1], [2, 2]] >>> np.dot(a, b) array([[4, 1], [2, 2]]) >>> a = np.arange(3*4*5*6).reshape((3,4,5,6)) >>> b = np.arange(3*4*5*6)[::-1].reshape((5,4,6,3)) >>> np.dot(a, b)[2,3,2,1,2,2] 499128 >>> sum(a[2,3,2,:] * b[1,2,:,2]) 499128 """) add_newdoc('numpy.core', 'matmul', """ matmul(a, b, out=None) Matrix product of two arrays. The behavior depends on the arguments in the following way. - If both arguments are 2-D they are multiplied like conventional matrices. - If either argument is N-D, N > 2, it is treated as a stack of matrices residing in the last two indexes and broadcast accordingly. - If the first argument is 1-D, it is promoted to a matrix by prepending a 1 to its dimensions. After matrix multiplication the prepended 1 is removed. - If the second argument is 1-D, it is promoted to a matrix by appending a 1 to its dimensions. After matrix multiplication the appended 1 is removed. Multiplication by a scalar is not allowed, use ``*`` instead. Note that multiplying a stack of matrices with a vector will result in a stack of vectors, but matmul will not recognize it as such. ``matmul`` differs from ``dot`` in two important ways. - Multiplication by scalars is not allowed. - Stacks of matrices are broadcast together as if the matrices were elements. .. warning:: This function is preliminary and included in NumPy 1.10.0 for testing and documentation. Its semantics will not change, but the number and order of the optional arguments will. .. versionadded:: 1.10.0 Parameters ---------- a : array_like First argument. b : array_like Second argument. out : ndarray, optional Output argument. This must have the exact kind that would be returned if it was not used. In particular, it must have the right type, must be C-contiguous, and its dtype must be the dtype that would be returned for `dot(a,b)`. This is a performance feature. Therefore, if these conditions are not met, an exception is raised, instead of attempting to be flexible. Returns ------- output : ndarray Returns the dot product of `a` and `b`. If `a` and `b` are both 1-D arrays then a scalar is returned; otherwise an array is returned. If `out` is given, then it is returned. Raises ------ ValueError If the last dimension of `a` is not the same size as the second-to-last dimension of `b`. If scalar value is passed. See Also -------- vdot : Complex-conjugating dot product. tensordot : Sum products over arbitrary axes. einsum : Einstein summation convention. dot : alternative matrix product with different broadcasting rules. Notes ----- The matmul function implements the semantics of the `@` operator introduced in Python 3.5 following PEP465. Examples -------- For 2-D arrays it is the matrix product: >>> a = [[1, 0], [0, 1]] >>> b = [[4, 1], [2, 2]] >>> np.matmul(a, b) array([[4, 1], [2, 2]]) For 2-D mixed with 1-D, the result is the usual. >>> a = [[1, 0], [0, 1]] >>> b = [1, 2] >>> np.matmul(a, b) array([1, 2]) >>> np.matmul(b, a) array([1, 2]) Broadcasting is conventional for stacks of arrays >>> a = np.arange(2*2*4).reshape((2,2,4)) >>> b = np.arange(2*2*4).reshape((2,4,2)) >>> np.matmul(a,b).shape (2, 2, 2) >>> np.matmul(a,b)[0,1,1] 98 >>> sum(a[0,1,:] * b[0,:,1]) 98 Vector, vector returns the scalar inner product, but neither argument is complex-conjugated: >>> np.matmul([2j, 3j], [2j, 3j]) (-13+0j) Scalar multiplication raises an error. >>> np.matmul([1,2], 3) Traceback (most recent call last): ... ValueError: Scalar operands are not allowed, use '*' instead """) add_newdoc('numpy.core', 'c_einsum', """ c_einsum(subscripts, *operands, out=None, dtype=None, order='K', casting='safe') Evaluates the Einstein summation convention on the operands. Using the Einstein summation convention, many common multi-dimensional array operations can be represented in a simple fashion. This function provides a way to compute such summations. The best way to understand this function is to try the examples below, which show how many common NumPy functions can be implemented as calls to `einsum`. This is the core C function. Parameters ---------- subscripts : str Specifies the subscripts for summation. operands : list of array_like These are the arrays for the operation. out : ndarray, optional If provided, the calculation is done into this array. dtype : {data-type, None}, optional If provided, forces the calculation to use the data type specified. Note that you may have to also give a more liberal `casting` parameter to allow the conversions. Default is None. order : {'C', 'F', 'A', 'K'}, optional Controls the memory layout of the output. 'C' means it should be C contiguous. 'F' means it should be Fortran contiguous, 'A' means it should be 'F' if the inputs are all 'F', 'C' otherwise. 'K' means it should be as close to the layout as the inputs as is possible, including arbitrarily permuted axes. Default is 'K'. casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional Controls what kind of data casting may occur. Setting this to 'unsafe' is not recommended, as it can adversely affect accumulations. * 'no' means the data types should not be cast at all. * 'equiv' means only byte-order changes are allowed. * 'safe' means only casts which can preserve values are allowed. * 'same_kind' means only safe casts or casts within a kind, like float64 to float32, are allowed. * 'unsafe' means any data conversions may be done. Default is 'safe'. Returns ------- output : ndarray The calculation based on the Einstein summation convention. See Also -------- einsum, dot, inner, outer, tensordot Notes ----- .. versionadded:: 1.6.0 The subscripts string is a comma-separated list of subscript labels, where each label refers to a dimension of the corresponding operand. Repeated subscripts labels in one operand take the diagonal. For example, ``np.einsum('ii', a)`` is equivalent to ``np.trace(a)``. Whenever a label is repeated, it is summed, so ``np.einsum('i,i', a, b)`` is equivalent to ``np.inner(a,b)``. If a label appears only once, it is not summed, so ``np.einsum('i', a)`` produces a view of ``a`` with no changes. The order of labels in the output is by default alphabetical. This means that ``np.einsum('ij', a)`` doesn't affect a 2D array, while ``np.einsum('ji', a)`` takes its transpose. The output can be controlled by specifying output subscript labels as well. This specifies the label order, and allows summing to be disallowed or forced when desired. The call ``np.einsum('i->', a)`` is like ``np.sum(a, axis=-1)``, and ``np.einsum('ii->i', a)`` is like ``np.diag(a)``. The difference is that `einsum` does not allow broadcasting by default. To enable and control broadcasting, use an ellipsis. Default NumPy-style broadcasting is done by adding an ellipsis to the left of each term, like ``np.einsum('...ii->...i', a)``. To take the trace along the first and last axes, you can do ``np.einsum('i...i', a)``, or to do a matrix-matrix product with the left-most indices instead of rightmost, you can do ``np.einsum('ij...,jk...->ik...', a, b)``. When there is only one operand, no axes are summed, and no output parameter is provided, a view into the operand is returned instead of a new array. Thus, taking the diagonal as ``np.einsum('ii->i', a)`` produces a view. An alternative way to provide the subscripts and operands is as ``einsum(op0, sublist0, op1, sublist1, ..., [sublistout])``. The examples below have corresponding `einsum` calls with the two parameter methods. .. versionadded:: 1.10.0 Views returned from einsum are now writeable whenever the input array is writeable. For example, ``np.einsum('ijk...->kji...', a)`` will now have the same effect as ``np.swapaxes(a, 0, 2)`` and ``np.einsum('ii->i', a)`` will return a writeable view of the diagonal of a 2D array. Examples -------- >>> a = np.arange(25).reshape(5,5) >>> b = np.arange(5) >>> c = np.arange(6).reshape(2,3) >>> np.einsum('ii', a) 60 >>> np.einsum(a, [0,0]) 60 >>> np.trace(a) 60 >>> np.einsum('ii->i', a) array([ 0, 6, 12, 18, 24]) >>> np.einsum(a, [0,0], [0]) array([ 0, 6, 12, 18, 24]) >>> np.diag(a) array([ 0, 6, 12, 18, 24]) >>> np.einsum('ij,j', a, b) array([ 30, 80, 130, 180, 230]) >>> np.einsum(a, [0,1], b, [1]) array([ 30, 80, 130, 180, 230]) >>> np.dot(a, b) array([ 30, 80, 130, 180, 230]) >>> np.einsum('...j,j', a, b) array([ 30, 80, 130, 180, 230]) >>> np.einsum('ji', c) array([[0, 3], [1, 4], [2, 5]]) >>> np.einsum(c, [1,0]) array([[0, 3], [1, 4], [2, 5]]) >>> c.T array([[0, 3], [1, 4], [2, 5]]) >>> np.einsum('..., ...', 3, c) array([[ 0, 3, 6], [ 9, 12, 15]]) >>> np.einsum(3, [Ellipsis], c, [Ellipsis]) array([[ 0, 3, 6], [ 9, 12, 15]]) >>> np.multiply(3, c) array([[ 0, 3, 6], [ 9, 12, 15]]) >>> np.einsum('i,i', b, b) 30 >>> np.einsum(b, [0], b, [0]) 30 >>> np.inner(b,b) 30 >>> np.einsum('i,j', np.arange(2)+1, b) array([[0, 1, 2, 3, 4], [0, 2, 4, 6, 8]]) >>> np.einsum(np.arange(2)+1, [0], b, [1]) array([[0, 1, 2, 3, 4], [0, 2, 4, 6, 8]]) >>> np.outer(np.arange(2)+1, b) array([[0, 1, 2, 3, 4], [0, 2, 4, 6, 8]]) >>> np.einsum('i...->...', a) array([50, 55, 60, 65, 70]) >>> np.einsum(a, [0,Ellipsis], [Ellipsis]) array([50, 55, 60, 65, 70]) >>> np.sum(a, axis=0) array([50, 55, 60, 65, 70]) >>> a = np.arange(60.).reshape(3,4,5) >>> b = np.arange(24.).reshape(4,3,2) >>> np.einsum('ijk,jil->kl', a, b) array([[ 4400., 4730.], [ 4532., 4874.], [ 4664., 5018.], [ 4796., 5162.], [ 4928., 5306.]]) >>> np.einsum(a, [0,1,2], b, [1,0,3], [2,3]) array([[ 4400., 4730.], [ 4532., 4874.], [ 4664., 5018.], [ 4796., 5162.], [ 4928., 5306.]]) >>> np.tensordot(a,b, axes=([1,0],[0,1])) array([[ 4400., 4730.], [ 4532., 4874.], [ 4664., 5018.], [ 4796., 5162.], [ 4928., 5306.]]) >>> a = np.arange(6).reshape((3,2)) >>> b = np.arange(12).reshape((4,3)) >>> np.einsum('ki,jk->ij', a, b) array([[10, 28, 46, 64], [13, 40, 67, 94]]) >>> np.einsum('ki,...k->i...', a, b) array([[10, 28, 46, 64], [13, 40, 67, 94]]) >>> np.einsum('k...,jk', a, b) array([[10, 28, 46, 64], [13, 40, 67, 94]]) >>> # since version 1.10.0 >>> a = np.zeros((3, 3)) >>> np.einsum('ii->i', a)[:] = 1 >>> a array([[ 1., 0., 0.], [ 0., 1., 0.], [ 0., 0., 1.]]) """) add_newdoc('numpy.core', 'vdot', """ vdot(a, b) Return the dot product of two vectors. The vdot(`a`, `b`) function handles complex numbers differently than dot(`a`, `b`). If the first argument is complex the complex conjugate of the first argument is used for the calculation of the dot product. Note that `vdot` handles multidimensional arrays differently than `dot`: it does *not* perform a matrix product, but flattens input arguments to 1-D vectors first. Consequently, it should only be used for vectors. Parameters ---------- a : array_like If `a` is complex the complex conjugate is taken before calculation of the dot product. b : array_like Second argument to the dot product. Returns ------- output : ndarray Dot product of `a` and `b`. Can be an int, float, or complex depending on the types of `a` and `b`. See Also -------- dot : Return the dot product without using the complex conjugate of the first argument. Examples -------- >>> a = np.array([1+2j,3+4j]) >>> b = np.array([5+6j,7+8j]) >>> np.vdot(a, b) (70-8j) >>> np.vdot(b, a) (70+8j) Note that higher-dimensional arrays are flattened! >>> a = np.array([[1, 4], [5, 6]]) >>> b = np.array([[4, 1], [2, 2]]) >>> np.vdot(a, b) 30 >>> np.vdot(b, a) 30 >>> 1*4 + 4*1 + 5*2 + 6*2 30 """) ############################################################################## # # Documentation for ndarray attributes and methods # ############################################################################## ############################################################################## # # ndarray object # ############################################################################## add_newdoc('numpy.core.multiarray', 'ndarray', """ ndarray(shape, dtype=float, buffer=None, offset=0, strides=None, order=None) An array object represents a multidimensional, homogeneous array of fixed-size items. An associated data-type object describes the format of each element in the array (its byte-order, how many bytes it occupies in memory, whether it is an integer, a floating point number, or something else, etc.) Arrays should be constructed using `array`, `zeros` or `empty` (refer to the See Also section below). The parameters given here refer to a low-level method (`ndarray(...)`) for instantiating an array. For more information, refer to the `numpy` module and examine the methods and attributes of an array. Parameters ---------- (for the __new__ method; see Notes below) shape : tuple of ints Shape of created array. dtype : data-type, optional Any object that can be interpreted as a numpy data type. buffer : object exposing buffer interface, optional Used to fill the array with data. offset : int, optional Offset of array data in buffer. strides : tuple of ints, optional Strides of data in memory. order : {'C', 'F'}, optional Row-major (C-style) or column-major (Fortran-style) order. Attributes ---------- T : ndarray Transpose of the array. data : buffer The array's elements, in memory. dtype : dtype object Describes the format of the elements in the array. flags : dict Dictionary containing information related to memory use, e.g., 'C_CONTIGUOUS', 'OWNDATA', 'WRITEABLE', etc. flat : numpy.flatiter object Flattened version of the array as an iterator. The iterator allows assignments, e.g., ``x.flat = 3`` (See `ndarray.flat` for assignment examples; TODO). imag : ndarray Imaginary part of the array. real : ndarray Real part of the array. size : int Number of elements in the array. itemsize : int The memory use of each array element in bytes. nbytes : int The total number of bytes required to store the array data, i.e., ``itemsize * size``. ndim : int The array's number of dimensions. shape : tuple of ints Shape of the array. strides : tuple of ints The step-size required to move from one element to the next in memory. For example, a contiguous ``(3, 4)`` array of type ``int16`` in C-order has strides ``(8, 2)``. This implies that to move from element to element in memory requires jumps of 2 bytes. To move from row-to-row, one needs to jump 8 bytes at a time (``2 * 4``). ctypes : ctypes object Class containing properties of the array needed for interaction with ctypes. base : ndarray If the array is a view into another array, that array is its `base` (unless that array is also a view). The `base` array is where the array data is actually stored. See Also -------- array : Construct an array. zeros : Create an array, each element of which is zero. empty : Create an array, but leave its allocated memory unchanged (i.e., it contains "garbage"). dtype : Create a data-type. Notes ----- There are two modes of creating an array using ``__new__``: 1. If `buffer` is None, then only `shape`, `dtype`, and `order` are used. 2. If `buffer` is an object exposing the buffer interface, then all keywords are interpreted. No ``__init__`` method is needed because the array is fully initialized after the ``__new__`` method. Examples -------- These examples illustrate the low-level `ndarray` constructor. Refer to the `See Also` section above for easier ways of constructing an ndarray. First mode, `buffer` is None: >>> np.ndarray(shape=(2,2), dtype=float, order='F') array([[ -1.13698227e+002, 4.25087011e-303], [ 2.88528414e-306, 3.27025015e-309]]) #random Second mode: >>> np.ndarray((2,), buffer=np.array([1,2,3]), ... offset=np.int_().itemsize, ... dtype=int) # offset = 1*itemsize, i.e. skip first element array([2, 3]) """) ############################################################################## # # ndarray attributes # ############################################################################## add_newdoc('numpy.core.multiarray', 'ndarray', ('__array_interface__', """Array protocol: Python side.""")) add_newdoc('numpy.core.multiarray', 'ndarray', ('__array_finalize__', """None.""")) add_newdoc('numpy.core.multiarray', 'ndarray', ('__array_priority__', """Array priority.""")) add_newdoc('numpy.core.multiarray', 'ndarray', ('__array_struct__', """Array protocol: C-struct side.""")) add_newdoc('numpy.core.multiarray', 'ndarray', ('_as_parameter_', """Allow the array to be interpreted as a ctypes object by returning the data-memory location as an integer """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('base', """ Base object if memory is from some other object. Examples -------- The base of an array that owns its memory is None: >>> x = np.array([1,2,3,4]) >>> x.base is None True Slicing creates a view, whose memory is shared with x: >>> y = x[2:] >>> y.base is x True """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('ctypes', """ An object to simplify the interaction of the array with the ctypes module. This attribute creates an object that makes it easier to use arrays when calling shared libraries with the ctypes module. The returned object has, among others, data, shape, and strides attributes (see Notes below) which themselves return ctypes objects that can be used as arguments to a shared library. Parameters ---------- None Returns ------- c : Python object Possessing attributes data, shape, strides, etc. See Also -------- numpy.ctypeslib Notes ----- Below are the public attributes of this object which were documented in "Guide to NumPy" (we have omitted undocumented public attributes, as well as documented private attributes): * data: A pointer to the memory area of the array as a Python integer. This memory area may contain data that is not aligned, or not in correct byte-order. The memory area may not even be writeable. The array flags and data-type of this array should be respected when passing this attribute to arbitrary C-code to avoid trouble that can include Python crashing. User Beware! The value of this attribute is exactly the same as self._array_interface_['data'][0]. * shape (c_intp*self.ndim): A ctypes array of length self.ndim where the basetype is the C-integer corresponding to dtype('p') on this platform. This base-type could be c_int, c_long, or c_longlong depending on the platform. The c_intp type is defined accordingly in numpy.ctypeslib. The ctypes array contains the shape of the underlying array. * strides (c_intp*self.ndim): A ctypes array of length self.ndim where the basetype is the same as for the shape attribute. This ctypes array contains the strides information from the underlying array. This strides information is important for showing how many bytes must be jumped to get to the next element in the array. * data_as(obj): Return the data pointer cast to a particular c-types object. For example, calling self._as_parameter_ is equivalent to self.data_as(ctypes.c_void_p). Perhaps you want to use the data as a pointer to a ctypes array of floating-point data: self.data_as(ctypes.POINTER(ctypes.c_double)). * shape_as(obj): Return the shape tuple as an array of some other c-types type. For example: self.shape_as(ctypes.c_short). * strides_as(obj): Return the strides tuple as an array of some other c-types type. For example: self.strides_as(ctypes.c_longlong). Be careful using the ctypes attribute - especially on temporary arrays or arrays constructed on the fly. For example, calling ``(a+b).ctypes.data_as(ctypes.c_void_p)`` returns a pointer to memory that is invalid because the array created as (a+b) is deallocated before the next Python statement. You can avoid this problem using either ``c=a+b`` or ``ct=(a+b).ctypes``. In the latter case, ct will hold a reference to the array until ct is deleted or re-assigned. If the ctypes module is not available, then the ctypes attribute of array objects still returns something useful, but ctypes objects are not returned and errors may be raised instead. In particular, the object will still have the as parameter attribute which will return an integer equal to the data attribute. Examples -------- >>> import ctypes >>> x array([[0, 1], [2, 3]]) >>> x.ctypes.data 30439712 >>> x.ctypes.data_as(ctypes.POINTER(ctypes.c_long)) <ctypes.LP_c_long object at 0x01F01300> >>> x.ctypes.data_as(ctypes.POINTER(ctypes.c_long)).contents c_long(0) >>> x.ctypes.data_as(ctypes.POINTER(ctypes.c_longlong)).contents c_longlong(4294967296L) >>> x.ctypes.shape <numpy.core._internal.c_long_Array_2 object at 0x01FFD580> >>> x.ctypes.shape_as(ctypes.c_long) <numpy.core._internal.c_long_Array_2 object at 0x01FCE620> >>> x.ctypes.strides <numpy.core._internal.c_long_Array_2 object at 0x01FCE620> >>> x.ctypes.strides_as(ctypes.c_longlong) <numpy.core._internal.c_longlong_Array_2 object at 0x01F01300> """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('data', """Python buffer object pointing to the start of the array's data.""")) add_newdoc('numpy.core.multiarray', 'ndarray', ('dtype', """ Data-type of the array's elements. Parameters ---------- None Returns ------- d : numpy dtype object See Also -------- numpy.dtype Examples -------- >>> x array([[0, 1], [2, 3]]) >>> x.dtype dtype('int32') >>> type(x.dtype) <type 'numpy.dtype'> """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('imag', """ The imaginary part of the array. Examples -------- >>> x = np.sqrt([1+0j, 0+1j]) >>> x.imag array([ 0. , 0.70710678]) >>> x.imag.dtype dtype('float64') """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('itemsize', """ Length of one array element in bytes. Examples -------- >>> x = np.array([1,2,3], dtype=np.float64) >>> x.itemsize 8 >>> x = np.array([1,2,3], dtype=np.complex128) >>> x.itemsize 16 """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('flags', """ Information about the memory layout of the array. Attributes ---------- C_CONTIGUOUS (C) The data is in a single, C-style contiguous segment. F_CONTIGUOUS (F) The data is in a single, Fortran-style contiguous segment. OWNDATA (O) The array owns the memory it uses or borrows it from another object. WRITEABLE (W) The data area can be written to. Setting this to False locks the data, making it read-only. A view (slice, etc.) inherits WRITEABLE from its base array at creation time, but a view of a writeable array may be subsequently locked while the base array remains writeable. (The opposite is not true, in that a view of a locked array may not be made writeable. However, currently, locking a base object does not lock any views that already reference it, so under that circumstance it is possible to alter the contents of a locked array via a previously created writeable view onto it.) Attempting to change a non-writeable array raises a RuntimeError exception. ALIGNED (A) The data and all elements are aligned appropriately for the hardware. WRITEBACKIFCOPY (X) This array is a copy of some other array. The C-API function PyArray_ResolveWritebackIfCopy must be called before deallocating to the base array will be updated with the contents of this array. UPDATEIFCOPY (U) (Deprecated, use WRITEBACKIFCOPY) This array is a copy of some other array. When this array is deallocated, the base array will be updated with the contents of this array. FNC F_CONTIGUOUS and not C_CONTIGUOUS. FORC F_CONTIGUOUS or C_CONTIGUOUS (one-segment test). BEHAVED (B) ALIGNED and WRITEABLE. CARRAY (CA) BEHAVED and C_CONTIGUOUS. FARRAY (FA) BEHAVED and F_CONTIGUOUS and not C_CONTIGUOUS. Notes ----- The `flags` object can be accessed dictionary-like (as in ``a.flags['WRITEABLE']``), or by using lowercased attribute names (as in ``a.flags.writeable``). Short flag names are only supported in dictionary access. Only the WRITEBACKIFCOPY, UPDATEIFCOPY, WRITEABLE, and ALIGNED flags can be changed by the user, via direct assignment to the attribute or dictionary entry, or by calling `ndarray.setflags`. The array flags cannot be set arbitrarily: - UPDATEIFCOPY can only be set ``False``. - WRITEBACKIFCOPY can only be set ``False``. - ALIGNED can only be set ``True`` if the data is truly aligned. - WRITEABLE can only be set ``True`` if the array owns its own memory or the ultimate owner of the memory exposes a writeable buffer interface or is a string. Arrays can be both C-style and Fortran-style contiguous simultaneously. This is clear for 1-dimensional arrays, but can also be true for higher dimensional arrays. Even for contiguous arrays a stride for a given dimension ``arr.strides[dim]`` may be *arbitrary* if ``arr.shape[dim] == 1`` or the array has no elements. It does *not* generally hold that ``self.strides[-1] == self.itemsize`` for C-style contiguous arrays or ``self.strides[0] == self.itemsize`` for Fortran-style contiguous arrays is true. """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('flat', """ A 1-D iterator over the array. This is a `numpy.flatiter` instance, which acts similarly to, but is not a subclass of, Python's built-in iterator object. See Also -------- flatten : Return a copy of the array collapsed into one dimension. flatiter Examples -------- >>> x = np.arange(1, 7).reshape(2, 3) >>> x array([[1, 2, 3], [4, 5, 6]]) >>> x.flat[3] 4 >>> x.T array([[1, 4], [2, 5], [3, 6]]) >>> x.T.flat[3] 5 >>> type(x.flat) <type 'numpy.flatiter'> An assignment example: >>> x.flat = 3; x array([[3, 3, 3], [3, 3, 3]]) >>> x.flat[[1,4]] = 1; x array([[3, 1, 3], [3, 1, 3]]) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('nbytes', """ Total bytes consumed by the elements of the array. Notes ----- Does not include memory consumed by non-element attributes of the array object. Examples -------- >>> x = np.zeros((3,5,2), dtype=np.complex128) >>> x.nbytes 480 >>> np.prod(x.shape) * x.itemsize 480 """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('ndim', """ Number of array dimensions. Examples -------- >>> x = np.array([1, 2, 3]) >>> x.ndim 1 >>> y = np.zeros((2, 3, 4)) >>> y.ndim 3 """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('real', """ The real part of the array. Examples -------- >>> x = np.sqrt([1+0j, 0+1j]) >>> x.real array([ 1. , 0.70710678]) >>> x.real.dtype dtype('float64') See Also -------- numpy.real : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('shape', """ Tuple of array dimensions. The shape property is usually used to get the current shape of an array, but may also be used to reshape the array in-place by assigning a tuple of array dimensions to it. As with `numpy.reshape`, one of the new shape dimensions can be -1, in which case its value is inferred from the size of the array and the remaining dimensions. Reshaping an array in-place will fail if a copy is required. Examples -------- >>> x = np.array([1, 2, 3, 4]) >>> x.shape (4,) >>> y = np.zeros((2, 3, 4)) >>> y.shape (2, 3, 4) >>> y.shape = (3, 8) >>> y array([[ 0., 0., 0., 0., 0., 0., 0., 0.], [ 0., 0., 0., 0., 0., 0., 0., 0.], [ 0., 0., 0., 0., 0., 0., 0., 0.]]) >>> y.shape = (3, 6) Traceback (most recent call last): File "<stdin>", line 1, in <module> ValueError: total size of new array must be unchanged >>> np.zeros((4,2))[::2].shape = (-1,) Traceback (most recent call last): File "<stdin>", line 1, in <module> AttributeError: incompatible shape for a non-contiguous array See Also -------- numpy.reshape : similar function ndarray.reshape : similar method """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('size', """ Number of elements in the array. Equivalent to ``np.prod(a.shape)``, i.e., the product of the array's dimensions. Examples -------- >>> x = np.zeros((3, 5, 2), dtype=np.complex128) >>> x.size 30 >>> np.prod(x.shape) 30 """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('strides', """ Tuple of bytes to step in each dimension when traversing an array. The byte offset of element ``(i[0], i[1], ..., i[n])`` in an array `a` is:: offset = sum(np.array(i) * a.strides) A more detailed explanation of strides can be found in the "ndarray.rst" file in the NumPy reference guide. Notes ----- Imagine an array of 32-bit integers (each 4 bytes):: x = np.array([[0, 1, 2, 3, 4], [5, 6, 7, 8, 9]], dtype=np.int32) This array is stored in memory as 40 bytes, one after the other (known as a contiguous block of memory). The strides of an array tell us how many bytes we have to skip in memory to move to the next position along a certain axis. For example, we have to skip 4 bytes (1 value) to move to the next column, but 20 bytes (5 values) to get to the same position in the next row. As such, the strides for the array `x` will be ``(20, 4)``. See Also -------- numpy.lib.stride_tricks.as_strided Examples -------- >>> y = np.reshape(np.arange(2*3*4), (2,3,4)) >>> y array([[[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]], [[12, 13, 14, 15], [16, 17, 18, 19], [20, 21, 22, 23]]]) >>> y.strides (48, 16, 4) >>> y[1,1,1] 17 >>> offset=sum(y.strides * np.array((1,1,1))) >>> offset/y.itemsize 17 >>> x = np.reshape(np.arange(5*6*7*8), (5,6,7,8)).transpose(2,3,1,0) >>> x.strides (32, 4, 224, 1344) >>> i = np.array([3,5,2,2]) >>> offset = sum(i * x.strides) >>> x[3,5,2,2] 813 >>> offset / x.itemsize 813 """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('T', """ Same as self.transpose(), except that self is returned if self.ndim < 2. Examples -------- >>> x = np.array([[1.,2.],[3.,4.]]) >>> x array([[ 1., 2.], [ 3., 4.]]) >>> x.T array([[ 1., 3.], [ 2., 4.]]) >>> x = np.array([1.,2.,3.,4.]) >>> x array([ 1., 2., 3., 4.]) >>> x.T array([ 1., 2., 3., 4.]) """)) ############################################################################## # # ndarray methods # ############################################################################## add_newdoc('numpy.core.multiarray', 'ndarray', ('__array__', """ a.__array__(|dtype) -> reference if type unchanged, copy otherwise. Returns either a new reference to self if dtype is not given or a new array of provided data type if dtype is different from the current dtype of the array. """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('__array_prepare__', """a.__array_prepare__(obj) -> Object of same type as ndarray object obj. """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('__array_wrap__', """a.__array_wrap__(obj) -> Object of same type as ndarray object a. """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('__copy__', """a.__copy__() Used if :func:`copy.copy` is called on an array. Returns a copy of the array. Equivalent to ``a.copy(order='K')``. """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('__deepcopy__', """a.__deepcopy__(memo, /) -> Deep copy of array. Used if :func:`copy.deepcopy` is called on an array. """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('__reduce__', """a.__reduce__() For pickling. """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('__setstate__', """a.__setstate__(state, /) For unpickling. The `state` argument must be a sequence that contains the following elements: Parameters ---------- version : int optional pickle version. If omitted defaults to 0. shape : tuple dtype : data-type isFortran : bool rawdata : string or list a binary string with the data (or a list if 'a' is an object array) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('all', """ a.all(axis=None, out=None, keepdims=False) Returns True if all elements evaluate to True. Refer to `numpy.all` for full documentation. See Also -------- numpy.all : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('any', """ a.any(axis=None, out=None, keepdims=False) Returns True if any of the elements of `a` evaluate to True. Refer to `numpy.any` for full documentation. See Also -------- numpy.any : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('argmax', """ a.argmax(axis=None, out=None) Return indices of the maximum values along the given axis. Refer to `numpy.argmax` for full documentation. See Also -------- numpy.argmax : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('argmin', """ a.argmin(axis=None, out=None) Return indices of the minimum values along the given axis of `a`. Refer to `numpy.argmin` for detailed documentation. See Also -------- numpy.argmin : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('argsort', """ a.argsort(axis=-1, kind='quicksort', order=None) Returns the indices that would sort this array. Refer to `numpy.argsort` for full documentation. See Also -------- numpy.argsort : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('argpartition', """ a.argpartition(kth, axis=-1, kind='introselect', order=None) Returns the indices that would partition this array. Refer to `numpy.argpartition` for full documentation. .. versionadded:: 1.8.0 See Also -------- numpy.argpartition : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('astype', """ a.astype(dtype, order='K', casting='unsafe', subok=True, copy=True) Copy of the array, cast to a specified type. Parameters ---------- dtype : str or dtype Typecode or data-type to which the array is cast. order : {'C', 'F', 'A', 'K'}, optional Controls the memory layout order of the result. 'C' means C order, 'F' means Fortran order, 'A' means 'F' order if all the arrays are Fortran contiguous, 'C' order otherwise, and 'K' means as close to the order the array elements appear in memory as possible. Default is 'K'. casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional Controls what kind of data casting may occur. Defaults to 'unsafe' for backwards compatibility. * 'no' means the data types should not be cast at all. * 'equiv' means only byte-order changes are allowed. * 'safe' means only casts which can preserve values are allowed. * 'same_kind' means only safe casts or casts within a kind, like float64 to float32, are allowed. * 'unsafe' means any data conversions may be done. subok : bool, optional If True, then sub-classes will be passed-through (default), otherwise the returned array will be forced to be a base-class array. copy : bool, optional By default, astype always returns a newly allocated array. If this is set to false, and the `dtype`, `order`, and `subok` requirements are satisfied, the input array is returned instead of a copy. Returns ------- arr_t : ndarray Unless `copy` is False and the other conditions for returning the input array are satisfied (see description for `copy` input parameter), `arr_t` is a new array of the same shape as the input array, with dtype, order given by `dtype`, `order`. Notes ----- Starting in NumPy 1.9, astype method now returns an error if the string dtype to cast to is not long enough in 'safe' casting mode to hold the max value of integer/float array that is being casted. Previously the casting was allowed even if the result was truncated. Raises ------ ComplexWarning When casting from complex to float or int. To avoid this, one should use ``a.real.astype(t)``. Examples -------- >>> x = np.array([1, 2, 2.5]) >>> x array([ 1. , 2. , 2.5]) >>> x.astype(int) array([1, 2, 2]) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('byteswap', """ a.byteswap(inplace=False) Swap the bytes of the array elements Toggle between low-endian and big-endian data representation by returning a byteswapped array, optionally swapped in-place. Parameters ---------- inplace : bool, optional If ``True``, swap bytes in-place, default is ``False``. Returns ------- out : ndarray The byteswapped array. If `inplace` is ``True``, this is a view to self. Examples -------- >>> A = np.array([1, 256, 8755], dtype=np.int16) >>> map(hex, A) ['0x1', '0x100', '0x2233'] >>> A.byteswap(inplace=True) array([ 256, 1, 13090], dtype=int16) >>> map(hex, A) ['0x100', '0x1', '0x3322'] Arrays of strings are not swapped >>> A = np.array(['ceg', 'fac']) >>> A.byteswap() array(['ceg', 'fac'], dtype='|S3') """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('choose', """ a.choose(choices, out=None, mode='raise') Use an index array to construct a new array from a set of choices. Refer to `numpy.choose` for full documentation. See Also -------- numpy.choose : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('clip', """ a.clip(min=None, max=None, out=None) Return an array whose values are limited to ``[min, max]``. One of max or min must be given. Refer to `numpy.clip` for full documentation. See Also -------- numpy.clip : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('compress', """ a.compress(condition, axis=None, out=None) Return selected slices of this array along given axis. Refer to `numpy.compress` for full documentation. See Also -------- numpy.compress : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('conj', """ a.conj() Complex-conjugate all elements. Refer to `numpy.conjugate` for full documentation. See Also -------- numpy.conjugate : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('conjugate', """ a.conjugate() Return the complex conjugate, element-wise. Refer to `numpy.conjugate` for full documentation. See Also -------- numpy.conjugate : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('copy', """ a.copy(order='C') Return a copy of the array. Parameters ---------- order : {'C', 'F', 'A', 'K'}, optional Controls the memory layout of the copy. 'C' means C-order, 'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous, 'C' otherwise. 'K' means match the layout of `a` as closely as possible. (Note that this function and :func:`numpy.copy` are very similar, but have different default values for their order= arguments.) See also -------- numpy.copy numpy.copyto Examples -------- >>> x = np.array([[1,2,3],[4,5,6]], order='F') >>> y = x.copy() >>> x.fill(0) >>> x array([[0, 0, 0], [0, 0, 0]]) >>> y array([[1, 2, 3], [4, 5, 6]]) >>> y.flags['C_CONTIGUOUS'] True """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('cumprod', """ a.cumprod(axis=None, dtype=None, out=None) Return the cumulative product of the elements along the given axis. Refer to `numpy.cumprod` for full documentation. See Also -------- numpy.cumprod : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('cumsum', """ a.cumsum(axis=None, dtype=None, out=None) Return the cumulative sum of the elements along the given axis. Refer to `numpy.cumsum` for full documentation. See Also -------- numpy.cumsum : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('diagonal', """ a.diagonal(offset=0, axis1=0, axis2=1) Return specified diagonals. In NumPy 1.9 the returned array is a read-only view instead of a copy as in previous NumPy versions. In a future version the read-only restriction will be removed. Refer to :func:`numpy.diagonal` for full documentation. See Also -------- numpy.diagonal : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('dot', """ a.dot(b, out=None) Dot product of two arrays. Refer to `numpy.dot` for full documentation. See Also -------- numpy.dot : equivalent function Examples -------- >>> a = np.eye(2) >>> b = np.ones((2, 2)) * 2 >>> a.dot(b) array([[ 2., 2.], [ 2., 2.]]) This array method can be conveniently chained: >>> a.dot(b).dot(b) array([[ 8., 8.], [ 8., 8.]]) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('dump', """a.dump(file) Dump a pickle of the array to the specified file. The array can be read back with pickle.load or numpy.load. Parameters ---------- file : str A string naming the dump file. """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('dumps', """ a.dumps() Returns the pickle of the array as a string. pickle.loads or numpy.loads will convert the string back to an array. Parameters ---------- None """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('fill', """ a.fill(value) Fill the array with a scalar value. Parameters ---------- value : scalar All elements of `a` will be assigned this value. Examples -------- >>> a = np.array([1, 2]) >>> a.fill(0) >>> a array([0, 0]) >>> a = np.empty(2) >>> a.fill(1) >>> a array([ 1., 1.]) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('flatten', """ a.flatten(order='C') Return a copy of the array collapsed into one dimension. Parameters ---------- order : {'C', 'F', 'A', 'K'}, optional 'C' means to flatten in row-major (C-style) order. 'F' means to flatten in column-major (Fortran- style) order. 'A' means to flatten in column-major order if `a` is Fortran *contiguous* in memory, row-major order otherwise. 'K' means to flatten `a` in the order the elements occur in memory. The default is 'C'. Returns ------- y : ndarray A copy of the input array, flattened to one dimension. See Also -------- ravel : Return a flattened array. flat : A 1-D flat iterator over the array. Examples -------- >>> a = np.array([[1,2], [3,4]]) >>> a.flatten() array([1, 2, 3, 4]) >>> a.flatten('F') array([1, 3, 2, 4]) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('getfield', """ a.getfield(dtype, offset=0) Returns a field of the given array as a certain type. A field is a view of the array data with a given data-type. The values in the view are determined by the given type and the offset into the current array in bytes. The offset needs to be such that the view dtype fits in the array dtype; for example an array of dtype complex128 has 16-byte elements. If taking a view with a 32-bit integer (4 bytes), the offset needs to be between 0 and 12 bytes. Parameters ---------- dtype : str or dtype The data type of the view. The dtype size of the view can not be larger than that of the array itself. offset : int Number of bytes to skip before beginning the element view. Examples -------- >>> x = np.diag([1.+1.j]*2) >>> x[1, 1] = 2 + 4.j >>> x array([[ 1.+1.j, 0.+0.j], [ 0.+0.j, 2.+4.j]]) >>> x.getfield(np.float64) array([[ 1., 0.], [ 0., 2.]]) By choosing an offset of 8 bytes we can select the complex part of the array for our view: >>> x.getfield(np.float64, offset=8) array([[ 1., 0.], [ 0., 4.]]) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('item', """ a.item(*args) Copy an element of an array to a standard Python scalar and return it. Parameters ---------- \\*args : Arguments (variable number and type) * none: in this case, the method only works for arrays with one element (`a.size == 1`), which element is copied into a standard Python scalar object and returned. * int_type: this argument is interpreted as a flat index into the array, specifying which element to copy and return. * tuple of int_types: functions as does a single int_type argument, except that the argument is interpreted as an nd-index into the array. Returns ------- z : Standard Python scalar object A copy of the specified element of the array as a suitable Python scalar Notes ----- When the data type of `a` is longdouble or clongdouble, item() returns a scalar array object because there is no available Python scalar that would not lose information. Void arrays return a buffer object for item(), unless fields are defined, in which case a tuple is returned. `item` is very similar to a[args], except, instead of an array scalar, a standard Python scalar is returned. This can be useful for speeding up access to elements of the array and doing arithmetic on elements of the array using Python's optimized math. Examples -------- >>> x = np.random.randint(9, size=(3, 3)) >>> x array([[3, 1, 7], [2, 8, 3], [8, 5, 3]]) >>> x.item(3) 2 >>> x.item(7) 5 >>> x.item((0, 1)) 1 >>> x.item((2, 2)) 3 """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('itemset', """ a.itemset(*args) Insert scalar into an array (scalar is cast to array's dtype, if possible) There must be at least 1 argument, and define the last argument as *item*. Then, ``a.itemset(*args)`` is equivalent to but faster than ``a[args] = item``. The item should be a scalar value and `args` must select a single item in the array `a`. Parameters ---------- \\*args : Arguments If one argument: a scalar, only used in case `a` is of size 1. If two arguments: the last argument is the value to be set and must be a scalar, the first argument specifies a single array element location. It is either an int or a tuple. Notes ----- Compared to indexing syntax, `itemset` provides some speed increase for placing a scalar into a particular location in an `ndarray`, if you must do this. However, generally this is discouraged: among other problems, it complicates the appearance of the code. Also, when using `itemset` (and `item`) inside a loop, be sure to assign the methods to a local variable to avoid the attribute look-up at each loop iteration. Examples -------- >>> x = np.random.randint(9, size=(3, 3)) >>> x array([[3, 1, 7], [2, 8, 3], [8, 5, 3]]) >>> x.itemset(4, 0) >>> x.itemset((2, 2), 9) >>> x array([[3, 1, 7], [2, 0, 3], [8, 5, 9]]) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('max', """ a.max(axis=None, out=None, keepdims=False) Return the maximum along a given axis. Refer to `numpy.amax` for full documentation. See Also -------- numpy.amax : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('mean', """ a.mean(axis=None, dtype=None, out=None, keepdims=False) Returns the average of the array elements along given axis. Refer to `numpy.mean` for full documentation. See Also -------- numpy.mean : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('min', """ a.min(axis=None, out=None, keepdims=False) Return the minimum along a given axis. Refer to `numpy.amin` for full documentation. See Also -------- numpy.amin : equivalent function """)) add_newdoc('numpy.core.multiarray', 'shares_memory', """ shares_memory(a, b, max_work=None) Determine if two arrays share memory Parameters ---------- a, b : ndarray Input arrays max_work : int, optional Effort to spend on solving the overlap problem (maximum number of candidate solutions to consider). The following special values are recognized: max_work=MAY_SHARE_EXACT (default) The problem is solved exactly. In this case, the function returns True only if there is an element shared between the arrays. max_work=MAY_SHARE_BOUNDS Only the memory bounds of a and b are checked. Raises ------ numpy.TooHardError Exceeded max_work. Returns ------- out : bool See Also -------- may_share_memory Examples -------- >>> np.may_share_memory(np.array([1,2]), np.array([5,8,9])) False """) add_newdoc('numpy.core.multiarray', 'may_share_memory', """ may_share_memory(a, b, max_work=None) Determine if two arrays might share memory A return of True does not necessarily mean that the two arrays share any element. It just means that they *might*. Only the memory bounds of a and b are checked by default. Parameters ---------- a, b : ndarray Input arrays max_work : int, optional Effort to spend on solving the overlap problem. See `shares_memory` for details. Default for ``may_share_memory`` is to do a bounds check. Returns ------- out : bool See Also -------- shares_memory Examples -------- >>> np.may_share_memory(np.array([1,2]), np.array([5,8,9])) False >>> x = np.zeros([3, 4]) >>> np.may_share_memory(x[:,0], x[:,1]) True """) add_newdoc('numpy.core.multiarray', 'ndarray', ('newbyteorder', """ arr.newbyteorder(new_order='S') Return the array with the same data viewed with a different byte order. Equivalent to:: arr.view(arr.dtype.newbytorder(new_order)) Changes are also made in all fields and sub-arrays of the array data type. Parameters ---------- new_order : string, optional Byte order to force; a value from the byte order specifications below. `new_order` codes can be any of: * 'S' - swap dtype from current to opposite endian * {'<', 'L'} - little endian * {'>', 'B'} - big endian * {'=', 'N'} - native order * {'|', 'I'} - ignore (no change to byte order) The default value ('S') results in swapping the current byte order. The code does a case-insensitive check on the first letter of `new_order` for the alternatives above. For example, any of 'B' or 'b' or 'biggish' are valid to specify big-endian. Returns ------- new_arr : array New array object with the dtype reflecting given change to the byte order. """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('nonzero', """ a.nonzero() Return the indices of the elements that are non-zero. Refer to `numpy.nonzero` for full documentation. See Also -------- numpy.nonzero : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('prod', """ a.prod(axis=None, dtype=None, out=None, keepdims=False) Return the product of the array elements over the given axis Refer to `numpy.prod` for full documentation. See Also -------- numpy.prod : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('ptp', """ a.ptp(axis=None, out=None) Peak to peak (maximum - minimum) value along a given axis. Refer to `numpy.ptp` for full documentation. See Also -------- numpy.ptp : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('put', """ a.put(indices, values, mode='raise') Set ``a.flat[n] = values[n]`` for all `n` in indices. Refer to `numpy.put` for full documentation. See Also -------- numpy.put : equivalent function """)) add_newdoc('numpy.core.multiarray', 'copyto', """ copyto(dst, src, casting='same_kind', where=True) Copies values from one array to another, broadcasting as necessary. Raises a TypeError if the `casting` rule is violated, and if `where` is provided, it selects which elements to copy. .. versionadded:: 1.7.0 Parameters ---------- dst : ndarray The array into which values are copied. src : array_like The array from which values are copied. casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional Controls what kind of data casting may occur when copying. * 'no' means the data types should not be cast at all. * 'equiv' means only byte-order changes are allowed. * 'safe' means only casts which can preserve values are allowed. * 'same_kind' means only safe casts or casts within a kind, like float64 to float32, are allowed. * 'unsafe' means any data conversions may be done. where : array_like of bool, optional A boolean array which is broadcasted to match the dimensions of `dst`, and selects elements to copy from `src` to `dst` wherever it contains the value True. """) add_newdoc('numpy.core.multiarray', 'putmask', """ putmask(a, mask, values) Changes elements of an array based on conditional and input values. Sets ``a.flat[n] = values[n]`` for each n where ``mask.flat[n]==True``. If `values` is not the same size as `a` and `mask` then it will repeat. This gives behavior different from ``a[mask] = values``. Parameters ---------- a : array_like Target array. mask : array_like Boolean mask array. It has to be the same shape as `a`. values : array_like Values to put into `a` where `mask` is True. If `values` is smaller than `a` it will be repeated. See Also -------- place, put, take, copyto Examples -------- >>> x = np.arange(6).reshape(2, 3) >>> np.putmask(x, x>2, x**2) >>> x array([[ 0, 1, 2], [ 9, 16, 25]]) If `values` is smaller than `a` it is repeated: >>> x = np.arange(5) >>> np.putmask(x, x>1, [-33, -44]) >>> x array([ 0, 1, -33, -44, -33]) """) add_newdoc('numpy.core.multiarray', 'ndarray', ('ravel', """ a.ravel([order]) Return a flattened array. Refer to `numpy.ravel` for full documentation. See Also -------- numpy.ravel : equivalent function ndarray.flat : a flat iterator on the array. """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('repeat', """ a.repeat(repeats, axis=None) Repeat elements of an array. Refer to `numpy.repeat` for full documentation. See Also -------- numpy.repeat : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('reshape', """ a.reshape(shape, order='C') Returns an array containing the same data with a new shape. Refer to `numpy.reshape` for full documentation. See Also -------- numpy.reshape : equivalent function Notes ----- Unlike the free function `numpy.reshape`, this method on `ndarray` allows the elements of the shape parameter to be passed in as separate arguments. For example, ``a.reshape(10, 11)`` is equivalent to ``a.reshape((10, 11))``. """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('resize', """ a.resize(new_shape, refcheck=True) Change shape and size of array in-place. Parameters ---------- new_shape : tuple of ints, or `n` ints Shape of resized array. refcheck : bool, optional If False, reference count will not be checked. Default is True. Returns ------- None Raises ------ ValueError If `a` does not own its own data or references or views to it exist, and the data memory must be changed. PyPy only: will always raise if the data memory must be changed, since there is no reliable way to determine if references or views to it exist. SystemError If the `order` keyword argument is specified. This behaviour is a bug in NumPy. See Also -------- resize : Return a new array with the specified shape. Notes ----- This reallocates space for the data area if necessary. Only contiguous arrays (data elements consecutive in memory) can be resized. The purpose of the reference count check is to make sure you do not use this array as a buffer for another Python object and then reallocate the memory. However, reference counts can increase in other ways so if you are sure that you have not shared the memory for this array with another Python object, then you may safely set `refcheck` to False. Examples -------- Shrinking an array: array is flattened (in the order that the data are stored in memory), resized, and reshaped: >>> a = np.array([[0, 1], [2, 3]], order='C') >>> a.resize((2, 1)) >>> a array([[0], [1]]) >>> a = np.array([[0, 1], [2, 3]], order='F') >>> a.resize((2, 1)) >>> a array([[0], [2]]) Enlarging an array: as above, but missing entries are filled with zeros: >>> b = np.array([[0, 1], [2, 3]]) >>> b.resize(2, 3) # new_shape parameter doesn't have to be a tuple >>> b array([[0, 1, 2], [3, 0, 0]]) Referencing an array prevents resizing... >>> c = a >>> a.resize((1, 1)) Traceback (most recent call last): ... ValueError: cannot resize an array that has been referenced ... Unless `refcheck` is False: >>> a.resize((1, 1), refcheck=False) >>> a array([[0]]) >>> c array([[0]]) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('round', """ a.round(decimals=0, out=None) Return `a` with each element rounded to the given number of decimals. Refer to `numpy.around` for full documentation. See Also -------- numpy.around : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('searchsorted', """ a.searchsorted(v, side='left', sorter=None) Find indices where elements of v should be inserted in a to maintain order. For full documentation, see `numpy.searchsorted` See Also -------- numpy.searchsorted : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('setfield', """ a.setfield(val, dtype, offset=0) Put a value into a specified place in a field defined by a data-type. Place `val` into `a`'s field defined by `dtype` and beginning `offset` bytes into the field. Parameters ---------- val : object Value to be placed in field. dtype : dtype object Data-type of the field in which to place `val`. offset : int, optional The number of bytes into the field at which to place `val`. Returns ------- None See Also -------- getfield Examples -------- >>> x = np.eye(3) >>> x.getfield(np.float64) array([[ 1., 0., 0.], [ 0., 1., 0.], [ 0., 0., 1.]]) >>> x.setfield(3, np.int32) >>> x.getfield(np.int32) array([[3, 3, 3], [3, 3, 3], [3, 3, 3]]) >>> x array([[ 1.00000000e+000, 1.48219694e-323, 1.48219694e-323], [ 1.48219694e-323, 1.00000000e+000, 1.48219694e-323], [ 1.48219694e-323, 1.48219694e-323, 1.00000000e+000]]) >>> x.setfield(np.eye(3), np.int32) >>> x array([[ 1., 0., 0.], [ 0., 1., 0.], [ 0., 0., 1.]]) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('setflags', """ a.setflags(write=None, align=None, uic=None) Set array flags WRITEABLE, ALIGNED, (WRITEBACKIFCOPY and UPDATEIFCOPY), respectively. These Boolean-valued flags affect how numpy interprets the memory area used by `a` (see Notes below). The ALIGNED flag can only be set to True if the data is actually aligned according to the type. The WRITEBACKIFCOPY and (deprecated) UPDATEIFCOPY flags can never be set to True. The flag WRITEABLE can only be set to True if the array owns its own memory, or the ultimate owner of the memory exposes a writeable buffer interface, or is a string. (The exception for string is made so that unpickling can be done without copying memory.) Parameters ---------- write : bool, optional Describes whether or not `a` can be written to. align : bool, optional Describes whether or not `a` is aligned properly for its type. uic : bool, optional Describes whether or not `a` is a copy of another "base" array. Notes ----- Array flags provide information about how the memory area used for the array is to be interpreted. There are 7 Boolean flags in use, only four of which can be changed by the user: WRITEBACKIFCOPY, UPDATEIFCOPY, WRITEABLE, and ALIGNED. WRITEABLE (W) the data area can be written to; ALIGNED (A) the data and strides are aligned appropriately for the hardware (as determined by the compiler); UPDATEIFCOPY (U) (deprecated), replaced by WRITEBACKIFCOPY; WRITEBACKIFCOPY (X) this array is a copy of some other array (referenced by .base). When the C-API function PyArray_ResolveWritebackIfCopy is called, the base array will be updated with the contents of this array. All flags can be accessed using the single (upper case) letter as well as the full name. Examples -------- >>> y array([[3, 1, 7], [2, 0, 0], [8, 5, 9]]) >>> y.flags C_CONTIGUOUS : True F_CONTIGUOUS : False OWNDATA : True WRITEABLE : True ALIGNED : True WRITEBACKIFCOPY : False UPDATEIFCOPY : False >>> y.setflags(write=0, align=0) >>> y.flags C_CONTIGUOUS : True F_CONTIGUOUS : False OWNDATA : True WRITEABLE : False ALIGNED : False WRITEBACKIFCOPY : False UPDATEIFCOPY : False >>> y.setflags(uic=1) Traceback (most recent call last): File "<stdin>", line 1, in <module> ValueError: cannot set WRITEBACKIFCOPY flag to True """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('sort', """ a.sort(axis=-1, kind='quicksort', order=None) Sort an array, in-place. Parameters ---------- axis : int, optional Axis along which to sort. Default is -1, which means sort along the last axis. kind : {'quicksort', 'mergesort', 'heapsort'}, optional Sorting algorithm. Default is 'quicksort'. order : str or list of str, optional When `a` is an array with fields defined, this argument specifies which fields to compare first, second, etc. A single field can be specified as a string, and not all fields need be specified, but unspecified fields will still be used, in the order in which they come up in the dtype, to break ties. See Also -------- numpy.sort : Return a sorted copy of an array. argsort : Indirect sort. lexsort : Indirect stable sort on multiple keys. searchsorted : Find elements in sorted array. partition: Partial sort. Notes ----- See ``sort`` for notes on the different sorting algorithms. Examples -------- >>> a = np.array([[1,4], [3,1]]) >>> a.sort(axis=1) >>> a array([[1, 4], [1, 3]]) >>> a.sort(axis=0) >>> a array([[1, 3], [1, 4]]) Use the `order` keyword to specify a field to use when sorting a structured array: >>> a = np.array([('a', 2), ('c', 1)], dtype=[('x', 'S1'), ('y', int)]) >>> a.sort(order='y') >>> a array([('c', 1), ('a', 2)], dtype=[('x', '|S1'), ('y', '<i4')]) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('partition', """ a.partition(kth, axis=-1, kind='introselect', order=None) Rearranges the elements in the array in such a way that value of the element in kth position is in the position it would be in a sorted array. All elements smaller than the kth element are moved before this element and all equal or greater are moved behind it. The ordering of the elements in the two partitions is undefined. .. versionadded:: 1.8.0 Parameters ---------- kth : int or sequence of ints Element index to partition by. The kth element value will be in its final sorted position and all smaller elements will be moved before it and all equal or greater elements behind it. The order all elements in the partitions is undefined. If provided with a sequence of kth it will partition all elements indexed by kth of them into their sorted position at once. axis : int, optional Axis along which to sort. Default is -1, which means sort along the last axis. kind : {'introselect'}, optional Selection algorithm. Default is 'introselect'. order : str or list of str, optional When `a` is an array with fields defined, this argument specifies which fields to compare first, second, etc. A single field can be specified as a string, and not all fields need be specified, but unspecified fields will still be used, in the order in which they come up in the dtype, to break ties. See Also -------- numpy.partition : Return a parititioned copy of an array. argpartition : Indirect partition. sort : Full sort. Notes ----- See ``np.partition`` for notes on the different algorithms. Examples -------- >>> a = np.array([3, 4, 2, 1]) >>> a.partition(3) >>> a array([2, 1, 3, 4]) >>> a.partition((1, 3)) array([1, 2, 3, 4]) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('squeeze', """ a.squeeze(axis=None) Remove single-dimensional entries from the shape of `a`. Refer to `numpy.squeeze` for full documentation. See Also -------- numpy.squeeze : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('std', """ a.std(axis=None, dtype=None, out=None, ddof=0, keepdims=False) Returns the standard deviation of the array elements along given axis. Refer to `numpy.std` for full documentation. See Also -------- numpy.std : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('sum', """ a.sum(axis=None, dtype=None, out=None, keepdims=False) Return the sum of the array elements over the given axis. Refer to `numpy.sum` for full documentation. See Also -------- numpy.sum : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('swapaxes', """ a.swapaxes(axis1, axis2) Return a view of the array with `axis1` and `axis2` interchanged. Refer to `numpy.swapaxes` for full documentation. See Also -------- numpy.swapaxes : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('take', """ a.take(indices, axis=None, out=None, mode='raise') Return an array formed from the elements of `a` at the given indices. Refer to `numpy.take` for full documentation. See Also -------- numpy.take : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('tofile', """ a.tofile(fid, sep="", format="%s") Write array to a file as text or binary (default). Data is always written in 'C' order, independent of the order of `a`. The data produced by this method can be recovered using the function fromfile(). Parameters ---------- fid : file or str An open file object, or a string containing a filename. sep : str Separator between array items for text output. If "" (empty), a binary file is written, equivalent to ``file.write(a.tobytes())``. format : str Format string for text file output. Each entry in the array is formatted to text by first converting it to the closest Python type, and then using "format" % item. Notes ----- This is a convenience function for quick storage of array data. Information on endianness and precision is lost, so this method is not a good choice for files intended to archive data or transport data between machines with different endianness. Some of these problems can be overcome by outputting the data as text files, at the expense of speed and file size. """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('tolist', """ a.tolist() Return the array as a (possibly nested) list. Return a copy of the array data as a (nested) Python list. Data items are converted to the nearest compatible Python type. Parameters ---------- none Returns ------- y : list The possibly nested list of array elements. Notes ----- The array may be recreated, ``a = np.array(a.tolist())``. Examples -------- >>> a = np.array([1, 2]) >>> a.tolist() [1, 2] >>> a = np.array([[1, 2], [3, 4]]) >>> list(a) [array([1, 2]), array([3, 4])] >>> a.tolist() [[1, 2], [3, 4]] """)) tobytesdoc = """ a.{name}(order='C') Construct Python bytes containing the raw data bytes in the array. Constructs Python bytes showing a copy of the raw contents of data memory. The bytes object can be produced in either 'C' or 'Fortran', or 'Any' order (the default is 'C'-order). 'Any' order means C-order unless the F_CONTIGUOUS flag in the array is set, in which case it means 'Fortran' order. {deprecated} Parameters ---------- order : {{'C', 'F', None}}, optional Order of the data for multidimensional arrays: C, Fortran, or the same as for the original array. Returns ------- s : bytes Python bytes exhibiting a copy of `a`'s raw data. Examples -------- >>> x = np.array([[0, 1], [2, 3]]) >>> x.tobytes() b'\\x00\\x00\\x00\\x00\\x01\\x00\\x00\\x00\\x02\\x00\\x00\\x00\\x03\\x00\\x00\\x00' >>> x.tobytes('C') == x.tobytes() True >>> x.tobytes('F') b'\\x00\\x00\\x00\\x00\\x02\\x00\\x00\\x00\\x01\\x00\\x00\\x00\\x03\\x00\\x00\\x00' """ add_newdoc('numpy.core.multiarray', 'ndarray', ('tostring', tobytesdoc.format(name='tostring', deprecated= 'This function is a compatibility ' 'alias for tobytes. Despite its ' 'name it returns bytes not ' 'strings.'))) add_newdoc('numpy.core.multiarray', 'ndarray', ('tobytes', tobytesdoc.format(name='tobytes', deprecated='.. versionadded:: 1.9.0'))) add_newdoc('numpy.core.multiarray', 'ndarray', ('trace', """ a.trace(offset=0, axis1=0, axis2=1, dtype=None, out=None) Return the sum along diagonals of the array. Refer to `numpy.trace` for full documentation. See Also -------- numpy.trace : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('transpose', """ a.transpose(*axes) Returns a view of the array with axes transposed. For a 1-D array, this has no effect. (To change between column and row vectors, first cast the 1-D array into a matrix object.) For a 2-D array, this is the usual matrix transpose. For an n-D array, if axes are given, their order indicates how the axes are permuted (see Examples). If axes are not provided and ``a.shape = (i[0], i[1], ... i[n-2], i[n-1])``, then ``a.transpose().shape = (i[n-1], i[n-2], ... i[1], i[0])``. Parameters ---------- axes : None, tuple of ints, or `n` ints * None or no argument: reverses the order of the axes. * tuple of ints: `i` in the `j`-th place in the tuple means `a`'s `i`-th axis becomes `a.transpose()`'s `j`-th axis. * `n` ints: same as an n-tuple of the same ints (this form is intended simply as a "convenience" alternative to the tuple form) Returns ------- out : ndarray View of `a`, with axes suitably permuted. See Also -------- ndarray.T : Array property returning the array transposed. Examples -------- >>> a = np.array([[1, 2], [3, 4]]) >>> a array([[1, 2], [3, 4]]) >>> a.transpose() array([[1, 3], [2, 4]]) >>> a.transpose((1, 0)) array([[1, 3], [2, 4]]) >>> a.transpose(1, 0) array([[1, 3], [2, 4]]) """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('var', """ a.var(axis=None, dtype=None, out=None, ddof=0, keepdims=False) Returns the variance of the array elements, along given axis. Refer to `numpy.var` for full documentation. See Also -------- numpy.var : equivalent function """)) add_newdoc('numpy.core.multiarray', 'ndarray', ('view', """ a.view(dtype=None, type=None) New view of array with the same data. Parameters ---------- dtype : data-type or ndarray sub-class, optional Data-type descriptor of the returned view, e.g., float32 or int16. The default, None, results in the view having the same data-type as `a`. This argument can also be specified as an ndarray sub-class, which then specifies the type of the returned object (this is equivalent to setting the ``type`` parameter). type : Python type, optional Type of the returned view, e.g., ndarray or matrix. Again, the default None results in type preservation. Notes ----- ``a.view()`` is used two different ways: ``a.view(some_dtype)`` or ``a.view(dtype=some_dtype)`` constructs a view of the array's memory with a different data-type. This can cause a reinterpretation of the bytes of memory. ``a.view(ndarray_subclass)`` or ``a.view(type=ndarray_subclass)`` just returns an instance of `ndarray_subclass` that looks at the same array (same shape, dtype, etc.) This does not cause a reinterpretation of the memory. For ``a.view(some_dtype)``, if ``some_dtype`` has a different number of bytes per entry than the previous dtype (for example, converting a regular array to a structured array), then the behavior of the view cannot be predicted just from the superficial appearance of ``a`` (shown by ``print(a)``). It also depends on exactly how ``a`` is stored in memory. Therefore if ``a`` is C-ordered versus fortran-ordered, versus defined as a slice or transpose, etc., the view may give different results. Examples -------- >>> x = np.array([(1, 2)], dtype=[('a', np.int8), ('b', np.int8)]) Viewing array data using a different type and dtype: >>> y = x.view(dtype=np.int16, type=np.matrix) >>> y matrix([[513]], dtype=int16) >>> print(type(y)) <class 'numpy.matrixlib.defmatrix.matrix'> Creating a view on a structured array so it can be used in calculations >>> x = np.array([(1, 2),(3,4)], dtype=[('a', np.int8), ('b', np.int8)]) >>> xv = x.view(dtype=np.int8).reshape(-1,2) >>> xv array([[1, 2], [3, 4]], dtype=int8) >>> xv.mean(0) array([ 2., 3.]) Making changes to the view changes the underlying array >>> xv[0,1] = 20 >>> print(x) [(1, 20) (3, 4)] Using a view to convert an array to a recarray: >>> z = x.view(np.recarray) >>> z.a array([1], dtype=int8) Views share data: >>> x[0] = (9, 10) >>> z[0] (9, 10) Views that change the dtype size (bytes per entry) should normally be avoided on arrays defined by slices, transposes, fortran-ordering, etc.: >>> x = np.array([[1,2,3],[4,5,6]], dtype=np.int16) >>> y = x[:, 0:2] >>> y array([[1, 2], [4, 5]], dtype=int16) >>> y.view(dtype=[('width', np.int16), ('length', np.int16)]) Traceback (most recent call last): File "<stdin>", line 1, in <module> ValueError: new type not compatible with array. >>> z = y.copy() >>> z.view(dtype=[('width', np.int16), ('length', np.int16)]) array([[(1, 2)], [(4, 5)]], dtype=[('width', '<i2'), ('length', '<i2')]) """)) ############################################################################## # # umath functions # ############################################################################## add_newdoc('numpy.core.umath', 'frompyfunc', """ frompyfunc(func, nin, nout) Takes an arbitrary Python function and returns a NumPy ufunc. Can be used, for example, to add broadcasting to a built-in Python function (see Examples section). Parameters ---------- func : Python function object An arbitrary Python function. nin : int The number of input arguments. nout : int The number of objects returned by `func`. Returns ------- out : ufunc Returns a NumPy universal function (``ufunc``) object. See Also -------- vectorize : evaluates pyfunc over input arrays using broadcasting rules of numpy Notes ----- The returned ufunc always returns PyObject arrays. Examples -------- Use frompyfunc to add broadcasting to the Python function ``oct``: >>> oct_array = np.frompyfunc(oct, 1, 1) >>> oct_array(np.array((10, 30, 100))) array([012, 036, 0144], dtype=object) >>> np.array((oct(10), oct(30), oct(100))) # for comparison array(['012', '036', '0144'], dtype='|S4') """) add_newdoc('numpy.core.umath', 'geterrobj', """ geterrobj() Return the current object that defines floating-point error handling. The error object contains all information that defines the error handling behavior in NumPy. `geterrobj` is used internally by the other functions that get and set error handling behavior (`geterr`, `seterr`, `geterrcall`, `seterrcall`). Returns ------- errobj : list The error object, a list containing three elements: [internal numpy buffer size, error mask, error callback function]. The error mask is a single integer that holds the treatment information on all four floating point errors. The information for each error type is contained in three bits of the integer. If we print it in base 8, we can see what treatment is set for "invalid", "under", "over", and "divide" (in that order). The printed string can be interpreted with * 0 : 'ignore' * 1 : 'warn' * 2 : 'raise' * 3 : 'call' * 4 : 'print' * 5 : 'log' See Also -------- seterrobj, seterr, geterr, seterrcall, geterrcall getbufsize, setbufsize Notes ----- For complete documentation of the types of floating-point exceptions and treatment options, see `seterr`. Examples -------- >>> np.geterrobj() # first get the defaults [10000, 0, None] >>> def err_handler(type, flag): ... print("Floating point error (%s), with flag %s" % (type, flag)) ... >>> old_bufsize = np.setbufsize(20000) >>> old_err = np.seterr(divide='raise') >>> old_handler = np.seterrcall(err_handler) >>> np.geterrobj() [20000, 2, <function err_handler at 0x91dcaac>] >>> old_err = np.seterr(all='ignore') >>> np.base_repr(np.geterrobj()[1], 8) '0' >>> old_err = np.seterr(divide='warn', over='log', under='call', invalid='print') >>> np.base_repr(np.geterrobj()[1], 8) '4351' """) add_newdoc('numpy.core.umath', 'seterrobj', """ seterrobj(errobj) Set the object that defines floating-point error handling. The error object contains all information that defines the error handling behavior in NumPy. `seterrobj` is used internally by the other functions that set error handling behavior (`seterr`, `seterrcall`). Parameters ---------- errobj : list The error object, a list containing three elements: [internal numpy buffer size, error mask, error callback function]. The error mask is a single integer that holds the treatment information on all four floating point errors. The information for each error type is contained in three bits of the integer. If we print it in base 8, we can see what treatment is set for "invalid", "under", "over", and "divide" (in that order). The printed string can be interpreted with * 0 : 'ignore' * 1 : 'warn' * 2 : 'raise' * 3 : 'call' * 4 : 'print' * 5 : 'log' See Also -------- geterrobj, seterr, geterr, seterrcall, geterrcall getbufsize, setbufsize Notes ----- For complete documentation of the types of floating-point exceptions and treatment options, see `seterr`. Examples -------- >>> old_errobj = np.geterrobj() # first get the defaults >>> old_errobj [10000, 0, None] >>> def err_handler(type, flag): ... print("Floating point error (%s), with flag %s" % (type, flag)) ... >>> new_errobj = [20000, 12, err_handler] >>> np.seterrobj(new_errobj) >>> np.base_repr(12, 8) # int for divide=4 ('print') and over=1 ('warn') '14' >>> np.geterr() {'over': 'warn', 'divide': 'print', 'invalid': 'ignore', 'under': 'ignore'} >>> np.geterrcall() is err_handler True """) ############################################################################## # # compiled_base functions # ############################################################################## add_newdoc('numpy.core.multiarray', 'digitize', """ digitize(x, bins, right=False) Return the indices of the bins to which each value in input array belongs. Each index ``i`` returned is such that ``bins[i-1] <= x < bins[i]`` if `bins` is monotonically increasing, or ``bins[i-1] > x >= bins[i]`` if `bins` is monotonically decreasing. If values in `x` are beyond the bounds of `bins`, 0 or ``len(bins)`` is returned as appropriate. If right is True, then the right bin is closed so that the index ``i`` is such that ``bins[i-1] < x <= bins[i]`` or ``bins[i-1] >= x > bins[i]`` if `bins` is monotonically increasing or decreasing, respectively. Parameters ---------- x : array_like Input array to be binned. Prior to NumPy 1.10.0, this array had to be 1-dimensional, but can now have any shape. bins : array_like Array of bins. It has to be 1-dimensional and monotonic. right : bool, optional Indicating whether the intervals include the right or the left bin edge. Default behavior is (right==False) indicating that the interval does not include the right edge. The left bin end is open in this case, i.e., bins[i-1] <= x < bins[i] is the default behavior for monotonically increasing bins. Returns ------- out : ndarray of ints Output array of indices, of same shape as `x`. Raises ------ ValueError If `bins` is not monotonic. TypeError If the type of the input is complex. See Also -------- bincount, histogram, unique, searchsorted Notes ----- If values in `x` are such that they fall outside the bin range, attempting to index `bins` with the indices that `digitize` returns will result in an IndexError. .. versionadded:: 1.10.0 `np.digitize` is implemented in terms of `np.searchsorted`. This means that a binary search is used to bin the values, which scales much better for larger number of bins than the previous linear search. It also removes the requirement for the input array to be 1-dimensional. Examples -------- >>> x = np.array([0.2, 6.4, 3.0, 1.6]) >>> bins = np.array([0.0, 1.0, 2.5, 4.0, 10.0]) >>> inds = np.digitize(x, bins) >>> inds array([1, 4, 3, 2]) >>> for n in range(x.size): ... print(bins[inds[n]-1], "<=", x[n], "<", bins[inds[n]]) ... 0.0 <= 0.2 < 1.0 4.0 <= 6.4 < 10.0 2.5 <= 3.0 < 4.0 1.0 <= 1.6 < 2.5 >>> x = np.array([1.2, 10.0, 12.4, 15.5, 20.]) >>> bins = np.array([0, 5, 10, 15, 20]) >>> np.digitize(x,bins,right=True) array([1, 2, 3, 4, 4]) >>> np.digitize(x,bins,right=False) array([1, 3, 3, 4, 5]) """) add_newdoc('numpy.core.multiarray', 'bincount', """ bincount(x, weights=None, minlength=0) Count number of occurrences of each value in array of non-negative ints. The number of bins (of size 1) is one larger than the largest value in `x`. If `minlength` is specified, there will be at least this number of bins in the output array (though it will be longer if necessary, depending on the contents of `x`). Each bin gives the number of occurrences of its index value in `x`. If `weights` is specified the input array is weighted by it, i.e. if a value ``n`` is found at position ``i``, ``out[n] += weight[i]`` instead of ``out[n] += 1``. Parameters ---------- x : array_like, 1 dimension, nonnegative ints Input array. weights : array_like, optional Weights, array of the same shape as `x`. minlength : int, optional A minimum number of bins for the output array. .. versionadded:: 1.6.0 Returns ------- out : ndarray of ints The result of binning the input array. The length of `out` is equal to ``np.amax(x)+1``. Raises ------ ValueError If the input is not 1-dimensional, or contains elements with negative values, or if `minlength` is negative. TypeError If the type of the input is float or complex. See Also -------- histogram, digitize, unique Examples -------- >>> np.bincount(np.arange(5)) array([1, 1, 1, 1, 1]) >>> np.bincount(np.array([0, 1, 1, 3, 2, 1, 7])) array([1, 3, 1, 1, 0, 0, 0, 1]) >>> x = np.array([0, 1, 1, 3, 2, 1, 7, 23]) >>> np.bincount(x).size == np.amax(x)+1 True The input array needs to be of integer dtype, otherwise a TypeError is raised: >>> np.bincount(np.arange(5, dtype=float)) Traceback (most recent call last): File "<stdin>", line 1, in <module> TypeError: array cannot be safely cast to required type A possible use of ``bincount`` is to perform sums over variable-size chunks of an array, using the ``weights`` keyword. >>> w = np.array([0.3, 0.5, 0.2, 0.7, 1., -0.6]) # weights >>> x = np.array([0, 1, 1, 2, 2, 2]) >>> np.bincount(x, weights=w) array([ 0.3, 0.7, 1.1]) """) add_newdoc('numpy.core.multiarray', 'ravel_multi_index', """ ravel_multi_index(multi_index, dims, mode='raise', order='C') Converts a tuple of index arrays into an array of flat indices, applying boundary modes to the multi-index. Parameters ---------- multi_index : tuple of array_like A tuple of integer arrays, one array for each dimension. dims : tuple of ints The shape of array into which the indices from ``multi_index`` apply. mode : {'raise', 'wrap', 'clip'}, optional Specifies how out-of-bounds indices are handled. Can specify either one mode or a tuple of modes, one mode per index. * 'raise' -- raise an error (default) * 'wrap' -- wrap around * 'clip' -- clip to the range In 'clip' mode, a negative index which would normally wrap will clip to 0 instead. order : {'C', 'F'}, optional Determines whether the multi-index should be viewed as indexing in row-major (C-style) or column-major (Fortran-style) order. Returns ------- raveled_indices : ndarray An array of indices into the flattened version of an array of dimensions ``dims``. See Also -------- unravel_index Notes ----- .. versionadded:: 1.6.0 Examples -------- >>> arr = np.array([[3,6,6],[4,5,1]]) >>> np.ravel_multi_index(arr, (7,6)) array([22, 41, 37]) >>> np.ravel_multi_index(arr, (7,6), order='F') array([31, 41, 13]) >>> np.ravel_multi_index(arr, (4,6), mode='clip') array([22, 23, 19]) >>> np.ravel_multi_index(arr, (4,4), mode=('clip','wrap')) array([12, 13, 13]) >>> np.ravel_multi_index((3,1,4,1), (6,7,8,9)) 1621 """) add_newdoc('numpy.core.multiarray', 'unravel_index', """ unravel_index(indices, dims, order='C') Converts a flat index or array of flat indices into a tuple of coordinate arrays. Parameters ---------- indices : array_like An integer array whose elements are indices into the flattened version of an array of dimensions ``dims``. Before version 1.6.0, this function accepted just one index value. dims : tuple of ints The shape of the array to use for unraveling ``indices``. order : {'C', 'F'}, optional Determines whether the indices should be viewed as indexing in row-major (C-style) or column-major (Fortran-style) order. .. versionadded:: 1.6.0 Returns ------- unraveled_coords : tuple of ndarray Each array in the tuple has the same shape as the ``indices`` array. See Also -------- ravel_multi_index Examples -------- >>> np.unravel_index([22, 41, 37], (7,6)) (array([3, 6, 6]), array([4, 5, 1])) >>> np.unravel_index([31, 41, 13], (7,6), order='F') (array([3, 6, 6]), array([4, 5, 1])) >>> np.unravel_index(1621, (6,7,8,9)) (3, 1, 4, 1) """) add_newdoc('numpy.core.multiarray', 'add_docstring', """ add_docstring(obj, docstring) Add a docstring to a built-in obj if possible. If the obj already has a docstring raise a RuntimeError If this routine does not know how to add a docstring to the object raise a TypeError """) add_newdoc('numpy.core.umath', '_add_newdoc_ufunc', """ add_ufunc_docstring(ufunc, new_docstring) Replace the docstring for a ufunc with new_docstring. This method will only work if the current docstring for the ufunc is NULL. (At the C level, i.e. when ufunc->doc is NULL.) Parameters ---------- ufunc : numpy.ufunc A ufunc whose current doc is NULL. new_docstring : string The new docstring for the ufunc. Notes ----- This method allocates memory for new_docstring on the heap. Technically this creates a mempory leak, since this memory will not be reclaimed until the end of the program even if the ufunc itself is removed. However this will only be a problem if the user is repeatedly creating ufuncs with no documentation, adding documentation via add_newdoc_ufunc, and then throwing away the ufunc. """) add_newdoc('numpy.core.multiarray', 'packbits', """ packbits(myarray, axis=None) Packs the elements of a binary-valued array into bits in a uint8 array. The result is padded to full bytes by inserting zero bits at the end. Parameters ---------- myarray : array_like An array of integers or booleans whose elements should be packed to bits. axis : int, optional The dimension over which bit-packing is done. ``None`` implies packing the flattened array. Returns ------- packed : ndarray Array of type uint8 whose elements represent bits corresponding to the logical (0 or nonzero) value of the input elements. The shape of `packed` has the same number of dimensions as the input (unless `axis` is None, in which case the output is 1-D). See Also -------- unpackbits: Unpacks elements of a uint8 array into a binary-valued output array. Examples -------- >>> a = np.array([[[1,0,1], ... [0,1,0]], ... [[1,1,0], ... [0,0,1]]]) >>> b = np.packbits(a, axis=-1) >>> b array([[[160],[64]],[[192],[32]]], dtype=uint8) Note that in binary 160 = 1010 0000, 64 = 0100 0000, 192 = 1100 0000, and 32 = 0010 0000. """) add_newdoc('numpy.core.multiarray', 'unpackbits', """ unpackbits(myarray, axis=None) Unpacks elements of a uint8 array into a binary-valued output array. Each element of `myarray` represents a bit-field that should be unpacked into a binary-valued output array. The shape of the output array is either 1-D (if `axis` is None) or the same shape as the input array with unpacking done along the axis specified. Parameters ---------- myarray : ndarray, uint8 type Input array. axis : int, optional The dimension over which bit-unpacking is done. ``None`` implies unpacking the flattened array. Returns ------- unpacked : ndarray, uint8 type The elements are binary-valued (0 or 1). See Also -------- packbits : Packs the elements of a binary-valued array into bits in a uint8 array. Examples -------- >>> a = np.array([[2], [7], [23]], dtype=np.uint8) >>> a array([[ 2], [ 7], [23]], dtype=uint8) >>> b = np.unpackbits(a, axis=1) >>> b array([[0, 0, 0, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1, 1, 1], [0, 0, 0, 1, 0, 1, 1, 1]], dtype=uint8) """) ############################################################################## # # Documentation for ufunc attributes and methods # ############################################################################## ############################################################################## # # ufunc object # ############################################################################## add_newdoc('numpy.core', 'ufunc', """ Functions that operate element by element on whole arrays. To see the documentation for a specific ufunc, use `info`. For example, ``np.info(np.sin)``. Because ufuncs are written in C (for speed) and linked into Python with NumPy's ufunc facility, Python's help() function finds this page whenever help() is called on a ufunc. A detailed explanation of ufuncs can be found in the docs for :ref:`ufuncs`. Calling ufuncs: =============== op(*x[, out], where=True, **kwargs) Apply `op` to the arguments `*x` elementwise, broadcasting the arguments. The broadcasting rules are: * Dimensions of length 1 may be prepended to either array. * Arrays may be repeated along dimensions of length 1. Parameters ---------- *x : array_like Input arrays. out : ndarray, None, or tuple of ndarray and None, optional Alternate array object(s) in which to put the result; if provided, it must have a shape that the inputs broadcast to. A tuple of arrays (possible only as a keyword argument) must have length equal to the number of outputs; use `None` for outputs to be allocated by the ufunc. where : array_like, optional Values of True indicate to calculate the ufunc at that position, values of False indicate to leave the value in the output alone. **kwargs For other keyword-only arguments, see the :ref:`ufunc docs <ufuncs.kwargs>`. Returns ------- r : ndarray or tuple of ndarray `r` will have the shape that the arrays in `x` broadcast to; if `out` is provided, `r` will be equal to `out`. If the function has more than one output, then the result will be a tuple of arrays. """) ############################################################################## # # ufunc attributes # ############################################################################## add_newdoc('numpy.core', 'ufunc', ('identity', """ The identity value. Data attribute containing the identity element for the ufunc, if it has one. If it does not, the attribute value is None. Examples -------- >>> np.add.identity 0 >>> np.multiply.identity 1 >>> np.power.identity 1 >>> print(np.exp.identity) None """)) add_newdoc('numpy.core', 'ufunc', ('nargs', """ The number of arguments. Data attribute containing the number of arguments the ufunc takes, including optional ones. Notes ----- Typically this value will be one more than what you might expect because all ufuncs take the optional "out" argument. Examples -------- >>> np.add.nargs 3 >>> np.multiply.nargs 3 >>> np.power.nargs 3 >>> np.exp.nargs 2 """)) add_newdoc('numpy.core', 'ufunc', ('nin', """ The number of inputs. Data attribute containing the number of arguments the ufunc treats as input. Examples -------- >>> np.add.nin 2 >>> np.multiply.nin 2 >>> np.power.nin 2 >>> np.exp.nin 1 """)) add_newdoc('numpy.core', 'ufunc', ('nout', """ The number of outputs. Data attribute containing the number of arguments the ufunc treats as output. Notes ----- Since all ufuncs can take output arguments, this will always be (at least) 1. Examples -------- >>> np.add.nout 1 >>> np.multiply.nout 1 >>> np.power.nout 1 >>> np.exp.nout 1 """)) add_newdoc('numpy.core', 'ufunc', ('ntypes', """ The number of types. The number of numerical NumPy types - of which there are 18 total - on which the ufunc can operate. See Also -------- numpy.ufunc.types Examples -------- >>> np.add.ntypes 18 >>> np.multiply.ntypes 18 >>> np.power.ntypes 17 >>> np.exp.ntypes 7 >>> np.remainder.ntypes 14 """)) add_newdoc('numpy.core', 'ufunc', ('types', """ Returns a list with types grouped input->output. Data attribute listing the data-type "Domain-Range" groupings the ufunc can deliver. The data-types are given using the character codes. See Also -------- numpy.ufunc.ntypes Examples -------- >>> np.add.types ['??->?', 'bb->b', 'BB->B', 'hh->h', 'HH->H', 'ii->i', 'II->I', 'll->l', 'LL->L', 'qq->q', 'QQ->Q', 'ff->f', 'dd->d', 'gg->g', 'FF->F', 'DD->D', 'GG->G', 'OO->O'] >>> np.multiply.types ['??->?', 'bb->b', 'BB->B', 'hh->h', 'HH->H', 'ii->i', 'II->I', 'll->l', 'LL->L', 'qq->q', 'QQ->Q', 'ff->f', 'dd->d', 'gg->g', 'FF->F', 'DD->D', 'GG->G', 'OO->O'] >>> np.power.types ['bb->b', 'BB->B', 'hh->h', 'HH->H', 'ii->i', 'II->I', 'll->l', 'LL->L', 'qq->q', 'QQ->Q', 'ff->f', 'dd->d', 'gg->g', 'FF->F', 'DD->D', 'GG->G', 'OO->O'] >>> np.exp.types ['f->f', 'd->d', 'g->g', 'F->F', 'D->D', 'G->G', 'O->O'] >>> np.remainder.types ['bb->b', 'BB->B', 'hh->h', 'HH->H', 'ii->i', 'II->I', 'll->l', 'LL->L', 'qq->q', 'QQ->Q', 'ff->f', 'dd->d', 'gg->g', 'OO->O'] """)) add_newdoc('numpy.core', 'ufunc', ('signature', """ Definition of the core elements a generalized ufunc operates on. The signature determines how the dimensions of each input/output array are split into core and loop dimensions: 1. Each dimension in the signature is matched to a dimension of the corresponding passed-in array, starting from the end of the shape tuple. 2. Core dimensions assigned to the same label in the signature must have exactly matching sizes, no broadcasting is performed. 3. The core dimensions are removed from all inputs and the remaining dimensions are broadcast together, defining the loop dimensions. Notes ----- Generalized ufuncs are used internally in many linalg functions, and in the testing suite; the examples below are taken from these. For ufuncs that operate on scalars, the signature is `None`, which is equivalent to '()' for every argument. Examples -------- >>> np.core.umath_tests.matrix_multiply.signature '(m,n),(n,p)->(m,p)' >>> np.linalg._umath_linalg.det.signature '(m,m)->()' >>> np.add.signature is None True # equivalent to '(),()->()' """)) ############################################################################## # # ufunc methods # ############################################################################## add_newdoc('numpy.core', 'ufunc', ('reduce', """ reduce(a, axis=0, dtype=None, out=None, keepdims=False) Reduces `a`'s dimension by one, by applying ufunc along one axis. Let :math:`a.shape = (N_0, ..., N_i, ..., N_{M-1})`. Then :math:`ufunc.reduce(a, axis=i)[k_0, ..,k_{i-1}, k_{i+1}, .., k_{M-1}]` = the result of iterating `j` over :math:`range(N_i)`, cumulatively applying ufunc to each :math:`a[k_0, ..,k_{i-1}, j, k_{i+1}, .., k_{M-1}]`. For a one-dimensional array, reduce produces results equivalent to: :: r = op.identity # op = ufunc for i in range(len(A)): r = op(r, A[i]) return r For example, add.reduce() is equivalent to sum(). Parameters ---------- a : array_like The array to act on. axis : None or int or tuple of ints, optional Axis or axes along which a reduction is performed. The default (`axis` = 0) is perform a reduction over the first dimension of the input array. `axis` may be negative, in which case it counts from the last to the first axis. .. versionadded:: 1.7.0 If this is `None`, a reduction is performed over all the axes. If this is a tuple of ints, a reduction is performed on multiple axes, instead of a single axis or all the axes as before. For operations which are either not commutative or not associative, doing a reduction over multiple axes is not well-defined. The ufuncs do not currently raise an exception in this case, but will likely do so in the future. dtype : data-type code, optional The type used to represent the intermediate results. Defaults to the data-type of the output array if this is provided, or the data-type of the input array if no output array is provided. out : ndarray, None, or tuple of ndarray and None, optional A location into which the result is stored. If not provided or `None`, a freshly-allocated array is returned. For consistency with :ref:`ufunc.__call__`, if given as a keyword, this may be wrapped in a 1-element tuple. .. versionchanged:: 1.13.0 Tuples are allowed for keyword argument. keepdims : bool, optional If this is set to True, the axes which are reduced are left in the result as dimensions with size one. With this option, the result will broadcast correctly against the original `arr`. .. versionadded:: 1.7.0 Returns ------- r : ndarray The reduced array. If `out` was supplied, `r` is a reference to it. Examples -------- >>> np.multiply.reduce([2,3,5]) 30 A multi-dimensional array example: >>> X = np.arange(8).reshape((2,2,2)) >>> X array([[[0, 1], [2, 3]], [[4, 5], [6, 7]]]) >>> np.add.reduce(X, 0) array([[ 4, 6], [ 8, 10]]) >>> np.add.reduce(X) # confirm: default axis value is 0 array([[ 4, 6], [ 8, 10]]) >>> np.add.reduce(X, 1) array([[ 2, 4], [10, 12]]) >>> np.add.reduce(X, 2) array([[ 1, 5], [ 9, 13]]) """)) add_newdoc('numpy.core', 'ufunc', ('accumulate', """ accumulate(array, axis=0, dtype=None, out=None) Accumulate the result of applying the operator to all elements. For a one-dimensional array, accumulate produces results equivalent to:: r = np.empty(len(A)) t = op.identity # op = the ufunc being applied to A's elements for i in range(len(A)): t = op(t, A[i]) r[i] = t return r For example, add.accumulate() is equivalent to np.cumsum(). For a multi-dimensional array, accumulate is applied along only one axis (axis zero by default; see Examples below) so repeated use is necessary if one wants to accumulate over multiple axes. Parameters ---------- array : array_like The array to act on. axis : int, optional The axis along which to apply the accumulation; default is zero. dtype : data-type code, optional The data-type used to represent the intermediate results. Defaults to the data-type of the output array if such is provided, or the the data-type of the input array if no output array is provided. out : ndarray, None, or tuple of ndarray and None, optional A location into which the result is stored. If not provided or `None`, a freshly-allocated array is returned. For consistency with :ref:`ufunc.__call__`, if given as a keyword, this may be wrapped in a 1-element tuple. .. versionchanged:: 1.13.0 Tuples are allowed for keyword argument. Returns ------- r : ndarray The accumulated values. If `out` was supplied, `r` is a reference to `out`. Examples -------- 1-D array examples: >>> np.add.accumulate([2, 3, 5]) array([ 2, 5, 10]) >>> np.multiply.accumulate([2, 3, 5]) array([ 2, 6, 30]) 2-D array examples: >>> I = np.eye(2) >>> I array([[ 1., 0.], [ 0., 1.]]) Accumulate along axis 0 (rows), down columns: >>> np.add.accumulate(I, 0) array([[ 1., 0.], [ 1., 1.]]) >>> np.add.accumulate(I) # no axis specified = axis zero array([[ 1., 0.], [ 1., 1.]]) Accumulate along axis 1 (columns), through rows: >>> np.add.accumulate(I, 1) array([[ 1., 1.], [ 0., 1.]]) """)) add_newdoc('numpy.core', 'ufunc', ('reduceat', """ reduceat(a, indices, axis=0, dtype=None, out=None) Performs a (local) reduce with specified slices over a single axis. For i in ``range(len(indices))``, `reduceat` computes ``ufunc.reduce(a[indices[i]:indices[i+1]])``, which becomes the i-th generalized "row" parallel to `axis` in the final result (i.e., in a 2-D array, for example, if `axis = 0`, it becomes the i-th row, but if `axis = 1`, it becomes the i-th column). There are three exceptions to this: * when ``i = len(indices) - 1`` (so for the last index), ``indices[i+1] = a.shape[axis]``. * if ``indices[i] >= indices[i + 1]``, the i-th generalized "row" is simply ``a[indices[i]]``. * if ``indices[i] >= len(a)`` or ``indices[i] < 0``, an error is raised. The shape of the output depends on the size of `indices`, and may be larger than `a` (this happens if ``len(indices) > a.shape[axis]``). Parameters ---------- a : array_like The array to act on. indices : array_like Paired indices, comma separated (not colon), specifying slices to reduce. axis : int, optional The axis along which to apply the reduceat. dtype : data-type code, optional The type used to represent the intermediate results. Defaults to the data type of the output array if this is provided, or the data type of the input array if no output array is provided. out : ndarray, None, or tuple of ndarray and None, optional A location into which the result is stored. If not provided or `None`, a freshly-allocated array is returned. For consistency with :ref:`ufunc.__call__`, if given as a keyword, this may be wrapped in a 1-element tuple. .. versionchanged:: 1.13.0 Tuples are allowed for keyword argument. Returns ------- r : ndarray The reduced values. If `out` was supplied, `r` is a reference to `out`. Notes ----- A descriptive example: If `a` is 1-D, the function `ufunc.accumulate(a)` is the same as ``ufunc.reduceat(a, indices)[::2]`` where `indices` is ``range(len(array) - 1)`` with a zero placed in every other element: ``indices = zeros(2 * len(a) - 1)``, ``indices[1::2] = range(1, len(a))``. Don't be fooled by this attribute's name: `reduceat(a)` is not necessarily smaller than `a`. Examples -------- To take the running sum of four successive values: >>> np.add.reduceat(np.arange(8),[0,4, 1,5, 2,6, 3,7])[::2] array([ 6, 10, 14, 18]) A 2-D example: >>> x = np.linspace(0, 15, 16).reshape(4,4) >>> x array([[ 0., 1., 2., 3.], [ 4., 5., 6., 7.], [ 8., 9., 10., 11.], [ 12., 13., 14., 15.]]) :: # reduce such that the result has the following five rows: # [row1 + row2 + row3] # [row4] # [row2] # [row3] # [row1 + row2 + row3 + row4] >>> np.add.reduceat(x, [0, 3, 1, 2, 0]) array([[ 12., 15., 18., 21.], [ 12., 13., 14., 15.], [ 4., 5., 6., 7.], [ 8., 9., 10., 11.], [ 24., 28., 32., 36.]]) :: # reduce such that result has the following two columns: # [col1 * col2 * col3, col4] >>> np.multiply.reduceat(x, [0, 3], 1) array([[ 0., 3.], [ 120., 7.], [ 720., 11.], [ 2184., 15.]]) """)) add_newdoc('numpy.core', 'ufunc', ('outer', """ outer(A, B, **kwargs) Apply the ufunc `op` to all pairs (a, b) with a in `A` and b in `B`. Let ``M = A.ndim``, ``N = B.ndim``. Then the result, `C`, of ``op.outer(A, B)`` is an array of dimension M + N such that: .. math:: C[i_0, ..., i_{M-1}, j_0, ..., j_{N-1}] = op(A[i_0, ..., i_{M-1}], B[j_0, ..., j_{N-1}]) For `A` and `B` one-dimensional, this is equivalent to:: r = empty(len(A),len(B)) for i in range(len(A)): for j in range(len(B)): r[i,j] = op(A[i], B[j]) # op = ufunc in question Parameters ---------- A : array_like First array B : array_like Second array kwargs : any Arguments to pass on to the ufunc. Typically `dtype` or `out`. Returns ------- r : ndarray Output array See Also -------- numpy.outer Examples -------- >>> np.multiply.outer([1, 2, 3], [4, 5, 6]) array([[ 4, 5, 6], [ 8, 10, 12], [12, 15, 18]]) A multi-dimensional example: >>> A = np.array([[1, 2, 3], [4, 5, 6]]) >>> A.shape (2, 3) >>> B = np.array([[1, 2, 3, 4]]) >>> B.shape (1, 4) >>> C = np.multiply.outer(A, B) >>> C.shape; C (2, 3, 1, 4) array([[[[ 1, 2, 3, 4]], [[ 2, 4, 6, 8]], [[ 3, 6, 9, 12]]], [[[ 4, 8, 12, 16]], [[ 5, 10, 15, 20]], [[ 6, 12, 18, 24]]]]) """)) add_newdoc('numpy.core', 'ufunc', ('at', """ at(a, indices, b=None) Performs unbuffered in place operation on operand 'a' for elements specified by 'indices'. For addition ufunc, this method is equivalent to `a[indices] += b`, except that results are accumulated for elements that are indexed more than once. For example, `a[[0,0]] += 1` will only increment the first element once because of buffering, whereas `add.at(a, [0,0], 1)` will increment the first element twice. .. versionadded:: 1.8.0 Parameters ---------- a : array_like The array to perform in place operation on. indices : array_like or tuple Array like index object or slice object for indexing into first operand. If first operand has multiple dimensions, indices can be a tuple of array like index objects or slice objects. b : array_like Second operand for ufuncs requiring two operands. Operand must be broadcastable over first operand after indexing or slicing. Examples -------- Set items 0 and 1 to their negative values: >>> a = np.array([1, 2, 3, 4]) >>> np.negative.at(a, [0, 1]) >>> print(a) array([-1, -2, 3, 4]) :: Increment items 0 and 1, and increment item 2 twice: >>> a = np.array([1, 2, 3, 4]) >>> np.add.at(a, [0, 1, 2, 2], 1) >>> print(a) array([2, 3, 5, 4]) :: Add items 0 and 1 in first array to second array, and store results in first array: >>> a = np.array([1, 2, 3, 4]) >>> b = np.array([1, 2]) >>> np.add.at(a, [0, 1], b) >>> print(a) array([2, 4, 3, 4]) """)) ############################################################################## # # Documentation for dtype attributes and methods # ############################################################################## ############################################################################## # # dtype object # ############################################################################## add_newdoc('numpy.core.multiarray', 'dtype', """ dtype(obj, align=False, copy=False) Create a data type object. A numpy array is homogeneous, and contains elements described by a dtype object. A dtype object can be constructed from different combinations of fundamental numeric types. Parameters ---------- obj Object to be converted to a data type object. align : bool, optional Add padding to the fields to match what a C compiler would output for a similar C-struct. Can be ``True`` only if `obj` is a dictionary or a comma-separated string. If a struct dtype is being created, this also sets a sticky alignment flag ``isalignedstruct``. copy : bool, optional Make a new copy of the data-type object. If ``False``, the result may just be a reference to a built-in data-type object. See also -------- result_type Examples -------- Using array-scalar type: >>> np.dtype(np.int16) dtype('int16') Structured type, one field name 'f1', containing int16: >>> np.dtype([('f1', np.int16)]) dtype([('f1', '<i2')]) Structured type, one field named 'f1', in itself containing a structured type with one field: >>> np.dtype([('f1', [('f1', np.int16)])]) dtype([('f1', [('f1', '<i2')])]) Structured type, two fields: the first field contains an unsigned int, the second an int32: >>> np.dtype([('f1', np.uint), ('f2', np.int32)]) dtype([('f1', '<u4'), ('f2', '<i4')]) Using array-protocol type strings: >>> np.dtype([('a','f8'),('b','S10')]) dtype([('a', '<f8'), ('b', '|S10')]) Using comma-separated field formats. The shape is (2,3): >>> np.dtype("i4, (2,3)f8") dtype([('f0', '<i4'), ('f1', '<f8', (2, 3))]) Using tuples. ``int`` is a fixed type, 3 the field's shape. ``void`` is a flexible type, here of size 10: >>> np.dtype([('hello',(int,3)),('world',np.void,10)]) dtype([('hello', '<i4', 3), ('world', '|V10')]) Subdivide ``int16`` into 2 ``int8``'s, called x and y. 0 and 1 are the offsets in bytes: >>> np.dtype((np.int16, {'x':(np.int8,0), 'y':(np.int8,1)})) dtype(('<i2', [('x', '|i1'), ('y', '|i1')])) Using dictionaries. Two fields named 'gender' and 'age': >>> np.dtype({'names':['gender','age'], 'formats':['S1',np.uint8]}) dtype([('gender', '|S1'), ('age', '|u1')]) Offsets in bytes, here 0 and 25: >>> np.dtype({'surname':('S25',0),'age':(np.uint8,25)}) dtype([('surname', '|S25'), ('age', '|u1')]) """) ############################################################################## # # dtype attributes # ############################################################################## add_newdoc('numpy.core.multiarray', 'dtype', ('alignment', """ The required alignment (bytes) of this data-type according to the compiler. More information is available in the C-API section of the manual. """)) add_newdoc('numpy.core.multiarray', 'dtype', ('byteorder', """ A character indicating the byte-order of this data-type object. One of: === ============== '=' native '<' little-endian '>' big-endian '|' not applicable === ============== All built-in data-type objects have byteorder either '=' or '|'. Examples -------- >>> dt = np.dtype('i2') >>> dt.byteorder '=' >>> # endian is not relevant for 8 bit numbers >>> np.dtype('i1').byteorder '|' >>> # or ASCII strings >>> np.dtype('S2').byteorder '|' >>> # Even if specific code is given, and it is native >>> # '=' is the byteorder >>> import sys >>> sys_is_le = sys.byteorder == 'little' >>> native_code = sys_is_le and '<' or '>' >>> swapped_code = sys_is_le and '>' or '<' >>> dt = np.dtype(native_code + 'i2') >>> dt.byteorder '=' >>> # Swapped code shows up as itself >>> dt = np.dtype(swapped_code + 'i2') >>> dt.byteorder == swapped_code True """)) add_newdoc('numpy.core.multiarray', 'dtype', ('char', """A unique character code for each of the 21 different built-in types.""")) add_newdoc('numpy.core.multiarray', 'dtype', ('descr', """ PEP3118 interface description of the data-type. The format is that required by the 'descr' key in the PEP3118 `__array_interface__` attribute. Warning: This attribute exists specifically for PEP3118 compliance, and is not a datatype description compatible with `np.dtype`. """)) add_newdoc('numpy.core.multiarray', 'dtype', ('fields', """ Dictionary of named fields defined for this data type, or ``None``. The dictionary is indexed by keys that are the names of the fields. Each entry in the dictionary is a tuple fully describing the field:: (dtype, offset[, title]) If present, the optional title can be any object (if it is a string or unicode then it will also be a key in the fields dictionary, otherwise it's meta-data). Notice also that the first two elements of the tuple can be passed directly as arguments to the ``ndarray.getfield`` and ``ndarray.setfield`` methods. See Also -------- ndarray.getfield, ndarray.setfield Examples -------- >>> dt = np.dtype([('name', np.str_, 16), ('grades', np.float64, (2,))]) >>> print(dt.fields) {'grades': (dtype(('float64',(2,))), 16), 'name': (dtype('|S16'), 0)} """)) add_newdoc('numpy.core.multiarray', 'dtype', ('flags', """ Bit-flags describing how this data type is to be interpreted. Bit-masks are in `numpy.core.multiarray` as the constants `ITEM_HASOBJECT`, `LIST_PICKLE`, `ITEM_IS_POINTER`, `NEEDS_INIT`, `NEEDS_PYAPI`, `USE_GETITEM`, `USE_SETITEM`. A full explanation of these flags is in C-API documentation; they are largely useful for user-defined data-types. """)) add_newdoc('numpy.core.multiarray', 'dtype', ('hasobject', """ Boolean indicating whether this dtype contains any reference-counted objects in any fields or sub-dtypes. Recall that what is actually in the ndarray memory representing the Python object is the memory address of that object (a pointer). Special handling may be required, and this attribute is useful for distinguishing data types that may contain arbitrary Python objects and data-types that won't. """)) add_newdoc('numpy.core.multiarray', 'dtype', ('isbuiltin', """ Integer indicating how this dtype relates to the built-in dtypes. Read-only. = ======================================================================== 0 if this is a structured array type, with fields 1 if this is a dtype compiled into numpy (such as ints, floats etc) 2 if the dtype is for a user-defined numpy type A user-defined type uses the numpy C-API machinery to extend numpy to handle a new array type. See :ref:`user.user-defined-data-types` in the NumPy manual. = ======================================================================== Examples -------- >>> dt = np.dtype('i2') >>> dt.isbuiltin 1 >>> dt = np.dtype('f8') >>> dt.isbuiltin 1 >>> dt = np.dtype([('field1', 'f8')]) >>> dt.isbuiltin 0 """)) add_newdoc('numpy.core.multiarray', 'dtype', ('isnative', """ Boolean indicating whether the byte order of this dtype is native to the platform. """)) add_newdoc('numpy.core.multiarray', 'dtype', ('isalignedstruct', """ Boolean indicating whether the dtype is a struct which maintains field alignment. This flag is sticky, so when combining multiple structs together, it is preserved and produces new dtypes which are also aligned. """)) add_newdoc('numpy.core.multiarray', 'dtype', ('itemsize', """ The element size of this data-type object. For 18 of the 21 types this number is fixed by the data-type. For the flexible data-types, this number can be anything. """)) add_newdoc('numpy.core.multiarray', 'dtype', ('kind', """ A character code (one of 'biufcmMOSUV') identifying the general kind of data. = ====================== b boolean i signed integer u unsigned integer f floating-point c complex floating-point m timedelta M datetime O object S (byte-)string U Unicode V void = ====================== """)) add_newdoc('numpy.core.multiarray', 'dtype', ('name', """ A bit-width name for this data-type. Un-sized flexible data-type objects do not have this attribute. """)) add_newdoc('numpy.core.multiarray', 'dtype', ('names', """ Ordered list of field names, or ``None`` if there are no fields. The names are ordered according to increasing byte offset. This can be used, for example, to walk through all of the named fields in offset order. Examples -------- >>> dt = np.dtype([('name', np.str_, 16), ('grades', np.float64, (2,))]) >>> dt.names ('name', 'grades') """)) add_newdoc('numpy.core.multiarray', 'dtype', ('num', """ A unique number for each of the 21 different built-in types. These are roughly ordered from least-to-most precision. """)) add_newdoc('numpy.core.multiarray', 'dtype', ('shape', """ Shape tuple of the sub-array if this data type describes a sub-array, and ``()`` otherwise. """)) add_newdoc('numpy.core.multiarray', 'dtype', ('ndim', """ Number of dimensions of the sub-array if this data type describes a sub-array, and ``0`` otherwise. .. versionadded:: 1.13.0 """)) add_newdoc('numpy.core.multiarray', 'dtype', ('str', """The array-protocol typestring of this data-type object.""")) add_newdoc('numpy.core.multiarray', 'dtype', ('subdtype', """ Tuple ``(item_dtype, shape)`` if this `dtype` describes a sub-array, and None otherwise. The *shape* is the fixed shape of the sub-array described by this data type, and *item_dtype* the data type of the array. If a field whose dtype object has this attribute is retrieved, then the extra dimensions implied by *shape* are tacked on to the end of the retrieved array. """)) add_newdoc('numpy.core.multiarray', 'dtype', ('type', """The type object used to instantiate a scalar of this data-type.""")) ############################################################################## # # dtype methods # ############################################################################## add_newdoc('numpy.core.multiarray', 'dtype', ('newbyteorder', """ newbyteorder(new_order='S') Return a new dtype with a different byte order. Changes are also made in all fields and sub-arrays of the data type. Parameters ---------- new_order : string, optional Byte order to force; a value from the byte order specifications below. The default value ('S') results in swapping the current byte order. `new_order` codes can be any of: * 'S' - swap dtype from current to opposite endian * {'<', 'L'} - little endian * {'>', 'B'} - big endian * {'=', 'N'} - native order * {'|', 'I'} - ignore (no change to byte order) The code does a case-insensitive check on the first letter of `new_order` for these alternatives. For example, any of '>' or 'B' or 'b' or 'brian' are valid to specify big-endian. Returns ------- new_dtype : dtype New dtype object with the given change to the byte order. Notes ----- Changes are also made in all fields and sub-arrays of the data type. Examples -------- >>> import sys >>> sys_is_le = sys.byteorder == 'little' >>> native_code = sys_is_le and '<' or '>' >>> swapped_code = sys_is_le and '>' or '<' >>> native_dt = np.dtype(native_code+'i2') >>> swapped_dt = np.dtype(swapped_code+'i2') >>> native_dt.newbyteorder('S') == swapped_dt True >>> native_dt.newbyteorder() == swapped_dt True >>> native_dt == swapped_dt.newbyteorder('S') True >>> native_dt == swapped_dt.newbyteorder('=') True >>> native_dt == swapped_dt.newbyteorder('N') True >>> native_dt == native_dt.newbyteorder('|') True >>> np.dtype('<i2') == native_dt.newbyteorder('<') True >>> np.dtype('<i2') == native_dt.newbyteorder('L') True >>> np.dtype('>i2') == native_dt.newbyteorder('>') True >>> np.dtype('>i2') == native_dt.newbyteorder('B') True """)) ############################################################################## # # Datetime-related Methods # ############################################################################## add_newdoc('numpy.core.multiarray', 'busdaycalendar', """ busdaycalendar(weekmask='1111100', holidays=None) A business day calendar object that efficiently stores information defining valid days for the busday family of functions. The default valid days are Monday through Friday ("business days"). A busdaycalendar object can be specified with any set of weekly valid days, plus an optional "holiday" dates that always will be invalid. Once a busdaycalendar object is created, the weekmask and holidays cannot be modified. .. versionadded:: 1.7.0 Parameters ---------- weekmask : str or array_like of bool, optional A seven-element array indicating which of Monday through Sunday are valid days. May be specified as a length-seven list or array, like [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for weekdays, optionally separated by white space. Valid abbreviations are: Mon Tue Wed Thu Fri Sat Sun holidays : array_like of datetime64[D], optional An array of dates to consider as invalid dates, no matter which weekday they fall upon. Holiday dates may be specified in any order, and NaT (not-a-time) dates are ignored. This list is saved in a normalized form that is suited for fast calculations of valid days. Returns ------- out : busdaycalendar A business day calendar object containing the specified weekmask and holidays values. See Also -------- is_busday : Returns a boolean array indicating valid days. busday_offset : Applies an offset counted in valid days. busday_count : Counts how many valid days are in a half-open date range. Attributes ---------- Note: once a busdaycalendar object is created, you cannot modify the weekmask or holidays. The attributes return copies of internal data. weekmask : (copy) seven-element array of bool holidays : (copy) sorted array of datetime64[D] Examples -------- >>> # Some important days in July ... bdd = np.busdaycalendar( ... holidays=['2011-07-01', '2011-07-04', '2011-07-17']) >>> # Default is Monday to Friday weekdays ... bdd.weekmask array([ True, True, True, True, True, False, False], dtype='bool') >>> # Any holidays already on the weekend are removed ... bdd.holidays array(['2011-07-01', '2011-07-04'], dtype='datetime64[D]') """) add_newdoc('numpy.core.multiarray', 'busdaycalendar', ('weekmask', """A copy of the seven-element boolean mask indicating valid days.""")) add_newdoc('numpy.core.multiarray', 'busdaycalendar', ('holidays', """A copy of the holiday array indicating additional invalid days.""")) add_newdoc('numpy.core.multiarray', 'is_busday', """ is_busday(dates, weekmask='1111100', holidays=None, busdaycal=None, out=None) Calculates which of the given dates are valid days, and which are not. .. versionadded:: 1.7.0 Parameters ---------- dates : array_like of datetime64[D] The array of dates to process. weekmask : str or array_like of bool, optional A seven-element array indicating which of Monday through Sunday are valid days. May be specified as a length-seven list or array, like [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for weekdays, optionally separated by white space. Valid abbreviations are: Mon Tue Wed Thu Fri Sat Sun holidays : array_like of datetime64[D], optional An array of dates to consider as invalid dates. They may be specified in any order, and NaT (not-a-time) dates are ignored. This list is saved in a normalized form that is suited for fast calculations of valid days. busdaycal : busdaycalendar, optional A `busdaycalendar` object which specifies the valid days. If this parameter is provided, neither weekmask nor holidays may be provided. out : array of bool, optional If provided, this array is filled with the result. Returns ------- out : array of bool An array with the same shape as ``dates``, containing True for each valid day, and False for each invalid day. See Also -------- busdaycalendar: An object that specifies a custom set of valid days. busday_offset : Applies an offset counted in valid days. busday_count : Counts how many valid days are in a half-open date range. Examples -------- >>> # The weekdays are Friday, Saturday, and Monday ... np.is_busday(['2011-07-01', '2011-07-02', '2011-07-18'], ... holidays=['2011-07-01', '2011-07-04', '2011-07-17']) array([False, False, True], dtype='bool') """) add_newdoc('numpy.core.multiarray', 'busday_offset', """ busday_offset(dates, offsets, roll='raise', weekmask='1111100', holidays=None, busdaycal=None, out=None) First adjusts the date to fall on a valid day according to the ``roll`` rule, then applies offsets to the given dates counted in valid days. .. versionadded:: 1.7.0 Parameters ---------- dates : array_like of datetime64[D] The array of dates to process. offsets : array_like of int The array of offsets, which is broadcast with ``dates``. roll : {'raise', 'nat', 'forward', 'following', 'backward', 'preceding', 'modifiedfollowing', 'modifiedpreceding'}, optional How to treat dates that do not fall on a valid day. The default is 'raise'. * 'raise' means to raise an exception for an invalid day. * 'nat' means to return a NaT (not-a-time) for an invalid day. * 'forward' and 'following' mean to take the first valid day later in time. * 'backward' and 'preceding' mean to take the first valid day earlier in time. * 'modifiedfollowing' means to take the first valid day later in time unless it is across a Month boundary, in which case to take the first valid day earlier in time. * 'modifiedpreceding' means to take the first valid day earlier in time unless it is across a Month boundary, in which case to take the first valid day later in time. weekmask : str or array_like of bool, optional A seven-element array indicating which of Monday through Sunday are valid days. May be specified as a length-seven list or array, like [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for weekdays, optionally separated by white space. Valid abbreviations are: Mon Tue Wed Thu Fri Sat Sun holidays : array_like of datetime64[D], optional An array of dates to consider as invalid dates. They may be specified in any order, and NaT (not-a-time) dates are ignored. This list is saved in a normalized form that is suited for fast calculations of valid days. busdaycal : busdaycalendar, optional A `busdaycalendar` object which specifies the valid days. If this parameter is provided, neither weekmask nor holidays may be provided. out : array of datetime64[D], optional If provided, this array is filled with the result. Returns ------- out : array of datetime64[D] An array with a shape from broadcasting ``dates`` and ``offsets`` together, containing the dates with offsets applied. See Also -------- busdaycalendar: An object that specifies a custom set of valid days. is_busday : Returns a boolean array indicating valid days. busday_count : Counts how many valid days are in a half-open date range. Examples -------- >>> # First business day in October 2011 (not accounting for holidays) ... np.busday_offset('2011-10', 0, roll='forward') numpy.datetime64('2011-10-03','D') >>> # Last business day in February 2012 (not accounting for holidays) ... np.busday_offset('2012-03', -1, roll='forward') numpy.datetime64('2012-02-29','D') >>> # Third Wednesday in January 2011 ... np.busday_offset('2011-01', 2, roll='forward', weekmask='Wed') numpy.datetime64('2011-01-19','D') >>> # 2012 Mother's Day in Canada and the U.S. ... np.busday_offset('2012-05', 1, roll='forward', weekmask='Sun') numpy.datetime64('2012-05-13','D') >>> # First business day on or after a date ... np.busday_offset('2011-03-20', 0, roll='forward') numpy.datetime64('2011-03-21','D') >>> np.busday_offset('2011-03-22', 0, roll='forward') numpy.datetime64('2011-03-22','D') >>> # First business day after a date ... np.busday_offset('2011-03-20', 1, roll='backward') numpy.datetime64('2011-03-21','D') >>> np.busday_offset('2011-03-22', 1, roll='backward') numpy.datetime64('2011-03-23','D') """) add_newdoc('numpy.core.multiarray', 'busday_count', """ busday_count(begindates, enddates, weekmask='1111100', holidays=[], busdaycal=None, out=None) Counts the number of valid days between `begindates` and `enddates`, not including the day of `enddates`. If ``enddates`` specifies a date value that is earlier than the corresponding ``begindates`` date value, the count will be negative. .. versionadded:: 1.7.0 Parameters ---------- begindates : array_like of datetime64[D] The array of the first dates for counting. enddates : array_like of datetime64[D] The array of the end dates for counting, which are excluded from the count themselves. weekmask : str or array_like of bool, optional A seven-element array indicating which of Monday through Sunday are valid days. May be specified as a length-seven list or array, like [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for weekdays, optionally separated by white space. Valid abbreviations are: Mon Tue Wed Thu Fri Sat Sun holidays : array_like of datetime64[D], optional An array of dates to consider as invalid dates. They may be specified in any order, and NaT (not-a-time) dates are ignored. This list is saved in a normalized form that is suited for fast calculations of valid days. busdaycal : busdaycalendar, optional A `busdaycalendar` object which specifies the valid days. If this parameter is provided, neither weekmask nor holidays may be provided. out : array of int, optional If provided, this array is filled with the result. Returns ------- out : array of int An array with a shape from broadcasting ``begindates`` and ``enddates`` together, containing the number of valid days between the begin and end dates. See Also -------- busdaycalendar: An object that specifies a custom set of valid days. is_busday : Returns a boolean array indicating valid days. busday_offset : Applies an offset counted in valid days. Examples -------- >>> # Number of weekdays in January 2011 ... np.busday_count('2011-01', '2011-02') 21 >>> # Number of weekdays in 2011 ... np.busday_count('2011', '2012') 260 >>> # Number of Saturdays in 2011 ... np.busday_count('2011', '2012', weekmask='Sat') 53 """) add_newdoc('numpy.core.multiarray', 'normalize_axis_index', """ normalize_axis_index(axis, ndim, msg_prefix=None) Normalizes an axis index, `axis`, such that is a valid positive index into the shape of array with `ndim` dimensions. Raises an AxisError with an appropriate message if this is not possible. Used internally by all axis-checking logic. .. versionadded:: 1.13.0 Parameters ---------- axis : int The un-normalized index of the axis. Can be negative ndim : int The number of dimensions of the array that `axis` should be normalized against msg_prefix : str A prefix to put before the message, typically the name of the argument Returns ------- normalized_axis : int The normalized axis index, such that `0 <= normalized_axis < ndim` Raises ------ AxisError If the axis index is invalid, when `-ndim <= axis < ndim` is false. Examples -------- >>> normalize_axis_index(0, ndim=3) 0 >>> normalize_axis_index(1, ndim=3) 1 >>> normalize_axis_index(-1, ndim=3) 2 >>> normalize_axis_index(3, ndim=3) Traceback (most recent call last): ... AxisError: axis 3 is out of bounds for array of dimension 3 >>> normalize_axis_index(-4, ndim=3, msg_prefix='axes_arg') Traceback (most recent call last): ... AxisError: axes_arg: axis -4 is out of bounds for array of dimension 3 """) add_newdoc('numpy.core.multiarray', 'datetime_as_string', """ datetime_as_string(arr, unit=None, timezone='naive', casting='same_kind') Convert an array of datetimes into an array of strings. Parameters ---------- arr : array_like of datetime64 The array of UTC timestamps to format. unit : str One of None, 'auto', or a datetime unit. timezone : {'naive', 'UTC', 'local'} or tzinfo Timezone information to use when displaying the datetime. If 'UTC', end with a Z to indicate UTC time. If 'local', convert to the local timezone first, and suffix with a +-#### timezone offset. If a tzinfo object, then do as with 'local', but use the specified timezone. casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'} Casting to allow when changing between datetime units. Returns ------- str_arr : ndarray An array of strings the same shape as `arr`. Examples -------- >>> d = np.arange('2002-10-27T04:30', 4*60, 60, dtype='M8[m]') >>> d array(['2002-10-27T04:30', '2002-10-27T05:30', '2002-10-27T06:30', '2002-10-27T07:30'], dtype='datetime64[m]') Setting the timezone to UTC shows the same information, but with a Z suffix >>> np.datetime_as_string(d, timezone='UTC') array(['2002-10-27T04:30Z', '2002-10-27T05:30Z', '2002-10-27T06:30Z', '2002-10-27T07:30Z'], dtype='<U35') Note that we picked datetimes that cross a DST boundary. Passing in a ``pytz`` timezone object will print the appropriate offset:: >>> np.datetime_as_string(d, timezone=pytz.timezone('US/Eastern')) array(['2002-10-27T00:30-0400', '2002-10-27T01:30-0400', '2002-10-27T01:30-0500', '2002-10-27T02:30-0500'], dtype='<U39') Passing in a unit will change the precision:: >>> np.datetime_as_string(d, unit='h') array(['2002-10-27T04', '2002-10-27T05', '2002-10-27T06', '2002-10-27T07'], dtype='<U32') >>> np.datetime_as_string(d, unit='s') array(['2002-10-27T04:30:00', '2002-10-27T05:30:00', '2002-10-27T06:30:00', '2002-10-27T07:30:00'], dtype='<U38') But can be made to not lose precision:: >>> np.datetime_as_string(d, unit='h', casting='safe') TypeError: Cannot create a datetime string as units 'h' from a NumPy datetime with units 'm' according to the rule 'safe' """) add_newdoc('numpy.core.multiarray', 'datetime_data', """ datetime_data(dtype, /) Get information about the step size of a date or time type. The returned tuple can be passed as the second argument of `datetime64` and `timedelta64`. Parameters ---------- dtype : dtype The dtype object, which must be a `datetime64` or `timedelta64` type. Returns ------- unit : str The :ref:`datetime unit <arrays.dtypes.dateunits>` on which this dtype is based. count : int The number of base units in a step. Examples -------- >>> dt_25s = np.dtype('timedelta64[25s]') >>> np.datetime_data(dt_25s) ('s', 25) >>> np.array(10, dt_25s).astype('timedelta64[s]') array(250, dtype='timedelta64[s]') The result can be used to construct a datetime that uses the same units as a timedelta:: >>> np.datetime64('2010', np.datetime_data(dt_25s)) numpy.datetime64('2010-01-01T00:00:00','25s') """) ############################################################################## # # nd_grid instances # ############################################################################## add_newdoc('numpy.lib.index_tricks', 'mgrid', """ `nd_grid` instance which returns a dense multi-dimensional "meshgrid". An instance of `numpy.lib.index_tricks.nd_grid` which returns an dense (or fleshed out) mesh-grid when indexed, so that each returned argument has the same shape. The dimensions and number of the output arrays are equal to the number of indexing dimensions. If the step length is not a complex number, then the stop is not inclusive. However, if the step length is a **complex number** (e.g. 5j), then the integer part of its magnitude is interpreted as specifying the number of points to create between the start and stop values, where the stop value **is inclusive**. Returns ---------- mesh-grid `ndarrays` all of the same dimensions See Also -------- numpy.lib.index_tricks.nd_grid : class of `ogrid` and `mgrid` objects ogrid : like mgrid but returns open (not fleshed out) mesh grids r_ : array concatenator Examples -------- >>> np.mgrid[0:5,0:5] array([[[0, 0, 0, 0, 0], [1, 1, 1, 1, 1], [2, 2, 2, 2, 2], [3, 3, 3, 3, 3], [4, 4, 4, 4, 4]], [[0, 1, 2, 3, 4], [0, 1, 2, 3, 4], [0, 1, 2, 3, 4], [0, 1, 2, 3, 4], [0, 1, 2, 3, 4]]]) >>> np.mgrid[-1:1:5j] array([-1. , -0.5, 0. , 0.5, 1. ]) """) add_newdoc('numpy.lib.index_tricks', 'ogrid', """ `nd_grid` instance which returns an open multi-dimensional "meshgrid". An instance of `numpy.lib.index_tricks.nd_grid` which returns an open (i.e. not fleshed out) mesh-grid when indexed, so that only one dimension of each returned array is greater than 1. The dimension and number of the output arrays are equal to the number of indexing dimensions. If the step length is not a complex number, then the stop is not inclusive. However, if the step length is a **complex number** (e.g. 5j), then the integer part of its magnitude is interpreted as specifying the number of points to create between the start and stop values, where the stop value **is inclusive**. Returns ---------- mesh-grid `ndarrays` with only one dimension :math:`\\neq 1` See Also -------- np.lib.index_tricks.nd_grid : class of `ogrid` and `mgrid` objects mgrid : like `ogrid` but returns dense (or fleshed out) mesh grids r_ : array concatenator Examples -------- >>> from numpy import ogrid >>> ogrid[-1:1:5j] array([-1. , -0.5, 0. , 0.5, 1. ]) >>> ogrid[0:5,0:5] [array([[0], [1], [2], [3], [4]]), array([[0, 1, 2, 3, 4]])] """) ############################################################################## # # Documentation for `generic` attributes and methods # ############################################################################## add_newdoc('numpy.core.numerictypes', 'generic', """ Base class for numpy scalar types. Class from which most (all?) numpy scalar types are derived. For consistency, exposes the same API as `ndarray`, despite many consequent attributes being either "get-only," or completely irrelevant. This is the class from which it is strongly suggested users should derive custom scalar types. """) # Attributes add_newdoc('numpy.core.numerictypes', 'generic', ('T', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('base', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('data', """Pointer to start of data.""")) add_newdoc('numpy.core.numerictypes', 'generic', ('dtype', """Get array data-descriptor.""")) add_newdoc('numpy.core.numerictypes', 'generic', ('flags', """The integer value of flags.""")) add_newdoc('numpy.core.numerictypes', 'generic', ('flat', """A 1-D view of the scalar.""")) add_newdoc('numpy.core.numerictypes', 'generic', ('imag', """The imaginary part of the scalar.""")) add_newdoc('numpy.core.numerictypes', 'generic', ('itemsize', """The length of one element in bytes.""")) add_newdoc('numpy.core.numerictypes', 'generic', ('nbytes', """The length of the scalar in bytes.""")) add_newdoc('numpy.core.numerictypes', 'generic', ('ndim', """The number of array dimensions.""")) add_newdoc('numpy.core.numerictypes', 'generic', ('real', """The real part of the scalar.""")) add_newdoc('numpy.core.numerictypes', 'generic', ('shape', """Tuple of array dimensions.""")) add_newdoc('numpy.core.numerictypes', 'generic', ('size', """The number of elements in the gentype.""")) add_newdoc('numpy.core.numerictypes', 'generic', ('strides', """Tuple of bytes steps in each dimension.""")) # Methods add_newdoc('numpy.core.numerictypes', 'generic', ('all', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('any', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('argmax', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('argmin', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('argsort', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('astype', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('byteswap', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('choose', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('clip', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('compress', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('conjugate', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('copy', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('cumprod', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('cumsum', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('diagonal', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('dump', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('dumps', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('fill', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('flatten', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('getfield', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('item', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('itemset', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('max', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('mean', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('min', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('newbyteorder', """ newbyteorder(new_order='S') Return a new `dtype` with a different byte order. Changes are also made in all fields and sub-arrays of the data type. The `new_order` code can be any from the following: * 'S' - swap dtype from current to opposite endian * {'<', 'L'} - little endian * {'>', 'B'} - big endian * {'=', 'N'} - native order * {'|', 'I'} - ignore (no change to byte order) Parameters ---------- new_order : str, optional Byte order to force; a value from the byte order specifications above. The default value ('S') results in swapping the current byte order. The code does a case-insensitive check on the first letter of `new_order` for the alternatives above. For example, any of 'B' or 'b' or 'biggish' are valid to specify big-endian. Returns ------- new_dtype : dtype New `dtype` object with the given change to the byte order. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('nonzero', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('prod', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('ptp', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('put', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('ravel', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('repeat', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('reshape', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('resize', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('round', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('searchsorted', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('setfield', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('setflags', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('sort', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('squeeze', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('std', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('sum', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('swapaxes', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('take', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('tofile', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('tolist', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('tostring', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('trace', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('transpose', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('var', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) add_newdoc('numpy.core.numerictypes', 'generic', ('view', """ Not implemented (virtual attribute) Class generic exists solely to derive numpy scalars from, and possesses, albeit unimplemented, all the attributes of the ndarray class so as to provide a uniform API. See Also -------- The corresponding attribute of the derived class of interest. """)) ############################################################################## # # Documentation for other scalar classes # ############################################################################## add_newdoc('numpy.core.numerictypes', 'bool_', """NumPy's Boolean type. Character code: ``?``. Alias: bool8""") add_newdoc('numpy.core.numerictypes', 'complex64', """ Complex number type composed of two 32 bit floats. Character code: 'F'. """) add_newdoc('numpy.core.numerictypes', 'complex128', """ Complex number type composed of two 64 bit floats. Character code: 'D'. Python complex compatible. """) add_newdoc('numpy.core.numerictypes', 'complex256', """ Complex number type composed of two 128-bit floats. Character code: 'G'. """) add_newdoc('numpy.core.numerictypes', 'float32', """ 32-bit floating-point number. Character code 'f'. C float compatible. """) add_newdoc('numpy.core.numerictypes', 'float64', """ 64-bit floating-point number. Character code 'd'. Python float compatible. """) add_newdoc('numpy.core.numerictypes', 'float96', """ """) add_newdoc('numpy.core.numerictypes', 'float128', """ 128-bit floating-point number. Character code: 'g'. C long float compatible. """) add_newdoc('numpy.core.numerictypes', 'int8', """8-bit integer. Character code ``b``. C char compatible.""") add_newdoc('numpy.core.numerictypes', 'int16', """16-bit integer. Character code ``h``. C short compatible.""") add_newdoc('numpy.core.numerictypes', 'int32', """32-bit integer. Character code 'i'. C int compatible.""") add_newdoc('numpy.core.numerictypes', 'int64', """64-bit integer. Character code 'l'. Python int compatible.""") add_newdoc('numpy.core.numerictypes', 'object_', """Any Python object. Character code: 'O'.""")
234,747
28.576414
128
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/_globals.py
""" Module defining global singleton classes. This module raises a RuntimeError if an attempt to reload it is made. In that way the identities of the classes defined here are fixed and will remain so even if numpy itself is reloaded. In particular, a function like the following will still work correctly after numpy is reloaded:: def foo(arg=np._NoValue): if arg is np._NoValue: ... That was not the case when the singleton classes were defined in the numpy ``__init__.py`` file. See gh-7844 for a discussion of the reload problem that motivated this module. """ from __future__ import division, absolute_import, print_function __ALL__ = [ 'ModuleDeprecationWarning', 'VisibleDeprecationWarning', '_NoValue' ] # Disallow reloading this module so as to preserve the identities of the # classes defined here. if '_is_loaded' in globals(): raise RuntimeError('Reloading numpy._globals is not allowed') _is_loaded = True class ModuleDeprecationWarning(DeprecationWarning): """Module deprecation warning. The nose tester turns ordinary Deprecation warnings into test failures. That makes it hard to deprecate whole modules, because they get imported by default. So this is a special Deprecation warning that the nose tester will let pass without making tests fail. """ pass class VisibleDeprecationWarning(UserWarning): """Visible deprecation warning. By default, python will not show deprecation warnings, so this class can be used when a very visible warning is helpful, for example because the usage is most likely a user bug. """ pass class _NoValue(object): """Special keyword value. This class may be used as the default value assigned to a deprecated keyword in order to check if it has been given a user defined value. """ pass
1,859
28.52381
78
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/__init__.py
""" NumPy ===== Provides 1. An array object of arbitrary homogeneous items 2. Fast mathematical operations over arrays 3. Linear Algebra, Fourier Transforms, Random Number Generation How to use the documentation ---------------------------- Documentation is available in two forms: docstrings provided with the code, and a loose standing reference guide, available from `the NumPy homepage <http://www.scipy.org>`_. We recommend exploring the docstrings using `IPython <http://ipython.scipy.org>`_, an advanced Python shell with TAB-completion and introspection capabilities. See below for further instructions. The docstring examples assume that `numpy` has been imported as `np`:: >>> import numpy as np Code snippets are indicated by three greater-than signs:: >>> x = 42 >>> x = x + 1 Use the built-in ``help`` function to view a function's docstring:: >>> help(np.sort) ... # doctest: +SKIP For some objects, ``np.info(obj)`` may provide additional help. This is particularly true if you see the line "Help on ufunc object:" at the top of the help() page. Ufuncs are implemented in C, not Python, for speed. The native Python help() does not know how to view their help, but our np.info() function does. To search for documents containing a keyword, do:: >>> np.lookfor('keyword') ... # doctest: +SKIP General-purpose documents like a glossary and help on the basic concepts of numpy are available under the ``doc`` sub-module:: >>> from numpy import doc >>> help(doc) ... # doctest: +SKIP Available subpackages --------------------- doc Topical documentation on broadcasting, indexing, etc. lib Basic functions used by several sub-packages. random Core Random Tools linalg Core Linear Algebra Tools fft Core FFT routines polynomial Polynomial tools testing NumPy testing tools f2py Fortran to Python Interface Generator. distutils Enhancements to distutils with support for Fortran compilers support and more. Utilities --------- test Run numpy unittests show_config Show numpy build configuration dual Overwrite certain functions with high-performance Scipy tools matlib Make everything matrices. __version__ NumPy version string Viewing documentation using IPython ----------------------------------- Start IPython with the NumPy profile (``ipython -p numpy``), which will import `numpy` under the alias `np`. Then, use the ``cpaste`` command to paste examples into the shell. To see which functions are available in `numpy`, type ``np.<TAB>`` (where ``<TAB>`` refers to the TAB key), or use ``np.*cos*?<ENTER>`` (where ``<ENTER>`` refers to the ENTER key) to narrow down the list. To view the docstring for a function, use ``np.cos?<ENTER>`` (to view the docstring) and ``np.cos??<ENTER>`` (to view the source code). Copies vs. in-place operation ----------------------------- Most of the functions in `numpy` return a copy of the array argument (e.g., `np.sort`). In-place versions of these functions are often available as array methods, i.e. ``x = np.array([1,2,3]); x.sort()``. Exceptions to this rule are documented. """ from __future__ import division, absolute_import, print_function import sys import warnings from ._globals import ModuleDeprecationWarning, VisibleDeprecationWarning from ._globals import _NoValue # We first need to detect if we're being called as part of the numpy setup # procedure itself in a reliable manner. try: __NUMPY_SETUP__ except NameError: __NUMPY_SETUP__ = False if __NUMPY_SETUP__: sys.stderr.write('Running from numpy source directory.\n') else: try: from numpy.__config__ import show as show_config except ImportError: msg = """Error importing numpy: you should not try to import numpy from its source directory; please exit the numpy source tree, and relaunch your python interpreter from there.""" raise ImportError(msg) from .version import git_revision as __git_revision__ from .version import version as __version__ from ._import_tools import PackageLoader def pkgload(*packages, **options): loader = PackageLoader(infunc=True) return loader(*packages, **options) from . import add_newdocs __all__ = ['add_newdocs', 'ModuleDeprecationWarning', 'VisibleDeprecationWarning'] pkgload.__doc__ = PackageLoader.__call__.__doc__ # We don't actually use this ourselves anymore, but I'm not 100% sure that # no-one else in the world is using it (though I hope not) from .testing import Tester, _numpy_tester test = _numpy_tester().test bench = _numpy_tester().bench # Allow distributors to run custom init code from . import _distributor_init from . import core from .core import * from . import compat from . import lib from .lib import * from . import linalg from . import fft from . import polynomial from . import random from . import ctypeslib from . import ma from . import matrixlib as _mat from .matrixlib import * from .compat import long # Make these accessible from numpy name-space # but not imported in from numpy import * if sys.version_info[0] >= 3: from builtins import bool, int, float, complex, object, str unicode = str else: from __builtin__ import bool, int, float, complex, object, unicode, str from .core import round, abs, max, min __all__.extend(['__version__', 'pkgload', 'PackageLoader', 'show_config']) __all__.extend(core.__all__) __all__.extend(_mat.__all__) __all__.extend(lib.__all__) __all__.extend(['linalg', 'fft', 'random', 'ctypeslib', 'ma']) # Filter annoying Cython warnings that serve no good purpose. warnings.filterwarnings("ignore", message="numpy.dtype size changed") warnings.filterwarnings("ignore", message="numpy.ufunc size changed") warnings.filterwarnings("ignore", message="numpy.ndarray size changed") # oldnumeric and numarray were removed in 1.9. In case some packages import # but do not use them, we define them here for backward compatibility. oldnumeric = 'removed' numarray = 'removed' def _sanity_check(): """ Quick sanity checks for common bugs caused by environment. There are some cases (e.g., the wrong BLAS ABI) that cause wrong results under specific runtime conditions that are not necessarily achieved during test suite runs, and it is useful to catch those early. See https://github.com/numpy/numpy/issues/8577 and other similar bug reports. """ try: x = ones(2, dtype=float32) if not abs(x.dot(x) - 2.0) < 1e-5: raise AssertionError() except AssertionError: msg = ("The current Numpy installation ({!r}) fails to " "pass simple sanity checks. This can be caused for example " "by incorrect BLAS library being linked in.") raise RuntimeError(msg.format(__file__)) _sanity_check() del _sanity_check
7,171
31.017857
79
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/__config__.py
# This file is generated by numpy's setup.py # It contains system_info results at the time of building this package. __all__ = ["get_info","show"] import os import sys extra_dll_dir = os.path.join(os.path.dirname(__file__), '.libs') if sys.platform == 'win32' and os.path.isdir(extra_dll_dir): os.environ.setdefault('PATH', '') os.environ['PATH'] += os.pathsep + extra_dll_dir blas_mkl_info={} blis_info={} openblas_info={} atlas_3_10_blas_threads_info={} atlas_3_10_blas_info={} atlas_blas_threads_info={} atlas_blas_info={} blas_opt_info={'extra_compile_args': ['-msse3', '-I/System/Library/Frameworks/vecLib.framework/Headers'], 'extra_link_args': ['-Wl,-framework', '-Wl,Accelerate'], 'define_macros': [('NO_ATLAS_INFO', 3), ('HAVE_CBLAS', None)]} lapack_mkl_info={} openblas_lapack_info={} openblas_clapack_info={} atlas_3_10_threads_info={} atlas_3_10_info={} atlas_threads_info={} atlas_info={} lapack_opt_info={'extra_compile_args': ['-msse3'], 'extra_link_args': ['-Wl,-framework', '-Wl,Accelerate'], 'define_macros': [('NO_ATLAS_INFO', 3), ('HAVE_CBLAS', None)]} def get_info(name): g = globals() return g.get(name, g.get(name + "_info", {})) def show(): for name,info_dict in globals().items(): if name[0] == "_" or type(info_dict) is not type({}): continue print(name + ":") if not info_dict: print(" NOT AVAILABLE") for k,v in info_dict.items(): v = str(v) if k == "sources" and len(v) > 200: v = v[:60] + " ...\n... " + v[-60:] print(" %s = %s" % (k,v))
1,597
34.511111
225
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/matlib.py
from __future__ import division, absolute_import, print_function import numpy as np from numpy.matrixlib.defmatrix import matrix, asmatrix # need * as we're copying the numpy namespace from numpy import * __version__ = np.__version__ __all__ = np.__all__[:] # copy numpy namespace __all__ += ['rand', 'randn', 'repmat'] def empty(shape, dtype=None, order='C'): """Return a new matrix of given shape and type, without initializing entries. Parameters ---------- shape : int or tuple of int Shape of the empty matrix. dtype : data-type, optional Desired output data-type. order : {'C', 'F'}, optional Whether to store multi-dimensional data in row-major (C-style) or column-major (Fortran-style) order in memory. See Also -------- empty_like, zeros Notes ----- `empty`, unlike `zeros`, does not set the matrix values to zero, and may therefore be marginally faster. On the other hand, it requires the user to manually set all the values in the array, and should be used with caution. Examples -------- >>> import numpy.matlib >>> np.matlib.empty((2, 2)) # filled with random data matrix([[ 6.76425276e-320, 9.79033856e-307], [ 7.39337286e-309, 3.22135945e-309]]) #random >>> np.matlib.empty((2, 2), dtype=int) matrix([[ 6600475, 0], [ 6586976, 22740995]]) #random """ return ndarray.__new__(matrix, shape, dtype, order=order) def ones(shape, dtype=None, order='C'): """ Matrix of ones. Return a matrix of given shape and type, filled with ones. Parameters ---------- shape : {sequence of ints, int} Shape of the matrix dtype : data-type, optional The desired data-type for the matrix, default is np.float64. order : {'C', 'F'}, optional Whether to store matrix in C- or Fortran-contiguous order, default is 'C'. Returns ------- out : matrix Matrix of ones of given shape, dtype, and order. See Also -------- ones : Array of ones. matlib.zeros : Zero matrix. Notes ----- If `shape` has length one i.e. ``(N,)``, or is a scalar ``N``, `out` becomes a single row matrix of shape ``(1,N)``. Examples -------- >>> np.matlib.ones((2,3)) matrix([[ 1., 1., 1.], [ 1., 1., 1.]]) >>> np.matlib.ones(2) matrix([[ 1., 1.]]) """ a = ndarray.__new__(matrix, shape, dtype, order=order) a.fill(1) return a def zeros(shape, dtype=None, order='C'): """ Return a matrix of given shape and type, filled with zeros. Parameters ---------- shape : int or sequence of ints Shape of the matrix dtype : data-type, optional The desired data-type for the matrix, default is float. order : {'C', 'F'}, optional Whether to store the result in C- or Fortran-contiguous order, default is 'C'. Returns ------- out : matrix Zero matrix of given shape, dtype, and order. See Also -------- numpy.zeros : Equivalent array function. matlib.ones : Return a matrix of ones. Notes ----- If `shape` has length one i.e. ``(N,)``, or is a scalar ``N``, `out` becomes a single row matrix of shape ``(1,N)``. Examples -------- >>> import numpy.matlib >>> np.matlib.zeros((2, 3)) matrix([[ 0., 0., 0.], [ 0., 0., 0.]]) >>> np.matlib.zeros(2) matrix([[ 0., 0.]]) """ a = ndarray.__new__(matrix, shape, dtype, order=order) a.fill(0) return a def identity(n,dtype=None): """ Returns the square identity matrix of given size. Parameters ---------- n : int Size of the returned identity matrix. dtype : data-type, optional Data-type of the output. Defaults to ``float``. Returns ------- out : matrix `n` x `n` matrix with its main diagonal set to one, and all other elements zero. See Also -------- numpy.identity : Equivalent array function. matlib.eye : More general matrix identity function. Examples -------- >>> import numpy.matlib >>> np.matlib.identity(3, dtype=int) matrix([[1, 0, 0], [0, 1, 0], [0, 0, 1]]) """ a = array([1]+n*[0], dtype=dtype) b = empty((n, n), dtype=dtype) b.flat = a return b def eye(n,M=None, k=0, dtype=float, order='C'): """ Return a matrix with ones on the diagonal and zeros elsewhere. Parameters ---------- n : int Number of rows in the output. M : int, optional Number of columns in the output, defaults to `n`. k : int, optional Index of the diagonal: 0 refers to the main diagonal, a positive value refers to an upper diagonal, and a negative value to a lower diagonal. dtype : dtype, optional Data-type of the returned matrix. order : {'C', 'F'}, optional Whether the output should be stored in row-major (C-style) or column-major (Fortran-style) order in memory. .. versionadded:: 1.14.0 Returns ------- I : matrix A `n` x `M` matrix where all elements are equal to zero, except for the `k`-th diagonal, whose values are equal to one. See Also -------- numpy.eye : Equivalent array function. identity : Square identity matrix. Examples -------- >>> import numpy.matlib >>> np.matlib.eye(3, k=1, dtype=float) matrix([[ 0., 1., 0.], [ 0., 0., 1.], [ 0., 0., 0.]]) """ return asmatrix(np.eye(n, M=M, k=k, dtype=dtype, order=order)) def rand(*args): """ Return a matrix of random values with given shape. Create a matrix of the given shape and propagate it with random samples from a uniform distribution over ``[0, 1)``. Parameters ---------- \\*args : Arguments Shape of the output. If given as N integers, each integer specifies the size of one dimension. If given as a tuple, this tuple gives the complete shape. Returns ------- out : ndarray The matrix of random values with shape given by `\\*args`. See Also -------- randn, numpy.random.rand Examples -------- >>> import numpy.matlib >>> np.matlib.rand(2, 3) matrix([[ 0.68340382, 0.67926887, 0.83271405], [ 0.00793551, 0.20468222, 0.95253525]]) #random >>> np.matlib.rand((2, 3)) matrix([[ 0.84682055, 0.73626594, 0.11308016], [ 0.85429008, 0.3294825 , 0.89139555]]) #random If the first argument is a tuple, other arguments are ignored: >>> np.matlib.rand((2, 3), 4) matrix([[ 0.46898646, 0.15163588, 0.95188261], [ 0.59208621, 0.09561818, 0.00583606]]) #random """ if isinstance(args[0], tuple): args = args[0] return asmatrix(np.random.rand(*args)) def randn(*args): """ Return a random matrix with data from the "standard normal" distribution. `randn` generates a matrix filled with random floats sampled from a univariate "normal" (Gaussian) distribution of mean 0 and variance 1. Parameters ---------- \\*args : Arguments Shape of the output. If given as N integers, each integer specifies the size of one dimension. If given as a tuple, this tuple gives the complete shape. Returns ------- Z : matrix of floats A matrix of floating-point samples drawn from the standard normal distribution. See Also -------- rand, random.randn Notes ----- For random samples from :math:`N(\\mu, \\sigma^2)`, use: ``sigma * np.matlib.randn(...) + mu`` Examples -------- >>> import numpy.matlib >>> np.matlib.randn(1) matrix([[-0.09542833]]) #random >>> np.matlib.randn(1, 2, 3) matrix([[ 0.16198284, 0.0194571 , 0.18312985], [-0.7509172 , 1.61055 , 0.45298599]]) #random Two-by-four matrix of samples from :math:`N(3, 6.25)`: >>> 2.5 * np.matlib.randn((2, 4)) + 3 matrix([[ 4.74085004, 8.89381862, 4.09042411, 4.83721922], [ 7.52373709, 5.07933944, -2.64043543, 0.45610557]]) #random """ if isinstance(args[0], tuple): args = args[0] return asmatrix(np.random.randn(*args)) def repmat(a, m, n): """ Repeat a 0-D to 2-D array or matrix MxN times. Parameters ---------- a : array_like The array or matrix to be repeated. m, n : int The number of times `a` is repeated along the first and second axes. Returns ------- out : ndarray The result of repeating `a`. Examples -------- >>> import numpy.matlib >>> a0 = np.array(1) >>> np.matlib.repmat(a0, 2, 3) array([[1, 1, 1], [1, 1, 1]]) >>> a1 = np.arange(4) >>> np.matlib.repmat(a1, 2, 2) array([[0, 1, 2, 3, 0, 1, 2, 3], [0, 1, 2, 3, 0, 1, 2, 3]]) >>> a2 = np.asmatrix(np.arange(6).reshape(2, 3)) >>> np.matlib.repmat(a2, 2, 3) matrix([[0, 1, 2, 0, 1, 2, 0, 1, 2], [3, 4, 5, 3, 4, 5, 3, 4, 5], [0, 1, 2, 0, 1, 2, 0, 1, 2], [3, 4, 5, 3, 4, 5, 3, 4, 5]]) """ a = asanyarray(a) ndim = a.ndim if ndim == 0: origrows, origcols = (1, 1) elif ndim == 1: origrows, origcols = (1, a.shape[0]) else: origrows, origcols = a.shape rows = origrows * m cols = origcols * n c = a.reshape(1, a.size).repeat(m, 0).reshape(rows, origcols).repeat(n, 0) return c.reshape(rows, cols)
9,809
25.950549
81
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/random/setup.py
from __future__ import division, print_function from os.path import join, split, dirname import os import sys from distutils.dep_util import newer from distutils.msvccompiler import get_build_version as get_msvc_build_version def needs_mingw_ftime_workaround(): # We need the mingw workaround for _ftime if the msvc runtime version is # 7.1 or above and we build with mingw ... # ... but we can't easily detect compiler version outside distutils command # context, so we will need to detect in randomkit whether we build with gcc msver = get_msvc_build_version() if msver and msver >= 8: return True return False def configuration(parent_package='',top_path=None): from numpy.distutils.misc_util import Configuration, get_mathlibs config = Configuration('random', parent_package, top_path) def generate_libraries(ext, build_dir): config_cmd = config.get_config_cmd() libs = get_mathlibs() if sys.platform == 'win32': libs.append('Advapi32') ext.libraries.extend(libs) return None # enable unix large file support on 32 bit systems # (64 bit off_t, lseek -> lseek64 etc.) if sys.platform[:3] == "aix": defs = [('_LARGE_FILES', None)] else: defs = [('_FILE_OFFSET_BITS', '64'), ('_LARGEFILE_SOURCE', '1'), ('_LARGEFILE64_SOURCE', '1')] if needs_mingw_ftime_workaround(): defs.append(("NPY_NEEDS_MINGW_TIME_WORKAROUND", None)) libs = [] # Configure mtrand config.add_extension('mtrand', sources=[join('mtrand', x) for x in ['mtrand.c', 'randomkit.c', 'initarray.c', 'distributions.c']]+[generate_libraries], libraries=libs, depends=[join('mtrand', '*.h'), join('mtrand', '*.pyx'), join('mtrand', '*.pxi'),], define_macros=defs, ) config.add_data_files(('.', join('mtrand', 'randomkit.h'))) config.add_data_dir('tests') return config if __name__ == '__main__': from numpy.distutils.core import setup setup(configuration=configuration)
2,312
34.584615
79
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/random/info.py
""" ======================== Random Number Generation ======================== ==================== ========================================================= Utility functions ============================================================================== random_sample Uniformly distributed floats over ``[0, 1)``. random Alias for `random_sample`. bytes Uniformly distributed random bytes. random_integers Uniformly distributed integers in a given range. permutation Randomly permute a sequence / generate a random sequence. shuffle Randomly permute a sequence in place. seed Seed the random number generator. choice Random sample from 1-D array. ==================== ========================================================= ==================== ========================================================= Compatibility functions ============================================================================== rand Uniformly distributed values. randn Normally distributed values. ranf Uniformly distributed floating point numbers. randint Uniformly distributed integers in a given range. ==================== ========================================================= ==================== ========================================================= Univariate distributions ============================================================================== beta Beta distribution over ``[0, 1]``. binomial Binomial distribution. chisquare :math:`\\chi^2` distribution. exponential Exponential distribution. f F (Fisher-Snedecor) distribution. gamma Gamma distribution. geometric Geometric distribution. gumbel Gumbel distribution. hypergeometric Hypergeometric distribution. laplace Laplace distribution. logistic Logistic distribution. lognormal Log-normal distribution. logseries Logarithmic series distribution. negative_binomial Negative binomial distribution. noncentral_chisquare Non-central chi-square distribution. noncentral_f Non-central F distribution. normal Normal / Gaussian distribution. pareto Pareto distribution. poisson Poisson distribution. power Power distribution. rayleigh Rayleigh distribution. triangular Triangular distribution. uniform Uniform distribution. vonmises Von Mises circular distribution. wald Wald (inverse Gaussian) distribution. weibull Weibull distribution. zipf Zipf's distribution over ranked data. ==================== ========================================================= ==================== ========================================================= Multivariate distributions ============================================================================== dirichlet Multivariate generalization of Beta distribution. multinomial Multivariate generalization of the binomial distribution. multivariate_normal Multivariate generalization of the normal distribution. ==================== ========================================================= ==================== ========================================================= Standard distributions ============================================================================== standard_cauchy Standard Cauchy-Lorentz distribution. standard_exponential Standard exponential distribution. standard_gamma Standard Gamma distribution. standard_normal Standard normal distribution. standard_t Standard Student's t-distribution. ==================== ========================================================= ==================== ========================================================= Internal functions ============================================================================== get_state Get tuple representing internal state of generator. set_state Set state of generator. ==================== ========================================================= """ from __future__ import division, absolute_import, print_function depends = ['core'] __all__ = [ 'beta', 'binomial', 'bytes', 'chisquare', 'choice', 'dirichlet', 'exponential', 'f', 'gamma', 'geometric', 'get_state', 'gumbel', 'hypergeometric', 'laplace', 'logistic', 'lognormal', 'logseries', 'multinomial', 'multivariate_normal', 'negative_binomial', 'noncentral_chisquare', 'noncentral_f', 'normal', 'pareto', 'permutation', 'poisson', 'power', 'rand', 'randint', 'randn', 'random_integers', 'random_sample', 'rayleigh', 'seed', 'set_state', 'shuffle', 'standard_cauchy', 'standard_exponential', 'standard_gamma', 'standard_normal', 'standard_t', 'triangular', 'uniform', 'vonmises', 'wald', 'weibull', 'zipf' ]
5,199
36.142857
78
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/random/randomkit.h
/* Random kit 1.3 */ /* * Copyright (c) 2003-2005, Jean-Sebastien Roy (js@jeannot.org) * * Permission is hereby granted, free of charge, to any person obtaining a * copy of this software and associated documentation files (the * "Software"), to deal in the Software without restriction, including * without limitation the rights to use, copy, modify, merge, publish, * distribute, sublicense, and/or sell copies of the Software, and to * permit persons to whom the Software is furnished to do so, subject to * the following conditions: * * The above copyright notice and this permission notice shall be included * in all copies or substantial portions of the Software. * * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS * OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF * MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. * IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY * CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, * TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE * SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /* @(#) $Jeannot: randomkit.h,v 1.24 2005/07/21 22:14:09 js Exp $ */ /* * Typical use: * * { * rk_state state; * unsigned long seed = 1, random_value; * * rk_seed(seed, &state); // Initialize the RNG * ... * random_value = rk_random(&state); // Generate random values in [0..RK_MAX] * } * * Instead of rk_seed, you can use rk_randomseed which will get a random seed * from /dev/urandom (or the clock, if /dev/urandom is unavailable): * * { * rk_state state; * unsigned long random_value; * * rk_randomseed(&state); // Initialize the RNG with a random seed * ... * random_value = rk_random(&state); // Generate random values in [0..RK_MAX] * } */ /* * Useful macro: * RK_DEV_RANDOM: the device used for random seeding. * defaults to "/dev/urandom" */ #ifndef _RANDOMKIT_ #define _RANDOMKIT_ #include <stddef.h> #include <numpy/npy_common.h> #define RK_STATE_LEN 624 typedef struct rk_state_ { unsigned long key[RK_STATE_LEN]; int pos; int has_gauss; /* !=0: gauss contains a gaussian deviate */ double gauss; /* The rk_state structure has been extended to store the following * information for the binomial generator. If the input values of n or p * are different than nsave and psave, then the other parameters will be * recomputed. RTK 2005-09-02 */ int has_binomial; /* !=0: following parameters initialized for binomial */ double psave; long nsave; double r; double q; double fm; long m; double p1; double xm; double xl; double xr; double c; double laml; double lamr; double p2; double p3; double p4; } rk_state; typedef enum { RK_NOERR = 0, /* no error */ RK_ENODEV = 1, /* no RK_DEV_RANDOM device */ RK_ERR_MAX = 2 } rk_error; /* error strings */ extern char *rk_strerror[RK_ERR_MAX]; /* Maximum generated random value */ #define RK_MAX 0xFFFFFFFFUL #ifdef __cplusplus extern "C" { #endif /* * Initialize the RNG state using the given seed. */ extern void rk_seed(unsigned long seed, rk_state *state); /* * Initialize the RNG state using a random seed. * Uses /dev/random or, when unavailable, the clock (see randomkit.c). * Returns RK_NOERR when no errors occurs. * Returns RK_ENODEV when the use of RK_DEV_RANDOM failed (for example because * there is no such device). In this case, the RNG was initialized using the * clock. */ extern rk_error rk_randomseed(rk_state *state); /* * Returns a random unsigned long between 0 and RK_MAX inclusive */ extern unsigned long rk_random(rk_state *state); /* * Returns a random long between 0 and LONG_MAX inclusive */ extern long rk_long(rk_state *state); /* * Returns a random unsigned long between 0 and ULONG_MAX inclusive */ extern unsigned long rk_ulong(rk_state *state); /* * Returns a random unsigned long between 0 and max inclusive. */ extern unsigned long rk_interval(unsigned long max, rk_state *state); /* * Fills an array with cnt random npy_uint64 between off and off + rng * inclusive. The numbers wrap if rng is sufficiently large. */ extern void rk_random_uint64(npy_uint64 off, npy_uint64 rng, npy_intp cnt, npy_uint64 *out, rk_state *state); /* * Fills an array with cnt random npy_uint32 between off and off + rng * inclusive. The numbers wrap if rng is sufficiently large. */ extern void rk_random_uint32(npy_uint32 off, npy_uint32 rng, npy_intp cnt, npy_uint32 *out, rk_state *state); /* * Fills an array with cnt random npy_uint16 between off and off + rng * inclusive. The numbers wrap if rng is sufficiently large. */ extern void rk_random_uint16(npy_uint16 off, npy_uint16 rng, npy_intp cnt, npy_uint16 *out, rk_state *state); /* * Fills an array with cnt random npy_uint8 between off and off + rng * inclusive. The numbers wrap if rng is sufficiently large. */ extern void rk_random_uint8(npy_uint8 off, npy_uint8 rng, npy_intp cnt, npy_uint8 *out, rk_state *state); /* * Fills an array with cnt random npy_bool between off and off + rng * inclusive. It is assumed tha npy_bool as the same size as npy_uint8. */ extern void rk_random_bool(npy_bool off, npy_bool rng, npy_intp cnt, npy_bool *out, rk_state *state); /* * Returns a random double between 0.0 and 1.0, 1.0 excluded. */ extern double rk_double(rk_state *state); /* * fill the buffer with size random bytes */ extern void rk_fill(void *buffer, size_t size, rk_state *state); /* * fill the buffer with randombytes from the random device * Returns RK_ENODEV if the device is unavailable, or RK_NOERR if it is * On Unix, if strong is defined, RK_DEV_RANDOM is used. If not, RK_DEV_URANDOM * is used instead. This parameter has no effect on Windows. * Warning: on most unixes RK_DEV_RANDOM will wait for enough entropy to answer * which can take a very long time on quiet systems. */ extern rk_error rk_devfill(void *buffer, size_t size, int strong); /* * fill the buffer using rk_devfill if the random device is available and using * rk_fill if is is not * parameters have the same meaning as rk_fill and rk_devfill * Returns RK_ENODEV if the device is unavailable, or RK_NOERR if it is */ extern rk_error rk_altfill(void *buffer, size_t size, int strong, rk_state *state); /* * return a random gaussian deviate with variance unity and zero mean. */ extern double rk_gauss(rk_state *state); #ifdef __cplusplus } #endif #endif /* _RANDOMKIT_ */
6,799
28.955947
79
h
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/random/__init__.py
""" ======================== Random Number Generation ======================== ==================== ========================================================= Utility functions ============================================================================== random Uniformly distributed values of a given shape. bytes Uniformly distributed random bytes. random_integers Uniformly distributed integers in a given range. random_sample Uniformly distributed floats in a given range. random Alias for random_sample ranf Alias for random_sample sample Alias for random_sample choice Generate a weighted random sample from a given array-like permutation Randomly permute a sequence / generate a random sequence. shuffle Randomly permute a sequence in place. seed Seed the random number generator. ==================== ========================================================= ==================== ========================================================= Compatibility functions ============================================================================== rand Uniformly distributed values. randn Normally distributed values. ranf Uniformly distributed floating point numbers. randint Uniformly distributed integers in a given range. ==================== ========================================================= ==================== ========================================================= Univariate distributions ============================================================================== beta Beta distribution over ``[0, 1]``. binomial Binomial distribution. chisquare :math:`\\chi^2` distribution. exponential Exponential distribution. f F (Fisher-Snedecor) distribution. gamma Gamma distribution. geometric Geometric distribution. gumbel Gumbel distribution. hypergeometric Hypergeometric distribution. laplace Laplace distribution. logistic Logistic distribution. lognormal Log-normal distribution. logseries Logarithmic series distribution. negative_binomial Negative binomial distribution. noncentral_chisquare Non-central chi-square distribution. noncentral_f Non-central F distribution. normal Normal / Gaussian distribution. pareto Pareto distribution. poisson Poisson distribution. power Power distribution. rayleigh Rayleigh distribution. triangular Triangular distribution. uniform Uniform distribution. vonmises Von Mises circular distribution. wald Wald (inverse Gaussian) distribution. weibull Weibull distribution. zipf Zipf's distribution over ranked data. ==================== ========================================================= ==================== ========================================================= Multivariate distributions ============================================================================== dirichlet Multivariate generalization of Beta distribution. multinomial Multivariate generalization of the binomial distribution. multivariate_normal Multivariate generalization of the normal distribution. ==================== ========================================================= ==================== ========================================================= Standard distributions ============================================================================== standard_cauchy Standard Cauchy-Lorentz distribution. standard_exponential Standard exponential distribution. standard_gamma Standard Gamma distribution. standard_normal Standard normal distribution. standard_t Standard Student's t-distribution. ==================== ========================================================= ==================== ========================================================= Internal functions ============================================================================== get_state Get tuple representing internal state of generator. set_state Set state of generator. ==================== ========================================================= """ from __future__ import division, absolute_import, print_function import warnings # To get sub-modules from .info import __doc__, __all__ with warnings.catch_warnings(): warnings.filterwarnings("ignore", message="numpy.ndarray size changed") from .mtrand import * # Some aliases: ranf = random = sample = random_sample __all__.extend(['ranf', 'random', 'sample']) def __RandomState_ctor(): """Return a RandomState instance. This function exists solely to assist (un)pickling. Note that the state of the RandomState returned here is irrelevant, as this function's entire purpose is to return a newly allocated RandomState whose state pickle can set. Consequently the RandomState returned by this function is a freshly allocated copy with a seed=0. See https://github.com/numpy/numpy/issues/4763 for a detailed discussion """ return RandomState(seed=0) from numpy.testing import _numpy_tester test = _numpy_tester().test bench = _numpy_tester().bench
5,481
43.569106
90
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/random/tests/test_regression.py
from __future__ import division, absolute_import, print_function import sys from numpy.testing import ( run_module_suite, assert_, assert_array_equal, assert_raises, ) from numpy import random from numpy.compat import long import numpy as np class TestRegression(object): def test_VonMises_range(self): # Make sure generated random variables are in [-pi, pi]. # Regression test for ticket #986. for mu in np.linspace(-7., 7., 5): r = random.mtrand.vonmises(mu, 1, 50) assert_(np.all(r > -np.pi) and np.all(r <= np.pi)) def test_hypergeometric_range(self): # Test for ticket #921 assert_(np.all(np.random.hypergeometric(3, 18, 11, size=10) < 4)) assert_(np.all(np.random.hypergeometric(18, 3, 11, size=10) > 0)) # Test for ticket #5623 args = [ (2**20 - 2, 2**20 - 2, 2**20 - 2), # Check for 32-bit systems ] is_64bits = sys.maxsize > 2**32 if is_64bits and sys.platform != 'win32': args.append((2**40 - 2, 2**40 - 2, 2**40 - 2)) # Check for 64-bit systems for arg in args: assert_(np.random.hypergeometric(*arg) > 0) def test_logseries_convergence(self): # Test for ticket #923 N = 1000 np.random.seed(0) rvsn = np.random.logseries(0.8, size=N) # these two frequency counts should be close to theoretical # numbers with this large sample # theoretical large N result is 0.49706795 freq = np.sum(rvsn == 1) / float(N) msg = "Frequency was %f, should be > 0.45" % freq assert_(freq > 0.45, msg) # theoretical large N result is 0.19882718 freq = np.sum(rvsn == 2) / float(N) msg = "Frequency was %f, should be < 0.23" % freq assert_(freq < 0.23, msg) def test_permutation_longs(self): np.random.seed(1234) a = np.random.permutation(12) np.random.seed(1234) b = np.random.permutation(long(12)) assert_array_equal(a, b) def test_shuffle_mixed_dimension(self): # Test for trac ticket #2074 for t in [[1, 2, 3, None], [(1, 1), (2, 2), (3, 3), None], [1, (2, 2), (3, 3), None], [(1, 1), 2, 3, None]]: np.random.seed(12345) shuffled = list(t) random.shuffle(shuffled) assert_array_equal(shuffled, [t[0], t[3], t[1], t[2]]) def test_call_within_randomstate(self): # Check that custom RandomState does not call into global state m = np.random.RandomState() res = np.array([0, 8, 7, 2, 1, 9, 4, 7, 0, 3]) for i in range(3): np.random.seed(i) m.seed(4321) # If m.state is not honored, the result will change assert_array_equal(m.choice(10, size=10, p=np.ones(10)/10.), res) def test_multivariate_normal_size_types(self): # Test for multivariate_normal issue with 'size' argument. # Check that the multivariate_normal size argument can be a # numpy integer. np.random.multivariate_normal([0], [[0]], size=1) np.random.multivariate_normal([0], [[0]], size=np.int_(1)) np.random.multivariate_normal([0], [[0]], size=np.int64(1)) def test_beta_small_parameters(self): # Test that beta with small a and b parameters does not produce # NaNs due to roundoff errors causing 0 / 0, gh-5851 np.random.seed(1234567890) x = np.random.beta(0.0001, 0.0001, size=100) assert_(not np.any(np.isnan(x)), 'Nans in np.random.beta') def test_choice_sum_of_probs_tolerance(self): # The sum of probs should be 1.0 with some tolerance. # For low precision dtypes the tolerance was too tight. # See numpy github issue 6123. np.random.seed(1234) a = [1, 2, 3] counts = [4, 4, 2] for dt in np.float16, np.float32, np.float64: probs = np.array(counts, dtype=dt) / sum(counts) c = np.random.choice(a, p=probs) assert_(c in a) assert_raises(ValueError, np.random.choice, a, p=probs*0.9) def test_shuffle_of_array_of_different_length_strings(self): # Test that permuting an array of different length strings # will not cause a segfault on garbage collection # Tests gh-7710 np.random.seed(1234) a = np.array(['a', 'a' * 1000]) for _ in range(100): np.random.shuffle(a) # Force Garbage Collection - should not segfault. import gc gc.collect() def test_shuffle_of_array_of_objects(self): # Test that permuting an array of objects will not cause # a segfault on garbage collection. # See gh-7719 np.random.seed(1234) a = np.array([np.arange(1), np.arange(4)]) for _ in range(1000): np.random.shuffle(a) # Force Garbage Collection - should not segfault. import gc gc.collect() if __name__ == "__main__": run_module_suite()
5,119
35.834532
85
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/random/tests/test_random.py
from __future__ import division, absolute_import, print_function import warnings import numpy as np from numpy.testing import ( run_module_suite, assert_, assert_raises, assert_equal, assert_warns, assert_no_warnings, assert_array_equal, assert_array_almost_equal, suppress_warnings ) from numpy import random import sys import warnings class TestSeed(object): def test_scalar(self): s = np.random.RandomState(0) assert_equal(s.randint(1000), 684) s = np.random.RandomState(4294967295) assert_equal(s.randint(1000), 419) def test_array(self): s = np.random.RandomState(range(10)) assert_equal(s.randint(1000), 468) s = np.random.RandomState(np.arange(10)) assert_equal(s.randint(1000), 468) s = np.random.RandomState([0]) assert_equal(s.randint(1000), 973) s = np.random.RandomState([4294967295]) assert_equal(s.randint(1000), 265) def test_invalid_scalar(self): # seed must be an unsigned 32 bit integer assert_raises(TypeError, np.random.RandomState, -0.5) assert_raises(ValueError, np.random.RandomState, -1) def test_invalid_array(self): # seed must be an unsigned 32 bit integer assert_raises(TypeError, np.random.RandomState, [-0.5]) assert_raises(ValueError, np.random.RandomState, [-1]) assert_raises(ValueError, np.random.RandomState, [4294967296]) assert_raises(ValueError, np.random.RandomState, [1, 2, 4294967296]) assert_raises(ValueError, np.random.RandomState, [1, -2, 4294967296]) def test_invalid_array_shape(self): # gh-9832 assert_raises(ValueError, np.random.RandomState, np.array([], dtype=np.int64)) assert_raises(ValueError, np.random.RandomState, [[1, 2, 3]]) assert_raises(ValueError, np.random.RandomState, [[1, 2, 3], [4, 5, 6]]) class TestBinomial(object): def test_n_zero(self): # Tests the corner case of n == 0 for the binomial distribution. # binomial(0, p) should be zero for any p in [0, 1]. # This test addresses issue #3480. zeros = np.zeros(2, dtype='int') for p in [0, .5, 1]: assert_(random.binomial(0, p) == 0) assert_array_equal(random.binomial(zeros, p), zeros) def test_p_is_nan(self): # Issue #4571. assert_raises(ValueError, random.binomial, 1, np.nan) class TestMultinomial(object): def test_basic(self): random.multinomial(100, [0.2, 0.8]) def test_zero_probability(self): random.multinomial(100, [0.2, 0.8, 0.0, 0.0, 0.0]) def test_int_negative_interval(self): assert_(-5 <= random.randint(-5, -1) < -1) x = random.randint(-5, -1, 5) assert_(np.all(-5 <= x)) assert_(np.all(x < -1)) def test_size(self): # gh-3173 p = [0.5, 0.5] assert_equal(np.random.multinomial(1, p, np.uint32(1)).shape, (1, 2)) assert_equal(np.random.multinomial(1, p, np.uint32(1)).shape, (1, 2)) assert_equal(np.random.multinomial(1, p, np.uint32(1)).shape, (1, 2)) assert_equal(np.random.multinomial(1, p, [2, 2]).shape, (2, 2, 2)) assert_equal(np.random.multinomial(1, p, (2, 2)).shape, (2, 2, 2)) assert_equal(np.random.multinomial(1, p, np.array((2, 2))).shape, (2, 2, 2)) assert_raises(TypeError, np.random.multinomial, 1, p, float(1)) class TestSetState(object): def setup(self): self.seed = 1234567890 self.prng = random.RandomState(self.seed) self.state = self.prng.get_state() def test_basic(self): old = self.prng.tomaxint(16) self.prng.set_state(self.state) new = self.prng.tomaxint(16) assert_(np.all(old == new)) def test_gaussian_reset(self): # Make sure the cached every-other-Gaussian is reset. old = self.prng.standard_normal(size=3) self.prng.set_state(self.state) new = self.prng.standard_normal(size=3) assert_(np.all(old == new)) def test_gaussian_reset_in_media_res(self): # When the state is saved with a cached Gaussian, make sure the # cached Gaussian is restored. self.prng.standard_normal() state = self.prng.get_state() old = self.prng.standard_normal(size=3) self.prng.set_state(state) new = self.prng.standard_normal(size=3) assert_(np.all(old == new)) def test_backwards_compatibility(self): # Make sure we can accept old state tuples that do not have the # cached Gaussian value. old_state = self.state[:-2] x1 = self.prng.standard_normal(size=16) self.prng.set_state(old_state) x2 = self.prng.standard_normal(size=16) self.prng.set_state(self.state) x3 = self.prng.standard_normal(size=16) assert_(np.all(x1 == x2)) assert_(np.all(x1 == x3)) def test_negative_binomial(self): # Ensure that the negative binomial results take floating point # arguments without truncation. self.prng.negative_binomial(0.5, 0.5) class TestRandint(object): rfunc = np.random.randint # valid integer/boolean types itype = [np.bool_, np.int8, np.uint8, np.int16, np.uint16, np.int32, np.uint32, np.int64, np.uint64] def test_unsupported_type(self): assert_raises(TypeError, self.rfunc, 1, dtype=float) def test_bounds_checking(self): for dt in self.itype: lbnd = 0 if dt is np.bool_ else np.iinfo(dt).min ubnd = 2 if dt is np.bool_ else np.iinfo(dt).max + 1 assert_raises(ValueError, self.rfunc, lbnd - 1, ubnd, dtype=dt) assert_raises(ValueError, self.rfunc, lbnd, ubnd + 1, dtype=dt) assert_raises(ValueError, self.rfunc, ubnd, lbnd, dtype=dt) assert_raises(ValueError, self.rfunc, 1, 0, dtype=dt) def test_rng_zero_and_extremes(self): for dt in self.itype: lbnd = 0 if dt is np.bool_ else np.iinfo(dt).min ubnd = 2 if dt is np.bool_ else np.iinfo(dt).max + 1 tgt = ubnd - 1 assert_equal(self.rfunc(tgt, tgt + 1, size=1000, dtype=dt), tgt) tgt = lbnd assert_equal(self.rfunc(tgt, tgt + 1, size=1000, dtype=dt), tgt) tgt = (lbnd + ubnd)//2 assert_equal(self.rfunc(tgt, tgt + 1, size=1000, dtype=dt), tgt) def test_full_range(self): # Test for ticket #1690 for dt in self.itype: lbnd = 0 if dt is np.bool_ else np.iinfo(dt).min ubnd = 2 if dt is np.bool_ else np.iinfo(dt).max + 1 try: self.rfunc(lbnd, ubnd, dtype=dt) except Exception as e: raise AssertionError("No error should have been raised, " "but one was with the following " "message:\n\n%s" % str(e)) def test_in_bounds_fuzz(self): # Don't use fixed seed np.random.seed() for dt in self.itype[1:]: for ubnd in [4, 8, 16]: vals = self.rfunc(2, ubnd, size=2**16, dtype=dt) assert_(vals.max() < ubnd) assert_(vals.min() >= 2) vals = self.rfunc(0, 2, size=2**16, dtype=np.bool_) assert_(vals.max() < 2) assert_(vals.min() >= 0) def test_repeatability(self): import hashlib # We use a md5 hash of generated sequences of 1000 samples # in the range [0, 6) for all but bool, where the range # is [0, 2). Hashes are for little endian numbers. tgt = {'bool': '7dd3170d7aa461d201a65f8bcf3944b0', 'int16': '1b7741b80964bb190c50d541dca1cac1', 'int32': '4dc9fcc2b395577ebb51793e58ed1a05', 'int64': '17db902806f448331b5a758d7d2ee672', 'int8': '27dd30c4e08a797063dffac2490b0be6', 'uint16': '1b7741b80964bb190c50d541dca1cac1', 'uint32': '4dc9fcc2b395577ebb51793e58ed1a05', 'uint64': '17db902806f448331b5a758d7d2ee672', 'uint8': '27dd30c4e08a797063dffac2490b0be6'} for dt in self.itype[1:]: np.random.seed(1234) # view as little endian for hash if sys.byteorder == 'little': val = self.rfunc(0, 6, size=1000, dtype=dt) else: val = self.rfunc(0, 6, size=1000, dtype=dt).byteswap() res = hashlib.md5(val.view(np.int8)).hexdigest() assert_(tgt[np.dtype(dt).name] == res) # bools do not depend on endianess np.random.seed(1234) val = self.rfunc(0, 2, size=1000, dtype=bool).view(np.int8) res = hashlib.md5(val).hexdigest() assert_(tgt[np.dtype(bool).name] == res) def test_int64_uint64_corner_case(self): # When stored in Numpy arrays, `lbnd` is casted # as np.int64, and `ubnd` is casted as np.uint64. # Checking whether `lbnd` >= `ubnd` used to be # done solely via direct comparison, which is incorrect # because when Numpy tries to compare both numbers, # it casts both to np.float64 because there is # no integer superset of np.int64 and np.uint64. However, # `ubnd` is too large to be represented in np.float64, # causing it be round down to np.iinfo(np.int64).max, # leading to a ValueError because `lbnd` now equals # the new `ubnd`. dt = np.int64 tgt = np.iinfo(np.int64).max lbnd = np.int64(np.iinfo(np.int64).max) ubnd = np.uint64(np.iinfo(np.int64).max + 1) # None of these function calls should # generate a ValueError now. actual = np.random.randint(lbnd, ubnd, dtype=dt) assert_equal(actual, tgt) def test_respect_dtype_singleton(self): # See gh-7203 for dt in self.itype: lbnd = 0 if dt is np.bool_ else np.iinfo(dt).min ubnd = 2 if dt is np.bool_ else np.iinfo(dt).max + 1 sample = self.rfunc(lbnd, ubnd, dtype=dt) assert_equal(sample.dtype, np.dtype(dt)) for dt in (bool, int, np.long): lbnd = 0 if dt is bool else np.iinfo(dt).min ubnd = 2 if dt is bool else np.iinfo(dt).max + 1 # gh-7284: Ensure that we get Python data types sample = self.rfunc(lbnd, ubnd, dtype=dt) assert_(not hasattr(sample, 'dtype')) assert_equal(type(sample), dt) class TestRandomDist(object): # Make sure the random distribution returns the correct value for a # given seed def setup(self): self.seed = 1234567890 def test_rand(self): np.random.seed(self.seed) actual = np.random.rand(3, 2) desired = np.array([[0.61879477158567997, 0.59162362775974664], [0.88868358904449662, 0.89165480011560816], [0.4575674820298663, 0.7781880808593471]]) assert_array_almost_equal(actual, desired, decimal=15) def test_randn(self): np.random.seed(self.seed) actual = np.random.randn(3, 2) desired = np.array([[1.34016345771863121, 1.73759122771936081], [1.498988344300628, -0.2286433324536169], [2.031033998682787, 2.17032494605655257]]) assert_array_almost_equal(actual, desired, decimal=15) def test_randint(self): np.random.seed(self.seed) actual = np.random.randint(-99, 99, size=(3, 2)) desired = np.array([[31, 3], [-52, 41], [-48, -66]]) assert_array_equal(actual, desired) def test_random_integers(self): np.random.seed(self.seed) with suppress_warnings() as sup: w = sup.record(DeprecationWarning) actual = np.random.random_integers(-99, 99, size=(3, 2)) assert_(len(w) == 1) desired = np.array([[31, 3], [-52, 41], [-48, -66]]) assert_array_equal(actual, desired) def test_random_integers_max_int(self): # Tests whether random_integers can generate the # maximum allowed Python int that can be converted # into a C long. Previous implementations of this # method have thrown an OverflowError when attempting # to generate this integer. with suppress_warnings() as sup: w = sup.record(DeprecationWarning) actual = np.random.random_integers(np.iinfo('l').max, np.iinfo('l').max) assert_(len(w) == 1) desired = np.iinfo('l').max assert_equal(actual, desired) def test_random_integers_deprecated(self): with warnings.catch_warnings(): warnings.simplefilter("error", DeprecationWarning) # DeprecationWarning raised with high == None assert_raises(DeprecationWarning, np.random.random_integers, np.iinfo('l').max) # DeprecationWarning raised with high != None assert_raises(DeprecationWarning, np.random.random_integers, np.iinfo('l').max, np.iinfo('l').max) def test_random_sample(self): np.random.seed(self.seed) actual = np.random.random_sample((3, 2)) desired = np.array([[0.61879477158567997, 0.59162362775974664], [0.88868358904449662, 0.89165480011560816], [0.4575674820298663, 0.7781880808593471]]) assert_array_almost_equal(actual, desired, decimal=15) def test_choice_uniform_replace(self): np.random.seed(self.seed) actual = np.random.choice(4, 4) desired = np.array([2, 3, 2, 3]) assert_array_equal(actual, desired) def test_choice_nonuniform_replace(self): np.random.seed(self.seed) actual = np.random.choice(4, 4, p=[0.4, 0.4, 0.1, 0.1]) desired = np.array([1, 1, 2, 2]) assert_array_equal(actual, desired) def test_choice_uniform_noreplace(self): np.random.seed(self.seed) actual = np.random.choice(4, 3, replace=False) desired = np.array([0, 1, 3]) assert_array_equal(actual, desired) def test_choice_nonuniform_noreplace(self): np.random.seed(self.seed) actual = np.random.choice(4, 3, replace=False, p=[0.1, 0.3, 0.5, 0.1]) desired = np.array([2, 3, 1]) assert_array_equal(actual, desired) def test_choice_noninteger(self): np.random.seed(self.seed) actual = np.random.choice(['a', 'b', 'c', 'd'], 4) desired = np.array(['c', 'd', 'c', 'd']) assert_array_equal(actual, desired) def test_choice_exceptions(self): sample = np.random.choice assert_raises(ValueError, sample, -1, 3) assert_raises(ValueError, sample, 3., 3) assert_raises(ValueError, sample, [[1, 2], [3, 4]], 3) assert_raises(ValueError, sample, [], 3) assert_raises(ValueError, sample, [1, 2, 3, 4], 3, p=[[0.25, 0.25], [0.25, 0.25]]) assert_raises(ValueError, sample, [1, 2], 3, p=[0.4, 0.4, 0.2]) assert_raises(ValueError, sample, [1, 2], 3, p=[1.1, -0.1]) assert_raises(ValueError, sample, [1, 2], 3, p=[0.4, 0.4]) assert_raises(ValueError, sample, [1, 2, 3], 4, replace=False) assert_raises(ValueError, sample, [1, 2, 3], 2, replace=False, p=[1, 0, 0]) def test_choice_return_shape(self): p = [0.1, 0.9] # Check scalar assert_(np.isscalar(np.random.choice(2, replace=True))) assert_(np.isscalar(np.random.choice(2, replace=False))) assert_(np.isscalar(np.random.choice(2, replace=True, p=p))) assert_(np.isscalar(np.random.choice(2, replace=False, p=p))) assert_(np.isscalar(np.random.choice([1, 2], replace=True))) assert_(np.random.choice([None], replace=True) is None) a = np.array([1, 2]) arr = np.empty(1, dtype=object) arr[0] = a assert_(np.random.choice(arr, replace=True) is a) # Check 0-d array s = tuple() assert_(not np.isscalar(np.random.choice(2, s, replace=True))) assert_(not np.isscalar(np.random.choice(2, s, replace=False))) assert_(not np.isscalar(np.random.choice(2, s, replace=True, p=p))) assert_(not np.isscalar(np.random.choice(2, s, replace=False, p=p))) assert_(not np.isscalar(np.random.choice([1, 2], s, replace=True))) assert_(np.random.choice([None], s, replace=True).ndim == 0) a = np.array([1, 2]) arr = np.empty(1, dtype=object) arr[0] = a assert_(np.random.choice(arr, s, replace=True).item() is a) # Check multi dimensional array s = (2, 3) p = [0.1, 0.1, 0.1, 0.1, 0.4, 0.2] assert_equal(np.random.choice(6, s, replace=True).shape, s) assert_equal(np.random.choice(6, s, replace=False).shape, s) assert_equal(np.random.choice(6, s, replace=True, p=p).shape, s) assert_equal(np.random.choice(6, s, replace=False, p=p).shape, s) assert_equal(np.random.choice(np.arange(6), s, replace=True).shape, s) def test_bytes(self): np.random.seed(self.seed) actual = np.random.bytes(10) desired = b'\x82Ui\x9e\xff\x97+Wf\xa5' assert_equal(actual, desired) def test_shuffle(self): # Test lists, arrays (of various dtypes), and multidimensional versions # of both, c-contiguous or not: for conv in [lambda x: np.array([]), lambda x: x, lambda x: np.asarray(x).astype(np.int8), lambda x: np.asarray(x).astype(np.float32), lambda x: np.asarray(x).astype(np.complex64), lambda x: np.asarray(x).astype(object), lambda x: [(i, i) for i in x], lambda x: np.asarray([[i, i] for i in x]), lambda x: np.vstack([x, x]).T, # gh-4270 lambda x: np.asarray([(i, i) for i in x], [("a", object, 1), ("b", np.int32, 1)])]: np.random.seed(self.seed) alist = conv([1, 2, 3, 4, 5, 6, 7, 8, 9, 0]) np.random.shuffle(alist) actual = alist desired = conv([0, 1, 9, 6, 2, 4, 5, 8, 7, 3]) assert_array_equal(actual, desired) def test_shuffle_masked(self): # gh-3263 a = np.ma.masked_values(np.reshape(range(20), (5, 4)) % 3 - 1, -1) b = np.ma.masked_values(np.arange(20) % 3 - 1, -1) a_orig = a.copy() b_orig = b.copy() for i in range(50): np.random.shuffle(a) assert_equal( sorted(a.data[~a.mask]), sorted(a_orig.data[~a_orig.mask])) np.random.shuffle(b) assert_equal( sorted(b.data[~b.mask]), sorted(b_orig.data[~b_orig.mask])) def test_beta(self): np.random.seed(self.seed) actual = np.random.beta(.1, .9, size=(3, 2)) desired = np.array( [[1.45341850513746058e-02, 5.31297615662868145e-04], [1.85366619058432324e-06, 4.19214516800110563e-03], [1.58405155108498093e-04, 1.26252891949397652e-04]]) assert_array_almost_equal(actual, desired, decimal=15) def test_binomial(self): np.random.seed(self.seed) actual = np.random.binomial(100.123, .456, size=(3, 2)) desired = np.array([[37, 43], [42, 48], [46, 45]]) assert_array_equal(actual, desired) def test_chisquare(self): np.random.seed(self.seed) actual = np.random.chisquare(50, size=(3, 2)) desired = np.array([[63.87858175501090585, 68.68407748911370447], [65.77116116901505904, 47.09686762438974483], [72.3828403199695174, 74.18408615260374006]]) assert_array_almost_equal(actual, desired, decimal=13) def test_dirichlet(self): np.random.seed(self.seed) alpha = np.array([51.72840233779265162, 39.74494232180943953]) actual = np.random.mtrand.dirichlet(alpha, size=(3, 2)) desired = np.array([[[0.54539444573611562, 0.45460555426388438], [0.62345816822039413, 0.37654183177960598]], [[0.55206000085785778, 0.44793999914214233], [0.58964023305154301, 0.41035976694845688]], [[0.59266909280647828, 0.40733090719352177], [0.56974431743975207, 0.43025568256024799]]]) assert_array_almost_equal(actual, desired, decimal=15) def test_dirichlet_size(self): # gh-3173 p = np.array([51.72840233779265162, 39.74494232180943953]) assert_equal(np.random.dirichlet(p, np.uint32(1)).shape, (1, 2)) assert_equal(np.random.dirichlet(p, np.uint32(1)).shape, (1, 2)) assert_equal(np.random.dirichlet(p, np.uint32(1)).shape, (1, 2)) assert_equal(np.random.dirichlet(p, [2, 2]).shape, (2, 2, 2)) assert_equal(np.random.dirichlet(p, (2, 2)).shape, (2, 2, 2)) assert_equal(np.random.dirichlet(p, np.array((2, 2))).shape, (2, 2, 2)) assert_raises(TypeError, np.random.dirichlet, p, float(1)) def test_dirichlet_bad_alpha(self): # gh-2089 alpha = np.array([5.4e-01, -1.0e-16]) assert_raises(ValueError, np.random.mtrand.dirichlet, alpha) def test_exponential(self): np.random.seed(self.seed) actual = np.random.exponential(1.1234, size=(3, 2)) desired = np.array([[1.08342649775011624, 1.00607889924557314], [2.46628830085216721, 2.49668106809923884], [0.68717433461363442, 1.69175666993575979]]) assert_array_almost_equal(actual, desired, decimal=15) def test_exponential_0(self): assert_equal(np.random.exponential(scale=0), 0) assert_raises(ValueError, np.random.exponential, scale=-0.) def test_f(self): np.random.seed(self.seed) actual = np.random.f(12, 77, size=(3, 2)) desired = np.array([[1.21975394418575878, 1.75135759791559775], [1.44803115017146489, 1.22108959480396262], [1.02176975757740629, 1.34431827623300415]]) assert_array_almost_equal(actual, desired, decimal=15) def test_gamma(self): np.random.seed(self.seed) actual = np.random.gamma(5, 3, size=(3, 2)) desired = np.array([[24.60509188649287182, 28.54993563207210627], [26.13476110204064184, 12.56988482927716078], [31.71863275789960568, 33.30143302795922011]]) assert_array_almost_equal(actual, desired, decimal=14) def test_gamma_0(self): assert_equal(np.random.gamma(shape=0, scale=0), 0) assert_raises(ValueError, np.random.gamma, shape=-0., scale=-0.) def test_geometric(self): np.random.seed(self.seed) actual = np.random.geometric(.123456789, size=(3, 2)) desired = np.array([[8, 7], [17, 17], [5, 12]]) assert_array_equal(actual, desired) def test_gumbel(self): np.random.seed(self.seed) actual = np.random.gumbel(loc=.123456789, scale=2.0, size=(3, 2)) desired = np.array([[0.19591898743416816, 0.34405539668096674], [-1.4492522252274278, -1.47374816298446865], [1.10651090478803416, -0.69535848626236174]]) assert_array_almost_equal(actual, desired, decimal=15) def test_gumbel_0(self): assert_equal(np.random.gumbel(scale=0), 0) assert_raises(ValueError, np.random.gumbel, scale=-0.) def test_hypergeometric(self): np.random.seed(self.seed) actual = np.random.hypergeometric(10.1, 5.5, 14, size=(3, 2)) desired = np.array([[10, 10], [10, 10], [9, 9]]) assert_array_equal(actual, desired) # Test nbad = 0 actual = np.random.hypergeometric(5, 0, 3, size=4) desired = np.array([3, 3, 3, 3]) assert_array_equal(actual, desired) actual = np.random.hypergeometric(15, 0, 12, size=4) desired = np.array([12, 12, 12, 12]) assert_array_equal(actual, desired) # Test ngood = 0 actual = np.random.hypergeometric(0, 5, 3, size=4) desired = np.array([0, 0, 0, 0]) assert_array_equal(actual, desired) actual = np.random.hypergeometric(0, 15, 12, size=4) desired = np.array([0, 0, 0, 0]) assert_array_equal(actual, desired) def test_laplace(self): np.random.seed(self.seed) actual = np.random.laplace(loc=.123456789, scale=2.0, size=(3, 2)) desired = np.array([[0.66599721112760157, 0.52829452552221945], [3.12791959514407125, 3.18202813572992005], [-0.05391065675859356, 1.74901336242837324]]) assert_array_almost_equal(actual, desired, decimal=15) def test_laplace_0(self): assert_equal(np.random.laplace(scale=0), 0) assert_raises(ValueError, np.random.laplace, scale=-0.) def test_logistic(self): np.random.seed(self.seed) actual = np.random.logistic(loc=.123456789, scale=2.0, size=(3, 2)) desired = np.array([[1.09232835305011444, 0.8648196662399954], [4.27818590694950185, 4.33897006346929714], [-0.21682183359214885, 2.63373365386060332]]) assert_array_almost_equal(actual, desired, decimal=15) def test_lognormal(self): np.random.seed(self.seed) actual = np.random.lognormal(mean=.123456789, sigma=2.0, size=(3, 2)) desired = np.array([[16.50698631688883822, 36.54846706092654784], [22.67886599981281748, 0.71617561058995771], [65.72798501792723869, 86.84341601437161273]]) assert_array_almost_equal(actual, desired, decimal=13) def test_lognormal_0(self): assert_equal(np.random.lognormal(sigma=0), 1) assert_raises(ValueError, np.random.lognormal, sigma=-0.) def test_logseries(self): np.random.seed(self.seed) actual = np.random.logseries(p=.923456789, size=(3, 2)) desired = np.array([[2, 2], [6, 17], [3, 6]]) assert_array_equal(actual, desired) def test_multinomial(self): np.random.seed(self.seed) actual = np.random.multinomial(20, [1/6.]*6, size=(3, 2)) desired = np.array([[[4, 3, 5, 4, 2, 2], [5, 2, 8, 2, 2, 1]], [[3, 4, 3, 6, 0, 4], [2, 1, 4, 3, 6, 4]], [[4, 4, 2, 5, 2, 3], [4, 3, 4, 2, 3, 4]]]) assert_array_equal(actual, desired) def test_multivariate_normal(self): np.random.seed(self.seed) mean = (.123456789, 10) cov = [[1, 0], [0, 1]] size = (3, 2) actual = np.random.multivariate_normal(mean, cov, size) desired = np.array([[[1.463620246718631, 11.73759122771936 ], [1.622445133300628, 9.771356667546383]], [[2.154490787682787, 12.170324946056553], [1.719909438201865, 9.230548443648306]], [[0.689515026297799, 9.880729819607714], [-0.023054015651998, 9.201096623542879]]]) assert_array_almost_equal(actual, desired, decimal=15) # Check for default size, was raising deprecation warning actual = np.random.multivariate_normal(mean, cov) desired = np.array([0.895289569463708, 9.17180864067987]) assert_array_almost_equal(actual, desired, decimal=15) # Check that non positive-semidefinite covariance warns with # RuntimeWarning mean = [0, 0] cov = [[1, 2], [2, 1]] assert_warns(RuntimeWarning, np.random.multivariate_normal, mean, cov) # and that it doesn't warn with RuntimeWarning check_valid='ignore' assert_no_warnings(np.random.multivariate_normal, mean, cov, check_valid='ignore') # and that it raises with RuntimeWarning check_valid='raises' assert_raises(ValueError, np.random.multivariate_normal, mean, cov, check_valid='raise') def test_negative_binomial(self): np.random.seed(self.seed) actual = np.random.negative_binomial(n=100, p=.12345, size=(3, 2)) desired = np.array([[848, 841], [892, 611], [779, 647]]) assert_array_equal(actual, desired) def test_noncentral_chisquare(self): np.random.seed(self.seed) actual = np.random.noncentral_chisquare(df=5, nonc=5, size=(3, 2)) desired = np.array([[23.91905354498517511, 13.35324692733826346], [31.22452661329736401, 16.60047399466177254], [5.03461598262724586, 17.94973089023519464]]) assert_array_almost_equal(actual, desired, decimal=14) actual = np.random.noncentral_chisquare(df=.5, nonc=.2, size=(3, 2)) desired = np.array([[1.47145377828516666, 0.15052899268012659], [0.00943803056963588, 1.02647251615666169], [0.332334982684171, 0.15451287602753125]]) assert_array_almost_equal(actual, desired, decimal=14) np.random.seed(self.seed) actual = np.random.noncentral_chisquare(df=5, nonc=0, size=(3, 2)) desired = np.array([[9.597154162763948, 11.725484450296079], [10.413711048138335, 3.694475922923986], [13.484222138963087, 14.377255424602957]]) assert_array_almost_equal(actual, desired, decimal=14) def test_noncentral_f(self): np.random.seed(self.seed) actual = np.random.noncentral_f(dfnum=5, dfden=2, nonc=1, size=(3, 2)) desired = np.array([[1.40598099674926669, 0.34207973179285761], [3.57715069265772545, 7.92632662577829805], [0.43741599463544162, 1.1774208752428319]]) assert_array_almost_equal(actual, desired, decimal=14) def test_normal(self): np.random.seed(self.seed) actual = np.random.normal(loc=.123456789, scale=2.0, size=(3, 2)) desired = np.array([[2.80378370443726244, 3.59863924443872163], [3.121433477601256, -0.33382987590723379], [4.18552478636557357, 4.46410668111310471]]) assert_array_almost_equal(actual, desired, decimal=15) def test_normal_0(self): assert_equal(np.random.normal(scale=0), 0) assert_raises(ValueError, np.random.normal, scale=-0.) def test_pareto(self): np.random.seed(self.seed) actual = np.random.pareto(a=.123456789, size=(3, 2)) desired = np.array( [[2.46852460439034849e+03, 1.41286880810518346e+03], [5.28287797029485181e+07, 6.57720981047328785e+07], [1.40840323350391515e+02, 1.98390255135251704e+05]]) # For some reason on 32-bit x86 Ubuntu 12.10 the [1, 0] entry in this # matrix differs by 24 nulps. Discussion: # http://mail.python.org/pipermail/numpy-discussion/2012-September/063801.html # Consensus is that this is probably some gcc quirk that affects # rounding but not in any important way, so we just use a looser # tolerance on this test: np.testing.assert_array_almost_equal_nulp(actual, desired, nulp=30) def test_poisson(self): np.random.seed(self.seed) actual = np.random.poisson(lam=.123456789, size=(3, 2)) desired = np.array([[0, 0], [1, 0], [0, 0]]) assert_array_equal(actual, desired) def test_poisson_exceptions(self): lambig = np.iinfo('l').max lamneg = -1 assert_raises(ValueError, np.random.poisson, lamneg) assert_raises(ValueError, np.random.poisson, [lamneg]*10) assert_raises(ValueError, np.random.poisson, lambig) assert_raises(ValueError, np.random.poisson, [lambig]*10) def test_power(self): np.random.seed(self.seed) actual = np.random.power(a=.123456789, size=(3, 2)) desired = np.array([[0.02048932883240791, 0.01424192241128213], [0.38446073748535298, 0.39499689943484395], [0.00177699707563439, 0.13115505880863756]]) assert_array_almost_equal(actual, desired, decimal=15) def test_rayleigh(self): np.random.seed(self.seed) actual = np.random.rayleigh(scale=10, size=(3, 2)) desired = np.array([[13.8882496494248393, 13.383318339044731], [20.95413364294492098, 21.08285015800712614], [11.06066537006854311, 17.35468505778271009]]) assert_array_almost_equal(actual, desired, decimal=14) def test_rayleigh_0(self): assert_equal(np.random.rayleigh(scale=0), 0) assert_raises(ValueError, np.random.rayleigh, scale=-0.) def test_standard_cauchy(self): np.random.seed(self.seed) actual = np.random.standard_cauchy(size=(3, 2)) desired = np.array([[0.77127660196445336, -6.55601161955910605], [0.93582023391158309, -2.07479293013759447], [-4.74601644297011926, 0.18338989290760804]]) assert_array_almost_equal(actual, desired, decimal=15) def test_standard_exponential(self): np.random.seed(self.seed) actual = np.random.standard_exponential(size=(3, 2)) desired = np.array([[0.96441739162374596, 0.89556604882105506], [2.1953785836319808, 2.22243285392490542], [0.6116915921431676, 1.50592546727413201]]) assert_array_almost_equal(actual, desired, decimal=15) def test_standard_gamma(self): np.random.seed(self.seed) actual = np.random.standard_gamma(shape=3, size=(3, 2)) desired = np.array([[5.50841531318455058, 6.62953470301903103], [5.93988484943779227, 2.31044849402133989], [7.54838614231317084, 8.012756093271868]]) assert_array_almost_equal(actual, desired, decimal=14) def test_standard_gamma_0(self): assert_equal(np.random.standard_gamma(shape=0), 0) assert_raises(ValueError, np.random.standard_gamma, shape=-0.) def test_standard_normal(self): np.random.seed(self.seed) actual = np.random.standard_normal(size=(3, 2)) desired = np.array([[1.34016345771863121, 1.73759122771936081], [1.498988344300628, -0.2286433324536169], [2.031033998682787, 2.17032494605655257]]) assert_array_almost_equal(actual, desired, decimal=15) def test_standard_t(self): np.random.seed(self.seed) actual = np.random.standard_t(df=10, size=(3, 2)) desired = np.array([[0.97140611862659965, -0.08830486548450577], [1.36311143689505321, -0.55317463909867071], [-0.18473749069684214, 0.61181537341755321]]) assert_array_almost_equal(actual, desired, decimal=15) def test_triangular(self): np.random.seed(self.seed) actual = np.random.triangular(left=5.12, mode=10.23, right=20.34, size=(3, 2)) desired = np.array([[12.68117178949215784, 12.4129206149193152], [16.20131377335158263, 16.25692138747600524], [11.20400690911820263, 14.4978144835829923]]) assert_array_almost_equal(actual, desired, decimal=14) def test_uniform(self): np.random.seed(self.seed) actual = np.random.uniform(low=1.23, high=10.54, size=(3, 2)) desired = np.array([[6.99097932346268003, 6.73801597444323974], [9.50364421400426274, 9.53130618907631089], [5.48995325769805476, 8.47493103280052118]]) assert_array_almost_equal(actual, desired, decimal=15) def test_uniform_range_bounds(self): fmin = np.finfo('float').min fmax = np.finfo('float').max func = np.random.uniform assert_raises(OverflowError, func, -np.inf, 0) assert_raises(OverflowError, func, 0, np.inf) assert_raises(OverflowError, func, fmin, fmax) assert_raises(OverflowError, func, [-np.inf], [0]) assert_raises(OverflowError, func, [0], [np.inf]) # (fmax / 1e17) - fmin is within range, so this should not throw # account for i386 extended precision DBL_MAX / 1e17 + DBL_MAX > # DBL_MAX by increasing fmin a bit np.random.uniform(low=np.nextafter(fmin, 1), high=fmax / 1e17) def test_scalar_exception_propagation(self): # Tests that exceptions are correctly propagated in distributions # when called with objects that throw exceptions when converted to # scalars. # # Regression test for gh: 8865 class ThrowingFloat(np.ndarray): def __float__(self): raise TypeError throwing_float = np.array(1.0).view(ThrowingFloat) assert_raises(TypeError, np.random.uniform, throwing_float, throwing_float) class ThrowingInteger(np.ndarray): def __int__(self): raise TypeError throwing_int = np.array(1).view(ThrowingInteger) assert_raises(TypeError, np.random.hypergeometric, throwing_int, 1, 1) def test_vonmises(self): np.random.seed(self.seed) actual = np.random.vonmises(mu=1.23, kappa=1.54, size=(3, 2)) desired = np.array([[2.28567572673902042, 2.89163838442285037], [0.38198375564286025, 2.57638023113890746], [1.19153771588353052, 1.83509849681825354]]) assert_array_almost_equal(actual, desired, decimal=15) def test_vonmises_small(self): # check infinite loop, gh-4720 np.random.seed(self.seed) r = np.random.vonmises(mu=0., kappa=1.1e-8, size=10**6) np.testing.assert_(np.isfinite(r).all()) def test_wald(self): np.random.seed(self.seed) actual = np.random.wald(mean=1.23, scale=1.54, size=(3, 2)) desired = np.array([[3.82935265715889983, 5.13125249184285526], [0.35045403618358717, 1.50832396872003538], [0.24124319895843183, 0.22031101461955038]]) assert_array_almost_equal(actual, desired, decimal=14) def test_weibull(self): np.random.seed(self.seed) actual = np.random.weibull(a=1.23, size=(3, 2)) desired = np.array([[0.97097342648766727, 0.91422896443565516], [1.89517770034962929, 1.91414357960479564], [0.67057783752390987, 1.39494046635066793]]) assert_array_almost_equal(actual, desired, decimal=15) def test_weibull_0(self): assert_equal(np.random.weibull(a=0), 0) assert_raises(ValueError, np.random.weibull, a=-0.) def test_zipf(self): np.random.seed(self.seed) actual = np.random.zipf(a=1.23, size=(3, 2)) desired = np.array([[66, 29], [1, 1], [3, 13]]) assert_array_equal(actual, desired) class TestBroadcast(object): # tests that functions that broadcast behave # correctly when presented with non-scalar arguments def setup(self): self.seed = 123456789 def setSeed(self): np.random.seed(self.seed) # TODO: Include test for randint once it can broadcast # Can steal the test written in PR #6938 def test_uniform(self): low = [0] high = [1] uniform = np.random.uniform desired = np.array([0.53283302478975902, 0.53413660089041659, 0.50955303552646702]) self.setSeed() actual = uniform(low * 3, high) assert_array_almost_equal(actual, desired, decimal=14) self.setSeed() actual = uniform(low, high * 3) assert_array_almost_equal(actual, desired, decimal=14) def test_normal(self): loc = [0] scale = [1] bad_scale = [-1] normal = np.random.normal desired = np.array([2.2129019979039612, 2.1283977976520019, 1.8417114045748335]) self.setSeed() actual = normal(loc * 3, scale) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, normal, loc * 3, bad_scale) self.setSeed() actual = normal(loc, scale * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, normal, loc, bad_scale * 3) def test_beta(self): a = [1] b = [2] bad_a = [-1] bad_b = [-2] beta = np.random.beta desired = np.array([0.19843558305989056, 0.075230336409423643, 0.24976865978980844]) self.setSeed() actual = beta(a * 3, b) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, beta, bad_a * 3, b) assert_raises(ValueError, beta, a * 3, bad_b) self.setSeed() actual = beta(a, b * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, beta, bad_a, b * 3) assert_raises(ValueError, beta, a, bad_b * 3) def test_exponential(self): scale = [1] bad_scale = [-1] exponential = np.random.exponential desired = np.array([0.76106853658845242, 0.76386282278691653, 0.71243813125891797]) self.setSeed() actual = exponential(scale * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, exponential, bad_scale * 3) def test_standard_gamma(self): shape = [1] bad_shape = [-1] std_gamma = np.random.standard_gamma desired = np.array([0.76106853658845242, 0.76386282278691653, 0.71243813125891797]) self.setSeed() actual = std_gamma(shape * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, std_gamma, bad_shape * 3) def test_gamma(self): shape = [1] scale = [2] bad_shape = [-1] bad_scale = [-2] gamma = np.random.gamma desired = np.array([1.5221370731769048, 1.5277256455738331, 1.4248762625178359]) self.setSeed() actual = gamma(shape * 3, scale) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, gamma, bad_shape * 3, scale) assert_raises(ValueError, gamma, shape * 3, bad_scale) self.setSeed() actual = gamma(shape, scale * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, gamma, bad_shape, scale * 3) assert_raises(ValueError, gamma, shape, bad_scale * 3) def test_f(self): dfnum = [1] dfden = [2] bad_dfnum = [-1] bad_dfden = [-2] f = np.random.f desired = np.array([0.80038951638264799, 0.86768719635363512, 2.7251095168386801]) self.setSeed() actual = f(dfnum * 3, dfden) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, f, bad_dfnum * 3, dfden) assert_raises(ValueError, f, dfnum * 3, bad_dfden) self.setSeed() actual = f(dfnum, dfden * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, f, bad_dfnum, dfden * 3) assert_raises(ValueError, f, dfnum, bad_dfden * 3) def test_noncentral_f(self): dfnum = [2] dfden = [3] nonc = [4] bad_dfnum = [0] bad_dfden = [-1] bad_nonc = [-2] nonc_f = np.random.noncentral_f desired = np.array([9.1393943263705211, 13.025456344595602, 8.8018098359100545]) self.setSeed() actual = nonc_f(dfnum * 3, dfden, nonc) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, nonc_f, bad_dfnum * 3, dfden, nonc) assert_raises(ValueError, nonc_f, dfnum * 3, bad_dfden, nonc) assert_raises(ValueError, nonc_f, dfnum * 3, dfden, bad_nonc) self.setSeed() actual = nonc_f(dfnum, dfden * 3, nonc) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, nonc_f, bad_dfnum, dfden * 3, nonc) assert_raises(ValueError, nonc_f, dfnum, bad_dfden * 3, nonc) assert_raises(ValueError, nonc_f, dfnum, dfden * 3, bad_nonc) self.setSeed() actual = nonc_f(dfnum, dfden, nonc * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, nonc_f, bad_dfnum, dfden, nonc * 3) assert_raises(ValueError, nonc_f, dfnum, bad_dfden, nonc * 3) assert_raises(ValueError, nonc_f, dfnum, dfden, bad_nonc * 3) def test_noncentral_f_small_df(self): self.setSeed() desired = np.array([6.869638627492048, 0.785880199263955]) actual = np.random.noncentral_f(0.9, 0.9, 2, size=2) assert_array_almost_equal(actual, desired, decimal=14) def test_chisquare(self): df = [1] bad_df = [-1] chisquare = np.random.chisquare desired = np.array([0.57022801133088286, 0.51947702108840776, 0.1320969254923558]) self.setSeed() actual = chisquare(df * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, chisquare, bad_df * 3) def test_noncentral_chisquare(self): df = [1] nonc = [2] bad_df = [-1] bad_nonc = [-2] nonc_chi = np.random.noncentral_chisquare desired = np.array([9.0015599467913763, 4.5804135049718742, 6.0872302432834564]) self.setSeed() actual = nonc_chi(df * 3, nonc) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, nonc_chi, bad_df * 3, nonc) assert_raises(ValueError, nonc_chi, df * 3, bad_nonc) self.setSeed() actual = nonc_chi(df, nonc * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, nonc_chi, bad_df, nonc * 3) assert_raises(ValueError, nonc_chi, df, bad_nonc * 3) def test_standard_t(self): df = [1] bad_df = [-1] t = np.random.standard_t desired = np.array([3.0702872575217643, 5.8560725167361607, 1.0274791436474273]) self.setSeed() actual = t(df * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, t, bad_df * 3) def test_vonmises(self): mu = [2] kappa = [1] bad_kappa = [-1] vonmises = np.random.vonmises desired = np.array([2.9883443664201312, -2.7064099483995943, -1.8672476700665914]) self.setSeed() actual = vonmises(mu * 3, kappa) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, vonmises, mu * 3, bad_kappa) self.setSeed() actual = vonmises(mu, kappa * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, vonmises, mu, bad_kappa * 3) def test_pareto(self): a = [1] bad_a = [-1] pareto = np.random.pareto desired = np.array([1.1405622680198362, 1.1465519762044529, 1.0389564467453547]) self.setSeed() actual = pareto(a * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, pareto, bad_a * 3) def test_weibull(self): a = [1] bad_a = [-1] weibull = np.random.weibull desired = np.array([0.76106853658845242, 0.76386282278691653, 0.71243813125891797]) self.setSeed() actual = weibull(a * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, weibull, bad_a * 3) def test_power(self): a = [1] bad_a = [-1] power = np.random.power desired = np.array([0.53283302478975902, 0.53413660089041659, 0.50955303552646702]) self.setSeed() actual = power(a * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, power, bad_a * 3) def test_laplace(self): loc = [0] scale = [1] bad_scale = [-1] laplace = np.random.laplace desired = np.array([0.067921356028507157, 0.070715642226971326, 0.019290950698972624]) self.setSeed() actual = laplace(loc * 3, scale) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, laplace, loc * 3, bad_scale) self.setSeed() actual = laplace(loc, scale * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, laplace, loc, bad_scale * 3) def test_gumbel(self): loc = [0] scale = [1] bad_scale = [-1] gumbel = np.random.gumbel desired = np.array([0.2730318639556768, 0.26936705726291116, 0.33906220393037939]) self.setSeed() actual = gumbel(loc * 3, scale) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, gumbel, loc * 3, bad_scale) self.setSeed() actual = gumbel(loc, scale * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, gumbel, loc, bad_scale * 3) def test_logistic(self): loc = [0] scale = [1] bad_scale = [-1] logistic = np.random.logistic desired = np.array([0.13152135837586171, 0.13675915696285773, 0.038216792802833396]) self.setSeed() actual = logistic(loc * 3, scale) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, logistic, loc * 3, bad_scale) self.setSeed() actual = logistic(loc, scale * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, logistic, loc, bad_scale * 3) def test_lognormal(self): mean = [0] sigma = [1] bad_sigma = [-1] lognormal = np.random.lognormal desired = np.array([9.1422086044848427, 8.4013952870126261, 6.3073234116578671]) self.setSeed() actual = lognormal(mean * 3, sigma) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, lognormal, mean * 3, bad_sigma) self.setSeed() actual = lognormal(mean, sigma * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, lognormal, mean, bad_sigma * 3) def test_rayleigh(self): scale = [1] bad_scale = [-1] rayleigh = np.random.rayleigh desired = np.array([1.2337491937897689, 1.2360119924878694, 1.1936818095781789]) self.setSeed() actual = rayleigh(scale * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, rayleigh, bad_scale * 3) def test_wald(self): mean = [0.5] scale = [1] bad_mean = [0] bad_scale = [-2] wald = np.random.wald desired = np.array([0.11873681120271318, 0.12450084820795027, 0.9096122728408238]) self.setSeed() actual = wald(mean * 3, scale) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, wald, bad_mean * 3, scale) assert_raises(ValueError, wald, mean * 3, bad_scale) self.setSeed() actual = wald(mean, scale * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, wald, bad_mean, scale * 3) assert_raises(ValueError, wald, mean, bad_scale * 3) def test_triangular(self): left = [1] right = [3] mode = [2] bad_left_one = [3] bad_mode_one = [4] bad_left_two, bad_mode_two = right * 2 triangular = np.random.triangular desired = np.array([2.03339048710429, 2.0347400359389356, 2.0095991069536208]) self.setSeed() actual = triangular(left * 3, mode, right) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, triangular, bad_left_one * 3, mode, right) assert_raises(ValueError, triangular, left * 3, bad_mode_one, right) assert_raises(ValueError, triangular, bad_left_two * 3, bad_mode_two, right) self.setSeed() actual = triangular(left, mode * 3, right) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, triangular, bad_left_one, mode * 3, right) assert_raises(ValueError, triangular, left, bad_mode_one * 3, right) assert_raises(ValueError, triangular, bad_left_two, bad_mode_two * 3, right) self.setSeed() actual = triangular(left, mode, right * 3) assert_array_almost_equal(actual, desired, decimal=14) assert_raises(ValueError, triangular, bad_left_one, mode, right * 3) assert_raises(ValueError, triangular, left, bad_mode_one, right * 3) assert_raises(ValueError, triangular, bad_left_two, bad_mode_two, right * 3) def test_binomial(self): n = [1] p = [0.5] bad_n = [-1] bad_p_one = [-1] bad_p_two = [1.5] binom = np.random.binomial desired = np.array([1, 1, 1]) self.setSeed() actual = binom(n * 3, p) assert_array_equal(actual, desired) assert_raises(ValueError, binom, bad_n * 3, p) assert_raises(ValueError, binom, n * 3, bad_p_one) assert_raises(ValueError, binom, n * 3, bad_p_two) self.setSeed() actual = binom(n, p * 3) assert_array_equal(actual, desired) assert_raises(ValueError, binom, bad_n, p * 3) assert_raises(ValueError, binom, n, bad_p_one * 3) assert_raises(ValueError, binom, n, bad_p_two * 3) def test_negative_binomial(self): n = [1] p = [0.5] bad_n = [-1] bad_p_one = [-1] bad_p_two = [1.5] neg_binom = np.random.negative_binomial desired = np.array([1, 0, 1]) self.setSeed() actual = neg_binom(n * 3, p) assert_array_equal(actual, desired) assert_raises(ValueError, neg_binom, bad_n * 3, p) assert_raises(ValueError, neg_binom, n * 3, bad_p_one) assert_raises(ValueError, neg_binom, n * 3, bad_p_two) self.setSeed() actual = neg_binom(n, p * 3) assert_array_equal(actual, desired) assert_raises(ValueError, neg_binom, bad_n, p * 3) assert_raises(ValueError, neg_binom, n, bad_p_one * 3) assert_raises(ValueError, neg_binom, n, bad_p_two * 3) def test_poisson(self): max_lam = np.random.RandomState().poisson_lam_max lam = [1] bad_lam_one = [-1] bad_lam_two = [max_lam * 2] poisson = np.random.poisson desired = np.array([1, 1, 0]) self.setSeed() actual = poisson(lam * 3) assert_array_equal(actual, desired) assert_raises(ValueError, poisson, bad_lam_one * 3) assert_raises(ValueError, poisson, bad_lam_two * 3) def test_zipf(self): a = [2] bad_a = [0] zipf = np.random.zipf desired = np.array([2, 2, 1]) self.setSeed() actual = zipf(a * 3) assert_array_equal(actual, desired) assert_raises(ValueError, zipf, bad_a * 3) with np.errstate(invalid='ignore'): assert_raises(ValueError, zipf, np.nan) assert_raises(ValueError, zipf, [0, 0, np.nan]) def test_geometric(self): p = [0.5] bad_p_one = [-1] bad_p_two = [1.5] geom = np.random.geometric desired = np.array([2, 2, 2]) self.setSeed() actual = geom(p * 3) assert_array_equal(actual, desired) assert_raises(ValueError, geom, bad_p_one * 3) assert_raises(ValueError, geom, bad_p_two * 3) def test_hypergeometric(self): ngood = [1] nbad = [2] nsample = [2] bad_ngood = [-1] bad_nbad = [-2] bad_nsample_one = [0] bad_nsample_two = [4] hypergeom = np.random.hypergeometric desired = np.array([1, 1, 1]) self.setSeed() actual = hypergeom(ngood * 3, nbad, nsample) assert_array_equal(actual, desired) assert_raises(ValueError, hypergeom, bad_ngood * 3, nbad, nsample) assert_raises(ValueError, hypergeom, ngood * 3, bad_nbad, nsample) assert_raises(ValueError, hypergeom, ngood * 3, nbad, bad_nsample_one) assert_raises(ValueError, hypergeom, ngood * 3, nbad, bad_nsample_two) self.setSeed() actual = hypergeom(ngood, nbad * 3, nsample) assert_array_equal(actual, desired) assert_raises(ValueError, hypergeom, bad_ngood, nbad * 3, nsample) assert_raises(ValueError, hypergeom, ngood, bad_nbad * 3, nsample) assert_raises(ValueError, hypergeom, ngood, nbad * 3, bad_nsample_one) assert_raises(ValueError, hypergeom, ngood, nbad * 3, bad_nsample_two) self.setSeed() actual = hypergeom(ngood, nbad, nsample * 3) assert_array_equal(actual, desired) assert_raises(ValueError, hypergeom, bad_ngood, nbad, nsample * 3) assert_raises(ValueError, hypergeom, ngood, bad_nbad, nsample * 3) assert_raises(ValueError, hypergeom, ngood, nbad, bad_nsample_one * 3) assert_raises(ValueError, hypergeom, ngood, nbad, bad_nsample_two * 3) def test_logseries(self): p = [0.5] bad_p_one = [2] bad_p_two = [-1] logseries = np.random.logseries desired = np.array([1, 1, 1]) self.setSeed() actual = logseries(p * 3) assert_array_equal(actual, desired) assert_raises(ValueError, logseries, bad_p_one * 3) assert_raises(ValueError, logseries, bad_p_two * 3) class TestThread(object): # make sure each state produces the same sequence even in threads def setup(self): self.seeds = range(4) def check_function(self, function, sz): from threading import Thread out1 = np.empty((len(self.seeds),) + sz) out2 = np.empty((len(self.seeds),) + sz) # threaded generation t = [Thread(target=function, args=(np.random.RandomState(s), o)) for s, o in zip(self.seeds, out1)] [x.start() for x in t] [x.join() for x in t] # the same serial for s, o in zip(self.seeds, out2): function(np.random.RandomState(s), o) # these platforms change x87 fpu precision mode in threads if np.intp().dtype.itemsize == 4 and sys.platform == "win32": assert_array_almost_equal(out1, out2) else: assert_array_equal(out1, out2) def test_normal(self): def gen_random(state, out): out[...] = state.normal(size=10000) self.check_function(gen_random, sz=(10000,)) def test_exp(self): def gen_random(state, out): out[...] = state.exponential(scale=np.ones((100, 1000))) self.check_function(gen_random, sz=(100, 1000)) def test_multinomial(self): def gen_random(state, out): out[...] = state.multinomial(10, [1/6.]*6, size=10000) self.check_function(gen_random, sz=(10000, 6)) # See Issue #4263 class TestSingleEltArrayInput(object): def setup(self): self.argOne = np.array([2]) self.argTwo = np.array([3]) self.argThree = np.array([4]) self.tgtShape = (1,) def test_one_arg_funcs(self): funcs = (np.random.exponential, np.random.standard_gamma, np.random.chisquare, np.random.standard_t, np.random.pareto, np.random.weibull, np.random.power, np.random.rayleigh, np.random.poisson, np.random.zipf, np.random.geometric, np.random.logseries) probfuncs = (np.random.geometric, np.random.logseries) for func in funcs: if func in probfuncs: # p < 1.0 out = func(np.array([0.5])) else: out = func(self.argOne) assert_equal(out.shape, self.tgtShape) def test_two_arg_funcs(self): funcs = (np.random.uniform, np.random.normal, np.random.beta, np.random.gamma, np.random.f, np.random.noncentral_chisquare, np.random.vonmises, np.random.laplace, np.random.gumbel, np.random.logistic, np.random.lognormal, np.random.wald, np.random.binomial, np.random.negative_binomial) probfuncs = (np.random.binomial, np.random.negative_binomial) for func in funcs: if func in probfuncs: # p <= 1 argTwo = np.array([0.5]) else: argTwo = self.argTwo out = func(self.argOne, argTwo) assert_equal(out.shape, self.tgtShape) out = func(self.argOne[0], argTwo) assert_equal(out.shape, self.tgtShape) out = func(self.argOne, argTwo[0]) assert_equal(out.shape, self.tgtShape) # TODO: Uncomment once randint can broadcast arguments # def test_randint(self): # itype = [bool, np.int8, np.uint8, np.int16, np.uint16, # np.int32, np.uint32, np.int64, np.uint64] # func = np.random.randint # high = np.array([1]) # low = np.array([0]) # # for dt in itype: # out = func(low, high, dtype=dt) # self.assert_equal(out.shape, self.tgtShape) # # out = func(low[0], high, dtype=dt) # self.assert_equal(out.shape, self.tgtShape) # # out = func(low, high[0], dtype=dt) # self.assert_equal(out.shape, self.tgtShape) def test_three_arg_funcs(self): funcs = [np.random.noncentral_f, np.random.triangular, np.random.hypergeometric] for func in funcs: out = func(self.argOne, self.argTwo, self.argThree) assert_equal(out.shape, self.tgtShape) out = func(self.argOne[0], self.argTwo, self.argThree) assert_equal(out.shape, self.tgtShape) out = func(self.argOne, self.argTwo[0], self.argThree) assert_equal(out.shape, self.tgtShape) if __name__ == "__main__": run_module_suite()
65,295
38.814634
88
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/random/tests/__init__.py
0
0
0
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/einsumfunc.py
""" Implementation of optimized einsum. """ from __future__ import division, absolute_import, print_function from numpy.compat import basestring from numpy.core.multiarray import c_einsum from numpy.core.numeric import asarray, asanyarray, result_type, tensordot, dot __all__ = ['einsum', 'einsum_path'] einsum_symbols = 'abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ' einsum_symbols_set = set(einsum_symbols) def _compute_size_by_dict(indices, idx_dict): """ Computes the product of the elements in indices based on the dictionary idx_dict. Parameters ---------- indices : iterable Indices to base the product on. idx_dict : dictionary Dictionary of index sizes Returns ------- ret : int The resulting product. Examples -------- >>> _compute_size_by_dict('abbc', {'a': 2, 'b':3, 'c':5}) 90 """ ret = 1 for i in indices: ret *= idx_dict[i] return ret def _find_contraction(positions, input_sets, output_set): """ Finds the contraction for a given set of input and output sets. Parameters ---------- positions : iterable Integer positions of terms used in the contraction. input_sets : list List of sets that represent the lhs side of the einsum subscript output_set : set Set that represents the rhs side of the overall einsum subscript Returns ------- new_result : set The indices of the resulting contraction remaining : list List of sets that have not been contracted, the new set is appended to the end of this list idx_removed : set Indices removed from the entire contraction idx_contraction : set The indices used in the current contraction Examples -------- # A simple dot product test case >>> pos = (0, 1) >>> isets = [set('ab'), set('bc')] >>> oset = set('ac') >>> _find_contraction(pos, isets, oset) ({'a', 'c'}, [{'a', 'c'}], {'b'}, {'a', 'b', 'c'}) # A more complex case with additional terms in the contraction >>> pos = (0, 2) >>> isets = [set('abd'), set('ac'), set('bdc')] >>> oset = set('ac') >>> _find_contraction(pos, isets, oset) ({'a', 'c'}, [{'a', 'c'}, {'a', 'c'}], {'b', 'd'}, {'a', 'b', 'c', 'd'}) """ idx_contract = set() idx_remain = output_set.copy() remaining = [] for ind, value in enumerate(input_sets): if ind in positions: idx_contract |= value else: remaining.append(value) idx_remain |= value new_result = idx_remain & idx_contract idx_removed = (idx_contract - new_result) remaining.append(new_result) return (new_result, remaining, idx_removed, idx_contract) def _optimal_path(input_sets, output_set, idx_dict, memory_limit): """ Computes all possible pair contractions, sieves the results based on ``memory_limit`` and returns the lowest cost path. This algorithm scales factorial with respect to the elements in the list ``input_sets``. Parameters ---------- input_sets : list List of sets that represent the lhs side of the einsum subscript output_set : set Set that represents the rhs side of the overall einsum subscript idx_dict : dictionary Dictionary of index sizes memory_limit : int The maximum number of elements in a temporary array Returns ------- path : list The optimal contraction order within the memory limit constraint. Examples -------- >>> isets = [set('abd'), set('ac'), set('bdc')] >>> oset = set('') >>> idx_sizes = {'a': 1, 'b':2, 'c':3, 'd':4} >>> _path__optimal_path(isets, oset, idx_sizes, 5000) [(0, 2), (0, 1)] """ full_results = [(0, [], input_sets)] for iteration in range(len(input_sets) - 1): iter_results = [] # Compute all unique pairs comb_iter = [] for x in range(len(input_sets) - iteration): for y in range(x + 1, len(input_sets) - iteration): comb_iter.append((x, y)) for curr in full_results: cost, positions, remaining = curr for con in comb_iter: # Find the contraction cont = _find_contraction(con, remaining, output_set) new_result, new_input_sets, idx_removed, idx_contract = cont # Sieve the results based on memory_limit new_size = _compute_size_by_dict(new_result, idx_dict) if new_size > memory_limit: continue # Find cost new_cost = _compute_size_by_dict(idx_contract, idx_dict) if idx_removed: new_cost *= 2 # Build (total_cost, positions, indices_remaining) new_cost += cost new_pos = positions + [con] iter_results.append((new_cost, new_pos, new_input_sets)) # Update combinatorial list, if we did not find anything return best # path + remaining contractions if iter_results: full_results = iter_results else: path = min(full_results, key=lambda x: x[0])[1] path += [tuple(range(len(input_sets) - iteration))] return path # If we have not found anything return single einsum contraction if len(full_results) == 0: return [tuple(range(len(input_sets)))] path = min(full_results, key=lambda x: x[0])[1] return path def _greedy_path(input_sets, output_set, idx_dict, memory_limit): """ Finds the path by contracting the best pair until the input list is exhausted. The best pair is found by minimizing the tuple ``(-prod(indices_removed), cost)``. What this amounts to is prioritizing matrix multiplication or inner product operations, then Hadamard like operations, and finally outer operations. Outer products are limited by ``memory_limit``. This algorithm scales cubically with respect to the number of elements in the list ``input_sets``. Parameters ---------- input_sets : list List of sets that represent the lhs side of the einsum subscript output_set : set Set that represents the rhs side of the overall einsum subscript idx_dict : dictionary Dictionary of index sizes memory_limit_limit : int The maximum number of elements in a temporary array Returns ------- path : list The greedy contraction order within the memory limit constraint. Examples -------- >>> isets = [set('abd'), set('ac'), set('bdc')] >>> oset = set('') >>> idx_sizes = {'a': 1, 'b':2, 'c':3, 'd':4} >>> _path__greedy_path(isets, oset, idx_sizes, 5000) [(0, 2), (0, 1)] """ if len(input_sets) == 1: return [(0,)] path = [] for iteration in range(len(input_sets) - 1): iteration_results = [] comb_iter = [] # Compute all unique pairs for x in range(len(input_sets)): for y in range(x + 1, len(input_sets)): comb_iter.append((x, y)) for positions in comb_iter: # Find the contraction contract = _find_contraction(positions, input_sets, output_set) idx_result, new_input_sets, idx_removed, idx_contract = contract # Sieve the results based on memory_limit if _compute_size_by_dict(idx_result, idx_dict) > memory_limit: continue # Build sort tuple removed_size = _compute_size_by_dict(idx_removed, idx_dict) cost = _compute_size_by_dict(idx_contract, idx_dict) sort = (-removed_size, cost) # Add contraction to possible choices iteration_results.append([sort, positions, new_input_sets]) # If we did not find a new contraction contract remaining if len(iteration_results) == 0: path.append(tuple(range(len(input_sets)))) break # Sort based on first index best = min(iteration_results, key=lambda x: x[0]) path.append(best[1]) input_sets = best[2] return path def _can_dot(inputs, result, idx_removed): """ Checks if we can use BLAS (np.tensordot) call and its beneficial to do so. Parameters ---------- inputs : list of str Specifies the subscripts for summation. result : str Resulting summation. idx_removed : set Indices that are removed in the summation Returns ------- type : bool Returns true if BLAS should and can be used, else False Notes ----- If the operations is BLAS level 1 or 2 and is not already aligned we default back to einsum as the memory movement to copy is more costly than the operation itself. Examples -------- # Standard GEMM operation >>> _can_dot(['ij', 'jk'], 'ik', set('j')) True # Can use the standard BLAS, but requires odd data movement >>> _can_dot(['ijj', 'jk'], 'ik', set('j')) False # DDOT where the memory is not aligned >>> _can_dot(['ijk', 'ikj'], '', set('ijk')) False """ # All `dot` calls remove indices if len(idx_removed) == 0: return False # BLAS can only handle two operands if len(inputs) != 2: return False # Build a few temporaries input_left, input_right = inputs set_left = set(input_left) set_right = set(input_right) keep_left = set_left - idx_removed keep_right = set_right - idx_removed rs = len(idx_removed) # Indices must overlap between the two operands if not len(set_left & set_right): return False # We cannot have duplicate indices ("ijj, jk -> ik") if (len(set_left) != len(input_left)) or (len(set_right) != len(input_right)): return False # Cannot handle partial inner ("ij, ji -> i") if len(keep_left & keep_right): return False # At this point we are a DOT, GEMV, or GEMM operation # Handle inner products # DDOT with aligned data if input_left == input_right: return True # DDOT without aligned data (better to use einsum) if set_left == set_right: return False # Handle the 4 possible (aligned) GEMV or GEMM cases # GEMM or GEMV no transpose if input_left[-rs:] == input_right[:rs]: return True # GEMM or GEMV transpose both if input_left[:rs] == input_right[-rs:]: return True # GEMM or GEMV transpose right if input_left[-rs:] == input_right[-rs:]: return True # GEMM or GEMV transpose left if input_left[:rs] == input_right[:rs]: return True # Einsum is faster than GEMV if we have to copy data if not keep_left or not keep_right: return False # We are a matrix-matrix product, but we need to copy data return True def _parse_einsum_input(operands): """ A reproduction of einsum c side einsum parsing in python. Returns ------- input_strings : str Parsed input strings output_string : str Parsed output string operands : list of array_like The operands to use in the numpy contraction Examples -------- The operand list is simplified to reduce printing: >>> a = np.random.rand(4, 4) >>> b = np.random.rand(4, 4, 4) >>> __parse_einsum_input(('...a,...a->...', a, b)) ('za,xza', 'xz', [a, b]) >>> __parse_einsum_input((a, [Ellipsis, 0], b, [Ellipsis, 0])) ('za,xza', 'xz', [a, b]) """ if len(operands) == 0: raise ValueError("No input operands") if isinstance(operands[0], basestring): subscripts = operands[0].replace(" ", "") operands = [asanyarray(v) for v in operands[1:]] # Ensure all characters are valid for s in subscripts: if s in '.,->': continue if s not in einsum_symbols: raise ValueError("Character %s is not a valid symbol." % s) else: tmp_operands = list(operands) operand_list = [] subscript_list = [] for p in range(len(operands) // 2): operand_list.append(tmp_operands.pop(0)) subscript_list.append(tmp_operands.pop(0)) output_list = tmp_operands[-1] if len(tmp_operands) else None operands = [asanyarray(v) for v in operand_list] subscripts = "" last = len(subscript_list) - 1 for num, sub in enumerate(subscript_list): for s in sub: if s is Ellipsis: subscripts += "..." elif isinstance(s, int): subscripts += einsum_symbols[s] else: raise TypeError("For this input type lists must contain " "either int or Ellipsis") if num != last: subscripts += "," if output_list is not None: subscripts += "->" for s in output_list: if s is Ellipsis: subscripts += "..." elif isinstance(s, int): subscripts += einsum_symbols[s] else: raise TypeError("For this input type lists must contain " "either int or Ellipsis") # Check for proper "->" if ("-" in subscripts) or (">" in subscripts): invalid = (subscripts.count("-") > 1) or (subscripts.count(">") > 1) if invalid or (subscripts.count("->") != 1): raise ValueError("Subscripts can only contain one '->'.") # Parse ellipses if "." in subscripts: used = subscripts.replace(".", "").replace(",", "").replace("->", "") unused = list(einsum_symbols_set - set(used)) ellipse_inds = "".join(unused) longest = 0 if "->" in subscripts: input_tmp, output_sub = subscripts.split("->") split_subscripts = input_tmp.split(",") out_sub = True else: split_subscripts = subscripts.split(',') out_sub = False for num, sub in enumerate(split_subscripts): if "." in sub: if (sub.count(".") != 3) or (sub.count("...") != 1): raise ValueError("Invalid Ellipses.") # Take into account numerical values if operands[num].shape == (): ellipse_count = 0 else: ellipse_count = max(operands[num].ndim, 1) ellipse_count -= (len(sub) - 3) if ellipse_count > longest: longest = ellipse_count if ellipse_count < 0: raise ValueError("Ellipses lengths do not match.") elif ellipse_count == 0: split_subscripts[num] = sub.replace('...', '') else: rep_inds = ellipse_inds[-ellipse_count:] split_subscripts[num] = sub.replace('...', rep_inds) subscripts = ",".join(split_subscripts) if longest == 0: out_ellipse = "" else: out_ellipse = ellipse_inds[-longest:] if out_sub: subscripts += "->" + output_sub.replace("...", out_ellipse) else: # Special care for outputless ellipses output_subscript = "" tmp_subscripts = subscripts.replace(",", "") for s in sorted(set(tmp_subscripts)): if s not in (einsum_symbols): raise ValueError("Character %s is not a valid symbol." % s) if tmp_subscripts.count(s) == 1: output_subscript += s normal_inds = ''.join(sorted(set(output_subscript) - set(out_ellipse))) subscripts += "->" + out_ellipse + normal_inds # Build output string if does not exist if "->" in subscripts: input_subscripts, output_subscript = subscripts.split("->") else: input_subscripts = subscripts # Build output subscripts tmp_subscripts = subscripts.replace(",", "") output_subscript = "" for s in sorted(set(tmp_subscripts)): if s not in einsum_symbols: raise ValueError("Character %s is not a valid symbol." % s) if tmp_subscripts.count(s) == 1: output_subscript += s # Make sure output subscripts are in the input for char in output_subscript: if char not in input_subscripts: raise ValueError("Output character %s did not appear in the input" % char) # Make sure number operands is equivalent to the number of terms if len(input_subscripts.split(',')) != len(operands): raise ValueError("Number of einsum subscripts must be equal to the " "number of operands.") return (input_subscripts, output_subscript, operands) def einsum_path(*operands, **kwargs): """ einsum_path(subscripts, *operands, optimize='greedy') Evaluates the lowest cost contraction order for an einsum expression by considering the creation of intermediate arrays. Parameters ---------- subscripts : str Specifies the subscripts for summation. *operands : list of array_like These are the arrays for the operation. optimize : {bool, list, tuple, 'greedy', 'optimal'} Choose the type of path. If a tuple is provided, the second argument is assumed to be the maximum intermediate size created. If only a single argument is provided the largest input or output array size is used as a maximum intermediate size. * if a list is given that starts with ``einsum_path``, uses this as the contraction path * if False no optimization is taken * if True defaults to the 'greedy' algorithm * 'optimal' An algorithm that combinatorially explores all possible ways of contracting the listed tensors and choosest the least costly path. Scales exponentially with the number of terms in the contraction. * 'greedy' An algorithm that chooses the best pair contraction at each step. Effectively, this algorithm searches the largest inner, Hadamard, and then outer products at each step. Scales cubically with the number of terms in the contraction. Equivalent to the 'optimal' path for most contractions. Default is 'greedy'. Returns ------- path : list of tuples A list representation of the einsum path. string_repr : str A printable representation of the einsum path. Notes ----- The resulting path indicates which terms of the input contraction should be contracted first, the result of this contraction is then appended to the end of the contraction list. This list can then be iterated over until all intermediate contractions are complete. See Also -------- einsum, linalg.multi_dot Examples -------- We can begin with a chain dot example. In this case, it is optimal to contract the ``b`` and ``c`` tensors first as reprsented by the first element of the path ``(1, 2)``. The resulting tensor is added to the end of the contraction and the remaining contraction ``(0, 1)`` is then completed. >>> a = np.random.rand(2, 2) >>> b = np.random.rand(2, 5) >>> c = np.random.rand(5, 2) >>> path_info = np.einsum_path('ij,jk,kl->il', a, b, c, optimize='greedy') >>> print(path_info[0]) ['einsum_path', (1, 2), (0, 1)] >>> print(path_info[1]) Complete contraction: ij,jk,kl->il Naive scaling: 4 Optimized scaling: 3 Naive FLOP count: 1.600e+02 Optimized FLOP count: 5.600e+01 Theoretical speedup: 2.857 Largest intermediate: 4.000e+00 elements ------------------------------------------------------------------------- scaling current remaining ------------------------------------------------------------------------- 3 kl,jk->jl ij,jl->il 3 jl,ij->il il->il A more complex index transformation example. >>> I = np.random.rand(10, 10, 10, 10) >>> C = np.random.rand(10, 10) >>> path_info = np.einsum_path('ea,fb,abcd,gc,hd->efgh', C, C, I, C, C, optimize='greedy') >>> print(path_info[0]) ['einsum_path', (0, 2), (0, 3), (0, 2), (0, 1)] >>> print(path_info[1]) Complete contraction: ea,fb,abcd,gc,hd->efgh Naive scaling: 8 Optimized scaling: 5 Naive FLOP count: 8.000e+08 Optimized FLOP count: 8.000e+05 Theoretical speedup: 1000.000 Largest intermediate: 1.000e+04 elements -------------------------------------------------------------------------- scaling current remaining -------------------------------------------------------------------------- 5 abcd,ea->bcde fb,gc,hd,bcde->efgh 5 bcde,fb->cdef gc,hd,cdef->efgh 5 cdef,gc->defg hd,defg->efgh 5 defg,hd->efgh efgh->efgh """ # Make sure all keywords are valid valid_contract_kwargs = ['optimize', 'einsum_call'] unknown_kwargs = [k for (k, v) in kwargs.items() if k not in valid_contract_kwargs] if len(unknown_kwargs): raise TypeError("Did not understand the following kwargs:" " %s" % unknown_kwargs) # Figure out what the path really is path_type = kwargs.pop('optimize', True) if path_type is True: path_type = 'greedy' if path_type is None: path_type = False memory_limit = None # No optimization or a named path algorithm if (path_type is False) or isinstance(path_type, basestring): pass # Given an explicit path elif len(path_type) and (path_type[0] == 'einsum_path'): pass # Path tuple with memory limit elif ((len(path_type) == 2) and isinstance(path_type[0], basestring) and isinstance(path_type[1], (int, float))): memory_limit = int(path_type[1]) path_type = path_type[0] else: raise TypeError("Did not understand the path: %s" % str(path_type)) # Hidden option, only einsum should call this einsum_call_arg = kwargs.pop("einsum_call", False) # Python side parsing input_subscripts, output_subscript, operands = _parse_einsum_input(operands) subscripts = input_subscripts + '->' + output_subscript # Build a few useful list and sets input_list = input_subscripts.split(',') input_sets = [set(x) for x in input_list] output_set = set(output_subscript) indices = set(input_subscripts.replace(',', '')) # Get length of each unique dimension and ensure all dimensions are correct dimension_dict = {} for tnum, term in enumerate(input_list): sh = operands[tnum].shape if len(sh) != len(term): raise ValueError("Einstein sum subscript %s does not contain the " "correct number of indices for operand %d." % (input_subscripts[tnum], tnum)) for cnum, char in enumerate(term): dim = sh[cnum] if char in dimension_dict.keys(): # For broadcasting cases we always want the largest dim size if dimension_dict[char] == 1: dimension_dict[char] = dim elif dim not in (1, dimension_dict[char]): raise ValueError("Size of label '%s' for operand %d (%d) " "does not match previous terms (%d)." % (char, tnum, dimension_dict[char], dim)) else: dimension_dict[char] = dim # Compute size of each input array plus the output array size_list = [] for term in input_list + [output_subscript]: size_list.append(_compute_size_by_dict(term, dimension_dict)) max_size = max(size_list) if memory_limit is None: memory_arg = max_size else: memory_arg = memory_limit # Compute naive cost # This isnt quite right, need to look into exactly how einsum does this naive_cost = _compute_size_by_dict(indices, dimension_dict) indices_in_input = input_subscripts.replace(',', '') mult = max(len(input_list) - 1, 1) if (len(indices_in_input) - len(set(indices_in_input))): mult *= 2 naive_cost *= mult # Compute the path if (path_type is False) or (len(input_list) in [1, 2]) or (indices == output_set): # Nothing to be optimized, leave it to einsum path = [tuple(range(len(input_list)))] elif path_type == "greedy": # Maximum memory should be at most out_size for this algorithm memory_arg = min(memory_arg, max_size) path = _greedy_path(input_sets, output_set, dimension_dict, memory_arg) elif path_type == "optimal": path = _optimal_path(input_sets, output_set, dimension_dict, memory_arg) elif path_type[0] == 'einsum_path': path = path_type[1:] else: raise KeyError("Path name %s not found", path_type) cost_list, scale_list, size_list, contraction_list = [], [], [], [] # Build contraction tuple (positions, gemm, einsum_str, remaining) for cnum, contract_inds in enumerate(path): # Make sure we remove inds from right to left contract_inds = tuple(sorted(list(contract_inds), reverse=True)) contract = _find_contraction(contract_inds, input_sets, output_set) out_inds, input_sets, idx_removed, idx_contract = contract cost = _compute_size_by_dict(idx_contract, dimension_dict) if idx_removed: cost *= 2 cost_list.append(cost) scale_list.append(len(idx_contract)) size_list.append(_compute_size_by_dict(out_inds, dimension_dict)) tmp_inputs = [] for x in contract_inds: tmp_inputs.append(input_list.pop(x)) do_blas = _can_dot(tmp_inputs, out_inds, idx_removed) # Last contraction if (cnum - len(path)) == -1: idx_result = output_subscript else: sort_result = [(dimension_dict[ind], ind) for ind in out_inds] idx_result = "".join([x[1] for x in sorted(sort_result)]) input_list.append(idx_result) einsum_str = ",".join(tmp_inputs) + "->" + idx_result contraction = (contract_inds, idx_removed, einsum_str, input_list[:], do_blas) contraction_list.append(contraction) opt_cost = sum(cost_list) + 1 if einsum_call_arg: return (operands, contraction_list) # Return the path along with a nice string representation overall_contraction = input_subscripts + "->" + output_subscript header = ("scaling", "current", "remaining") speedup = naive_cost / opt_cost max_i = max(size_list) path_print = " Complete contraction: %s\n" % overall_contraction path_print += " Naive scaling: %d\n" % len(indices) path_print += " Optimized scaling: %d\n" % max(scale_list) path_print += " Naive FLOP count: %.3e\n" % naive_cost path_print += " Optimized FLOP count: %.3e\n" % opt_cost path_print += " Theoretical speedup: %3.3f\n" % speedup path_print += " Largest intermediate: %.3e elements\n" % max_i path_print += "-" * 74 + "\n" path_print += "%6s %24s %40s\n" % header path_print += "-" * 74 for n, contraction in enumerate(contraction_list): inds, idx_rm, einsum_str, remaining, blas = contraction remaining_str = ",".join(remaining) + "->" + output_subscript path_run = (scale_list[n], einsum_str, remaining_str) path_print += "\n%4d %24s %40s" % path_run path = ['einsum_path'] + path return (path, path_print) # Rewrite einsum to handle different cases def einsum(*operands, **kwargs): """ einsum(subscripts, *operands, out=None, dtype=None, order='K', casting='safe', optimize=False) Evaluates the Einstein summation convention on the operands. Using the Einstein summation convention, many common multi-dimensional array operations can be represented in a simple fashion. This function provides a way to compute such summations. The best way to understand this function is to try the examples below, which show how many common NumPy functions can be implemented as calls to `einsum`. Parameters ---------- subscripts : str Specifies the subscripts for summation. operands : list of array_like These are the arrays for the operation. out : {ndarray, None}, optional If provided, the calculation is done into this array. dtype : {data-type, None}, optional If provided, forces the calculation to use the data type specified. Note that you may have to also give a more liberal `casting` parameter to allow the conversions. Default is None. order : {'C', 'F', 'A', 'K'}, optional Controls the memory layout of the output. 'C' means it should be C contiguous. 'F' means it should be Fortran contiguous, 'A' means it should be 'F' if the inputs are all 'F', 'C' otherwise. 'K' means it should be as close to the layout as the inputs as is possible, including arbitrarily permuted axes. Default is 'K'. casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional Controls what kind of data casting may occur. Setting this to 'unsafe' is not recommended, as it can adversely affect accumulations. * 'no' means the data types should not be cast at all. * 'equiv' means only byte-order changes are allowed. * 'safe' means only casts which can preserve values are allowed. * 'same_kind' means only safe casts or casts within a kind, like float64 to float32, are allowed. * 'unsafe' means any data conversions may be done. Default is 'safe'. optimize : {False, True, 'greedy', 'optimal'}, optional Controls if intermediate optimization should occur. No optimization will occur if False and True will default to the 'greedy' algorithm. Also accepts an explicit contraction list from the ``np.einsum_path`` function. See ``np.einsum_path`` for more details. Default is False. Returns ------- output : ndarray The calculation based on the Einstein summation convention. See Also -------- einsum_path, dot, inner, outer, tensordot, linalg.multi_dot Notes ----- .. versionadded:: 1.6.0 The subscripts string is a comma-separated list of subscript labels, where each label refers to a dimension of the corresponding operand. Repeated subscripts labels in one operand take the diagonal. For example, ``np.einsum('ii', a)`` is equivalent to ``np.trace(a)``. Whenever a label is repeated, it is summed, so ``np.einsum('i,i', a, b)`` is equivalent to ``np.inner(a,b)``. If a label appears only once, it is not summed, so ``np.einsum('i', a)`` produces a view of ``a`` with no changes. The order of labels in the output is by default alphabetical. This means that ``np.einsum('ij', a)`` doesn't affect a 2D array, while ``np.einsum('ji', a)`` takes its transpose. The output can be controlled by specifying output subscript labels as well. This specifies the label order, and allows summing to be disallowed or forced when desired. The call ``np.einsum('i->', a)`` is like ``np.sum(a, axis=-1)``, and ``np.einsum('ii->i', a)`` is like ``np.diag(a)``. The difference is that `einsum` does not allow broadcasting by default. To enable and control broadcasting, use an ellipsis. Default NumPy-style broadcasting is done by adding an ellipsis to the left of each term, like ``np.einsum('...ii->...i', a)``. To take the trace along the first and last axes, you can do ``np.einsum('i...i', a)``, or to do a matrix-matrix product with the left-most indices instead of rightmost, you can do ``np.einsum('ij...,jk...->ik...', a, b)``. When there is only one operand, no axes are summed, and no output parameter is provided, a view into the operand is returned instead of a new array. Thus, taking the diagonal as ``np.einsum('ii->i', a)`` produces a view. An alternative way to provide the subscripts and operands is as ``einsum(op0, sublist0, op1, sublist1, ..., [sublistout])``. The examples below have corresponding `einsum` calls with the two parameter methods. .. versionadded:: 1.10.0 Views returned from einsum are now writeable whenever the input array is writeable. For example, ``np.einsum('ijk...->kji...', a)`` will now have the same effect as ``np.swapaxes(a, 0, 2)`` and ``np.einsum('ii->i', a)`` will return a writeable view of the diagonal of a 2D array. .. versionadded:: 1.12.0 Added the ``optimize`` argument which will optimize the contraction order of an einsum expression. For a contraction with three or more operands this can greatly increase the computational efficiency at the cost of a larger memory footprint during computation. See ``np.einsum_path`` for more details. Examples -------- >>> a = np.arange(25).reshape(5,5) >>> b = np.arange(5) >>> c = np.arange(6).reshape(2,3) >>> np.einsum('ii', a) 60 >>> np.einsum(a, [0,0]) 60 >>> np.trace(a) 60 >>> np.einsum('ii->i', a) array([ 0, 6, 12, 18, 24]) >>> np.einsum(a, [0,0], [0]) array([ 0, 6, 12, 18, 24]) >>> np.diag(a) array([ 0, 6, 12, 18, 24]) >>> np.einsum('ij,j', a, b) array([ 30, 80, 130, 180, 230]) >>> np.einsum(a, [0,1], b, [1]) array([ 30, 80, 130, 180, 230]) >>> np.dot(a, b) array([ 30, 80, 130, 180, 230]) >>> np.einsum('...j,j', a, b) array([ 30, 80, 130, 180, 230]) >>> np.einsum('ji', c) array([[0, 3], [1, 4], [2, 5]]) >>> np.einsum(c, [1,0]) array([[0, 3], [1, 4], [2, 5]]) >>> c.T array([[0, 3], [1, 4], [2, 5]]) >>> np.einsum('..., ...', 3, c) array([[ 0, 3, 6], [ 9, 12, 15]]) >>> np.einsum(',ij', 3, C) array([[ 0, 3, 6], [ 9, 12, 15]]) >>> np.einsum(3, [Ellipsis], c, [Ellipsis]) array([[ 0, 3, 6], [ 9, 12, 15]]) >>> np.multiply(3, c) array([[ 0, 3, 6], [ 9, 12, 15]]) >>> np.einsum('i,i', b, b) 30 >>> np.einsum(b, [0], b, [0]) 30 >>> np.inner(b,b) 30 >>> np.einsum('i,j', np.arange(2)+1, b) array([[0, 1, 2, 3, 4], [0, 2, 4, 6, 8]]) >>> np.einsum(np.arange(2)+1, [0], b, [1]) array([[0, 1, 2, 3, 4], [0, 2, 4, 6, 8]]) >>> np.outer(np.arange(2)+1, b) array([[0, 1, 2, 3, 4], [0, 2, 4, 6, 8]]) >>> np.einsum('i...->...', a) array([50, 55, 60, 65, 70]) >>> np.einsum(a, [0,Ellipsis], [Ellipsis]) array([50, 55, 60, 65, 70]) >>> np.sum(a, axis=0) array([50, 55, 60, 65, 70]) >>> a = np.arange(60.).reshape(3,4,5) >>> b = np.arange(24.).reshape(4,3,2) >>> np.einsum('ijk,jil->kl', a, b) array([[ 4400., 4730.], [ 4532., 4874.], [ 4664., 5018.], [ 4796., 5162.], [ 4928., 5306.]]) >>> np.einsum(a, [0,1,2], b, [1,0,3], [2,3]) array([[ 4400., 4730.], [ 4532., 4874.], [ 4664., 5018.], [ 4796., 5162.], [ 4928., 5306.]]) >>> np.tensordot(a,b, axes=([1,0],[0,1])) array([[ 4400., 4730.], [ 4532., 4874.], [ 4664., 5018.], [ 4796., 5162.], [ 4928., 5306.]]) >>> a = np.arange(6).reshape((3,2)) >>> b = np.arange(12).reshape((4,3)) >>> np.einsum('ki,jk->ij', a, b) array([[10, 28, 46, 64], [13, 40, 67, 94]]) >>> np.einsum('ki,...k->i...', a, b) array([[10, 28, 46, 64], [13, 40, 67, 94]]) >>> np.einsum('k...,jk', a, b) array([[10, 28, 46, 64], [13, 40, 67, 94]]) >>> # since version 1.10.0 >>> a = np.zeros((3, 3)) >>> np.einsum('ii->i', a)[:] = 1 >>> a array([[ 1., 0., 0.], [ 0., 1., 0.], [ 0., 0., 1.]]) """ # Grab non-einsum kwargs optimize_arg = kwargs.pop('optimize', False) # If no optimization, run pure einsum if optimize_arg is False: return c_einsum(*operands, **kwargs) valid_einsum_kwargs = ['out', 'dtype', 'order', 'casting'] einsum_kwargs = {k: v for (k, v) in kwargs.items() if k in valid_einsum_kwargs} # Make sure all keywords are valid valid_contract_kwargs = ['optimize'] + valid_einsum_kwargs unknown_kwargs = [k for (k, v) in kwargs.items() if k not in valid_contract_kwargs] if len(unknown_kwargs): raise TypeError("Did not understand the following kwargs: %s" % unknown_kwargs) # Special handeling if out is specified specified_out = False out_array = einsum_kwargs.pop('out', None) if out_array is not None: specified_out = True # Build the contraction list and operand operands, contraction_list = einsum_path(*operands, optimize=optimize_arg, einsum_call=True) handle_out = False # Start contraction loop for num, contraction in enumerate(contraction_list): inds, idx_rm, einsum_str, remaining, blas = contraction tmp_operands = [] for x in inds: tmp_operands.append(operands.pop(x)) # Do we need to deal with the output? if specified_out and ((num + 1) == len(contraction_list)): handle_out = True # Handle broadcasting vs BLAS cases if blas: # Checks have already been handled input_str, results_index = einsum_str.split('->') input_left, input_right = input_str.split(',') if 1 in tmp_operands[0].shape or 1 in tmp_operands[1].shape: left_dims = {dim: size for dim, size in zip(input_left, tmp_operands[0].shape)} right_dims = {dim: size for dim, size in zip(input_right, tmp_operands[1].shape)} # If dims do not match we are broadcasting, BLAS off if any(left_dims[ind] != right_dims[ind] for ind in idx_rm): blas = False # Call tensordot if still possible if blas: tensor_result = input_left + input_right for s in idx_rm: tensor_result = tensor_result.replace(s, "") # Find indices to contract over left_pos, right_pos = [], [] for s in idx_rm: left_pos.append(input_left.find(s)) right_pos.append(input_right.find(s)) # Contract! new_view = tensordot(*tmp_operands, axes=(tuple(left_pos), tuple(right_pos))) # Build a new view if needed if (tensor_result != results_index) or handle_out: if handle_out: einsum_kwargs["out"] = out_array new_view = c_einsum(tensor_result + '->' + results_index, new_view, **einsum_kwargs) # Call einsum else: # If out was specified if handle_out: einsum_kwargs["out"] = out_array # Do the contraction new_view = c_einsum(einsum_str, *tmp_operands, **einsum_kwargs) # Append new items and derefernce what we can operands.append(new_view) del tmp_operands, new_view if specified_out: return out_array else: return operands[0]
40,704
34.120794
100
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/arrayprint.py
"""Array printing function $Id: arrayprint.py,v 1.9 2005/09/13 13:58:44 teoliphant Exp $ """ from __future__ import division, absolute_import, print_function __all__ = ["array2string", "array_str", "array_repr", "set_string_function", "set_printoptions", "get_printoptions", "format_float_positional", "format_float_scientific"] __docformat__ = 'restructuredtext' # # Written by Konrad Hinsen <hinsenk@ere.umontreal.ca> # last revision: 1996-3-13 # modified by Jim Hugunin 1997-3-3 for repr's and str's (and other details) # and by Perry Greenfield 2000-4-1 for numarray # and by Travis Oliphant 2005-8-22 for numpy # Note: Both scalartypes.c.src and arrayprint.py implement strs for numpy # scalars but for different purposes. scalartypes.c.src has str/reprs for when # the scalar is printed on its own, while arrayprint.py has strs for when # scalars are printed inside an ndarray. Only the latter strs are currently # user-customizable. import sys import functools if sys.version_info[0] >= 3: try: from _thread import get_ident except ImportError: from _dummy_thread import get_ident else: try: from thread import get_ident except ImportError: from dummy_thread import get_ident import numpy as np from . import numerictypes as _nt from .umath import absolute, not_equal, isnan, isinf, isfinite, isnat from . import multiarray from .multiarray import (array, dragon4_positional, dragon4_scientific, datetime_as_string, datetime_data, dtype, ndarray, set_legacy_print_mode) from .fromnumeric import ravel, any from .numeric import concatenate, asarray, errstate from .numerictypes import (longlong, intc, int_, float_, complex_, bool_, flexible) import warnings _format_options = { 'edgeitems': 3, # repr N leading and trailing items of each dimension 'threshold': 1000, # total items > triggers array summarization 'floatmode': 'maxprec', 'precision': 8, # precision of floating point representations 'suppress': False, # suppress printing small floating values in exp format 'linewidth': 75, 'nanstr': 'nan', 'infstr': 'inf', 'sign': '-', 'formatter': None, 'legacy': False} def _make_options_dict(precision=None, threshold=None, edgeitems=None, linewidth=None, suppress=None, nanstr=None, infstr=None, sign=None, formatter=None, floatmode=None, legacy=None): """ make a dictionary out of the non-None arguments, plus sanity checks """ options = {k: v for k, v in locals().items() if v is not None} if suppress is not None: options['suppress'] = bool(suppress) modes = ['fixed', 'unique', 'maxprec', 'maxprec_equal'] if floatmode not in modes + [None]: raise ValueError("floatmode option must be one of " + ", ".join('"{}"'.format(m) for m in modes)) if sign not in [None, '-', '+', ' ']: raise ValueError("sign option must be one of ' ', '+', or '-'") if legacy not in [None, False, '1.13']: warnings.warn("legacy printing option can currently only be '1.13' or " "`False`", stacklevel=3) return options def set_printoptions(precision=None, threshold=None, edgeitems=None, linewidth=None, suppress=None, nanstr=None, infstr=None, formatter=None, sign=None, floatmode=None, **kwarg): """ Set printing options. These options determine the way floating point numbers, arrays and other NumPy objects are displayed. Parameters ---------- precision : int or None, optional Number of digits of precision for floating point output (default 8). May be `None` if `floatmode` is not `fixed`, to print as many digits as necessary to uniquely specify the value. threshold : int, optional Total number of array elements which trigger summarization rather than full repr (default 1000). edgeitems : int, optional Number of array items in summary at beginning and end of each dimension (default 3). linewidth : int, optional The number of characters per line for the purpose of inserting line breaks (default 75). suppress : bool, optional If True, always print floating point numbers using fixed point notation, in which case numbers equal to zero in the current precision will print as zero. If False, then scientific notation is used when absolute value of the smallest number is < 1e-4 or the ratio of the maximum absolute value to the minimum is > 1e3. The default is False. nanstr : str, optional String representation of floating point not-a-number (default nan). infstr : str, optional String representation of floating point infinity (default inf). sign : string, either '-', '+', or ' ', optional Controls printing of the sign of floating-point types. If '+', always print the sign of positive values. If ' ', always prints a space (whitespace character) in the sign position of positive values. If '-', omit the sign character of positive values. (default '-') formatter : dict of callables, optional If not None, the keys should indicate the type(s) that the respective formatting function applies to. Callables should return a string. Types that are not specified (by their corresponding keys) are handled by the default formatters. Individual types for which a formatter can be set are:: - 'bool' - 'int' - 'timedelta' : a `numpy.timedelta64` - 'datetime' : a `numpy.datetime64` - 'float' - 'longfloat' : 128-bit floats - 'complexfloat' - 'longcomplexfloat' : composed of two 128-bit floats - 'numpystr' : types `numpy.string_` and `numpy.unicode_` - 'object' : `np.object_` arrays - 'str' : all other strings Other keys that can be used to set a group of types at once are:: - 'all' : sets all types - 'int_kind' : sets 'int' - 'float_kind' : sets 'float' and 'longfloat' - 'complex_kind' : sets 'complexfloat' and 'longcomplexfloat' - 'str_kind' : sets 'str' and 'numpystr' floatmode : str, optional Controls the interpretation of the `precision` option for floating-point types. Can take the following values: - 'fixed' : Always print exactly `precision` fractional digits, even if this would print more or fewer digits than necessary to specify the value uniquely. - 'unique : Print the minimum number of fractional digits necessary to represent each value uniquely. Different elements may have a different number of digits. The value of the `precision` option is ignored. - 'maxprec' : Print at most `precision` fractional digits, but if an element can be uniquely represented with fewer digits only print it with that many. - 'maxprec_equal' : Print at most `precision` fractional digits, but if every element in the array can be uniquely represented with an equal number of fewer digits, use that many digits for all elements. legacy : string or `False`, optional If set to the string `'1.13'` enables 1.13 legacy printing mode. This approximates numpy 1.13 print output by including a space in the sign position of floats and different behavior for 0d arrays. If set to `False`, disables legacy mode. Unrecognized strings will be ignored with a warning for forward compatibility. .. versionadded:: 1.14.0 See Also -------- get_printoptions, set_string_function, array2string Notes ----- `formatter` is always reset with a call to `set_printoptions`. Examples -------- Floating point precision can be set: >>> np.set_printoptions(precision=4) >>> print(np.array([1.123456789])) [ 1.1235] Long arrays can be summarised: >>> np.set_printoptions(threshold=5) >>> print(np.arange(10)) [0 1 2 ..., 7 8 9] Small results can be suppressed: >>> eps = np.finfo(float).eps >>> x = np.arange(4.) >>> x**2 - (x + eps)**2 array([ -4.9304e-32, -4.4409e-16, 0.0000e+00, 0.0000e+00]) >>> np.set_printoptions(suppress=True) >>> x**2 - (x + eps)**2 array([-0., -0., 0., 0.]) A custom formatter can be used to display array elements as desired: >>> np.set_printoptions(formatter={'all':lambda x: 'int: '+str(-x)}) >>> x = np.arange(3) >>> x array([int: 0, int: -1, int: -2]) >>> np.set_printoptions() # formatter gets reset >>> x array([0, 1, 2]) To put back the default options, you can use: >>> np.set_printoptions(edgeitems=3,infstr='inf', ... linewidth=75, nanstr='nan', precision=8, ... suppress=False, threshold=1000, formatter=None) """ legacy = kwarg.pop('legacy', None) if kwarg: msg = "set_printoptions() got unexpected keyword argument '{}'" raise TypeError(msg.format(kwarg.popitem()[0])) opt = _make_options_dict(precision, threshold, edgeitems, linewidth, suppress, nanstr, infstr, sign, formatter, floatmode, legacy) # formatter is always reset opt['formatter'] = formatter _format_options.update(opt) # set the C variable for legacy mode if _format_options['legacy'] == '1.13': set_legacy_print_mode(113) # reset the sign option in legacy mode to avoid confusion _format_options['sign'] = '-' elif _format_options['legacy'] is False: set_legacy_print_mode(0) def get_printoptions(): """ Return the current print options. Returns ------- print_opts : dict Dictionary of current print options with keys - precision : int - threshold : int - edgeitems : int - linewidth : int - suppress : bool - nanstr : str - infstr : str - formatter : dict of callables - sign : str For a full description of these options, see `set_printoptions`. See Also -------- set_printoptions, set_string_function """ return _format_options.copy() def _leading_trailing(a, edgeitems, index=()): """ Keep only the N-D corners (leading and trailing edges) of an array. Should be passed a base-class ndarray, since it makes no guarantees about preserving subclasses. """ axis = len(index) if axis == a.ndim: return a[index] if a.shape[axis] > 2*edgeitems: return concatenate(( _leading_trailing(a, edgeitems, index + np.index_exp[ :edgeitems]), _leading_trailing(a, edgeitems, index + np.index_exp[-edgeitems:]) ), axis=axis) else: return _leading_trailing(a, edgeitems, index + np.index_exp[:]) def _object_format(o): """ Object arrays containing lists should be printed unambiguously """ if type(o) is list: fmt = 'list({!r})' else: fmt = '{!r}' return fmt.format(o) def repr_format(x): return repr(x) def str_format(x): return str(x) def _get_formatdict(data, **opt): prec, fmode = opt['precision'], opt['floatmode'] supp, sign = opt['suppress'], opt['sign'] legacy = opt['legacy'] # wrapped in lambdas to avoid taking a code path with the wrong type of data formatdict = { 'bool': lambda: BoolFormat(data), 'int': lambda: IntegerFormat(data), 'float': lambda: FloatingFormat(data, prec, fmode, supp, sign, legacy=legacy), 'longfloat': lambda: FloatingFormat(data, prec, fmode, supp, sign, legacy=legacy), 'complexfloat': lambda: ComplexFloatingFormat(data, prec, fmode, supp, sign, legacy=legacy), 'longcomplexfloat': lambda: ComplexFloatingFormat(data, prec, fmode, supp, sign, legacy=legacy), 'datetime': lambda: DatetimeFormat(data, legacy=legacy), 'timedelta': lambda: TimedeltaFormat(data), 'object': lambda: _object_format, 'void': lambda: str_format, 'numpystr': lambda: repr_format, 'str': lambda: str} # we need to wrap values in `formatter` in a lambda, so that the interface # is the same as the above values. def indirect(x): return lambda: x formatter = opt['formatter'] if formatter is not None: fkeys = [k for k in formatter.keys() if formatter[k] is not None] if 'all' in fkeys: for key in formatdict.keys(): formatdict[key] = indirect(formatter['all']) if 'int_kind' in fkeys: for key in ['int']: formatdict[key] = indirect(formatter['int_kind']) if 'float_kind' in fkeys: for key in ['float', 'longfloat']: formatdict[key] = indirect(formatter['float_kind']) if 'complex_kind' in fkeys: for key in ['complexfloat', 'longcomplexfloat']: formatdict[key] = indirect(formatter['complex_kind']) if 'str_kind' in fkeys: for key in ['numpystr', 'str']: formatdict[key] = indirect(formatter['str_kind']) for key in formatdict.keys(): if key in fkeys: formatdict[key] = indirect(formatter[key]) return formatdict def _get_format_function(data, **options): """ find the right formatting function for the dtype_ """ dtype_ = data.dtype dtypeobj = dtype_.type formatdict = _get_formatdict(data, **options) if issubclass(dtypeobj, _nt.bool_): return formatdict['bool']() elif issubclass(dtypeobj, _nt.integer): if issubclass(dtypeobj, _nt.timedelta64): return formatdict['timedelta']() else: return formatdict['int']() elif issubclass(dtypeobj, _nt.floating): if issubclass(dtypeobj, _nt.longfloat): return formatdict['longfloat']() else: return formatdict['float']() elif issubclass(dtypeobj, _nt.complexfloating): if issubclass(dtypeobj, _nt.clongfloat): return formatdict['longcomplexfloat']() else: return formatdict['complexfloat']() elif issubclass(dtypeobj, (_nt.unicode_, _nt.string_)): return formatdict['numpystr']() elif issubclass(dtypeobj, _nt.datetime64): return formatdict['datetime']() elif issubclass(dtypeobj, _nt.object_): return formatdict['object']() elif issubclass(dtypeobj, _nt.void): if dtype_.names is not None: return StructuredVoidFormat.from_data(data, **options) else: return formatdict['void']() else: return formatdict['numpystr']() def _recursive_guard(fillvalue='...'): """ Like the python 3.2 reprlib.recursive_repr, but forwards *args and **kwargs Decorates a function such that if it calls itself with the same first argument, it returns `fillvalue` instead of recursing. Largely copied from reprlib.recursive_repr """ def decorating_function(f): repr_running = set() @functools.wraps(f) def wrapper(self, *args, **kwargs): key = id(self), get_ident() if key in repr_running: return fillvalue repr_running.add(key) try: return f(self, *args, **kwargs) finally: repr_running.discard(key) return wrapper return decorating_function # gracefully handle recursive calls, when object arrays contain themselves @_recursive_guard() def _array2string(a, options, separator=' ', prefix=""): # The formatter __init__s in _get_format_function cannot deal with # subclasses yet, and we also need to avoid recursion issues in # _formatArray with subclasses which return 0d arrays in place of scalars data = asarray(a) if a.shape == (): a = data if a.size > options['threshold']: summary_insert = "..." data = _leading_trailing(data, options['edgeitems']) else: summary_insert = "" # find the right formatting function for the array format_function = _get_format_function(data, **options) # skip over "[" next_line_prefix = " " # skip over array( next_line_prefix += " "*len(prefix) lst = _formatArray(a, format_function, options['linewidth'], next_line_prefix, separator, options['edgeitems'], summary_insert, options['legacy']) return lst def array2string(a, max_line_width=None, precision=None, suppress_small=None, separator=' ', prefix="", style=np._NoValue, formatter=None, threshold=None, edgeitems=None, sign=None, floatmode=None, suffix="", **kwarg): """ Return a string representation of an array. Parameters ---------- a : array_like Input array. max_line_width : int, optional The maximum number of columns the string should span. Newline characters splits the string appropriately after array elements. precision : int or None, optional Floating point precision. Default is the current printing precision (usually 8), which can be altered using `set_printoptions`. suppress_small : bool, optional Represent very small numbers as zero. A number is "very small" if it is smaller than the current printing precision. separator : str, optional Inserted between elements. prefix : str, optional suffix: str, optional The length of the prefix and suffix strings are used to respectively align and wrap the output. An array is typically printed as:: prefix + array2string(a) + suffix The output is left-padded by the length of the prefix string, and wrapping is forced at the column ``max_line_width - len(suffix)``. style : _NoValue, optional Has no effect, do not use. .. deprecated:: 1.14.0 formatter : dict of callables, optional If not None, the keys should indicate the type(s) that the respective formatting function applies to. Callables should return a string. Types that are not specified (by their corresponding keys) are handled by the default formatters. Individual types for which a formatter can be set are:: - 'bool' - 'int' - 'timedelta' : a `numpy.timedelta64` - 'datetime' : a `numpy.datetime64` - 'float' - 'longfloat' : 128-bit floats - 'complexfloat' - 'longcomplexfloat' : composed of two 128-bit floats - 'void' : type `numpy.void` - 'numpystr' : types `numpy.string_` and `numpy.unicode_` - 'str' : all other strings Other keys that can be used to set a group of types at once are:: - 'all' : sets all types - 'int_kind' : sets 'int' - 'float_kind' : sets 'float' and 'longfloat' - 'complex_kind' : sets 'complexfloat' and 'longcomplexfloat' - 'str_kind' : sets 'str' and 'numpystr' threshold : int, optional Total number of array elements which trigger summarization rather than full repr. edgeitems : int, optional Number of array items in summary at beginning and end of each dimension. sign : string, either '-', '+', or ' ', optional Controls printing of the sign of floating-point types. If '+', always print the sign of positive values. If ' ', always prints a space (whitespace character) in the sign position of positive values. If '-', omit the sign character of positive values. floatmode : str, optional Controls the interpretation of the `precision` option for floating-point types. Can take the following values: - 'fixed' : Always print exactly `precision` fractional digits, even if this would print more or fewer digits than necessary to specify the value uniquely. - 'unique : Print the minimum number of fractional digits necessary to represent each value uniquely. Different elements may have a different number of digits. The value of the `precision` option is ignored. - 'maxprec' : Print at most `precision` fractional digits, but if an element can be uniquely represented with fewer digits only print it with that many. - 'maxprec_equal' : Print at most `precision` fractional digits, but if every element in the array can be uniquely represented with an equal number of fewer digits, use that many digits for all elements. legacy : string or `False`, optional If set to the string `'1.13'` enables 1.13 legacy printing mode. This approximates numpy 1.13 print output by including a space in the sign position of floats and different behavior for 0d arrays. If set to `False`, disables legacy mode. Unrecognized strings will be ignored with a warning for forward compatibility. .. versionadded:: 1.14.0 Returns ------- array_str : str String representation of the array. Raises ------ TypeError if a callable in `formatter` does not return a string. See Also -------- array_str, array_repr, set_printoptions, get_printoptions Notes ----- If a formatter is specified for a certain type, the `precision` keyword is ignored for that type. This is a very flexible function; `array_repr` and `array_str` are using `array2string` internally so keywords with the same name should work identically in all three functions. Examples -------- >>> x = np.array([1e-16,1,2,3]) >>> print(np.array2string(x, precision=2, separator=',', ... suppress_small=True)) [ 0., 1., 2., 3.] >>> x = np.arange(3.) >>> np.array2string(x, formatter={'float_kind':lambda x: "%.2f" % x}) '[0.00 1.00 2.00]' >>> x = np.arange(3) >>> np.array2string(x, formatter={'int':lambda x: hex(x)}) '[0x0L 0x1L 0x2L]' """ legacy = kwarg.pop('legacy', None) if kwarg: msg = "array2string() got unexpected keyword argument '{}'" raise TypeError(msg.format(kwarg.popitem()[0])) overrides = _make_options_dict(precision, threshold, edgeitems, max_line_width, suppress_small, None, None, sign, formatter, floatmode, legacy) options = _format_options.copy() options.update(overrides) if options['legacy'] == '1.13': if style is np._NoValue: style = repr if a.shape == () and not a.dtype.names: return style(a.item()) elif style is not np._NoValue: # Deprecation 11-9-2017 v1.14 warnings.warn("'style' argument is deprecated and no longer functional" " except in 1.13 'legacy' mode", DeprecationWarning, stacklevel=3) if options['legacy'] != '1.13': options['linewidth'] -= len(suffix) # treat as a null array if any of shape elements == 0 if a.size == 0: return "[]" return _array2string(a, options, separator, prefix) def _extendLine(s, line, word, line_width, next_line_prefix, legacy): needs_wrap = len(line) + len(word) > line_width if legacy != '1.13': s# don't wrap lines if it won't help if len(line) <= len(next_line_prefix): needs_wrap = False if needs_wrap: s += line.rstrip() + "\n" line = next_line_prefix line += word return s, line def _formatArray(a, format_function, line_width, next_line_prefix, separator, edge_items, summary_insert, legacy): """formatArray is designed for two modes of operation: 1. Full output 2. Summarized output """ def recurser(index, hanging_indent, curr_width): """ By using this local function, we don't need to recurse with all the arguments. Since this function is not created recursively, the cost is not significant """ axis = len(index) axes_left = a.ndim - axis if axes_left == 0: return format_function(a[index]) # when recursing, add a space to align with the [ added, and reduce the # length of the line by 1 next_hanging_indent = hanging_indent + ' ' if legacy == '1.13': next_width = curr_width else: next_width = curr_width - len(']') a_len = a.shape[axis] show_summary = summary_insert and 2*edge_items < a_len if show_summary: leading_items = edge_items trailing_items = edge_items else: leading_items = 0 trailing_items = a_len # stringify the array with the hanging indent on the first line too s = '' # last axis (rows) - wrap elements if they would not fit on one line if axes_left == 1: # the length up until the beginning of the separator / bracket if legacy == '1.13': elem_width = curr_width - len(separator.rstrip()) else: elem_width = curr_width - max(len(separator.rstrip()), len(']')) line = hanging_indent for i in range(leading_items): word = recurser(index + (i,), next_hanging_indent, next_width) s, line = _extendLine( s, line, word, elem_width, hanging_indent, legacy) line += separator if show_summary: s, line = _extendLine( s, line, summary_insert, elem_width, hanging_indent, legacy) if legacy == '1.13': line += ", " else: line += separator for i in range(trailing_items, 1, -1): word = recurser(index + (-i,), next_hanging_indent, next_width) s, line = _extendLine( s, line, word, elem_width, hanging_indent, legacy) line += separator if legacy == '1.13': # width of the seperator is not considered on 1.13 elem_width = curr_width word = recurser(index + (-1,), next_hanging_indent, next_width) s, line = _extendLine( s, line, word, elem_width, hanging_indent, legacy) s += line # other axes - insert newlines between rows else: s = '' line_sep = separator.rstrip() + '\n'*(axes_left - 1) for i in range(leading_items): nested = recurser(index + (i,), next_hanging_indent, next_width) s += hanging_indent + nested + line_sep if show_summary: if legacy == '1.13': # trailing space, fixed nbr of newlines, and fixed separator s += hanging_indent + summary_insert + ", \n" else: s += hanging_indent + summary_insert + line_sep for i in range(trailing_items, 1, -1): nested = recurser(index + (-i,), next_hanging_indent, next_width) s += hanging_indent + nested + line_sep nested = recurser(index + (-1,), next_hanging_indent, next_width) s += hanging_indent + nested # remove the hanging indent, and wrap in [] s = '[' + s[len(hanging_indent):] + ']' return s try: # invoke the recursive part with an initial index and prefix return recurser(index=(), hanging_indent=next_line_prefix, curr_width=line_width) finally: # recursive closures have a cyclic reference to themselves, which # requires gc to collect (gh-10620). To avoid this problem, for # performance and PyPy friendliness, we break the cycle: recurser = None def _none_or_positive_arg(x, name): if x is None: return -1 if x < 0: raise ValueError("{} must be >= 0".format(name)) return x class FloatingFormat(object): """ Formatter for subtypes of np.floating """ def __init__(self, data, precision, floatmode, suppress_small, sign=False, **kwarg): # for backcompatibility, accept bools if isinstance(sign, bool): sign = '+' if sign else '-' self._legacy = kwarg.get('legacy', False) if self._legacy == '1.13': # when not 0d, legacy does not support '-' if data.shape != () and sign == '-': sign = ' ' self.floatmode = floatmode if floatmode == 'unique': self.precision = None else: self.precision = precision self.precision = _none_or_positive_arg(self.precision, 'precision') self.suppress_small = suppress_small self.sign = sign self.exp_format = False self.large_exponent = False self.fillFormat(data) def fillFormat(self, data): # only the finite values are used to compute the number of digits finite_vals = data[isfinite(data)] # choose exponential mode based on the non-zero finite values: abs_non_zero = absolute(finite_vals[finite_vals != 0]) if len(abs_non_zero) != 0: max_val = np.max(abs_non_zero) min_val = np.min(abs_non_zero) with errstate(over='ignore'): # division can overflow if max_val >= 1.e8 or (not self.suppress_small and (min_val < 0.0001 or max_val/min_val > 1000.)): self.exp_format = True # do a first pass of printing all the numbers, to determine sizes if len(finite_vals) == 0: self.pad_left = 0 self.pad_right = 0 self.trim = '.' self.exp_size = -1 self.unique = True elif self.exp_format: trim, unique = '.', True if self.floatmode == 'fixed' or self._legacy == '1.13': trim, unique = 'k', False strs = (dragon4_scientific(x, precision=self.precision, unique=unique, trim=trim, sign=self.sign == '+') for x in finite_vals) frac_strs, _, exp_strs = zip(*(s.partition('e') for s in strs)) int_part, frac_part = zip(*(s.split('.') for s in frac_strs)) self.exp_size = max(len(s) for s in exp_strs) - 1 self.trim = 'k' self.precision = max(len(s) for s in frac_part) # for back-compat with np 1.13, use 2 spaces & sign and full prec if self._legacy == '1.13': self.pad_left = 3 else: # this should be only 1 or 2. Can be calculated from sign. self.pad_left = max(len(s) for s in int_part) # pad_right is only needed for nan length calculation self.pad_right = self.exp_size + 2 + self.precision self.unique = False else: # first pass printing to determine sizes trim, unique = '.', True if self.floatmode == 'fixed': trim, unique = 'k', False strs = (dragon4_positional(x, precision=self.precision, fractional=True, unique=unique, trim=trim, sign=self.sign == '+') for x in finite_vals) int_part, frac_part = zip(*(s.split('.') for s in strs)) if self._legacy == '1.13': self.pad_left = 1 + max(len(s.lstrip('-+')) for s in int_part) else: self.pad_left = max(len(s) for s in int_part) self.pad_right = max(len(s) for s in frac_part) self.exp_size = -1 if self.floatmode in ['fixed', 'maxprec_equal']: self.precision = self.pad_right self.unique = False self.trim = 'k' else: self.unique = True self.trim = '.' if self._legacy != '1.13': # account for sign = ' ' by adding one to pad_left if self.sign == ' ' and not any(np.signbit(finite_vals)): self.pad_left += 1 # if there are non-finite values, may need to increase pad_left if data.size != finite_vals.size: neginf = self.sign != '-' or any(data[isinf(data)] < 0) nanlen = len(_format_options['nanstr']) inflen = len(_format_options['infstr']) + neginf offset = self.pad_right + 1 # +1 for decimal pt self.pad_left = max(self.pad_left, nanlen - offset, inflen - offset) def __call__(self, x): if not np.isfinite(x): with errstate(invalid='ignore'): if np.isnan(x): sign = '+' if self.sign == '+' else '' ret = sign + _format_options['nanstr'] else: # isinf sign = '-' if x < 0 else '+' if self.sign == '+' else '' ret = sign + _format_options['infstr'] return ' '*(self.pad_left + self.pad_right + 1 - len(ret)) + ret if self.exp_format: return dragon4_scientific(x, precision=self.precision, unique=self.unique, trim=self.trim, sign=self.sign == '+', pad_left=self.pad_left, exp_digits=self.exp_size) else: return dragon4_positional(x, precision=self.precision, unique=self.unique, fractional=True, trim=self.trim, sign=self.sign == '+', pad_left=self.pad_left, pad_right=self.pad_right) # for back-compatibility, we keep the classes for each float type too class FloatFormat(FloatingFormat): def __init__(self, *args, **kwargs): warnings.warn("FloatFormat has been replaced by FloatingFormat", DeprecationWarning, stacklevel=2) super(FloatFormat, self).__init__(*args, **kwargs) class LongFloatFormat(FloatingFormat): def __init__(self, *args, **kwargs): warnings.warn("LongFloatFormat has been replaced by FloatingFormat", DeprecationWarning, stacklevel=2) super(LongFloatFormat, self).__init__(*args, **kwargs) def format_float_scientific(x, precision=None, unique=True, trim='k', sign=False, pad_left=None, exp_digits=None): """ Format a floating-point scalar as a decimal string in scientific notation. Provides control over rounding, trimming and padding. Uses and assumes IEEE unbiased rounding. Uses the "Dragon4" algorithm. Parameters ---------- x : python float or numpy floating scalar Value to format. precision : non-negative integer or None, optional Maximum number of digits to print. May be None if `unique` is `True`, but must be an integer if unique is `False`. unique : boolean, optional If `True`, use a digit-generation strategy which gives the shortest representation which uniquely identifies the floating-point number from other values of the same type, by judicious rounding. If `precision` was omitted, print all necessary digits, otherwise digit generation is cut off after `precision` digits and the remaining value is rounded. If `False`, digits are generated as if printing an infinite-precision value and stopping after `precision` digits, rounding the remaining value. trim : one of 'k', '.', '0', '-', optional Controls post-processing trimming of trailing digits, as follows: k : keep trailing zeros, keep decimal point (no trimming) . : trim all trailing zeros, leave decimal point 0 : trim all but the zero before the decimal point. Insert the zero if it is missing. - : trim trailing zeros and any trailing decimal point sign : boolean, optional Whether to show the sign for positive values. pad_left : non-negative integer, optional Pad the left side of the string with whitespace until at least that many characters are to the left of the decimal point. exp_digits : non-negative integer, optional Pad the exponent with zeros until it contains at least this many digits. If omitted, the exponent will be at least 2 digits. Returns ------- rep : string The string representation of the floating point value See Also -------- format_float_positional Examples -------- >>> np.format_float_scientific(np.float32(np.pi)) '3.1415927e+00' >>> s = np.float32(1.23e24) >>> np.format_float_scientific(s, unique=False, precision=15) '1.230000071797338e+24' >>> np.format_float_scientific(s, exp_digits=4) '1.23e+0024' """ precision = _none_or_positive_arg(precision, 'precision') pad_left = _none_or_positive_arg(pad_left, 'pad_left') exp_digits = _none_or_positive_arg(exp_digits, 'exp_digits') return dragon4_scientific(x, precision=precision, unique=unique, trim=trim, sign=sign, pad_left=pad_left, exp_digits=exp_digits) def format_float_positional(x, precision=None, unique=True, fractional=True, trim='k', sign=False, pad_left=None, pad_right=None): """ Format a floating-point scalar as a decimal string in positional notation. Provides control over rounding, trimming and padding. Uses and assumes IEEE unbiased rounding. Uses the "Dragon4" algorithm. Parameters ---------- x : python float or numpy floating scalar Value to format. precision : non-negative integer or None, optional Maximum number of digits to print. May be None if `unique` is `True`, but must be an integer if unique is `False`. unique : boolean, optional If `True`, use a digit-generation strategy which gives the shortest representation which uniquely identifies the floating-point number from other values of the same type, by judicious rounding. If `precision` was omitted, print out all necessary digits, otherwise digit generation is cut off after `precision` digits and the remaining value is rounded. If `False`, digits are generated as if printing an infinite-precision value and stopping after `precision` digits, rounding the remaining value. fractional : boolean, optional If `True`, the cutoff of `precision` digits refers to the total number of digits after the decimal point, including leading zeros. If `False`, `precision` refers to the total number of significant digits, before or after the decimal point, ignoring leading zeros. trim : one of 'k', '.', '0', '-', optional Controls post-processing trimming of trailing digits, as follows: k : keep trailing zeros, keep decimal point (no trimming) . : trim all trailing zeros, leave decimal point 0 : trim all but the zero before the decimal point. Insert the zero if it is missing. - : trim trailing zeros and any trailing decimal point sign : boolean, optional Whether to show the sign for positive values. pad_left : non-negative integer, optional Pad the left side of the string with whitespace until at least that many characters are to the left of the decimal point. pad_right : non-negative integer, optional Pad the right side of the string with whitespace until at least that many characters are to the right of the decimal point. Returns ------- rep : string The string representation of the floating point value See Also -------- format_float_scientific Examples -------- >>> np.format_float_scientific(np.float32(np.pi)) '3.1415927' >>> np.format_float_positional(np.float16(np.pi)) '3.14' >>> np.format_float_positional(np.float16(0.3)) '0.3' >>> np.format_float_positional(np.float16(0.3), unique=False, precision=10) '0.3000488281' """ precision = _none_or_positive_arg(precision, 'precision') pad_left = _none_or_positive_arg(pad_left, 'pad_left') pad_right = _none_or_positive_arg(pad_right, 'pad_right') return dragon4_positional(x, precision=precision, unique=unique, fractional=fractional, trim=trim, sign=sign, pad_left=pad_left, pad_right=pad_right) class IntegerFormat(object): def __init__(self, data): if data.size > 0: max_str_len = max(len(str(np.max(data))), len(str(np.min(data)))) else: max_str_len = 0 self.format = '%{}d'.format(max_str_len) def __call__(self, x): return self.format % x class BoolFormat(object): def __init__(self, data, **kwargs): # add an extra space so " True" and "False" have the same length and # array elements align nicely when printed, except in 0d arrays self.truestr = ' True' if data.shape != () else 'True' def __call__(self, x): return self.truestr if x else "False" class ComplexFloatingFormat(object): """ Formatter for subtypes of np.complexfloating """ def __init__(self, x, precision, floatmode, suppress_small, sign=False, **kwarg): # for backcompatibility, accept bools if isinstance(sign, bool): sign = '+' if sign else '-' floatmode_real = floatmode_imag = floatmode if kwarg.get('legacy', False) == '1.13': floatmode_real = 'maxprec_equal' floatmode_imag = 'maxprec' self.real_format = FloatingFormat(x.real, precision, floatmode_real, suppress_small, sign=sign, **kwarg) self.imag_format = FloatingFormat(x.imag, precision, floatmode_imag, suppress_small, sign='+', **kwarg) def __call__(self, x): r = self.real_format(x.real) i = self.imag_format(x.imag) # add the 'j' before the terminal whitespace in i sp = len(i.rstrip()) i = i[:sp] + 'j' + i[sp:] return r + i # for back-compatibility, we keep the classes for each complex type too class ComplexFormat(ComplexFloatingFormat): def __init__(self, *args, **kwargs): warnings.warn( "ComplexFormat has been replaced by ComplexFloatingFormat", DeprecationWarning, stacklevel=2) super(ComplexFormat, self).__init__(*args, **kwargs) class LongComplexFormat(ComplexFloatingFormat): def __init__(self, *args, **kwargs): warnings.warn( "LongComplexFormat has been replaced by ComplexFloatingFormat", DeprecationWarning, stacklevel=2) super(LongComplexFormat, self).__init__(*args, **kwargs) class _TimelikeFormat(object): def __init__(self, data): non_nat = data[~isnat(data)] if len(non_nat) > 0: # Max str length of non-NaT elements max_str_len = max(len(self._format_non_nat(np.max(non_nat))), len(self._format_non_nat(np.min(non_nat)))) else: max_str_len = 0 if len(non_nat) < data.size: # data contains a NaT max_str_len = max(max_str_len, 5) self._format = '%{}s'.format(max_str_len) self._nat = "'NaT'".rjust(max_str_len) def _format_non_nat(self, x): # override in subclass raise NotImplementedError def __call__(self, x): if isnat(x): return self._nat else: return self._format % self._format_non_nat(x) class DatetimeFormat(_TimelikeFormat): def __init__(self, x, unit=None, timezone=None, casting='same_kind', legacy=False): # Get the unit from the dtype if unit is None: if x.dtype.kind == 'M': unit = datetime_data(x.dtype)[0] else: unit = 's' if timezone is None: timezone = 'naive' self.timezone = timezone self.unit = unit self.casting = casting self.legacy = legacy # must be called after the above are configured super(DatetimeFormat, self).__init__(x) def __call__(self, x): if self.legacy == '1.13': return self._format_non_nat(x) return super(DatetimeFormat, self).__call__(x) def _format_non_nat(self, x): return "'%s'" % datetime_as_string(x, unit=self.unit, timezone=self.timezone, casting=self.casting) class TimedeltaFormat(_TimelikeFormat): def _format_non_nat(self, x): return str(x.astype('i8')) class SubArrayFormat(object): def __init__(self, format_function): self.format_function = format_function def __call__(self, arr): if arr.ndim <= 1: return "[" + ", ".join(self.format_function(a) for a in arr) + "]" return "[" + ", ".join(self.__call__(a) for a in arr) + "]" class StructuredVoidFormat(object): """ Formatter for structured np.void objects. This does not work on structured alias types like np.dtype(('i4', 'i2,i2')), as alias scalars lose their field information, and the implementation relies upon np.void.__getitem__. """ def __init__(self, format_functions): self.format_functions = format_functions @classmethod def from_data(cls, data, **options): """ This is a second way to initialize StructuredVoidFormat, using the raw data as input. Added to avoid changing the signature of __init__. """ format_functions = [] for field_name in data.dtype.names: format_function = _get_format_function(data[field_name], **options) if data.dtype[field_name].shape != (): format_function = SubArrayFormat(format_function) format_functions.append(format_function) return cls(format_functions) def __call__(self, x): str_fields = [ format_function(field) for field, format_function in zip(x, self.format_functions) ] if len(str_fields) == 1: return "({},)".format(str_fields[0]) else: return "({})".format(", ".join(str_fields)) # for backwards compatibility class StructureFormat(StructuredVoidFormat): def __init__(self, *args, **kwargs): # NumPy 1.14, 2018-02-14 warnings.warn( "StructureFormat has been replaced by StructuredVoidFormat", DeprecationWarning, stacklevel=2) super(StructureFormat, self).__init__(*args, **kwargs) def _void_scalar_repr(x): """ Implements the repr for structured-void scalars. It is called from the scalartypes.c.src code, and is placed here because it uses the elementwise formatters defined above. """ return StructuredVoidFormat.from_data(array(x), **_format_options)(x) _typelessdata = [int_, float_, complex_, bool_] if issubclass(intc, int): _typelessdata.append(intc) if issubclass(longlong, int): _typelessdata.append(longlong) def dtype_is_implied(dtype): """ Determine if the given dtype is implied by the representation of its values. Parameters ---------- dtype : dtype Data type Returns ------- implied : bool True if the dtype is implied by the representation of its values. Examples -------- >>> np.core.arrayprint.dtype_is_implied(int) True >>> np.array([1, 2, 3], int) array([1, 2, 3]) >>> np.core.arrayprint.dtype_is_implied(np.int8) False >>> np.array([1, 2, 3], np.int8) array([1, 2, 3], dtype=np.int8) """ dtype = np.dtype(dtype) if _format_options['legacy'] == '1.13' and dtype.type == bool_: return False # not just void types can be structured, and names are not part of the repr if dtype.names is not None: return False return dtype.type in _typelessdata def dtype_short_repr(dtype): """ Convert a dtype to a short form which evaluates to the same dtype. The intent is roughly that the following holds >>> from numpy import * >>> assert eval(dtype_short_repr(dt)) == dt """ if dtype.names is not None: # structured dtypes give a list or tuple repr return str(dtype) elif issubclass(dtype.type, flexible): # handle these separately so they don't give garbage like str256 return "'%s'" % str(dtype) typename = dtype.name # quote typenames which can't be represented as python variable names if typename and not (typename[0].isalpha() and typename.isalnum()): typename = repr(typename) return typename def array_repr(arr, max_line_width=None, precision=None, suppress_small=None): """ Return the string representation of an array. Parameters ---------- arr : ndarray Input array. max_line_width : int, optional The maximum number of columns the string should span. Newline characters split the string appropriately after array elements. precision : int, optional Floating point precision. Default is the current printing precision (usually 8), which can be altered using `set_printoptions`. suppress_small : bool, optional Represent very small numbers as zero, default is False. Very small is defined by `precision`, if the precision is 8 then numbers smaller than 5e-9 are represented as zero. Returns ------- string : str The string representation of an array. See Also -------- array_str, array2string, set_printoptions Examples -------- >>> np.array_repr(np.array([1,2])) 'array([1, 2])' >>> np.array_repr(np.ma.array([0.])) 'MaskedArray([ 0.])' >>> np.array_repr(np.array([], np.int32)) 'array([], dtype=int32)' >>> x = np.array([1e-6, 4e-7, 2, 3]) >>> np.array_repr(x, precision=6, suppress_small=True) 'array([ 0.000001, 0. , 2. , 3. ])' """ if max_line_width is None: max_line_width = _format_options['linewidth'] if type(arr) is not ndarray: class_name = type(arr).__name__ else: class_name = "array" skipdtype = dtype_is_implied(arr.dtype) and arr.size > 0 prefix = class_name + "(" suffix = ")" if skipdtype else "," if (_format_options['legacy'] == '1.13' and arr.shape == () and not arr.dtype.names): lst = repr(arr.item()) elif arr.size > 0 or arr.shape == (0,): lst = array2string(arr, max_line_width, precision, suppress_small, ', ', prefix, suffix=suffix) else: # show zero-length shape unless it is (0,) lst = "[], shape=%s" % (repr(arr.shape),) arr_str = prefix + lst + suffix if skipdtype: return arr_str dtype_str = "dtype={})".format(dtype_short_repr(arr.dtype)) # compute whether we should put dtype on a new line: Do so if adding the # dtype would extend the last line past max_line_width. # Note: This line gives the correct result even when rfind returns -1. last_line_len = len(arr_str) - (arr_str.rfind('\n') + 1) spacer = " " if _format_options['legacy'] == '1.13': if issubclass(arr.dtype.type, flexible): spacer = '\n' + ' '*len(class_name + "(") elif last_line_len + len(dtype_str) + 1 > max_line_width: spacer = '\n' + ' '*len(class_name + "(") return arr_str + spacer + dtype_str _guarded_str = _recursive_guard()(str) def array_str(a, max_line_width=None, precision=None, suppress_small=None): """ Return a string representation of the data in an array. The data in the array is returned as a single string. This function is similar to `array_repr`, the difference being that `array_repr` also returns information on the kind of array and its data type. Parameters ---------- a : ndarray Input array. max_line_width : int, optional Inserts newlines if text is longer than `max_line_width`. The default is, indirectly, 75. precision : int, optional Floating point precision. Default is the current printing precision (usually 8), which can be altered using `set_printoptions`. suppress_small : bool, optional Represent numbers "very close" to zero as zero; default is False. Very close is defined by precision: if the precision is 8, e.g., numbers smaller (in absolute value) than 5e-9 are represented as zero. See Also -------- array2string, array_repr, set_printoptions Examples -------- >>> np.array_str(np.arange(3)) '[0 1 2]' """ if (_format_options['legacy'] == '1.13' and a.shape == () and not a.dtype.names): return str(a.item()) # the str of 0d arrays is a special case: It should appear like a scalar, # so floats are not truncated by `precision`, and strings are not wrapped # in quotes. So we return the str of the scalar value. if a.shape == (): # obtain a scalar and call str on it, avoiding problems for subclasses # for which indexing with () returns a 0d instead of a scalar by using # ndarray's getindex. Also guard against recursive 0d object arrays. return _guarded_str(np.ndarray.__getitem__(a, ())) return array2string(a, max_line_width, precision, suppress_small, ' ', "") def set_string_function(f, repr=True): """ Set a Python function to be used when pretty printing arrays. Parameters ---------- f : function or None Function to be used to pretty print arrays. The function should expect a single array argument and return a string of the representation of the array. If None, the function is reset to the default NumPy function to print arrays. repr : bool, optional If True (default), the function for pretty printing (``__repr__``) is set, if False the function that returns the default string representation (``__str__``) is set. See Also -------- set_printoptions, get_printoptions Examples -------- >>> def pprint(arr): ... return 'HA! - What are you going to do now?' ... >>> np.set_string_function(pprint) >>> a = np.arange(10) >>> a HA! - What are you going to do now? >>> print(a) [0 1 2 3 4 5 6 7 8 9] We can reset the function to the default: >>> np.set_string_function(None) >>> a array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]) `repr` affects either pretty printing or normal string representation. Note that ``__repr__`` is still affected by setting ``__str__`` because the width of each array element in the returned string becomes equal to the length of the result of ``__str__()``. >>> x = np.arange(4) >>> np.set_string_function(lambda x:'random', repr=False) >>> x.__str__() 'random' >>> x.__repr__() 'array([ 0, 1, 2, 3])' """ if f is None: if repr: return multiarray.set_string_function(array_repr, 1) else: return multiarray.set_string_function(array_str, 0) else: return multiarray.set_string_function(f, repr) set_string_function(array_str, 0) set_string_function(array_repr, 1)
57,352
36.485621
83
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/records.py
""" Record Arrays ============= Record arrays expose the fields of structured arrays as properties. Most commonly, ndarrays contain elements of a single type, e.g. floats, integers, bools etc. However, it is possible for elements to be combinations of these using structured types, such as:: >>> a = np.array([(1, 2.0), (1, 2.0)], dtype=[('x', int), ('y', float)]) >>> a array([(1, 2.0), (1, 2.0)], dtype=[('x', '<i4'), ('y', '<f8')]) Here, each element consists of two fields: x (and int), and y (a float). This is known as a structured array. The different fields are analogous to columns in a spread-sheet. The different fields can be accessed as one would a dictionary:: >>> a['x'] array([1, 1]) >>> a['y'] array([ 2., 2.]) Record arrays allow us to access fields as properties:: >>> ar = np.rec.array(a) >>> ar.x array([1, 1]) >>> ar.y array([ 2., 2.]) """ from __future__ import division, absolute_import, print_function import sys import os import warnings from . import numeric as sb from . import numerictypes as nt from numpy.compat import isfileobj, bytes, long from .arrayprint import get_printoptions # All of the functions allow formats to be a dtype __all__ = ['record', 'recarray', 'format_parser'] ndarray = sb.ndarray _byteorderconv = {'b':'>', 'l':'<', 'n':'=', 'B':'>', 'L':'<', 'N':'=', 'S':'s', 's':'s', '>':'>', '<':'<', '=':'=', '|':'|', 'I':'|', 'i':'|'} # formats regular expression # allows multidimension spec with a tuple syntax in front # of the letter code '(2,3)f4' and ' ( 2 , 3 ) f4 ' # are equally allowed numfmt = nt.typeDict def find_duplicate(list): """Find duplication in a list, return a list of duplicated elements""" dup = [] for i in range(len(list)): if (list[i] in list[i + 1:]): if (list[i] not in dup): dup.append(list[i]) return dup class format_parser(object): """ Class to convert formats, names, titles description to a dtype. After constructing the format_parser object, the dtype attribute is the converted data-type: ``dtype = format_parser(formats, names, titles).dtype`` Attributes ---------- dtype : dtype The converted data-type. Parameters ---------- formats : str or list of str The format description, either specified as a string with comma-separated format descriptions in the form ``'f8, i4, a5'``, or a list of format description strings in the form ``['f8', 'i4', 'a5']``. names : str or list/tuple of str The field names, either specified as a comma-separated string in the form ``'col1, col2, col3'``, or as a list or tuple of strings in the form ``['col1', 'col2', 'col3']``. An empty list can be used, in that case default field names ('f0', 'f1', ...) are used. titles : sequence Sequence of title strings. An empty list can be used to leave titles out. aligned : bool, optional If True, align the fields by padding as the C-compiler would. Default is False. byteorder : str, optional If specified, all the fields will be changed to the provided byte-order. Otherwise, the default byte-order is used. For all available string specifiers, see `dtype.newbyteorder`. See Also -------- dtype, typename, sctype2char Examples -------- >>> np.format_parser(['f8', 'i4', 'a5'], ['col1', 'col2', 'col3'], ... ['T1', 'T2', 'T3']).dtype dtype([(('T1', 'col1'), '<f8'), (('T2', 'col2'), '<i4'), (('T3', 'col3'), '|S5')]) `names` and/or `titles` can be empty lists. If `titles` is an empty list, titles will simply not appear. If `names` is empty, default field names will be used. >>> np.format_parser(['f8', 'i4', 'a5'], ['col1', 'col2', 'col3'], ... []).dtype dtype([('col1', '<f8'), ('col2', '<i4'), ('col3', '|S5')]) >>> np.format_parser(['f8', 'i4', 'a5'], [], []).dtype dtype([('f0', '<f8'), ('f1', '<i4'), ('f2', '|S5')]) """ def __init__(self, formats, names, titles, aligned=False, byteorder=None): self._parseFormats(formats, aligned) self._setfieldnames(names, titles) self._createdescr(byteorder) self.dtype = self._descr def _parseFormats(self, formats, aligned=0): """ Parse the field formats """ if formats is None: raise ValueError("Need formats argument") if isinstance(formats, list): if len(formats) < 2: formats.append('') formats = ','.join(formats) dtype = sb.dtype(formats, aligned) fields = dtype.fields if fields is None: dtype = sb.dtype([('f1', dtype)], aligned) fields = dtype.fields keys = dtype.names self._f_formats = [fields[key][0] for key in keys] self._offsets = [fields[key][1] for key in keys] self._nfields = len(keys) def _setfieldnames(self, names, titles): """convert input field names into a list and assign to the _names attribute """ if (names): if (type(names) in [list, tuple]): pass elif isinstance(names, str): names = names.split(',') else: raise NameError("illegal input names %s" % repr(names)) self._names = [n.strip() for n in names[:self._nfields]] else: self._names = [] # if the names are not specified, they will be assigned as # "f0, f1, f2,..." # if not enough names are specified, they will be assigned as "f[n], # f[n+1],..." etc. where n is the number of specified names..." self._names += ['f%d' % i for i in range(len(self._names), self._nfields)] # check for redundant names _dup = find_duplicate(self._names) if _dup: raise ValueError("Duplicate field names: %s" % _dup) if (titles): self._titles = [n.strip() for n in titles[:self._nfields]] else: self._titles = [] titles = [] if (self._nfields > len(titles)): self._titles += [None] * (self._nfields - len(titles)) def _createdescr(self, byteorder): descr = sb.dtype({'names':self._names, 'formats':self._f_formats, 'offsets':self._offsets, 'titles':self._titles}) if (byteorder is not None): byteorder = _byteorderconv[byteorder[0]] descr = descr.newbyteorder(byteorder) self._descr = descr class record(nt.void): """A data-type scalar that allows field access as attribute lookup. """ # manually set name and module so that this class's type shows up # as numpy.record when printed __name__ = 'record' __module__ = 'numpy' def __repr__(self): if get_printoptions()['legacy'] == '1.13': return self.__str__() return super(record, self).__repr__() def __str__(self): if get_printoptions()['legacy'] == '1.13': return str(self.item()) return super(record, self).__str__() def __getattribute__(self, attr): if attr in ['setfield', 'getfield', 'dtype']: return nt.void.__getattribute__(self, attr) try: return nt.void.__getattribute__(self, attr) except AttributeError: pass fielddict = nt.void.__getattribute__(self, 'dtype').fields res = fielddict.get(attr, None) if res: obj = self.getfield(*res[:2]) # if it has fields return a record, # otherwise return the object try: dt = obj.dtype except AttributeError: #happens if field is Object type return obj if dt.fields: return obj.view((self.__class__, obj.dtype.fields)) return obj else: raise AttributeError("'record' object has no " "attribute '%s'" % attr) def __setattr__(self, attr, val): if attr in ['setfield', 'getfield', 'dtype']: raise AttributeError("Cannot set '%s' attribute" % attr) fielddict = nt.void.__getattribute__(self, 'dtype').fields res = fielddict.get(attr, None) if res: return self.setfield(val, *res[:2]) else: if getattr(self, attr, None): return nt.void.__setattr__(self, attr, val) else: raise AttributeError("'record' object has no " "attribute '%s'" % attr) def __getitem__(self, indx): obj = nt.void.__getitem__(self, indx) # copy behavior of record.__getattribute__, if isinstance(obj, nt.void) and obj.dtype.fields: return obj.view((self.__class__, obj.dtype.fields)) else: # return a single element return obj def pprint(self): """Pretty-print all fields.""" # pretty-print all fields names = self.dtype.names maxlen = max(len(name) for name in names) rows = [] fmt = '%% %ds: %%s' % maxlen for name in names: rows.append(fmt % (name, getattr(self, name))) return "\n".join(rows) # The recarray is almost identical to a standard array (which supports # named fields already) The biggest difference is that it can use # attribute-lookup to find the fields and it is constructed using # a record. # If byteorder is given it forces a particular byteorder on all # the fields (and any subfields) class recarray(ndarray): """Construct an ndarray that allows field access using attributes. Arrays may have a data-types containing fields, analogous to columns in a spread sheet. An example is ``[(x, int), (y, float)]``, where each entry in the array is a pair of ``(int, float)``. Normally, these attributes are accessed using dictionary lookups such as ``arr['x']`` and ``arr['y']``. Record arrays allow the fields to be accessed as members of the array, using ``arr.x`` and ``arr.y``. Parameters ---------- shape : tuple Shape of output array. dtype : data-type, optional The desired data-type. By default, the data-type is determined from `formats`, `names`, `titles`, `aligned` and `byteorder`. formats : list of data-types, optional A list containing the data-types for the different columns, e.g. ``['i4', 'f8', 'i4']``. `formats` does *not* support the new convention of using types directly, i.e. ``(int, float, int)``. Note that `formats` must be a list, not a tuple. Given that `formats` is somewhat limited, we recommend specifying `dtype` instead. names : tuple of str, optional The name of each column, e.g. ``('x', 'y', 'z')``. buf : buffer, optional By default, a new array is created of the given shape and data-type. If `buf` is specified and is an object exposing the buffer interface, the array will use the memory from the existing buffer. In this case, the `offset` and `strides` keywords are available. Other Parameters ---------------- titles : tuple of str, optional Aliases for column names. For example, if `names` were ``('x', 'y', 'z')`` and `titles` is ``('x_coordinate', 'y_coordinate', 'z_coordinate')``, then ``arr['x']`` is equivalent to both ``arr.x`` and ``arr.x_coordinate``. byteorder : {'<', '>', '='}, optional Byte-order for all fields. aligned : bool, optional Align the fields in memory as the C-compiler would. strides : tuple of ints, optional Buffer (`buf`) is interpreted according to these strides (strides define how many bytes each array element, row, column, etc. occupy in memory). offset : int, optional Start reading buffer (`buf`) from this offset onwards. order : {'C', 'F'}, optional Row-major (C-style) or column-major (Fortran-style) order. Returns ------- rec : recarray Empty array of the given shape and type. See Also -------- rec.fromrecords : Construct a record array from data. record : fundamental data-type for `recarray`. format_parser : determine a data-type from formats, names, titles. Notes ----- This constructor can be compared to ``empty``: it creates a new record array but does not fill it with data. To create a record array from data, use one of the following methods: 1. Create a standard ndarray and convert it to a record array, using ``arr.view(np.recarray)`` 2. Use the `buf` keyword. 3. Use `np.rec.fromrecords`. Examples -------- Create an array with two fields, ``x`` and ``y``: >>> x = np.array([(1.0, 2), (3.0, 4)], dtype=[('x', float), ('y', int)]) >>> x array([(1.0, 2), (3.0, 4)], dtype=[('x', '<f8'), ('y', '<i4')]) >>> x['x'] array([ 1., 3.]) View the array as a record array: >>> x = x.view(np.recarray) >>> x.x array([ 1., 3.]) >>> x.y array([2, 4]) Create a new, empty record array: >>> np.recarray((2,), ... dtype=[('x', int), ('y', float), ('z', int)]) #doctest: +SKIP rec.array([(-1073741821, 1.2249118382103472e-301, 24547520), (3471280, 1.2134086255804012e-316, 0)], dtype=[('x', '<i4'), ('y', '<f8'), ('z', '<i4')]) """ # manually set name and module so that this class's type shows # up as "numpy.recarray" when printed __name__ = 'recarray' __module__ = 'numpy' def __new__(subtype, shape, dtype=None, buf=None, offset=0, strides=None, formats=None, names=None, titles=None, byteorder=None, aligned=False, order='C'): if dtype is not None: descr = sb.dtype(dtype) else: descr = format_parser(formats, names, titles, aligned, byteorder)._descr if buf is None: self = ndarray.__new__(subtype, shape, (record, descr), order=order) else: self = ndarray.__new__(subtype, shape, (record, descr), buffer=buf, offset=offset, strides=strides, order=order) return self def __array_finalize__(self, obj): if self.dtype.type is not record and self.dtype.fields: # if self.dtype is not np.record, invoke __setattr__ which will # convert it to a record if it is a void dtype. self.dtype = self.dtype def __getattribute__(self, attr): # See if ndarray has this attr, and return it if so. (note that this # means a field with the same name as an ndarray attr cannot be # accessed by attribute). try: return object.__getattribute__(self, attr) except AttributeError: # attr must be a fieldname pass # look for a field with this name fielddict = ndarray.__getattribute__(self, 'dtype').fields try: res = fielddict[attr][:2] except (TypeError, KeyError): raise AttributeError("recarray has no attribute %s" % attr) obj = self.getfield(*res) # At this point obj will always be a recarray, since (see # PyArray_GetField) the type of obj is inherited. Next, if obj.dtype is # non-structured, convert it to an ndarray. Then if obj is structured # with void type convert it to the same dtype.type (eg to preserve # numpy.record type if present), since nested structured fields do not # inherit type. Don't do this for non-void structures though. if obj.dtype.fields: if issubclass(obj.dtype.type, nt.void): return obj.view(dtype=(self.dtype.type, obj.dtype)) return obj else: return obj.view(ndarray) # Save the dictionary. # If the attr is a field name and not in the saved dictionary # Undo any "setting" of the attribute and do a setfield # Thus, you can't create attributes on-the-fly that are field names. def __setattr__(self, attr, val): # Automatically convert (void) structured types to records # (but not non-void structures, subarrays, or non-structured voids) if attr == 'dtype' and issubclass(val.type, nt.void) and val.fields: val = sb.dtype((record, val)) newattr = attr not in self.__dict__ try: ret = object.__setattr__(self, attr, val) except Exception: fielddict = ndarray.__getattribute__(self, 'dtype').fields or {} if attr not in fielddict: exctype, value = sys.exc_info()[:2] raise exctype(value) else: fielddict = ndarray.__getattribute__(self, 'dtype').fields or {} if attr not in fielddict: return ret if newattr: # We just added this one or this setattr worked on an # internal attribute. try: object.__delattr__(self, attr) except Exception: return ret try: res = fielddict[attr][:2] except (TypeError, KeyError): raise AttributeError("record array has no attribute %s" % attr) return self.setfield(val, *res) def __getitem__(self, indx): obj = super(recarray, self).__getitem__(indx) # copy behavior of getattr, except that here # we might also be returning a single element if isinstance(obj, ndarray): if obj.dtype.fields: obj = obj.view(type(self)) if issubclass(obj.dtype.type, nt.void): return obj.view(dtype=(self.dtype.type, obj.dtype)) return obj else: return obj.view(type=ndarray) else: # return a single element return obj def __repr__(self): repr_dtype = self.dtype if (self.dtype.type is record or (not issubclass(self.dtype.type, nt.void))): # If this is a full record array (has numpy.record dtype), # or if it has a scalar (non-void) dtype with no records, # represent it using the rec.array function. Since rec.array # converts dtype to a numpy.record for us, convert back # to non-record before printing if repr_dtype.type is record: repr_dtype = sb.dtype((nt.void, repr_dtype)) prefix = "rec.array(" fmt = 'rec.array(%s,%sdtype=%s)' else: # otherwise represent it using np.array plus a view # This should only happen if the user is playing # strange games with dtypes. prefix = "array(" fmt = 'array(%s,%sdtype=%s).view(numpy.recarray)' # get data/shape string. logic taken from numeric.array_repr if self.size > 0 or self.shape == (0,): lst = sb.array2string( self, separator=', ', prefix=prefix, suffix=',') else: # show zero-length shape unless it is (0,) lst = "[], shape=%s" % (repr(self.shape),) lf = '\n'+' '*len(prefix) if get_printoptions()['legacy'] == '1.13': lf = ' ' + lf # trailing space return fmt % (lst, lf, repr_dtype) def field(self, attr, val=None): if isinstance(attr, int): names = ndarray.__getattribute__(self, 'dtype').names attr = names[attr] fielddict = ndarray.__getattribute__(self, 'dtype').fields res = fielddict[attr][:2] if val is None: obj = self.getfield(*res) if obj.dtype.fields: return obj return obj.view(ndarray) else: return self.setfield(val, *res) def fromarrays(arrayList, dtype=None, shape=None, formats=None, names=None, titles=None, aligned=False, byteorder=None): """ create a record array from a (flat) list of arrays >>> x1=np.array([1,2,3,4]) >>> x2=np.array(['a','dd','xyz','12']) >>> x3=np.array([1.1,2,3,4]) >>> r = np.core.records.fromarrays([x1,x2,x3],names='a,b,c') >>> print(r[1]) (2, 'dd', 2.0) >>> x1[1]=34 >>> r.a array([1, 2, 3, 4]) """ arrayList = [sb.asarray(x) for x in arrayList] if shape is None or shape == 0: shape = arrayList[0].shape if isinstance(shape, int): shape = (shape,) if formats is None and dtype is None: # go through each object in the list to see if it is an ndarray # and determine the formats. formats = [] for obj in arrayList: if not isinstance(obj, ndarray): raise ValueError("item in the array list must be an ndarray.") formats.append(obj.dtype.str) formats = ','.join(formats) if dtype is not None: descr = sb.dtype(dtype) _names = descr.names else: parsed = format_parser(formats, names, titles, aligned, byteorder) _names = parsed._names descr = parsed._descr # Determine shape from data-type. if len(descr) != len(arrayList): raise ValueError("mismatch between the number of fields " "and the number of arrays") d0 = descr[0].shape nn = len(d0) if nn > 0: shape = shape[:-nn] for k, obj in enumerate(arrayList): nn = descr[k].ndim testshape = obj.shape[:obj.ndim - nn] if testshape != shape: raise ValueError("array-shape mismatch in array %d" % k) _array = recarray(shape, descr) # populate the record array (makes a copy) for i in range(len(arrayList)): _array[_names[i]] = arrayList[i] return _array def fromrecords(recList, dtype=None, shape=None, formats=None, names=None, titles=None, aligned=False, byteorder=None): """ create a recarray from a list of records in text form The data in the same field can be heterogeneous, they will be promoted to the highest data type. This method is intended for creating smaller record arrays. If used to create large array without formats defined r=fromrecords([(2,3.,'abc')]*100000) it can be slow. If formats is None, then this will auto-detect formats. Use list of tuples rather than list of lists for faster processing. >>> r=np.core.records.fromrecords([(456,'dbe',1.2),(2,'de',1.3)], ... names='col1,col2,col3') >>> print(r[0]) (456, 'dbe', 1.2) >>> r.col1 array([456, 2]) >>> r.col2 array(['dbe', 'de'], dtype='|S3') >>> import pickle >>> print(pickle.loads(pickle.dumps(r))) [(456, 'dbe', 1.2) (2, 'de', 1.3)] """ if formats is None and dtype is None: # slower obj = sb.array(recList, dtype=object) arrlist = [sb.array(obj[..., i].tolist()) for i in range(obj.shape[-1])] return fromarrays(arrlist, formats=formats, shape=shape, names=names, titles=titles, aligned=aligned, byteorder=byteorder) if dtype is not None: descr = sb.dtype((record, dtype)) else: descr = format_parser(formats, names, titles, aligned, byteorder)._descr # deprecated back-compat block for numpy 1.14, to be removed in a later # release. This converts list-of-list input to list-of-tuples in some # cases, as done in numpy <= 1.13. In the future we will require tuples. if (isinstance(recList, list) and len(recList) > 0 and isinstance(recList[0], list) and len(recList[0]) > 0 and not isinstance(recList[0][0], (list, tuple))): try: memoryview(recList[0][0]) except: if (shape is None or shape == 0): shape = len(recList) if isinstance(shape, (int, long)): shape = (shape,) if len(shape) > 1: raise ValueError("Can only deal with 1-d array.") _array = recarray(shape, descr) for k in range(_array.size): _array[k] = tuple(recList[k]) # list of lists instead of list of tuples ? # 2018-02-07, 1.14.1 warnings.warn( "fromrecords expected a list of tuples, may have received a " "list of lists instead. In the future that will raise an error", FutureWarning, stacklevel=2) return _array else: pass retval = sb.array(recList, dtype=descr) if shape is not None and retval.shape != shape: retval.shape = shape return retval.view(recarray) def fromstring(datastring, dtype=None, shape=None, offset=0, formats=None, names=None, titles=None, aligned=False, byteorder=None): """ create a (read-only) record array from binary data contained in a string""" if dtype is None and formats is None: raise ValueError("Must have dtype= or formats=") if dtype is not None: descr = sb.dtype(dtype) else: descr = format_parser(formats, names, titles, aligned, byteorder)._descr itemsize = descr.itemsize if (shape is None or shape == 0 or shape == -1): shape = (len(datastring) - offset) // itemsize _array = recarray(shape, descr, buf=datastring, offset=offset) return _array def get_remaining_size(fd): try: fn = fd.fileno() except AttributeError: return os.path.getsize(fd.name) - fd.tell() st = os.fstat(fn) size = st.st_size - fd.tell() return size def fromfile(fd, dtype=None, shape=None, offset=0, formats=None, names=None, titles=None, aligned=False, byteorder=None): """Create an array from binary file data If file is a string then that file is opened, else it is assumed to be a file object. The file object must support random access (i.e. it must have tell and seek methods). >>> from tempfile import TemporaryFile >>> a = np.empty(10,dtype='f8,i4,a5') >>> a[5] = (0.5,10,'abcde') >>> >>> fd=TemporaryFile() >>> a = a.newbyteorder('<') >>> a.tofile(fd) >>> >>> fd.seek(0) >>> r=np.core.records.fromfile(fd, formats='f8,i4,a5', shape=10, ... byteorder='<') >>> print(r[5]) (0.5, 10, 'abcde') >>> r.shape (10,) """ if (shape is None or shape == 0): shape = (-1,) elif isinstance(shape, (int, long)): shape = (shape,) name = 0 if isinstance(fd, str): name = 1 fd = open(fd, 'rb') if (offset > 0): fd.seek(offset, 1) size = get_remaining_size(fd) if dtype is not None: descr = sb.dtype(dtype) else: descr = format_parser(formats, names, titles, aligned, byteorder)._descr itemsize = descr.itemsize shapeprod = sb.array(shape).prod() shapesize = shapeprod * itemsize if shapesize < 0: shape = list(shape) shape[shape.index(-1)] = size / -shapesize shape = tuple(shape) shapeprod = sb.array(shape).prod() nbytes = shapeprod * itemsize if nbytes > size: raise ValueError( "Not enough bytes left in file for specified shape and type") # create the array _array = recarray(shape, descr) nbytesread = fd.readinto(_array.data) if nbytesread != nbytes: raise IOError("Didn't read as many bytes as expected") if name: fd.close() return _array def array(obj, dtype=None, shape=None, offset=0, strides=None, formats=None, names=None, titles=None, aligned=False, byteorder=None, copy=True): """Construct a record array from a wide-variety of objects. """ if ((isinstance(obj, (type(None), str)) or isfileobj(obj)) and (formats is None) and (dtype is None)): raise ValueError("Must define formats (or dtype) if object is " "None, string, or an open file") kwds = {} if dtype is not None: dtype = sb.dtype(dtype) elif formats is not None: dtype = format_parser(formats, names, titles, aligned, byteorder)._descr else: kwds = {'formats': formats, 'names': names, 'titles': titles, 'aligned': aligned, 'byteorder': byteorder } if obj is None: if shape is None: raise ValueError("Must define a shape if obj is None") return recarray(shape, dtype, buf=obj, offset=offset, strides=strides) elif isinstance(obj, bytes): return fromstring(obj, dtype, shape=shape, offset=offset, **kwds) elif isinstance(obj, (list, tuple)): if isinstance(obj[0], (tuple, list)): return fromrecords(obj, dtype=dtype, shape=shape, **kwds) else: return fromarrays(obj, dtype=dtype, shape=shape, **kwds) elif isinstance(obj, recarray): if dtype is not None and (obj.dtype != dtype): new = obj.view(dtype) else: new = obj if copy: new = new.copy() return new elif isfileobj(obj): return fromfile(obj, dtype=dtype, shape=shape, offset=offset) elif isinstance(obj, ndarray): if dtype is not None and (obj.dtype != dtype): new = obj.view(dtype) else: new = obj if copy: new = new.copy() return new.view(recarray) else: interface = getattr(obj, "__array_interface__", None) if interface is None or not isinstance(interface, dict): raise ValueError("Unknown input type") obj = sb.array(obj) if dtype is not None and (obj.dtype != dtype): obj = obj.view(dtype) return obj.view(recarray)
30,591
33.763636
84
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/shape_base.py
from __future__ import division, absolute_import, print_function __all__ = ['atleast_1d', 'atleast_2d', 'atleast_3d', 'block', 'hstack', 'stack', 'vstack'] from . import numeric as _nx from .numeric import array, asanyarray, newaxis from .multiarray import normalize_axis_index def atleast_1d(*arys): """ Convert inputs to arrays with at least one dimension. Scalar inputs are converted to 1-dimensional arrays, whilst higher-dimensional inputs are preserved. Parameters ---------- arys1, arys2, ... : array_like One or more input arrays. Returns ------- ret : ndarray An array, or list of arrays, each with ``a.ndim >= 1``. Copies are made only if necessary. See Also -------- atleast_2d, atleast_3d Examples -------- >>> np.atleast_1d(1.0) array([ 1.]) >>> x = np.arange(9.0).reshape(3,3) >>> np.atleast_1d(x) array([[ 0., 1., 2.], [ 3., 4., 5.], [ 6., 7., 8.]]) >>> np.atleast_1d(x) is x True >>> np.atleast_1d(1, [3, 4]) [array([1]), array([3, 4])] """ res = [] for ary in arys: ary = asanyarray(ary) if ary.ndim == 0: result = ary.reshape(1) else: result = ary res.append(result) if len(res) == 1: return res[0] else: return res def atleast_2d(*arys): """ View inputs as arrays with at least two dimensions. Parameters ---------- arys1, arys2, ... : array_like One or more array-like sequences. Non-array inputs are converted to arrays. Arrays that already have two or more dimensions are preserved. Returns ------- res, res2, ... : ndarray An array, or list of arrays, each with ``a.ndim >= 2``. Copies are avoided where possible, and views with two or more dimensions are returned. See Also -------- atleast_1d, atleast_3d Examples -------- >>> np.atleast_2d(3.0) array([[ 3.]]) >>> x = np.arange(3.0) >>> np.atleast_2d(x) array([[ 0., 1., 2.]]) >>> np.atleast_2d(x).base is x True >>> np.atleast_2d(1, [1, 2], [[1, 2]]) [array([[1]]), array([[1, 2]]), array([[1, 2]])] """ res = [] for ary in arys: ary = asanyarray(ary) if ary.ndim == 0: result = ary.reshape(1, 1) elif ary.ndim == 1: result = ary[newaxis,:] else: result = ary res.append(result) if len(res) == 1: return res[0] else: return res def atleast_3d(*arys): """ View inputs as arrays with at least three dimensions. Parameters ---------- arys1, arys2, ... : array_like One or more array-like sequences. Non-array inputs are converted to arrays. Arrays that already have three or more dimensions are preserved. Returns ------- res1, res2, ... : ndarray An array, or list of arrays, each with ``a.ndim >= 3``. Copies are avoided where possible, and views with three or more dimensions are returned. For example, a 1-D array of shape ``(N,)`` becomes a view of shape ``(1, N, 1)``, and a 2-D array of shape ``(M, N)`` becomes a view of shape ``(M, N, 1)``. See Also -------- atleast_1d, atleast_2d Examples -------- >>> np.atleast_3d(3.0) array([[[ 3.]]]) >>> x = np.arange(3.0) >>> np.atleast_3d(x).shape (1, 3, 1) >>> x = np.arange(12.0).reshape(4,3) >>> np.atleast_3d(x).shape (4, 3, 1) >>> np.atleast_3d(x).base is x.base # x is a reshape, so not base itself True >>> for arr in np.atleast_3d([1, 2], [[1, 2]], [[[1, 2]]]): ... print(arr, arr.shape) ... [[[1] [2]]] (1, 2, 1) [[[1] [2]]] (1, 2, 1) [[[1 2]]] (1, 1, 2) """ res = [] for ary in arys: ary = asanyarray(ary) if ary.ndim == 0: result = ary.reshape(1, 1, 1) elif ary.ndim == 1: result = ary[newaxis,:, newaxis] elif ary.ndim == 2: result = ary[:,:, newaxis] else: result = ary res.append(result) if len(res) == 1: return res[0] else: return res def vstack(tup): """ Stack arrays in sequence vertically (row wise). This is equivalent to concatenation along the first axis after 1-D arrays of shape `(N,)` have been reshaped to `(1,N)`. Rebuilds arrays divided by `vsplit`. This function makes most sense for arrays with up to 3 dimensions. For instance, for pixel-data with a height (first axis), width (second axis), and r/g/b channels (third axis). The functions `concatenate`, `stack` and `block` provide more general stacking and concatenation operations. Parameters ---------- tup : sequence of ndarrays The arrays must have the same shape along all but the first axis. 1-D arrays must have the same length. Returns ------- stacked : ndarray The array formed by stacking the given arrays, will be at least 2-D. See Also -------- stack : Join a sequence of arrays along a new axis. hstack : Stack arrays in sequence horizontally (column wise). dstack : Stack arrays in sequence depth wise (along third dimension). concatenate : Join a sequence of arrays along an existing axis. vsplit : Split array into a list of multiple sub-arrays vertically. block : Assemble arrays from blocks. Examples -------- >>> a = np.array([1, 2, 3]) >>> b = np.array([2, 3, 4]) >>> np.vstack((a,b)) array([[1, 2, 3], [2, 3, 4]]) >>> a = np.array([[1], [2], [3]]) >>> b = np.array([[2], [3], [4]]) >>> np.vstack((a,b)) array([[1], [2], [3], [2], [3], [4]]) """ return _nx.concatenate([atleast_2d(_m) for _m in tup], 0) def hstack(tup): """ Stack arrays in sequence horizontally (column wise). This is equivalent to concatenation along the second axis, except for 1-D arrays where it concatenates along the first axis. Rebuilds arrays divided by `hsplit`. This function makes most sense for arrays with up to 3 dimensions. For instance, for pixel-data with a height (first axis), width (second axis), and r/g/b channels (third axis). The functions `concatenate`, `stack` and `block` provide more general stacking and concatenation operations. Parameters ---------- tup : sequence of ndarrays The arrays must have the same shape along all but the second axis, except 1-D arrays which can be any length. Returns ------- stacked : ndarray The array formed by stacking the given arrays. See Also -------- stack : Join a sequence of arrays along a new axis. vstack : Stack arrays in sequence vertically (row wise). dstack : Stack arrays in sequence depth wise (along third axis). concatenate : Join a sequence of arrays along an existing axis. hsplit : Split array along second axis. block : Assemble arrays from blocks. Examples -------- >>> a = np.array((1,2,3)) >>> b = np.array((2,3,4)) >>> np.hstack((a,b)) array([1, 2, 3, 2, 3, 4]) >>> a = np.array([[1],[2],[3]]) >>> b = np.array([[2],[3],[4]]) >>> np.hstack((a,b)) array([[1, 2], [2, 3], [3, 4]]) """ arrs = [atleast_1d(_m) for _m in tup] # As a special case, dimension 0 of 1-dimensional arrays is "horizontal" if arrs and arrs[0].ndim == 1: return _nx.concatenate(arrs, 0) else: return _nx.concatenate(arrs, 1) def stack(arrays, axis=0, out=None): """ Join a sequence of arrays along a new axis. The `axis` parameter specifies the index of the new axis in the dimensions of the result. For example, if ``axis=0`` it will be the first dimension and if ``axis=-1`` it will be the last dimension. .. versionadded:: 1.10.0 Parameters ---------- arrays : sequence of array_like Each array must have the same shape. axis : int, optional The axis in the result array along which the input arrays are stacked. out : ndarray, optional If provided, the destination to place the result. The shape must be correct, matching that of what stack would have returned if no out argument were specified. Returns ------- stacked : ndarray The stacked array has one more dimension than the input arrays. See Also -------- concatenate : Join a sequence of arrays along an existing axis. split : Split array into a list of multiple sub-arrays of equal size. block : Assemble arrays from blocks. Examples -------- >>> arrays = [np.random.randn(3, 4) for _ in range(10)] >>> np.stack(arrays, axis=0).shape (10, 3, 4) >>> np.stack(arrays, axis=1).shape (3, 10, 4) >>> np.stack(arrays, axis=2).shape (3, 4, 10) >>> a = np.array([1, 2, 3]) >>> b = np.array([2, 3, 4]) >>> np.stack((a, b)) array([[1, 2, 3], [2, 3, 4]]) >>> np.stack((a, b), axis=-1) array([[1, 2], [2, 3], [3, 4]]) """ arrays = [asanyarray(arr) for arr in arrays] if not arrays: raise ValueError('need at least one array to stack') shapes = set(arr.shape for arr in arrays) if len(shapes) != 1: raise ValueError('all input arrays must have the same shape') result_ndim = arrays[0].ndim + 1 axis = normalize_axis_index(axis, result_ndim) sl = (slice(None),) * axis + (_nx.newaxis,) expanded_arrays = [arr[sl] for arr in arrays] return _nx.concatenate(expanded_arrays, axis=axis, out=out) def _block_check_depths_match(arrays, parent_index=[]): """ Recursive function checking that the depths of nested lists in `arrays` all match. Mismatch raises a ValueError as described in the block docstring below. The entire index (rather than just the depth) needs to be calculated for each innermost list, in case an error needs to be raised, so that the index of the offending list can be printed as part of the error. The parameter `parent_index` is the full index of `arrays` within the nested lists passed to _block_check_depths_match at the top of the recursion. The return value is a pair. The first item returned is the full index of an element (specifically the first element) from the bottom of the nesting in `arrays`. An empty list at the bottom of the nesting is represented by a `None` index. The second item is the maximum of the ndims of the arrays nested in `arrays`. """ def format_index(index): idx_str = ''.join('[{}]'.format(i) for i in index if i is not None) return 'arrays' + idx_str if type(arrays) is tuple: # not strictly necessary, but saves us from: # - more than one way to do things - no point treating tuples like # lists # - horribly confusing behaviour that results when tuples are # treated like ndarray raise TypeError( '{} is a tuple. ' 'Only lists can be used to arrange blocks, and np.block does ' 'not allow implicit conversion from tuple to ndarray.'.format( format_index(parent_index) ) ) elif type(arrays) is list and len(arrays) > 0: idxs_ndims = (_block_check_depths_match(arr, parent_index + [i]) for i, arr in enumerate(arrays)) first_index, max_arr_ndim = next(idxs_ndims) for index, ndim in idxs_ndims: if ndim > max_arr_ndim: max_arr_ndim = ndim if len(index) != len(first_index): raise ValueError( "List depths are mismatched. First element was at depth " "{}, but there is an element at depth {} ({})".format( len(first_index), len(index), format_index(index) ) ) return first_index, max_arr_ndim elif type(arrays) is list and len(arrays) == 0: # We've 'bottomed out' on an empty list return parent_index + [None], 0 else: # We've 'bottomed out' - arrays is either a scalar or an array return parent_index, _nx.ndim(arrays) def _block(arrays, max_depth, result_ndim): """ Internal implementation of block. `arrays` is the argument passed to block. `max_depth` is the depth of nested lists within `arrays` and `result_ndim` is the greatest of the dimensions of the arrays in `arrays` and the depth of the lists in `arrays` (see block docstring for details). """ def atleast_nd(a, ndim): # Ensures `a` has at least `ndim` dimensions by prepending # ones to `a.shape` as necessary return array(a, ndmin=ndim, copy=False, subok=True) def block_recursion(arrays, depth=0): if depth < max_depth: if len(arrays) == 0: raise ValueError('Lists cannot be empty') arrs = [block_recursion(arr, depth+1) for arr in arrays] return _nx.concatenate(arrs, axis=-(max_depth-depth)) else: # We've 'bottomed out' - arrays is either a scalar or an array # type(arrays) is not list return atleast_nd(arrays, result_ndim) try: return block_recursion(arrays) finally: # recursive closures have a cyclic reference to themselves, which # requires gc to collect (gh-10620). To avoid this problem, for # performance and PyPy friendliness, we break the cycle: block_recursion = None def block(arrays): """ Assemble an nd-array from nested lists of blocks. Blocks in the innermost lists are concatenated (see `concatenate`) along the last dimension (-1), then these are concatenated along the second-last dimension (-2), and so on until the outermost list is reached. Blocks can be of any dimension, but will not be broadcasted using the normal rules. Instead, leading axes of size 1 are inserted, to make ``block.ndim`` the same for all blocks. This is primarily useful for working with scalars, and means that code like ``np.block([v, 1])`` is valid, where ``v.ndim == 1``. When the nested list is two levels deep, this allows block matrices to be constructed from their components. .. versionadded:: 1.13.0 Parameters ---------- arrays : nested list of array_like or scalars (but not tuples) If passed a single ndarray or scalar (a nested list of depth 0), this is returned unmodified (and not copied). Elements shapes must match along the appropriate axes (without broadcasting), but leading 1s will be prepended to the shape as necessary to make the dimensions match. Returns ------- block_array : ndarray The array assembled from the given blocks. The dimensionality of the output is equal to the greatest of: * the dimensionality of all the inputs * the depth to which the input list is nested Raises ------ ValueError * If list depths are mismatched - for instance, ``[[a, b], c]`` is illegal, and should be spelt ``[[a, b], [c]]`` * If lists are empty - for instance, ``[[a, b], []]`` See Also -------- concatenate : Join a sequence of arrays together. stack : Stack arrays in sequence along a new dimension. hstack : Stack arrays in sequence horizontally (column wise). vstack : Stack arrays in sequence vertically (row wise). dstack : Stack arrays in sequence depth wise (along third dimension). vsplit : Split array into a list of multiple sub-arrays vertically. Notes ----- When called with only scalars, ``np.block`` is equivalent to an ndarray call. So ``np.block([[1, 2], [3, 4]])`` is equivalent to ``np.array([[1, 2], [3, 4]])``. This function does not enforce that the blocks lie on a fixed grid. ``np.block([[a, b], [c, d]])`` is not restricted to arrays of the form:: AAAbb AAAbb cccDD But is also allowed to produce, for some ``a, b, c, d``:: AAAbb AAAbb cDDDD Since concatenation happens along the last axis first, `block` is _not_ capable of producing the following directly:: AAAbb cccbb cccDD Matlab's "square bracket stacking", ``[A, B, ...; p, q, ...]``, is equivalent to ``np.block([[A, B, ...], [p, q, ...]])``. Examples -------- The most common use of this function is to build a block matrix >>> A = np.eye(2) * 2 >>> B = np.eye(3) * 3 >>> np.block([ ... [A, np.zeros((2, 3))], ... [np.ones((3, 2)), B ] ... ]) array([[ 2., 0., 0., 0., 0.], [ 0., 2., 0., 0., 0.], [ 1., 1., 3., 0., 0.], [ 1., 1., 0., 3., 0.], [ 1., 1., 0., 0., 3.]]) With a list of depth 1, `block` can be used as `hstack` >>> np.block([1, 2, 3]) # hstack([1, 2, 3]) array([1, 2, 3]) >>> a = np.array([1, 2, 3]) >>> b = np.array([2, 3, 4]) >>> np.block([a, b, 10]) # hstack([a, b, 10]) array([1, 2, 3, 2, 3, 4, 10]) >>> A = np.ones((2, 2), int) >>> B = 2 * A >>> np.block([A, B]) # hstack([A, B]) array([[1, 1, 2, 2], [1, 1, 2, 2]]) With a list of depth 2, `block` can be used in place of `vstack`: >>> a = np.array([1, 2, 3]) >>> b = np.array([2, 3, 4]) >>> np.block([[a], [b]]) # vstack([a, b]) array([[1, 2, 3], [2, 3, 4]]) >>> A = np.ones((2, 2), int) >>> B = 2 * A >>> np.block([[A], [B]]) # vstack([A, B]) array([[1, 1], [1, 1], [2, 2], [2, 2]]) It can also be used in places of `atleast_1d` and `atleast_2d` >>> a = np.array(0) >>> b = np.array([1]) >>> np.block([a]) # atleast_1d(a) array([0]) >>> np.block([b]) # atleast_1d(b) array([1]) >>> np.block([[a]]) # atleast_2d(a) array([[0]]) >>> np.block([[b]]) # atleast_2d(b) array([[1]]) """ bottom_index, arr_ndim = _block_check_depths_match(arrays) list_ndim = len(bottom_index) return _block(arrays, list_ndim, max(arr_ndim, list_ndim))
18,816
29.898194
80
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/_internal.py
""" A place for code to be called from core C-code. Some things are more easily handled Python. """ from __future__ import division, absolute_import, print_function import re import sys from numpy.compat import basestring from .multiarray import dtype, array, ndarray try: import ctypes except ImportError: ctypes = None from .numerictypes import object_ if (sys.byteorder == 'little'): _nbo = b'<' else: _nbo = b'>' def _makenames_list(adict, align): allfields = [] fnames = list(adict.keys()) for fname in fnames: obj = adict[fname] n = len(obj) if not isinstance(obj, tuple) or n not in [2, 3]: raise ValueError("entry not a 2- or 3- tuple") if (n > 2) and (obj[2] == fname): continue num = int(obj[1]) if (num < 0): raise ValueError("invalid offset.") format = dtype(obj[0], align=align) if (n > 2): title = obj[2] else: title = None allfields.append((fname, format, num, title)) # sort by offsets allfields.sort(key=lambda x: x[2]) names = [x[0] for x in allfields] formats = [x[1] for x in allfields] offsets = [x[2] for x in allfields] titles = [x[3] for x in allfields] return names, formats, offsets, titles # Called in PyArray_DescrConverter function when # a dictionary without "names" and "formats" # fields is used as a data-type descriptor. def _usefields(adict, align): try: names = adict[-1] except KeyError: names = None if names is None: names, formats, offsets, titles = _makenames_list(adict, align) else: formats = [] offsets = [] titles = [] for name in names: res = adict[name] formats.append(res[0]) offsets.append(res[1]) if (len(res) > 2): titles.append(res[2]) else: titles.append(None) return dtype({"names": names, "formats": formats, "offsets": offsets, "titles": titles}, align) # construct an array_protocol descriptor list # from the fields attribute of a descriptor # This calls itself recursively but should eventually hit # a descriptor that has no fields and then return # a simple typestring def _array_descr(descriptor): fields = descriptor.fields if fields is None: subdtype = descriptor.subdtype if subdtype is None: if descriptor.metadata is None: return descriptor.str else: new = descriptor.metadata.copy() if new: return (descriptor.str, new) else: return descriptor.str else: return (_array_descr(subdtype[0]), subdtype[1]) names = descriptor.names ordered_fields = [fields[x] + (x,) for x in names] result = [] offset = 0 for field in ordered_fields: if field[1] > offset: num = field[1] - offset result.append(('', '|V%d' % num)) offset += num elif field[1] < offset: raise ValueError( "dtype.descr is not defined for types with overlapping or " "out-of-order fields") if len(field) > 3: name = (field[2], field[3]) else: name = field[2] if field[0].subdtype: tup = (name, _array_descr(field[0].subdtype[0]), field[0].subdtype[1]) else: tup = (name, _array_descr(field[0])) offset += field[0].itemsize result.append(tup) if descriptor.itemsize > offset: num = descriptor.itemsize - offset result.append(('', '|V%d' % num)) return result # Build a new array from the information in a pickle. # Note that the name numpy.core._internal._reconstruct is embedded in # pickles of ndarrays made with NumPy before release 1.0 # so don't remove the name here, or you'll # break backward compatibility. def _reconstruct(subtype, shape, dtype): return ndarray.__new__(subtype, shape, dtype) # format_re was originally from numarray by J. Todd Miller format_re = re.compile(br'(?P<order1>[<>|=]?)' br'(?P<repeats> *[(]?[ ,0-9L]*[)]? *)' br'(?P<order2>[<>|=]?)' br'(?P<dtype>[A-Za-z0-9.?]*(?:\[[a-zA-Z0-9,.]+\])?)') sep_re = re.compile(br'\s*,\s*') space_re = re.compile(br'\s+$') # astr is a string (perhaps comma separated) _convorder = {b'=': _nbo} def _commastring(astr): startindex = 0 result = [] while startindex < len(astr): mo = format_re.match(astr, pos=startindex) try: (order1, repeats, order2, dtype) = mo.groups() except (TypeError, AttributeError): raise ValueError('format number %d of "%s" is not recognized' % (len(result)+1, astr)) startindex = mo.end() # Separator or ending padding if startindex < len(astr): if space_re.match(astr, pos=startindex): startindex = len(astr) else: mo = sep_re.match(astr, pos=startindex) if not mo: raise ValueError( 'format number %d of "%s" is not recognized' % (len(result)+1, astr)) startindex = mo.end() if order2 == b'': order = order1 elif order1 == b'': order = order2 else: order1 = _convorder.get(order1, order1) order2 = _convorder.get(order2, order2) if (order1 != order2): raise ValueError( 'inconsistent byte-order specification %s and %s' % (order1, order2)) order = order1 if order in [b'|', b'=', _nbo]: order = b'' dtype = order + dtype if (repeats == b''): newitem = dtype else: newitem = (dtype, eval(repeats)) result.append(newitem) return result class dummy_ctype(object): def __init__(self, cls): self._cls = cls def __mul__(self, other): return self def __call__(self, *other): return self._cls(other) def __eq__(self, other): return self._cls == other._cls def __ne__(self, other): return self._cls != other._cls def _getintp_ctype(): val = _getintp_ctype.cache if val is not None: return val if ctypes is None: import numpy as np val = dummy_ctype(np.intp) else: char = dtype('p').char if (char == 'i'): val = ctypes.c_int elif char == 'l': val = ctypes.c_long elif char == 'q': val = ctypes.c_longlong else: val = ctypes.c_long _getintp_ctype.cache = val return val _getintp_ctype.cache = None # Used for .ctypes attribute of ndarray class _missing_ctypes(object): def cast(self, num, obj): return num def c_void_p(self, num): return num class _ctypes(object): def __init__(self, array, ptr=None): if ctypes: self._ctypes = ctypes else: self._ctypes = _missing_ctypes() self._arr = array self._data = ptr if self._arr.ndim == 0: self._zerod = True else: self._zerod = False def data_as(self, obj): return self._ctypes.cast(self._data, obj) def shape_as(self, obj): if self._zerod: return None return (obj*self._arr.ndim)(*self._arr.shape) def strides_as(self, obj): if self._zerod: return None return (obj*self._arr.ndim)(*self._arr.strides) def get_data(self): return self._data def get_shape(self): return self.shape_as(_getintp_ctype()) def get_strides(self): return self.strides_as(_getintp_ctype()) def get_as_parameter(self): return self._ctypes.c_void_p(self._data) data = property(get_data, None, doc="c-types data") shape = property(get_shape, None, doc="c-types shape") strides = property(get_strides, None, doc="c-types strides") _as_parameter_ = property(get_as_parameter, None, doc="_as parameter_") def _newnames(datatype, order): """ Given a datatype and an order object, return a new names tuple, with the order indicated """ oldnames = datatype.names nameslist = list(oldnames) if isinstance(order, str): order = [order] seen = set() if isinstance(order, (list, tuple)): for name in order: try: nameslist.remove(name) except ValueError: if name in seen: raise ValueError("duplicate field name: %s" % (name,)) else: raise ValueError("unknown field name: %s" % (name,)) seen.add(name) return tuple(list(order) + nameslist) raise ValueError("unsupported order value: %s" % (order,)) def _copy_fields(ary): """Return copy of structured array with padding between fields removed. Parameters ---------- ary : ndarray Structured array from which to remove padding bytes Returns ------- ary_copy : ndarray Copy of ary with padding bytes removed """ dt = ary.dtype copy_dtype = {'names': dt.names, 'formats': [dt.fields[name][0] for name in dt.names]} return array(ary, dtype=copy_dtype, copy=True) def _getfield_is_safe(oldtype, newtype, offset): """ Checks safety of getfield for object arrays. As in _view_is_safe, we need to check that memory containing objects is not reinterpreted as a non-object datatype and vice versa. Parameters ---------- oldtype : data-type Data type of the original ndarray. newtype : data-type Data type of the field being accessed by ndarray.getfield offset : int Offset of the field being accessed by ndarray.getfield Raises ------ TypeError If the field access is invalid """ if newtype.hasobject or oldtype.hasobject: if offset == 0 and newtype == oldtype: return if oldtype.names: for name in oldtype.names: if (oldtype.fields[name][1] == offset and oldtype.fields[name][0] == newtype): return raise TypeError("Cannot get/set field of an object array") return def _view_is_safe(oldtype, newtype): """ Checks safety of a view involving object arrays, for example when doing:: np.zeros(10, dtype=oldtype).view(newtype) Parameters ---------- oldtype : data-type Data type of original ndarray newtype : data-type Data type of the view Raises ------ TypeError If the new type is incompatible with the old type. """ # if the types are equivalent, there is no problem. # for example: dtype((np.record, 'i4,i4')) == dtype((np.void, 'i4,i4')) if oldtype == newtype: return if newtype.hasobject or oldtype.hasobject: raise TypeError("Cannot change data-type for object array.") return # Given a string containing a PEP 3118 format specifier, # construct a NumPy dtype _pep3118_native_map = { '?': '?', 'c': 'S1', 'b': 'b', 'B': 'B', 'h': 'h', 'H': 'H', 'i': 'i', 'I': 'I', 'l': 'l', 'L': 'L', 'q': 'q', 'Q': 'Q', 'e': 'e', 'f': 'f', 'd': 'd', 'g': 'g', 'Zf': 'F', 'Zd': 'D', 'Zg': 'G', 's': 'S', 'w': 'U', 'O': 'O', 'x': 'V', # padding } _pep3118_native_typechars = ''.join(_pep3118_native_map.keys()) _pep3118_standard_map = { '?': '?', 'c': 'S1', 'b': 'b', 'B': 'B', 'h': 'i2', 'H': 'u2', 'i': 'i4', 'I': 'u4', 'l': 'i4', 'L': 'u4', 'q': 'i8', 'Q': 'u8', 'e': 'f2', 'f': 'f', 'd': 'd', 'Zf': 'F', 'Zd': 'D', 's': 'S', 'w': 'U', 'O': 'O', 'x': 'V', # padding } _pep3118_standard_typechars = ''.join(_pep3118_standard_map.keys()) def _dtype_from_pep3118(spec): class Stream(object): def __init__(self, s): self.s = s self.byteorder = '@' def advance(self, n): res = self.s[:n] self.s = self.s[n:] return res def consume(self, c): if self.s[:len(c)] == c: self.advance(len(c)) return True return False def consume_until(self, c): if callable(c): i = 0 while i < len(self.s) and not c(self.s[i]): i = i + 1 return self.advance(i) else: i = self.s.index(c) res = self.advance(i) self.advance(len(c)) return res @property def next(self): return self.s[0] def __bool__(self): return bool(self.s) __nonzero__ = __bool__ stream = Stream(spec) dtype, align = __dtype_from_pep3118(stream, is_subdtype=False) return dtype def __dtype_from_pep3118(stream, is_subdtype): field_spec = dict( names=[], formats=[], offsets=[], itemsize=0 ) offset = 0 common_alignment = 1 is_padding = False # Parse spec while stream: value = None # End of structure, bail out to upper level if stream.consume('}'): break # Sub-arrays (1) shape = None if stream.consume('('): shape = stream.consume_until(')') shape = tuple(map(int, shape.split(','))) # Byte order if stream.next in ('@', '=', '<', '>', '^', '!'): byteorder = stream.advance(1) if byteorder == '!': byteorder = '>' stream.byteorder = byteorder # Byte order characters also control native vs. standard type sizes if stream.byteorder in ('@', '^'): type_map = _pep3118_native_map type_map_chars = _pep3118_native_typechars else: type_map = _pep3118_standard_map type_map_chars = _pep3118_standard_typechars # Item sizes itemsize_str = stream.consume_until(lambda c: not c.isdigit()) if itemsize_str: itemsize = int(itemsize_str) else: itemsize = 1 # Data types is_padding = False if stream.consume('T{'): value, align = __dtype_from_pep3118( stream, is_subdtype=True) elif stream.next in type_map_chars: if stream.next == 'Z': typechar = stream.advance(2) else: typechar = stream.advance(1) is_padding = (typechar == 'x') dtypechar = type_map[typechar] if dtypechar in 'USV': dtypechar += '%d' % itemsize itemsize = 1 numpy_byteorder = {'@': '=', '^': '='}.get( stream.byteorder, stream.byteorder) value = dtype(numpy_byteorder + dtypechar) align = value.alignment else: raise ValueError("Unknown PEP 3118 data type specifier %r" % stream.s) # # Native alignment may require padding # # Here we assume that the presence of a '@' character implicitly implies # that the start of the array is *already* aligned. # extra_offset = 0 if stream.byteorder == '@': start_padding = (-offset) % align intra_padding = (-value.itemsize) % align offset += start_padding if intra_padding != 0: if itemsize > 1 or (shape is not None and _prod(shape) > 1): # Inject internal padding to the end of the sub-item value = _add_trailing_padding(value, intra_padding) else: # We can postpone the injection of internal padding, # as the item appears at most once extra_offset += intra_padding # Update common alignment common_alignment = _lcm(align, common_alignment) # Convert itemsize to sub-array if itemsize != 1: value = dtype((value, (itemsize,))) # Sub-arrays (2) if shape is not None: value = dtype((value, shape)) # Field name if stream.consume(':'): name = stream.consume_until(':') else: name = None if not (is_padding and name is None): if name is not None and name in field_spec['names']: raise RuntimeError("Duplicate field name '%s' in PEP3118 format" % name) field_spec['names'].append(name) field_spec['formats'].append(value) field_spec['offsets'].append(offset) offset += value.itemsize offset += extra_offset field_spec['itemsize'] = offset # extra final padding for aligned types if stream.byteorder == '@': field_spec['itemsize'] += (-offset) % common_alignment # Check if this was a simple 1-item type, and unwrap it if (field_spec['names'] == [None] and field_spec['offsets'][0] == 0 and field_spec['itemsize'] == field_spec['formats'][0].itemsize and not is_subdtype): ret = field_spec['formats'][0] else: _fix_names(field_spec) ret = dtype(field_spec) # Finished return ret, common_alignment def _fix_names(field_spec): """ Replace names which are None with the next unused f%d name """ names = field_spec['names'] for i, name in enumerate(names): if name is not None: continue j = 0 while True: name = 'f{}'.format(j) if name not in names: break j = j + 1 names[i] = name def _add_trailing_padding(value, padding): """Inject the specified number of padding bytes at the end of a dtype""" if value.fields is None: field_spec = dict( names=['f0'], formats=[value], offsets=[0], itemsize=value.itemsize ) else: fields = value.fields names = value.names field_spec = dict( names=names, formats=[fields[name][0] for name in names], offsets=[fields[name][1] for name in names], itemsize=value.itemsize ) field_spec['itemsize'] += padding return dtype(field_spec) def _prod(a): p = 1 for x in a: p *= x return p def _gcd(a, b): """Calculate the greatest common divisor of a and b""" while b: a, b = b, a % b return a def _lcm(a, b): return a // _gcd(a, b) * b # Exception used in shares_memory() class TooHardError(RuntimeError): pass class AxisError(ValueError, IndexError): """ Axis supplied was invalid. """ def __init__(self, axis, ndim=None, msg_prefix=None): # single-argument form just delegates to base class if ndim is None and msg_prefix is None: msg = axis # do the string formatting here, to save work in the C code else: msg = ("axis {} is out of bounds for array of dimension {}" .format(axis, ndim)) if msg_prefix is not None: msg = "{}: {}".format(msg_prefix, msg) super(AxisError, self).__init__(msg) def array_ufunc_errmsg_formatter(dummy, ufunc, method, *inputs, **kwargs): """ Format the error message for when __array_ufunc__ gives up. """ args_string = ', '.join(['{!r}'.format(arg) for arg in inputs] + ['{}={!r}'.format(k, v) for k, v in kwargs.items()]) args = inputs + kwargs.get('out', ()) types_string = ', '.join(repr(type(arg).__name__) for arg in args) return ('operand type(s) all returned NotImplemented from ' '__array_ufunc__({!r}, {!r}, {}): {}' .format(ufunc, method, args_string, types_string)) def _ufunc_doc_signature_formatter(ufunc): """ Builds a signature string which resembles PEP 457 This is used to construct the first line of the docstring """ # input arguments are simple if ufunc.nin == 1: in_args = 'x' else: in_args = ', '.join('x{}'.format(i+1) for i in range(ufunc.nin)) # output arguments are both keyword or positional if ufunc.nout == 0: out_args = ', /, out=()' elif ufunc.nout == 1: out_args = ', /, out=None' else: out_args = '[, {positional}], / [, out={default}]'.format( positional=', '.join( 'out{}'.format(i+1) for i in range(ufunc.nout)), default=repr((None,)*ufunc.nout) ) # keyword only args depend on whether this is a gufunc kwargs = ( ", casting='same_kind'" ", order='K'" ", dtype=None" ", subok=True" "[, signature" ", extobj]" ) if ufunc.signature is None: kwargs = ", where=True" + kwargs # join all the parts together return '{name}({in_args}{out_args}, *{kwargs})'.format( name=ufunc.__name__, in_args=in_args, out_args=out_args, kwargs=kwargs )
21,816
27.744401
82
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/cversions.py
"""Simple script to compute the api hash of the current API. The API has is defined by numpy_api_order and ufunc_api_order. """ from __future__ import division, absolute_import, print_function from os.path import dirname from code_generators.genapi import fullapi_hash from code_generators.numpy_api import full_api if __name__ == '__main__': curdir = dirname(__file__) print(fullapi_hash(full_api))
413
24.875
64
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/setup.py
from __future__ import division, print_function import os import sys import pickle import copy import sysconfig import warnings import platform from os.path import join from numpy.distutils import log from distutils.dep_util import newer from distutils.sysconfig import get_config_var from numpy._build_utils.apple_accelerate import ( uses_accelerate_framework, get_sgemv_fix ) from numpy.compat import npy_load_module from setup_common import * # Set to True to enable relaxed strides checking. This (mostly) means # that `strides[dim]` is ignored if `shape[dim] == 1` when setting flags. NPY_RELAXED_STRIDES_CHECKING = (os.environ.get('NPY_RELAXED_STRIDES_CHECKING', "1") != "0") # Put NPY_RELAXED_STRIDES_DEBUG=1 in the environment if you want numpy to use a # bogus value for affected strides in order to help smoke out bad stride usage # when relaxed stride checking is enabled. NPY_RELAXED_STRIDES_DEBUG = (os.environ.get('NPY_RELAXED_STRIDES_DEBUG', "0") != "0") NPY_RELAXED_STRIDES_DEBUG = NPY_RELAXED_STRIDES_DEBUG and NPY_RELAXED_STRIDES_CHECKING # XXX: ugly, we use a class to avoid calling twice some expensive functions in # config.h/numpyconfig.h. I don't see a better way because distutils force # config.h generation inside an Extension class, and as such sharing # configuration informations between extensions is not easy. # Using a pickled-based memoize does not work because config_cmd is an instance # method, which cPickle does not like. # # Use pickle in all cases, as cPickle is gone in python3 and the difference # in time is only in build. -- Charles Harris, 2013-03-30 class CallOnceOnly(object): def __init__(self): self._check_types = None self._check_ieee_macros = None self._check_complex = None def check_types(self, *a, **kw): if self._check_types is None: out = check_types(*a, **kw) self._check_types = pickle.dumps(out) else: out = copy.deepcopy(pickle.loads(self._check_types)) return out def check_ieee_macros(self, *a, **kw): if self._check_ieee_macros is None: out = check_ieee_macros(*a, **kw) self._check_ieee_macros = pickle.dumps(out) else: out = copy.deepcopy(pickle.loads(self._check_ieee_macros)) return out def check_complex(self, *a, **kw): if self._check_complex is None: out = check_complex(*a, **kw) self._check_complex = pickle.dumps(out) else: out = copy.deepcopy(pickle.loads(self._check_complex)) return out def pythonlib_dir(): """return path where libpython* is.""" if sys.platform == 'win32': return os.path.join(sys.prefix, "libs") else: return get_config_var('LIBDIR') def is_npy_no_signal(): """Return True if the NPY_NO_SIGNAL symbol must be defined in configuration header.""" return sys.platform == 'win32' def is_npy_no_smp(): """Return True if the NPY_NO_SMP symbol must be defined in public header (when SMP support cannot be reliably enabled).""" # Perhaps a fancier check is in order here. # so that threads are only enabled if there # are actually multiple CPUS? -- but # threaded code can be nice even on a single # CPU so that long-calculating code doesn't # block. return 'NPY_NOSMP' in os.environ def win32_checks(deflist): from numpy.distutils.misc_util import get_build_architecture a = get_build_architecture() # Distutils hack on AMD64 on windows print('BUILD_ARCHITECTURE: %r, os.name=%r, sys.platform=%r' % (a, os.name, sys.platform)) if a == 'AMD64': deflist.append('DISTUTILS_USE_SDK') # On win32, force long double format string to be 'g', not # 'Lg', since the MS runtime does not support long double whose # size is > sizeof(double) if a == "Intel" or a == "AMD64": deflist.append('FORCE_NO_LONG_DOUBLE_FORMATTING') def check_math_capabilities(config, moredefs, mathlibs): def check_func(func_name): return config.check_func(func_name, libraries=mathlibs, decl=True, call=True) def check_funcs_once(funcs_name): decl = dict([(f, True) for f in funcs_name]) st = config.check_funcs_once(funcs_name, libraries=mathlibs, decl=decl, call=decl) if st: moredefs.extend([(fname2def(f), 1) for f in funcs_name]) return st def check_funcs(funcs_name): # Use check_funcs_once first, and if it does not work, test func per # func. Return success only if all the functions are available if not check_funcs_once(funcs_name): # Global check failed, check func per func for f in funcs_name: if check_func(f): moredefs.append((fname2def(f), 1)) return 0 else: return 1 #use_msvc = config.check_decl("_MSC_VER") if not check_funcs_once(MANDATORY_FUNCS): raise SystemError("One of the required function to build numpy is not" " available (the list is %s)." % str(MANDATORY_FUNCS)) # Standard functions which may not be available and for which we have a # replacement implementation. Note that some of these are C99 functions. # XXX: hack to circumvent cpp pollution from python: python put its # config.h in the public namespace, so we have a clash for the common # functions we test. We remove every function tested by python's # autoconf, hoping their own test are correct for f in OPTIONAL_STDFUNCS_MAYBE: if config.check_decl(fname2def(f), headers=["Python.h", "math.h"]): OPTIONAL_STDFUNCS.remove(f) check_funcs(OPTIONAL_STDFUNCS) for h in OPTIONAL_HEADERS: if config.check_func("", decl=False, call=False, headers=[h]): moredefs.append((fname2def(h).replace(".", "_"), 1)) for tup in OPTIONAL_INTRINSICS: headers = None if len(tup) == 2: f, args, m = tup[0], tup[1], fname2def(tup[0]) elif len(tup) == 3: f, args, headers, m = tup[0], tup[1], [tup[2]], fname2def(tup[0]) else: f, args, headers, m = tup[0], tup[1], [tup[2]], fname2def(tup[3]) if config.check_func(f, decl=False, call=True, call_args=args, headers=headers): moredefs.append((m, 1)) for dec, fn in OPTIONAL_FUNCTION_ATTRIBUTES: if config.check_gcc_function_attribute(dec, fn): moredefs.append((fname2def(fn), 1)) for fn in OPTIONAL_VARIABLE_ATTRIBUTES: if config.check_gcc_variable_attribute(fn): m = fn.replace("(", "_").replace(")", "_") moredefs.append((fname2def(m), 1)) # C99 functions: float and long double versions check_funcs(C99_FUNCS_SINGLE) check_funcs(C99_FUNCS_EXTENDED) def check_complex(config, mathlibs): priv = [] pub = [] try: if os.uname()[0] == "Interix": warnings.warn("Disabling broken complex support. See #1365", stacklevel=2) return priv, pub except Exception: # os.uname not available on all platforms. blanket except ugly but safe pass # Check for complex support st = config.check_header('complex.h') if st: priv.append(('HAVE_COMPLEX_H', 1)) pub.append(('NPY_USE_C99_COMPLEX', 1)) for t in C99_COMPLEX_TYPES: st = config.check_type(t, headers=["complex.h"]) if st: pub.append(('NPY_HAVE_%s' % type2def(t), 1)) def check_prec(prec): flist = [f + prec for f in C99_COMPLEX_FUNCS] decl = dict([(f, True) for f in flist]) if not config.check_funcs_once(flist, call=decl, decl=decl, libraries=mathlibs): for f in flist: if config.check_func(f, call=True, decl=True, libraries=mathlibs): priv.append((fname2def(f), 1)) else: priv.extend([(fname2def(f), 1) for f in flist]) check_prec('') check_prec('f') check_prec('l') return priv, pub def check_ieee_macros(config): priv = [] pub = [] macros = [] def _add_decl(f): priv.append(fname2def("decl_%s" % f)) pub.append('NPY_%s' % fname2def("decl_%s" % f)) # XXX: hack to circumvent cpp pollution from python: python put its # config.h in the public namespace, so we have a clash for the common # functions we test. We remove every function tested by python's # autoconf, hoping their own test are correct _macros = ["isnan", "isinf", "signbit", "isfinite"] for f in _macros: py_symbol = fname2def("decl_%s" % f) already_declared = config.check_decl(py_symbol, headers=["Python.h", "math.h"]) if already_declared: if config.check_macro_true(py_symbol, headers=["Python.h", "math.h"]): pub.append('NPY_%s' % fname2def("decl_%s" % f)) else: macros.append(f) # Normally, isnan and isinf are macro (C99), but some platforms only have # func, or both func and macro version. Check for macro only, and define # replacement ones if not found. # Note: including Python.h is necessary because it modifies some math.h # definitions for f in macros: st = config.check_decl(f, headers=["Python.h", "math.h"]) if st: _add_decl(f) return priv, pub def check_types(config_cmd, ext, build_dir): private_defines = [] public_defines = [] # Expected size (in number of bytes) for each type. This is an # optimization: those are only hints, and an exhaustive search for the size # is done if the hints are wrong. expected = {'short': [2], 'int': [4], 'long': [8, 4], 'float': [4], 'double': [8], 'long double': [16, 12, 8], 'Py_intptr_t': [8, 4], 'PY_LONG_LONG': [8], 'long long': [8], 'off_t': [8, 4]} # Check we have the python header (-dev* packages on Linux) result = config_cmd.check_header('Python.h') if not result: python = 'python' if '__pypy__' in sys.builtin_module_names: python = 'pypy' raise SystemError( "Cannot compile 'Python.h'. Perhaps you need to " "install {0}-dev|{0}-devel.".format(python)) res = config_cmd.check_header("endian.h") if res: private_defines.append(('HAVE_ENDIAN_H', 1)) public_defines.append(('NPY_HAVE_ENDIAN_H', 1)) res = config_cmd.check_header("sys/endian.h") if res: private_defines.append(('HAVE_SYS_ENDIAN_H', 1)) public_defines.append(('NPY_HAVE_SYS_ENDIAN_H', 1)) # Check basic types sizes for type in ('short', 'int', 'long'): res = config_cmd.check_decl("SIZEOF_%s" % sym2def(type), headers=["Python.h"]) if res: public_defines.append(('NPY_SIZEOF_%s' % sym2def(type), "SIZEOF_%s" % sym2def(type))) else: res = config_cmd.check_type_size(type, expected=expected[type]) if res >= 0: public_defines.append(('NPY_SIZEOF_%s' % sym2def(type), '%d' % res)) else: raise SystemError("Checking sizeof (%s) failed !" % type) for type in ('float', 'double', 'long double'): already_declared = config_cmd.check_decl("SIZEOF_%s" % sym2def(type), headers=["Python.h"]) res = config_cmd.check_type_size(type, expected=expected[type]) if res >= 0: public_defines.append(('NPY_SIZEOF_%s' % sym2def(type), '%d' % res)) if not already_declared and not type == 'long double': private_defines.append(('SIZEOF_%s' % sym2def(type), '%d' % res)) else: raise SystemError("Checking sizeof (%s) failed !" % type) # Compute size of corresponding complex type: used to check that our # definition is binary compatible with C99 complex type (check done at # build time in npy_common.h) complex_def = "struct {%s __x; %s __y;}" % (type, type) res = config_cmd.check_type_size(complex_def, expected=[2 * x for x in expected[type]]) if res >= 0: public_defines.append(('NPY_SIZEOF_COMPLEX_%s' % sym2def(type), '%d' % res)) else: raise SystemError("Checking sizeof (%s) failed !" % complex_def) for type in ('Py_intptr_t', 'off_t'): res = config_cmd.check_type_size(type, headers=["Python.h"], library_dirs=[pythonlib_dir()], expected=expected[type]) if res >= 0: private_defines.append(('SIZEOF_%s' % sym2def(type), '%d' % res)) public_defines.append(('NPY_SIZEOF_%s' % sym2def(type), '%d' % res)) else: raise SystemError("Checking sizeof (%s) failed !" % type) # We check declaration AND type because that's how distutils does it. if config_cmd.check_decl('PY_LONG_LONG', headers=['Python.h']): res = config_cmd.check_type_size('PY_LONG_LONG', headers=['Python.h'], library_dirs=[pythonlib_dir()], expected=expected['PY_LONG_LONG']) if res >= 0: private_defines.append(('SIZEOF_%s' % sym2def('PY_LONG_LONG'), '%d' % res)) public_defines.append(('NPY_SIZEOF_%s' % sym2def('PY_LONG_LONG'), '%d' % res)) else: raise SystemError("Checking sizeof (%s) failed !" % 'PY_LONG_LONG') res = config_cmd.check_type_size('long long', expected=expected['long long']) if res >= 0: #private_defines.append(('SIZEOF_%s' % sym2def('long long'), '%d' % res)) public_defines.append(('NPY_SIZEOF_%s' % sym2def('long long'), '%d' % res)) else: raise SystemError("Checking sizeof (%s) failed !" % 'long long') if not config_cmd.check_decl('CHAR_BIT', headers=['Python.h']): raise RuntimeError( "Config wo CHAR_BIT is not supported" ", please contact the maintainers") return private_defines, public_defines def check_mathlib(config_cmd): # Testing the C math library mathlibs = [] mathlibs_choices = [[], ['m'], ['cpml']] mathlib = os.environ.get('MATHLIB') if mathlib: mathlibs_choices.insert(0, mathlib.split(',')) for libs in mathlibs_choices: if config_cmd.check_func("exp", libraries=libs, decl=True, call=True): mathlibs = libs break else: raise EnvironmentError("math library missing; rerun " "setup.py after setting the " "MATHLIB env variable") return mathlibs def visibility_define(config): """Return the define value to use for NPY_VISIBILITY_HIDDEN (may be empty string).""" if config.check_compiler_gcc4(): return '__attribute__((visibility("hidden")))' else: return '' def configuration(parent_package='',top_path=None): from numpy.distutils.misc_util import Configuration, dot_join from numpy.distutils.system_info import get_info config = Configuration('core', parent_package, top_path) local_dir = config.local_path codegen_dir = join(local_dir, 'code_generators') if is_released(config): warnings.simplefilter('error', MismatchCAPIWarning) # Check whether we have a mismatch between the set C API VERSION and the # actual C API VERSION check_api_version(C_API_VERSION, codegen_dir) generate_umath_py = join(codegen_dir, 'generate_umath.py') n = dot_join(config.name, 'generate_umath') generate_umath = npy_load_module('_'.join(n.split('.')), generate_umath_py, ('.py', 'U', 1)) header_dir = 'include/numpy' # this is relative to config.path_in_package cocache = CallOnceOnly() def generate_config_h(ext, build_dir): target = join(build_dir, header_dir, 'config.h') d = os.path.dirname(target) if not os.path.exists(d): os.makedirs(d) if newer(__file__, target): config_cmd = config.get_config_cmd() log.info('Generating %s', target) # Check sizeof moredefs, ignored = cocache.check_types(config_cmd, ext, build_dir) # Check math library and C99 math funcs availability mathlibs = check_mathlib(config_cmd) moredefs.append(('MATHLIB', ','.join(mathlibs))) check_math_capabilities(config_cmd, moredefs, mathlibs) moredefs.extend(cocache.check_ieee_macros(config_cmd)[0]) moredefs.extend(cocache.check_complex(config_cmd, mathlibs)[0]) # Signal check if is_npy_no_signal(): moredefs.append('__NPY_PRIVATE_NO_SIGNAL') # Windows checks if sys.platform == 'win32' or os.name == 'nt': win32_checks(moredefs) # C99 restrict keyword moredefs.append(('NPY_RESTRICT', config_cmd.check_restrict())) # Inline check inline = config_cmd.check_inline() # Use relaxed stride checking if NPY_RELAXED_STRIDES_CHECKING: moredefs.append(('NPY_RELAXED_STRIDES_CHECKING', 1)) # Use bogus stride debug aid when relaxed strides are enabled if NPY_RELAXED_STRIDES_DEBUG: moredefs.append(('NPY_RELAXED_STRIDES_DEBUG', 1)) # Get long double representation if sys.platform != 'darwin': rep = check_long_double_representation(config_cmd) if rep in ['INTEL_EXTENDED_12_BYTES_LE', 'INTEL_EXTENDED_16_BYTES_LE', 'MOTOROLA_EXTENDED_12_BYTES_BE', 'IEEE_QUAD_LE', 'IEEE_QUAD_BE', 'IEEE_DOUBLE_LE', 'IEEE_DOUBLE_BE', 'DOUBLE_DOUBLE_BE', 'DOUBLE_DOUBLE_LE']: moredefs.append(('HAVE_LDOUBLE_%s' % rep, 1)) else: raise ValueError("Unrecognized long double format: %s" % rep) # Py3K check if sys.version_info[0] == 3: moredefs.append(('NPY_PY3K', 1)) # Generate the config.h file from moredefs target_f = open(target, 'w') for d in moredefs: if isinstance(d, str): target_f.write('#define %s\n' % (d)) else: target_f.write('#define %s %s\n' % (d[0], d[1])) # define inline to our keyword, or nothing target_f.write('#ifndef __cplusplus\n') if inline == 'inline': target_f.write('/* #undef inline */\n') else: target_f.write('#define inline %s\n' % inline) target_f.write('#endif\n') # add the guard to make sure config.h is never included directly, # but always through npy_config.h target_f.write(""" #ifndef _NPY_NPY_CONFIG_H_ #error config.h should never be included directly, include npy_config.h instead #endif """) target_f.close() print('File:', target) target_f = open(target) print(target_f.read()) target_f.close() print('EOF') else: mathlibs = [] target_f = open(target) for line in target_f: s = '#define MATHLIB' if line.startswith(s): value = line[len(s):].strip() if value: mathlibs.extend(value.split(',')) target_f.close() # Ugly: this can be called within a library and not an extension, # in which case there is no libraries attributes (and none is # needed). if hasattr(ext, 'libraries'): ext.libraries.extend(mathlibs) incl_dir = os.path.dirname(target) if incl_dir not in config.numpy_include_dirs: config.numpy_include_dirs.append(incl_dir) return target def generate_numpyconfig_h(ext, build_dir): """Depends on config.h: generate_config_h has to be called before !""" # put private include directory in build_dir on search path # allows using code generation in headers headers config.add_include_dirs(join(build_dir, "src", "private")) config.add_include_dirs(join(build_dir, "src", "npymath")) target = join(build_dir, header_dir, '_numpyconfig.h') d = os.path.dirname(target) if not os.path.exists(d): os.makedirs(d) if newer(__file__, target): config_cmd = config.get_config_cmd() log.info('Generating %s', target) # Check sizeof ignored, moredefs = cocache.check_types(config_cmd, ext, build_dir) if is_npy_no_signal(): moredefs.append(('NPY_NO_SIGNAL', 1)) if is_npy_no_smp(): moredefs.append(('NPY_NO_SMP', 1)) else: moredefs.append(('NPY_NO_SMP', 0)) mathlibs = check_mathlib(config_cmd) moredefs.extend(cocache.check_ieee_macros(config_cmd)[1]) moredefs.extend(cocache.check_complex(config_cmd, mathlibs)[1]) if NPY_RELAXED_STRIDES_CHECKING: moredefs.append(('NPY_RELAXED_STRIDES_CHECKING', 1)) if NPY_RELAXED_STRIDES_DEBUG: moredefs.append(('NPY_RELAXED_STRIDES_DEBUG', 1)) # Check wether we can use inttypes (C99) formats if config_cmd.check_decl('PRIdPTR', headers=['inttypes.h']): moredefs.append(('NPY_USE_C99_FORMATS', 1)) # visibility check hidden_visibility = visibility_define(config_cmd) moredefs.append(('NPY_VISIBILITY_HIDDEN', hidden_visibility)) # Add the C API/ABI versions moredefs.append(('NPY_ABI_VERSION', '0x%.8X' % C_ABI_VERSION)) moredefs.append(('NPY_API_VERSION', '0x%.8X' % C_API_VERSION)) # Add moredefs to header target_f = open(target, 'w') for d in moredefs: if isinstance(d, str): target_f.write('#define %s\n' % (d)) else: target_f.write('#define %s %s\n' % (d[0], d[1])) # Define __STDC_FORMAT_MACROS target_f.write(""" #ifndef __STDC_FORMAT_MACROS #define __STDC_FORMAT_MACROS 1 #endif """) target_f.close() # Dump the numpyconfig.h header to stdout print('File: %s' % target) target_f = open(target) print(target_f.read()) target_f.close() print('EOF') config.add_data_files((header_dir, target)) return target def generate_api_func(module_name): def generate_api(ext, build_dir): script = join(codegen_dir, module_name + '.py') sys.path.insert(0, codegen_dir) try: m = __import__(module_name) log.info('executing %s', script) h_file, c_file, doc_file = m.generate_api(os.path.join(build_dir, header_dir)) finally: del sys.path[0] config.add_data_files((header_dir, h_file), (header_dir, doc_file)) return (h_file,) return generate_api generate_numpy_api = generate_api_func('generate_numpy_api') generate_ufunc_api = generate_api_func('generate_ufunc_api') config.add_include_dirs(join(local_dir, "src", "private")) config.add_include_dirs(join(local_dir, "src")) config.add_include_dirs(join(local_dir)) config.add_data_files('include/numpy/*.h') config.add_include_dirs(join('src', 'npymath')) config.add_include_dirs(join('src', 'multiarray')) config.add_include_dirs(join('src', 'umath')) config.add_include_dirs(join('src', 'npysort')) config.add_define_macros([("NPY_INTERNAL_BUILD", "1")]) # this macro indicates that Numpy build is in process config.add_define_macros([("HAVE_NPY_CONFIG_H", "1")]) if sys.platform[:3] == "aix": config.add_define_macros([("_LARGE_FILES", None)]) else: config.add_define_macros([("_FILE_OFFSET_BITS", "64")]) config.add_define_macros([('_LARGEFILE_SOURCE', '1')]) config.add_define_macros([('_LARGEFILE64_SOURCE', '1')]) config.numpy_include_dirs.extend(config.paths('include')) deps = [join('src', 'npymath', '_signbit.c'), join('include', 'numpy', '*object.h'), join(codegen_dir, 'genapi.py'), ] ####################################################################### # dummy module # ####################################################################### # npymath needs the config.h and numpyconfig.h files to be generated, but # build_clib cannot handle generate_config_h and generate_numpyconfig_h # (don't ask). Because clib are generated before extensions, we have to # explicitly add an extension which has generate_config_h and # generate_numpyconfig_h as sources *before* adding npymath. config.add_extension('_dummy', sources=[join('src', 'dummymodule.c'), generate_config_h, generate_numpyconfig_h, generate_numpy_api] ) ####################################################################### # npymath library # ####################################################################### subst_dict = dict([("sep", os.path.sep), ("pkgname", "numpy.core")]) def get_mathlib_info(*args): # Another ugly hack: the mathlib info is known once build_src is run, # but we cannot use add_installed_pkg_config here either, so we only # update the substition dictionary during npymath build config_cmd = config.get_config_cmd() # Check that the toolchain works, to fail early if it doesn't # (avoid late errors with MATHLIB which are confusing if the # compiler does not work). st = config_cmd.try_link('int main(void) { return 0;}') if not st: raise RuntimeError("Broken toolchain: cannot link a simple C program") mlibs = check_mathlib(config_cmd) posix_mlib = ' '.join(['-l%s' % l for l in mlibs]) msvc_mlib = ' '.join(['%s.lib' % l for l in mlibs]) subst_dict["posix_mathlib"] = posix_mlib subst_dict["msvc_mathlib"] = msvc_mlib npymath_sources = [join('src', 'npymath', 'npy_math_internal.h.src'), join('src', 'npymath', 'npy_math.c'), join('src', 'npymath', 'ieee754.c.src'), join('src', 'npymath', 'npy_math_complex.c.src'), join('src', 'npymath', 'halffloat.c') ] # Must be true for CRT compilers but not MinGW/cygwin. See gh-9977. is_msvc = platform.system() == 'Windows' config.add_installed_library('npymath', sources=npymath_sources + [get_mathlib_info], install_dir='lib', build_info={ 'include_dirs' : [], # empty list required for creating npy_math_internal.h 'extra_compiler_args' : (['/GL-'] if is_msvc else []), }) config.add_npy_pkg_config("npymath.ini.in", "lib/npy-pkg-config", subst_dict) config.add_npy_pkg_config("mlib.ini.in", "lib/npy-pkg-config", subst_dict) ####################################################################### # npysort library # ####################################################################### # This library is created for the build but it is not installed npysort_sources = [join('src', 'npysort', 'quicksort.c.src'), join('src', 'npysort', 'mergesort.c.src'), join('src', 'npysort', 'heapsort.c.src'), join('src', 'private', 'npy_partition.h.src'), join('src', 'npysort', 'selection.c.src'), join('src', 'private', 'npy_binsearch.h.src'), join('src', 'npysort', 'binsearch.c.src'), ] config.add_library('npysort', sources=npysort_sources, include_dirs=[]) ####################################################################### # multiarray module # ####################################################################### multiarray_deps = [ join('src', 'multiarray', 'arrayobject.h'), join('src', 'multiarray', 'arraytypes.h'), join('src', 'multiarray', 'array_assign.h'), join('src', 'multiarray', 'buffer.h'), join('src', 'multiarray', 'calculation.h'), join('src', 'multiarray', 'cblasfuncs.h'), join('src', 'multiarray', 'common.h'), join('src', 'multiarray', 'convert_datatype.h'), join('src', 'multiarray', 'convert.h'), join('src', 'multiarray', 'conversion_utils.h'), join('src', 'multiarray', 'ctors.h'), join('src', 'multiarray', 'descriptor.h'), join('src', 'multiarray', 'dragon4.h'), join('src', 'multiarray', 'getset.h'), join('src', 'multiarray', 'hashdescr.h'), join('src', 'multiarray', 'iterators.h'), join('src', 'multiarray', 'mapping.h'), join('src', 'multiarray', 'methods.h'), join('src', 'multiarray', 'multiarraymodule.h'), join('src', 'multiarray', 'nditer_impl.h'), join('src', 'multiarray', 'number.h'), join('src', 'multiarray', 'numpyos.h'), join('src', 'multiarray', 'refcount.h'), join('src', 'multiarray', 'scalartypes.h'), join('src', 'multiarray', 'sequence.h'), join('src', 'multiarray', 'shape.h'), join('src', 'multiarray', 'strfuncs.h'), join('src', 'multiarray', 'ucsnarrow.h'), join('src', 'multiarray', 'usertypes.h'), join('src', 'multiarray', 'vdot.h'), join('src', 'private', 'npy_config.h'), join('src', 'private', 'templ_common.h.src'), join('src', 'private', 'lowlevel_strided_loops.h'), join('src', 'private', 'mem_overlap.h'), join('src', 'private', 'npy_longdouble.h'), join('src', 'private', 'ufunc_override.h'), join('src', 'private', 'binop_override.h'), join('src', 'private', 'npy_extint128.h'), join('include', 'numpy', 'arrayobject.h'), join('include', 'numpy', '_neighborhood_iterator_imp.h'), join('include', 'numpy', 'npy_endian.h'), join('include', 'numpy', 'arrayscalars.h'), join('include', 'numpy', 'noprefix.h'), join('include', 'numpy', 'npy_interrupt.h'), join('include', 'numpy', 'npy_3kcompat.h'), join('include', 'numpy', 'npy_math.h'), join('include', 'numpy', 'halffloat.h'), join('include', 'numpy', 'npy_common.h'), join('include', 'numpy', 'npy_os.h'), join('include', 'numpy', 'utils.h'), join('include', 'numpy', 'ndarrayobject.h'), join('include', 'numpy', 'npy_cpu.h'), join('include', 'numpy', 'numpyconfig.h'), join('include', 'numpy', 'ndarraytypes.h'), join('include', 'numpy', 'npy_1_7_deprecated_api.h'), # add library sources as distuils does not consider libraries # dependencies ] + npysort_sources + npymath_sources multiarray_src = [ join('src', 'multiarray', 'alloc.c'), join('src', 'multiarray', 'arrayobject.c'), join('src', 'multiarray', 'arraytypes.c.src'), join('src', 'multiarray', 'array_assign.c'), join('src', 'multiarray', 'array_assign_scalar.c'), join('src', 'multiarray', 'array_assign_array.c'), join('src', 'multiarray', 'buffer.c'), join('src', 'multiarray', 'calculation.c'), join('src', 'multiarray', 'compiled_base.c'), join('src', 'multiarray', 'common.c'), join('src', 'multiarray', 'convert.c'), join('src', 'multiarray', 'convert_datatype.c'), join('src', 'multiarray', 'conversion_utils.c'), join('src', 'multiarray', 'ctors.c'), join('src', 'multiarray', 'datetime.c'), join('src', 'multiarray', 'datetime_strings.c'), join('src', 'multiarray', 'datetime_busday.c'), join('src', 'multiarray', 'datetime_busdaycal.c'), join('src', 'multiarray', 'descriptor.c'), join('src', 'multiarray', 'dragon4.c'), join('src', 'multiarray', 'dtype_transfer.c'), join('src', 'multiarray', 'einsum.c.src'), join('src', 'multiarray', 'flagsobject.c'), join('src', 'multiarray', 'getset.c'), join('src', 'multiarray', 'hashdescr.c'), join('src', 'multiarray', 'item_selection.c'), join('src', 'multiarray', 'iterators.c'), join('src', 'multiarray', 'lowlevel_strided_loops.c.src'), join('src', 'multiarray', 'mapping.c'), join('src', 'multiarray', 'methods.c'), join('src', 'multiarray', 'multiarraymodule.c'), join('src', 'multiarray', 'nditer_templ.c.src'), join('src', 'multiarray', 'nditer_api.c'), join('src', 'multiarray', 'nditer_constr.c'), join('src', 'multiarray', 'nditer_pywrap.c'), join('src', 'multiarray', 'number.c'), join('src', 'multiarray', 'numpyos.c'), join('src', 'multiarray', 'refcount.c'), join('src', 'multiarray', 'sequence.c'), join('src', 'multiarray', 'shape.c'), join('src', 'multiarray', 'scalarapi.c'), join('src', 'multiarray', 'scalartypes.c.src'), join('src', 'multiarray', 'strfuncs.c'), join('src', 'multiarray', 'temp_elide.c'), join('src', 'multiarray', 'usertypes.c'), join('src', 'multiarray', 'ucsnarrow.c'), join('src', 'multiarray', 'vdot.c'), join('src', 'private', 'templ_common.h.src'), join('src', 'private', 'mem_overlap.c'), join('src', 'private', 'npy_longdouble.c'), join('src', 'private', 'ufunc_override.c'), ] blas_info = get_info('blas_opt', 0) if blas_info and ('HAVE_CBLAS', None) in blas_info.get('define_macros', []): extra_info = blas_info # These files are also in MANIFEST.in so that they are always in # the source distribution independently of HAVE_CBLAS. multiarray_src.extend([join('src', 'multiarray', 'cblasfuncs.c'), join('src', 'multiarray', 'python_xerbla.c'), ]) if uses_accelerate_framework(blas_info): multiarray_src.extend(get_sgemv_fix()) else: extra_info = {} config.add_extension('multiarray', sources=multiarray_src + [generate_config_h, generate_numpyconfig_h, generate_numpy_api, join(codegen_dir, 'generate_numpy_api.py'), join('*.py')], depends=deps + multiarray_deps, libraries=['npymath', 'npysort'], extra_info=extra_info) ####################################################################### # umath module # ####################################################################### def generate_umath_c(ext, build_dir): target = join(build_dir, header_dir, '__umath_generated.c') dir = os.path.dirname(target) if not os.path.exists(dir): os.makedirs(dir) script = generate_umath_py if newer(script, target): f = open(target, 'w') f.write(generate_umath.make_code(generate_umath.defdict, generate_umath.__file__)) f.close() return [] umath_src = [ join('src', 'umath', 'umathmodule.c'), join('src', 'umath', 'reduction.c'), join('src', 'umath', 'funcs.inc.src'), join('src', 'umath', 'simd.inc.src'), join('src', 'umath', 'loops.h.src'), join('src', 'umath', 'loops.c.src'), join('src', 'umath', 'ufunc_object.c'), join('src', 'umath', 'extobj.c'), join('src', 'umath', 'scalarmath.c.src'), join('src', 'umath', 'ufunc_type_resolution.c'), join('src', 'umath', 'override.c'), join('src', 'private', 'mem_overlap.c'), join('src', 'private', 'npy_longdouble.c'), join('src', 'private', 'ufunc_override.c')] umath_deps = [ generate_umath_py, join('include', 'numpy', 'npy_math.h'), join('include', 'numpy', 'halffloat.h'), join('src', 'multiarray', 'common.h'), join('src', 'private', 'templ_common.h.src'), join('src', 'umath', 'simd.inc.src'), join('src', 'umath', 'override.h'), join(codegen_dir, 'generate_ufunc_api.py'), join('src', 'private', 'lowlevel_strided_loops.h'), join('src', 'private', 'mem_overlap.h'), join('src', 'private', 'npy_longdouble.h'), join('src', 'private', 'ufunc_override.h'), join('src', 'private', 'binop_override.h')] + npymath_sources config.add_extension('umath', sources=umath_src + [generate_config_h, generate_numpyconfig_h, generate_umath_c, generate_ufunc_api], depends=deps + umath_deps, libraries=['npymath'], ) ####################################################################### # umath_tests module # ####################################################################### config.add_extension('umath_tests', sources=[join('src', 'umath', 'umath_tests.c.src')]) ####################################################################### # custom rational dtype module # ####################################################################### config.add_extension('test_rational', sources=[join('src', 'umath', 'test_rational.c.src')]) ####################################################################### # struct_ufunc_test module # ####################################################################### config.add_extension('struct_ufunc_test', sources=[join('src', 'umath', 'struct_ufunc_test.c.src')]) ####################################################################### # multiarray_tests module # ####################################################################### config.add_extension('multiarray_tests', sources=[join('src', 'multiarray', 'multiarray_tests.c.src'), join('src', 'private', 'mem_overlap.c')], depends=[join('src', 'private', 'mem_overlap.h'), join('src', 'private', 'npy_extint128.h')], libraries=['npymath']) ####################################################################### # operand_flag_tests module # ####################################################################### config.add_extension('operand_flag_tests', sources=[join('src', 'umath', 'operand_flag_tests.c.src')]) config.add_data_dir('tests') config.add_data_dir('tests/data') config.make_svn_version_py() return config if __name__ == '__main__': from numpy.distutils.core import setup setup(configuration=configuration)
41,477
41.760825
113
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/_methods.py
""" Array methods which are called by both the C-code for the method and the Python code for the NumPy-namespace function """ from __future__ import division, absolute_import, print_function import warnings from numpy.core import multiarray as mu from numpy.core import umath as um from numpy.core.numeric import asanyarray from numpy.core import numerictypes as nt # save those O(100) nanoseconds! umr_maximum = um.maximum.reduce umr_minimum = um.minimum.reduce umr_sum = um.add.reduce umr_prod = um.multiply.reduce umr_any = um.logical_or.reduce umr_all = um.logical_and.reduce # avoid keyword arguments to speed up parsing, saves about 15%-20% for very # small reductions def _amax(a, axis=None, out=None, keepdims=False): return umr_maximum(a, axis, None, out, keepdims) def _amin(a, axis=None, out=None, keepdims=False): return umr_minimum(a, axis, None, out, keepdims) def _sum(a, axis=None, dtype=None, out=None, keepdims=False): return umr_sum(a, axis, dtype, out, keepdims) def _prod(a, axis=None, dtype=None, out=None, keepdims=False): return umr_prod(a, axis, dtype, out, keepdims) def _any(a, axis=None, dtype=None, out=None, keepdims=False): return umr_any(a, axis, dtype, out, keepdims) def _all(a, axis=None, dtype=None, out=None, keepdims=False): return umr_all(a, axis, dtype, out, keepdims) def _count_reduce_items(arr, axis): if axis is None: axis = tuple(range(arr.ndim)) if not isinstance(axis, tuple): axis = (axis,) items = 1 for ax in axis: items *= arr.shape[ax] return items def _mean(a, axis=None, dtype=None, out=None, keepdims=False): arr = asanyarray(a) is_float16_result = False rcount = _count_reduce_items(arr, axis) # Make this warning show up first if rcount == 0: warnings.warn("Mean of empty slice.", RuntimeWarning, stacklevel=2) # Cast bool, unsigned int, and int to float64 by default if dtype is None: if issubclass(arr.dtype.type, (nt.integer, nt.bool_)): dtype = mu.dtype('f8') elif issubclass(arr.dtype.type, nt.float16): dtype = mu.dtype('f4') is_float16_result = True ret = umr_sum(arr, axis, dtype, out, keepdims) if isinstance(ret, mu.ndarray): ret = um.true_divide( ret, rcount, out=ret, casting='unsafe', subok=False) if is_float16_result and out is None: ret = arr.dtype.type(ret) elif hasattr(ret, 'dtype'): if is_float16_result: ret = arr.dtype.type(ret / rcount) else: ret = ret.dtype.type(ret / rcount) else: ret = ret / rcount return ret def _var(a, axis=None, dtype=None, out=None, ddof=0, keepdims=False): arr = asanyarray(a) rcount = _count_reduce_items(arr, axis) # Make this warning show up on top. if ddof >= rcount: warnings.warn("Degrees of freedom <= 0 for slice", RuntimeWarning, stacklevel=2) # Cast bool, unsigned int, and int to float64 by default if dtype is None and issubclass(arr.dtype.type, (nt.integer, nt.bool_)): dtype = mu.dtype('f8') # Compute the mean. # Note that if dtype is not of inexact type then arraymean will # not be either. arrmean = umr_sum(arr, axis, dtype, keepdims=True) if isinstance(arrmean, mu.ndarray): arrmean = um.true_divide( arrmean, rcount, out=arrmean, casting='unsafe', subok=False) else: arrmean = arrmean.dtype.type(arrmean / rcount) # Compute sum of squared deviations from mean # Note that x may not be inexact and that we need it to be an array, # not a scalar. x = asanyarray(arr - arrmean) if issubclass(arr.dtype.type, nt.complexfloating): x = um.multiply(x, um.conjugate(x), out=x).real else: x = um.multiply(x, x, out=x) ret = umr_sum(x, axis, dtype, out, keepdims) # Compute degrees of freedom and make sure it is not negative. rcount = max([rcount - ddof, 0]) # divide by degrees of freedom if isinstance(ret, mu.ndarray): ret = um.true_divide( ret, rcount, out=ret, casting='unsafe', subok=False) elif hasattr(ret, 'dtype'): ret = ret.dtype.type(ret / rcount) else: ret = ret / rcount return ret def _std(a, axis=None, dtype=None, out=None, ddof=0, keepdims=False): ret = _var(a, axis=axis, dtype=dtype, out=out, ddof=ddof, keepdims=keepdims) if isinstance(ret, mu.ndarray): ret = um.sqrt(ret, out=ret) elif hasattr(ret, 'dtype'): ret = ret.dtype.type(um.sqrt(ret)) else: ret = um.sqrt(ret) return ret
4,704
31.448276
76
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/memmap.py
from __future__ import division, absolute_import, print_function import numpy as np from .numeric import uint8, ndarray, dtype from numpy.compat import long, basestring, is_pathlib_path __all__ = ['memmap'] dtypedescr = dtype valid_filemodes = ["r", "c", "r+", "w+"] writeable_filemodes = ["r+", "w+"] mode_equivalents = { "readonly":"r", "copyonwrite":"c", "readwrite":"r+", "write":"w+" } class memmap(ndarray): """Create a memory-map to an array stored in a *binary* file on disk. Memory-mapped files are used for accessing small segments of large files on disk, without reading the entire file into memory. NumPy's memmap's are array-like objects. This differs from Python's ``mmap`` module, which uses file-like objects. This subclass of ndarray has some unpleasant interactions with some operations, because it doesn't quite fit properly as a subclass. An alternative to using this subclass is to create the ``mmap`` object yourself, then create an ndarray with ndarray.__new__ directly, passing the object created in its 'buffer=' parameter. This class may at some point be turned into a factory function which returns a view into an mmap buffer. Delete the memmap instance to close. Parameters ---------- filename : str, file-like object, or pathlib.Path instance The file name or file object to be used as the array data buffer. dtype : data-type, optional The data-type used to interpret the file contents. Default is `uint8`. mode : {'r+', 'r', 'w+', 'c'}, optional The file is opened in this mode: +------+-------------------------------------------------------------+ | 'r' | Open existing file for reading only. | +------+-------------------------------------------------------------+ | 'r+' | Open existing file for reading and writing. | +------+-------------------------------------------------------------+ | 'w+' | Create or overwrite existing file for reading and writing. | +------+-------------------------------------------------------------+ | 'c' | Copy-on-write: assignments affect data in memory, but | | | changes are not saved to disk. The file on disk is | | | read-only. | +------+-------------------------------------------------------------+ Default is 'r+'. offset : int, optional In the file, array data starts at this offset. Since `offset` is measured in bytes, it should normally be a multiple of the byte-size of `dtype`. When ``mode != 'r'``, even positive offsets beyond end of file are valid; The file will be extended to accommodate the additional data. By default, ``memmap`` will start at the beginning of the file, even if ``filename`` is a file pointer ``fp`` and ``fp.tell() != 0``. shape : tuple, optional The desired shape of the array. If ``mode == 'r'`` and the number of remaining bytes after `offset` is not a multiple of the byte-size of `dtype`, you must specify `shape`. By default, the returned array will be 1-D with the number of elements determined by file size and data-type. order : {'C', 'F'}, optional Specify the order of the ndarray memory layout: :term:`row-major`, C-style or :term:`column-major`, Fortran-style. This only has an effect if the shape is greater than 1-D. The default order is 'C'. Attributes ---------- filename : str or pathlib.Path instance Path to the mapped file. offset : int Offset position in the file. mode : str File mode. Methods ------- flush Flush any changes in memory to file on disk. When you delete a memmap object, flush is called first to write changes to disk before removing the object. See also -------- lib.format.open_memmap : Create or load a memory-mapped ``.npy`` file. Notes ----- The memmap object can be used anywhere an ndarray is accepted. Given a memmap ``fp``, ``isinstance(fp, numpy.ndarray)`` returns ``True``. Memory-mapped files cannot be larger than 2GB on 32-bit systems. When a memmap causes a file to be created or extended beyond its current size in the filesystem, the contents of the new part are unspecified. On systems with POSIX filesystem semantics, the extended part will be filled with zero bytes. Examples -------- >>> data = np.arange(12, dtype='float32') >>> data.resize((3,4)) This example uses a temporary file so that doctest doesn't write files to your directory. You would use a 'normal' filename. >>> from tempfile import mkdtemp >>> import os.path as path >>> filename = path.join(mkdtemp(), 'newfile.dat') Create a memmap with dtype and shape that matches our data: >>> fp = np.memmap(filename, dtype='float32', mode='w+', shape=(3,4)) >>> fp memmap([[ 0., 0., 0., 0.], [ 0., 0., 0., 0.], [ 0., 0., 0., 0.]], dtype=float32) Write data to memmap array: >>> fp[:] = data[:] >>> fp memmap([[ 0., 1., 2., 3.], [ 4., 5., 6., 7.], [ 8., 9., 10., 11.]], dtype=float32) >>> fp.filename == path.abspath(filename) True Deletion flushes memory changes to disk before removing the object: >>> del fp Load the memmap and verify data was stored: >>> newfp = np.memmap(filename, dtype='float32', mode='r', shape=(3,4)) >>> newfp memmap([[ 0., 1., 2., 3.], [ 4., 5., 6., 7.], [ 8., 9., 10., 11.]], dtype=float32) Read-only memmap: >>> fpr = np.memmap(filename, dtype='float32', mode='r', shape=(3,4)) >>> fpr.flags.writeable False Copy-on-write memmap: >>> fpc = np.memmap(filename, dtype='float32', mode='c', shape=(3,4)) >>> fpc.flags.writeable True It's possible to assign to copy-on-write array, but values are only written into the memory copy of the array, and not written to disk: >>> fpc memmap([[ 0., 1., 2., 3.], [ 4., 5., 6., 7.], [ 8., 9., 10., 11.]], dtype=float32) >>> fpc[0,:] = 0 >>> fpc memmap([[ 0., 0., 0., 0.], [ 4., 5., 6., 7.], [ 8., 9., 10., 11.]], dtype=float32) File on disk is unchanged: >>> fpr memmap([[ 0., 1., 2., 3.], [ 4., 5., 6., 7.], [ 8., 9., 10., 11.]], dtype=float32) Offset into a memmap: >>> fpo = np.memmap(filename, dtype='float32', mode='r', offset=16) >>> fpo memmap([ 4., 5., 6., 7., 8., 9., 10., 11.], dtype=float32) """ __array_priority__ = -100.0 def __new__(subtype, filename, dtype=uint8, mode='r+', offset=0, shape=None, order='C'): # Import here to minimize 'import numpy' overhead import mmap import os.path try: mode = mode_equivalents[mode] except KeyError: if mode not in valid_filemodes: raise ValueError("mode must be one of %s" % (valid_filemodes + list(mode_equivalents.keys()))) if hasattr(filename, 'read'): fid = filename own_file = False elif is_pathlib_path(filename): fid = filename.open((mode == 'c' and 'r' or mode)+'b') own_file = True else: fid = open(filename, (mode == 'c' and 'r' or mode)+'b') own_file = True if (mode == 'w+') and shape is None: raise ValueError("shape must be given") fid.seek(0, 2) flen = fid.tell() descr = dtypedescr(dtype) _dbytes = descr.itemsize if shape is None: bytes = flen - offset if (bytes % _dbytes): fid.close() raise ValueError("Size of available data is not a " "multiple of the data-type size.") size = bytes // _dbytes shape = (size,) else: if not isinstance(shape, tuple): shape = (shape,) size = 1 for k in shape: size *= k bytes = long(offset + size*_dbytes) if mode == 'w+' or (mode == 'r+' and flen < bytes): fid.seek(bytes - 1, 0) fid.write(b'\0') fid.flush() if mode == 'c': acc = mmap.ACCESS_COPY elif mode == 'r': acc = mmap.ACCESS_READ else: acc = mmap.ACCESS_WRITE start = offset - offset % mmap.ALLOCATIONGRANULARITY bytes -= start array_offset = offset - start mm = mmap.mmap(fid.fileno(), bytes, access=acc, offset=start) self = ndarray.__new__(subtype, shape, dtype=descr, buffer=mm, offset=array_offset, order=order) self._mmap = mm self.offset = offset self.mode = mode if isinstance(filename, basestring): self.filename = os.path.abspath(filename) elif is_pathlib_path(filename): self.filename = filename.resolve() # py3 returns int for TemporaryFile().name elif (hasattr(filename, "name") and isinstance(filename.name, basestring)): self.filename = os.path.abspath(filename.name) # same as memmap copies (e.g. memmap + 1) else: self.filename = None if own_file: fid.close() return self def __array_finalize__(self, obj): if hasattr(obj, '_mmap') and np.may_share_memory(self, obj): self._mmap = obj._mmap self.filename = obj.filename self.offset = obj.offset self.mode = obj.mode else: self._mmap = None self.filename = None self.offset = None self.mode = None def flush(self): """ Write any changes in the array to the file on disk. For further information, see `memmap`. Parameters ---------- None See Also -------- memmap """ if self.base is not None and hasattr(self.base, 'flush'): self.base.flush() def __array_wrap__(self, arr, context=None): arr = super(memmap, self).__array_wrap__(arr, context) # Return a memmap if a memmap was given as the output of the # ufunc. Leave the arr class unchanged if self is not a memmap # to keep original memmap subclasses behavior if self is arr or type(self) is not memmap: return arr # Return scalar instead of 0d memmap, e.g. for np.sum with # axis=None if arr.shape == (): return arr[()] # Return ndarray otherwise return arr.view(np.ndarray) def __getitem__(self, index): res = super(memmap, self).__getitem__(index) if type(res) is memmap and res._mmap is None: return res.view(type=ndarray) return res
11,432
32.725664
83
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/getlimits.py
"""Machine limits for Float32 and Float64 and (long double) if available... """ from __future__ import division, absolute_import, print_function __all__ = ['finfo', 'iinfo'] import warnings from .machar import MachAr from . import numeric from . import numerictypes as ntypes from .numeric import array, inf from .umath import log10, exp2 from . import umath def _fr0(a): """fix rank-0 --> rank-1""" if a.ndim == 0: a = a.copy() a.shape = (1,) return a def _fr1(a): """fix rank > 0 --> rank-0""" if a.size == 1: a = a.copy() a.shape = () return a _convert_to_float = { ntypes.csingle: ntypes.single, ntypes.complex_: ntypes.float_, ntypes.clongfloat: ntypes.longfloat } # Parameters for creating MachAr / MachAr-like objects _title_fmt = 'numpy {} precision floating point number' _MACHAR_PARAMS = { ntypes.double: dict( itype = ntypes.int64, fmt = '%24.16e', title = _title_fmt.format('double')), ntypes.single: dict( itype = ntypes.int32, fmt = '%15.7e', title = _title_fmt.format('single')), ntypes.longdouble: dict( itype = ntypes.longlong, fmt = '%s', title = _title_fmt.format('long double')), ntypes.half: dict( itype = ntypes.int16, fmt = '%12.5e', title = _title_fmt.format('half'))} class MachArLike(object): """ Object to simulate MachAr instance """ def __init__(self, ftype, **kwargs): params = _MACHAR_PARAMS[ftype] float_conv = lambda v: array([v], ftype) float_to_float = lambda v : _fr1(float_conv(v)) self._float_to_str = lambda v: (params['fmt'] % array(_fr0(v)[0], ftype)) self.title = params['title'] # Parameter types same as for discovered MachAr object. self.epsilon = self.eps = float_to_float(kwargs.pop('eps')) self.epsneg = float_to_float(kwargs.pop('epsneg')) self.xmax = self.huge = float_to_float(kwargs.pop('huge')) self.xmin = self.tiny = float_to_float(kwargs.pop('tiny')) self.ibeta = params['itype'](kwargs.pop('ibeta')) self.__dict__.update(kwargs) self.precision = int(-log10(self.eps)) self.resolution = float_to_float(float_conv(10) ** (-self.precision)) # Properties below to delay need for float_to_str, and thus avoid circular # imports during early numpy module loading. # See: https://github.com/numpy/numpy/pull/8983#discussion_r115838683 @property def _str_eps(self): return self._float_to_str(self.eps) @property def _str_epsneg(self): return self._float_to_str(self.epsneg) @property def _str_xmin(self): return self._float_to_str(self.xmin) @property def _str_xmax(self): return self._float_to_str(self.xmax) @property def _str_resolution(self): return self._float_to_str(self.resolution) # Known parameters for float16 # See docstring of MachAr class for description of parameters. _f16 = ntypes.float16 _float16_ma = MachArLike(_f16, machep=-10, negep=-11, minexp=-14, maxexp=16, it=10, iexp=5, ibeta=2, irnd=5, ngrd=0, eps=exp2(_f16(-10)), epsneg=exp2(_f16(-11)), huge=_f16(65504), tiny=_f16(2 ** -14)) # Known parameters for float32 _f32 = ntypes.float32 _float32_ma = MachArLike(_f32, machep=-23, negep=-24, minexp=-126, maxexp=128, it=23, iexp=8, ibeta=2, irnd=5, ngrd=0, eps=exp2(_f32(-23)), epsneg=exp2(_f32(-24)), huge=_f32((1 - 2 ** -24) * 2**128), tiny=exp2(_f32(-126))) # Known parameters for float64 _f64 = ntypes.float64 _epsneg_f64 = 2.0 ** -53.0 _tiny_f64 = 2.0 ** -1022.0 _float64_ma = MachArLike(_f64, machep=-52, negep=-53, minexp=-1022, maxexp=1024, it=52, iexp=11, ibeta=2, irnd=5, ngrd=0, eps=2.0 ** -52.0, epsneg=_epsneg_f64, huge=(1.0 - _epsneg_f64) / _tiny_f64 * _f64(4), tiny=_tiny_f64) # Known parameters for IEEE 754 128-bit binary float _ld = ntypes.longdouble _epsneg_f128 = exp2(_ld(-113)) _tiny_f128 = exp2(_ld(-16382)) # Ignore runtime error when this is not f128 with numeric.errstate(all='ignore'): _huge_f128 = (_ld(1) - _epsneg_f128) / _tiny_f128 * _ld(4) _float128_ma = MachArLike(_ld, machep=-112, negep=-113, minexp=-16382, maxexp=16384, it=112, iexp=15, ibeta=2, irnd=5, ngrd=0, eps=exp2(_ld(-112)), epsneg=_epsneg_f128, huge=_huge_f128, tiny=_tiny_f128) # Known parameters for float80 (Intel 80-bit extended precision) _epsneg_f80 = exp2(_ld(-64)) _tiny_f80 = exp2(_ld(-16382)) # Ignore runtime error when this is not f80 with numeric.errstate(all='ignore'): _huge_f80 = (_ld(1) - _epsneg_f80) / _tiny_f80 * _ld(4) _float80_ma = MachArLike(_ld, machep=-63, negep=-64, minexp=-16382, maxexp=16384, it=63, iexp=15, ibeta=2, irnd=5, ngrd=0, eps=exp2(_ld(-63)), epsneg=_epsneg_f80, huge=_huge_f80, tiny=_tiny_f80) # Guessed / known parameters for double double; see: # https://en.wikipedia.org/wiki/Quadruple-precision_floating-point_format#Double-double_arithmetic # These numbers have the same exponent range as float64, but extended number of # digits in the significand. _huge_dd = (umath.nextafter(_ld(inf), _ld(0)) if hasattr(umath, 'nextafter') # Missing on some platforms? else _float64_ma.huge) _float_dd_ma = MachArLike(_ld, machep=-105, negep=-106, minexp=-1022, maxexp=1024, it=105, iexp=11, ibeta=2, irnd=5, ngrd=0, eps=exp2(_ld(-105)), epsneg= exp2(_ld(-106)), huge=_huge_dd, tiny=exp2(_ld(-1022))) # Key to identify the floating point type. Key is result of # ftype('-0.1').newbyteorder('<').tobytes() # See: # https://perl5.git.perl.org/perl.git/blob/3118d7d684b56cbeb702af874f4326683c45f045:/Configure _KNOWN_TYPES = { b'\x9a\x99\x99\x99\x99\x99\xb9\xbf' : _float64_ma, b'\xcd\xcc\xcc\xbd' : _float32_ma, b'f\xae' : _float16_ma, # float80, first 10 bytes containing actual storage b'\xcd\xcc\xcc\xcc\xcc\xcc\xcc\xcc\xfb\xbf' : _float80_ma, # double double; low, high order (e.g. PPC 64) b'\x9a\x99\x99\x99\x99\x99Y<\x9a\x99\x99\x99\x99\x99\xb9\xbf' : _float_dd_ma, # double double; high, low order (e.g. PPC 64 le) b'\x9a\x99\x99\x99\x99\x99\xb9\xbf\x9a\x99\x99\x99\x99\x99Y<' : _float_dd_ma, # IEEE 754 128-bit binary float b'\x9a\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\xfb\xbf' : _float128_ma, } def _get_machar(ftype): """ Get MachAr instance or MachAr-like instance Get parameters for floating point type, by first trying signatures of various known floating point types, then, if none match, attempting to identify parameters by analysis. Parameters ---------- ftype : class Numpy floating point type class (e.g. ``np.float64``) Returns ------- ma_like : instance of :class:`MachAr` or :class:`MachArLike` Object giving floating point parameters for `ftype`. Warns ----- UserWarning If the binary signature of the float type is not in the dictionary of known float types. """ params = _MACHAR_PARAMS.get(ftype) if params is None: raise ValueError(repr(ftype)) # Detect known / suspected types key = ftype('-0.1').newbyteorder('<').tobytes() ma_like = _KNOWN_TYPES.get(key) # Could be 80 bit == 10 byte extended precision, where last bytes can be # random garbage. Try comparing first 10 bytes to pattern. if ma_like is None and ftype == ntypes.longdouble: ma_like = _KNOWN_TYPES.get(key[:10]) if ma_like is not None: return ma_like # Fall back to parameter discovery warnings.warn( 'Signature {} for {} does not match any known type: ' 'falling back to type probe function'.format(key, ftype), UserWarning, stacklevel=2) return _discovered_machar(ftype) def _discovered_machar(ftype): """ Create MachAr instance with found information on float types """ params = _MACHAR_PARAMS[ftype] return MachAr(lambda v: array([v], ftype), lambda v:_fr0(v.astype(params['itype']))[0], lambda v:array(_fr0(v)[0], ftype), lambda v: params['fmt'] % array(_fr0(v)[0], ftype), params['title']) class finfo(object): """ finfo(dtype) Machine limits for floating point types. Attributes ---------- bits : int The number of bits occupied by the type. eps : float The smallest representable positive number such that ``1.0 + eps != 1.0``. Type of `eps` is an appropriate floating point type. epsneg : floating point number of the appropriate type The smallest representable positive number such that ``1.0 - epsneg != 1.0``. iexp : int The number of bits in the exponent portion of the floating point representation. machar : MachAr The object which calculated these parameters and holds more detailed information. machep : int The exponent that yields `eps`. max : floating point number of the appropriate type The largest representable number. maxexp : int The smallest positive power of the base (2) that causes overflow. min : floating point number of the appropriate type The smallest representable number, typically ``-max``. minexp : int The most negative power of the base (2) consistent with there being no leading 0's in the mantissa. negep : int The exponent that yields `epsneg`. nexp : int The number of bits in the exponent including its sign and bias. nmant : int The number of bits in the mantissa. precision : int The approximate number of decimal digits to which this kind of float is precise. resolution : floating point number of the appropriate type The approximate decimal resolution of this type, i.e., ``10**-precision``. tiny : float The smallest positive usable number. Type of `tiny` is an appropriate floating point type. Parameters ---------- dtype : float, dtype, or instance Kind of floating point data-type about which to get information. See Also -------- MachAr : The implementation of the tests that produce this information. iinfo : The equivalent for integer data types. Notes ----- For developers of NumPy: do not instantiate this at the module level. The initial calculation of these parameters is expensive and negatively impacts import times. These objects are cached, so calling ``finfo()`` repeatedly inside your functions is not a problem. """ _finfo_cache = {} def __new__(cls, dtype): try: dtype = numeric.dtype(dtype) except TypeError: # In case a float instance was given dtype = numeric.dtype(type(dtype)) obj = cls._finfo_cache.get(dtype, None) if obj is not None: return obj dtypes = [dtype] newdtype = numeric.obj2sctype(dtype) if newdtype is not dtype: dtypes.append(newdtype) dtype = newdtype if not issubclass(dtype, numeric.inexact): raise ValueError("data type %r not inexact" % (dtype)) obj = cls._finfo_cache.get(dtype, None) if obj is not None: return obj if not issubclass(dtype, numeric.floating): newdtype = _convert_to_float[dtype] if newdtype is not dtype: dtypes.append(newdtype) dtype = newdtype obj = cls._finfo_cache.get(dtype, None) if obj is not None: return obj obj = object.__new__(cls)._init(dtype) for dt in dtypes: cls._finfo_cache[dt] = obj return obj def _init(self, dtype): self.dtype = numeric.dtype(dtype) machar = _get_machar(dtype) for word in ['precision', 'iexp', 'maxexp', 'minexp', 'negep', 'machep']: setattr(self, word, getattr(machar, word)) for word in ['tiny', 'resolution', 'epsneg']: setattr(self, word, getattr(machar, word).flat[0]) self.bits = self.dtype.itemsize * 8 self.max = machar.huge.flat[0] self.min = -self.max self.eps = machar.eps.flat[0] self.nexp = machar.iexp self.nmant = machar.it self.machar = machar self._str_tiny = machar._str_xmin.strip() self._str_max = machar._str_xmax.strip() self._str_epsneg = machar._str_epsneg.strip() self._str_eps = machar._str_eps.strip() self._str_resolution = machar._str_resolution.strip() return self def __str__(self): fmt = ( 'Machine parameters for %(dtype)s\n' '---------------------------------------------------------------\n' 'precision = %(precision)3s resolution = %(_str_resolution)s\n' 'machep = %(machep)6s eps = %(_str_eps)s\n' 'negep = %(negep)6s epsneg = %(_str_epsneg)s\n' 'minexp = %(minexp)6s tiny = %(_str_tiny)s\n' 'maxexp = %(maxexp)6s max = %(_str_max)s\n' 'nexp = %(nexp)6s min = -max\n' '---------------------------------------------------------------\n' ) return fmt % self.__dict__ def __repr__(self): c = self.__class__.__name__ d = self.__dict__.copy() d['klass'] = c return (("%(klass)s(resolution=%(resolution)s, min=-%(_str_max)s," " max=%(_str_max)s, dtype=%(dtype)s)") % d) class iinfo(object): """ iinfo(type) Machine limits for integer types. Attributes ---------- bits : int The number of bits occupied by the type. min : int The smallest integer expressible by the type. max : int The largest integer expressible by the type. Parameters ---------- int_type : integer type, dtype, or instance The kind of integer data type to get information about. See Also -------- finfo : The equivalent for floating point data types. Examples -------- With types: >>> ii16 = np.iinfo(np.int16) >>> ii16.min -32768 >>> ii16.max 32767 >>> ii32 = np.iinfo(np.int32) >>> ii32.min -2147483648 >>> ii32.max 2147483647 With instances: >>> ii32 = np.iinfo(np.int32(10)) >>> ii32.min -2147483648 >>> ii32.max 2147483647 """ _min_vals = {} _max_vals = {} def __init__(self, int_type): try: self.dtype = numeric.dtype(int_type) except TypeError: self.dtype = numeric.dtype(type(int_type)) self.kind = self.dtype.kind self.bits = self.dtype.itemsize * 8 self.key = "%s%d" % (self.kind, self.bits) if self.kind not in 'iu': raise ValueError("Invalid integer data type.") def min(self): """Minimum value of given dtype.""" if self.kind == 'u': return 0 else: try: val = iinfo._min_vals[self.key] except KeyError: val = int(-(1 << (self.bits-1))) iinfo._min_vals[self.key] = val return val min = property(min) def max(self): """Maximum value of given dtype.""" try: val = iinfo._max_vals[self.key] except KeyError: if self.kind == 'u': val = int((1 << self.bits) - 1) else: val = int((1 << (self.bits-1)) - 1) iinfo._max_vals[self.key] = val return val max = property(max) def __str__(self): """String representation.""" fmt = ( 'Machine parameters for %(dtype)s\n' '---------------------------------------------------------------\n' 'min = %(min)s\n' 'max = %(max)s\n' '---------------------------------------------------------------\n' ) return fmt % {'dtype': self.dtype, 'min': self.min, 'max': self.max} def __repr__(self): return "%s(min=%s, max=%s, dtype=%s)" % (self.__class__.__name__, self.min, self.max, self.dtype)
18,422
31.839572
98
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/function_base.py
from __future__ import division, absolute_import, print_function import warnings import operator from . import numeric as _nx from .numeric import (result_type, NaN, shares_memory, MAY_SHARE_BOUNDS, TooHardError,asanyarray) __all__ = ['logspace', 'linspace', 'geomspace'] def _index_deprecate(i, stacklevel=2): try: i = operator.index(i) except TypeError: msg = ("object of type {} cannot be safely interpreted as " "an integer.".format(type(i))) i = int(i) stacklevel += 1 warnings.warn(msg, DeprecationWarning, stacklevel=stacklevel) return i def linspace(start, stop, num=50, endpoint=True, retstep=False, dtype=None): """ Return evenly spaced numbers over a specified interval. Returns `num` evenly spaced samples, calculated over the interval [`start`, `stop`]. The endpoint of the interval can optionally be excluded. Parameters ---------- start : scalar The starting value of the sequence. stop : scalar The end value of the sequence, unless `endpoint` is set to False. In that case, the sequence consists of all but the last of ``num + 1`` evenly spaced samples, so that `stop` is excluded. Note that the step size changes when `endpoint` is False. num : int, optional Number of samples to generate. Default is 50. Must be non-negative. endpoint : bool, optional If True, `stop` is the last sample. Otherwise, it is not included. Default is True. retstep : bool, optional If True, return (`samples`, `step`), where `step` is the spacing between samples. dtype : dtype, optional The type of the output array. If `dtype` is not given, infer the data type from the other input arguments. .. versionadded:: 1.9.0 Returns ------- samples : ndarray There are `num` equally spaced samples in the closed interval ``[start, stop]`` or the half-open interval ``[start, stop)`` (depending on whether `endpoint` is True or False). step : float, optional Only returned if `retstep` is True Size of spacing between samples. See Also -------- arange : Similar to `linspace`, but uses a step size (instead of the number of samples). logspace : Samples uniformly distributed in log space. Examples -------- >>> np.linspace(2.0, 3.0, num=5) array([ 2. , 2.25, 2.5 , 2.75, 3. ]) >>> np.linspace(2.0, 3.0, num=5, endpoint=False) array([ 2. , 2.2, 2.4, 2.6, 2.8]) >>> np.linspace(2.0, 3.0, num=5, retstep=True) (array([ 2. , 2.25, 2.5 , 2.75, 3. ]), 0.25) Graphical illustration: >>> import matplotlib.pyplot as plt >>> N = 8 >>> y = np.zeros(N) >>> x1 = np.linspace(0, 10, N, endpoint=True) >>> x2 = np.linspace(0, 10, N, endpoint=False) >>> plt.plot(x1, y, 'o') [<matplotlib.lines.Line2D object at 0x...>] >>> plt.plot(x2, y + 0.5, 'o') [<matplotlib.lines.Line2D object at 0x...>] >>> plt.ylim([-0.5, 1]) (-0.5, 1) >>> plt.show() """ # 2016-02-25, 1.12 num = _index_deprecate(num) if num < 0: raise ValueError("Number of samples, %s, must be non-negative." % num) div = (num - 1) if endpoint else num # Convert float/complex array scalars to float, gh-3504 # and make sure one can use variables that have an __array_interface__, gh-6634 start = asanyarray(start) * 1.0 stop = asanyarray(stop) * 1.0 dt = result_type(start, stop, float(num)) if dtype is None: dtype = dt y = _nx.arange(0, num, dtype=dt) delta = stop - start # In-place multiplication y *= delta/div is faster, but prevents the multiplicant # from overriding what class is produced, and thus prevents, e.g. use of Quantities, # see gh-7142. Hence, we multiply in place only for standard scalar types. _mult_inplace = _nx.isscalar(delta) if num > 1: step = delta / div if step == 0: # Special handling for denormal numbers, gh-5437 y /= div if _mult_inplace: y *= delta else: y = y * delta else: if _mult_inplace: y *= step else: y = y * step else: # 0 and 1 item long sequences have an undefined step step = NaN # Multiply with delta to allow possible override of output class. y = y * delta y += start if endpoint and num > 1: y[-1] = stop if retstep: return y.astype(dtype, copy=False), step else: return y.astype(dtype, copy=False) def logspace(start, stop, num=50, endpoint=True, base=10.0, dtype=None): """ Return numbers spaced evenly on a log scale. In linear space, the sequence starts at ``base ** start`` (`base` to the power of `start`) and ends with ``base ** stop`` (see `endpoint` below). Parameters ---------- start : float ``base ** start`` is the starting value of the sequence. stop : float ``base ** stop`` is the final value of the sequence, unless `endpoint` is False. In that case, ``num + 1`` values are spaced over the interval in log-space, of which all but the last (a sequence of length `num`) are returned. num : integer, optional Number of samples to generate. Default is 50. endpoint : boolean, optional If true, `stop` is the last sample. Otherwise, it is not included. Default is True. base : float, optional The base of the log space. The step size between the elements in ``ln(samples) / ln(base)`` (or ``log_base(samples)``) is uniform. Default is 10.0. dtype : dtype The type of the output array. If `dtype` is not given, infer the data type from the other input arguments. Returns ------- samples : ndarray `num` samples, equally spaced on a log scale. See Also -------- arange : Similar to linspace, with the step size specified instead of the number of samples. Note that, when used with a float endpoint, the endpoint may or may not be included. linspace : Similar to logspace, but with the samples uniformly distributed in linear space, instead of log space. geomspace : Similar to logspace, but with endpoints specified directly. Notes ----- Logspace is equivalent to the code >>> y = np.linspace(start, stop, num=num, endpoint=endpoint) ... # doctest: +SKIP >>> power(base, y).astype(dtype) ... # doctest: +SKIP Examples -------- >>> np.logspace(2.0, 3.0, num=4) array([ 100. , 215.443469 , 464.15888336, 1000. ]) >>> np.logspace(2.0, 3.0, num=4, endpoint=False) array([ 100. , 177.827941 , 316.22776602, 562.34132519]) >>> np.logspace(2.0, 3.0, num=4, base=2.0) array([ 4. , 5.0396842 , 6.34960421, 8. ]) Graphical illustration: >>> import matplotlib.pyplot as plt >>> N = 10 >>> x1 = np.logspace(0.1, 1, N, endpoint=True) >>> x2 = np.logspace(0.1, 1, N, endpoint=False) >>> y = np.zeros(N) >>> plt.plot(x1, y, 'o') [<matplotlib.lines.Line2D object at 0x...>] >>> plt.plot(x2, y + 0.5, 'o') [<matplotlib.lines.Line2D object at 0x...>] >>> plt.ylim([-0.5, 1]) (-0.5, 1) >>> plt.show() """ y = linspace(start, stop, num=num, endpoint=endpoint) if dtype is None: return _nx.power(base, y) return _nx.power(base, y).astype(dtype) def geomspace(start, stop, num=50, endpoint=True, dtype=None): """ Return numbers spaced evenly on a log scale (a geometric progression). This is similar to `logspace`, but with endpoints specified directly. Each output sample is a constant multiple of the previous. Parameters ---------- start : scalar The starting value of the sequence. stop : scalar The final value of the sequence, unless `endpoint` is False. In that case, ``num + 1`` values are spaced over the interval in log-space, of which all but the last (a sequence of length `num`) are returned. num : integer, optional Number of samples to generate. Default is 50. endpoint : boolean, optional If true, `stop` is the last sample. Otherwise, it is not included. Default is True. dtype : dtype The type of the output array. If `dtype` is not given, infer the data type from the other input arguments. Returns ------- samples : ndarray `num` samples, equally spaced on a log scale. See Also -------- logspace : Similar to geomspace, but with endpoints specified using log and base. linspace : Similar to geomspace, but with arithmetic instead of geometric progression. arange : Similar to linspace, with the step size specified instead of the number of samples. Notes ----- If the inputs or dtype are complex, the output will follow a logarithmic spiral in the complex plane. (There are an infinite number of spirals passing through two points; the output will follow the shortest such path.) Examples -------- >>> np.geomspace(1, 1000, num=4) array([ 1., 10., 100., 1000.]) >>> np.geomspace(1, 1000, num=3, endpoint=False) array([ 1., 10., 100.]) >>> np.geomspace(1, 1000, num=4, endpoint=False) array([ 1. , 5.62341325, 31.6227766 , 177.827941 ]) >>> np.geomspace(1, 256, num=9) array([ 1., 2., 4., 8., 16., 32., 64., 128., 256.]) Note that the above may not produce exact integers: >>> np.geomspace(1, 256, num=9, dtype=int) array([ 1, 2, 4, 7, 16, 32, 63, 127, 256]) >>> np.around(np.geomspace(1, 256, num=9)).astype(int) array([ 1, 2, 4, 8, 16, 32, 64, 128, 256]) Negative, decreasing, and complex inputs are allowed: >>> np.geomspace(1000, 1, num=4) array([ 1000., 100., 10., 1.]) >>> np.geomspace(-1000, -1, num=4) array([-1000., -100., -10., -1.]) >>> np.geomspace(1j, 1000j, num=4) # Straight line array([ 0. +1.j, 0. +10.j, 0. +100.j, 0.+1000.j]) >>> np.geomspace(-1+0j, 1+0j, num=5) # Circle array([-1.00000000+0.j , -0.70710678+0.70710678j, 0.00000000+1.j , 0.70710678+0.70710678j, 1.00000000+0.j ]) Graphical illustration of ``endpoint`` parameter: >>> import matplotlib.pyplot as plt >>> N = 10 >>> y = np.zeros(N) >>> plt.semilogx(np.geomspace(1, 1000, N, endpoint=True), y + 1, 'o') >>> plt.semilogx(np.geomspace(1, 1000, N, endpoint=False), y + 2, 'o') >>> plt.axis([0.5, 2000, 0, 3]) >>> plt.grid(True, color='0.7', linestyle='-', which='both', axis='both') >>> plt.show() """ if start == 0 or stop == 0: raise ValueError('Geometric sequence cannot include zero') dt = result_type(start, stop, float(num)) if dtype is None: dtype = dt else: # complex to dtype('complex128'), for instance dtype = _nx.dtype(dtype) # Avoid negligible real or imaginary parts in output by rotating to # positive real, calculating, then undoing rotation out_sign = 1 if start.real == stop.real == 0: start, stop = start.imag, stop.imag out_sign = 1j * out_sign if _nx.sign(start) == _nx.sign(stop) == -1: start, stop = -start, -stop out_sign = -out_sign # Promote both arguments to the same dtype in case, for instance, one is # complex and another is negative and log would produce NaN otherwise start = start + (stop - stop) stop = stop + (start - start) if _nx.issubdtype(dtype, _nx.complexfloating): start = start + 0j stop = stop + 0j log_start = _nx.log10(start) log_stop = _nx.log10(stop) result = out_sign * logspace(log_start, log_stop, num=num, endpoint=endpoint, base=10.0, dtype=dtype) return result.astype(dtype)
12,340
33.376045
88
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/defchararray.py
""" This module contains a set of functions for vectorized string operations and methods. .. note:: The `chararray` class exists for backwards compatibility with Numarray, it is not recommended for new development. Starting from numpy 1.4, if one needs arrays of strings, it is recommended to use arrays of `dtype` `object_`, `string_` or `unicode_`, and use the free functions in the `numpy.char` module for fast vectorized string operations. Some methods will only be available if the corresponding string method is available in your version of Python. The preferred alias for `defchararray` is `numpy.char`. """ from __future__ import division, absolute_import, print_function import sys from .numerictypes import string_, unicode_, integer, object_, bool_, character from .numeric import ndarray, compare_chararrays from .numeric import array as narray from numpy.core.multiarray import _vec_string from numpy.compat import asbytes, long import numpy __all__ = [ 'chararray', 'equal', 'not_equal', 'greater_equal', 'less_equal', 'greater', 'less', 'str_len', 'add', 'multiply', 'mod', 'capitalize', 'center', 'count', 'decode', 'encode', 'endswith', 'expandtabs', 'find', 'index', 'isalnum', 'isalpha', 'isdigit', 'islower', 'isspace', 'istitle', 'isupper', 'join', 'ljust', 'lower', 'lstrip', 'partition', 'replace', 'rfind', 'rindex', 'rjust', 'rpartition', 'rsplit', 'rstrip', 'split', 'splitlines', 'startswith', 'strip', 'swapcase', 'title', 'translate', 'upper', 'zfill', 'isnumeric', 'isdecimal', 'array', 'asarray' ] _globalvar = 0 if sys.version_info[0] >= 3: _unicode = str _bytes = bytes else: _unicode = unicode _bytes = str _len = len def _use_unicode(*args): """ Helper function for determining the output type of some string operations. For an operation on two ndarrays, if at least one is unicode, the result should be unicode. """ for x in args: if (isinstance(x, _unicode) or issubclass(numpy.asarray(x).dtype.type, unicode_)): return unicode_ return string_ def _to_string_or_unicode_array(result): """ Helper function to cast a result back into a string or unicode array if an object array must be used as an intermediary. """ return numpy.asarray(result.tolist()) def _clean_args(*args): """ Helper function for delegating arguments to Python string functions. Many of the Python string operations that have optional arguments do not use 'None' to indicate a default value. In these cases, we need to remove all `None` arguments, and those following them. """ newargs = [] for chk in args: if chk is None: break newargs.append(chk) return newargs def _get_num_chars(a): """ Helper function that returns the number of characters per field in a string or unicode array. This is to abstract out the fact that for a unicode array this is itemsize / 4. """ if issubclass(a.dtype.type, unicode_): return a.itemsize // 4 return a.itemsize def equal(x1, x2): """ Return (x1 == x2) element-wise. Unlike `numpy.equal`, this comparison is performed by first stripping whitespace characters from the end of the string. This behavior is provided for backward-compatibility with numarray. Parameters ---------- x1, x2 : array_like of str or unicode Input arrays of the same shape. Returns ------- out : ndarray or bool Output array of bools, or a single bool if x1 and x2 are scalars. See Also -------- not_equal, greater_equal, less_equal, greater, less """ return compare_chararrays(x1, x2, '==', True) def not_equal(x1, x2): """ Return (x1 != x2) element-wise. Unlike `numpy.not_equal`, this comparison is performed by first stripping whitespace characters from the end of the string. This behavior is provided for backward-compatibility with numarray. Parameters ---------- x1, x2 : array_like of str or unicode Input arrays of the same shape. Returns ------- out : ndarray or bool Output array of bools, or a single bool if x1 and x2 are scalars. See Also -------- equal, greater_equal, less_equal, greater, less """ return compare_chararrays(x1, x2, '!=', True) def greater_equal(x1, x2): """ Return (x1 >= x2) element-wise. Unlike `numpy.greater_equal`, this comparison is performed by first stripping whitespace characters from the end of the string. This behavior is provided for backward-compatibility with numarray. Parameters ---------- x1, x2 : array_like of str or unicode Input arrays of the same shape. Returns ------- out : ndarray or bool Output array of bools, or a single bool if x1 and x2 are scalars. See Also -------- equal, not_equal, less_equal, greater, less """ return compare_chararrays(x1, x2, '>=', True) def less_equal(x1, x2): """ Return (x1 <= x2) element-wise. Unlike `numpy.less_equal`, this comparison is performed by first stripping whitespace characters from the end of the string. This behavior is provided for backward-compatibility with numarray. Parameters ---------- x1, x2 : array_like of str or unicode Input arrays of the same shape. Returns ------- out : ndarray or bool Output array of bools, or a single bool if x1 and x2 are scalars. See Also -------- equal, not_equal, greater_equal, greater, less """ return compare_chararrays(x1, x2, '<=', True) def greater(x1, x2): """ Return (x1 > x2) element-wise. Unlike `numpy.greater`, this comparison is performed by first stripping whitespace characters from the end of the string. This behavior is provided for backward-compatibility with numarray. Parameters ---------- x1, x2 : array_like of str or unicode Input arrays of the same shape. Returns ------- out : ndarray or bool Output array of bools, or a single bool if x1 and x2 are scalars. See Also -------- equal, not_equal, greater_equal, less_equal, less """ return compare_chararrays(x1, x2, '>', True) def less(x1, x2): """ Return (x1 < x2) element-wise. Unlike `numpy.greater`, this comparison is performed by first stripping whitespace characters from the end of the string. This behavior is provided for backward-compatibility with numarray. Parameters ---------- x1, x2 : array_like of str or unicode Input arrays of the same shape. Returns ------- out : ndarray or bool Output array of bools, or a single bool if x1 and x2 are scalars. See Also -------- equal, not_equal, greater_equal, less_equal, greater """ return compare_chararrays(x1, x2, '<', True) def str_len(a): """ Return len(a) element-wise. Parameters ---------- a : array_like of str or unicode Returns ------- out : ndarray Output array of integers See also -------- __builtin__.len """ return _vec_string(a, integer, '__len__') def add(x1, x2): """ Return element-wise string concatenation for two arrays of str or unicode. Arrays `x1` and `x2` must have the same shape. Parameters ---------- x1 : array_like of str or unicode Input array. x2 : array_like of str or unicode Input array. Returns ------- add : ndarray Output array of `string_` or `unicode_`, depending on input types of the same shape as `x1` and `x2`. """ arr1 = numpy.asarray(x1) arr2 = numpy.asarray(x2) out_size = _get_num_chars(arr1) + _get_num_chars(arr2) dtype = _use_unicode(arr1, arr2) return _vec_string(arr1, (dtype, out_size), '__add__', (arr2,)) def multiply(a, i): """ Return (a * i), that is string multiple concatenation, element-wise. Values in `i` of less than 0 are treated as 0 (which yields an empty string). Parameters ---------- a : array_like of str or unicode i : array_like of ints Returns ------- out : ndarray Output array of str or unicode, depending on input types """ a_arr = numpy.asarray(a) i_arr = numpy.asarray(i) if not issubclass(i_arr.dtype.type, integer): raise ValueError("Can only multiply by integers") out_size = _get_num_chars(a_arr) * max(long(i_arr.max()), 0) return _vec_string( a_arr, (a_arr.dtype.type, out_size), '__mul__', (i_arr,)) def mod(a, values): """ Return (a % i), that is pre-Python 2.6 string formatting (iterpolation), element-wise for a pair of array_likes of str or unicode. Parameters ---------- a : array_like of str or unicode values : array_like of values These values will be element-wise interpolated into the string. Returns ------- out : ndarray Output array of str or unicode, depending on input types See also -------- str.__mod__ """ return _to_string_or_unicode_array( _vec_string(a, object_, '__mod__', (values,))) def capitalize(a): """ Return a copy of `a` with only the first character of each element capitalized. Calls `str.capitalize` element-wise. For 8-bit strings, this method is locale-dependent. Parameters ---------- a : array_like of str or unicode Input array of strings to capitalize. Returns ------- out : ndarray Output array of str or unicode, depending on input types See also -------- str.capitalize Examples -------- >>> c = np.array(['a1b2','1b2a','b2a1','2a1b'],'S4'); c array(['a1b2', '1b2a', 'b2a1', '2a1b'], dtype='|S4') >>> np.char.capitalize(c) array(['A1b2', '1b2a', 'B2a1', '2a1b'], dtype='|S4') """ a_arr = numpy.asarray(a) return _vec_string(a_arr, a_arr.dtype, 'capitalize') def center(a, width, fillchar=' '): """ Return a copy of `a` with its elements centered in a string of length `width`. Calls `str.center` element-wise. Parameters ---------- a : array_like of str or unicode width : int The length of the resulting strings fillchar : str or unicode, optional The padding character to use (default is space). Returns ------- out : ndarray Output array of str or unicode, depending on input types See also -------- str.center """ a_arr = numpy.asarray(a) width_arr = numpy.asarray(width) size = long(numpy.max(width_arr.flat)) if numpy.issubdtype(a_arr.dtype, numpy.string_): fillchar = asbytes(fillchar) return _vec_string( a_arr, (a_arr.dtype.type, size), 'center', (width_arr, fillchar)) def count(a, sub, start=0, end=None): """ Returns an array with the number of non-overlapping occurrences of substring `sub` in the range [`start`, `end`]. Calls `str.count` element-wise. Parameters ---------- a : array_like of str or unicode sub : str or unicode The substring to search for. start, end : int, optional Optional arguments `start` and `end` are interpreted as slice notation to specify the range in which to count. Returns ------- out : ndarray Output array of ints. See also -------- str.count Examples -------- >>> c = np.array(['aAaAaA', ' aA ', 'abBABba']) >>> c array(['aAaAaA', ' aA ', 'abBABba'], dtype='|S7') >>> np.char.count(c, 'A') array([3, 1, 1]) >>> np.char.count(c, 'aA') array([3, 1, 0]) >>> np.char.count(c, 'A', start=1, end=4) array([2, 1, 1]) >>> np.char.count(c, 'A', start=1, end=3) array([1, 0, 0]) """ return _vec_string(a, integer, 'count', [sub, start] + _clean_args(end)) def decode(a, encoding=None, errors=None): """ Calls `str.decode` element-wise. The set of available codecs comes from the Python standard library, and may be extended at runtime. For more information, see the :mod:`codecs` module. Parameters ---------- a : array_like of str or unicode encoding : str, optional The name of an encoding errors : str, optional Specifies how to handle encoding errors Returns ------- out : ndarray See also -------- str.decode Notes ----- The type of the result will depend on the encoding specified. Examples -------- >>> c = np.array(['aAaAaA', ' aA ', 'abBABba']) >>> c array(['aAaAaA', ' aA ', 'abBABba'], dtype='|S7') >>> np.char.encode(c, encoding='cp037') array(['\\x81\\xc1\\x81\\xc1\\x81\\xc1', '@@\\x81\\xc1@@', '\\x81\\x82\\xc2\\xc1\\xc2\\x82\\x81'], dtype='|S7') """ return _to_string_or_unicode_array( _vec_string(a, object_, 'decode', _clean_args(encoding, errors))) def encode(a, encoding=None, errors=None): """ Calls `str.encode` element-wise. The set of available codecs comes from the Python standard library, and may be extended at runtime. For more information, see the codecs module. Parameters ---------- a : array_like of str or unicode encoding : str, optional The name of an encoding errors : str, optional Specifies how to handle encoding errors Returns ------- out : ndarray See also -------- str.encode Notes ----- The type of the result will depend on the encoding specified. """ return _to_string_or_unicode_array( _vec_string(a, object_, 'encode', _clean_args(encoding, errors))) def endswith(a, suffix, start=0, end=None): """ Returns a boolean array which is `True` where the string element in `a` ends with `suffix`, otherwise `False`. Calls `str.endswith` element-wise. Parameters ---------- a : array_like of str or unicode suffix : str start, end : int, optional With optional `start`, test beginning at that position. With optional `end`, stop comparing at that position. Returns ------- out : ndarray Outputs an array of bools. See also -------- str.endswith Examples -------- >>> s = np.array(['foo', 'bar']) >>> s[0] = 'foo' >>> s[1] = 'bar' >>> s array(['foo', 'bar'], dtype='|S3') >>> np.char.endswith(s, 'ar') array([False, True]) >>> np.char.endswith(s, 'a', start=1, end=2) array([False, True]) """ return _vec_string( a, bool_, 'endswith', [suffix, start] + _clean_args(end)) def expandtabs(a, tabsize=8): """ Return a copy of each string element where all tab characters are replaced by one or more spaces. Calls `str.expandtabs` element-wise. Return a copy of each string element where all tab characters are replaced by one or more spaces, depending on the current column and the given `tabsize`. The column number is reset to zero after each newline occurring in the string. This doesn't understand other non-printing characters or escape sequences. Parameters ---------- a : array_like of str or unicode Input array tabsize : int, optional Replace tabs with `tabsize` number of spaces. If not given defaults to 8 spaces. Returns ------- out : ndarray Output array of str or unicode, depending on input type See also -------- str.expandtabs """ return _to_string_or_unicode_array( _vec_string(a, object_, 'expandtabs', (tabsize,))) def find(a, sub, start=0, end=None): """ For each element, return the lowest index in the string where substring `sub` is found. Calls `str.find` element-wise. For each element, return the lowest index in the string where substring `sub` is found, such that `sub` is contained in the range [`start`, `end`]. Parameters ---------- a : array_like of str or unicode sub : str or unicode start, end : int, optional Optional arguments `start` and `end` are interpreted as in slice notation. Returns ------- out : ndarray or int Output array of ints. Returns -1 if `sub` is not found. See also -------- str.find """ return _vec_string( a, integer, 'find', [sub, start] + _clean_args(end)) def index(a, sub, start=0, end=None): """ Like `find`, but raises `ValueError` when the substring is not found. Calls `str.index` element-wise. Parameters ---------- a : array_like of str or unicode sub : str or unicode start, end : int, optional Returns ------- out : ndarray Output array of ints. Returns -1 if `sub` is not found. See also -------- find, str.find """ return _vec_string( a, integer, 'index', [sub, start] + _clean_args(end)) def isalnum(a): """ Returns true for each element if all characters in the string are alphanumeric and there is at least one character, false otherwise. Calls `str.isalnum` element-wise. For 8-bit strings, this method is locale-dependent. Parameters ---------- a : array_like of str or unicode Returns ------- out : ndarray Output array of str or unicode, depending on input type See also -------- str.isalnum """ return _vec_string(a, bool_, 'isalnum') def isalpha(a): """ Returns true for each element if all characters in the string are alphabetic and there is at least one character, false otherwise. Calls `str.isalpha` element-wise. For 8-bit strings, this method is locale-dependent. Parameters ---------- a : array_like of str or unicode Returns ------- out : ndarray Output array of bools See also -------- str.isalpha """ return _vec_string(a, bool_, 'isalpha') def isdigit(a): """ Returns true for each element if all characters in the string are digits and there is at least one character, false otherwise. Calls `str.isdigit` element-wise. For 8-bit strings, this method is locale-dependent. Parameters ---------- a : array_like of str or unicode Returns ------- out : ndarray Output array of bools See also -------- str.isdigit """ return _vec_string(a, bool_, 'isdigit') def islower(a): """ Returns true for each element if all cased characters in the string are lowercase and there is at least one cased character, false otherwise. Calls `str.islower` element-wise. For 8-bit strings, this method is locale-dependent. Parameters ---------- a : array_like of str or unicode Returns ------- out : ndarray Output array of bools See also -------- str.islower """ return _vec_string(a, bool_, 'islower') def isspace(a): """ Returns true for each element if there are only whitespace characters in the string and there is at least one character, false otherwise. Calls `str.isspace` element-wise. For 8-bit strings, this method is locale-dependent. Parameters ---------- a : array_like of str or unicode Returns ------- out : ndarray Output array of bools See also -------- str.isspace """ return _vec_string(a, bool_, 'isspace') def istitle(a): """ Returns true for each element if the element is a titlecased string and there is at least one character, false otherwise. Call `str.istitle` element-wise. For 8-bit strings, this method is locale-dependent. Parameters ---------- a : array_like of str or unicode Returns ------- out : ndarray Output array of bools See also -------- str.istitle """ return _vec_string(a, bool_, 'istitle') def isupper(a): """ Returns true for each element if all cased characters in the string are uppercase and there is at least one character, false otherwise. Call `str.isupper` element-wise. For 8-bit strings, this method is locale-dependent. Parameters ---------- a : array_like of str or unicode Returns ------- out : ndarray Output array of bools See also -------- str.isupper """ return _vec_string(a, bool_, 'isupper') def join(sep, seq): """ Return a string which is the concatenation of the strings in the sequence `seq`. Calls `str.join` element-wise. Parameters ---------- sep : array_like of str or unicode seq : array_like of str or unicode Returns ------- out : ndarray Output array of str or unicode, depending on input types See also -------- str.join """ return _to_string_or_unicode_array( _vec_string(sep, object_, 'join', (seq,))) def ljust(a, width, fillchar=' '): """ Return an array with the elements of `a` left-justified in a string of length `width`. Calls `str.ljust` element-wise. Parameters ---------- a : array_like of str or unicode width : int The length of the resulting strings fillchar : str or unicode, optional The character to use for padding Returns ------- out : ndarray Output array of str or unicode, depending on input type See also -------- str.ljust """ a_arr = numpy.asarray(a) width_arr = numpy.asarray(width) size = long(numpy.max(width_arr.flat)) if numpy.issubdtype(a_arr.dtype, numpy.string_): fillchar = asbytes(fillchar) return _vec_string( a_arr, (a_arr.dtype.type, size), 'ljust', (width_arr, fillchar)) def lower(a): """ Return an array with the elements converted to lowercase. Call `str.lower` element-wise. For 8-bit strings, this method is locale-dependent. Parameters ---------- a : array_like, {str, unicode} Input array. Returns ------- out : ndarray, {str, unicode} Output array of str or unicode, depending on input type See also -------- str.lower Examples -------- >>> c = np.array(['A1B C', '1BCA', 'BCA1']); c array(['A1B C', '1BCA', 'BCA1'], dtype='|S5') >>> np.char.lower(c) array(['a1b c', '1bca', 'bca1'], dtype='|S5') """ a_arr = numpy.asarray(a) return _vec_string(a_arr, a_arr.dtype, 'lower') def lstrip(a, chars=None): """ For each element in `a`, return a copy with the leading characters removed. Calls `str.lstrip` element-wise. Parameters ---------- a : array-like, {str, unicode} Input array. chars : {str, unicode}, optional The `chars` argument is a string specifying the set of characters to be removed. If omitted or None, the `chars` argument defaults to removing whitespace. The `chars` argument is not a prefix; rather, all combinations of its values are stripped. Returns ------- out : ndarray, {str, unicode} Output array of str or unicode, depending on input type See also -------- str.lstrip Examples -------- >>> c = np.array(['aAaAaA', ' aA ', 'abBABba']) >>> c array(['aAaAaA', ' aA ', 'abBABba'], dtype='|S7') The 'a' variable is unstripped from c[1] because whitespace leading. >>> np.char.lstrip(c, 'a') array(['AaAaA', ' aA ', 'bBABba'], dtype='|S7') >>> np.char.lstrip(c, 'A') # leaves c unchanged array(['aAaAaA', ' aA ', 'abBABba'], dtype='|S7') >>> (np.char.lstrip(c, ' ') == np.char.lstrip(c, '')).all() ... # XXX: is this a regression? this line now returns False ... # np.char.lstrip(c,'') does not modify c at all. True >>> (np.char.lstrip(c, ' ') == np.char.lstrip(c, None)).all() True """ a_arr = numpy.asarray(a) return _vec_string(a_arr, a_arr.dtype, 'lstrip', (chars,)) def partition(a, sep): """ Partition each element in `a` around `sep`. Calls `str.partition` element-wise. For each element in `a`, split the element as the first occurrence of `sep`, and return 3 strings containing the part before the separator, the separator itself, and the part after the separator. If the separator is not found, return 3 strings containing the string itself, followed by two empty strings. Parameters ---------- a : array_like, {str, unicode} Input array sep : {str, unicode} Separator to split each string element in `a`. Returns ------- out : ndarray, {str, unicode} Output array of str or unicode, depending on input type. The output array will have an extra dimension with 3 elements per input element. See also -------- str.partition """ return _to_string_or_unicode_array( _vec_string(a, object_, 'partition', (sep,))) def replace(a, old, new, count=None): """ For each element in `a`, return a copy of the string with all occurrences of substring `old` replaced by `new`. Calls `str.replace` element-wise. Parameters ---------- a : array-like of str or unicode old, new : str or unicode count : int, optional If the optional argument `count` is given, only the first `count` occurrences are replaced. Returns ------- out : ndarray Output array of str or unicode, depending on input type See also -------- str.replace """ return _to_string_or_unicode_array( _vec_string( a, object_, 'replace', [old, new] + _clean_args(count))) def rfind(a, sub, start=0, end=None): """ For each element in `a`, return the highest index in the string where substring `sub` is found, such that `sub` is contained within [`start`, `end`]. Calls `str.rfind` element-wise. Parameters ---------- a : array-like of str or unicode sub : str or unicode start, end : int, optional Optional arguments `start` and `end` are interpreted as in slice notation. Returns ------- out : ndarray Output array of ints. Return -1 on failure. See also -------- str.rfind """ return _vec_string( a, integer, 'rfind', [sub, start] + _clean_args(end)) def rindex(a, sub, start=0, end=None): """ Like `rfind`, but raises `ValueError` when the substring `sub` is not found. Calls `str.rindex` element-wise. Parameters ---------- a : array-like of str or unicode sub : str or unicode start, end : int, optional Returns ------- out : ndarray Output array of ints. See also -------- rfind, str.rindex """ return _vec_string( a, integer, 'rindex', [sub, start] + _clean_args(end)) def rjust(a, width, fillchar=' '): """ Return an array with the elements of `a` right-justified in a string of length `width`. Calls `str.rjust` element-wise. Parameters ---------- a : array_like of str or unicode width : int The length of the resulting strings fillchar : str or unicode, optional The character to use for padding Returns ------- out : ndarray Output array of str or unicode, depending on input type See also -------- str.rjust """ a_arr = numpy.asarray(a) width_arr = numpy.asarray(width) size = long(numpy.max(width_arr.flat)) if numpy.issubdtype(a_arr.dtype, numpy.string_): fillchar = asbytes(fillchar) return _vec_string( a_arr, (a_arr.dtype.type, size), 'rjust', (width_arr, fillchar)) def rpartition(a, sep): """ Partition (split) each element around the right-most separator. Calls `str.rpartition` element-wise. For each element in `a`, split the element as the last occurrence of `sep`, and return 3 strings containing the part before the separator, the separator itself, and the part after the separator. If the separator is not found, return 3 strings containing the string itself, followed by two empty strings. Parameters ---------- a : array_like of str or unicode Input array sep : str or unicode Right-most separator to split each element in array. Returns ------- out : ndarray Output array of string or unicode, depending on input type. The output array will have an extra dimension with 3 elements per input element. See also -------- str.rpartition """ return _to_string_or_unicode_array( _vec_string(a, object_, 'rpartition', (sep,))) def rsplit(a, sep=None, maxsplit=None): """ For each element in `a`, return a list of the words in the string, using `sep` as the delimiter string. Calls `str.rsplit` element-wise. Except for splitting from the right, `rsplit` behaves like `split`. Parameters ---------- a : array_like of str or unicode sep : str or unicode, optional If `sep` is not specified or `None`, any whitespace string is a separator. maxsplit : int, optional If `maxsplit` is given, at most `maxsplit` splits are done, the rightmost ones. Returns ------- out : ndarray Array of list objects See also -------- str.rsplit, split """ # This will return an array of lists of different sizes, so we # leave it as an object array return _vec_string( a, object_, 'rsplit', [sep] + _clean_args(maxsplit)) def rstrip(a, chars=None): """ For each element in `a`, return a copy with the trailing characters removed. Calls `str.rstrip` element-wise. Parameters ---------- a : array-like of str or unicode chars : str or unicode, optional The `chars` argument is a string specifying the set of characters to be removed. If omitted or None, the `chars` argument defaults to removing whitespace. The `chars` argument is not a suffix; rather, all combinations of its values are stripped. Returns ------- out : ndarray Output array of str or unicode, depending on input type See also -------- str.rstrip Examples -------- >>> c = np.array(['aAaAaA', 'abBABba'], dtype='S7'); c array(['aAaAaA', 'abBABba'], dtype='|S7') >>> np.char.rstrip(c, 'a') array(['aAaAaA', 'abBABb'], dtype='|S7') >>> np.char.rstrip(c, 'A') array(['aAaAa', 'abBABba'], dtype='|S7') """ a_arr = numpy.asarray(a) return _vec_string(a_arr, a_arr.dtype, 'rstrip', (chars,)) def split(a, sep=None, maxsplit=None): """ For each element in `a`, return a list of the words in the string, using `sep` as the delimiter string. Calls `str.split` element-wise. Parameters ---------- a : array_like of str or unicode sep : str or unicode, optional If `sep` is not specified or `None`, any whitespace string is a separator. maxsplit : int, optional If `maxsplit` is given, at most `maxsplit` splits are done. Returns ------- out : ndarray Array of list objects See also -------- str.split, rsplit """ # This will return an array of lists of different sizes, so we # leave it as an object array return _vec_string( a, object_, 'split', [sep] + _clean_args(maxsplit)) def splitlines(a, keepends=None): """ For each element in `a`, return a list of the lines in the element, breaking at line boundaries. Calls `str.splitlines` element-wise. Parameters ---------- a : array_like of str or unicode keepends : bool, optional Line breaks are not included in the resulting list unless keepends is given and true. Returns ------- out : ndarray Array of list objects See also -------- str.splitlines """ return _vec_string( a, object_, 'splitlines', _clean_args(keepends)) def startswith(a, prefix, start=0, end=None): """ Returns a boolean array which is `True` where the string element in `a` starts with `prefix`, otherwise `False`. Calls `str.startswith` element-wise. Parameters ---------- a : array_like of str or unicode prefix : str start, end : int, optional With optional `start`, test beginning at that position. With optional `end`, stop comparing at that position. Returns ------- out : ndarray Array of booleans See also -------- str.startswith """ return _vec_string( a, bool_, 'startswith', [prefix, start] + _clean_args(end)) def strip(a, chars=None): """ For each element in `a`, return a copy with the leading and trailing characters removed. Calls `str.strip` element-wise. Parameters ---------- a : array-like of str or unicode chars : str or unicode, optional The `chars` argument is a string specifying the set of characters to be removed. If omitted or None, the `chars` argument defaults to removing whitespace. The `chars` argument is not a prefix or suffix; rather, all combinations of its values are stripped. Returns ------- out : ndarray Output array of str or unicode, depending on input type See also -------- str.strip Examples -------- >>> c = np.array(['aAaAaA', ' aA ', 'abBABba']) >>> c array(['aAaAaA', ' aA ', 'abBABba'], dtype='|S7') >>> np.char.strip(c) array(['aAaAaA', 'aA', 'abBABba'], dtype='|S7') >>> np.char.strip(c, 'a') # 'a' unstripped from c[1] because whitespace leads array(['AaAaA', ' aA ', 'bBABb'], dtype='|S7') >>> np.char.strip(c, 'A') # 'A' unstripped from c[1] because (unprinted) ws trails array(['aAaAa', ' aA ', 'abBABba'], dtype='|S7') """ a_arr = numpy.asarray(a) return _vec_string(a_arr, a_arr.dtype, 'strip', _clean_args(chars)) def swapcase(a): """ Return element-wise a copy of the string with uppercase characters converted to lowercase and vice versa. Calls `str.swapcase` element-wise. For 8-bit strings, this method is locale-dependent. Parameters ---------- a : array_like, {str, unicode} Input array. Returns ------- out : ndarray, {str, unicode} Output array of str or unicode, depending on input type See also -------- str.swapcase Examples -------- >>> c=np.array(['a1B c','1b Ca','b Ca1','cA1b'],'S5'); c array(['a1B c', '1b Ca', 'b Ca1', 'cA1b'], dtype='|S5') >>> np.char.swapcase(c) array(['A1b C', '1B cA', 'B cA1', 'Ca1B'], dtype='|S5') """ a_arr = numpy.asarray(a) return _vec_string(a_arr, a_arr.dtype, 'swapcase') def title(a): """ Return element-wise title cased version of string or unicode. Title case words start with uppercase characters, all remaining cased characters are lowercase. Calls `str.title` element-wise. For 8-bit strings, this method is locale-dependent. Parameters ---------- a : array_like, {str, unicode} Input array. Returns ------- out : ndarray Output array of str or unicode, depending on input type See also -------- str.title Examples -------- >>> c=np.array(['a1b c','1b ca','b ca1','ca1b'],'S5'); c array(['a1b c', '1b ca', 'b ca1', 'ca1b'], dtype='|S5') >>> np.char.title(c) array(['A1B C', '1B Ca', 'B Ca1', 'Ca1B'], dtype='|S5') """ a_arr = numpy.asarray(a) return _vec_string(a_arr, a_arr.dtype, 'title') def translate(a, table, deletechars=None): """ For each element in `a`, return a copy of the string where all characters occurring in the optional argument `deletechars` are removed, and the remaining characters have been mapped through the given translation table. Calls `str.translate` element-wise. Parameters ---------- a : array-like of str or unicode table : str of length 256 deletechars : str Returns ------- out : ndarray Output array of str or unicode, depending on input type See also -------- str.translate """ a_arr = numpy.asarray(a) if issubclass(a_arr.dtype.type, unicode_): return _vec_string( a_arr, a_arr.dtype, 'translate', (table,)) else: return _vec_string( a_arr, a_arr.dtype, 'translate', [table] + _clean_args(deletechars)) def upper(a): """ Return an array with the elements converted to uppercase. Calls `str.upper` element-wise. For 8-bit strings, this method is locale-dependent. Parameters ---------- a : array_like, {str, unicode} Input array. Returns ------- out : ndarray, {str, unicode} Output array of str or unicode, depending on input type See also -------- str.upper Examples -------- >>> c = np.array(['a1b c', '1bca', 'bca1']); c array(['a1b c', '1bca', 'bca1'], dtype='|S5') >>> np.char.upper(c) array(['A1B C', '1BCA', 'BCA1'], dtype='|S5') """ a_arr = numpy.asarray(a) return _vec_string(a_arr, a_arr.dtype, 'upper') def zfill(a, width): """ Return the numeric string left-filled with zeros Calls `str.zfill` element-wise. Parameters ---------- a : array_like, {str, unicode} Input array. width : int Width of string to left-fill elements in `a`. Returns ------- out : ndarray, {str, unicode} Output array of str or unicode, depending on input type See also -------- str.zfill """ a_arr = numpy.asarray(a) width_arr = numpy.asarray(width) size = long(numpy.max(width_arr.flat)) return _vec_string( a_arr, (a_arr.dtype.type, size), 'zfill', (width_arr,)) def isnumeric(a): """ For each element, return True if there are only numeric characters in the element. Calls `unicode.isnumeric` element-wise. Numeric characters include digit characters, and all characters that have the Unicode numeric value property, e.g. ``U+2155, VULGAR FRACTION ONE FIFTH``. Parameters ---------- a : array_like, unicode Input array. Returns ------- out : ndarray, bool Array of booleans of same shape as `a`. See also -------- unicode.isnumeric """ if _use_unicode(a) != unicode_: raise TypeError("isnumeric is only available for Unicode strings and arrays") return _vec_string(a, bool_, 'isnumeric') def isdecimal(a): """ For each element, return True if there are only decimal characters in the element. Calls `unicode.isdecimal` element-wise. Decimal characters include digit characters, and all characters that that can be used to form decimal-radix numbers, e.g. ``U+0660, ARABIC-INDIC DIGIT ZERO``. Parameters ---------- a : array_like, unicode Input array. Returns ------- out : ndarray, bool Array of booleans identical in shape to `a`. See also -------- unicode.isdecimal """ if _use_unicode(a) != unicode_: raise TypeError("isnumeric is only available for Unicode strings and arrays") return _vec_string(a, bool_, 'isdecimal') class chararray(ndarray): """ chararray(shape, itemsize=1, unicode=False, buffer=None, offset=0, strides=None, order=None) Provides a convenient view on arrays of string and unicode values. .. note:: The `chararray` class exists for backwards compatibility with Numarray, it is not recommended for new development. Starting from numpy 1.4, if one needs arrays of strings, it is recommended to use arrays of `dtype` `object_`, `string_` or `unicode_`, and use the free functions in the `numpy.char` module for fast vectorized string operations. Versus a regular NumPy array of type `str` or `unicode`, this class adds the following functionality: 1) values automatically have whitespace removed from the end when indexed 2) comparison operators automatically remove whitespace from the end when comparing values 3) vectorized string operations are provided as methods (e.g. `.endswith`) and infix operators (e.g. ``"+", "*", "%"``) chararrays should be created using `numpy.char.array` or `numpy.char.asarray`, rather than this constructor directly. This constructor creates the array, using `buffer` (with `offset` and `strides`) if it is not ``None``. If `buffer` is ``None``, then constructs a new array with `strides` in "C order", unless both ``len(shape) >= 2`` and ``order='Fortran'``, in which case `strides` is in "Fortran order". Methods ------- astype argsort copy count decode dump dumps encode endswith expandtabs fill find flatten getfield index isalnum isalpha isdecimal isdigit islower isnumeric isspace istitle isupper item join ljust lower lstrip nonzero put ravel repeat replace reshape resize rfind rindex rjust rsplit rstrip searchsorted setfield setflags sort split splitlines squeeze startswith strip swapaxes swapcase take title tofile tolist tostring translate transpose upper view zfill Parameters ---------- shape : tuple Shape of the array. itemsize : int, optional Length of each array element, in number of characters. Default is 1. unicode : bool, optional Are the array elements of type unicode (True) or string (False). Default is False. buffer : int, optional Memory address of the start of the array data. Default is None, in which case a new array is created. offset : int, optional Fixed stride displacement from the beginning of an axis? Default is 0. Needs to be >=0. strides : array_like of ints, optional Strides for the array (see `ndarray.strides` for full description). Default is None. order : {'C', 'F'}, optional The order in which the array data is stored in memory: 'C' -> "row major" order (the default), 'F' -> "column major" (Fortran) order. Examples -------- >>> charar = np.chararray((3, 3)) >>> charar[:] = 'a' >>> charar chararray([['a', 'a', 'a'], ['a', 'a', 'a'], ['a', 'a', 'a']], dtype='|S1') >>> charar = np.chararray(charar.shape, itemsize=5) >>> charar[:] = 'abc' >>> charar chararray([['abc', 'abc', 'abc'], ['abc', 'abc', 'abc'], ['abc', 'abc', 'abc']], dtype='|S5') """ def __new__(subtype, shape, itemsize=1, unicode=False, buffer=None, offset=0, strides=None, order='C'): global _globalvar if unicode: dtype = unicode_ else: dtype = string_ # force itemsize to be a Python long, since using NumPy integer # types results in itemsize.itemsize being used as the size of # strings in the new array. itemsize = long(itemsize) if sys.version_info[0] >= 3 and isinstance(buffer, _unicode): # On Py3, unicode objects do not have the buffer interface filler = buffer buffer = None else: filler = None _globalvar = 1 if buffer is None: self = ndarray.__new__(subtype, shape, (dtype, itemsize), order=order) else: self = ndarray.__new__(subtype, shape, (dtype, itemsize), buffer=buffer, offset=offset, strides=strides, order=order) if filler is not None: self[...] = filler _globalvar = 0 return self def __array_finalize__(self, obj): # The b is a special case because it is used for reconstructing. if not _globalvar and self.dtype.char not in 'SUbc': raise ValueError("Can only create a chararray from string data.") def __getitem__(self, obj): val = ndarray.__getitem__(self, obj) if isinstance(val, character): temp = val.rstrip() if _len(temp) == 0: val = '' else: val = temp return val # IMPLEMENTATION NOTE: Most of the methods of this class are # direct delegations to the free functions in this module. # However, those that return an array of strings should instead # return a chararray, so some extra wrapping is required. def __eq__(self, other): """ Return (self == other) element-wise. See also -------- equal """ return equal(self, other) def __ne__(self, other): """ Return (self != other) element-wise. See also -------- not_equal """ return not_equal(self, other) def __ge__(self, other): """ Return (self >= other) element-wise. See also -------- greater_equal """ return greater_equal(self, other) def __le__(self, other): """ Return (self <= other) element-wise. See also -------- less_equal """ return less_equal(self, other) def __gt__(self, other): """ Return (self > other) element-wise. See also -------- greater """ return greater(self, other) def __lt__(self, other): """ Return (self < other) element-wise. See also -------- less """ return less(self, other) def __add__(self, other): """ Return (self + other), that is string concatenation, element-wise for a pair of array_likes of str or unicode. See also -------- add """ return asarray(add(self, other)) def __radd__(self, other): """ Return (other + self), that is string concatenation, element-wise for a pair of array_likes of `string_` or `unicode_`. See also -------- add """ return asarray(add(numpy.asarray(other), self)) def __mul__(self, i): """ Return (self * i), that is string multiple concatenation, element-wise. See also -------- multiply """ return asarray(multiply(self, i)) def __rmul__(self, i): """ Return (self * i), that is string multiple concatenation, element-wise. See also -------- multiply """ return asarray(multiply(self, i)) def __mod__(self, i): """ Return (self % i), that is pre-Python 2.6 string formatting (iterpolation), element-wise for a pair of array_likes of `string_` or `unicode_`. See also -------- mod """ return asarray(mod(self, i)) def __rmod__(self, other): return NotImplemented def argsort(self, axis=-1, kind='quicksort', order=None): """ Return the indices that sort the array lexicographically. For full documentation see `numpy.argsort`, for which this method is in fact merely a "thin wrapper." Examples -------- >>> c = np.array(['a1b c', '1b ca', 'b ca1', 'Ca1b'], 'S5') >>> c = c.view(np.chararray); c chararray(['a1b c', '1b ca', 'b ca1', 'Ca1b'], dtype='|S5') >>> c[c.argsort()] chararray(['1b ca', 'Ca1b', 'a1b c', 'b ca1'], dtype='|S5') """ return self.__array__().argsort(axis, kind, order) argsort.__doc__ = ndarray.argsort.__doc__ def capitalize(self): """ Return a copy of `self` with only the first character of each element capitalized. See also -------- char.capitalize """ return asarray(capitalize(self)) def center(self, width, fillchar=' '): """ Return a copy of `self` with its elements centered in a string of length `width`. See also -------- center """ return asarray(center(self, width, fillchar)) def count(self, sub, start=0, end=None): """ Returns an array with the number of non-overlapping occurrences of substring `sub` in the range [`start`, `end`]. See also -------- char.count """ return count(self, sub, start, end) def decode(self, encoding=None, errors=None): """ Calls `str.decode` element-wise. See also -------- char.decode """ return decode(self, encoding, errors) def encode(self, encoding=None, errors=None): """ Calls `str.encode` element-wise. See also -------- char.encode """ return encode(self, encoding, errors) def endswith(self, suffix, start=0, end=None): """ Returns a boolean array which is `True` where the string element in `self` ends with `suffix`, otherwise `False`. See also -------- char.endswith """ return endswith(self, suffix, start, end) def expandtabs(self, tabsize=8): """ Return a copy of each string element where all tab characters are replaced by one or more spaces. See also -------- char.expandtabs """ return asarray(expandtabs(self, tabsize)) def find(self, sub, start=0, end=None): """ For each element, return the lowest index in the string where substring `sub` is found. See also -------- char.find """ return find(self, sub, start, end) def index(self, sub, start=0, end=None): """ Like `find`, but raises `ValueError` when the substring is not found. See also -------- char.index """ return index(self, sub, start, end) def isalnum(self): """ Returns true for each element if all characters in the string are alphanumeric and there is at least one character, false otherwise. See also -------- char.isalnum """ return isalnum(self) def isalpha(self): """ Returns true for each element if all characters in the string are alphabetic and there is at least one character, false otherwise. See also -------- char.isalpha """ return isalpha(self) def isdigit(self): """ Returns true for each element if all characters in the string are digits and there is at least one character, false otherwise. See also -------- char.isdigit """ return isdigit(self) def islower(self): """ Returns true for each element if all cased characters in the string are lowercase and there is at least one cased character, false otherwise. See also -------- char.islower """ return islower(self) def isspace(self): """ Returns true for each element if there are only whitespace characters in the string and there is at least one character, false otherwise. See also -------- char.isspace """ return isspace(self) def istitle(self): """ Returns true for each element if the element is a titlecased string and there is at least one character, false otherwise. See also -------- char.istitle """ return istitle(self) def isupper(self): """ Returns true for each element if all cased characters in the string are uppercase and there is at least one character, false otherwise. See also -------- char.isupper """ return isupper(self) def join(self, seq): """ Return a string which is the concatenation of the strings in the sequence `seq`. See also -------- char.join """ return join(self, seq) def ljust(self, width, fillchar=' '): """ Return an array with the elements of `self` left-justified in a string of length `width`. See also -------- char.ljust """ return asarray(ljust(self, width, fillchar)) def lower(self): """ Return an array with the elements of `self` converted to lowercase. See also -------- char.lower """ return asarray(lower(self)) def lstrip(self, chars=None): """ For each element in `self`, return a copy with the leading characters removed. See also -------- char.lstrip """ return asarray(lstrip(self, chars)) def partition(self, sep): """ Partition each element in `self` around `sep`. See also -------- partition """ return asarray(partition(self, sep)) def replace(self, old, new, count=None): """ For each element in `self`, return a copy of the string with all occurrences of substring `old` replaced by `new`. See also -------- char.replace """ return asarray(replace(self, old, new, count)) def rfind(self, sub, start=0, end=None): """ For each element in `self`, return the highest index in the string where substring `sub` is found, such that `sub` is contained within [`start`, `end`]. See also -------- char.rfind """ return rfind(self, sub, start, end) def rindex(self, sub, start=0, end=None): """ Like `rfind`, but raises `ValueError` when the substring `sub` is not found. See also -------- char.rindex """ return rindex(self, sub, start, end) def rjust(self, width, fillchar=' '): """ Return an array with the elements of `self` right-justified in a string of length `width`. See also -------- char.rjust """ return asarray(rjust(self, width, fillchar)) def rpartition(self, sep): """ Partition each element in `self` around `sep`. See also -------- rpartition """ return asarray(rpartition(self, sep)) def rsplit(self, sep=None, maxsplit=None): """ For each element in `self`, return a list of the words in the string, using `sep` as the delimiter string. See also -------- char.rsplit """ return rsplit(self, sep, maxsplit) def rstrip(self, chars=None): """ For each element in `self`, return a copy with the trailing characters removed. See also -------- char.rstrip """ return asarray(rstrip(self, chars)) def split(self, sep=None, maxsplit=None): """ For each element in `self`, return a list of the words in the string, using `sep` as the delimiter string. See also -------- char.split """ return split(self, sep, maxsplit) def splitlines(self, keepends=None): """ For each element in `self`, return a list of the lines in the element, breaking at line boundaries. See also -------- char.splitlines """ return splitlines(self, keepends) def startswith(self, prefix, start=0, end=None): """ Returns a boolean array which is `True` where the string element in `self` starts with `prefix`, otherwise `False`. See also -------- char.startswith """ return startswith(self, prefix, start, end) def strip(self, chars=None): """ For each element in `self`, return a copy with the leading and trailing characters removed. See also -------- char.strip """ return asarray(strip(self, chars)) def swapcase(self): """ For each element in `self`, return a copy of the string with uppercase characters converted to lowercase and vice versa. See also -------- char.swapcase """ return asarray(swapcase(self)) def title(self): """ For each element in `self`, return a titlecased version of the string: words start with uppercase characters, all remaining cased characters are lowercase. See also -------- char.title """ return asarray(title(self)) def translate(self, table, deletechars=None): """ For each element in `self`, return a copy of the string where all characters occurring in the optional argument `deletechars` are removed, and the remaining characters have been mapped through the given translation table. See also -------- char.translate """ return asarray(translate(self, table, deletechars)) def upper(self): """ Return an array with the elements of `self` converted to uppercase. See also -------- char.upper """ return asarray(upper(self)) def zfill(self, width): """ Return the numeric string left-filled with zeros in a string of length `width`. See also -------- char.zfill """ return asarray(zfill(self, width)) def isnumeric(self): """ For each element in `self`, return True if there are only numeric characters in the element. See also -------- char.isnumeric """ return isnumeric(self) def isdecimal(self): """ For each element in `self`, return True if there are only decimal characters in the element. See also -------- char.isdecimal """ return isdecimal(self) def array(obj, itemsize=None, copy=True, unicode=None, order=None): """ Create a `chararray`. .. note:: This class is provided for numarray backward-compatibility. New code (not concerned with numarray compatibility) should use arrays of type `string_` or `unicode_` and use the free functions in :mod:`numpy.char <numpy.core.defchararray>` for fast vectorized string operations instead. Versus a regular NumPy array of type `str` or `unicode`, this class adds the following functionality: 1) values automatically have whitespace removed from the end when indexed 2) comparison operators automatically remove whitespace from the end when comparing values 3) vectorized string operations are provided as methods (e.g. `str.endswith`) and infix operators (e.g. ``+, *, %``) Parameters ---------- obj : array of str or unicode-like itemsize : int, optional `itemsize` is the number of characters per scalar in the resulting array. If `itemsize` is None, and `obj` is an object array or a Python list, the `itemsize` will be automatically determined. If `itemsize` is provided and `obj` is of type str or unicode, then the `obj` string will be chunked into `itemsize` pieces. copy : bool, optional If true (default), then the object is copied. Otherwise, a copy will only be made if __array__ returns a copy, if obj is a nested sequence, or if a copy is needed to satisfy any of the other requirements (`itemsize`, unicode, `order`, etc.). unicode : bool, optional When true, the resulting `chararray` can contain Unicode characters, when false only 8-bit characters. If unicode is `None` and `obj` is one of the following: - a `chararray`, - an ndarray of type `str` or `unicode` - a Python str or unicode object, then the unicode setting of the output array will be automatically determined. order : {'C', 'F', 'A'}, optional Specify the order of the array. If order is 'C' (default), then the array will be in C-contiguous order (last-index varies the fastest). If order is 'F', then the returned array will be in Fortran-contiguous order (first-index varies the fastest). If order is 'A', then the returned array may be in any order (either C-, Fortran-contiguous, or even discontiguous). """ if isinstance(obj, (_bytes, _unicode)): if unicode is None: if isinstance(obj, _unicode): unicode = True else: unicode = False if itemsize is None: itemsize = _len(obj) shape = _len(obj) // itemsize if unicode: if sys.maxunicode == 0xffff: # On a narrow Python build, the buffer for Unicode # strings is UCS2, which doesn't match the buffer for # NumPy Unicode types, which is ALWAYS UCS4. # Therefore, we need to convert the buffer. On Python # 2.6 and later, we can use the utf_32 codec. Earlier # versions don't have that codec, so we convert to a # numerical array that matches the input buffer, and # then use NumPy to convert it to UCS4. All of this # should happen in native endianness. obj = obj.encode('utf_32') else: obj = _unicode(obj) else: # Let the default Unicode -> string encoding (if any) take # precedence. obj = _bytes(obj) return chararray(shape, itemsize=itemsize, unicode=unicode, buffer=obj, order=order) if isinstance(obj, (list, tuple)): obj = numpy.asarray(obj) if isinstance(obj, ndarray) and issubclass(obj.dtype.type, character): # If we just have a vanilla chararray, create a chararray # view around it. if not isinstance(obj, chararray): obj = obj.view(chararray) if itemsize is None: itemsize = obj.itemsize # itemsize is in 8-bit chars, so for Unicode, we need # to divide by the size of a single Unicode character, # which for NumPy is always 4 if issubclass(obj.dtype.type, unicode_): itemsize //= 4 if unicode is None: if issubclass(obj.dtype.type, unicode_): unicode = True else: unicode = False if unicode: dtype = unicode_ else: dtype = string_ if order is not None: obj = numpy.asarray(obj, order=order) if (copy or (itemsize != obj.itemsize) or (not unicode and isinstance(obj, unicode_)) or (unicode and isinstance(obj, string_))): obj = obj.astype((dtype, long(itemsize))) return obj if isinstance(obj, ndarray) and issubclass(obj.dtype.type, object): if itemsize is None: # Since no itemsize was specified, convert the input array to # a list so the ndarray constructor will automatically # determine the itemsize for us. obj = obj.tolist() # Fall through to the default case if unicode: dtype = unicode_ else: dtype = string_ if itemsize is None: val = narray(obj, dtype=dtype, order=order, subok=True) else: val = narray(obj, dtype=(dtype, itemsize), order=order, subok=True) return val.view(chararray) def asarray(obj, itemsize=None, unicode=None, order=None): """ Convert the input to a `chararray`, copying the data only if necessary. Versus a regular NumPy array of type `str` or `unicode`, this class adds the following functionality: 1) values automatically have whitespace removed from the end when indexed 2) comparison operators automatically remove whitespace from the end when comparing values 3) vectorized string operations are provided as methods (e.g. `str.endswith`) and infix operators (e.g. ``+``, ``*``,``%``) Parameters ---------- obj : array of str or unicode-like itemsize : int, optional `itemsize` is the number of characters per scalar in the resulting array. If `itemsize` is None, and `obj` is an object array or a Python list, the `itemsize` will be automatically determined. If `itemsize` is provided and `obj` is of type str or unicode, then the `obj` string will be chunked into `itemsize` pieces. unicode : bool, optional When true, the resulting `chararray` can contain Unicode characters, when false only 8-bit characters. If unicode is `None` and `obj` is one of the following: - a `chararray`, - an ndarray of type `str` or 'unicode` - a Python str or unicode object, then the unicode setting of the output array will be automatically determined. order : {'C', 'F'}, optional Specify the order of the array. If order is 'C' (default), then the array will be in C-contiguous order (last-index varies the fastest). If order is 'F', then the returned array will be in Fortran-contiguous order (first-index varies the fastest). """ return array(obj, itemsize, copy=False, unicode=unicode, order=order)
67,369
24.13806
86
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/numerictypes.py
""" numerictypes: Define the numeric type objects This module is designed so "from numerictypes import \\*" is safe. Exported symbols include: Dictionary with all registered number types (including aliases): typeDict Type objects (not all will be available, depends on platform): see variable sctypes for which ones you have Bit-width names int8 int16 int32 int64 int128 uint8 uint16 uint32 uint64 uint128 float16 float32 float64 float96 float128 float256 complex32 complex64 complex128 complex192 complex256 complex512 datetime64 timedelta64 c-based names bool_ object_ void, str_, unicode_ byte, ubyte, short, ushort intc, uintc, intp, uintp, int_, uint, longlong, ulonglong, single, csingle, float_, complex_, longfloat, clongfloat, As part of the type-hierarchy: xx -- is bit-width generic +-> bool_ (kind=b) +-> number (kind=i) | integer | signedinteger (intxx) | byte | short | intc | intp int0 | int_ | longlong +-> unsignedinteger (uintxx) (kind=u) | ubyte | ushort | uintc | uintp uint0 | uint_ | ulonglong +-> inexact | +-> floating (floatxx) (kind=f) | | half | | single | | float_ (double) | | longfloat | \\-> complexfloating (complexxx) (kind=c) | csingle (singlecomplex) | complex_ (cfloat, cdouble) | clongfloat (longcomplex) +-> flexible | character | void (kind=V) | | str_ (string_, bytes_) (kind=S) [Python 2] | unicode_ (kind=U) [Python 2] | | bytes_ (string_) (kind=S) [Python 3] | str_ (unicode_) (kind=U) [Python 3] | \\-> object_ (not used much) (kind=O) """ from __future__ import division, absolute_import, print_function import types as _types import sys import numbers import warnings from numpy.compat import bytes, long from numpy.core.multiarray import ( typeinfo, ndarray, array, empty, dtype, datetime_data, datetime_as_string, busday_offset, busday_count, is_busday, busdaycalendar ) # we add more at the bottom __all__ = ['sctypeDict', 'sctypeNA', 'typeDict', 'typeNA', 'sctypes', 'ScalarType', 'obj2sctype', 'cast', 'nbytes', 'sctype2char', 'maximum_sctype', 'issctype', 'typecodes', 'find_common_type', 'issubdtype', 'datetime_data', 'datetime_as_string', 'busday_offset', 'busday_count', 'is_busday', 'busdaycalendar', ] # we don't export these for import *, but we do want them accessible # as numerictypes.bool, etc. if sys.version_info[0] >= 3: from builtins import bool, int, float, complex, object, str unicode = str else: from __builtin__ import bool, int, float, complex, object, unicode, str # String-handling utilities to avoid locale-dependence. # "import string" is costly to import! # Construct the translation tables directly # "A" = chr(65), "a" = chr(97) _all_chars = [chr(_m) for _m in range(256)] _ascii_upper = _all_chars[65:65+26] _ascii_lower = _all_chars[97:97+26] LOWER_TABLE = "".join(_all_chars[:65] + _ascii_lower + _all_chars[65+26:]) UPPER_TABLE = "".join(_all_chars[:97] + _ascii_upper + _all_chars[97+26:]) def english_lower(s): """ Apply English case rules to convert ASCII strings to all lower case. This is an internal utility function to replace calls to str.lower() such that we can avoid changing behavior with changing locales. In particular, Turkish has distinct dotted and dotless variants of the Latin letter "I" in both lowercase and uppercase. Thus, "I".lower() != "i" in a "tr" locale. Parameters ---------- s : str Returns ------- lowered : str Examples -------- >>> from numpy.core.numerictypes import english_lower >>> english_lower('ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789_') 'abcdefghijklmnopqrstuvwxyzabcdefghijklmnopqrstuvwxyz0123456789_' >>> english_lower('') '' """ lowered = s.translate(LOWER_TABLE) return lowered def english_upper(s): """ Apply English case rules to convert ASCII strings to all upper case. This is an internal utility function to replace calls to str.upper() such that we can avoid changing behavior with changing locales. In particular, Turkish has distinct dotted and dotless variants of the Latin letter "I" in both lowercase and uppercase. Thus, "i".upper() != "I" in a "tr" locale. Parameters ---------- s : str Returns ------- uppered : str Examples -------- >>> from numpy.core.numerictypes import english_upper >>> english_upper('ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789_') 'ABCDEFGHIJKLMNOPQRSTUVWXYZABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789_' >>> english_upper('') '' """ uppered = s.translate(UPPER_TABLE) return uppered def english_capitalize(s): """ Apply English case rules to convert the first character of an ASCII string to upper case. This is an internal utility function to replace calls to str.capitalize() such that we can avoid changing behavior with changing locales. Parameters ---------- s : str Returns ------- capitalized : str Examples -------- >>> from numpy.core.numerictypes import english_capitalize >>> english_capitalize('int8') 'Int8' >>> english_capitalize('Int8') 'Int8' >>> english_capitalize('') '' """ if s: return english_upper(s[0]) + s[1:] else: return s sctypeDict = {} # Contains all leaf-node scalar types with aliases sctypeNA = {} # Contails all leaf-node types -> numarray type equivalences allTypes = {} # Collect the types we will add to the module here def _evalname(name): k = 0 for ch in name: if ch in '0123456789': break k += 1 try: bits = int(name[k:]) except ValueError: bits = 0 base = name[:k] return base, bits def bitname(obj): """Return a bit-width name for a given type object""" name = obj.__name__ base = '' char = '' try: if name[-1] == '_': newname = name[:-1] else: newname = name info = typeinfo[english_upper(newname)] assert(info[-1] == obj) # sanity check bits = info[2] except KeyError: # bit-width name base, bits = _evalname(name) char = base[0] if name == 'bool_': char = 'b' base = 'bool' elif name == 'void': char = 'V' base = 'void' elif name == 'object_': char = 'O' base = 'object' bits = 0 elif name == 'datetime64': char = 'M' elif name == 'timedelta64': char = 'm' if sys.version_info[0] >= 3: if name == 'bytes_': char = 'S' base = 'bytes' elif name == 'str_': char = 'U' base = 'str' else: if name == 'string_': char = 'S' base = 'string' elif name == 'unicode_': char = 'U' base = 'unicode' bytes = bits // 8 if char != '' and bytes != 0: char = "%s%d" % (char, bytes) return base, bits, char def _add_types(): for a in typeinfo.keys(): name = english_lower(a) if isinstance(typeinfo[a], tuple): typeobj = typeinfo[a][-1] # define C-name and insert typenum and typechar references also allTypes[name] = typeobj sctypeDict[name] = typeobj sctypeDict[typeinfo[a][0]] = typeobj sctypeDict[typeinfo[a][1]] = typeobj else: # generic class allTypes[name] = typeinfo[a] _add_types() def _add_aliases(): for a in typeinfo.keys(): name = english_lower(a) if not isinstance(typeinfo[a], tuple): continue typeobj = typeinfo[a][-1] # insert bit-width version for this class (if relevant) base, bit, char = bitname(typeobj) if base[-3:] == 'int' or char[0] in 'ui': continue if base != '': myname = "%s%d" % (base, bit) if ((name != 'longdouble' and name != 'clongdouble') or myname not in allTypes.keys()): allTypes[myname] = typeobj sctypeDict[myname] = typeobj if base == 'complex': na_name = '%s%d' % (english_capitalize(base), bit//2) elif base == 'bool': na_name = english_capitalize(base) sctypeDict[na_name] = typeobj else: na_name = "%s%d" % (english_capitalize(base), bit) sctypeDict[na_name] = typeobj sctypeNA[na_name] = typeobj sctypeDict[na_name] = typeobj sctypeNA[typeobj] = na_name sctypeNA[typeinfo[a][0]] = na_name if char != '': sctypeDict[char] = typeobj sctypeNA[char] = na_name _add_aliases() # Integers are handled so that the int32 and int64 types should agree # exactly with NPY_INT32, NPY_INT64. We need to enforce the same checking # as is done in arrayobject.h where the order of getting a bit-width match # is long, longlong, int, short, char. def _add_integer_aliases(): _ctypes = ['LONG', 'LONGLONG', 'INT', 'SHORT', 'BYTE'] for ctype in _ctypes: val = typeinfo[ctype] bits = val[2] charname = 'i%d' % (bits//8,) ucharname = 'u%d' % (bits//8,) intname = 'int%d' % bits UIntname = 'UInt%d' % bits Intname = 'Int%d' % bits uval = typeinfo['U'+ctype] typeobj = val[-1] utypeobj = uval[-1] if intname not in allTypes.keys(): uintname = 'uint%d' % bits allTypes[intname] = typeobj allTypes[uintname] = utypeobj sctypeDict[intname] = typeobj sctypeDict[uintname] = utypeobj sctypeDict[Intname] = typeobj sctypeDict[UIntname] = utypeobj sctypeDict[charname] = typeobj sctypeDict[ucharname] = utypeobj sctypeNA[Intname] = typeobj sctypeNA[UIntname] = utypeobj sctypeNA[charname] = typeobj sctypeNA[ucharname] = utypeobj sctypeNA[typeobj] = Intname sctypeNA[utypeobj] = UIntname sctypeNA[val[0]] = Intname sctypeNA[uval[0]] = UIntname _add_integer_aliases() # We use these later void = allTypes['void'] generic = allTypes['generic'] # # Rework the Python names (so that float and complex and int are consistent # with Python usage) # def _set_up_aliases(): type_pairs = [('complex_', 'cdouble'), ('int0', 'intp'), ('uint0', 'uintp'), ('single', 'float'), ('csingle', 'cfloat'), ('singlecomplex', 'cfloat'), ('float_', 'double'), ('intc', 'int'), ('uintc', 'uint'), ('int_', 'long'), ('uint', 'ulong'), ('cfloat', 'cdouble'), ('longfloat', 'longdouble'), ('clongfloat', 'clongdouble'), ('longcomplex', 'clongdouble'), ('bool_', 'bool'), ('unicode_', 'unicode'), ('object_', 'object')] if sys.version_info[0] >= 3: type_pairs.extend([('bytes_', 'string'), ('str_', 'unicode'), ('string_', 'string')]) else: type_pairs.extend([('str_', 'string'), ('string_', 'string'), ('bytes_', 'string')]) for alias, t in type_pairs: allTypes[alias] = allTypes[t] sctypeDict[alias] = sctypeDict[t] # Remove aliases overriding python types and modules to_remove = ['ulong', 'object', 'unicode', 'int', 'long', 'float', 'complex', 'bool', 'string', 'datetime', 'timedelta'] if sys.version_info[0] >= 3: # Py3K to_remove.append('bytes') to_remove.append('str') to_remove.remove('unicode') to_remove.remove('long') for t in to_remove: try: del allTypes[t] del sctypeDict[t] except KeyError: pass _set_up_aliases() # Now, construct dictionary to lookup character codes from types _sctype2char_dict = {} def _construct_char_code_lookup(): for name in typeinfo.keys(): tup = typeinfo[name] if isinstance(tup, tuple): if tup[0] not in ['p', 'P']: _sctype2char_dict[tup[-1]] = tup[0] _construct_char_code_lookup() sctypes = {'int': [], 'uint':[], 'float':[], 'complex':[], 'others':[bool, object, bytes, unicode, void]} def _add_array_type(typename, bits): try: t = allTypes['%s%d' % (typename, bits)] except KeyError: pass else: sctypes[typename].append(t) def _set_array_types(): ibytes = [1, 2, 4, 8, 16, 32, 64] fbytes = [2, 4, 8, 10, 12, 16, 32, 64] for bytes in ibytes: bits = 8*bytes _add_array_type('int', bits) _add_array_type('uint', bits) for bytes in fbytes: bits = 8*bytes _add_array_type('float', bits) _add_array_type('complex', 2*bits) _gi = dtype('p') if _gi.type not in sctypes['int']: indx = 0 sz = _gi.itemsize _lst = sctypes['int'] while (indx < len(_lst) and sz >= _lst[indx](0).itemsize): indx += 1 sctypes['int'].insert(indx, _gi.type) sctypes['uint'].insert(indx, dtype('P').type) _set_array_types() genericTypeRank = ['bool', 'int8', 'uint8', 'int16', 'uint16', 'int32', 'uint32', 'int64', 'uint64', 'int128', 'uint128', 'float16', 'float32', 'float64', 'float80', 'float96', 'float128', 'float256', 'complex32', 'complex64', 'complex128', 'complex160', 'complex192', 'complex256', 'complex512', 'object'] def maximum_sctype(t): """ Return the scalar type of highest precision of the same kind as the input. Parameters ---------- t : dtype or dtype specifier The input data type. This can be a `dtype` object or an object that is convertible to a `dtype`. Returns ------- out : dtype The highest precision data type of the same kind (`dtype.kind`) as `t`. See Also -------- obj2sctype, mintypecode, sctype2char dtype Examples -------- >>> np.maximum_sctype(int) <type 'numpy.int64'> >>> np.maximum_sctype(np.uint8) <type 'numpy.uint64'> >>> np.maximum_sctype(complex) <type 'numpy.complex192'> >>> np.maximum_sctype(str) <type 'numpy.string_'> >>> np.maximum_sctype('i2') <type 'numpy.int64'> >>> np.maximum_sctype('f4') <type 'numpy.float96'> """ g = obj2sctype(t) if g is None: return t t = g name = t.__name__ base, bits = _evalname(name) if bits == 0: return t else: return sctypes[base][-1] def issctype(rep): """ Determines whether the given object represents a scalar data-type. Parameters ---------- rep : any If `rep` is an instance of a scalar dtype, True is returned. If not, False is returned. Returns ------- out : bool Boolean result of check whether `rep` is a scalar dtype. See Also -------- issubsctype, issubdtype, obj2sctype, sctype2char Examples -------- >>> np.issctype(np.int32) True >>> np.issctype(list) False >>> np.issctype(1.1) False Strings are also a scalar type: >>> np.issctype(np.dtype('str')) True """ if not isinstance(rep, (type, dtype)): return False try: res = obj2sctype(rep) if res and res != object_: return True return False except Exception: return False def obj2sctype(rep, default=None): """ Return the scalar dtype or NumPy equivalent of Python type of an object. Parameters ---------- rep : any The object of which the type is returned. default : any, optional If given, this is returned for objects whose types can not be determined. If not given, None is returned for those objects. Returns ------- dtype : dtype or Python type The data type of `rep`. See Also -------- sctype2char, issctype, issubsctype, issubdtype, maximum_sctype Examples -------- >>> np.obj2sctype(np.int32) <type 'numpy.int32'> >>> np.obj2sctype(np.array([1., 2.])) <type 'numpy.float64'> >>> np.obj2sctype(np.array([1.j])) <type 'numpy.complex128'> >>> np.obj2sctype(dict) <type 'numpy.object_'> >>> np.obj2sctype('string') <type 'numpy.string_'> >>> np.obj2sctype(1, default=list) <type 'list'> """ # prevent abtract classes being upcast if isinstance(rep, type) and issubclass(rep, generic): return rep # extract dtype from arrays if isinstance(rep, ndarray): return rep.dtype.type # fall back on dtype to convert try: res = dtype(rep) except Exception: return default else: return res.type def issubclass_(arg1, arg2): """ Determine if a class is a subclass of a second class. `issubclass_` is equivalent to the Python built-in ``issubclass``, except that it returns False instead of raising a TypeError if one of the arguments is not a class. Parameters ---------- arg1 : class Input class. True is returned if `arg1` is a subclass of `arg2`. arg2 : class or tuple of classes. Input class. If a tuple of classes, True is returned if `arg1` is a subclass of any of the tuple elements. Returns ------- out : bool Whether `arg1` is a subclass of `arg2` or not. See Also -------- issubsctype, issubdtype, issctype Examples -------- >>> np.issubclass_(np.int32, int) True >>> np.issubclass_(np.int32, float) False """ try: return issubclass(arg1, arg2) except TypeError: return False def issubsctype(arg1, arg2): """ Determine if the first argument is a subclass of the second argument. Parameters ---------- arg1, arg2 : dtype or dtype specifier Data-types. Returns ------- out : bool The result. See Also -------- issctype, issubdtype,obj2sctype Examples -------- >>> np.issubsctype('S8', str) True >>> np.issubsctype(np.array([1]), int) True >>> np.issubsctype(np.array([1]), float) False """ return issubclass(obj2sctype(arg1), obj2sctype(arg2)) def issubdtype(arg1, arg2): """ Returns True if first argument is a typecode lower/equal in type hierarchy. Parameters ---------- arg1, arg2 : dtype_like dtype or string representing a typecode. Returns ------- out : bool See Also -------- issubsctype, issubclass_ numpy.core.numerictypes : Overview of numpy type hierarchy. Examples -------- >>> np.issubdtype('S1', np.string_) True >>> np.issubdtype(np.float64, np.float32) False """ if not issubclass_(arg1, generic): arg1 = dtype(arg1).type if not issubclass_(arg2, generic): arg2_orig = arg2 arg2 = dtype(arg2).type if not isinstance(arg2_orig, dtype): # weird deprecated behaviour, that tried to infer np.floating from # float, and similar less obvious things, such as np.generic from # basestring mro = arg2.mro() arg2 = mro[1] if len(mro) > 1 else mro[0] def type_repr(x): """ Helper to produce clear error messages """ if not isinstance(x, type): return repr(x) elif issubclass(x, generic): return "np.{}".format(x.__name__) else: return x.__name__ # 1.14, 2017-08-01 warnings.warn( "Conversion of the second argument of issubdtype from `{raw}` " "to `{abstract}` is deprecated. In future, it will be treated " "as `{concrete} == np.dtype({raw}).type`.".format( raw=type_repr(arg2_orig), abstract=type_repr(arg2), concrete=type_repr(dtype(arg2_orig).type) ), FutureWarning, stacklevel=2 ) return issubclass(arg1, arg2) # This dictionary allows look up based on any alias for an array data-type class _typedict(dict): """ Base object for a dictionary for look-up with any alias for an array dtype. Instances of `_typedict` can not be used as dictionaries directly, first they have to be populated. """ def __getitem__(self, obj): return dict.__getitem__(self, obj2sctype(obj)) nbytes = _typedict() _alignment = _typedict() _maxvals = _typedict() _minvals = _typedict() def _construct_lookups(): for name, val in typeinfo.items(): if not isinstance(val, tuple): continue obj = val[-1] nbytes[obj] = val[2] // 8 _alignment[obj] = val[3] if (len(val) > 5): _maxvals[obj] = val[4] _minvals[obj] = val[5] else: _maxvals[obj] = None _minvals[obj] = None _construct_lookups() def sctype2char(sctype): """ Return the string representation of a scalar dtype. Parameters ---------- sctype : scalar dtype or object If a scalar dtype, the corresponding string character is returned. If an object, `sctype2char` tries to infer its scalar type and then return the corresponding string character. Returns ------- typechar : str The string character corresponding to the scalar type. Raises ------ ValueError If `sctype` is an object for which the type can not be inferred. See Also -------- obj2sctype, issctype, issubsctype, mintypecode Examples -------- >>> for sctype in [np.int32, float, complex, np.string_, np.ndarray]: ... print(np.sctype2char(sctype)) l d D S O >>> x = np.array([1., 2-1.j]) >>> np.sctype2char(x) 'D' >>> np.sctype2char(list) 'O' """ sctype = obj2sctype(sctype) if sctype is None: raise ValueError("unrecognized type") return _sctype2char_dict[sctype] # Create dictionary of casting functions that wrap sequences # indexed by type or type character cast = _typedict() try: ScalarType = [_types.IntType, _types.FloatType, _types.ComplexType, _types.LongType, _types.BooleanType, _types.StringType, _types.UnicodeType, _types.BufferType] except AttributeError: # Py3K ScalarType = [int, float, complex, int, bool, bytes, str, memoryview] ScalarType.extend(_sctype2char_dict.keys()) ScalarType = tuple(ScalarType) for key in _sctype2char_dict.keys(): cast[key] = lambda x, k=key: array(x, copy=False).astype(k) # Create the typestring lookup dictionary _typestr = _typedict() for key in _sctype2char_dict.keys(): if issubclass(key, allTypes['flexible']): _typestr[key] = _sctype2char_dict[key] else: _typestr[key] = empty((1,), key).dtype.str[1:] # Make sure all typestrings are in sctypeDict for key, val in _typestr.items(): if val not in sctypeDict: sctypeDict[val] = key # Add additional strings to the sctypeDict if sys.version_info[0] >= 3: _toadd = ['int', 'float', 'complex', 'bool', 'object', 'str', 'bytes', 'object', ('a', allTypes['bytes_'])] else: _toadd = ['int', 'float', 'complex', 'bool', 'object', 'string', ('str', allTypes['string_']), 'unicode', 'object', ('a', allTypes['string_'])] for name in _toadd: if isinstance(name, tuple): sctypeDict[name[0]] = name[1] else: sctypeDict[name] = allTypes['%s_' % name] del _toadd, name # Now add the types we've determined to this module for key in allTypes: globals()[key] = allTypes[key] __all__.append(key) del key typecodes = {'Character':'c', 'Integer':'bhilqp', 'UnsignedInteger':'BHILQP', 'Float':'efdg', 'Complex':'FDG', 'AllInteger':'bBhHiIlLqQpP', 'AllFloat':'efdgFDG', 'Datetime': 'Mm', 'All':'?bhilqpBHILQPefdgFDGSUVOMm'} # backwards compatibility --- deprecated name typeDict = sctypeDict typeNA = sctypeNA # b -> boolean # u -> unsigned integer # i -> signed integer # f -> floating point # c -> complex # M -> datetime # m -> timedelta # S -> string # U -> Unicode string # V -> record # O -> Python object _kind_list = ['b', 'u', 'i', 'f', 'c', 'S', 'U', 'V', 'O', 'M', 'm'] __test_types = '?'+typecodes['AllInteger'][:-2]+typecodes['AllFloat']+'O' __len_test_types = len(__test_types) # Keep incrementing until a common type both can be coerced to # is found. Otherwise, return None def _find_common_coerce(a, b): if a > b: return a try: thisind = __test_types.index(a.char) except ValueError: return None return _can_coerce_all([a, b], start=thisind) # Find a data-type that all data-types in a list can be coerced to def _can_coerce_all(dtypelist, start=0): N = len(dtypelist) if N == 0: return None if N == 1: return dtypelist[0] thisind = start while thisind < __len_test_types: newdtype = dtype(__test_types[thisind]) numcoerce = len([x for x in dtypelist if newdtype >= x]) if numcoerce == N: return newdtype thisind += 1 return None def _register_types(): numbers.Integral.register(integer) numbers.Complex.register(inexact) numbers.Real.register(floating) numbers.Number.register(number) _register_types() def find_common_type(array_types, scalar_types): """ Determine common type following standard coercion rules. Parameters ---------- array_types : sequence A list of dtypes or dtype convertible objects representing arrays. scalar_types : sequence A list of dtypes or dtype convertible objects representing scalars. Returns ------- datatype : dtype The common data type, which is the maximum of `array_types` ignoring `scalar_types`, unless the maximum of `scalar_types` is of a different kind (`dtype.kind`). If the kind is not understood, then None is returned. See Also -------- dtype, common_type, can_cast, mintypecode Examples -------- >>> np.find_common_type([], [np.int64, np.float32, complex]) dtype('complex128') >>> np.find_common_type([np.int64, np.float32], []) dtype('float64') The standard casting rules ensure that a scalar cannot up-cast an array unless the scalar is of a fundamentally different kind of data (i.e. under a different hierarchy in the data type hierarchy) then the array: >>> np.find_common_type([np.float32], [np.int64, np.float64]) dtype('float32') Complex is of a different type, so it up-casts the float in the `array_types` argument: >>> np.find_common_type([np.float32], [complex]) dtype('complex128') Type specifier strings are convertible to dtypes and can therefore be used instead of dtypes: >>> np.find_common_type(['f4', 'f4', 'i4'], ['c8']) dtype('complex128') """ array_types = [dtype(x) for x in array_types] scalar_types = [dtype(x) for x in scalar_types] maxa = _can_coerce_all(array_types) maxsc = _can_coerce_all(scalar_types) if maxa is None: return maxsc if maxsc is None: return maxa try: index_a = _kind_list.index(maxa.kind) index_sc = _kind_list.index(maxsc.kind) except ValueError: return None if index_sc > index_a: return _find_common_coerce(maxsc, maxa) else: return maxa
29,102
27.118841
88
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/info.py
"""Defines a multi-dimensional array and useful procedures for Numerical computation. Functions - array - NumPy Array construction - zeros - Return an array of all zeros - empty - Return an uninitialized array - shape - Return shape of sequence or array - rank - Return number of dimensions - size - Return number of elements in entire array or a certain dimension - fromstring - Construct array from (byte) string - take - Select sub-arrays using sequence of indices - put - Set sub-arrays using sequence of 1-D indices - putmask - Set portion of arrays using a mask - reshape - Return array with new shape - repeat - Repeat elements of array - choose - Construct new array from indexed array tuple - correlate - Correlate two 1-d arrays - searchsorted - Search for element in 1-d array - sum - Total sum over a specified dimension - average - Average, possibly weighted, over axis or array. - cumsum - Cumulative sum over a specified dimension - product - Total product over a specified dimension - cumproduct - Cumulative product over a specified dimension - alltrue - Logical and over an entire axis - sometrue - Logical or over an entire axis - allclose - Tests if sequences are essentially equal More Functions: - arange - Return regularly spaced array - asarray - Guarantee NumPy array - convolve - Convolve two 1-d arrays - swapaxes - Exchange axes - concatenate - Join arrays together - transpose - Permute axes - sort - Sort elements of array - argsort - Indices of sorted array - argmax - Index of largest value - argmin - Index of smallest value - inner - Innerproduct of two arrays - dot - Dot product (matrix multiplication) - outer - Outerproduct of two arrays - resize - Return array with arbitrary new shape - indices - Tuple of indices - fromfunction - Construct array from universal function - diagonal - Return diagonal array - trace - Trace of array - dump - Dump array to file object (pickle) - dumps - Return pickled string representing data - load - Return array stored in file object - loads - Return array from pickled string - ravel - Return array as 1-D - nonzero - Indices of nonzero elements for 1-D array - shape - Shape of array - where - Construct array from binary result - compress - Elements of array where condition is true - clip - Clip array between two values - ones - Array of all ones - identity - 2-D identity array (matrix) (Universal) Math Functions add logical_or exp subtract logical_xor log multiply logical_not log10 divide maximum sin divide_safe minimum sinh conjugate bitwise_and sqrt power bitwise_or tan absolute bitwise_xor tanh negative invert ceil greater left_shift fabs greater_equal right_shift floor less arccos arctan2 less_equal arcsin fmod equal arctan hypot not_equal cos around logical_and cosh sign arccosh arcsinh arctanh """ from __future__ import division, absolute_import, print_function depends = ['testing'] global_symbols = ['*']
4,692
52.329545
85
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/__init__.py
from __future__ import division, absolute_import, print_function from .info import __doc__ from numpy.version import version as __version__ # disables OpenBLAS affinity setting of the main thread that limits # python threads or processes to one core import os env_added = [] for envkey in ['OPENBLAS_MAIN_FREE', 'GOTOBLAS_MAIN_FREE']: if envkey not in os.environ: os.environ[envkey] = '1' env_added.append(envkey) try: from . import multiarray except ImportError as exc: msg = """ Importing the multiarray numpy extension module failed. Most likely you are trying to import a failed build of numpy. If you're working with a numpy git repo, try `git clean -xdf` (removes all files not under version control). Otherwise reinstall numpy. Original error was: %s """ % (exc,) raise ImportError(msg) finally: for envkey in env_added: del os.environ[envkey] del envkey del env_added del os from . import umath from . import _internal # for freeze programs from . import numerictypes as nt multiarray.set_typeDict(nt.sctypeDict) from . import numeric from .numeric import * from . import fromnumeric from .fromnumeric import * from . import defchararray as char from . import records as rec from .records import * from .memmap import * from .defchararray import chararray from . import function_base from .function_base import * from . import machar from .machar import * from . import getlimits from .getlimits import * from . import shape_base from .shape_base import * from . import einsumfunc from .einsumfunc import * del nt from .fromnumeric import amax as max, amin as min, round_ as round from .numeric import absolute as abs __all__ = ['char', 'rec', 'memmap'] __all__ += numeric.__all__ __all__ += fromnumeric.__all__ __all__ += rec.__all__ __all__ += ['chararray'] __all__ += function_base.__all__ __all__ += machar.__all__ __all__ += getlimits.__all__ __all__ += shape_base.__all__ __all__ += einsumfunc.__all__ from numpy.testing import _numpy_tester test = _numpy_tester().test bench = _numpy_tester().bench # Make it possible so that ufuncs can be pickled # Here are the loading and unloading functions # The name numpy.core._ufunc_reconstruct must be # available for unpickling to work. def _ufunc_reconstruct(module, name): # The `fromlist` kwarg is required to ensure that `mod` points to the # inner-most module rather than the parent package when module name is # nested. This makes it possible to pickle non-toplevel ufuncs such as # scipy.special.expit for instance. mod = __import__(module, fromlist=[name]) return getattr(mod, name) def _ufunc_reduce(func): from pickle import whichmodule name = func.__name__ return _ufunc_reconstruct, (whichmodule(func, name), name) import sys if sys.version_info[0] >= 3: import copyreg else: import copy_reg as copyreg copyreg.pickle(ufunc, _ufunc_reduce, _ufunc_reconstruct) # Unclutter namespace (must keep _ufunc_reconstruct for unpickling) del copyreg del sys del _ufunc_reduce
3,044
27.457944
74
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/machar.py
""" Machine arithmetics - determine the parameters of the floating-point arithmetic system Author: Pearu Peterson, September 2003 """ from __future__ import division, absolute_import, print_function __all__ = ['MachAr'] from numpy.core.fromnumeric import any from numpy.core.numeric import errstate # Need to speed this up...especially for longfloat class MachAr(object): """ Diagnosing machine parameters. Attributes ---------- ibeta : int Radix in which numbers are represented. it : int Number of base-`ibeta` digits in the floating point mantissa M. machep : int Exponent of the smallest (most negative) power of `ibeta` that, added to 1.0, gives something different from 1.0 eps : float Floating-point number ``beta**machep`` (floating point precision) negep : int Exponent of the smallest power of `ibeta` that, subtracted from 1.0, gives something different from 1.0. epsneg : float Floating-point number ``beta**negep``. iexp : int Number of bits in the exponent (including its sign and bias). minexp : int Smallest (most negative) power of `ibeta` consistent with there being no leading zeros in the mantissa. xmin : float Floating point number ``beta**minexp`` (the smallest [in magnitude] usable floating value). maxexp : int Smallest (positive) power of `ibeta` that causes overflow. xmax : float ``(1-epsneg) * beta**maxexp`` (the largest [in magnitude] usable floating value). irnd : int In ``range(6)``, information on what kind of rounding is done in addition, and on how underflow is handled. ngrd : int Number of 'guard digits' used when truncating the product of two mantissas to fit the representation. epsilon : float Same as `eps`. tiny : float Same as `xmin`. huge : float Same as `xmax`. precision : float ``- int(-log10(eps))`` resolution : float ``- 10**(-precision)`` Parameters ---------- float_conv : function, optional Function that converts an integer or integer array to a float or float array. Default is `float`. int_conv : function, optional Function that converts a float or float array to an integer or integer array. Default is `int`. float_to_float : function, optional Function that converts a float array to float. Default is `float`. Note that this does not seem to do anything useful in the current implementation. float_to_str : function, optional Function that converts a single float to a string. Default is ``lambda v:'%24.16e' %v``. title : str, optional Title that is printed in the string representation of `MachAr`. See Also -------- finfo : Machine limits for floating point types. iinfo : Machine limits for integer types. References ---------- .. [1] Press, Teukolsky, Vetterling and Flannery, "Numerical Recipes in C++," 2nd ed, Cambridge University Press, 2002, p. 31. """ def __init__(self, float_conv=float,int_conv=int, float_to_float=float, float_to_str=lambda v:'%24.16e' % v, title='Python floating point number'): """ float_conv - convert integer to float (array) int_conv - convert float (array) to integer float_to_float - convert float array to float float_to_str - convert array float to str title - description of used floating point numbers """ # We ignore all errors here because we are purposely triggering # underflow to detect the properties of the runninng arch. with errstate(under='ignore'): self._do_init(float_conv, int_conv, float_to_float, float_to_str, title) def _do_init(self, float_conv, int_conv, float_to_float, float_to_str, title): max_iterN = 10000 msg = "Did not converge after %d tries with %s" one = float_conv(1) two = one + one zero = one - one # Do we really need to do this? Aren't they 2 and 2.0? # Determine ibeta and beta a = one for _ in range(max_iterN): a = a + a temp = a + one temp1 = temp - a if any(temp1 - one != zero): break else: raise RuntimeError(msg % (_, one.dtype)) b = one for _ in range(max_iterN): b = b + b temp = a + b itemp = int_conv(temp-a) if any(itemp != 0): break else: raise RuntimeError(msg % (_, one.dtype)) ibeta = itemp beta = float_conv(ibeta) # Determine it and irnd it = -1 b = one for _ in range(max_iterN): it = it + 1 b = b * beta temp = b + one temp1 = temp - b if any(temp1 - one != zero): break else: raise RuntimeError(msg % (_, one.dtype)) betah = beta / two a = one for _ in range(max_iterN): a = a + a temp = a + one temp1 = temp - a if any(temp1 - one != zero): break else: raise RuntimeError(msg % (_, one.dtype)) temp = a + betah irnd = 0 if any(temp-a != zero): irnd = 1 tempa = a + beta temp = tempa + betah if irnd == 0 and any(temp-tempa != zero): irnd = 2 # Determine negep and epsneg negep = it + 3 betain = one / beta a = one for i in range(negep): a = a * betain b = a for _ in range(max_iterN): temp = one - a if any(temp-one != zero): break a = a * beta negep = negep - 1 # Prevent infinite loop on PPC with gcc 4.0: if negep < 0: raise RuntimeError("could not determine machine tolerance " "for 'negep', locals() -> %s" % (locals())) else: raise RuntimeError(msg % (_, one.dtype)) negep = -negep epsneg = a # Determine machep and eps machep = - it - 3 a = b for _ in range(max_iterN): temp = one + a if any(temp-one != zero): break a = a * beta machep = machep + 1 else: raise RuntimeError(msg % (_, one.dtype)) eps = a # Determine ngrd ngrd = 0 temp = one + eps if irnd == 0 and any(temp*one - one != zero): ngrd = 1 # Determine iexp i = 0 k = 1 z = betain t = one + eps nxres = 0 for _ in range(max_iterN): y = z z = y*y a = z*one # Check here for underflow temp = z*t if any(a+a == zero) or any(abs(z) >= y): break temp1 = temp * betain if any(temp1*beta == z): break i = i + 1 k = k + k else: raise RuntimeError(msg % (_, one.dtype)) if ibeta != 10: iexp = i + 1 mx = k + k else: iexp = 2 iz = ibeta while k >= iz: iz = iz * ibeta iexp = iexp + 1 mx = iz + iz - 1 # Determine minexp and xmin for _ in range(max_iterN): xmin = y y = y * betain a = y * one temp = y * t if any((a + a) != zero) and any(abs(y) < xmin): k = k + 1 temp1 = temp * betain if any(temp1*beta == y) and any(temp != y): nxres = 3 xmin = y break else: break else: raise RuntimeError(msg % (_, one.dtype)) minexp = -k # Determine maxexp, xmax if mx <= k + k - 3 and ibeta != 10: mx = mx + mx iexp = iexp + 1 maxexp = mx + minexp irnd = irnd + nxres if irnd >= 2: maxexp = maxexp - 2 i = maxexp + minexp if ibeta == 2 and not i: maxexp = maxexp - 1 if i > 20: maxexp = maxexp - 1 if any(a != y): maxexp = maxexp - 2 xmax = one - epsneg if any(xmax*one != xmax): xmax = one - beta*epsneg xmax = xmax / (xmin*beta*beta*beta) i = maxexp + minexp + 3 for j in range(i): if ibeta == 2: xmax = xmax + xmax else: xmax = xmax * beta self.ibeta = ibeta self.it = it self.negep = negep self.epsneg = float_to_float(epsneg) self._str_epsneg = float_to_str(epsneg) self.machep = machep self.eps = float_to_float(eps) self._str_eps = float_to_str(eps) self.ngrd = ngrd self.iexp = iexp self.minexp = minexp self.xmin = float_to_float(xmin) self._str_xmin = float_to_str(xmin) self.maxexp = maxexp self.xmax = float_to_float(xmax) self._str_xmax = float_to_str(xmax) self.irnd = irnd self.title = title # Commonly used parameters self.epsilon = self.eps self.tiny = self.xmin self.huge = self.xmax import math self.precision = int(-math.log10(float_to_float(self.eps))) ten = two + two + two + two + two resolution = ten ** (-self.precision) self.resolution = float_to_float(resolution) self._str_resolution = float_to_str(resolution) def __str__(self): fmt = ( 'Machine parameters for %(title)s\n' '---------------------------------------------------------------------\n' 'ibeta=%(ibeta)s it=%(it)s iexp=%(iexp)s ngrd=%(ngrd)s irnd=%(irnd)s\n' 'machep=%(machep)s eps=%(_str_eps)s (beta**machep == epsilon)\n' 'negep =%(negep)s epsneg=%(_str_epsneg)s (beta**epsneg)\n' 'minexp=%(minexp)s xmin=%(_str_xmin)s (beta**minexp == tiny)\n' 'maxexp=%(maxexp)s xmax=%(_str_xmax)s ((1-epsneg)*beta**maxexp == huge)\n' '---------------------------------------------------------------------\n' ) return fmt % self.__dict__ if __name__ == '__main__': print(MachAr())
10,789
30.457726
88
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/fromnumeric.py
"""Module containing non-deprecated functions borrowed from Numeric. """ from __future__ import division, absolute_import, print_function import types import warnings import numpy as np from .. import VisibleDeprecationWarning from . import multiarray as mu from . import umath as um from . import numerictypes as nt from .numeric import asarray, array, asanyarray, concatenate from . import _methods _dt_ = nt.sctype2char # functions that are methods __all__ = [ 'alen', 'all', 'alltrue', 'amax', 'amin', 'any', 'argmax', 'argmin', 'argpartition', 'argsort', 'around', 'choose', 'clip', 'compress', 'cumprod', 'cumproduct', 'cumsum', 'diagonal', 'mean', 'ndim', 'nonzero', 'partition', 'prod', 'product', 'ptp', 'put', 'rank', 'ravel', 'repeat', 'reshape', 'resize', 'round_', 'searchsorted', 'shape', 'size', 'sometrue', 'sort', 'squeeze', 'std', 'sum', 'swapaxes', 'take', 'trace', 'transpose', 'var', ] _gentype = types.GeneratorType # save away Python sum _sum_ = sum # functions that are now methods def _wrapit(obj, method, *args, **kwds): try: wrap = obj.__array_wrap__ except AttributeError: wrap = None result = getattr(asarray(obj), method)(*args, **kwds) if wrap: if not isinstance(result, mu.ndarray): result = asarray(result) result = wrap(result) return result def _wrapfunc(obj, method, *args, **kwds): try: return getattr(obj, method)(*args, **kwds) # An AttributeError occurs if the object does not have # such a method in its class. # A TypeError occurs if the object does have such a method # in its class, but its signature is not identical to that # of NumPy's. This situation has occurred in the case of # a downstream library like 'pandas'. except (AttributeError, TypeError): return _wrapit(obj, method, *args, **kwds) def take(a, indices, axis=None, out=None, mode='raise'): """ Take elements from an array along an axis. When axis is not None, this function does the same thing as "fancy" indexing (indexing arrays using arrays); however, it can be easier to use if you need elements along a given axis. A call such as ``np.take(arr, indices, axis=3)`` is equivalent to ``arr[:,:,:,indices,...]``. Explained without fancy indexing, this is equivalent to the following use of `ndindex`, which sets each of ``ii``, ``jj``, and ``kk`` to a tuple of indices:: Ni, Nk = a.shape[:axis], a.shape[axis+1:] Nj = indices.shape for ii in ndindex(Ni): for jj in ndindex(Nj): for kk in ndindex(Nk): out[ii + jj + kk] = a[ii + (indices[jj],) + kk] Parameters ---------- a : array_like (Ni..., M, Nk...) The source array. indices : array_like (Nj...) The indices of the values to extract. .. versionadded:: 1.8.0 Also allow scalars for indices. axis : int, optional The axis over which to select values. By default, the flattened input array is used. out : ndarray, optional (Ni..., Nj..., Nk...) If provided, the result will be placed in this array. It should be of the appropriate shape and dtype. mode : {'raise', 'wrap', 'clip'}, optional Specifies how out-of-bounds indices will behave. * 'raise' -- raise an error (default) * 'wrap' -- wrap around * 'clip' -- clip to the range 'clip' mode means that all indices that are too large are replaced by the index that addresses the last element along that axis. Note that this disables indexing with negative numbers. Returns ------- out : ndarray (Ni..., Nj..., Nk...) The returned array has the same type as `a`. See Also -------- compress : Take elements using a boolean mask ndarray.take : equivalent method Notes ----- By eliminating the inner loop in the description above, and using `s_` to build simple slice objects, `take` can be expressed in terms of applying fancy indexing to each 1-d slice:: Ni, Nk = a.shape[:axis], a.shape[axis+1:] for ii in ndindex(Ni): for kk in ndindex(Nj): out[ii + s_[...,] + kk] = a[ii + s_[:,] + kk][indices] For this reason, it is equivalent to (but faster than) the following use of `apply_along_axis`:: out = np.apply_along_axis(lambda a_1d: a_1d[indices], axis, a) Examples -------- >>> a = [4, 3, 5, 7, 6, 8] >>> indices = [0, 1, 4] >>> np.take(a, indices) array([4, 3, 6]) In this example if `a` is an ndarray, "fancy" indexing can be used. >>> a = np.array(a) >>> a[indices] array([4, 3, 6]) If `indices` is not one dimensional, the output also has these dimensions. >>> np.take(a, [[0, 1], [2, 3]]) array([[4, 3], [5, 7]]) """ return _wrapfunc(a, 'take', indices, axis=axis, out=out, mode=mode) # not deprecated --- copy if necessary, view otherwise def reshape(a, newshape, order='C'): """ Gives a new shape to an array without changing its data. Parameters ---------- a : array_like Array to be reshaped. newshape : int or tuple of ints The new shape should be compatible with the original shape. If an integer, then the result will be a 1-D array of that length. One shape dimension can be -1. In this case, the value is inferred from the length of the array and remaining dimensions. order : {'C', 'F', 'A'}, optional Read the elements of `a` using this index order, and place the elements into the reshaped array using this index order. 'C' means to read / write the elements using C-like index order, with the last axis index changing fastest, back to the first axis index changing slowest. 'F' means to read / write the elements using Fortran-like index order, with the first index changing fastest, and the last index changing slowest. Note that the 'C' and 'F' options take no account of the memory layout of the underlying array, and only refer to the order of indexing. 'A' means to read / write the elements in Fortran-like index order if `a` is Fortran *contiguous* in memory, C-like order otherwise. Returns ------- reshaped_array : ndarray This will be a new view object if possible; otherwise, it will be a copy. Note there is no guarantee of the *memory layout* (C- or Fortran- contiguous) of the returned array. See Also -------- ndarray.reshape : Equivalent method. Notes ----- It is not always possible to change the shape of an array without copying the data. If you want an error to be raised when the data is copied, you should assign the new shape to the shape attribute of the array:: >>> a = np.zeros((10, 2)) # A transpose makes the array non-contiguous >>> b = a.T # Taking a view makes it possible to modify the shape without modifying # the initial object. >>> c = b.view() >>> c.shape = (20) AttributeError: incompatible shape for a non-contiguous array The `order` keyword gives the index ordering both for *fetching* the values from `a`, and then *placing* the values into the output array. For example, let's say you have an array: >>> a = np.arange(6).reshape((3, 2)) >>> a array([[0, 1], [2, 3], [4, 5]]) You can think of reshaping as first raveling the array (using the given index order), then inserting the elements from the raveled array into the new array using the same kind of index ordering as was used for the raveling. >>> np.reshape(a, (2, 3)) # C-like index ordering array([[0, 1, 2], [3, 4, 5]]) >>> np.reshape(np.ravel(a), (2, 3)) # equivalent to C ravel then C reshape array([[0, 1, 2], [3, 4, 5]]) >>> np.reshape(a, (2, 3), order='F') # Fortran-like index ordering array([[0, 4, 3], [2, 1, 5]]) >>> np.reshape(np.ravel(a, order='F'), (2, 3), order='F') array([[0, 4, 3], [2, 1, 5]]) Examples -------- >>> a = np.array([[1,2,3], [4,5,6]]) >>> np.reshape(a, 6) array([1, 2, 3, 4, 5, 6]) >>> np.reshape(a, 6, order='F') array([1, 4, 2, 5, 3, 6]) >>> np.reshape(a, (3,-1)) # the unspecified value is inferred to be 2 array([[1, 2], [3, 4], [5, 6]]) """ return _wrapfunc(a, 'reshape', newshape, order=order) def choose(a, choices, out=None, mode='raise'): """ Construct an array from an index array and a set of arrays to choose from. First of all, if confused or uncertain, definitely look at the Examples - in its full generality, this function is less simple than it might seem from the following code description (below ndi = `numpy.lib.index_tricks`): ``np.choose(a,c) == np.array([c[a[I]][I] for I in ndi.ndindex(a.shape)])``. But this omits some subtleties. Here is a fully general summary: Given an "index" array (`a`) of integers and a sequence of `n` arrays (`choices`), `a` and each choice array are first broadcast, as necessary, to arrays of a common shape; calling these *Ba* and *Bchoices[i], i = 0,...,n-1* we have that, necessarily, ``Ba.shape == Bchoices[i].shape`` for each `i`. Then, a new array with shape ``Ba.shape`` is created as follows: * if ``mode=raise`` (the default), then, first of all, each element of `a` (and thus `Ba`) must be in the range `[0, n-1]`; now, suppose that `i` (in that range) is the value at the `(j0, j1, ..., jm)` position in `Ba` - then the value at the same position in the new array is the value in `Bchoices[i]` at that same position; * if ``mode=wrap``, values in `a` (and thus `Ba`) may be any (signed) integer; modular arithmetic is used to map integers outside the range `[0, n-1]` back into that range; and then the new array is constructed as above; * if ``mode=clip``, values in `a` (and thus `Ba`) may be any (signed) integer; negative integers are mapped to 0; values greater than `n-1` are mapped to `n-1`; and then the new array is constructed as above. Parameters ---------- a : int array This array must contain integers in `[0, n-1]`, where `n` is the number of choices, unless ``mode=wrap`` or ``mode=clip``, in which cases any integers are permissible. choices : sequence of arrays Choice arrays. `a` and all of the choices must be broadcastable to the same shape. If `choices` is itself an array (not recommended), then its outermost dimension (i.e., the one corresponding to ``choices.shape[0]``) is taken as defining the "sequence". out : array, optional If provided, the result will be inserted into this array. It should be of the appropriate shape and dtype. mode : {'raise' (default), 'wrap', 'clip'}, optional Specifies how indices outside `[0, n-1]` will be treated: * 'raise' : an exception is raised * 'wrap' : value becomes value mod `n` * 'clip' : values < 0 are mapped to 0, values > n-1 are mapped to n-1 Returns ------- merged_array : array The merged result. Raises ------ ValueError: shape mismatch If `a` and each choice array are not all broadcastable to the same shape. See Also -------- ndarray.choose : equivalent method Notes ----- To reduce the chance of misinterpretation, even though the following "abuse" is nominally supported, `choices` should neither be, nor be thought of as, a single array, i.e., the outermost sequence-like container should be either a list or a tuple. Examples -------- >>> choices = [[0, 1, 2, 3], [10, 11, 12, 13], ... [20, 21, 22, 23], [30, 31, 32, 33]] >>> np.choose([2, 3, 1, 0], choices ... # the first element of the result will be the first element of the ... # third (2+1) "array" in choices, namely, 20; the second element ... # will be the second element of the fourth (3+1) choice array, i.e., ... # 31, etc. ... ) array([20, 31, 12, 3]) >>> np.choose([2, 4, 1, 0], choices, mode='clip') # 4 goes to 3 (4-1) array([20, 31, 12, 3]) >>> # because there are 4 choice arrays >>> np.choose([2, 4, 1, 0], choices, mode='wrap') # 4 goes to (4 mod 4) array([20, 1, 12, 3]) >>> # i.e., 0 A couple examples illustrating how choose broadcasts: >>> a = [[1, 0, 1], [0, 1, 0], [1, 0, 1]] >>> choices = [-10, 10] >>> np.choose(a, choices) array([[ 10, -10, 10], [-10, 10, -10], [ 10, -10, 10]]) >>> # With thanks to Anne Archibald >>> a = np.array([0, 1]).reshape((2,1,1)) >>> c1 = np.array([1, 2, 3]).reshape((1,3,1)) >>> c2 = np.array([-1, -2, -3, -4, -5]).reshape((1,1,5)) >>> np.choose(a, (c1, c2)) # result is 2x3x5, res[0,:,:]=c1, res[1,:,:]=c2 array([[[ 1, 1, 1, 1, 1], [ 2, 2, 2, 2, 2], [ 3, 3, 3, 3, 3]], [[-1, -2, -3, -4, -5], [-1, -2, -3, -4, -5], [-1, -2, -3, -4, -5]]]) """ return _wrapfunc(a, 'choose', choices, out=out, mode=mode) def repeat(a, repeats, axis=None): """ Repeat elements of an array. Parameters ---------- a : array_like Input array. repeats : int or array of ints The number of repetitions for each element. `repeats` is broadcasted to fit the shape of the given axis. axis : int, optional The axis along which to repeat values. By default, use the flattened input array, and return a flat output array. Returns ------- repeated_array : ndarray Output array which has the same shape as `a`, except along the given axis. See Also -------- tile : Tile an array. Examples -------- >>> np.repeat(3, 4) array([3, 3, 3, 3]) >>> x = np.array([[1,2],[3,4]]) >>> np.repeat(x, 2) array([1, 1, 2, 2, 3, 3, 4, 4]) >>> np.repeat(x, 3, axis=1) array([[1, 1, 1, 2, 2, 2], [3, 3, 3, 4, 4, 4]]) >>> np.repeat(x, [1, 2], axis=0) array([[1, 2], [3, 4], [3, 4]]) """ return _wrapfunc(a, 'repeat', repeats, axis=axis) def put(a, ind, v, mode='raise'): """ Replaces specified elements of an array with given values. The indexing works on the flattened target array. `put` is roughly equivalent to: :: a.flat[ind] = v Parameters ---------- a : ndarray Target array. ind : array_like Target indices, interpreted as integers. v : array_like Values to place in `a` at target indices. If `v` is shorter than `ind` it will be repeated as necessary. mode : {'raise', 'wrap', 'clip'}, optional Specifies how out-of-bounds indices will behave. * 'raise' -- raise an error (default) * 'wrap' -- wrap around * 'clip' -- clip to the range 'clip' mode means that all indices that are too large are replaced by the index that addresses the last element along that axis. Note that this disables indexing with negative numbers. See Also -------- putmask, place Examples -------- >>> a = np.arange(5) >>> np.put(a, [0, 2], [-44, -55]) >>> a array([-44, 1, -55, 3, 4]) >>> a = np.arange(5) >>> np.put(a, 22, -5, mode='clip') >>> a array([ 0, 1, 2, 3, -5]) """ try: put = a.put except AttributeError: raise TypeError("argument 1 must be numpy.ndarray, " "not {name}".format(name=type(a).__name__)) return put(ind, v, mode=mode) def swapaxes(a, axis1, axis2): """ Interchange two axes of an array. Parameters ---------- a : array_like Input array. axis1 : int First axis. axis2 : int Second axis. Returns ------- a_swapped : ndarray For NumPy >= 1.10.0, if `a` is an ndarray, then a view of `a` is returned; otherwise a new array is created. For earlier NumPy versions a view of `a` is returned only if the order of the axes is changed, otherwise the input array is returned. Examples -------- >>> x = np.array([[1,2,3]]) >>> np.swapaxes(x,0,1) array([[1], [2], [3]]) >>> x = np.array([[[0,1],[2,3]],[[4,5],[6,7]]]) >>> x array([[[0, 1], [2, 3]], [[4, 5], [6, 7]]]) >>> np.swapaxes(x,0,2) array([[[0, 4], [2, 6]], [[1, 5], [3, 7]]]) """ return _wrapfunc(a, 'swapaxes', axis1, axis2) def transpose(a, axes=None): """ Permute the dimensions of an array. Parameters ---------- a : array_like Input array. axes : list of ints, optional By default, reverse the dimensions, otherwise permute the axes according to the values given. Returns ------- p : ndarray `a` with its axes permuted. A view is returned whenever possible. See Also -------- moveaxis argsort Notes ----- Use `transpose(a, argsort(axes))` to invert the transposition of tensors when using the `axes` keyword argument. Transposing a 1-D array returns an unchanged view of the original array. Examples -------- >>> x = np.arange(4).reshape((2,2)) >>> x array([[0, 1], [2, 3]]) >>> np.transpose(x) array([[0, 2], [1, 3]]) >>> x = np.ones((1, 2, 3)) >>> np.transpose(x, (1, 0, 2)).shape (2, 1, 3) """ return _wrapfunc(a, 'transpose', axes) def partition(a, kth, axis=-1, kind='introselect', order=None): """ Return a partitioned copy of an array. Creates a copy of the array with its elements rearranged in such a way that the value of the element in k-th position is in the position it would be in a sorted array. All elements smaller than the k-th element are moved before this element and all equal or greater are moved behind it. The ordering of the elements in the two partitions is undefined. .. versionadded:: 1.8.0 Parameters ---------- a : array_like Array to be sorted. kth : int or sequence of ints Element index to partition by. The k-th value of the element will be in its final sorted position and all smaller elements will be moved before it and all equal or greater elements behind it. The order all elements in the partitions is undefined. If provided with a sequence of k-th it will partition all elements indexed by k-th of them into their sorted position at once. axis : int or None, optional Axis along which to sort. If None, the array is flattened before sorting. The default is -1, which sorts along the last axis. kind : {'introselect'}, optional Selection algorithm. Default is 'introselect'. order : str or list of str, optional When `a` is an array with fields defined, this argument specifies which fields to compare first, second, etc. A single field can be specified as a string. Not all fields need be specified, but unspecified fields will still be used, in the order in which they come up in the dtype, to break ties. Returns ------- partitioned_array : ndarray Array of the same type and shape as `a`. See Also -------- ndarray.partition : Method to sort an array in-place. argpartition : Indirect partition. sort : Full sorting Notes ----- The various selection algorithms are characterized by their average speed, worst case performance, work space size, and whether they are stable. A stable sort keeps items with the same key in the same relative order. The available algorithms have the following properties: ================= ======= ============= ============ ======= kind speed worst case work space stable ================= ======= ============= ============ ======= 'introselect' 1 O(n) 0 no ================= ======= ============= ============ ======= All the partition algorithms make temporary copies of the data when partitioning along any but the last axis. Consequently, partitioning along the last axis is faster and uses less space than partitioning along any other axis. The sort order for complex numbers is lexicographic. If both the real and imaginary parts are non-nan then the order is determined by the real parts except when they are equal, in which case the order is determined by the imaginary parts. Examples -------- >>> a = np.array([3, 4, 2, 1]) >>> np.partition(a, 3) array([2, 1, 3, 4]) >>> np.partition(a, (1, 3)) array([1, 2, 3, 4]) """ if axis is None: a = asanyarray(a).flatten() axis = 0 else: a = asanyarray(a).copy(order="K") a.partition(kth, axis=axis, kind=kind, order=order) return a def argpartition(a, kth, axis=-1, kind='introselect', order=None): """ Perform an indirect partition along the given axis using the algorithm specified by the `kind` keyword. It returns an array of indices of the same shape as `a` that index data along the given axis in partitioned order. .. versionadded:: 1.8.0 Parameters ---------- a : array_like Array to sort. kth : int or sequence of ints Element index to partition by. The k-th element will be in its final sorted position and all smaller elements will be moved before it and all larger elements behind it. The order all elements in the partitions is undefined. If provided with a sequence of k-th it will partition all of them into their sorted position at once. axis : int or None, optional Axis along which to sort. The default is -1 (the last axis). If None, the flattened array is used. kind : {'introselect'}, optional Selection algorithm. Default is 'introselect' order : str or list of str, optional When `a` is an array with fields defined, this argument specifies which fields to compare first, second, etc. A single field can be specified as a string, and not all fields need be specified, but unspecified fields will still be used, in the order in which they come up in the dtype, to break ties. Returns ------- index_array : ndarray, int Array of indices that partition `a` along the specified axis. In other words, ``a[index_array]`` yields a partitioned `a`. See Also -------- partition : Describes partition algorithms used. ndarray.partition : Inplace partition. argsort : Full indirect sort Notes ----- See `partition` for notes on the different selection algorithms. Examples -------- One dimensional array: >>> x = np.array([3, 4, 2, 1]) >>> x[np.argpartition(x, 3)] array([2, 1, 3, 4]) >>> x[np.argpartition(x, (1, 3))] array([1, 2, 3, 4]) >>> x = [3, 4, 2, 1] >>> np.array(x)[np.argpartition(x, 3)] array([2, 1, 3, 4]) """ return _wrapfunc(a, 'argpartition', kth, axis=axis, kind=kind, order=order) def sort(a, axis=-1, kind='quicksort', order=None): """ Return a sorted copy of an array. Parameters ---------- a : array_like Array to be sorted. axis : int or None, optional Axis along which to sort. If None, the array is flattened before sorting. The default is -1, which sorts along the last axis. kind : {'quicksort', 'mergesort', 'heapsort'}, optional Sorting algorithm. Default is 'quicksort'. order : str or list of str, optional When `a` is an array with fields defined, this argument specifies which fields to compare first, second, etc. A single field can be specified as a string, and not all fields need be specified, but unspecified fields will still be used, in the order in which they come up in the dtype, to break ties. Returns ------- sorted_array : ndarray Array of the same type and shape as `a`. See Also -------- ndarray.sort : Method to sort an array in-place. argsort : Indirect sort. lexsort : Indirect stable sort on multiple keys. searchsorted : Find elements in a sorted array. partition : Partial sort. Notes ----- The various sorting algorithms are characterized by their average speed, worst case performance, work space size, and whether they are stable. A stable sort keeps items with the same key in the same relative order. The three available algorithms have the following properties: =========== ======= ============= ============ ======= kind speed worst case work space stable =========== ======= ============= ============ ======= 'quicksort' 1 O(n^2) 0 no 'mergesort' 2 O(n*log(n)) ~n/2 yes 'heapsort' 3 O(n*log(n)) 0 no =========== ======= ============= ============ ======= All the sort algorithms make temporary copies of the data when sorting along any but the last axis. Consequently, sorting along the last axis is faster and uses less space than sorting along any other axis. The sort order for complex numbers is lexicographic. If both the real and imaginary parts are non-nan then the order is determined by the real parts except when they are equal, in which case the order is determined by the imaginary parts. Previous to numpy 1.4.0 sorting real and complex arrays containing nan values led to undefined behaviour. In numpy versions >= 1.4.0 nan values are sorted to the end. The extended sort order is: * Real: [R, nan] * Complex: [R + Rj, R + nanj, nan + Rj, nan + nanj] where R is a non-nan real value. Complex values with the same nan placements are sorted according to the non-nan part if it exists. Non-nan values are sorted as before. .. versionadded:: 1.12.0 quicksort has been changed to an introsort which will switch heapsort when it does not make enough progress. This makes its worst case O(n*log(n)). Examples -------- >>> a = np.array([[1,4],[3,1]]) >>> np.sort(a) # sort along the last axis array([[1, 4], [1, 3]]) >>> np.sort(a, axis=None) # sort the flattened array array([1, 1, 3, 4]) >>> np.sort(a, axis=0) # sort along the first axis array([[1, 1], [3, 4]]) Use the `order` keyword to specify a field to use when sorting a structured array: >>> dtype = [('name', 'S10'), ('height', float), ('age', int)] >>> values = [('Arthur', 1.8, 41), ('Lancelot', 1.9, 38), ... ('Galahad', 1.7, 38)] >>> a = np.array(values, dtype=dtype) # create a structured array >>> np.sort(a, order='height') # doctest: +SKIP array([('Galahad', 1.7, 38), ('Arthur', 1.8, 41), ('Lancelot', 1.8999999999999999, 38)], dtype=[('name', '|S10'), ('height', '<f8'), ('age', '<i4')]) Sort by age, then height if ages are equal: >>> np.sort(a, order=['age', 'height']) # doctest: +SKIP array([('Galahad', 1.7, 38), ('Lancelot', 1.8999999999999999, 38), ('Arthur', 1.8, 41)], dtype=[('name', '|S10'), ('height', '<f8'), ('age', '<i4')]) """ if axis is None: a = asanyarray(a).flatten() axis = 0 else: a = asanyarray(a).copy(order="K") a.sort(axis=axis, kind=kind, order=order) return a def argsort(a, axis=-1, kind='quicksort', order=None): """ Returns the indices that would sort an array. Perform an indirect sort along the given axis using the algorithm specified by the `kind` keyword. It returns an array of indices of the same shape as `a` that index data along the given axis in sorted order. Parameters ---------- a : array_like Array to sort. axis : int or None, optional Axis along which to sort. The default is -1 (the last axis). If None, the flattened array is used. kind : {'quicksort', 'mergesort', 'heapsort'}, optional Sorting algorithm. order : str or list of str, optional When `a` is an array with fields defined, this argument specifies which fields to compare first, second, etc. A single field can be specified as a string, and not all fields need be specified, but unspecified fields will still be used, in the order in which they come up in the dtype, to break ties. Returns ------- index_array : ndarray, int Array of indices that sort `a` along the specified axis. If `a` is one-dimensional, ``a[index_array]`` yields a sorted `a`. See Also -------- sort : Describes sorting algorithms used. lexsort : Indirect stable sort with multiple keys. ndarray.sort : Inplace sort. argpartition : Indirect partial sort. Notes ----- See `sort` for notes on the different sorting algorithms. As of NumPy 1.4.0 `argsort` works with real/complex arrays containing nan values. The enhanced sort order is documented in `sort`. Examples -------- One dimensional array: >>> x = np.array([3, 1, 2]) >>> np.argsort(x) array([1, 2, 0]) Two-dimensional array: >>> x = np.array([[0, 3], [2, 2]]) >>> x array([[0, 3], [2, 2]]) >>> np.argsort(x, axis=0) # sorts along first axis (down) array([[0, 1], [1, 0]]) >>> np.argsort(x, axis=1) # sorts along last axis (across) array([[0, 1], [0, 1]]) Indices of the sorted elements of a N-dimensional array: >>> ind = np.unravel_index(np.argsort(x, axis=None), x.shape) >>> ind (array([0, 1, 1, 0]), array([0, 0, 1, 1])) >>> x[ind] # same as np.sort(x, axis=None) array([0, 2, 2, 3]) Sorting with keys: >>> x = np.array([(1, 0), (0, 1)], dtype=[('x', '<i4'), ('y', '<i4')]) >>> x array([(1, 0), (0, 1)], dtype=[('x', '<i4'), ('y', '<i4')]) >>> np.argsort(x, order=('x','y')) array([1, 0]) >>> np.argsort(x, order=('y','x')) array([0, 1]) """ return _wrapfunc(a, 'argsort', axis=axis, kind=kind, order=order) def argmax(a, axis=None, out=None): """ Returns the indices of the maximum values along an axis. Parameters ---------- a : array_like Input array. axis : int, optional By default, the index is into the flattened array, otherwise along the specified axis. out : array, optional If provided, the result will be inserted into this array. It should be of the appropriate shape and dtype. Returns ------- index_array : ndarray of ints Array of indices into the array. It has the same shape as `a.shape` with the dimension along `axis` removed. See Also -------- ndarray.argmax, argmin amax : The maximum value along a given axis. unravel_index : Convert a flat index into an index tuple. Notes ----- In case of multiple occurrences of the maximum values, the indices corresponding to the first occurrence are returned. Examples -------- >>> a = np.arange(6).reshape(2,3) >>> a array([[0, 1, 2], [3, 4, 5]]) >>> np.argmax(a) 5 >>> np.argmax(a, axis=0) array([1, 1, 1]) >>> np.argmax(a, axis=1) array([2, 2]) Indexes of the maximal elements of a N-dimensional array: >>> ind = np.unravel_index(np.argmax(a, axis=None), a.shape) >>> ind (1, 2) >>> a[ind] 5 >>> b = np.arange(6) >>> b[1] = 5 >>> b array([0, 5, 2, 3, 4, 5]) >>> np.argmax(b) # Only the first occurrence is returned. 1 """ return _wrapfunc(a, 'argmax', axis=axis, out=out) def argmin(a, axis=None, out=None): """ Returns the indices of the minimum values along an axis. Parameters ---------- a : array_like Input array. axis : int, optional By default, the index is into the flattened array, otherwise along the specified axis. out : array, optional If provided, the result will be inserted into this array. It should be of the appropriate shape and dtype. Returns ------- index_array : ndarray of ints Array of indices into the array. It has the same shape as `a.shape` with the dimension along `axis` removed. See Also -------- ndarray.argmin, argmax amin : The minimum value along a given axis. unravel_index : Convert a flat index into an index tuple. Notes ----- In case of multiple occurrences of the minimum values, the indices corresponding to the first occurrence are returned. Examples -------- >>> a = np.arange(6).reshape(2,3) >>> a array([[0, 1, 2], [3, 4, 5]]) >>> np.argmin(a) 0 >>> np.argmin(a, axis=0) array([0, 0, 0]) >>> np.argmin(a, axis=1) array([0, 0]) Indices of the minimum elements of a N-dimensional array: >>> ind = np.unravel_index(np.argmin(a, axis=None), a.shape) >>> ind (0, 0) >>> a[ind] 0 >>> b = np.arange(6) >>> b[4] = 0 >>> b array([0, 1, 2, 3, 0, 5]) >>> np.argmin(b) # Only the first occurrence is returned. 0 """ return _wrapfunc(a, 'argmin', axis=axis, out=out) def searchsorted(a, v, side='left', sorter=None): """ Find indices where elements should be inserted to maintain order. Find the indices into a sorted array `a` such that, if the corresponding elements in `v` were inserted before the indices, the order of `a` would be preserved. Parameters ---------- a : 1-D array_like Input array. If `sorter` is None, then it must be sorted in ascending order, otherwise `sorter` must be an array of indices that sort it. v : array_like Values to insert into `a`. side : {'left', 'right'}, optional If 'left', the index of the first suitable location found is given. If 'right', return the last such index. If there is no suitable index, return either 0 or N (where N is the length of `a`). sorter : 1-D array_like, optional Optional array of integer indices that sort array a into ascending order. They are typically the result of argsort. .. versionadded:: 1.7.0 Returns ------- indices : array of ints Array of insertion points with the same shape as `v`. See Also -------- sort : Return a sorted copy of an array. histogram : Produce histogram from 1-D data. Notes ----- Binary search is used to find the required insertion points. As of NumPy 1.4.0 `searchsorted` works with real/complex arrays containing `nan` values. The enhanced sort order is documented in `sort`. Examples -------- >>> np.searchsorted([1,2,3,4,5], 3) 2 >>> np.searchsorted([1,2,3,4,5], 3, side='right') 3 >>> np.searchsorted([1,2,3,4,5], [-10, 10, 2, 3]) array([0, 5, 1, 2]) """ return _wrapfunc(a, 'searchsorted', v, side=side, sorter=sorter) def resize(a, new_shape): """ Return a new array with the specified shape. If the new array is larger than the original array, then the new array is filled with repeated copies of `a`. Note that this behavior is different from a.resize(new_shape) which fills with zeros instead of repeated copies of `a`. Parameters ---------- a : array_like Array to be resized. new_shape : int or tuple of int Shape of resized array. Returns ------- reshaped_array : ndarray The new array is formed from the data in the old array, repeated if necessary to fill out the required number of elements. The data are repeated in the order that they are stored in memory. See Also -------- ndarray.resize : resize an array in-place. Examples -------- >>> a=np.array([[0,1],[2,3]]) >>> np.resize(a,(2,3)) array([[0, 1, 2], [3, 0, 1]]) >>> np.resize(a,(1,4)) array([[0, 1, 2, 3]]) >>> np.resize(a,(2,4)) array([[0, 1, 2, 3], [0, 1, 2, 3]]) """ if isinstance(new_shape, (int, nt.integer)): new_shape = (new_shape,) a = ravel(a) Na = len(a) total_size = um.multiply.reduce(new_shape) if Na == 0 or total_size == 0: return mu.zeros(new_shape, a.dtype) n_copies = int(total_size / Na) extra = total_size % Na if extra != 0: n_copies = n_copies + 1 extra = Na - extra a = concatenate((a,)*n_copies) if extra > 0: a = a[:-extra] return reshape(a, new_shape) def squeeze(a, axis=None): """ Remove single-dimensional entries from the shape of an array. Parameters ---------- a : array_like Input data. axis : None or int or tuple of ints, optional .. versionadded:: 1.7.0 Selects a subset of the single-dimensional entries in the shape. If an axis is selected with shape entry greater than one, an error is raised. Returns ------- squeezed : ndarray The input array, but with all or a subset of the dimensions of length 1 removed. This is always `a` itself or a view into `a`. Raises ------ ValueError If `axis` is not `None`, and an axis being squeezed is not of length 1 See Also -------- expand_dims : The inverse operation, adding singleton dimensions reshape : Insert, remove, and combine dimensions, and resize existing ones Examples -------- >>> x = np.array([[[0], [1], [2]]]) >>> x.shape (1, 3, 1) >>> np.squeeze(x).shape (3,) >>> np.squeeze(x, axis=0).shape (3, 1) >>> np.squeeze(x, axis=1).shape Traceback (most recent call last): ... ValueError: cannot select an axis to squeeze out which has size not equal to one >>> np.squeeze(x, axis=2).shape (1, 3) """ try: squeeze = a.squeeze except AttributeError: return _wrapit(a, 'squeeze') try: # First try to use the new axis= parameter return squeeze(axis=axis) except TypeError: # For backwards compatibility return squeeze() def diagonal(a, offset=0, axis1=0, axis2=1): """ Return specified diagonals. If `a` is 2-D, returns the diagonal of `a` with the given offset, i.e., the collection of elements of the form ``a[i, i+offset]``. If `a` has more than two dimensions, then the axes specified by `axis1` and `axis2` are used to determine the 2-D sub-array whose diagonal is returned. The shape of the resulting array can be determined by removing `axis1` and `axis2` and appending an index to the right equal to the size of the resulting diagonals. In versions of NumPy prior to 1.7, this function always returned a new, independent array containing a copy of the values in the diagonal. In NumPy 1.7 and 1.8, it continues to return a copy of the diagonal, but depending on this fact is deprecated. Writing to the resulting array continues to work as it used to, but a FutureWarning is issued. Starting in NumPy 1.9 it returns a read-only view on the original array. Attempting to write to the resulting array will produce an error. In some future release, it will return a read/write view and writing to the returned array will alter your original array. The returned array will have the same type as the input array. If you don't write to the array returned by this function, then you can just ignore all of the above. If you depend on the current behavior, then we suggest copying the returned array explicitly, i.e., use ``np.diagonal(a).copy()`` instead of just ``np.diagonal(a)``. This will work with both past and future versions of NumPy. Parameters ---------- a : array_like Array from which the diagonals are taken. offset : int, optional Offset of the diagonal from the main diagonal. Can be positive or negative. Defaults to main diagonal (0). axis1 : int, optional Axis to be used as the first axis of the 2-D sub-arrays from which the diagonals should be taken. Defaults to first axis (0). axis2 : int, optional Axis to be used as the second axis of the 2-D sub-arrays from which the diagonals should be taken. Defaults to second axis (1). Returns ------- array_of_diagonals : ndarray If `a` is 2-D and not a `matrix`, a 1-D array of the same type as `a` containing the diagonal is returned. If `a` is a `matrix`, a 1-D array containing the diagonal is returned in order to maintain backward compatibility. If ``a.ndim > 2``, then the dimensions specified by `axis1` and `axis2` are removed, and a new axis inserted at the end corresponding to the diagonal. Raises ------ ValueError If the dimension of `a` is less than 2. See Also -------- diag : MATLAB work-a-like for 1-D and 2-D arrays. diagflat : Create diagonal arrays. trace : Sum along diagonals. Examples -------- >>> a = np.arange(4).reshape(2,2) >>> a array([[0, 1], [2, 3]]) >>> a.diagonal() array([0, 3]) >>> a.diagonal(1) array([1]) A 3-D example: >>> a = np.arange(8).reshape(2,2,2); a array([[[0, 1], [2, 3]], [[4, 5], [6, 7]]]) >>> a.diagonal(0, # Main diagonals of two arrays created by skipping ... 0, # across the outer(left)-most axis last and ... 1) # the "middle" (row) axis first. array([[0, 6], [1, 7]]) The sub-arrays whose main diagonals we just obtained; note that each corresponds to fixing the right-most (column) axis, and that the diagonals are "packed" in rows. >>> a[:,:,0] # main diagonal is [0 6] array([[0, 2], [4, 6]]) >>> a[:,:,1] # main diagonal is [1 7] array([[1, 3], [5, 7]]) """ if isinstance(a, np.matrix): # Make diagonal of matrix 1-D to preserve backward compatibility. return asarray(a).diagonal(offset=offset, axis1=axis1, axis2=axis2) else: return asanyarray(a).diagonal(offset=offset, axis1=axis1, axis2=axis2) def trace(a, offset=0, axis1=0, axis2=1, dtype=None, out=None): """ Return the sum along diagonals of the array. If `a` is 2-D, the sum along its diagonal with the given offset is returned, i.e., the sum of elements ``a[i,i+offset]`` for all i. If `a` has more than two dimensions, then the axes specified by axis1 and axis2 are used to determine the 2-D sub-arrays whose traces are returned. The shape of the resulting array is the same as that of `a` with `axis1` and `axis2` removed. Parameters ---------- a : array_like Input array, from which the diagonals are taken. offset : int, optional Offset of the diagonal from the main diagonal. Can be both positive and negative. Defaults to 0. axis1, axis2 : int, optional Axes to be used as the first and second axis of the 2-D sub-arrays from which the diagonals should be taken. Defaults are the first two axes of `a`. dtype : dtype, optional Determines the data-type of the returned array and of the accumulator where the elements are summed. If dtype has the value None and `a` is of integer type of precision less than the default integer precision, then the default integer precision is used. Otherwise, the precision is the same as that of `a`. out : ndarray, optional Array into which the output is placed. Its type is preserved and it must be of the right shape to hold the output. Returns ------- sum_along_diagonals : ndarray If `a` is 2-D, the sum along the diagonal is returned. If `a` has larger dimensions, then an array of sums along diagonals is returned. See Also -------- diag, diagonal, diagflat Examples -------- >>> np.trace(np.eye(3)) 3.0 >>> a = np.arange(8).reshape((2,2,2)) >>> np.trace(a) array([6, 8]) >>> a = np.arange(24).reshape((2,2,2,3)) >>> np.trace(a).shape (2, 3) """ if isinstance(a, np.matrix): # Get trace of matrix via an array to preserve backward compatibility. return asarray(a).trace(offset=offset, axis1=axis1, axis2=axis2, dtype=dtype, out=out) else: return asanyarray(a).trace(offset=offset, axis1=axis1, axis2=axis2, dtype=dtype, out=out) def ravel(a, order='C'): """Return a contiguous flattened array. A 1-D array, containing the elements of the input, is returned. A copy is made only if needed. As of NumPy 1.10, the returned array will have the same type as the input array. (for example, a masked array will be returned for a masked array input) Parameters ---------- a : array_like Input array. The elements in `a` are read in the order specified by `order`, and packed as a 1-D array. order : {'C','F', 'A', 'K'}, optional The elements of `a` are read using this index order. 'C' means to index the elements in row-major, C-style order, with the last axis index changing fastest, back to the first axis index changing slowest. 'F' means to index the elements in column-major, Fortran-style order, with the first index changing fastest, and the last index changing slowest. Note that the 'C' and 'F' options take no account of the memory layout of the underlying array, and only refer to the order of axis indexing. 'A' means to read the elements in Fortran-like index order if `a` is Fortran *contiguous* in memory, C-like order otherwise. 'K' means to read the elements in the order they occur in memory, except for reversing the data when strides are negative. By default, 'C' index order is used. Returns ------- y : array_like If `a` is a matrix, y is a 1-D ndarray, otherwise y is an array of the same subtype as `a`. The shape of the returned array is ``(a.size,)``. Matrices are special cased for backward compatibility. See Also -------- ndarray.flat : 1-D iterator over an array. ndarray.flatten : 1-D array copy of the elements of an array in row-major order. ndarray.reshape : Change the shape of an array without changing its data. Notes ----- In row-major, C-style order, in two dimensions, the row index varies the slowest, and the column index the quickest. This can be generalized to multiple dimensions, where row-major order implies that the index along the first axis varies slowest, and the index along the last quickest. The opposite holds for column-major, Fortran-style index ordering. When a view is desired in as many cases as possible, ``arr.reshape(-1)`` may be preferable. Examples -------- It is equivalent to ``reshape(-1, order=order)``. >>> x = np.array([[1, 2, 3], [4, 5, 6]]) >>> print(np.ravel(x)) [1 2 3 4 5 6] >>> print(x.reshape(-1)) [1 2 3 4 5 6] >>> print(np.ravel(x, order='F')) [1 4 2 5 3 6] When ``order`` is 'A', it will preserve the array's 'C' or 'F' ordering: >>> print(np.ravel(x.T)) [1 4 2 5 3 6] >>> print(np.ravel(x.T, order='A')) [1 2 3 4 5 6] When ``order`` is 'K', it will preserve orderings that are neither 'C' nor 'F', but won't reverse axes: >>> a = np.arange(3)[::-1]; a array([2, 1, 0]) >>> a.ravel(order='C') array([2, 1, 0]) >>> a.ravel(order='K') array([2, 1, 0]) >>> a = np.arange(12).reshape(2,3,2).swapaxes(1,2); a array([[[ 0, 2, 4], [ 1, 3, 5]], [[ 6, 8, 10], [ 7, 9, 11]]]) >>> a.ravel(order='C') array([ 0, 2, 4, 1, 3, 5, 6, 8, 10, 7, 9, 11]) >>> a.ravel(order='K') array([ 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11]) """ if isinstance(a, np.matrix): return asarray(a).ravel(order=order) else: return asanyarray(a).ravel(order=order) def nonzero(a): """ Return the indices of the elements that are non-zero. Returns a tuple of arrays, one for each dimension of `a`, containing the indices of the non-zero elements in that dimension. The values in `a` are always tested and returned in row-major, C-style order. The corresponding non-zero values can be obtained with:: a[nonzero(a)] To group the indices by element, rather than dimension, use:: transpose(nonzero(a)) The result of this is always a 2-D array, with a row for each non-zero element. Parameters ---------- a : array_like Input array. Returns ------- tuple_of_arrays : tuple Indices of elements that are non-zero. See Also -------- flatnonzero : Return indices that are non-zero in the flattened version of the input array. ndarray.nonzero : Equivalent ndarray method. count_nonzero : Counts the number of non-zero elements in the input array. Examples -------- >>> x = np.array([[1,0,0], [0,2,0], [1,1,0]]) >>> x array([[1, 0, 0], [0, 2, 0], [1, 1, 0]]) >>> np.nonzero(x) (array([0, 1, 2, 2]), array([0, 1, 0, 1])) >>> x[np.nonzero(x)] array([1, 2, 1, 1]) >>> np.transpose(np.nonzero(x)) array([[0, 0], [1, 1], [2, 0], [2, 1]) A common use for ``nonzero`` is to find the indices of an array, where a condition is True. Given an array `a`, the condition `a` > 3 is a boolean array and since False is interpreted as 0, np.nonzero(a > 3) yields the indices of the `a` where the condition is true. >>> a = np.array([[1,2,3],[4,5,6],[7,8,9]]) >>> a > 3 array([[False, False, False], [ True, True, True], [ True, True, True]]) >>> np.nonzero(a > 3) (array([1, 1, 1, 2, 2, 2]), array([0, 1, 2, 0, 1, 2])) The ``nonzero`` method of the boolean array can also be called. >>> (a > 3).nonzero() (array([1, 1, 1, 2, 2, 2]), array([0, 1, 2, 0, 1, 2])) """ return _wrapfunc(a, 'nonzero') def shape(a): """ Return the shape of an array. Parameters ---------- a : array_like Input array. Returns ------- shape : tuple of ints The elements of the shape tuple give the lengths of the corresponding array dimensions. See Also -------- alen ndarray.shape : Equivalent array method. Examples -------- >>> np.shape(np.eye(3)) (3, 3) >>> np.shape([[1, 2]]) (1, 2) >>> np.shape([0]) (1,) >>> np.shape(0) () >>> a = np.array([(1, 2), (3, 4)], dtype=[('x', 'i4'), ('y', 'i4')]) >>> np.shape(a) (2,) >>> a.shape (2,) """ try: result = a.shape except AttributeError: result = asarray(a).shape return result def compress(condition, a, axis=None, out=None): """ Return selected slices of an array along given axis. When working along a given axis, a slice along that axis is returned in `output` for each index where `condition` evaluates to True. When working on a 1-D array, `compress` is equivalent to `extract`. Parameters ---------- condition : 1-D array of bools Array that selects which entries to return. If len(condition) is less than the size of `a` along the given axis, then output is truncated to the length of the condition array. a : array_like Array from which to extract a part. axis : int, optional Axis along which to take slices. If None (default), work on the flattened array. out : ndarray, optional Output array. Its type is preserved and it must be of the right shape to hold the output. Returns ------- compressed_array : ndarray A copy of `a` without the slices along axis for which `condition` is false. See Also -------- take, choose, diag, diagonal, select ndarray.compress : Equivalent method in ndarray np.extract: Equivalent method when working on 1-D arrays numpy.doc.ufuncs : Section "Output arguments" Examples -------- >>> a = np.array([[1, 2], [3, 4], [5, 6]]) >>> a array([[1, 2], [3, 4], [5, 6]]) >>> np.compress([0, 1], a, axis=0) array([[3, 4]]) >>> np.compress([False, True, True], a, axis=0) array([[3, 4], [5, 6]]) >>> np.compress([False, True], a, axis=1) array([[2], [4], [6]]) Working on the flattened array does not return slices along an axis but selects elements. >>> np.compress([False, True], a) array([2]) """ return _wrapfunc(a, 'compress', condition, axis=axis, out=out) def clip(a, a_min, a_max, out=None): """ Clip (limit) the values in an array. Given an interval, values outside the interval are clipped to the interval edges. For example, if an interval of ``[0, 1]`` is specified, values smaller than 0 become 0, and values larger than 1 become 1. Parameters ---------- a : array_like Array containing elements to clip. a_min : scalar or array_like or `None` Minimum value. If `None`, clipping is not performed on lower interval edge. Not more than one of `a_min` and `a_max` may be `None`. a_max : scalar or array_like or `None` Maximum value. If `None`, clipping is not performed on upper interval edge. Not more than one of `a_min` and `a_max` may be `None`. If `a_min` or `a_max` are array_like, then the three arrays will be broadcasted to match their shapes. out : ndarray, optional The results will be placed in this array. It may be the input array for in-place clipping. `out` must be of the right shape to hold the output. Its type is preserved. Returns ------- clipped_array : ndarray An array with the elements of `a`, but where values < `a_min` are replaced with `a_min`, and those > `a_max` with `a_max`. See Also -------- numpy.doc.ufuncs : Section "Output arguments" Examples -------- >>> a = np.arange(10) >>> np.clip(a, 1, 8) array([1, 1, 2, 3, 4, 5, 6, 7, 8, 8]) >>> a array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]) >>> np.clip(a, 3, 6, out=a) array([3, 3, 3, 3, 4, 5, 6, 6, 6, 6]) >>> a = np.arange(10) >>> a array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]) >>> np.clip(a, [3, 4, 1, 1, 1, 4, 4, 4, 4, 4], 8) array([3, 4, 2, 3, 4, 5, 6, 7, 8, 8]) """ return _wrapfunc(a, 'clip', a_min, a_max, out=out) def sum(a, axis=None, dtype=None, out=None, keepdims=np._NoValue): """ Sum of array elements over a given axis. Parameters ---------- a : array_like Elements to sum. axis : None or int or tuple of ints, optional Axis or axes along which a sum is performed. The default, axis=None, will sum all of the elements of the input array. If axis is negative it counts from the last to the first axis. .. versionadded:: 1.7.0 If axis is a tuple of ints, a sum is performed on all of the axes specified in the tuple instead of a single axis or all the axes as before. dtype : dtype, optional The type of the returned array and of the accumulator in which the elements are summed. The dtype of `a` is used by default unless `a` has an integer dtype of less precision than the default platform integer. In that case, if `a` is signed then the platform integer is used while if `a` is unsigned then an unsigned integer of the same precision as the platform integer is used. out : ndarray, optional Alternative output array in which to place the result. It must have the same shape as the expected output, but the type of the output values will be cast if necessary. keepdims : bool, optional If this is set to True, the axes which are reduced are left in the result as dimensions with size one. With this option, the result will broadcast correctly against the input array. If the default value is passed, then `keepdims` will not be passed through to the `sum` method of sub-classes of `ndarray`, however any non-default value will be. If the sub-classes `sum` method does not implement `keepdims` any exceptions will be raised. Returns ------- sum_along_axis : ndarray An array with the same shape as `a`, with the specified axis removed. If `a` is a 0-d array, or if `axis` is None, a scalar is returned. If an output array is specified, a reference to `out` is returned. See Also -------- ndarray.sum : Equivalent method. cumsum : Cumulative sum of array elements. trapz : Integration of array values using the composite trapezoidal rule. mean, average Notes ----- Arithmetic is modular when using integer types, and no error is raised on overflow. The sum of an empty array is the neutral element 0: >>> np.sum([]) 0.0 Examples -------- >>> np.sum([0.5, 1.5]) 2.0 >>> np.sum([0.5, 0.7, 0.2, 1.5], dtype=np.int32) 1 >>> np.sum([[0, 1], [0, 5]]) 6 >>> np.sum([[0, 1], [0, 5]], axis=0) array([0, 6]) >>> np.sum([[0, 1], [0, 5]], axis=1) array([1, 5]) If the accumulator is too small, overflow occurs: >>> np.ones(128, dtype=np.int8).sum(dtype=np.int8) -128 """ kwargs = {} if keepdims is not np._NoValue: kwargs['keepdims'] = keepdims if isinstance(a, _gentype): res = _sum_(a) if out is not None: out[...] = res return out return res if type(a) is not mu.ndarray: try: sum = a.sum except AttributeError: pass else: return sum(axis=axis, dtype=dtype, out=out, **kwargs) return _methods._sum(a, axis=axis, dtype=dtype, out=out, **kwargs) def product(a, axis=None, dtype=None, out=None, keepdims=np._NoValue): """ Return the product of array elements over a given axis. See Also -------- prod : equivalent function; see for details. """ kwargs = {} if keepdims is not np._NoValue: kwargs['keepdims'] = keepdims return um.multiply.reduce(a, axis=axis, dtype=dtype, out=out, **kwargs) def sometrue(a, axis=None, out=None, keepdims=np._NoValue): """ Check whether some values are true. Refer to `any` for full documentation. See Also -------- any : equivalent function """ arr = asanyarray(a) kwargs = {} if keepdims is not np._NoValue: kwargs['keepdims'] = keepdims return arr.any(axis=axis, out=out, **kwargs) def alltrue(a, axis=None, out=None, keepdims=np._NoValue): """ Check if all elements of input array are true. See Also -------- numpy.all : Equivalent function; see for details. """ arr = asanyarray(a) kwargs = {} if keepdims is not np._NoValue: kwargs['keepdims'] = keepdims return arr.all(axis=axis, out=out, **kwargs) def any(a, axis=None, out=None, keepdims=np._NoValue): """ Test whether any array element along a given axis evaluates to True. Returns single boolean unless `axis` is not ``None`` Parameters ---------- a : array_like Input array or object that can be converted to an array. axis : None or int or tuple of ints, optional Axis or axes along which a logical OR reduction is performed. The default (`axis` = `None`) is to perform a logical OR over all the dimensions of the input array. `axis` may be negative, in which case it counts from the last to the first axis. .. versionadded:: 1.7.0 If this is a tuple of ints, a reduction is performed on multiple axes, instead of a single axis or all the axes as before. out : ndarray, optional Alternate output array in which to place the result. It must have the same shape as the expected output and its type is preserved (e.g., if it is of type float, then it will remain so, returning 1.0 for True and 0.0 for False, regardless of the type of `a`). See `doc.ufuncs` (Section "Output arguments") for details. keepdims : bool, optional If this is set to True, the axes which are reduced are left in the result as dimensions with size one. With this option, the result will broadcast correctly against the input array. If the default value is passed, then `keepdims` will not be passed through to the `any` method of sub-classes of `ndarray`, however any non-default value will be. If the sub-classes `sum` method does not implement `keepdims` any exceptions will be raised. Returns ------- any : bool or ndarray A new boolean or `ndarray` is returned unless `out` is specified, in which case a reference to `out` is returned. See Also -------- ndarray.any : equivalent method all : Test whether all elements along a given axis evaluate to True. Notes ----- Not a Number (NaN), positive infinity and negative infinity evaluate to `True` because these are not equal to zero. Examples -------- >>> np.any([[True, False], [True, True]]) True >>> np.any([[True, False], [False, False]], axis=0) array([ True, False]) >>> np.any([-1, 0, 5]) True >>> np.any(np.nan) True >>> o=np.array([False]) >>> z=np.any([-1, 4, 5], out=o) >>> z, o (array([ True]), array([ True])) >>> # Check now that z is a reference to o >>> z is o True >>> id(z), id(o) # identity of z and o # doctest: +SKIP (191614240, 191614240) """ arr = asanyarray(a) kwargs = {} if keepdims is not np._NoValue: kwargs['keepdims'] = keepdims return arr.any(axis=axis, out=out, **kwargs) def all(a, axis=None, out=None, keepdims=np._NoValue): """ Test whether all array elements along a given axis evaluate to True. Parameters ---------- a : array_like Input array or object that can be converted to an array. axis : None or int or tuple of ints, optional Axis or axes along which a logical AND reduction is performed. The default (`axis` = `None`) is to perform a logical AND over all the dimensions of the input array. `axis` may be negative, in which case it counts from the last to the first axis. .. versionadded:: 1.7.0 If this is a tuple of ints, a reduction is performed on multiple axes, instead of a single axis or all the axes as before. out : ndarray, optional Alternate output array in which to place the result. It must have the same shape as the expected output and its type is preserved (e.g., if ``dtype(out)`` is float, the result will consist of 0.0's and 1.0's). See `doc.ufuncs` (Section "Output arguments") for more details. keepdims : bool, optional If this is set to True, the axes which are reduced are left in the result as dimensions with size one. With this option, the result will broadcast correctly against the input array. If the default value is passed, then `keepdims` will not be passed through to the `all` method of sub-classes of `ndarray`, however any non-default value will be. If the sub-classes `sum` method does not implement `keepdims` any exceptions will be raised. Returns ------- all : ndarray, bool A new boolean or array is returned unless `out` is specified, in which case a reference to `out` is returned. See Also -------- ndarray.all : equivalent method any : Test whether any element along a given axis evaluates to True. Notes ----- Not a Number (NaN), positive infinity and negative infinity evaluate to `True` because these are not equal to zero. Examples -------- >>> np.all([[True,False],[True,True]]) False >>> np.all([[True,False],[True,True]], axis=0) array([ True, False]) >>> np.all([-1, 4, 5]) True >>> np.all([1.0, np.nan]) True >>> o=np.array([False]) >>> z=np.all([-1, 4, 5], out=o) >>> id(z), id(o), z # doctest: +SKIP (28293632, 28293632, array([ True])) """ arr = asanyarray(a) kwargs = {} if keepdims is not np._NoValue: kwargs['keepdims'] = keepdims return arr.all(axis=axis, out=out, **kwargs) def cumsum(a, axis=None, dtype=None, out=None): """ Return the cumulative sum of the elements along a given axis. Parameters ---------- a : array_like Input array. axis : int, optional Axis along which the cumulative sum is computed. The default (None) is to compute the cumsum over the flattened array. dtype : dtype, optional Type of the returned array and of the accumulator in which the elements are summed. If `dtype` is not specified, it defaults to the dtype of `a`, unless `a` has an integer dtype with a precision less than that of the default platform integer. In that case, the default platform integer is used. out : ndarray, optional Alternative output array in which to place the result. It must have the same shape and buffer length as the expected output but the type will be cast if necessary. See `doc.ufuncs` (Section "Output arguments") for more details. Returns ------- cumsum_along_axis : ndarray. A new array holding the result is returned unless `out` is specified, in which case a reference to `out` is returned. The result has the same size as `a`, and the same shape as `a` if `axis` is not None or `a` is a 1-d array. See Also -------- sum : Sum array elements. trapz : Integration of array values using the composite trapezoidal rule. diff : Calculate the n-th discrete difference along given axis. Notes ----- Arithmetic is modular when using integer types, and no error is raised on overflow. Examples -------- >>> a = np.array([[1,2,3], [4,5,6]]) >>> a array([[1, 2, 3], [4, 5, 6]]) >>> np.cumsum(a) array([ 1, 3, 6, 10, 15, 21]) >>> np.cumsum(a, dtype=float) # specifies type of output value(s) array([ 1., 3., 6., 10., 15., 21.]) >>> np.cumsum(a,axis=0) # sum over rows for each of the 3 columns array([[1, 2, 3], [5, 7, 9]]) >>> np.cumsum(a,axis=1) # sum over columns for each of the 2 rows array([[ 1, 3, 6], [ 4, 9, 15]]) """ return _wrapfunc(a, 'cumsum', axis=axis, dtype=dtype, out=out) def cumproduct(a, axis=None, dtype=None, out=None): """ Return the cumulative product over the given axis. See Also -------- cumprod : equivalent function; see for details. """ return _wrapfunc(a, 'cumprod', axis=axis, dtype=dtype, out=out) def ptp(a, axis=None, out=None): """ Range of values (maximum - minimum) along an axis. The name of the function comes from the acronym for 'peak to peak'. Parameters ---------- a : array_like Input values. axis : int, optional Axis along which to find the peaks. By default, flatten the array. out : array_like Alternative output array in which to place the result. It must have the same shape and buffer length as the expected output, but the type of the output values will be cast if necessary. Returns ------- ptp : ndarray A new array holding the result, unless `out` was specified, in which case a reference to `out` is returned. Examples -------- >>> x = np.arange(4).reshape((2,2)) >>> x array([[0, 1], [2, 3]]) >>> np.ptp(x, axis=0) array([2, 2]) >>> np.ptp(x, axis=1) array([1, 1]) """ return _wrapfunc(a, 'ptp', axis=axis, out=out) def amax(a, axis=None, out=None, keepdims=np._NoValue): """ Return the maximum of an array or maximum along an axis. Parameters ---------- a : array_like Input data. axis : None or int or tuple of ints, optional Axis or axes along which to operate. By default, flattened input is used. .. versionadded:: 1.7.0 If this is a tuple of ints, the maximum is selected over multiple axes, instead of a single axis or all the axes as before. out : ndarray, optional Alternative output array in which to place the result. Must be of the same shape and buffer length as the expected output. See `doc.ufuncs` (Section "Output arguments") for more details. keepdims : bool, optional If this is set to True, the axes which are reduced are left in the result as dimensions with size one. With this option, the result will broadcast correctly against the input array. If the default value is passed, then `keepdims` will not be passed through to the `amax` method of sub-classes of `ndarray`, however any non-default value will be. If the sub-classes `sum` method does not implement `keepdims` any exceptions will be raised. Returns ------- amax : ndarray or scalar Maximum of `a`. If `axis` is None, the result is a scalar value. If `axis` is given, the result is an array of dimension ``a.ndim - 1``. See Also -------- amin : The minimum value of an array along a given axis, propagating any NaNs. nanmax : The maximum value of an array along a given axis, ignoring any NaNs. maximum : Element-wise maximum of two arrays, propagating any NaNs. fmax : Element-wise maximum of two arrays, ignoring any NaNs. argmax : Return the indices of the maximum values. nanmin, minimum, fmin Notes ----- NaN values are propagated, that is if at least one item is NaN, the corresponding max value will be NaN as well. To ignore NaN values (MATLAB behavior), please use nanmax. Don't use `amax` for element-wise comparison of 2 arrays; when ``a.shape[0]`` is 2, ``maximum(a[0], a[1])`` is faster than ``amax(a, axis=0)``. Examples -------- >>> a = np.arange(4).reshape((2,2)) >>> a array([[0, 1], [2, 3]]) >>> np.amax(a) # Maximum of the flattened array 3 >>> np.amax(a, axis=0) # Maxima along the first axis array([2, 3]) >>> np.amax(a, axis=1) # Maxima along the second axis array([1, 3]) >>> b = np.arange(5, dtype=float) >>> b[2] = np.NaN >>> np.amax(b) nan >>> np.nanmax(b) 4.0 """ kwargs = {} if keepdims is not np._NoValue: kwargs['keepdims'] = keepdims if type(a) is not mu.ndarray: try: amax = a.max except AttributeError: pass else: return amax(axis=axis, out=out, **kwargs) return _methods._amax(a, axis=axis, out=out, **kwargs) def amin(a, axis=None, out=None, keepdims=np._NoValue): """ Return the minimum of an array or minimum along an axis. Parameters ---------- a : array_like Input data. axis : None or int or tuple of ints, optional Axis or axes along which to operate. By default, flattened input is used. .. versionadded:: 1.7.0 If this is a tuple of ints, the minimum is selected over multiple axes, instead of a single axis or all the axes as before. out : ndarray, optional Alternative output array in which to place the result. Must be of the same shape and buffer length as the expected output. See `doc.ufuncs` (Section "Output arguments") for more details. keepdims : bool, optional If this is set to True, the axes which are reduced are left in the result as dimensions with size one. With this option, the result will broadcast correctly against the input array. If the default value is passed, then `keepdims` will not be passed through to the `amin` method of sub-classes of `ndarray`, however any non-default value will be. If the sub-classes `sum` method does not implement `keepdims` any exceptions will be raised. Returns ------- amin : ndarray or scalar Minimum of `a`. If `axis` is None, the result is a scalar value. If `axis` is given, the result is an array of dimension ``a.ndim - 1``. See Also -------- amax : The maximum value of an array along a given axis, propagating any NaNs. nanmin : The minimum value of an array along a given axis, ignoring any NaNs. minimum : Element-wise minimum of two arrays, propagating any NaNs. fmin : Element-wise minimum of two arrays, ignoring any NaNs. argmin : Return the indices of the minimum values. nanmax, maximum, fmax Notes ----- NaN values are propagated, that is if at least one item is NaN, the corresponding min value will be NaN as well. To ignore NaN values (MATLAB behavior), please use nanmin. Don't use `amin` for element-wise comparison of 2 arrays; when ``a.shape[0]`` is 2, ``minimum(a[0], a[1])`` is faster than ``amin(a, axis=0)``. Examples -------- >>> a = np.arange(4).reshape((2,2)) >>> a array([[0, 1], [2, 3]]) >>> np.amin(a) # Minimum of the flattened array 0 >>> np.amin(a, axis=0) # Minima along the first axis array([0, 1]) >>> np.amin(a, axis=1) # Minima along the second axis array([0, 2]) >>> b = np.arange(5, dtype=float) >>> b[2] = np.NaN >>> np.amin(b) nan >>> np.nanmin(b) 0.0 """ kwargs = {} if keepdims is not np._NoValue: kwargs['keepdims'] = keepdims if type(a) is not mu.ndarray: try: amin = a.min except AttributeError: pass else: return amin(axis=axis, out=out, **kwargs) return _methods._amin(a, axis=axis, out=out, **kwargs) def alen(a): """ Return the length of the first dimension of the input array. Parameters ---------- a : array_like Input array. Returns ------- alen : int Length of the first dimension of `a`. See Also -------- shape, size Examples -------- >>> a = np.zeros((7,4,5)) >>> a.shape[0] 7 >>> np.alen(a) 7 """ try: return len(a) except TypeError: return len(array(a, ndmin=1)) def prod(a, axis=None, dtype=None, out=None, keepdims=np._NoValue): """ Return the product of array elements over a given axis. Parameters ---------- a : array_like Input data. axis : None or int or tuple of ints, optional Axis or axes along which a product is performed. The default, axis=None, will calculate the product of all the elements in the input array. If axis is negative it counts from the last to the first axis. .. versionadded:: 1.7.0 If axis is a tuple of ints, a product is performed on all of the axes specified in the tuple instead of a single axis or all the axes as before. dtype : dtype, optional The type of the returned array, as well as of the accumulator in which the elements are multiplied. The dtype of `a` is used by default unless `a` has an integer dtype of less precision than the default platform integer. In that case, if `a` is signed then the platform integer is used while if `a` is unsigned then an unsigned integer of the same precision as the platform integer is used. out : ndarray, optional Alternative output array in which to place the result. It must have the same shape as the expected output, but the type of the output values will be cast if necessary. keepdims : bool, optional If this is set to True, the axes which are reduced are left in the result as dimensions with size one. With this option, the result will broadcast correctly against the input array. If the default value is passed, then `keepdims` will not be passed through to the `prod` method of sub-classes of `ndarray`, however any non-default value will be. If the sub-classes `sum` method does not implement `keepdims` any exceptions will be raised. Returns ------- product_along_axis : ndarray, see `dtype` parameter above. An array shaped as `a` but with the specified axis removed. Returns a reference to `out` if specified. See Also -------- ndarray.prod : equivalent method numpy.doc.ufuncs : Section "Output arguments" Notes ----- Arithmetic is modular when using integer types, and no error is raised on overflow. That means that, on a 32-bit platform: >>> x = np.array([536870910, 536870910, 536870910, 536870910]) >>> np.prod(x) # random 16 The product of an empty array is the neutral element 1: >>> np.prod([]) 1.0 Examples -------- By default, calculate the product of all elements: >>> np.prod([1.,2.]) 2.0 Even when the input array is two-dimensional: >>> np.prod([[1.,2.],[3.,4.]]) 24.0 But we can also specify the axis over which to multiply: >>> np.prod([[1.,2.],[3.,4.]], axis=1) array([ 2., 12.]) If the type of `x` is unsigned, then the output type is the unsigned platform integer: >>> x = np.array([1, 2, 3], dtype=np.uint8) >>> np.prod(x).dtype == np.uint True If `x` is of a signed integer type, then the output type is the default platform integer: >>> x = np.array([1, 2, 3], dtype=np.int8) >>> np.prod(x).dtype == int True """ kwargs = {} if keepdims is not np._NoValue: kwargs['keepdims'] = keepdims if type(a) is not mu.ndarray: try: prod = a.prod except AttributeError: pass else: return prod(axis=axis, dtype=dtype, out=out, **kwargs) return _methods._prod(a, axis=axis, dtype=dtype, out=out, **kwargs) def cumprod(a, axis=None, dtype=None, out=None): """ Return the cumulative product of elements along a given axis. Parameters ---------- a : array_like Input array. axis : int, optional Axis along which the cumulative product is computed. By default the input is flattened. dtype : dtype, optional Type of the returned array, as well as of the accumulator in which the elements are multiplied. If *dtype* is not specified, it defaults to the dtype of `a`, unless `a` has an integer dtype with a precision less than that of the default platform integer. In that case, the default platform integer is used instead. out : ndarray, optional Alternative output array in which to place the result. It must have the same shape and buffer length as the expected output but the type of the resulting values will be cast if necessary. Returns ------- cumprod : ndarray A new array holding the result is returned unless `out` is specified, in which case a reference to out is returned. See Also -------- numpy.doc.ufuncs : Section "Output arguments" Notes ----- Arithmetic is modular when using integer types, and no error is raised on overflow. Examples -------- >>> a = np.array([1,2,3]) >>> np.cumprod(a) # intermediate results 1, 1*2 ... # total product 1*2*3 = 6 array([1, 2, 6]) >>> a = np.array([[1, 2, 3], [4, 5, 6]]) >>> np.cumprod(a, dtype=float) # specify type of output array([ 1., 2., 6., 24., 120., 720.]) The cumulative product for each column (i.e., over the rows) of `a`: >>> np.cumprod(a, axis=0) array([[ 1, 2, 3], [ 4, 10, 18]]) The cumulative product for each row (i.e. over the columns) of `a`: >>> np.cumprod(a,axis=1) array([[ 1, 2, 6], [ 4, 20, 120]]) """ return _wrapfunc(a, 'cumprod', axis=axis, dtype=dtype, out=out) def ndim(a): """ Return the number of dimensions of an array. Parameters ---------- a : array_like Input array. If it is not already an ndarray, a conversion is attempted. Returns ------- number_of_dimensions : int The number of dimensions in `a`. Scalars are zero-dimensional. See Also -------- ndarray.ndim : equivalent method shape : dimensions of array ndarray.shape : dimensions of array Examples -------- >>> np.ndim([[1,2,3],[4,5,6]]) 2 >>> np.ndim(np.array([[1,2,3],[4,5,6]])) 2 >>> np.ndim(1) 0 """ try: return a.ndim except AttributeError: return asarray(a).ndim def rank(a): """ Return the number of dimensions of an array. If `a` is not already an array, a conversion is attempted. Scalars are zero dimensional. .. note:: This function is deprecated in NumPy 1.9 to avoid confusion with `numpy.linalg.matrix_rank`. The ``ndim`` attribute or function should be used instead. Parameters ---------- a : array_like Array whose number of dimensions is desired. If `a` is not an array, a conversion is attempted. Returns ------- number_of_dimensions : int The number of dimensions in the array. See Also -------- ndim : equivalent function ndarray.ndim : equivalent property shape : dimensions of array ndarray.shape : dimensions of array Notes ----- In the old Numeric package, `rank` was the term used for the number of dimensions, but in NumPy `ndim` is used instead. Examples -------- >>> np.rank([1,2,3]) 1 >>> np.rank(np.array([[1,2,3],[4,5,6]])) 2 >>> np.rank(1) 0 """ # 2014-04-12, 1.9 warnings.warn( "`rank` is deprecated; use the `ndim` attribute or function instead. " "To find the rank of a matrix see `numpy.linalg.matrix_rank`.", VisibleDeprecationWarning, stacklevel=2) try: return a.ndim except AttributeError: return asarray(a).ndim def size(a, axis=None): """ Return the number of elements along a given axis. Parameters ---------- a : array_like Input data. axis : int, optional Axis along which the elements are counted. By default, give the total number of elements. Returns ------- element_count : int Number of elements along the specified axis. See Also -------- shape : dimensions of array ndarray.shape : dimensions of array ndarray.size : number of elements in array Examples -------- >>> a = np.array([[1,2,3],[4,5,6]]) >>> np.size(a) 6 >>> np.size(a,1) 3 >>> np.size(a,0) 2 """ if axis is None: try: return a.size except AttributeError: return asarray(a).size else: try: return a.shape[axis] except AttributeError: return asarray(a).shape[axis] def around(a, decimals=0, out=None): """ Evenly round to the given number of decimals. Parameters ---------- a : array_like Input data. decimals : int, optional Number of decimal places to round to (default: 0). If decimals is negative, it specifies the number of positions to the left of the decimal point. out : ndarray, optional Alternative output array in which to place the result. It must have the same shape as the expected output, but the type of the output values will be cast if necessary. See `doc.ufuncs` (Section "Output arguments") for details. Returns ------- rounded_array : ndarray An array of the same type as `a`, containing the rounded values. Unless `out` was specified, a new array is created. A reference to the result is returned. The real and imaginary parts of complex numbers are rounded separately. The result of rounding a float is a float. See Also -------- ndarray.round : equivalent method ceil, fix, floor, rint, trunc Notes ----- For values exactly halfway between rounded decimal values, NumPy rounds to the nearest even value. Thus 1.5 and 2.5 round to 2.0, -0.5 and 0.5 round to 0.0, etc. Results may also be surprising due to the inexact representation of decimal fractions in the IEEE floating point standard [1]_ and errors introduced when scaling by powers of ten. References ---------- .. [1] "Lecture Notes on the Status of IEEE 754", William Kahan, http://www.cs.berkeley.edu/~wkahan/ieee754status/IEEE754.PDF .. [2] "How Futile are Mindless Assessments of Roundoff in Floating-Point Computation?", William Kahan, http://www.cs.berkeley.edu/~wkahan/Mindless.pdf Examples -------- >>> np.around([0.37, 1.64]) array([ 0., 2.]) >>> np.around([0.37, 1.64], decimals=1) array([ 0.4, 1.6]) >>> np.around([.5, 1.5, 2.5, 3.5, 4.5]) # rounds to nearest even value array([ 0., 2., 2., 4., 4.]) >>> np.around([1,2,3,11], decimals=1) # ndarray of ints is returned array([ 1, 2, 3, 11]) >>> np.around([1,2,3,11], decimals=-1) array([ 0, 0, 0, 10]) """ return _wrapfunc(a, 'round', decimals=decimals, out=out) def round_(a, decimals=0, out=None): """ Round an array to the given number of decimals. Refer to `around` for full documentation. See Also -------- around : equivalent function """ return around(a, decimals=decimals, out=out) def mean(a, axis=None, dtype=None, out=None, keepdims=np._NoValue): """ Compute the arithmetic mean along the specified axis. Returns the average of the array elements. The average is taken over the flattened array by default, otherwise over the specified axis. `float64` intermediate and return values are used for integer inputs. Parameters ---------- a : array_like Array containing numbers whose mean is desired. If `a` is not an array, a conversion is attempted. axis : None or int or tuple of ints, optional Axis or axes along which the means are computed. The default is to compute the mean of the flattened array. .. versionadded:: 1.7.0 If this is a tuple of ints, a mean is performed over multiple axes, instead of a single axis or all the axes as before. dtype : data-type, optional Type to use in computing the mean. For integer inputs, the default is `float64`; for floating point inputs, it is the same as the input dtype. out : ndarray, optional Alternate output array in which to place the result. The default is ``None``; if provided, it must have the same shape as the expected output, but the type will be cast if necessary. See `doc.ufuncs` for details. keepdims : bool, optional If this is set to True, the axes which are reduced are left in the result as dimensions with size one. With this option, the result will broadcast correctly against the input array. If the default value is passed, then `keepdims` will not be passed through to the `mean` method of sub-classes of `ndarray`, however any non-default value will be. If the sub-classes `sum` method does not implement `keepdims` any exceptions will be raised. Returns ------- m : ndarray, see dtype parameter above If `out=None`, returns a new array containing the mean values, otherwise a reference to the output array is returned. See Also -------- average : Weighted average std, var, nanmean, nanstd, nanvar Notes ----- The arithmetic mean is the sum of the elements along the axis divided by the number of elements. Note that for floating-point input, the mean is computed using the same precision the input has. Depending on the input data, this can cause the results to be inaccurate, especially for `float32` (see example below). Specifying a higher-precision accumulator using the `dtype` keyword can alleviate this issue. By default, `float16` results are computed using `float32` intermediates for extra precision. Examples -------- >>> a = np.array([[1, 2], [3, 4]]) >>> np.mean(a) 2.5 >>> np.mean(a, axis=0) array([ 2., 3.]) >>> np.mean(a, axis=1) array([ 1.5, 3.5]) In single precision, `mean` can be inaccurate: >>> a = np.zeros((2, 512*512), dtype=np.float32) >>> a[0, :] = 1.0 >>> a[1, :] = 0.1 >>> np.mean(a) 0.54999924 Computing the mean in float64 is more accurate: >>> np.mean(a, dtype=np.float64) 0.55000000074505806 """ kwargs = {} if keepdims is not np._NoValue: kwargs['keepdims'] = keepdims if type(a) is not mu.ndarray: try: mean = a.mean except AttributeError: pass else: return mean(axis=axis, dtype=dtype, out=out, **kwargs) return _methods._mean(a, axis=axis, dtype=dtype, out=out, **kwargs) def std(a, axis=None, dtype=None, out=None, ddof=0, keepdims=np._NoValue): """ Compute the standard deviation along the specified axis. Returns the standard deviation, a measure of the spread of a distribution, of the array elements. The standard deviation is computed for the flattened array by default, otherwise over the specified axis. Parameters ---------- a : array_like Calculate the standard deviation of these values. axis : None or int or tuple of ints, optional Axis or axes along which the standard deviation is computed. The default is to compute the standard deviation of the flattened array. .. versionadded:: 1.7.0 If this is a tuple of ints, a standard deviation is performed over multiple axes, instead of a single axis or all the axes as before. dtype : dtype, optional Type to use in computing the standard deviation. For arrays of integer type the default is float64, for arrays of float types it is the same as the array type. out : ndarray, optional Alternative output array in which to place the result. It must have the same shape as the expected output but the type (of the calculated values) will be cast if necessary. ddof : int, optional Means Delta Degrees of Freedom. The divisor used in calculations is ``N - ddof``, where ``N`` represents the number of elements. By default `ddof` is zero. keepdims : bool, optional If this is set to True, the axes which are reduced are left in the result as dimensions with size one. With this option, the result will broadcast correctly against the input array. If the default value is passed, then `keepdims` will not be passed through to the `std` method of sub-classes of `ndarray`, however any non-default value will be. If the sub-classes `sum` method does not implement `keepdims` any exceptions will be raised. Returns ------- standard_deviation : ndarray, see dtype parameter above. If `out` is None, return a new array containing the standard deviation, otherwise return a reference to the output array. See Also -------- var, mean, nanmean, nanstd, nanvar numpy.doc.ufuncs : Section "Output arguments" Notes ----- The standard deviation is the square root of the average of the squared deviations from the mean, i.e., ``std = sqrt(mean(abs(x - x.mean())**2))``. The average squared deviation is normally calculated as ``x.sum() / N``, where ``N = len(x)``. If, however, `ddof` is specified, the divisor ``N - ddof`` is used instead. In standard statistical practice, ``ddof=1`` provides an unbiased estimator of the variance of the infinite population. ``ddof=0`` provides a maximum likelihood estimate of the variance for normally distributed variables. The standard deviation computed in this function is the square root of the estimated variance, so even with ``ddof=1``, it will not be an unbiased estimate of the standard deviation per se. Note that, for complex numbers, `std` takes the absolute value before squaring, so that the result is always real and nonnegative. For floating-point input, the *std* is computed using the same precision the input has. Depending on the input data, this can cause the results to be inaccurate, especially for float32 (see example below). Specifying a higher-accuracy accumulator using the `dtype` keyword can alleviate this issue. Examples -------- >>> a = np.array([[1, 2], [3, 4]]) >>> np.std(a) 1.1180339887498949 >>> np.std(a, axis=0) array([ 1., 1.]) >>> np.std(a, axis=1) array([ 0.5, 0.5]) In single precision, std() can be inaccurate: >>> a = np.zeros((2, 512*512), dtype=np.float32) >>> a[0, :] = 1.0 >>> a[1, :] = 0.1 >>> np.std(a) 0.45000005 Computing the standard deviation in float64 is more accurate: >>> np.std(a, dtype=np.float64) 0.44999999925494177 """ kwargs = {} if keepdims is not np._NoValue: kwargs['keepdims'] = keepdims if type(a) is not mu.ndarray: try: std = a.std except AttributeError: pass else: return std(axis=axis, dtype=dtype, out=out, ddof=ddof, **kwargs) return _methods._std(a, axis=axis, dtype=dtype, out=out, ddof=ddof, **kwargs) def var(a, axis=None, dtype=None, out=None, ddof=0, keepdims=np._NoValue): """ Compute the variance along the specified axis. Returns the variance of the array elements, a measure of the spread of a distribution. The variance is computed for the flattened array by default, otherwise over the specified axis. Parameters ---------- a : array_like Array containing numbers whose variance is desired. If `a` is not an array, a conversion is attempted. axis : None or int or tuple of ints, optional Axis or axes along which the variance is computed. The default is to compute the variance of the flattened array. .. versionadded:: 1.7.0 If this is a tuple of ints, a variance is performed over multiple axes, instead of a single axis or all the axes as before. dtype : data-type, optional Type to use in computing the variance. For arrays of integer type the default is `float32`; for arrays of float types it is the same as the array type. out : ndarray, optional Alternate output array in which to place the result. It must have the same shape as the expected output, but the type is cast if necessary. ddof : int, optional "Delta Degrees of Freedom": the divisor used in the calculation is ``N - ddof``, where ``N`` represents the number of elements. By default `ddof` is zero. keepdims : bool, optional If this is set to True, the axes which are reduced are left in the result as dimensions with size one. With this option, the result will broadcast correctly against the input array. If the default value is passed, then `keepdims` will not be passed through to the `var` method of sub-classes of `ndarray`, however any non-default value will be. If the sub-classes `sum` method does not implement `keepdims` any exceptions will be raised. Returns ------- variance : ndarray, see dtype parameter above If ``out=None``, returns a new array containing the variance; otherwise, a reference to the output array is returned. See Also -------- std , mean, nanmean, nanstd, nanvar numpy.doc.ufuncs : Section "Output arguments" Notes ----- The variance is the average of the squared deviations from the mean, i.e., ``var = mean(abs(x - x.mean())**2)``. The mean is normally calculated as ``x.sum() / N``, where ``N = len(x)``. If, however, `ddof` is specified, the divisor ``N - ddof`` is used instead. In standard statistical practice, ``ddof=1`` provides an unbiased estimator of the variance of a hypothetical infinite population. ``ddof=0`` provides a maximum likelihood estimate of the variance for normally distributed variables. Note that for complex numbers, the absolute value is taken before squaring, so that the result is always real and nonnegative. For floating-point input, the variance is computed using the same precision the input has. Depending on the input data, this can cause the results to be inaccurate, especially for `float32` (see example below). Specifying a higher-accuracy accumulator using the ``dtype`` keyword can alleviate this issue. Examples -------- >>> a = np.array([[1, 2], [3, 4]]) >>> np.var(a) 1.25 >>> np.var(a, axis=0) array([ 1., 1.]) >>> np.var(a, axis=1) array([ 0.25, 0.25]) In single precision, var() can be inaccurate: >>> a = np.zeros((2, 512*512), dtype=np.float32) >>> a[0, :] = 1.0 >>> a[1, :] = 0.1 >>> np.var(a) 0.20250003 Computing the variance in float64 is more accurate: >>> np.var(a, dtype=np.float64) 0.20249999932944759 >>> ((1-0.55)**2 + (0.1-0.55)**2)/2 0.2025 """ kwargs = {} if keepdims is not np._NoValue: kwargs['keepdims'] = keepdims if type(a) is not mu.ndarray: try: var = a.var except AttributeError: pass else: return var(axis=axis, dtype=dtype, out=out, ddof=ddof, **kwargs) return _methods._var(a, axis=axis, dtype=dtype, out=out, ddof=ddof, **kwargs)
100,637
30.498592
97
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/numeric.py
from __future__ import division, absolute_import, print_function import collections import itertools import operator import sys import warnings import numbers import numpy as np from . import multiarray from .multiarray import ( _fastCopyAndTranspose as fastCopyAndTranspose, ALLOW_THREADS, BUFSIZE, CLIP, MAXDIMS, MAY_SHARE_BOUNDS, MAY_SHARE_EXACT, RAISE, WRAP, arange, array, broadcast, can_cast, compare_chararrays, concatenate, copyto, count_nonzero, dot, dtype, empty, empty_like, flatiter, frombuffer, fromfile, fromiter, fromstring, inner, int_asbuffer, lexsort, matmul, may_share_memory, min_scalar_type, ndarray, nditer, nested_iters, promote_types, putmask, result_type, set_numeric_ops, shares_memory, vdot, where, zeros, normalize_axis_index) if sys.version_info[0] < 3: from .multiarray import newbuffer, getbuffer from . import umath from .umath import (multiply, invert, sin, UFUNC_BUFSIZE_DEFAULT, ERR_IGNORE, ERR_WARN, ERR_RAISE, ERR_CALL, ERR_PRINT, ERR_LOG, ERR_DEFAULT, PINF, NAN) from . import numerictypes from .numerictypes import longlong, intc, int_, float_, complex_, bool_ from ._internal import TooHardError, AxisError bitwise_not = invert ufunc = type(sin) newaxis = None if sys.version_info[0] >= 3: import pickle basestring = str import builtins else: import cPickle as pickle import __builtin__ as builtins loads = pickle.loads __all__ = [ 'newaxis', 'ndarray', 'flatiter', 'nditer', 'nested_iters', 'ufunc', 'arange', 'array', 'zeros', 'count_nonzero', 'empty', 'broadcast', 'dtype', 'fromstring', 'fromfile', 'frombuffer', 'int_asbuffer', 'where', 'argwhere', 'copyto', 'concatenate', 'fastCopyAndTranspose', 'lexsort', 'set_numeric_ops', 'can_cast', 'promote_types', 'min_scalar_type', 'result_type', 'asarray', 'asanyarray', 'ascontiguousarray', 'asfortranarray', 'isfortran', 'empty_like', 'zeros_like', 'ones_like', 'correlate', 'convolve', 'inner', 'dot', 'outer', 'vdot', 'roll', 'rollaxis', 'moveaxis', 'cross', 'tensordot', 'little_endian', 'require', 'fromiter', 'array_equal', 'array_equiv', 'indices', 'fromfunction', 'isclose', 'load', 'loads', 'isscalar', 'binary_repr', 'base_repr', 'ones', 'identity', 'allclose', 'compare_chararrays', 'putmask', 'seterr', 'geterr', 'setbufsize', 'getbufsize', 'seterrcall', 'geterrcall', 'errstate', 'flatnonzero', 'Inf', 'inf', 'infty', 'Infinity', 'nan', 'NaN', 'False_', 'True_', 'bitwise_not', 'CLIP', 'RAISE', 'WRAP', 'MAXDIMS', 'BUFSIZE', 'ALLOW_THREADS', 'ComplexWarning', 'full', 'full_like', 'matmul', 'shares_memory', 'may_share_memory', 'MAY_SHARE_BOUNDS', 'MAY_SHARE_EXACT', 'TooHardError', 'AxisError' ] if sys.version_info[0] < 3: __all__.extend(['getbuffer', 'newbuffer']) class ComplexWarning(RuntimeWarning): """ The warning raised when casting a complex dtype to a real dtype. As implemented, casting a complex number to a real discards its imaginary part, but this behavior may not be what the user actually wants. """ pass def zeros_like(a, dtype=None, order='K', subok=True): """ Return an array of zeros with the same shape and type as a given array. Parameters ---------- a : array_like The shape and data-type of `a` define these same attributes of the returned array. dtype : data-type, optional Overrides the data type of the result. .. versionadded:: 1.6.0 order : {'C', 'F', 'A', or 'K'}, optional Overrides the memory layout of the result. 'C' means C-order, 'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous, 'C' otherwise. 'K' means match the layout of `a` as closely as possible. .. versionadded:: 1.6.0 subok : bool, optional. If True, then the newly created array will use the sub-class type of 'a', otherwise it will be a base-class array. Defaults to True. Returns ------- out : ndarray Array of zeros with the same shape and type as `a`. See Also -------- ones_like : Return an array of ones with shape and type of input. empty_like : Return an empty array with shape and type of input. zeros : Return a new array setting values to zero. ones : Return a new array setting values to one. empty : Return a new uninitialized array. Examples -------- >>> x = np.arange(6) >>> x = x.reshape((2, 3)) >>> x array([[0, 1, 2], [3, 4, 5]]) >>> np.zeros_like(x) array([[0, 0, 0], [0, 0, 0]]) >>> y = np.arange(3, dtype=float) >>> y array([ 0., 1., 2.]) >>> np.zeros_like(y) array([ 0., 0., 0.]) """ res = empty_like(a, dtype=dtype, order=order, subok=subok) # needed instead of a 0 to get same result as zeros for for string dtypes z = zeros(1, dtype=res.dtype) multiarray.copyto(res, z, casting='unsafe') return res def ones(shape, dtype=None, order='C'): """ Return a new array of given shape and type, filled with ones. Parameters ---------- shape : int or sequence of ints Shape of the new array, e.g., ``(2, 3)`` or ``2``. dtype : data-type, optional The desired data-type for the array, e.g., `numpy.int8`. Default is `numpy.float64`. order : {'C', 'F'}, optional Whether to store multidimensional data in C- or Fortran-contiguous (row- or column-wise) order in memory. Returns ------- out : ndarray Array of ones with the given shape, dtype, and order. See Also -------- zeros, ones_like Examples -------- >>> np.ones(5) array([ 1., 1., 1., 1., 1.]) >>> np.ones((5,), dtype=int) array([1, 1, 1, 1, 1]) >>> np.ones((2, 1)) array([[ 1.], [ 1.]]) >>> s = (2,2) >>> np.ones(s) array([[ 1., 1.], [ 1., 1.]]) """ a = empty(shape, dtype, order) multiarray.copyto(a, 1, casting='unsafe') return a def ones_like(a, dtype=None, order='K', subok=True): """ Return an array of ones with the same shape and type as a given array. Parameters ---------- a : array_like The shape and data-type of `a` define these same attributes of the returned array. dtype : data-type, optional Overrides the data type of the result. .. versionadded:: 1.6.0 order : {'C', 'F', 'A', or 'K'}, optional Overrides the memory layout of the result. 'C' means C-order, 'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous, 'C' otherwise. 'K' means match the layout of `a` as closely as possible. .. versionadded:: 1.6.0 subok : bool, optional. If True, then the newly created array will use the sub-class type of 'a', otherwise it will be a base-class array. Defaults to True. Returns ------- out : ndarray Array of ones with the same shape and type as `a`. See Also -------- zeros_like : Return an array of zeros with shape and type of input. empty_like : Return an empty array with shape and type of input. zeros : Return a new array setting values to zero. ones : Return a new array setting values to one. empty : Return a new uninitialized array. Examples -------- >>> x = np.arange(6) >>> x = x.reshape((2, 3)) >>> x array([[0, 1, 2], [3, 4, 5]]) >>> np.ones_like(x) array([[1, 1, 1], [1, 1, 1]]) >>> y = np.arange(3, dtype=float) >>> y array([ 0., 1., 2.]) >>> np.ones_like(y) array([ 1., 1., 1.]) """ res = empty_like(a, dtype=dtype, order=order, subok=subok) multiarray.copyto(res, 1, casting='unsafe') return res def full(shape, fill_value, dtype=None, order='C'): """ Return a new array of given shape and type, filled with `fill_value`. Parameters ---------- shape : int or sequence of ints Shape of the new array, e.g., ``(2, 3)`` or ``2``. fill_value : scalar Fill value. dtype : data-type, optional The desired data-type for the array The default, `None`, means `np.array(fill_value).dtype`. order : {'C', 'F'}, optional Whether to store multidimensional data in C- or Fortran-contiguous (row- or column-wise) order in memory. Returns ------- out : ndarray Array of `fill_value` with the given shape, dtype, and order. See Also -------- zeros_like : Return an array of zeros with shape and type of input. ones_like : Return an array of ones with shape and type of input. empty_like : Return an empty array with shape and type of input. full_like : Fill an array with shape and type of input. zeros : Return a new array setting values to zero. ones : Return a new array setting values to one. empty : Return a new uninitialized array. Examples -------- >>> np.full((2, 2), np.inf) array([[ inf, inf], [ inf, inf]]) >>> np.full((2, 2), 10) array([[10, 10], [10, 10]]) """ if dtype is None: dtype = array(fill_value).dtype a = empty(shape, dtype, order) multiarray.copyto(a, fill_value, casting='unsafe') return a def full_like(a, fill_value, dtype=None, order='K', subok=True): """ Return a full array with the same shape and type as a given array. Parameters ---------- a : array_like The shape and data-type of `a` define these same attributes of the returned array. fill_value : scalar Fill value. dtype : data-type, optional Overrides the data type of the result. order : {'C', 'F', 'A', or 'K'}, optional Overrides the memory layout of the result. 'C' means C-order, 'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous, 'C' otherwise. 'K' means match the layout of `a` as closely as possible. subok : bool, optional. If True, then the newly created array will use the sub-class type of 'a', otherwise it will be a base-class array. Defaults to True. Returns ------- out : ndarray Array of `fill_value` with the same shape and type as `a`. See Also -------- zeros_like : Return an array of zeros with shape and type of input. ones_like : Return an array of ones with shape and type of input. empty_like : Return an empty array with shape and type of input. zeros : Return a new array setting values to zero. ones : Return a new array setting values to one. empty : Return a new uninitialized array. full : Fill a new array. Examples -------- >>> x = np.arange(6, dtype=int) >>> np.full_like(x, 1) array([1, 1, 1, 1, 1, 1]) >>> np.full_like(x, 0.1) array([0, 0, 0, 0, 0, 0]) >>> np.full_like(x, 0.1, dtype=np.double) array([ 0.1, 0.1, 0.1, 0.1, 0.1, 0.1]) >>> np.full_like(x, np.nan, dtype=np.double) array([ nan, nan, nan, nan, nan, nan]) >>> y = np.arange(6, dtype=np.double) >>> np.full_like(y, 0.1) array([ 0.1, 0.1, 0.1, 0.1, 0.1, 0.1]) """ res = empty_like(a, dtype=dtype, order=order, subok=subok) multiarray.copyto(res, fill_value, casting='unsafe') return res def count_nonzero(a, axis=None): """ Counts the number of non-zero values in the array ``a``. The word "non-zero" is in reference to the Python 2.x built-in method ``__nonzero__()`` (renamed ``__bool__()`` in Python 3.x) of Python objects that tests an object's "truthfulness". For example, any number is considered truthful if it is nonzero, whereas any string is considered truthful if it is not the empty string. Thus, this function (recursively) counts how many elements in ``a`` (and in sub-arrays thereof) have their ``__nonzero__()`` or ``__bool__()`` method evaluated to ``True``. Parameters ---------- a : array_like The array for which to count non-zeros. axis : int or tuple, optional Axis or tuple of axes along which to count non-zeros. Default is None, meaning that non-zeros will be counted along a flattened version of ``a``. .. versionadded:: 1.12.0 Returns ------- count : int or array of int Number of non-zero values in the array along a given axis. Otherwise, the total number of non-zero values in the array is returned. See Also -------- nonzero : Return the coordinates of all the non-zero values. Examples -------- >>> np.count_nonzero(np.eye(4)) 4 >>> np.count_nonzero([[0,1,7,0,0],[3,0,0,2,19]]) 5 >>> np.count_nonzero([[0,1,7,0,0],[3,0,0,2,19]], axis=0) array([1, 1, 1, 1, 1]) >>> np.count_nonzero([[0,1,7,0,0],[3,0,0,2,19]], axis=1) array([2, 3]) """ if axis is None: return multiarray.count_nonzero(a) a = asanyarray(a) # TODO: this works around .astype(bool) not working properly (gh-9847) if np.issubdtype(a.dtype, np.character): a_bool = a != a.dtype.type() else: a_bool = a.astype(np.bool_, copy=False) return a_bool.sum(axis=axis, dtype=np.intp) def asarray(a, dtype=None, order=None): """Convert the input to an array. Parameters ---------- a : array_like Input data, in any form that can be converted to an array. This includes lists, lists of tuples, tuples, tuples of tuples, tuples of lists and ndarrays. dtype : data-type, optional By default, the data-type is inferred from the input data. order : {'C', 'F'}, optional Whether to use row-major (C-style) or column-major (Fortran-style) memory representation. Defaults to 'C'. Returns ------- out : ndarray Array interpretation of `a`. No copy is performed if the input is already an ndarray with matching dtype and order. If `a` is a subclass of ndarray, a base class ndarray is returned. See Also -------- asanyarray : Similar function which passes through subclasses. ascontiguousarray : Convert input to a contiguous array. asfarray : Convert input to a floating point ndarray. asfortranarray : Convert input to an ndarray with column-major memory order. asarray_chkfinite : Similar function which checks input for NaNs and Infs. fromiter : Create an array from an iterator. fromfunction : Construct an array by executing a function on grid positions. Examples -------- Convert a list into an array: >>> a = [1, 2] >>> np.asarray(a) array([1, 2]) Existing arrays are not copied: >>> a = np.array([1, 2]) >>> np.asarray(a) is a True If `dtype` is set, array is copied only if dtype does not match: >>> a = np.array([1, 2], dtype=np.float32) >>> np.asarray(a, dtype=np.float32) is a True >>> np.asarray(a, dtype=np.float64) is a False Contrary to `asanyarray`, ndarray subclasses are not passed through: >>> issubclass(np.matrix, np.ndarray) True >>> a = np.matrix([[1, 2]]) >>> np.asarray(a) is a False >>> np.asanyarray(a) is a True """ return array(a, dtype, copy=False, order=order) def asanyarray(a, dtype=None, order=None): """Convert the input to an ndarray, but pass ndarray subclasses through. Parameters ---------- a : array_like Input data, in any form that can be converted to an array. This includes scalars, lists, lists of tuples, tuples, tuples of tuples, tuples of lists, and ndarrays. dtype : data-type, optional By default, the data-type is inferred from the input data. order : {'C', 'F'}, optional Whether to use row-major (C-style) or column-major (Fortran-style) memory representation. Defaults to 'C'. Returns ------- out : ndarray or an ndarray subclass Array interpretation of `a`. If `a` is an ndarray or a subclass of ndarray, it is returned as-is and no copy is performed. See Also -------- asarray : Similar function which always returns ndarrays. ascontiguousarray : Convert input to a contiguous array. asfarray : Convert input to a floating point ndarray. asfortranarray : Convert input to an ndarray with column-major memory order. asarray_chkfinite : Similar function which checks input for NaNs and Infs. fromiter : Create an array from an iterator. fromfunction : Construct an array by executing a function on grid positions. Examples -------- Convert a list into an array: >>> a = [1, 2] >>> np.asanyarray(a) array([1, 2]) Instances of `ndarray` subclasses are passed through as-is: >>> a = np.matrix([1, 2]) >>> np.asanyarray(a) is a True """ return array(a, dtype, copy=False, order=order, subok=True) def ascontiguousarray(a, dtype=None): """ Return a contiguous array in memory (C order). Parameters ---------- a : array_like Input array. dtype : str or dtype object, optional Data-type of returned array. Returns ------- out : ndarray Contiguous array of same shape and content as `a`, with type `dtype` if specified. See Also -------- asfortranarray : Convert input to an ndarray with column-major memory order. require : Return an ndarray that satisfies requirements. ndarray.flags : Information about the memory layout of the array. Examples -------- >>> x = np.arange(6).reshape(2,3) >>> np.ascontiguousarray(x, dtype=np.float32) array([[ 0., 1., 2.], [ 3., 4., 5.]], dtype=float32) >>> x.flags['C_CONTIGUOUS'] True """ return array(a, dtype, copy=False, order='C', ndmin=1) def asfortranarray(a, dtype=None): """ Return an array laid out in Fortran order in memory. Parameters ---------- a : array_like Input array. dtype : str or dtype object, optional By default, the data-type is inferred from the input data. Returns ------- out : ndarray The input `a` in Fortran, or column-major, order. See Also -------- ascontiguousarray : Convert input to a contiguous (C order) array. asanyarray : Convert input to an ndarray with either row or column-major memory order. require : Return an ndarray that satisfies requirements. ndarray.flags : Information about the memory layout of the array. Examples -------- >>> x = np.arange(6).reshape(2,3) >>> y = np.asfortranarray(x) >>> x.flags['F_CONTIGUOUS'] False >>> y.flags['F_CONTIGUOUS'] True """ return array(a, dtype, copy=False, order='F', ndmin=1) def require(a, dtype=None, requirements=None): """ Return an ndarray of the provided type that satisfies requirements. This function is useful to be sure that an array with the correct flags is returned for passing to compiled code (perhaps through ctypes). Parameters ---------- a : array_like The object to be converted to a type-and-requirement-satisfying array. dtype : data-type The required data-type. If None preserve the current dtype. If your application requires the data to be in native byteorder, include a byteorder specification as a part of the dtype specification. requirements : str or list of str The requirements list can be any of the following * 'F_CONTIGUOUS' ('F') - ensure a Fortran-contiguous array * 'C_CONTIGUOUS' ('C') - ensure a C-contiguous array * 'ALIGNED' ('A') - ensure a data-type aligned array * 'WRITEABLE' ('W') - ensure a writable array * 'OWNDATA' ('O') - ensure an array that owns its own data * 'ENSUREARRAY', ('E') - ensure a base array, instead of a subclass See Also -------- asarray : Convert input to an ndarray. asanyarray : Convert to an ndarray, but pass through ndarray subclasses. ascontiguousarray : Convert input to a contiguous array. asfortranarray : Convert input to an ndarray with column-major memory order. ndarray.flags : Information about the memory layout of the array. Notes ----- The returned array will be guaranteed to have the listed requirements by making a copy if needed. Examples -------- >>> x = np.arange(6).reshape(2,3) >>> x.flags C_CONTIGUOUS : True F_CONTIGUOUS : False OWNDATA : False WRITEABLE : True ALIGNED : True WRITEBACKIFCOPY : False UPDATEIFCOPY : False >>> y = np.require(x, dtype=np.float32, requirements=['A', 'O', 'W', 'F']) >>> y.flags C_CONTIGUOUS : False F_CONTIGUOUS : True OWNDATA : True WRITEABLE : True ALIGNED : True WRITEBACKIFCOPY : False UPDATEIFCOPY : False """ possible_flags = {'C':'C', 'C_CONTIGUOUS':'C', 'CONTIGUOUS':'C', 'F':'F', 'F_CONTIGUOUS':'F', 'FORTRAN':'F', 'A':'A', 'ALIGNED':'A', 'W':'W', 'WRITEABLE':'W', 'O':'O', 'OWNDATA':'O', 'E':'E', 'ENSUREARRAY':'E'} if not requirements: return asanyarray(a, dtype=dtype) else: requirements = set(possible_flags[x.upper()] for x in requirements) if 'E' in requirements: requirements.remove('E') subok = False else: subok = True order = 'A' if requirements >= set(['C', 'F']): raise ValueError('Cannot specify both "C" and "F" order') elif 'F' in requirements: order = 'F' requirements.remove('F') elif 'C' in requirements: order = 'C' requirements.remove('C') arr = array(a, dtype=dtype, order=order, copy=False, subok=subok) for prop in requirements: if not arr.flags[prop]: arr = arr.copy(order) break return arr def isfortran(a): """ Returns True if the array is Fortran contiguous but *not* C contiguous. This function is obsolete and, because of changes due to relaxed stride checking, its return value for the same array may differ for versions of NumPy >= 1.10.0 and previous versions. If you only want to check if an array is Fortran contiguous use ``a.flags.f_contiguous`` instead. Parameters ---------- a : ndarray Input array. Examples -------- np.array allows to specify whether the array is written in C-contiguous order (last index varies the fastest), or FORTRAN-contiguous order in memory (first index varies the fastest). >>> a = np.array([[1, 2, 3], [4, 5, 6]], order='C') >>> a array([[1, 2, 3], [4, 5, 6]]) >>> np.isfortran(a) False >>> b = np.array([[1, 2, 3], [4, 5, 6]], order='FORTRAN') >>> b array([[1, 2, 3], [4, 5, 6]]) >>> np.isfortran(b) True The transpose of a C-ordered array is a FORTRAN-ordered array. >>> a = np.array([[1, 2, 3], [4, 5, 6]], order='C') >>> a array([[1, 2, 3], [4, 5, 6]]) >>> np.isfortran(a) False >>> b = a.T >>> b array([[1, 4], [2, 5], [3, 6]]) >>> np.isfortran(b) True C-ordered arrays evaluate as False even if they are also FORTRAN-ordered. >>> np.isfortran(np.array([1, 2], order='FORTRAN')) False """ return a.flags.fnc def argwhere(a): """ Find the indices of array elements that are non-zero, grouped by element. Parameters ---------- a : array_like Input data. Returns ------- index_array : ndarray Indices of elements that are non-zero. Indices are grouped by element. See Also -------- where, nonzero Notes ----- ``np.argwhere(a)`` is the same as ``np.transpose(np.nonzero(a))``. The output of ``argwhere`` is not suitable for indexing arrays. For this purpose use ``nonzero(a)`` instead. Examples -------- >>> x = np.arange(6).reshape(2,3) >>> x array([[0, 1, 2], [3, 4, 5]]) >>> np.argwhere(x>1) array([[0, 2], [1, 0], [1, 1], [1, 2]]) """ return transpose(nonzero(a)) def flatnonzero(a): """ Return indices that are non-zero in the flattened version of a. This is equivalent to a.ravel().nonzero()[0]. Parameters ---------- a : ndarray Input array. Returns ------- res : ndarray Output array, containing the indices of the elements of `a.ravel()` that are non-zero. See Also -------- nonzero : Return the indices of the non-zero elements of the input array. ravel : Return a 1-D array containing the elements of the input array. Examples -------- >>> x = np.arange(-2, 3) >>> x array([-2, -1, 0, 1, 2]) >>> np.flatnonzero(x) array([0, 1, 3, 4]) Use the indices of the non-zero elements as an index array to extract these elements: >>> x.ravel()[np.flatnonzero(x)] array([-2, -1, 1, 2]) """ return a.ravel().nonzero()[0] _mode_from_name_dict = {'v': 0, 's': 1, 'f': 2} def _mode_from_name(mode): if isinstance(mode, basestring): return _mode_from_name_dict[mode.lower()[0]] return mode def correlate(a, v, mode='valid'): """ Cross-correlation of two 1-dimensional sequences. This function computes the correlation as generally defined in signal processing texts:: c_{av}[k] = sum_n a[n+k] * conj(v[n]) with a and v sequences being zero-padded where necessary and conj being the conjugate. Parameters ---------- a, v : array_like Input sequences. mode : {'valid', 'same', 'full'}, optional Refer to the `convolve` docstring. Note that the default is 'valid', unlike `convolve`, which uses 'full'. old_behavior : bool `old_behavior` was removed in NumPy 1.10. If you need the old behavior, use `multiarray.correlate`. Returns ------- out : ndarray Discrete cross-correlation of `a` and `v`. See Also -------- convolve : Discrete, linear convolution of two one-dimensional sequences. multiarray.correlate : Old, no conjugate, version of correlate. Notes ----- The definition of correlation above is not unique and sometimes correlation may be defined differently. Another common definition is:: c'_{av}[k] = sum_n a[n] conj(v[n+k]) which is related to ``c_{av}[k]`` by ``c'_{av}[k] = c_{av}[-k]``. Examples -------- >>> np.correlate([1, 2, 3], [0, 1, 0.5]) array([ 3.5]) >>> np.correlate([1, 2, 3], [0, 1, 0.5], "same") array([ 2. , 3.5, 3. ]) >>> np.correlate([1, 2, 3], [0, 1, 0.5], "full") array([ 0.5, 2. , 3.5, 3. , 0. ]) Using complex sequences: >>> np.correlate([1+1j, 2, 3-1j], [0, 1, 0.5j], 'full') array([ 0.5-0.5j, 1.0+0.j , 1.5-1.5j, 3.0-1.j , 0.0+0.j ]) Note that you get the time reversed, complex conjugated result when the two input sequences change places, i.e., ``c_{va}[k] = c^{*}_{av}[-k]``: >>> np.correlate([0, 1, 0.5j], [1+1j, 2, 3-1j], 'full') array([ 0.0+0.j , 3.0+1.j , 1.5+1.5j, 1.0+0.j , 0.5+0.5j]) """ mode = _mode_from_name(mode) return multiarray.correlate2(a, v, mode) def convolve(a, v, mode='full'): """ Returns the discrete, linear convolution of two one-dimensional sequences. The convolution operator is often seen in signal processing, where it models the effect of a linear time-invariant system on a signal [1]_. In probability theory, the sum of two independent random variables is distributed according to the convolution of their individual distributions. If `v` is longer than `a`, the arrays are swapped before computation. Parameters ---------- a : (N,) array_like First one-dimensional input array. v : (M,) array_like Second one-dimensional input array. mode : {'full', 'valid', 'same'}, optional 'full': By default, mode is 'full'. This returns the convolution at each point of overlap, with an output shape of (N+M-1,). At the end-points of the convolution, the signals do not overlap completely, and boundary effects may be seen. 'same': Mode 'same' returns output of length ``max(M, N)``. Boundary effects are still visible. 'valid': Mode 'valid' returns output of length ``max(M, N) - min(M, N) + 1``. The convolution product is only given for points where the signals overlap completely. Values outside the signal boundary have no effect. Returns ------- out : ndarray Discrete, linear convolution of `a` and `v`. See Also -------- scipy.signal.fftconvolve : Convolve two arrays using the Fast Fourier Transform. scipy.linalg.toeplitz : Used to construct the convolution operator. polymul : Polynomial multiplication. Same output as convolve, but also accepts poly1d objects as input. Notes ----- The discrete convolution operation is defined as .. math:: (a * v)[n] = \\sum_{m = -\\infty}^{\\infty} a[m] v[n - m] It can be shown that a convolution :math:`x(t) * y(t)` in time/space is equivalent to the multiplication :math:`X(f) Y(f)` in the Fourier domain, after appropriate padding (padding is necessary to prevent circular convolution). Since multiplication is more efficient (faster) than convolution, the function `scipy.signal.fftconvolve` exploits the FFT to calculate the convolution of large data-sets. References ---------- .. [1] Wikipedia, "Convolution", http://en.wikipedia.org/wiki/Convolution. Examples -------- Note how the convolution operator flips the second array before "sliding" the two across one another: >>> np.convolve([1, 2, 3], [0, 1, 0.5]) array([ 0. , 1. , 2.5, 4. , 1.5]) Only return the middle values of the convolution. Contains boundary effects, where zeros are taken into account: >>> np.convolve([1,2,3],[0,1,0.5], 'same') array([ 1. , 2.5, 4. ]) The two arrays are of the same length, so there is only one position where they completely overlap: >>> np.convolve([1,2,3],[0,1,0.5], 'valid') array([ 2.5]) """ a, v = array(a, copy=False, ndmin=1), array(v, copy=False, ndmin=1) if (len(v) > len(a)): a, v = v, a if len(a) == 0: raise ValueError('a cannot be empty') if len(v) == 0: raise ValueError('v cannot be empty') mode = _mode_from_name(mode) return multiarray.correlate(a, v[::-1], mode) def outer(a, b, out=None): """ Compute the outer product of two vectors. Given two vectors, ``a = [a0, a1, ..., aM]`` and ``b = [b0, b1, ..., bN]``, the outer product [1]_ is:: [[a0*b0 a0*b1 ... a0*bN ] [a1*b0 . [ ... . [aM*b0 aM*bN ]] Parameters ---------- a : (M,) array_like First input vector. Input is flattened if not already 1-dimensional. b : (N,) array_like Second input vector. Input is flattened if not already 1-dimensional. out : (M, N) ndarray, optional A location where the result is stored .. versionadded:: 1.9.0 Returns ------- out : (M, N) ndarray ``out[i, j] = a[i] * b[j]`` See also -------- inner einsum : ``einsum('i,j->ij', a.ravel(), b.ravel())`` is the equivalent. ufunc.outer : A generalization to N dimensions and other operations. ``np.multiply.outer(a.ravel(), b.ravel())`` is the equivalent. References ---------- .. [1] : G. H. Golub and C. F. van Loan, *Matrix Computations*, 3rd ed., Baltimore, MD, Johns Hopkins University Press, 1996, pg. 8. Examples -------- Make a (*very* coarse) grid for computing a Mandelbrot set: >>> rl = np.outer(np.ones((5,)), np.linspace(-2, 2, 5)) >>> rl array([[-2., -1., 0., 1., 2.], [-2., -1., 0., 1., 2.], [-2., -1., 0., 1., 2.], [-2., -1., 0., 1., 2.], [-2., -1., 0., 1., 2.]]) >>> im = np.outer(1j*np.linspace(2, -2, 5), np.ones((5,))) >>> im array([[ 0.+2.j, 0.+2.j, 0.+2.j, 0.+2.j, 0.+2.j], [ 0.+1.j, 0.+1.j, 0.+1.j, 0.+1.j, 0.+1.j], [ 0.+0.j, 0.+0.j, 0.+0.j, 0.+0.j, 0.+0.j], [ 0.-1.j, 0.-1.j, 0.-1.j, 0.-1.j, 0.-1.j], [ 0.-2.j, 0.-2.j, 0.-2.j, 0.-2.j, 0.-2.j]]) >>> grid = rl + im >>> grid array([[-2.+2.j, -1.+2.j, 0.+2.j, 1.+2.j, 2.+2.j], [-2.+1.j, -1.+1.j, 0.+1.j, 1.+1.j, 2.+1.j], [-2.+0.j, -1.+0.j, 0.+0.j, 1.+0.j, 2.+0.j], [-2.-1.j, -1.-1.j, 0.-1.j, 1.-1.j, 2.-1.j], [-2.-2.j, -1.-2.j, 0.-2.j, 1.-2.j, 2.-2.j]]) An example using a "vector" of letters: >>> x = np.array(['a', 'b', 'c'], dtype=object) >>> np.outer(x, [1, 2, 3]) array([[a, aa, aaa], [b, bb, bbb], [c, cc, ccc]], dtype=object) """ a = asarray(a) b = asarray(b) return multiply(a.ravel()[:, newaxis], b.ravel()[newaxis,:], out) def tensordot(a, b, axes=2): """ Compute tensor dot product along specified axes for arrays >= 1-D. Given two tensors (arrays of dimension greater than or equal to one), `a` and `b`, and an array_like object containing two array_like objects, ``(a_axes, b_axes)``, sum the products of `a`'s and `b`'s elements (components) over the axes specified by ``a_axes`` and ``b_axes``. The third argument can be a single non-negative integer_like scalar, ``N``; if it is such, then the last ``N`` dimensions of `a` and the first ``N`` dimensions of `b` are summed over. Parameters ---------- a, b : array_like, len(shape) >= 1 Tensors to "dot". axes : int or (2,) array_like * integer_like If an int N, sum over the last N axes of `a` and the first N axes of `b` in order. The sizes of the corresponding axes must match. * (2,) array_like Or, a list of axes to be summed over, first sequence applying to `a`, second to `b`. Both elements array_like must be of the same length. See Also -------- dot, einsum Notes ----- Three common use cases are: * ``axes = 0`` : tensor product :math:`a\\otimes b` * ``axes = 1`` : tensor dot product :math:`a\\cdot b` * ``axes = 2`` : (default) tensor double contraction :math:`a:b` When `axes` is integer_like, the sequence for evaluation will be: first the -Nth axis in `a` and 0th axis in `b`, and the -1th axis in `a` and Nth axis in `b` last. When there is more than one axis to sum over - and they are not the last (first) axes of `a` (`b`) - the argument `axes` should consist of two sequences of the same length, with the first axis to sum over given first in both sequences, the second axis second, and so forth. Examples -------- A "traditional" example: >>> a = np.arange(60.).reshape(3,4,5) >>> b = np.arange(24.).reshape(4,3,2) >>> c = np.tensordot(a,b, axes=([1,0],[0,1])) >>> c.shape (5, 2) >>> c array([[ 4400., 4730.], [ 4532., 4874.], [ 4664., 5018.], [ 4796., 5162.], [ 4928., 5306.]]) >>> # A slower but equivalent way of computing the same... >>> d = np.zeros((5,2)) >>> for i in range(5): ... for j in range(2): ... for k in range(3): ... for n in range(4): ... d[i,j] += a[k,n,i] * b[n,k,j] >>> c == d array([[ True, True], [ True, True], [ True, True], [ True, True], [ True, True]]) An extended example taking advantage of the overloading of + and \\*: >>> a = np.array(range(1, 9)) >>> a.shape = (2, 2, 2) >>> A = np.array(('a', 'b', 'c', 'd'), dtype=object) >>> A.shape = (2, 2) >>> a; A array([[[1, 2], [3, 4]], [[5, 6], [7, 8]]]) array([[a, b], [c, d]], dtype=object) >>> np.tensordot(a, A) # third argument default is 2 for double-contraction array([abbcccdddd, aaaaabbbbbbcccccccdddddddd], dtype=object) >>> np.tensordot(a, A, 1) array([[[acc, bdd], [aaacccc, bbbdddd]], [[aaaaacccccc, bbbbbdddddd], [aaaaaaacccccccc, bbbbbbbdddddddd]]], dtype=object) >>> np.tensordot(a, A, 0) # tensor product (result too long to incl.) array([[[[[a, b], [c, d]], ... >>> np.tensordot(a, A, (0, 1)) array([[[abbbbb, cddddd], [aabbbbbb, ccdddddd]], [[aaabbbbbbb, cccddddddd], [aaaabbbbbbbb, ccccdddddddd]]], dtype=object) >>> np.tensordot(a, A, (2, 1)) array([[[abb, cdd], [aaabbbb, cccdddd]], [[aaaaabbbbbb, cccccdddddd], [aaaaaaabbbbbbbb, cccccccdddddddd]]], dtype=object) >>> np.tensordot(a, A, ((0, 1), (0, 1))) array([abbbcccccddddddd, aabbbbccccccdddddddd], dtype=object) >>> np.tensordot(a, A, ((2, 1), (1, 0))) array([acccbbdddd, aaaaacccccccbbbbbbdddddddd], dtype=object) """ try: iter(axes) except Exception: axes_a = list(range(-axes, 0)) axes_b = list(range(0, axes)) else: axes_a, axes_b = axes try: na = len(axes_a) axes_a = list(axes_a) except TypeError: axes_a = [axes_a] na = 1 try: nb = len(axes_b) axes_b = list(axes_b) except TypeError: axes_b = [axes_b] nb = 1 a, b = asarray(a), asarray(b) as_ = a.shape nda = a.ndim bs = b.shape ndb = b.ndim equal = True if na != nb: equal = False else: for k in range(na): if as_[axes_a[k]] != bs[axes_b[k]]: equal = False break if axes_a[k] < 0: axes_a[k] += nda if axes_b[k] < 0: axes_b[k] += ndb if not equal: raise ValueError("shape-mismatch for sum") # Move the axes to sum over to the end of "a" # and to the front of "b" notin = [k for k in range(nda) if k not in axes_a] newaxes_a = notin + axes_a N2 = 1 for axis in axes_a: N2 *= as_[axis] newshape_a = (int(multiply.reduce([as_[ax] for ax in notin])), N2) olda = [as_[axis] for axis in notin] notin = [k for k in range(ndb) if k not in axes_b] newaxes_b = axes_b + notin N2 = 1 for axis in axes_b: N2 *= bs[axis] newshape_b = (N2, int(multiply.reduce([bs[ax] for ax in notin]))) oldb = [bs[axis] for axis in notin] at = a.transpose(newaxes_a).reshape(newshape_a) bt = b.transpose(newaxes_b).reshape(newshape_b) res = dot(at, bt) return res.reshape(olda + oldb) def roll(a, shift, axis=None): """ Roll array elements along a given axis. Elements that roll beyond the last position are re-introduced at the first. Parameters ---------- a : array_like Input array. shift : int or tuple of ints The number of places by which elements are shifted. If a tuple, then `axis` must be a tuple of the same size, and each of the given axes is shifted by the corresponding number. If an int while `axis` is a tuple of ints, then the same value is used for all given axes. axis : int or tuple of ints, optional Axis or axes along which elements are shifted. By default, the array is flattened before shifting, after which the original shape is restored. Returns ------- res : ndarray Output array, with the same shape as `a`. See Also -------- rollaxis : Roll the specified axis backwards, until it lies in a given position. Notes ----- .. versionadded:: 1.12.0 Supports rolling over multiple dimensions simultaneously. Examples -------- >>> x = np.arange(10) >>> np.roll(x, 2) array([8, 9, 0, 1, 2, 3, 4, 5, 6, 7]) >>> x2 = np.reshape(x, (2,5)) >>> x2 array([[0, 1, 2, 3, 4], [5, 6, 7, 8, 9]]) >>> np.roll(x2, 1) array([[9, 0, 1, 2, 3], [4, 5, 6, 7, 8]]) >>> np.roll(x2, 1, axis=0) array([[5, 6, 7, 8, 9], [0, 1, 2, 3, 4]]) >>> np.roll(x2, 1, axis=1) array([[4, 0, 1, 2, 3], [9, 5, 6, 7, 8]]) """ a = asanyarray(a) if axis is None: return roll(a.ravel(), shift, 0).reshape(a.shape) else: axis = normalize_axis_tuple(axis, a.ndim, allow_duplicate=True) broadcasted = broadcast(shift, axis) if broadcasted.ndim > 1: raise ValueError( "'shift' and 'axis' should be scalars or 1D sequences") shifts = {ax: 0 for ax in range(a.ndim)} for sh, ax in broadcasted: shifts[ax] += sh rolls = [((slice(None), slice(None)),)] * a.ndim for ax, offset in shifts.items(): offset %= a.shape[ax] or 1 # If `a` is empty, nothing matters. if offset: # (original, result), (original, result) rolls[ax] = ((slice(None, -offset), slice(offset, None)), (slice(-offset, None), slice(None, offset))) result = empty_like(a) for indices in itertools.product(*rolls): arr_index, res_index = zip(*indices) result[res_index] = a[arr_index] return result def rollaxis(a, axis, start=0): """ Roll the specified axis backwards, until it lies in a given position. This function continues to be supported for backward compatibility, but you should prefer `moveaxis`. The `moveaxis` function was added in NumPy 1.11. Parameters ---------- a : ndarray Input array. axis : int The axis to roll backwards. The positions of the other axes do not change relative to one another. start : int, optional The axis is rolled until it lies before this position. The default, 0, results in a "complete" roll. Returns ------- res : ndarray For NumPy >= 1.10.0 a view of `a` is always returned. For earlier NumPy versions a view of `a` is returned only if the order of the axes is changed, otherwise the input array is returned. See Also -------- moveaxis : Move array axes to new positions. roll : Roll the elements of an array by a number of positions along a given axis. Examples -------- >>> a = np.ones((3,4,5,6)) >>> np.rollaxis(a, 3, 1).shape (3, 6, 4, 5) >>> np.rollaxis(a, 2).shape (5, 3, 4, 6) >>> np.rollaxis(a, 1, 4).shape (3, 5, 6, 4) """ n = a.ndim axis = normalize_axis_index(axis, n) if start < 0: start += n msg = "'%s' arg requires %d <= %s < %d, but %d was passed in" if not (0 <= start < n + 1): raise AxisError(msg % ('start', -n, 'start', n + 1, start)) if axis < start: # it's been removed start -= 1 if axis == start: return a[...] axes = list(range(0, n)) axes.remove(axis) axes.insert(start, axis) return a.transpose(axes) def normalize_axis_tuple(axis, ndim, argname=None, allow_duplicate=False): """ Normalizes an axis argument into a tuple of non-negative integer axes. This handles shorthands such as ``1`` and converts them to ``(1,)``, as well as performing the handling of negative indices covered by `normalize_axis_index`. By default, this forbids axes from being specified multiple times. Used internally by multi-axis-checking logic. .. versionadded:: 1.13.0 Parameters ---------- axis : int, iterable of int The un-normalized index or indices of the axis. ndim : int The number of dimensions of the array that `axis` should be normalized against. argname : str, optional A prefix to put before the error message, typically the name of the argument. allow_duplicate : bool, optional If False, the default, disallow an axis from being specified twice. Returns ------- normalized_axes : tuple of int The normalized axis index, such that `0 <= normalized_axis < ndim` Raises ------ AxisError If any axis provided is out of range ValueError If an axis is repeated See also -------- normalize_axis_index : normalizing a single scalar axis """ try: axis = [operator.index(axis)] except TypeError: axis = tuple(axis) axis = tuple(normalize_axis_index(ax, ndim, argname) for ax in axis) if not allow_duplicate and len(set(axis)) != len(axis): if argname: raise ValueError('repeated axis in `{}` argument'.format(argname)) else: raise ValueError('repeated axis') return axis def moveaxis(a, source, destination): """ Move axes of an array to new positions. Other axes remain in their original order. .. versionadded:: 1.11.0 Parameters ---------- a : np.ndarray The array whose axes should be reordered. source : int or sequence of int Original positions of the axes to move. These must be unique. destination : int or sequence of int Destination positions for each of the original axes. These must also be unique. Returns ------- result : np.ndarray Array with moved axes. This array is a view of the input array. See Also -------- transpose: Permute the dimensions of an array. swapaxes: Interchange two axes of an array. Examples -------- >>> x = np.zeros((3, 4, 5)) >>> np.moveaxis(x, 0, -1).shape (4, 5, 3) >>> np.moveaxis(x, -1, 0).shape (5, 3, 4) These all achieve the same result: >>> np.transpose(x).shape (5, 4, 3) >>> np.swapaxes(x, 0, -1).shape (5, 4, 3) >>> np.moveaxis(x, [0, 1], [-1, -2]).shape (5, 4, 3) >>> np.moveaxis(x, [0, 1, 2], [-1, -2, -3]).shape (5, 4, 3) """ try: # allow duck-array types if they define transpose transpose = a.transpose except AttributeError: a = asarray(a) transpose = a.transpose source = normalize_axis_tuple(source, a.ndim, 'source') destination = normalize_axis_tuple(destination, a.ndim, 'destination') if len(source) != len(destination): raise ValueError('`source` and `destination` arguments must have ' 'the same number of elements') order = [n for n in range(a.ndim) if n not in source] for dest, src in sorted(zip(destination, source)): order.insert(dest, src) result = transpose(order) return result # fix hack in scipy which imports this function def _move_axis_to_0(a, axis): return moveaxis(a, axis, 0) def cross(a, b, axisa=-1, axisb=-1, axisc=-1, axis=None): """ Return the cross product of two (arrays of) vectors. The cross product of `a` and `b` in :math:`R^3` is a vector perpendicular to both `a` and `b`. If `a` and `b` are arrays of vectors, the vectors are defined by the last axis of `a` and `b` by default, and these axes can have dimensions 2 or 3. Where the dimension of either `a` or `b` is 2, the third component of the input vector is assumed to be zero and the cross product calculated accordingly. In cases where both input vectors have dimension 2, the z-component of the cross product is returned. Parameters ---------- a : array_like Components of the first vector(s). b : array_like Components of the second vector(s). axisa : int, optional Axis of `a` that defines the vector(s). By default, the last axis. axisb : int, optional Axis of `b` that defines the vector(s). By default, the last axis. axisc : int, optional Axis of `c` containing the cross product vector(s). Ignored if both input vectors have dimension 2, as the return is scalar. By default, the last axis. axis : int, optional If defined, the axis of `a`, `b` and `c` that defines the vector(s) and cross product(s). Overrides `axisa`, `axisb` and `axisc`. Returns ------- c : ndarray Vector cross product(s). Raises ------ ValueError When the dimension of the vector(s) in `a` and/or `b` does not equal 2 or 3. See Also -------- inner : Inner product outer : Outer product. ix_ : Construct index arrays. Notes ----- .. versionadded:: 1.9.0 Supports full broadcasting of the inputs. Examples -------- Vector cross-product. >>> x = [1, 2, 3] >>> y = [4, 5, 6] >>> np.cross(x, y) array([-3, 6, -3]) One vector with dimension 2. >>> x = [1, 2] >>> y = [4, 5, 6] >>> np.cross(x, y) array([12, -6, -3]) Equivalently: >>> x = [1, 2, 0] >>> y = [4, 5, 6] >>> np.cross(x, y) array([12, -6, -3]) Both vectors with dimension 2. >>> x = [1,2] >>> y = [4,5] >>> np.cross(x, y) -3 Multiple vector cross-products. Note that the direction of the cross product vector is defined by the `right-hand rule`. >>> x = np.array([[1,2,3], [4,5,6]]) >>> y = np.array([[4,5,6], [1,2,3]]) >>> np.cross(x, y) array([[-3, 6, -3], [ 3, -6, 3]]) The orientation of `c` can be changed using the `axisc` keyword. >>> np.cross(x, y, axisc=0) array([[-3, 3], [ 6, -6], [-3, 3]]) Change the vector definition of `x` and `y` using `axisa` and `axisb`. >>> x = np.array([[1,2,3], [4,5,6], [7, 8, 9]]) >>> y = np.array([[7, 8, 9], [4,5,6], [1,2,3]]) >>> np.cross(x, y) array([[ -6, 12, -6], [ 0, 0, 0], [ 6, -12, 6]]) >>> np.cross(x, y, axisa=0, axisb=0) array([[-24, 48, -24], [-30, 60, -30], [-36, 72, -36]]) """ if axis is not None: axisa, axisb, axisc = (axis,) * 3 a = asarray(a) b = asarray(b) # Check axisa and axisb are within bounds axisa = normalize_axis_index(axisa, a.ndim, msg_prefix='axisa') axisb = normalize_axis_index(axisb, b.ndim, msg_prefix='axisb') # Move working axis to the end of the shape a = moveaxis(a, axisa, -1) b = moveaxis(b, axisb, -1) msg = ("incompatible dimensions for cross product\n" "(dimension must be 2 or 3)") if a.shape[-1] not in (2, 3) or b.shape[-1] not in (2, 3): raise ValueError(msg) # Create the output array shape = broadcast(a[..., 0], b[..., 0]).shape if a.shape[-1] == 3 or b.shape[-1] == 3: shape += (3,) # Check axisc is within bounds axisc = normalize_axis_index(axisc, len(shape), msg_prefix='axisc') dtype = promote_types(a.dtype, b.dtype) cp = empty(shape, dtype) # create local aliases for readability a0 = a[..., 0] a1 = a[..., 1] if a.shape[-1] == 3: a2 = a[..., 2] b0 = b[..., 0] b1 = b[..., 1] if b.shape[-1] == 3: b2 = b[..., 2] if cp.ndim != 0 and cp.shape[-1] == 3: cp0 = cp[..., 0] cp1 = cp[..., 1] cp2 = cp[..., 2] if a.shape[-1] == 2: if b.shape[-1] == 2: # a0 * b1 - a1 * b0 multiply(a0, b1, out=cp) cp -= a1 * b0 return cp else: assert b.shape[-1] == 3 # cp0 = a1 * b2 - 0 (a2 = 0) # cp1 = 0 - a0 * b2 (a2 = 0) # cp2 = a0 * b1 - a1 * b0 multiply(a1, b2, out=cp0) multiply(a0, b2, out=cp1) negative(cp1, out=cp1) multiply(a0, b1, out=cp2) cp2 -= a1 * b0 else: assert a.shape[-1] == 3 if b.shape[-1] == 3: # cp0 = a1 * b2 - a2 * b1 # cp1 = a2 * b0 - a0 * b2 # cp2 = a0 * b1 - a1 * b0 multiply(a1, b2, out=cp0) tmp = array(a2 * b1) cp0 -= tmp multiply(a2, b0, out=cp1) multiply(a0, b2, out=tmp) cp1 -= tmp multiply(a0, b1, out=cp2) multiply(a1, b0, out=tmp) cp2 -= tmp else: assert b.shape[-1] == 2 # cp0 = 0 - a2 * b1 (b2 = 0) # cp1 = a2 * b0 - 0 (b2 = 0) # cp2 = a0 * b1 - a1 * b0 multiply(a2, b1, out=cp0) negative(cp0, out=cp0) multiply(a2, b0, out=cp1) multiply(a0, b1, out=cp2) cp2 -= a1 * b0 return moveaxis(cp, -1, axisc) little_endian = (sys.byteorder == 'little') def indices(dimensions, dtype=int): """ Return an array representing the indices of a grid. Compute an array where the subarrays contain index values 0,1,... varying only along the corresponding axis. Parameters ---------- dimensions : sequence of ints The shape of the grid. dtype : dtype, optional Data type of the result. Returns ------- grid : ndarray The array of grid indices, ``grid.shape = (len(dimensions),) + tuple(dimensions)``. See Also -------- mgrid, meshgrid Notes ----- The output shape is obtained by prepending the number of dimensions in front of the tuple of dimensions, i.e. if `dimensions` is a tuple ``(r0, ..., rN-1)`` of length ``N``, the output shape is ``(N,r0,...,rN-1)``. The subarrays ``grid[k]`` contains the N-D array of indices along the ``k-th`` axis. Explicitly:: grid[k,i0,i1,...,iN-1] = ik Examples -------- >>> grid = np.indices((2, 3)) >>> grid.shape (2, 2, 3) >>> grid[0] # row indices array([[0, 0, 0], [1, 1, 1]]) >>> grid[1] # column indices array([[0, 1, 2], [0, 1, 2]]) The indices can be used as an index into an array. >>> x = np.arange(20).reshape(5, 4) >>> row, col = np.indices((2, 3)) >>> x[row, col] array([[0, 1, 2], [4, 5, 6]]) Note that it would be more straightforward in the above example to extract the required elements directly with ``x[:2, :3]``. """ dimensions = tuple(dimensions) N = len(dimensions) shape = (1,)*N res = empty((N,)+dimensions, dtype=dtype) for i, dim in enumerate(dimensions): res[i] = arange(dim, dtype=dtype).reshape( shape[:i] + (dim,) + shape[i+1:] ) return res def fromfunction(function, shape, **kwargs): """ Construct an array by executing a function over each coordinate. The resulting array therefore has a value ``fn(x, y, z)`` at coordinate ``(x, y, z)``. Parameters ---------- function : callable The function is called with N parameters, where N is the rank of `shape`. Each parameter represents the coordinates of the array varying along a specific axis. For example, if `shape` were ``(2, 2)``, then the parameters would be ``array([[0, 0], [1, 1]])`` and ``array([[0, 1], [0, 1]])`` shape : (N,) tuple of ints Shape of the output array, which also determines the shape of the coordinate arrays passed to `function`. dtype : data-type, optional Data-type of the coordinate arrays passed to `function`. By default, `dtype` is float. Returns ------- fromfunction : any The result of the call to `function` is passed back directly. Therefore the shape of `fromfunction` is completely determined by `function`. If `function` returns a scalar value, the shape of `fromfunction` would match the `shape` parameter. See Also -------- indices, meshgrid Notes ----- Keywords other than `dtype` are passed to `function`. Examples -------- >>> np.fromfunction(lambda i, j: i == j, (3, 3), dtype=int) array([[ True, False, False], [False, True, False], [False, False, True]]) >>> np.fromfunction(lambda i, j: i + j, (3, 3), dtype=int) array([[0, 1, 2], [1, 2, 3], [2, 3, 4]]) """ dtype = kwargs.pop('dtype', float) args = indices(shape, dtype=dtype) return function(*args, **kwargs) def isscalar(num): """ Returns True if the type of `num` is a scalar type. Parameters ---------- num : any Input argument, can be of any type and shape. Returns ------- val : bool True if `num` is a scalar type, False if it is not. Examples -------- >>> np.isscalar(3.1) True >>> np.isscalar([3.1]) False >>> np.isscalar(False) True >>> np.isscalar('numpy') True NumPy supports PEP 3141 numbers: >>> from fractions import Fraction >>> isscalar(Fraction(5, 17)) True >>> from numbers import Number >>> isscalar(Number()) True """ return (isinstance(num, generic) or type(num) in ScalarType or isinstance(num, numbers.Number)) def binary_repr(num, width=None): """ Return the binary representation of the input number as a string. For negative numbers, if width is not given, a minus sign is added to the front. If width is given, the two's complement of the number is returned, with respect to that width. In a two's-complement system negative numbers are represented by the two's complement of the absolute value. This is the most common method of representing signed integers on computers [1]_. A N-bit two's-complement system can represent every integer in the range :math:`-2^{N-1}` to :math:`+2^{N-1}-1`. Parameters ---------- num : int Only an integer decimal number can be used. width : int, optional The length of the returned string if `num` is positive, or the length of the two's complement if `num` is negative, provided that `width` is at least a sufficient number of bits for `num` to be represented in the designated form. If the `width` value is insufficient, it will be ignored, and `num` will be returned in binary (`num` > 0) or two's complement (`num` < 0) form with its width equal to the minimum number of bits needed to represent the number in the designated form. This behavior is deprecated and will later raise an error. .. deprecated:: 1.12.0 Returns ------- bin : str Binary representation of `num` or two's complement of `num`. See Also -------- base_repr: Return a string representation of a number in the given base system. bin: Python's built-in binary representation generator of an integer. Notes ----- `binary_repr` is equivalent to using `base_repr` with base 2, but about 25x faster. References ---------- .. [1] Wikipedia, "Two's complement", http://en.wikipedia.org/wiki/Two's_complement Examples -------- >>> np.binary_repr(3) '11' >>> np.binary_repr(-3) '-11' >>> np.binary_repr(3, width=4) '0011' The two's complement is returned when the input number is negative and width is specified: >>> np.binary_repr(-3, width=3) '101' >>> np.binary_repr(-3, width=5) '11101' """ def warn_if_insufficient(width, binwdith): if width is not None and width < binwidth: warnings.warn( "Insufficient bit width provided. This behavior " "will raise an error in the future.", DeprecationWarning, stacklevel=3) if num == 0: return '0' * (width or 1) elif num > 0: binary = bin(num)[2:] binwidth = len(binary) outwidth = (binwidth if width is None else max(binwidth, width)) warn_if_insufficient(width, binwidth) return binary.zfill(outwidth) else: if width is None: return '-' + bin(-num)[2:] else: poswidth = len(bin(-num)[2:]) # See gh-8679: remove extra digit # for numbers at boundaries. if 2**(poswidth - 1) == -num: poswidth -= 1 twocomp = 2**(poswidth + 1) + num binary = bin(twocomp)[2:] binwidth = len(binary) outwidth = max(binwidth, width) warn_if_insufficient(width, binwidth) return '1' * (outwidth - binwidth) + binary def base_repr(number, base=2, padding=0): """ Return a string representation of a number in the given base system. Parameters ---------- number : int The value to convert. Positive and negative values are handled. base : int, optional Convert `number` to the `base` number system. The valid range is 2-36, the default value is 2. padding : int, optional Number of zeros padded on the left. Default is 0 (no padding). Returns ------- out : str String representation of `number` in `base` system. See Also -------- binary_repr : Faster version of `base_repr` for base 2. Examples -------- >>> np.base_repr(5) '101' >>> np.base_repr(6, 5) '11' >>> np.base_repr(7, base=5, padding=3) '00012' >>> np.base_repr(10, base=16) 'A' >>> np.base_repr(32, base=16) '20' """ digits = '0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZ' if base > len(digits): raise ValueError("Bases greater than 36 not handled in base_repr.") elif base < 2: raise ValueError("Bases less than 2 not handled in base_repr.") num = abs(number) res = [] while num: res.append(digits[num % base]) num //= base if padding: res.append('0' * padding) if number < 0: res.append('-') return ''.join(reversed(res or '0')) def load(file): """ Wrapper around cPickle.load which accepts either a file-like object or a filename. Note that the NumPy binary format is not based on pickle/cPickle anymore. For details on the preferred way of loading and saving files, see `load` and `save`. See Also -------- load, save """ if isinstance(file, type("")): file = open(file, "rb") return pickle.load(file) # These are all essentially abbreviations # These might wind up in a special abbreviations module def _maketup(descr, val): dt = dtype(descr) # Place val in all scalar tuples: fields = dt.fields if fields is None: return val else: res = [_maketup(fields[name][0], val) for name in dt.names] return tuple(res) def identity(n, dtype=None): """ Return the identity array. The identity array is a square array with ones on the main diagonal. Parameters ---------- n : int Number of rows (and columns) in `n` x `n` output. dtype : data-type, optional Data-type of the output. Defaults to ``float``. Returns ------- out : ndarray `n` x `n` array with its main diagonal set to one, and all other elements 0. Examples -------- >>> np.identity(3) array([[ 1., 0., 0.], [ 0., 1., 0.], [ 0., 0., 1.]]) """ from numpy import eye return eye(n, dtype=dtype) def allclose(a, b, rtol=1.e-5, atol=1.e-8, equal_nan=False): """ Returns True if two arrays are element-wise equal within a tolerance. The tolerance values are positive, typically very small numbers. The relative difference (`rtol` * abs(`b`)) and the absolute difference `atol` are added together to compare against the absolute difference between `a` and `b`. If either array contains one or more NaNs, False is returned. Infs are treated as equal if they are in the same place and of the same sign in both arrays. Parameters ---------- a, b : array_like Input arrays to compare. rtol : float The relative tolerance parameter (see Notes). atol : float The absolute tolerance parameter (see Notes). equal_nan : bool Whether to compare NaN's as equal. If True, NaN's in `a` will be considered equal to NaN's in `b` in the output array. .. versionadded:: 1.10.0 Returns ------- allclose : bool Returns True if the two arrays are equal within the given tolerance; False otherwise. See Also -------- isclose, all, any, equal Notes ----- If the following equation is element-wise True, then allclose returns True. absolute(`a` - `b`) <= (`atol` + `rtol` * absolute(`b`)) The above equation is not symmetric in `a` and `b`, so that ``allclose(a, b)`` might be different from ``allclose(b, a)`` in some rare cases. The comparison of `a` and `b` uses standard broadcasting, which means that `a` and `b` need not have the same shape in order for ``allclose(a, b)`` to evaluate to True. The same is true for `equal` but not `array_equal`. Examples -------- >>> np.allclose([1e10,1e-7], [1.00001e10,1e-8]) False >>> np.allclose([1e10,1e-8], [1.00001e10,1e-9]) True >>> np.allclose([1e10,1e-8], [1.0001e10,1e-9]) False >>> np.allclose([1.0, np.nan], [1.0, np.nan]) False >>> np.allclose([1.0, np.nan], [1.0, np.nan], equal_nan=True) True """ res = all(isclose(a, b, rtol=rtol, atol=atol, equal_nan=equal_nan)) return bool(res) def isclose(a, b, rtol=1.e-5, atol=1.e-8, equal_nan=False): """ Returns a boolean array where two arrays are element-wise equal within a tolerance. The tolerance values are positive, typically very small numbers. The relative difference (`rtol` * abs(`b`)) and the absolute difference `atol` are added together to compare against the absolute difference between `a` and `b`. Parameters ---------- a, b : array_like Input arrays to compare. rtol : float The relative tolerance parameter (see Notes). atol : float The absolute tolerance parameter (see Notes). equal_nan : bool Whether to compare NaN's as equal. If True, NaN's in `a` will be considered equal to NaN's in `b` in the output array. Returns ------- y : array_like Returns a boolean array of where `a` and `b` are equal within the given tolerance. If both `a` and `b` are scalars, returns a single boolean value. See Also -------- allclose Notes ----- .. versionadded:: 1.7.0 For finite values, isclose uses the following equation to test whether two floating point values are equivalent. absolute(`a` - `b`) <= (`atol` + `rtol` * absolute(`b`)) The above equation is not symmetric in `a` and `b`, so that `isclose(a, b)` might be different from `isclose(b, a)` in some rare cases. Examples -------- >>> np.isclose([1e10,1e-7], [1.00001e10,1e-8]) array([True, False]) >>> np.isclose([1e10,1e-8], [1.00001e10,1e-9]) array([True, True]) >>> np.isclose([1e10,1e-8], [1.0001e10,1e-9]) array([False, True]) >>> np.isclose([1.0, np.nan], [1.0, np.nan]) array([True, False]) >>> np.isclose([1.0, np.nan], [1.0, np.nan], equal_nan=True) array([True, True]) """ def within_tol(x, y, atol, rtol): with errstate(invalid='ignore'): return less_equal(abs(x-y), atol + rtol * abs(y)) x = asanyarray(a) y = asanyarray(b) # Make sure y is an inexact type to avoid bad behavior on abs(MIN_INT). # This will cause casting of x later. Also, make sure to allow subclasses # (e.g., for numpy.ma). dt = multiarray.result_type(y, 1.) y = array(y, dtype=dt, copy=False, subok=True) xfin = isfinite(x) yfin = isfinite(y) if all(xfin) and all(yfin): return within_tol(x, y, atol, rtol) else: finite = xfin & yfin cond = zeros_like(finite, subok=True) # Because we're using boolean indexing, x & y must be the same shape. # Ideally, we'd just do x, y = broadcast_arrays(x, y). It's in # lib.stride_tricks, though, so we can't import it here. x = x * ones_like(cond) y = y * ones_like(cond) # Avoid subtraction with infinite/nan values... cond[finite] = within_tol(x[finite], y[finite], atol, rtol) # Check for equality of infinite values... cond[~finite] = (x[~finite] == y[~finite]) if equal_nan: # Make NaN == NaN both_nan = isnan(x) & isnan(y) # Needed to treat masked arrays correctly. = True would not work. cond[both_nan] = both_nan[both_nan] return cond[()] # Flatten 0d arrays to scalars def array_equal(a1, a2): """ True if two arrays have the same shape and elements, False otherwise. Parameters ---------- a1, a2 : array_like Input arrays. Returns ------- b : bool Returns True if the arrays are equal. See Also -------- allclose: Returns True if two arrays are element-wise equal within a tolerance. array_equiv: Returns True if input arrays are shape consistent and all elements equal. Examples -------- >>> np.array_equal([1, 2], [1, 2]) True >>> np.array_equal(np.array([1, 2]), np.array([1, 2])) True >>> np.array_equal([1, 2], [1, 2, 3]) False >>> np.array_equal([1, 2], [1, 4]) False """ try: a1, a2 = asarray(a1), asarray(a2) except Exception: return False if a1.shape != a2.shape: return False return bool(asarray(a1 == a2).all()) def array_equiv(a1, a2): """ Returns True if input arrays are shape consistent and all elements equal. Shape consistent means they are either the same shape, or one input array can be broadcasted to create the same shape as the other one. Parameters ---------- a1, a2 : array_like Input arrays. Returns ------- out : bool True if equivalent, False otherwise. Examples -------- >>> np.array_equiv([1, 2], [1, 2]) True >>> np.array_equiv([1, 2], [1, 3]) False Showing the shape equivalence: >>> np.array_equiv([1, 2], [[1, 2], [1, 2]]) True >>> np.array_equiv([1, 2], [[1, 2, 1, 2], [1, 2, 1, 2]]) False >>> np.array_equiv([1, 2], [[1, 2], [1, 3]]) False """ try: a1, a2 = asarray(a1), asarray(a2) except Exception: return False try: multiarray.broadcast(a1, a2) except Exception: return False return bool(asarray(a1 == a2).all()) _errdict = {"ignore":ERR_IGNORE, "warn":ERR_WARN, "raise":ERR_RAISE, "call":ERR_CALL, "print":ERR_PRINT, "log":ERR_LOG} _errdict_rev = {} for key in _errdict.keys(): _errdict_rev[_errdict[key]] = key del key def seterr(all=None, divide=None, over=None, under=None, invalid=None): """ Set how floating-point errors are handled. Note that operations on integer scalar types (such as `int16`) are handled like floating point, and are affected by these settings. Parameters ---------- all : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional Set treatment for all types of floating-point errors at once: - ignore: Take no action when the exception occurs. - warn: Print a `RuntimeWarning` (via the Python `warnings` module). - raise: Raise a `FloatingPointError`. - call: Call a function specified using the `seterrcall` function. - print: Print a warning directly to ``stdout``. - log: Record error in a Log object specified by `seterrcall`. The default is not to change the current behavior. divide : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional Treatment for division by zero. over : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional Treatment for floating-point overflow. under : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional Treatment for floating-point underflow. invalid : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional Treatment for invalid floating-point operation. Returns ------- old_settings : dict Dictionary containing the old settings. See also -------- seterrcall : Set a callback function for the 'call' mode. geterr, geterrcall, errstate Notes ----- The floating-point exceptions are defined in the IEEE 754 standard [1]: - Division by zero: infinite result obtained from finite numbers. - Overflow: result too large to be expressed. - Underflow: result so close to zero that some precision was lost. - Invalid operation: result is not an expressible number, typically indicates that a NaN was produced. .. [1] http://en.wikipedia.org/wiki/IEEE_754 Examples -------- >>> old_settings = np.seterr(all='ignore') #seterr to known value >>> np.seterr(over='raise') {'over': 'ignore', 'divide': 'ignore', 'invalid': 'ignore', 'under': 'ignore'} >>> np.seterr(**old_settings) # reset to default {'over': 'raise', 'divide': 'ignore', 'invalid': 'ignore', 'under': 'ignore'} >>> np.int16(32000) * np.int16(3) 30464 >>> old_settings = np.seterr(all='warn', over='raise') >>> np.int16(32000) * np.int16(3) Traceback (most recent call last): File "<stdin>", line 1, in <module> FloatingPointError: overflow encountered in short_scalars >>> old_settings = np.seterr(all='print') >>> np.geterr() {'over': 'print', 'divide': 'print', 'invalid': 'print', 'under': 'print'} >>> np.int16(32000) * np.int16(3) Warning: overflow encountered in short_scalars 30464 """ pyvals = umath.geterrobj() old = geterr() if divide is None: divide = all or old['divide'] if over is None: over = all or old['over'] if under is None: under = all or old['under'] if invalid is None: invalid = all or old['invalid'] maskvalue = ((_errdict[divide] << SHIFT_DIVIDEBYZERO) + (_errdict[over] << SHIFT_OVERFLOW) + (_errdict[under] << SHIFT_UNDERFLOW) + (_errdict[invalid] << SHIFT_INVALID)) pyvals[1] = maskvalue umath.seterrobj(pyvals) return old def geterr(): """ Get the current way of handling floating-point errors. Returns ------- res : dict A dictionary with keys "divide", "over", "under", and "invalid", whose values are from the strings "ignore", "print", "log", "warn", "raise", and "call". The keys represent possible floating-point exceptions, and the values define how these exceptions are handled. See Also -------- geterrcall, seterr, seterrcall Notes ----- For complete documentation of the types of floating-point exceptions and treatment options, see `seterr`. Examples -------- >>> np.geterr() {'over': 'warn', 'divide': 'warn', 'invalid': 'warn', 'under': 'ignore'} >>> np.arange(3.) / np.arange(3.) array([ NaN, 1., 1.]) >>> oldsettings = np.seterr(all='warn', over='raise') >>> np.geterr() {'over': 'raise', 'divide': 'warn', 'invalid': 'warn', 'under': 'warn'} >>> np.arange(3.) / np.arange(3.) __main__:1: RuntimeWarning: invalid value encountered in divide array([ NaN, 1., 1.]) """ maskvalue = umath.geterrobj()[1] mask = 7 res = {} val = (maskvalue >> SHIFT_DIVIDEBYZERO) & mask res['divide'] = _errdict_rev[val] val = (maskvalue >> SHIFT_OVERFLOW) & mask res['over'] = _errdict_rev[val] val = (maskvalue >> SHIFT_UNDERFLOW) & mask res['under'] = _errdict_rev[val] val = (maskvalue >> SHIFT_INVALID) & mask res['invalid'] = _errdict_rev[val] return res def setbufsize(size): """ Set the size of the buffer used in ufuncs. Parameters ---------- size : int Size of buffer. """ if size > 10e6: raise ValueError("Buffer size, %s, is too big." % size) if size < 5: raise ValueError("Buffer size, %s, is too small." % size) if size % 16 != 0: raise ValueError("Buffer size, %s, is not a multiple of 16." % size) pyvals = umath.geterrobj() old = getbufsize() pyvals[0] = size umath.seterrobj(pyvals) return old def getbufsize(): """ Return the size of the buffer used in ufuncs. Returns ------- getbufsize : int Size of ufunc buffer in bytes. """ return umath.geterrobj()[0] def seterrcall(func): """ Set the floating-point error callback function or log object. There are two ways to capture floating-point error messages. The first is to set the error-handler to 'call', using `seterr`. Then, set the function to call using this function. The second is to set the error-handler to 'log', using `seterr`. Floating-point errors then trigger a call to the 'write' method of the provided object. Parameters ---------- func : callable f(err, flag) or object with write method Function to call upon floating-point errors ('call'-mode) or object whose 'write' method is used to log such message ('log'-mode). The call function takes two arguments. The first is a string describing the type of error (such as "divide by zero", "overflow", "underflow", or "invalid value"), and the second is the status flag. The flag is a byte, whose four least-significant bits indicate the type of error, one of "divide", "over", "under", "invalid":: [0 0 0 0 divide over under invalid] In other words, ``flags = divide + 2*over + 4*under + 8*invalid``. If an object is provided, its write method should take one argument, a string. Returns ------- h : callable, log instance or None The old error handler. See Also -------- seterr, geterr, geterrcall Examples -------- Callback upon error: >>> def err_handler(type, flag): ... print("Floating point error (%s), with flag %s" % (type, flag)) ... >>> saved_handler = np.seterrcall(err_handler) >>> save_err = np.seterr(all='call') >>> np.array([1, 2, 3]) / 0.0 Floating point error (divide by zero), with flag 1 array([ Inf, Inf, Inf]) >>> np.seterrcall(saved_handler) <function err_handler at 0x...> >>> np.seterr(**save_err) {'over': 'call', 'divide': 'call', 'invalid': 'call', 'under': 'call'} Log error message: >>> class Log(object): ... def write(self, msg): ... print("LOG: %s" % msg) ... >>> log = Log() >>> saved_handler = np.seterrcall(log) >>> save_err = np.seterr(all='log') >>> np.array([1, 2, 3]) / 0.0 LOG: Warning: divide by zero encountered in divide <BLANKLINE> array([ Inf, Inf, Inf]) >>> np.seterrcall(saved_handler) <__main__.Log object at 0x...> >>> np.seterr(**save_err) {'over': 'log', 'divide': 'log', 'invalid': 'log', 'under': 'log'} """ if func is not None and not isinstance(func, collections.Callable): if not hasattr(func, 'write') or not isinstance(func.write, collections.Callable): raise ValueError("Only callable can be used as callback") pyvals = umath.geterrobj() old = geterrcall() pyvals[2] = func umath.seterrobj(pyvals) return old def geterrcall(): """ Return the current callback function used on floating-point errors. When the error handling for a floating-point error (one of "divide", "over", "under", or "invalid") is set to 'call' or 'log', the function that is called or the log instance that is written to is returned by `geterrcall`. This function or log instance has been set with `seterrcall`. Returns ------- errobj : callable, log instance or None The current error handler. If no handler was set through `seterrcall`, ``None`` is returned. See Also -------- seterrcall, seterr, geterr Notes ----- For complete documentation of the types of floating-point exceptions and treatment options, see `seterr`. Examples -------- >>> np.geterrcall() # we did not yet set a handler, returns None >>> oldsettings = np.seterr(all='call') >>> def err_handler(type, flag): ... print("Floating point error (%s), with flag %s" % (type, flag)) >>> oldhandler = np.seterrcall(err_handler) >>> np.array([1, 2, 3]) / 0.0 Floating point error (divide by zero), with flag 1 array([ Inf, Inf, Inf]) >>> cur_handler = np.geterrcall() >>> cur_handler is err_handler True """ return umath.geterrobj()[2] class _unspecified(object): pass _Unspecified = _unspecified() class errstate(object): """ errstate(**kwargs) Context manager for floating-point error handling. Using an instance of `errstate` as a context manager allows statements in that context to execute with a known error handling behavior. Upon entering the context the error handling is set with `seterr` and `seterrcall`, and upon exiting it is reset to what it was before. Parameters ---------- kwargs : {divide, over, under, invalid} Keyword arguments. The valid keywords are the possible floating-point exceptions. Each keyword should have a string value that defines the treatment for the particular error. Possible values are {'ignore', 'warn', 'raise', 'call', 'print', 'log'}. See Also -------- seterr, geterr, seterrcall, geterrcall Notes ----- The ``with`` statement was introduced in Python 2.5, and can only be used there by importing it: ``from __future__ import with_statement``. In earlier Python versions the ``with`` statement is not available. For complete documentation of the types of floating-point exceptions and treatment options, see `seterr`. Examples -------- >>> from __future__ import with_statement # use 'with' in Python 2.5 >>> olderr = np.seterr(all='ignore') # Set error handling to known state. >>> np.arange(3) / 0. array([ NaN, Inf, Inf]) >>> with np.errstate(divide='warn'): ... np.arange(3) / 0. ... __main__:2: RuntimeWarning: divide by zero encountered in divide array([ NaN, Inf, Inf]) >>> np.sqrt(-1) nan >>> with np.errstate(invalid='raise'): ... np.sqrt(-1) Traceback (most recent call last): File "<stdin>", line 2, in <module> FloatingPointError: invalid value encountered in sqrt Outside the context the error handling behavior has not changed: >>> np.geterr() {'over': 'warn', 'divide': 'warn', 'invalid': 'warn', 'under': 'ignore'} """ # Note that we don't want to run the above doctests because they will fail # without a from __future__ import with_statement def __init__(self, **kwargs): self.call = kwargs.pop('call', _Unspecified) self.kwargs = kwargs def __enter__(self): self.oldstate = seterr(**self.kwargs) if self.call is not _Unspecified: self.oldcall = seterrcall(self.call) def __exit__(self, *exc_info): seterr(**self.oldstate) if self.call is not _Unspecified: seterrcall(self.oldcall) def _setdef(): defval = [UFUNC_BUFSIZE_DEFAULT, ERR_DEFAULT, None] umath.seterrobj(defval) # set the default values _setdef() Inf = inf = infty = Infinity = PINF nan = NaN = NAN False_ = bool_(False) True_ = bool_(True) def extend_all(module): adict = {} for a in __all__: adict[a] = 1 try: mall = getattr(module, '__all__') except AttributeError: mall = [k for k in module.__dict__.keys() if not k.startswith('_')] for a in mall: if a not in adict: __all__.append(a) from .umath import * from .numerictypes import * from . import fromnumeric from .fromnumeric import * from . import arrayprint from .arrayprint import * extend_all(fromnumeric) extend_all(umath) extend_all(numerictypes) extend_all(arrayprint)
85,731
28.522039
94
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/setup_common.py
from __future__ import division, absolute_import, print_function # Code common to build tools import sys import warnings import copy import binascii from numpy.distutils.misc_util import mingw32 #------------------- # Versioning support #------------------- # How to change C_API_VERSION ? # - increase C_API_VERSION value # - record the hash for the new C API with the script cversions.py # and add the hash to cversions.txt # The hash values are used to remind developers when the C API number was not # updated - generates a MismatchCAPIWarning warning which is turned into an # exception for released version. # Binary compatibility version number. This number is increased whenever the # C-API is changed such that binary compatibility is broken, i.e. whenever a # recompile of extension modules is needed. C_ABI_VERSION = 0x01000009 # Minor API version. This number is increased whenever a change is made to the # C-API -- whether it breaks binary compatibility or not. Some changes, such # as adding a function pointer to the end of the function table, can be made # without breaking binary compatibility. In this case, only the C_API_VERSION # (*not* C_ABI_VERSION) would be increased. Whenever binary compatibility is # broken, both C_API_VERSION and C_ABI_VERSION should be increased. # # 0x00000008 - 1.7.x # 0x00000009 - 1.8.x # 0x00000009 - 1.9.x # 0x0000000a - 1.10.x # 0x0000000a - 1.11.x # 0x0000000a - 1.12.x # 0x0000000b - 1.13.x # 0x0000000c - 1.14.x C_API_VERSION = 0x0000000c class MismatchCAPIWarning(Warning): pass def is_released(config): """Return True if a released version of numpy is detected.""" from distutils.version import LooseVersion v = config.get_version('../version.py') if v is None: raise ValueError("Could not get version") pv = LooseVersion(vstring=v).version if len(pv) > 3: return False return True def get_api_versions(apiversion, codegen_dir): """ Return current C API checksum and the recorded checksum. Return current C API checksum and the recorded checksum for the given version of the C API version. """ # Compute the hash of the current API as defined in the .txt files in # code_generators sys.path.insert(0, codegen_dir) try: m = __import__('genapi') numpy_api = __import__('numpy_api') curapi_hash = m.fullapi_hash(numpy_api.full_api) apis_hash = m.get_versions_hash() finally: del sys.path[0] return curapi_hash, apis_hash[apiversion] def check_api_version(apiversion, codegen_dir): """Emits a MismacthCAPIWarning if the C API version needs updating.""" curapi_hash, api_hash = get_api_versions(apiversion, codegen_dir) # If different hash, it means that the api .txt files in # codegen_dir have been updated without the API version being # updated. Any modification in those .txt files should be reflected # in the api and eventually abi versions. # To compute the checksum of the current API, use # code_generators/cversions.py script if not curapi_hash == api_hash: msg = ("API mismatch detected, the C API version " "numbers have to be updated. Current C api version is %d, " "with checksum %s, but recorded checksum for C API version %d in " "codegen_dir/cversions.txt is %s. If functions were added in the " "C API, you have to update C_API_VERSION in %s." ) warnings.warn(msg % (apiversion, curapi_hash, apiversion, api_hash, __file__), MismatchCAPIWarning, stacklevel=2) # Mandatory functions: if not found, fail the build MANDATORY_FUNCS = ["sin", "cos", "tan", "sinh", "cosh", "tanh", "fabs", "floor", "ceil", "sqrt", "log10", "log", "exp", "asin", "acos", "atan", "fmod", 'modf', 'frexp', 'ldexp'] # Standard functions which may not be available and for which we have a # replacement implementation. Note that some of these are C99 functions. OPTIONAL_STDFUNCS = ["expm1", "log1p", "acosh", "asinh", "atanh", "rint", "trunc", "exp2", "log2", "hypot", "atan2", "pow", "copysign", "nextafter", "ftello", "fseeko", "strtoll", "strtoull", "cbrt", "strtold_l", "fallocate", "backtrace"] OPTIONAL_HEADERS = [ # sse headers only enabled automatically on amd64/x32 builds "xmmintrin.h", # SSE "emmintrin.h", # SSE2 "features.h", # for glibc version linux "xlocale.h", # see GH#8367 "dlfcn.h", # dladdr ] # optional gcc compiler builtins and their call arguments and optional a # required header and definition name (HAVE_ prepended) # call arguments are required as the compiler will do strict signature checking OPTIONAL_INTRINSICS = [("__builtin_isnan", '5.'), ("__builtin_isinf", '5.'), ("__builtin_isfinite", '5.'), ("__builtin_bswap32", '5u'), ("__builtin_bswap64", '5u'), ("__builtin_expect", '5, 0'), ("__builtin_mul_overflow", '5, 5, (int*)5'), # broken on OSX 10.11, make sure its not optimized away ("volatile int r = __builtin_cpu_supports", '"sse"', "stdio.h", "__BUILTIN_CPU_SUPPORTS"), # MMX only needed for icc, but some clangs don't have it ("_m_from_int64", '0', "emmintrin.h"), ("_mm_load_ps", '(float*)0', "xmmintrin.h"), # SSE ("_mm_prefetch", '(float*)0, _MM_HINT_NTA', "xmmintrin.h"), # SSE ("_mm_load_pd", '(double*)0', "emmintrin.h"), # SSE2 ("__builtin_prefetch", "(float*)0, 0, 3"), # check that the linker can handle avx ("__asm__ volatile", '"vpand %xmm1, %xmm2, %xmm3"', "stdio.h", "LINK_AVX"), ("__asm__ volatile", '"vpand %ymm1, %ymm2, %ymm3"', "stdio.h", "LINK_AVX2"), ] # function attributes # tested via "int %s %s(void *);" % (attribute, name) # function name will be converted to HAVE_<upper-case-name> preprocessor macro OPTIONAL_FUNCTION_ATTRIBUTES = [('__attribute__((optimize("unroll-loops")))', 'attribute_optimize_unroll_loops'), ('__attribute__((optimize("O3")))', 'attribute_optimize_opt_3'), ('__attribute__((nonnull (1)))', 'attribute_nonnull'), ('__attribute__((target ("avx")))', 'attribute_target_avx'), ('__attribute__((target ("avx2")))', 'attribute_target_avx2'), ] # variable attributes tested via "int %s a" % attribute OPTIONAL_VARIABLE_ATTRIBUTES = ["__thread", "__declspec(thread)"] # Subset of OPTIONAL_STDFUNCS which may alreay have HAVE_* defined by Python.h OPTIONAL_STDFUNCS_MAYBE = [ "expm1", "log1p", "acosh", "atanh", "asinh", "hypot", "copysign", "ftello", "fseeko" ] # C99 functions: float and long double versions C99_FUNCS = [ "sin", "cos", "tan", "sinh", "cosh", "tanh", "fabs", "floor", "ceil", "rint", "trunc", "sqrt", "log10", "log", "log1p", "exp", "expm1", "asin", "acos", "atan", "asinh", "acosh", "atanh", "hypot", "atan2", "pow", "fmod", "modf", 'frexp', 'ldexp', "exp2", "log2", "copysign", "nextafter", "cbrt" ] C99_FUNCS_SINGLE = [f + 'f' for f in C99_FUNCS] C99_FUNCS_EXTENDED = [f + 'l' for f in C99_FUNCS] C99_COMPLEX_TYPES = [ 'complex double', 'complex float', 'complex long double' ] C99_COMPLEX_FUNCS = [ "cabs", "cacos", "cacosh", "carg", "casin", "casinh", "catan", "catanh", "ccos", "ccosh", "cexp", "cimag", "clog", "conj", "cpow", "cproj", "creal", "csin", "csinh", "csqrt", "ctan", "ctanh" ] def fname2def(name): return "HAVE_%s" % name.upper() def sym2def(symbol): define = symbol.replace(' ', '') return define.upper() def type2def(symbol): define = symbol.replace(' ', '_') return define.upper() # Code to detect long double representation taken from MPFR m4 macro def check_long_double_representation(cmd): cmd._check_compiler() body = LONG_DOUBLE_REPRESENTATION_SRC % {'type': 'long double'} # Disable whole program optimization (the default on vs2015, with python 3.5+) # which generates intermediary object files and prevents checking the # float representation. if sys.platform == "win32" and not mingw32(): try: cmd.compiler.compile_options.remove("/GL") except (AttributeError, ValueError): pass # Disable multi-file interprocedural optimization in the Intel compiler on Linux # which generates intermediary object files and prevents checking the # float representation. elif (sys.platform != "win32" and cmd.compiler.compiler_type.startswith('intel') and '-ipo' in cmd.compiler.cc_exe): newcompiler = cmd.compiler.cc_exe.replace(' -ipo', '') cmd.compiler.set_executables( compiler=newcompiler, compiler_so=newcompiler, compiler_cxx=newcompiler, linker_exe=newcompiler, linker_so=newcompiler + ' -shared' ) # We need to use _compile because we need the object filename src, obj = cmd._compile(body, None, None, 'c') try: ltype = long_double_representation(pyod(obj)) return ltype except ValueError: # try linking to support CC="gcc -flto" or icc -ipo # struct needs to be volatile so it isn't optimized away body = body.replace('struct', 'volatile struct') body += "int main(void) { return 0; }\n" src, obj = cmd._compile(body, None, None, 'c') cmd.temp_files.append("_configtest") cmd.compiler.link_executable([obj], "_configtest") ltype = long_double_representation(pyod("_configtest")) return ltype finally: cmd._clean() LONG_DOUBLE_REPRESENTATION_SRC = r""" /* "before" is 16 bytes to ensure there's no padding between it and "x". * We're not expecting any "long double" bigger than 16 bytes or with * alignment requirements stricter than 16 bytes. */ typedef %(type)s test_type; struct { char before[16]; test_type x; char after[8]; } foo = { { '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\0', '\001', '\043', '\105', '\147', '\211', '\253', '\315', '\357' }, -123456789.0, { '\376', '\334', '\272', '\230', '\166', '\124', '\062', '\020' } }; """ def pyod(filename): """Python implementation of the od UNIX utility (od -b, more exactly). Parameters ---------- filename : str name of the file to get the dump from. Returns ------- out : seq list of lines of od output Note ---- We only implement enough to get the necessary information for long double representation, this is not intended as a compatible replacement for od. """ def _pyod2(): out = [] fid = open(filename, 'rb') try: yo = [int(oct(int(binascii.b2a_hex(o), 16))) for o in fid.read()] for i in range(0, len(yo), 16): line = ['%07d' % int(oct(i))] line.extend(['%03d' % c for c in yo[i:i+16]]) out.append(" ".join(line)) return out finally: fid.close() def _pyod3(): out = [] fid = open(filename, 'rb') try: yo2 = [oct(o)[2:] for o in fid.read()] for i in range(0, len(yo2), 16): line = ['%07d' % int(oct(i)[2:])] line.extend(['%03d' % int(c) for c in yo2[i:i+16]]) out.append(" ".join(line)) return out finally: fid.close() if sys.version_info[0] < 3: return _pyod2() else: return _pyod3() _BEFORE_SEQ = ['000', '000', '000', '000', '000', '000', '000', '000', '001', '043', '105', '147', '211', '253', '315', '357'] _AFTER_SEQ = ['376', '334', '272', '230', '166', '124', '062', '020'] _IEEE_DOUBLE_BE = ['301', '235', '157', '064', '124', '000', '000', '000'] _IEEE_DOUBLE_LE = _IEEE_DOUBLE_BE[::-1] _INTEL_EXTENDED_12B = ['000', '000', '000', '000', '240', '242', '171', '353', '031', '300', '000', '000'] _INTEL_EXTENDED_16B = ['000', '000', '000', '000', '240', '242', '171', '353', '031', '300', '000', '000', '000', '000', '000', '000'] _MOTOROLA_EXTENDED_12B = ['300', '031', '000', '000', '353', '171', '242', '240', '000', '000', '000', '000'] _IEEE_QUAD_PREC_BE = ['300', '031', '326', '363', '105', '100', '000', '000', '000', '000', '000', '000', '000', '000', '000', '000'] _IEEE_QUAD_PREC_LE = _IEEE_QUAD_PREC_BE[::-1] _DOUBLE_DOUBLE_BE = (['301', '235', '157', '064', '124', '000', '000', '000'] + ['000'] * 8) _DOUBLE_DOUBLE_LE = (['000', '000', '000', '124', '064', '157', '235', '301'] + ['000'] * 8) def long_double_representation(lines): """Given a binary dump as given by GNU od -b, look for long double representation.""" # Read contains a list of 32 items, each item is a byte (in octal # representation, as a string). We 'slide' over the output until read is of # the form before_seq + content + after_sequence, where content is the long double # representation: # - content is 12 bytes: 80 bits Intel representation # - content is 16 bytes: 80 bits Intel representation (64 bits) or quad precision # - content is 8 bytes: same as double (not implemented yet) read = [''] * 32 saw = None for line in lines: # we skip the first word, as od -b output an index at the beginning of # each line for w in line.split()[1:]: read.pop(0) read.append(w) # If the end of read is equal to the after_sequence, read contains # the long double if read[-8:] == _AFTER_SEQ: saw = copy.copy(read) if read[:12] == _BEFORE_SEQ[4:]: if read[12:-8] == _INTEL_EXTENDED_12B: return 'INTEL_EXTENDED_12_BYTES_LE' if read[12:-8] == _MOTOROLA_EXTENDED_12B: return 'MOTOROLA_EXTENDED_12_BYTES_BE' elif read[:8] == _BEFORE_SEQ[8:]: if read[8:-8] == _INTEL_EXTENDED_16B: return 'INTEL_EXTENDED_16_BYTES_LE' elif read[8:-8] == _IEEE_QUAD_PREC_BE: return 'IEEE_QUAD_BE' elif read[8:-8] == _IEEE_QUAD_PREC_LE: return 'IEEE_QUAD_LE' elif read[8:-8] == _DOUBLE_DOUBLE_BE: return 'DOUBLE_DOUBLE_BE' elif read[8:-8] == _DOUBLE_DOUBLE_LE: return 'DOUBLE_DOUBLE_LE' elif read[:16] == _BEFORE_SEQ: if read[16:-8] == _IEEE_DOUBLE_LE: return 'IEEE_DOUBLE_LE' elif read[16:-8] == _IEEE_DOUBLE_BE: return 'IEEE_DOUBLE_BE' if saw is not None: raise ValueError("Unrecognized format (%s)" % saw) else: # We never detected the after_sequence raise ValueError("Could not lock sequences (%s)" % saw)
15,953
39.69898
86
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/generate_numpy_api.py
from __future__ import division, print_function import os import genapi from genapi import \ TypeApi, GlobalVarApi, FunctionApi, BoolValuesApi import numpy_api # use annotated api when running under cpychecker h_template = r""" #if defined(_MULTIARRAYMODULE) || defined(WITH_CPYCHECKER_STEALS_REFERENCE_TO_ARG_ATTRIBUTE) typedef struct { PyObject_HEAD npy_bool obval; } PyBoolScalarObject; extern NPY_NO_EXPORT PyTypeObject PyArrayMapIter_Type; extern NPY_NO_EXPORT PyTypeObject PyArrayNeighborhoodIter_Type; extern NPY_NO_EXPORT PyBoolScalarObject _PyArrayScalar_BoolValues[2]; %s #else #if defined(PY_ARRAY_UNIQUE_SYMBOL) #define PyArray_API PY_ARRAY_UNIQUE_SYMBOL #endif #if defined(NO_IMPORT) || defined(NO_IMPORT_ARRAY) extern void **PyArray_API; #else #if defined(PY_ARRAY_UNIQUE_SYMBOL) void **PyArray_API; #else static void **PyArray_API=NULL; #endif #endif %s #if !defined(NO_IMPORT_ARRAY) && !defined(NO_IMPORT) static int _import_array(void) { int st; PyObject *numpy = PyImport_ImportModule("numpy.core.multiarray"); PyObject *c_api = NULL; if (numpy == NULL) { PyErr_SetString(PyExc_ImportError, "numpy.core.multiarray failed to import"); return -1; } c_api = PyObject_GetAttrString(numpy, "_ARRAY_API"); Py_DECREF(numpy); if (c_api == NULL) { PyErr_SetString(PyExc_AttributeError, "_ARRAY_API not found"); return -1; } #if PY_VERSION_HEX >= 0x03000000 if (!PyCapsule_CheckExact(c_api)) { PyErr_SetString(PyExc_RuntimeError, "_ARRAY_API is not PyCapsule object"); Py_DECREF(c_api); return -1; } PyArray_API = (void **)PyCapsule_GetPointer(c_api, NULL); #else if (!PyCObject_Check(c_api)) { PyErr_SetString(PyExc_RuntimeError, "_ARRAY_API is not PyCObject object"); Py_DECREF(c_api); return -1; } PyArray_API = (void **)PyCObject_AsVoidPtr(c_api); #endif Py_DECREF(c_api); if (PyArray_API == NULL) { PyErr_SetString(PyExc_RuntimeError, "_ARRAY_API is NULL pointer"); return -1; } /* Perform runtime check of C API version */ if (NPY_VERSION != PyArray_GetNDArrayCVersion()) { PyErr_Format(PyExc_RuntimeError, "module compiled against "\ "ABI version 0x%%x but this version of numpy is 0x%%x", \ (int) NPY_VERSION, (int) PyArray_GetNDArrayCVersion()); return -1; } if (NPY_FEATURE_VERSION > PyArray_GetNDArrayCFeatureVersion()) { PyErr_Format(PyExc_RuntimeError, "module compiled against "\ "API version 0x%%x but this version of numpy is 0x%%x", \ (int) NPY_FEATURE_VERSION, (int) PyArray_GetNDArrayCFeatureVersion()); return -1; } /* * Perform runtime check of endianness and check it matches the one set by * the headers (npy_endian.h) as a safeguard */ st = PyArray_GetEndianness(); if (st == NPY_CPU_UNKNOWN_ENDIAN) { PyErr_Format(PyExc_RuntimeError, "FATAL: module compiled as unknown endian"); return -1; } #if NPY_BYTE_ORDER == NPY_BIG_ENDIAN if (st != NPY_CPU_BIG) { PyErr_Format(PyExc_RuntimeError, "FATAL: module compiled as "\ "big endian, but detected different endianness at runtime"); return -1; } #elif NPY_BYTE_ORDER == NPY_LITTLE_ENDIAN if (st != NPY_CPU_LITTLE) { PyErr_Format(PyExc_RuntimeError, "FATAL: module compiled as "\ "little endian, but detected different endianness at runtime"); return -1; } #endif return 0; } #if PY_VERSION_HEX >= 0x03000000 #define NUMPY_IMPORT_ARRAY_RETVAL NULL #else #define NUMPY_IMPORT_ARRAY_RETVAL #endif #define import_array() {if (_import_array() < 0) {PyErr_Print(); PyErr_SetString(PyExc_ImportError, "numpy.core.multiarray failed to import"); return NUMPY_IMPORT_ARRAY_RETVAL; } } #define import_array1(ret) {if (_import_array() < 0) {PyErr_Print(); PyErr_SetString(PyExc_ImportError, "numpy.core.multiarray failed to import"); return ret; } } #define import_array2(msg, ret) {if (_import_array() < 0) {PyErr_Print(); PyErr_SetString(PyExc_ImportError, msg); return ret; } } #endif #endif """ c_template = r""" /* These pointers will be stored in the C-object for use in other extension modules */ void *PyArray_API[] = { %s }; """ c_api_header = """ =========== NumPy C-API =========== """ def generate_api(output_dir, force=False): basename = 'multiarray_api' h_file = os.path.join(output_dir, '__%s.h' % basename) c_file = os.path.join(output_dir, '__%s.c' % basename) d_file = os.path.join(output_dir, '%s.txt' % basename) targets = (h_file, c_file, d_file) sources = numpy_api.multiarray_api if (not force and not genapi.should_rebuild(targets, [numpy_api.__file__, __file__])): return targets else: do_generate_api(targets, sources) return targets def do_generate_api(targets, sources): header_file = targets[0] c_file = targets[1] doc_file = targets[2] global_vars = sources[0] scalar_bool_values = sources[1] types_api = sources[2] multiarray_funcs = sources[3] multiarray_api = sources[:] module_list = [] extension_list = [] init_list = [] # Check multiarray api indexes multiarray_api_index = genapi.merge_api_dicts(multiarray_api) genapi.check_api_dict(multiarray_api_index) numpyapi_list = genapi.get_api_functions('NUMPY_API', multiarray_funcs) ordered_funcs_api = genapi.order_dict(multiarray_funcs) # Create dict name -> *Api instance api_name = 'PyArray_API' multiarray_api_dict = {} for f in numpyapi_list: name = f.name index = multiarray_funcs[name][0] annotations = multiarray_funcs[name][1:] multiarray_api_dict[f.name] = FunctionApi(f.name, index, annotations, f.return_type, f.args, api_name) for name, val in global_vars.items(): index, type = val multiarray_api_dict[name] = GlobalVarApi(name, index, type, api_name) for name, val in scalar_bool_values.items(): index = val[0] multiarray_api_dict[name] = BoolValuesApi(name, index, api_name) for name, val in types_api.items(): index = val[0] multiarray_api_dict[name] = TypeApi(name, index, 'PyTypeObject', api_name) if len(multiarray_api_dict) != len(multiarray_api_index): keys_dict = set(multiarray_api_dict.keys()) keys_index = set(multiarray_api_index.keys()) raise AssertionError( "Multiarray API size mismatch - " "index has extra keys {}, dict has extra keys {}" .format(keys_index - keys_dict, keys_dict - keys_index) ) extension_list = [] for name, index in genapi.order_dict(multiarray_api_index): api_item = multiarray_api_dict[name] extension_list.append(api_item.define_from_array_api_string()) init_list.append(api_item.array_api_define()) module_list.append(api_item.internal_define()) # Write to header s = h_template % ('\n'.join(module_list), '\n'.join(extension_list)) genapi.write_file(header_file, s) # Write to c-code s = c_template % ',\n'.join(init_list) genapi.write_file(c_file, s) # write to documentation s = c_api_header for func in numpyapi_list: s += func.to_ReST() s += '\n\n' genapi.write_file(doc_file, s) return targets
7,506
28.555118
180
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_print.py
from __future__ import division, absolute_import, print_function import sys import locale import nose import numpy as np from numpy.testing import ( run_module_suite, assert_, assert_equal, SkipTest ) if sys.version_info[0] >= 3: from io import StringIO else: from StringIO import StringIO _REF = {np.inf: 'inf', -np.inf: '-inf', np.nan: 'nan'} def check_float_type(tp): for x in [0, 1, -1, 1e20]: assert_equal(str(tp(x)), str(float(x)), err_msg='Failed str formatting for type %s' % tp) if tp(1e16).itemsize > 4: assert_equal(str(tp(1e16)), str(float('1e16')), err_msg='Failed str formatting for type %s' % tp) else: ref = '1e+16' assert_equal(str(tp(1e16)), ref, err_msg='Failed str formatting for type %s' % tp) def test_float_types(): """ Check formatting. This is only for the str function, and only for simple types. The precision of np.float32 and np.longdouble aren't the same as the python float precision. """ for t in [np.float32, np.double, np.longdouble]: yield check_float_type, t def check_nan_inf_float(tp): for x in [np.inf, -np.inf, np.nan]: assert_equal(str(tp(x)), _REF[x], err_msg='Failed str formatting for type %s' % tp) def test_nan_inf_float(): """ Check formatting of nan & inf. This is only for the str function, and only for simple types. The precision of np.float32 and np.longdouble aren't the same as the python float precision. """ for t in [np.float32, np.double, np.longdouble]: yield check_nan_inf_float, t def check_complex_type(tp): for x in [0, 1, -1, 1e20]: assert_equal(str(tp(x)), str(complex(x)), err_msg='Failed str formatting for type %s' % tp) assert_equal(str(tp(x*1j)), str(complex(x*1j)), err_msg='Failed str formatting for type %s' % tp) assert_equal(str(tp(x + x*1j)), str(complex(x + x*1j)), err_msg='Failed str formatting for type %s' % tp) if tp(1e16).itemsize > 8: assert_equal(str(tp(1e16)), str(complex(1e16)), err_msg='Failed str formatting for type %s' % tp) else: ref = '(1e+16+0j)' assert_equal(str(tp(1e16)), ref, err_msg='Failed str formatting for type %s' % tp) def test_complex_types(): """Check formatting of complex types. This is only for the str function, and only for simple types. The precision of np.float32 and np.longdouble aren't the same as the python float precision. """ for t in [np.complex64, np.cdouble, np.clongdouble]: yield check_complex_type, t def test_complex_inf_nan(): """Check inf/nan formatting of complex types.""" TESTS = { complex(np.inf, 0): "(inf+0j)", complex(0, np.inf): "infj", complex(-np.inf, 0): "(-inf+0j)", complex(0, -np.inf): "-infj", complex(np.inf, 1): "(inf+1j)", complex(1, np.inf): "(1+infj)", complex(-np.inf, 1): "(-inf+1j)", complex(1, -np.inf): "(1-infj)", complex(np.nan, 0): "(nan+0j)", complex(0, np.nan): "nanj", complex(-np.nan, 0): "(nan+0j)", complex(0, -np.nan): "nanj", complex(np.nan, 1): "(nan+1j)", complex(1, np.nan): "(1+nanj)", complex(-np.nan, 1): "(nan+1j)", complex(1, -np.nan): "(1+nanj)", } for tp in [np.complex64, np.cdouble, np.clongdouble]: for c, s in TESTS.items(): yield _check_complex_inf_nan, c, s, tp def _check_complex_inf_nan(c, s, dtype): assert_equal(str(dtype(c)), s) # print tests def _test_redirected_print(x, tp, ref=None): file = StringIO() file_tp = StringIO() stdout = sys.stdout try: sys.stdout = file_tp print(tp(x)) sys.stdout = file if ref: print(ref) else: print(x) finally: sys.stdout = stdout assert_equal(file.getvalue(), file_tp.getvalue(), err_msg='print failed for type%s' % tp) def check_float_type_print(tp): for x in [0, 1, -1, 1e20]: _test_redirected_print(float(x), tp) for x in [np.inf, -np.inf, np.nan]: _test_redirected_print(float(x), tp, _REF[x]) if tp(1e16).itemsize > 4: _test_redirected_print(float(1e16), tp) else: ref = '1e+16' _test_redirected_print(float(1e16), tp, ref) def check_complex_type_print(tp): # We do not create complex with inf/nan directly because the feature is # missing in python < 2.6 for x in [0, 1, -1, 1e20]: _test_redirected_print(complex(x), tp) if tp(1e16).itemsize > 8: _test_redirected_print(complex(1e16), tp) else: ref = '(1e+16+0j)' _test_redirected_print(complex(1e16), tp, ref) _test_redirected_print(complex(np.inf, 1), tp, '(inf+1j)') _test_redirected_print(complex(-np.inf, 1), tp, '(-inf+1j)') _test_redirected_print(complex(-np.nan, 1), tp, '(nan+1j)') def test_float_type_print(): """Check formatting when using print """ for t in [np.float32, np.double, np.longdouble]: yield check_float_type_print, t def test_complex_type_print(): """Check formatting when using print """ for t in [np.complex64, np.cdouble, np.clongdouble]: yield check_complex_type_print, t def test_scalar_format(): """Test the str.format method with NumPy scalar types""" tests = [('{0}', True, np.bool_), ('{0}', False, np.bool_), ('{0:d}', 130, np.uint8), ('{0:d}', 50000, np.uint16), ('{0:d}', 3000000000, np.uint32), ('{0:d}', 15000000000000000000, np.uint64), ('{0:d}', -120, np.int8), ('{0:d}', -30000, np.int16), ('{0:d}', -2000000000, np.int32), ('{0:d}', -7000000000000000000, np.int64), ('{0:g}', 1.5, np.float16), ('{0:g}', 1.5, np.float32), ('{0:g}', 1.5, np.float64), ('{0:g}', 1.5, np.longdouble), ('{0:g}', 1.5+0.5j, np.complex64), ('{0:g}', 1.5+0.5j, np.complex128), ('{0:g}', 1.5+0.5j, np.clongdouble)] for (fmat, val, valtype) in tests: try: assert_equal(fmat.format(val), fmat.format(valtype(val)), "failed with val %s, type %s" % (val, valtype)) except ValueError as e: assert_(False, "format raised exception (fmt='%s', val=%s, type=%s, exc='%s')" % (fmat, repr(val), repr(valtype), str(e))) # Locale tests: scalar types formatting should be independent of the locale def in_foreign_locale(func): """ Swap LC_NUMERIC locale to one in which the decimal point is ',' and not '.' If not possible, raise SkipTest """ if sys.platform == 'win32': locales = ['FRENCH'] else: locales = ['fr_FR', 'fr_FR.UTF-8', 'fi_FI', 'fi_FI.UTF-8'] def wrapper(*args, **kwargs): curloc = locale.getlocale(locale.LC_NUMERIC) try: for loc in locales: try: locale.setlocale(locale.LC_NUMERIC, loc) break except locale.Error: pass else: raise SkipTest("Skipping locale test, because " "French locale not found") return func(*args, **kwargs) finally: locale.setlocale(locale.LC_NUMERIC, locale=curloc) return nose.tools.make_decorator(func)(wrapper) @in_foreign_locale def test_locale_single(): assert_equal(str(np.float32(1.2)), str(float(1.2))) @in_foreign_locale def test_locale_double(): assert_equal(str(np.double(1.2)), str(float(1.2))) @in_foreign_locale def test_locale_longdouble(): assert_equal(str(np.longdouble('1.2')), str(float(1.2))) if __name__ == "__main__": run_module_suite()
8,089
31.753036
80
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_nditer.py
from __future__ import division, absolute_import, print_function import sys import warnings import numpy as np from numpy import array, arange, nditer, all from numpy.core.multiarray_tests import test_nditer_too_large from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_array_equal, assert_raises, assert_warns, dec, HAS_REFCOUNT, suppress_warnings ) def iter_multi_index(i): ret = [] while not i.finished: ret.append(i.multi_index) i.iternext() return ret def iter_indices(i): ret = [] while not i.finished: ret.append(i.index) i.iternext() return ret def iter_iterindices(i): ret = [] while not i.finished: ret.append(i.iterindex) i.iternext() return ret @dec.skipif(not HAS_REFCOUNT, "python does not have sys.getrefcount") def test_iter_refcount(): # Make sure the iterator doesn't leak # Basic a = arange(6) dt = np.dtype('f4').newbyteorder() rc_a = sys.getrefcount(a) rc_dt = sys.getrefcount(dt) it = nditer(a, [], [['readwrite', 'updateifcopy']], casting='unsafe', op_dtypes=[dt]) assert_(not it.iterationneedsapi) assert_(sys.getrefcount(a) > rc_a) assert_(sys.getrefcount(dt) > rc_dt) it = None assert_equal(sys.getrefcount(a), rc_a) assert_equal(sys.getrefcount(dt), rc_dt) # With a copy a = arange(6, dtype='f4') dt = np.dtype('f4') rc_a = sys.getrefcount(a) rc_dt = sys.getrefcount(dt) it = nditer(a, [], [['readwrite']], op_dtypes=[dt]) rc2_a = sys.getrefcount(a) rc2_dt = sys.getrefcount(dt) it2 = it.copy() assert_(sys.getrefcount(a) > rc2_a) assert_(sys.getrefcount(dt) > rc2_dt) it = None assert_equal(sys.getrefcount(a), rc2_a) assert_equal(sys.getrefcount(dt), rc2_dt) it2 = None assert_equal(sys.getrefcount(a), rc_a) assert_equal(sys.getrefcount(dt), rc_dt) del it2 # avoid pyflakes unused variable warning def test_iter_best_order(): # The iterator should always find the iteration order # with increasing memory addresses # Test the ordering for 1-D to 5-D shapes for shape in [(5,), (3, 4), (2, 3, 4), (2, 3, 4, 3), (2, 3, 2, 2, 3)]: a = arange(np.prod(shape)) # Test each combination of positive and negative strides for dirs in range(2**len(shape)): dirs_index = [slice(None)]*len(shape) for bit in range(len(shape)): if ((2**bit) & dirs): dirs_index[bit] = slice(None, None, -1) dirs_index = tuple(dirs_index) aview = a.reshape(shape)[dirs_index] # C-order i = nditer(aview, [], [['readonly']]) assert_equal([x for x in i], a) # Fortran-order i = nditer(aview.T, [], [['readonly']]) assert_equal([x for x in i], a) # Other order if len(shape) > 2: i = nditer(aview.swapaxes(0, 1), [], [['readonly']]) assert_equal([x for x in i], a) def test_iter_c_order(): # Test forcing C order # Test the ordering for 1-D to 5-D shapes for shape in [(5,), (3, 4), (2, 3, 4), (2, 3, 4, 3), (2, 3, 2, 2, 3)]: a = arange(np.prod(shape)) # Test each combination of positive and negative strides for dirs in range(2**len(shape)): dirs_index = [slice(None)]*len(shape) for bit in range(len(shape)): if ((2**bit) & dirs): dirs_index[bit] = slice(None, None, -1) dirs_index = tuple(dirs_index) aview = a.reshape(shape)[dirs_index] # C-order i = nditer(aview, order='C') assert_equal([x for x in i], aview.ravel(order='C')) # Fortran-order i = nditer(aview.T, order='C') assert_equal([x for x in i], aview.T.ravel(order='C')) # Other order if len(shape) > 2: i = nditer(aview.swapaxes(0, 1), order='C') assert_equal([x for x in i], aview.swapaxes(0, 1).ravel(order='C')) def test_iter_f_order(): # Test forcing F order # Test the ordering for 1-D to 5-D shapes for shape in [(5,), (3, 4), (2, 3, 4), (2, 3, 4, 3), (2, 3, 2, 2, 3)]: a = arange(np.prod(shape)) # Test each combination of positive and negative strides for dirs in range(2**len(shape)): dirs_index = [slice(None)]*len(shape) for bit in range(len(shape)): if ((2**bit) & dirs): dirs_index[bit] = slice(None, None, -1) dirs_index = tuple(dirs_index) aview = a.reshape(shape)[dirs_index] # C-order i = nditer(aview, order='F') assert_equal([x for x in i], aview.ravel(order='F')) # Fortran-order i = nditer(aview.T, order='F') assert_equal([x for x in i], aview.T.ravel(order='F')) # Other order if len(shape) > 2: i = nditer(aview.swapaxes(0, 1), order='F') assert_equal([x for x in i], aview.swapaxes(0, 1).ravel(order='F')) def test_iter_c_or_f_order(): # Test forcing any contiguous (C or F) order # Test the ordering for 1-D to 5-D shapes for shape in [(5,), (3, 4), (2, 3, 4), (2, 3, 4, 3), (2, 3, 2, 2, 3)]: a = arange(np.prod(shape)) # Test each combination of positive and negative strides for dirs in range(2**len(shape)): dirs_index = [slice(None)]*len(shape) for bit in range(len(shape)): if ((2**bit) & dirs): dirs_index[bit] = slice(None, None, -1) dirs_index = tuple(dirs_index) aview = a.reshape(shape)[dirs_index] # C-order i = nditer(aview, order='A') assert_equal([x for x in i], aview.ravel(order='A')) # Fortran-order i = nditer(aview.T, order='A') assert_equal([x for x in i], aview.T.ravel(order='A')) # Other order if len(shape) > 2: i = nditer(aview.swapaxes(0, 1), order='A') assert_equal([x for x in i], aview.swapaxes(0, 1).ravel(order='A')) def test_iter_best_order_multi_index_1d(): # The multi-indices should be correct with any reordering a = arange(4) # 1D order i = nditer(a, ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(0,), (1,), (2,), (3,)]) # 1D reversed order i = nditer(a[::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(3,), (2,), (1,), (0,)]) def test_iter_best_order_multi_index_2d(): # The multi-indices should be correct with any reordering a = arange(6) # 2D C-order i = nditer(a.reshape(2, 3), ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(0, 0), (0, 1), (0, 2), (1, 0), (1, 1), (1, 2)]) # 2D Fortran-order i = nditer(a.reshape(2, 3).copy(order='F'), ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(0, 0), (1, 0), (0, 1), (1, 1), (0, 2), (1, 2)]) # 2D reversed C-order i = nditer(a.reshape(2, 3)[::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(1, 0), (1, 1), (1, 2), (0, 0), (0, 1), (0, 2)]) i = nditer(a.reshape(2, 3)[:, ::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(0, 2), (0, 1), (0, 0), (1, 2), (1, 1), (1, 0)]) i = nditer(a.reshape(2, 3)[::-1, ::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(1, 2), (1, 1), (1, 0), (0, 2), (0, 1), (0, 0)]) # 2D reversed Fortran-order i = nditer(a.reshape(2, 3).copy(order='F')[::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(1, 0), (0, 0), (1, 1), (0, 1), (1, 2), (0, 2)]) i = nditer(a.reshape(2, 3).copy(order='F')[:, ::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(0, 2), (1, 2), (0, 1), (1, 1), (0, 0), (1, 0)]) i = nditer(a.reshape(2, 3).copy(order='F')[::-1, ::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(1, 2), (0, 2), (1, 1), (0, 1), (1, 0), (0, 0)]) def test_iter_best_order_multi_index_3d(): # The multi-indices should be correct with any reordering a = arange(12) # 3D C-order i = nditer(a.reshape(2, 3, 2), ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(0, 0, 0), (0, 0, 1), (0, 1, 0), (0, 1, 1), (0, 2, 0), (0, 2, 1), (1, 0, 0), (1, 0, 1), (1, 1, 0), (1, 1, 1), (1, 2, 0), (1, 2, 1)]) # 3D Fortran-order i = nditer(a.reshape(2, 3, 2).copy(order='F'), ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(0, 0, 0), (1, 0, 0), (0, 1, 0), (1, 1, 0), (0, 2, 0), (1, 2, 0), (0, 0, 1), (1, 0, 1), (0, 1, 1), (1, 1, 1), (0, 2, 1), (1, 2, 1)]) # 3D reversed C-order i = nditer(a.reshape(2, 3, 2)[::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(1, 0, 0), (1, 0, 1), (1, 1, 0), (1, 1, 1), (1, 2, 0), (1, 2, 1), (0, 0, 0), (0, 0, 1), (0, 1, 0), (0, 1, 1), (0, 2, 0), (0, 2, 1)]) i = nditer(a.reshape(2, 3, 2)[:, ::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(0, 2, 0), (0, 2, 1), (0, 1, 0), (0, 1, 1), (0, 0, 0), (0, 0, 1), (1, 2, 0), (1, 2, 1), (1, 1, 0), (1, 1, 1), (1, 0, 0), (1, 0, 1)]) i = nditer(a.reshape(2, 3, 2)[:,:, ::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(0, 0, 1), (0, 0, 0), (0, 1, 1), (0, 1, 0), (0, 2, 1), (0, 2, 0), (1, 0, 1), (1, 0, 0), (1, 1, 1), (1, 1, 0), (1, 2, 1), (1, 2, 0)]) # 3D reversed Fortran-order i = nditer(a.reshape(2, 3, 2).copy(order='F')[::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(1, 0, 0), (0, 0, 0), (1, 1, 0), (0, 1, 0), (1, 2, 0), (0, 2, 0), (1, 0, 1), (0, 0, 1), (1, 1, 1), (0, 1, 1), (1, 2, 1), (0, 2, 1)]) i = nditer(a.reshape(2, 3, 2).copy(order='F')[:, ::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(0, 2, 0), (1, 2, 0), (0, 1, 0), (1, 1, 0), (0, 0, 0), (1, 0, 0), (0, 2, 1), (1, 2, 1), (0, 1, 1), (1, 1, 1), (0, 0, 1), (1, 0, 1)]) i = nditer(a.reshape(2, 3, 2).copy(order='F')[:,:, ::-1], ['multi_index'], [['readonly']]) assert_equal(iter_multi_index(i), [(0, 0, 1), (1, 0, 1), (0, 1, 1), (1, 1, 1), (0, 2, 1), (1, 2, 1), (0, 0, 0), (1, 0, 0), (0, 1, 0), (1, 1, 0), (0, 2, 0), (1, 2, 0)]) def test_iter_best_order_c_index_1d(): # The C index should be correct with any reordering a = arange(4) # 1D order i = nditer(a, ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [0, 1, 2, 3]) # 1D reversed order i = nditer(a[::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [3, 2, 1, 0]) def test_iter_best_order_c_index_2d(): # The C index should be correct with any reordering a = arange(6) # 2D C-order i = nditer(a.reshape(2, 3), ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [0, 1, 2, 3, 4, 5]) # 2D Fortran-order i = nditer(a.reshape(2, 3).copy(order='F'), ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [0, 3, 1, 4, 2, 5]) # 2D reversed C-order i = nditer(a.reshape(2, 3)[::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [3, 4, 5, 0, 1, 2]) i = nditer(a.reshape(2, 3)[:, ::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [2, 1, 0, 5, 4, 3]) i = nditer(a.reshape(2, 3)[::-1, ::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [5, 4, 3, 2, 1, 0]) # 2D reversed Fortran-order i = nditer(a.reshape(2, 3).copy(order='F')[::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [3, 0, 4, 1, 5, 2]) i = nditer(a.reshape(2, 3).copy(order='F')[:, ::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [2, 5, 1, 4, 0, 3]) i = nditer(a.reshape(2, 3).copy(order='F')[::-1, ::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [5, 2, 4, 1, 3, 0]) def test_iter_best_order_c_index_3d(): # The C index should be correct with any reordering a = arange(12) # 3D C-order i = nditer(a.reshape(2, 3, 2), ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11]) # 3D Fortran-order i = nditer(a.reshape(2, 3, 2).copy(order='F'), ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [0, 6, 2, 8, 4, 10, 1, 7, 3, 9, 5, 11]) # 3D reversed C-order i = nditer(a.reshape(2, 3, 2)[::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [6, 7, 8, 9, 10, 11, 0, 1, 2, 3, 4, 5]) i = nditer(a.reshape(2, 3, 2)[:, ::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [4, 5, 2, 3, 0, 1, 10, 11, 8, 9, 6, 7]) i = nditer(a.reshape(2, 3, 2)[:,:, ::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [1, 0, 3, 2, 5, 4, 7, 6, 9, 8, 11, 10]) # 3D reversed Fortran-order i = nditer(a.reshape(2, 3, 2).copy(order='F')[::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [6, 0, 8, 2, 10, 4, 7, 1, 9, 3, 11, 5]) i = nditer(a.reshape(2, 3, 2).copy(order='F')[:, ::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [4, 10, 2, 8, 0, 6, 5, 11, 3, 9, 1, 7]) i = nditer(a.reshape(2, 3, 2).copy(order='F')[:,:, ::-1], ['c_index'], [['readonly']]) assert_equal(iter_indices(i), [1, 7, 3, 9, 5, 11, 0, 6, 2, 8, 4, 10]) def test_iter_best_order_f_index_1d(): # The Fortran index should be correct with any reordering a = arange(4) # 1D order i = nditer(a, ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [0, 1, 2, 3]) # 1D reversed order i = nditer(a[::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [3, 2, 1, 0]) def test_iter_best_order_f_index_2d(): # The Fortran index should be correct with any reordering a = arange(6) # 2D C-order i = nditer(a.reshape(2, 3), ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [0, 2, 4, 1, 3, 5]) # 2D Fortran-order i = nditer(a.reshape(2, 3).copy(order='F'), ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [0, 1, 2, 3, 4, 5]) # 2D reversed C-order i = nditer(a.reshape(2, 3)[::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [1, 3, 5, 0, 2, 4]) i = nditer(a.reshape(2, 3)[:, ::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [4, 2, 0, 5, 3, 1]) i = nditer(a.reshape(2, 3)[::-1, ::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [5, 3, 1, 4, 2, 0]) # 2D reversed Fortran-order i = nditer(a.reshape(2, 3).copy(order='F')[::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [1, 0, 3, 2, 5, 4]) i = nditer(a.reshape(2, 3).copy(order='F')[:, ::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [4, 5, 2, 3, 0, 1]) i = nditer(a.reshape(2, 3).copy(order='F')[::-1, ::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [5, 4, 3, 2, 1, 0]) def test_iter_best_order_f_index_3d(): # The Fortran index should be correct with any reordering a = arange(12) # 3D C-order i = nditer(a.reshape(2, 3, 2), ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [0, 6, 2, 8, 4, 10, 1, 7, 3, 9, 5, 11]) # 3D Fortran-order i = nditer(a.reshape(2, 3, 2).copy(order='F'), ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11]) # 3D reversed C-order i = nditer(a.reshape(2, 3, 2)[::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [1, 7, 3, 9, 5, 11, 0, 6, 2, 8, 4, 10]) i = nditer(a.reshape(2, 3, 2)[:, ::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [4, 10, 2, 8, 0, 6, 5, 11, 3, 9, 1, 7]) i = nditer(a.reshape(2, 3, 2)[:,:, ::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [6, 0, 8, 2, 10, 4, 7, 1, 9, 3, 11, 5]) # 3D reversed Fortran-order i = nditer(a.reshape(2, 3, 2).copy(order='F')[::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [1, 0, 3, 2, 5, 4, 7, 6, 9, 8, 11, 10]) i = nditer(a.reshape(2, 3, 2).copy(order='F')[:, ::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [4, 5, 2, 3, 0, 1, 10, 11, 8, 9, 6, 7]) i = nditer(a.reshape(2, 3, 2).copy(order='F')[:,:, ::-1], ['f_index'], [['readonly']]) assert_equal(iter_indices(i), [6, 7, 8, 9, 10, 11, 0, 1, 2, 3, 4, 5]) def test_iter_no_inner_full_coalesce(): # Check no_inner iterators which coalesce into a single inner loop for shape in [(5,), (3, 4), (2, 3, 4), (2, 3, 4, 3), (2, 3, 2, 2, 3)]: size = np.prod(shape) a = arange(size) # Test each combination of forward and backwards indexing for dirs in range(2**len(shape)): dirs_index = [slice(None)]*len(shape) for bit in range(len(shape)): if ((2**bit) & dirs): dirs_index[bit] = slice(None, None, -1) dirs_index = tuple(dirs_index) aview = a.reshape(shape)[dirs_index] # C-order i = nditer(aview, ['external_loop'], [['readonly']]) assert_equal(i.ndim, 1) assert_equal(i[0].shape, (size,)) # Fortran-order i = nditer(aview.T, ['external_loop'], [['readonly']]) assert_equal(i.ndim, 1) assert_equal(i[0].shape, (size,)) # Other order if len(shape) > 2: i = nditer(aview.swapaxes(0, 1), ['external_loop'], [['readonly']]) assert_equal(i.ndim, 1) assert_equal(i[0].shape, (size,)) def test_iter_no_inner_dim_coalescing(): # Check no_inner iterators whose dimensions may not coalesce completely # Skipping the last element in a dimension prevents coalescing # with the next-bigger dimension a = arange(24).reshape(2, 3, 4)[:,:, :-1] i = nditer(a, ['external_loop'], [['readonly']]) assert_equal(i.ndim, 2) assert_equal(i[0].shape, (3,)) a = arange(24).reshape(2, 3, 4)[:, :-1,:] i = nditer(a, ['external_loop'], [['readonly']]) assert_equal(i.ndim, 2) assert_equal(i[0].shape, (8,)) a = arange(24).reshape(2, 3, 4)[:-1,:,:] i = nditer(a, ['external_loop'], [['readonly']]) assert_equal(i.ndim, 1) assert_equal(i[0].shape, (12,)) # Even with lots of 1-sized dimensions, should still coalesce a = arange(24).reshape(1, 1, 2, 1, 1, 3, 1, 1, 4, 1, 1) i = nditer(a, ['external_loop'], [['readonly']]) assert_equal(i.ndim, 1) assert_equal(i[0].shape, (24,)) def test_iter_dim_coalescing(): # Check that the correct number of dimensions are coalesced # Tracking a multi-index disables coalescing a = arange(24).reshape(2, 3, 4) i = nditer(a, ['multi_index'], [['readonly']]) assert_equal(i.ndim, 3) # A tracked index can allow coalescing if it's compatible with the array a3d = arange(24).reshape(2, 3, 4) i = nditer(a3d, ['c_index'], [['readonly']]) assert_equal(i.ndim, 1) i = nditer(a3d.swapaxes(0, 1), ['c_index'], [['readonly']]) assert_equal(i.ndim, 3) i = nditer(a3d.T, ['c_index'], [['readonly']]) assert_equal(i.ndim, 3) i = nditer(a3d.T, ['f_index'], [['readonly']]) assert_equal(i.ndim, 1) i = nditer(a3d.T.swapaxes(0, 1), ['f_index'], [['readonly']]) assert_equal(i.ndim, 3) # When C or F order is forced, coalescing may still occur a3d = arange(24).reshape(2, 3, 4) i = nditer(a3d, order='C') assert_equal(i.ndim, 1) i = nditer(a3d.T, order='C') assert_equal(i.ndim, 3) i = nditer(a3d, order='F') assert_equal(i.ndim, 3) i = nditer(a3d.T, order='F') assert_equal(i.ndim, 1) i = nditer(a3d, order='A') assert_equal(i.ndim, 1) i = nditer(a3d.T, order='A') assert_equal(i.ndim, 1) def test_iter_broadcasting(): # Standard NumPy broadcasting rules # 1D with scalar i = nditer([arange(6), np.int32(2)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 6) assert_equal(i.shape, (6,)) # 2D with scalar i = nditer([arange(6).reshape(2, 3), np.int32(2)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 6) assert_equal(i.shape, (2, 3)) # 2D with 1D i = nditer([arange(6).reshape(2, 3), arange(3)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 6) assert_equal(i.shape, (2, 3)) i = nditer([arange(2).reshape(2, 1), arange(3)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 6) assert_equal(i.shape, (2, 3)) # 2D with 2D i = nditer([arange(2).reshape(2, 1), arange(3).reshape(1, 3)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 6) assert_equal(i.shape, (2, 3)) # 3D with scalar i = nditer([np.int32(2), arange(24).reshape(4, 2, 3)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 24) assert_equal(i.shape, (4, 2, 3)) # 3D with 1D i = nditer([arange(3), arange(24).reshape(4, 2, 3)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 24) assert_equal(i.shape, (4, 2, 3)) i = nditer([arange(3), arange(8).reshape(4, 2, 1)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 24) assert_equal(i.shape, (4, 2, 3)) # 3D with 2D i = nditer([arange(6).reshape(2, 3), arange(24).reshape(4, 2, 3)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 24) assert_equal(i.shape, (4, 2, 3)) i = nditer([arange(2).reshape(2, 1), arange(24).reshape(4, 2, 3)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 24) assert_equal(i.shape, (4, 2, 3)) i = nditer([arange(3).reshape(1, 3), arange(8).reshape(4, 2, 1)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 24) assert_equal(i.shape, (4, 2, 3)) # 3D with 3D i = nditer([arange(2).reshape(1, 2, 1), arange(3).reshape(1, 1, 3), arange(4).reshape(4, 1, 1)], ['multi_index'], [['readonly']]*3) assert_equal(i.itersize, 24) assert_equal(i.shape, (4, 2, 3)) i = nditer([arange(6).reshape(1, 2, 3), arange(4).reshape(4, 1, 1)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 24) assert_equal(i.shape, (4, 2, 3)) i = nditer([arange(24).reshape(4, 2, 3), arange(12).reshape(4, 1, 3)], ['multi_index'], [['readonly']]*2) assert_equal(i.itersize, 24) assert_equal(i.shape, (4, 2, 3)) def test_iter_itershape(): # Check that allocated outputs work with a specified shape a = np.arange(6, dtype='i2').reshape(2, 3) i = nditer([a, None], [], [['readonly'], ['writeonly', 'allocate']], op_axes=[[0, 1, None], None], itershape=(-1, -1, 4)) assert_equal(i.operands[1].shape, (2, 3, 4)) assert_equal(i.operands[1].strides, (24, 8, 2)) i = nditer([a.T, None], [], [['readonly'], ['writeonly', 'allocate']], op_axes=[[0, 1, None], None], itershape=(-1, -1, 4)) assert_equal(i.operands[1].shape, (3, 2, 4)) assert_equal(i.operands[1].strides, (8, 24, 2)) i = nditer([a.T, None], [], [['readonly'], ['writeonly', 'allocate']], order='F', op_axes=[[0, 1, None], None], itershape=(-1, -1, 4)) assert_equal(i.operands[1].shape, (3, 2, 4)) assert_equal(i.operands[1].strides, (2, 6, 12)) # If we specify 1 in the itershape, it shouldn't allow broadcasting # of that dimension to a bigger value assert_raises(ValueError, nditer, [a, None], [], [['readonly'], ['writeonly', 'allocate']], op_axes=[[0, 1, None], None], itershape=(-1, 1, 4)) # Test bug that for no op_axes but itershape, they are NULLed correctly i = np.nditer([np.ones(2), None, None], itershape=(2,)) def test_iter_broadcasting_errors(): # Check that errors are thrown for bad broadcasting shapes # 1D with 1D assert_raises(ValueError, nditer, [arange(2), arange(3)], [], [['readonly']]*2) # 2D with 1D assert_raises(ValueError, nditer, [arange(6).reshape(2, 3), arange(2)], [], [['readonly']]*2) # 2D with 2D assert_raises(ValueError, nditer, [arange(6).reshape(2, 3), arange(9).reshape(3, 3)], [], [['readonly']]*2) assert_raises(ValueError, nditer, [arange(6).reshape(2, 3), arange(4).reshape(2, 2)], [], [['readonly']]*2) # 3D with 3D assert_raises(ValueError, nditer, [arange(36).reshape(3, 3, 4), arange(24).reshape(2, 3, 4)], [], [['readonly']]*2) assert_raises(ValueError, nditer, [arange(8).reshape(2, 4, 1), arange(24).reshape(2, 3, 4)], [], [['readonly']]*2) # Verify that the error message mentions the right shapes try: nditer([arange(2).reshape(1, 2, 1), arange(3).reshape(1, 3), arange(6).reshape(2, 3)], [], [['readonly'], ['readonly'], ['writeonly', 'no_broadcast']]) raise AssertionError('Should have raised a broadcast error') except ValueError as e: msg = str(e) # The message should contain the shape of the 3rd operand assert_(msg.find('(2,3)') >= 0, 'Message "%s" doesn\'t contain operand shape (2,3)' % msg) # The message should contain the broadcast shape assert_(msg.find('(1,2,3)') >= 0, 'Message "%s" doesn\'t contain broadcast shape (1,2,3)' % msg) try: nditer([arange(6).reshape(2, 3), arange(2)], [], [['readonly'], ['readonly']], op_axes=[[0, 1], [0, np.newaxis]], itershape=(4, 3)) raise AssertionError('Should have raised a broadcast error') except ValueError as e: msg = str(e) # The message should contain "shape->remappedshape" for each operand assert_(msg.find('(2,3)->(2,3)') >= 0, 'Message "%s" doesn\'t contain operand shape (2,3)->(2,3)' % msg) assert_(msg.find('(2,)->(2,newaxis)') >= 0, ('Message "%s" doesn\'t contain remapped operand shape' + '(2,)->(2,newaxis)') % msg) # The message should contain the itershape parameter assert_(msg.find('(4,3)') >= 0, 'Message "%s" doesn\'t contain itershape parameter (4,3)' % msg) try: nditer([np.zeros((2, 1, 1)), np.zeros((2,))], [], [['writeonly', 'no_broadcast'], ['readonly']]) raise AssertionError('Should have raised a broadcast error') except ValueError as e: msg = str(e) # The message should contain the shape of the bad operand assert_(msg.find('(2,1,1)') >= 0, 'Message "%s" doesn\'t contain operand shape (2,1,1)' % msg) # The message should contain the broadcast shape assert_(msg.find('(2,1,2)') >= 0, 'Message "%s" doesn\'t contain the broadcast shape (2,1,2)' % msg) def test_iter_flags_errors(): # Check that bad combinations of flags produce errors a = arange(6) # Not enough operands assert_raises(ValueError, nditer, [], [], []) # Too many operands assert_raises(ValueError, nditer, [a]*100, [], [['readonly']]*100) # Bad global flag assert_raises(ValueError, nditer, [a], ['bad flag'], [['readonly']]) # Bad op flag assert_raises(ValueError, nditer, [a], [], [['readonly', 'bad flag']]) # Bad order parameter assert_raises(ValueError, nditer, [a], [], [['readonly']], order='G') # Bad casting parameter assert_raises(ValueError, nditer, [a], [], [['readonly']], casting='noon') # op_flags must match ops assert_raises(ValueError, nditer, [a]*3, [], [['readonly']]*2) # Cannot track both a C and an F index assert_raises(ValueError, nditer, a, ['c_index', 'f_index'], [['readonly']]) # Inner iteration and multi-indices/indices are incompatible assert_raises(ValueError, nditer, a, ['external_loop', 'multi_index'], [['readonly']]) assert_raises(ValueError, nditer, a, ['external_loop', 'c_index'], [['readonly']]) assert_raises(ValueError, nditer, a, ['external_loop', 'f_index'], [['readonly']]) # Must specify exactly one of readwrite/readonly/writeonly per operand assert_raises(ValueError, nditer, a, [], [[]]) assert_raises(ValueError, nditer, a, [], [['readonly', 'writeonly']]) assert_raises(ValueError, nditer, a, [], [['readonly', 'readwrite']]) assert_raises(ValueError, nditer, a, [], [['writeonly', 'readwrite']]) assert_raises(ValueError, nditer, a, [], [['readonly', 'writeonly', 'readwrite']]) # Python scalars are always readonly assert_raises(TypeError, nditer, 1.5, [], [['writeonly']]) assert_raises(TypeError, nditer, 1.5, [], [['readwrite']]) # Array scalars are always readonly assert_raises(TypeError, nditer, np.int32(1), [], [['writeonly']]) assert_raises(TypeError, nditer, np.int32(1), [], [['readwrite']]) # Check readonly array a.flags.writeable = False assert_raises(ValueError, nditer, a, [], [['writeonly']]) assert_raises(ValueError, nditer, a, [], [['readwrite']]) a.flags.writeable = True # Multi-indices available only with the multi_index flag i = nditer(arange(6), [], [['readonly']]) assert_raises(ValueError, lambda i:i.multi_index, i) # Index available only with an index flag assert_raises(ValueError, lambda i:i.index, i) # GotoCoords and GotoIndex incompatible with buffering or no_inner def assign_multi_index(i): i.multi_index = (0,) def assign_index(i): i.index = 0 def assign_iterindex(i): i.iterindex = 0 def assign_iterrange(i): i.iterrange = (0, 1) i = nditer(arange(6), ['external_loop']) assert_raises(ValueError, assign_multi_index, i) assert_raises(ValueError, assign_index, i) assert_raises(ValueError, assign_iterindex, i) assert_raises(ValueError, assign_iterrange, i) i = nditer(arange(6), ['buffered']) assert_raises(ValueError, assign_multi_index, i) assert_raises(ValueError, assign_index, i) assert_raises(ValueError, assign_iterrange, i) # Can't iterate if size is zero assert_raises(ValueError, nditer, np.array([])) def test_iter_slice(): a, b, c = np.arange(3), np.arange(3), np.arange(3.) i = nditer([a, b, c], [], ['readwrite']) i[0:2] = (3, 3) assert_equal(a, [3, 1, 2]) assert_equal(b, [3, 1, 2]) assert_equal(c, [0, 1, 2]) i[1] = 12 assert_equal(i[0:2], [3, 12]) def test_iter_nbo_align_contig(): # Check that byte order, alignment, and contig changes work # Byte order change by requesting a specific dtype a = np.arange(6, dtype='f4') au = a.byteswap().newbyteorder() assert_(a.dtype.byteorder != au.dtype.byteorder) i = nditer(au, [], [['readwrite', 'updateifcopy']], casting='equiv', op_dtypes=[np.dtype('f4')]) assert_equal(i.dtypes[0].byteorder, a.dtype.byteorder) assert_equal(i.operands[0].dtype.byteorder, a.dtype.byteorder) assert_equal(i.operands[0], a) i.operands[0][:] = 2 i = None assert_equal(au, [2]*6) # Byte order change by requesting NBO a = np.arange(6, dtype='f4') au = a.byteswap().newbyteorder() assert_(a.dtype.byteorder != au.dtype.byteorder) i = nditer(au, [], [['readwrite', 'updateifcopy', 'nbo']], casting='equiv') assert_equal(i.dtypes[0].byteorder, a.dtype.byteorder) assert_equal(i.operands[0].dtype.byteorder, a.dtype.byteorder) assert_equal(i.operands[0], a) i.operands[0][:] = 2 i = None assert_equal(au, [2]*6) # Unaligned input a = np.zeros((6*4+1,), dtype='i1')[1:] a.dtype = 'f4' a[:] = np.arange(6, dtype='f4') assert_(not a.flags.aligned) # Without 'aligned', shouldn't copy i = nditer(a, [], [['readonly']]) assert_(not i.operands[0].flags.aligned) assert_equal(i.operands[0], a) # With 'aligned', should make a copy i = nditer(a, [], [['readwrite', 'updateifcopy', 'aligned']]) assert_(i.operands[0].flags.aligned) assert_equal(i.operands[0], a) i.operands[0][:] = 3 i = None assert_equal(a, [3]*6) # Discontiguous input a = arange(12) # If it is contiguous, shouldn't copy i = nditer(a[:6], [], [['readonly']]) assert_(i.operands[0].flags.contiguous) assert_equal(i.operands[0], a[:6]) # If it isn't contiguous, should buffer i = nditer(a[::2], ['buffered', 'external_loop'], [['readonly', 'contig']], buffersize=10) assert_(i[0].flags.contiguous) assert_equal(i[0], a[::2]) def test_iter_array_cast(): # Check that arrays are cast as requested # No cast 'f4' -> 'f4' a = np.arange(6, dtype='f4').reshape(2, 3) i = nditer(a, [], [['readwrite']], op_dtypes=[np.dtype('f4')]) assert_equal(i.operands[0], a) assert_equal(i.operands[0].dtype, np.dtype('f4')) # Byte-order cast '<f4' -> '>f4' a = np.arange(6, dtype='<f4').reshape(2, 3) i = nditer(a, [], [['readwrite', 'updateifcopy']], casting='equiv', op_dtypes=[np.dtype('>f4')]) assert_equal(i.operands[0], a) assert_equal(i.operands[0].dtype, np.dtype('>f4')) # Safe case 'f4' -> 'f8' a = np.arange(24, dtype='f4').reshape(2, 3, 4).swapaxes(1, 2) i = nditer(a, [], [['readonly', 'copy']], casting='safe', op_dtypes=[np.dtype('f8')]) assert_equal(i.operands[0], a) assert_equal(i.operands[0].dtype, np.dtype('f8')) # The memory layout of the temporary should match a (a is (48,4,16)) # except negative strides get flipped to positive strides. assert_equal(i.operands[0].strides, (96, 8, 32)) a = a[::-1,:, ::-1] i = nditer(a, [], [['readonly', 'copy']], casting='safe', op_dtypes=[np.dtype('f8')]) assert_equal(i.operands[0], a) assert_equal(i.operands[0].dtype, np.dtype('f8')) assert_equal(i.operands[0].strides, (96, 8, 32)) # Same-kind cast 'f8' -> 'f4' -> 'f8' a = np.arange(24, dtype='f8').reshape(2, 3, 4).T i = nditer(a, [], [['readwrite', 'updateifcopy']], casting='same_kind', op_dtypes=[np.dtype('f4')]) assert_equal(i.operands[0], a) assert_equal(i.operands[0].dtype, np.dtype('f4')) assert_equal(i.operands[0].strides, (4, 16, 48)) # Check that UPDATEIFCOPY is activated i.operands[0][2, 1, 1] = -12.5 assert_(a[2, 1, 1] != -12.5) i = None assert_equal(a[2, 1, 1], -12.5) a = np.arange(6, dtype='i4')[::-2] i = nditer(a, [], [['writeonly', 'updateifcopy']], casting='unsafe', op_dtypes=[np.dtype('f4')]) assert_equal(i.operands[0].dtype, np.dtype('f4')) # Even though the stride was negative in 'a', it # becomes positive in the temporary assert_equal(i.operands[0].strides, (4,)) i.operands[0][:] = [1, 2, 3] i = None assert_equal(a, [1, 2, 3]) def test_iter_array_cast_errors(): # Check that invalid casts are caught # Need to enable copying for casts to occur assert_raises(TypeError, nditer, arange(2, dtype='f4'), [], [['readonly']], op_dtypes=[np.dtype('f8')]) # Also need to allow casting for casts to occur assert_raises(TypeError, nditer, arange(2, dtype='f4'), [], [['readonly', 'copy']], casting='no', op_dtypes=[np.dtype('f8')]) assert_raises(TypeError, nditer, arange(2, dtype='f4'), [], [['readonly', 'copy']], casting='equiv', op_dtypes=[np.dtype('f8')]) assert_raises(TypeError, nditer, arange(2, dtype='f8'), [], [['writeonly', 'updateifcopy']], casting='no', op_dtypes=[np.dtype('f4')]) assert_raises(TypeError, nditer, arange(2, dtype='f8'), [], [['writeonly', 'updateifcopy']], casting='equiv', op_dtypes=[np.dtype('f4')]) # '<f4' -> '>f4' should not work with casting='no' assert_raises(TypeError, nditer, arange(2, dtype='<f4'), [], [['readonly', 'copy']], casting='no', op_dtypes=[np.dtype('>f4')]) # 'f4' -> 'f8' is a safe cast, but 'f8' -> 'f4' isn't assert_raises(TypeError, nditer, arange(2, dtype='f4'), [], [['readwrite', 'updateifcopy']], casting='safe', op_dtypes=[np.dtype('f8')]) assert_raises(TypeError, nditer, arange(2, dtype='f8'), [], [['readwrite', 'updateifcopy']], casting='safe', op_dtypes=[np.dtype('f4')]) # 'f4' -> 'i4' is neither a safe nor a same-kind cast assert_raises(TypeError, nditer, arange(2, dtype='f4'), [], [['readonly', 'copy']], casting='same_kind', op_dtypes=[np.dtype('i4')]) assert_raises(TypeError, nditer, arange(2, dtype='i4'), [], [['writeonly', 'updateifcopy']], casting='same_kind', op_dtypes=[np.dtype('f4')]) def test_iter_scalar_cast(): # Check that scalars are cast as requested # No cast 'f4' -> 'f4' i = nditer(np.float32(2.5), [], [['readonly']], op_dtypes=[np.dtype('f4')]) assert_equal(i.dtypes[0], np.dtype('f4')) assert_equal(i.value.dtype, np.dtype('f4')) assert_equal(i.value, 2.5) # Safe cast 'f4' -> 'f8' i = nditer(np.float32(2.5), [], [['readonly', 'copy']], casting='safe', op_dtypes=[np.dtype('f8')]) assert_equal(i.dtypes[0], np.dtype('f8')) assert_equal(i.value.dtype, np.dtype('f8')) assert_equal(i.value, 2.5) # Same-kind cast 'f8' -> 'f4' i = nditer(np.float64(2.5), [], [['readonly', 'copy']], casting='same_kind', op_dtypes=[np.dtype('f4')]) assert_equal(i.dtypes[0], np.dtype('f4')) assert_equal(i.value.dtype, np.dtype('f4')) assert_equal(i.value, 2.5) # Unsafe cast 'f8' -> 'i4' i = nditer(np.float64(3.0), [], [['readonly', 'copy']], casting='unsafe', op_dtypes=[np.dtype('i4')]) assert_equal(i.dtypes[0], np.dtype('i4')) assert_equal(i.value.dtype, np.dtype('i4')) assert_equal(i.value, 3) # Readonly scalars may be cast even without setting COPY or BUFFERED i = nditer(3, [], [['readonly']], op_dtypes=[np.dtype('f8')]) assert_equal(i[0].dtype, np.dtype('f8')) assert_equal(i[0], 3.) def test_iter_scalar_cast_errors(): # Check that invalid casts are caught # Need to allow copying/buffering for write casts of scalars to occur assert_raises(TypeError, nditer, np.float32(2), [], [['readwrite']], op_dtypes=[np.dtype('f8')]) assert_raises(TypeError, nditer, 2.5, [], [['readwrite']], op_dtypes=[np.dtype('f4')]) # 'f8' -> 'f4' isn't a safe cast if the value would overflow assert_raises(TypeError, nditer, np.float64(1e60), [], [['readonly']], casting='safe', op_dtypes=[np.dtype('f4')]) # 'f4' -> 'i4' is neither a safe nor a same-kind cast assert_raises(TypeError, nditer, np.float32(2), [], [['readonly']], casting='same_kind', op_dtypes=[np.dtype('i4')]) def test_iter_object_arrays_basic(): # Check that object arrays work obj = {'a':3,'b':'d'} a = np.array([[1, 2, 3], None, obj, None], dtype='O') if HAS_REFCOUNT: rc = sys.getrefcount(obj) # Need to allow references for object arrays assert_raises(TypeError, nditer, a) if HAS_REFCOUNT: assert_equal(sys.getrefcount(obj), rc) i = nditer(a, ['refs_ok'], ['readonly']) vals = [x_[()] for x_ in i] assert_equal(np.array(vals, dtype='O'), a) vals, i, x = [None]*3 if HAS_REFCOUNT: assert_equal(sys.getrefcount(obj), rc) i = nditer(a.reshape(2, 2).T, ['refs_ok', 'buffered'], ['readonly'], order='C') assert_(i.iterationneedsapi) vals = [x_[()] for x_ in i] assert_equal(np.array(vals, dtype='O'), a.reshape(2, 2).ravel(order='F')) vals, i, x = [None]*3 if HAS_REFCOUNT: assert_equal(sys.getrefcount(obj), rc) i = nditer(a.reshape(2, 2).T, ['refs_ok', 'buffered'], ['readwrite'], order='C') for x in i: x[...] = None vals, i, x = [None]*3 if HAS_REFCOUNT: assert_(sys.getrefcount(obj) == rc-1) assert_equal(a, np.array([None]*4, dtype='O')) def test_iter_object_arrays_conversions(): # Conversions to/from objects a = np.arange(6, dtype='O') i = nditer(a, ['refs_ok', 'buffered'], ['readwrite'], casting='unsafe', op_dtypes='i4') for x in i: x[...] += 1 assert_equal(a, np.arange(6)+1) a = np.arange(6, dtype='i4') i = nditer(a, ['refs_ok', 'buffered'], ['readwrite'], casting='unsafe', op_dtypes='O') for x in i: x[...] += 1 assert_equal(a, np.arange(6)+1) # Non-contiguous object array a = np.zeros((6,), dtype=[('p', 'i1'), ('a', 'O')]) a = a['a'] a[:] = np.arange(6) i = nditer(a, ['refs_ok', 'buffered'], ['readwrite'], casting='unsafe', op_dtypes='i4') for x in i: x[...] += 1 assert_equal(a, np.arange(6)+1) #Non-contiguous value array a = np.zeros((6,), dtype=[('p', 'i1'), ('a', 'i4')]) a = a['a'] a[:] = np.arange(6) + 98172488 i = nditer(a, ['refs_ok', 'buffered'], ['readwrite'], casting='unsafe', op_dtypes='O') ob = i[0][()] if HAS_REFCOUNT: rc = sys.getrefcount(ob) for x in i: x[...] += 1 if HAS_REFCOUNT: assert_(sys.getrefcount(ob) == rc-1) assert_equal(a, np.arange(6)+98172489) def test_iter_common_dtype(): # Check that the iterator finds a common data type correctly i = nditer([array([3], dtype='f4'), array([0], dtype='f8')], ['common_dtype'], [['readonly', 'copy']]*2, casting='safe') assert_equal(i.dtypes[0], np.dtype('f8')) assert_equal(i.dtypes[1], np.dtype('f8')) i = nditer([array([3], dtype='i4'), array([0], dtype='f4')], ['common_dtype'], [['readonly', 'copy']]*2, casting='safe') assert_equal(i.dtypes[0], np.dtype('f8')) assert_equal(i.dtypes[1], np.dtype('f8')) i = nditer([array([3], dtype='f4'), array(0, dtype='f8')], ['common_dtype'], [['readonly', 'copy']]*2, casting='same_kind') assert_equal(i.dtypes[0], np.dtype('f4')) assert_equal(i.dtypes[1], np.dtype('f4')) i = nditer([array([3], dtype='u4'), array(0, dtype='i4')], ['common_dtype'], [['readonly', 'copy']]*2, casting='safe') assert_equal(i.dtypes[0], np.dtype('u4')) assert_equal(i.dtypes[1], np.dtype('u4')) i = nditer([array([3], dtype='u4'), array(-12, dtype='i4')], ['common_dtype'], [['readonly', 'copy']]*2, casting='safe') assert_equal(i.dtypes[0], np.dtype('i8')) assert_equal(i.dtypes[1], np.dtype('i8')) i = nditer([array([3], dtype='u4'), array(-12, dtype='i4'), array([2j], dtype='c8'), array([9], dtype='f8')], ['common_dtype'], [['readonly', 'copy']]*4, casting='safe') assert_equal(i.dtypes[0], np.dtype('c16')) assert_equal(i.dtypes[1], np.dtype('c16')) assert_equal(i.dtypes[2], np.dtype('c16')) assert_equal(i.dtypes[3], np.dtype('c16')) assert_equal(i.value, (3, -12, 2j, 9)) # When allocating outputs, other outputs aren't factored in i = nditer([array([3], dtype='i4'), None, array([2j], dtype='c16')], [], [['readonly', 'copy'], ['writeonly', 'allocate'], ['writeonly']], casting='safe') assert_equal(i.dtypes[0], np.dtype('i4')) assert_equal(i.dtypes[1], np.dtype('i4')) assert_equal(i.dtypes[2], np.dtype('c16')) # But, if common data types are requested, they are i = nditer([array([3], dtype='i4'), None, array([2j], dtype='c16')], ['common_dtype'], [['readonly', 'copy'], ['writeonly', 'allocate'], ['writeonly']], casting='safe') assert_equal(i.dtypes[0], np.dtype('c16')) assert_equal(i.dtypes[1], np.dtype('c16')) assert_equal(i.dtypes[2], np.dtype('c16')) def test_iter_copy_if_overlap(): # Ensure the iterator makes copies on read/write overlap, if requested # Copy not needed, 1 op for flag in ['readonly', 'writeonly', 'readwrite']: a = arange(10) i = nditer([a], ['copy_if_overlap'], [[flag]]) assert_(i.operands[0] is a) # Copy needed, 2 ops, read-write overlap x = arange(10) a = x[1:] b = x[:-1] i = nditer([a, b], ['copy_if_overlap'], [['readonly'], ['readwrite']]) assert_(not np.shares_memory(*i.operands)) # Copy not needed with elementwise, 2 ops, exactly same arrays x = arange(10) a = x b = x i = nditer([a, b], ['copy_if_overlap'], [['readonly', 'overlap_assume_elementwise'], ['readwrite', 'overlap_assume_elementwise']]) assert_(i.operands[0] is a and i.operands[1] is b) i = nditer([a, b], ['copy_if_overlap'], [['readonly'], ['readwrite']]) assert_(i.operands[0] is a and not np.shares_memory(i.operands[1], b)) # Copy not needed, 2 ops, no overlap x = arange(10) a = x[::2] b = x[1::2] i = nditer([a, b], ['copy_if_overlap'], [['readonly'], ['writeonly']]) assert_(i.operands[0] is a and i.operands[1] is b) # Copy needed, 2 ops, read-write overlap x = arange(4, dtype=np.int8) a = x[3:] b = x.view(np.int32)[:1] i = nditer([a, b], ['copy_if_overlap'], [['readonly'], ['writeonly']]) assert_(not np.shares_memory(*i.operands)) # Copy needed, 3 ops, read-write overlap for flag in ['writeonly', 'readwrite']: x = np.ones([10, 10]) a = x b = x.T c = x i = nditer([a, b, c], ['copy_if_overlap'], [['readonly'], ['readonly'], [flag]]) a2, b2, c2 = i.operands assert_(not np.shares_memory(a2, c2)) assert_(not np.shares_memory(b2, c2)) # Copy not needed, 3 ops, read-only overlap x = np.ones([10, 10]) a = x b = x.T c = x i = nditer([a, b, c], ['copy_if_overlap'], [['readonly'], ['readonly'], ['readonly']]) a2, b2, c2 = i.operands assert_(a is a2) assert_(b is b2) assert_(c is c2) # Copy not needed, 3 ops, read-only overlap x = np.ones([10, 10]) a = x b = np.ones([10, 10]) c = x.T i = nditer([a, b, c], ['copy_if_overlap'], [['readonly'], ['writeonly'], ['readonly']]) a2, b2, c2 = i.operands assert_(a is a2) assert_(b is b2) assert_(c is c2) # Copy not needed, 3 ops, write-only overlap x = np.arange(7) a = x[:3] b = x[3:6] c = x[4:7] i = nditer([a, b, c], ['copy_if_overlap'], [['readonly'], ['writeonly'], ['writeonly']]) a2, b2, c2 = i.operands assert_(a is a2) assert_(b is b2) assert_(c is c2) def test_iter_op_axes(): # Check that custom axes work # Reverse the axes a = arange(6).reshape(2, 3) i = nditer([a, a.T], [], [['readonly']]*2, op_axes=[[0, 1], [1, 0]]) assert_(all([x == y for (x, y) in i])) a = arange(24).reshape(2, 3, 4) i = nditer([a.T, a], [], [['readonly']]*2, op_axes=[[2, 1, 0], None]) assert_(all([x == y for (x, y) in i])) # Broadcast 1D to any dimension a = arange(1, 31).reshape(2, 3, 5) b = arange(1, 3) i = nditer([a, b], [], [['readonly']]*2, op_axes=[None, [0, -1, -1]]) assert_equal([x*y for (x, y) in i], (a*b.reshape(2, 1, 1)).ravel()) b = arange(1, 4) i = nditer([a, b], [], [['readonly']]*2, op_axes=[None, [-1, 0, -1]]) assert_equal([x*y for (x, y) in i], (a*b.reshape(1, 3, 1)).ravel()) b = arange(1, 6) i = nditer([a, b], [], [['readonly']]*2, op_axes=[None, [np.newaxis, np.newaxis, 0]]) assert_equal([x*y for (x, y) in i], (a*b.reshape(1, 1, 5)).ravel()) # Inner product-style broadcasting a = arange(24).reshape(2, 3, 4) b = arange(40).reshape(5, 2, 4) i = nditer([a, b], ['multi_index'], [['readonly']]*2, op_axes=[[0, 1, -1, -1], [-1, -1, 0, 1]]) assert_equal(i.shape, (2, 3, 5, 2)) # Matrix product-style broadcasting a = arange(12).reshape(3, 4) b = arange(20).reshape(4, 5) i = nditer([a, b], ['multi_index'], [['readonly']]*2, op_axes=[[0, -1], [-1, 1]]) assert_equal(i.shape, (3, 5)) def test_iter_op_axes_errors(): # Check that custom axes throws errors for bad inputs # Wrong number of items in op_axes a = arange(6).reshape(2, 3) assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, op_axes=[[0], [1], [0]]) # Out of bounds items in op_axes assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, op_axes=[[2, 1], [0, 1]]) assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, op_axes=[[0, 1], [2, -1]]) # Duplicate items in op_axes assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, op_axes=[[0, 0], [0, 1]]) assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, op_axes=[[0, 1], [1, 1]]) # Different sized arrays in op_axes assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, op_axes=[[0, 1], [0, 1, 0]]) # Non-broadcastable dimensions in the result assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, op_axes=[[0, 1], [1, 0]]) def test_iter_copy(): # Check that copying the iterator works correctly a = arange(24).reshape(2, 3, 4) # Simple iterator i = nditer(a) j = i.copy() assert_equal([x[()] for x in i], [x[()] for x in j]) i.iterindex = 3 j = i.copy() assert_equal([x[()] for x in i], [x[()] for x in j]) # Buffered iterator i = nditer(a, ['buffered', 'ranged'], order='F', buffersize=3) j = i.copy() assert_equal([x[()] for x in i], [x[()] for x in j]) i.iterindex = 3 j = i.copy() assert_equal([x[()] for x in i], [x[()] for x in j]) i.iterrange = (3, 9) j = i.copy() assert_equal([x[()] for x in i], [x[()] for x in j]) i.iterrange = (2, 18) next(i) next(i) j = i.copy() assert_equal([x[()] for x in i], [x[()] for x in j]) # Casting iterator i = nditer(a, ['buffered'], order='F', casting='unsafe', op_dtypes='f8', buffersize=5) j = i.copy() i = None assert_equal([x[()] for x in j], a.ravel(order='F')) a = arange(24, dtype='<i4').reshape(2, 3, 4) i = nditer(a, ['buffered'], order='F', casting='unsafe', op_dtypes='>f8', buffersize=5) j = i.copy() i = None assert_equal([x[()] for x in j], a.ravel(order='F')) def test_iter_allocate_output_simple(): # Check that the iterator will properly allocate outputs # Simple case a = arange(6) i = nditer([a, None], [], [['readonly'], ['writeonly', 'allocate']], op_dtypes=[None, np.dtype('f4')]) assert_equal(i.operands[1].shape, a.shape) assert_equal(i.operands[1].dtype, np.dtype('f4')) def test_iter_allocate_output_buffered_readwrite(): # Allocated output with buffering + delay_bufalloc a = arange(6) i = nditer([a, None], ['buffered', 'delay_bufalloc'], [['readonly'], ['allocate', 'readwrite']]) i.operands[1][:] = 1 i.reset() for x in i: x[1][...] += x[0][...] assert_equal(i.operands[1], a+1) def test_iter_allocate_output_itorder(): # The allocated output should match the iteration order # C-order input, best iteration order a = arange(6, dtype='i4').reshape(2, 3) i = nditer([a, None], [], [['readonly'], ['writeonly', 'allocate']], op_dtypes=[None, np.dtype('f4')]) assert_equal(i.operands[1].shape, a.shape) assert_equal(i.operands[1].strides, a.strides) assert_equal(i.operands[1].dtype, np.dtype('f4')) # F-order input, best iteration order a = arange(24, dtype='i4').reshape(2, 3, 4).T i = nditer([a, None], [], [['readonly'], ['writeonly', 'allocate']], op_dtypes=[None, np.dtype('f4')]) assert_equal(i.operands[1].shape, a.shape) assert_equal(i.operands[1].strides, a.strides) assert_equal(i.operands[1].dtype, np.dtype('f4')) # Non-contiguous input, C iteration order a = arange(24, dtype='i4').reshape(2, 3, 4).swapaxes(0, 1) i = nditer([a, None], [], [['readonly'], ['writeonly', 'allocate']], order='C', op_dtypes=[None, np.dtype('f4')]) assert_equal(i.operands[1].shape, a.shape) assert_equal(i.operands[1].strides, (32, 16, 4)) assert_equal(i.operands[1].dtype, np.dtype('f4')) def test_iter_allocate_output_opaxes(): # Specifying op_axes should work a = arange(24, dtype='i4').reshape(2, 3, 4) i = nditer([None, a], [], [['writeonly', 'allocate'], ['readonly']], op_dtypes=[np.dtype('u4'), None], op_axes=[[1, 2, 0], None]) assert_equal(i.operands[0].shape, (4, 2, 3)) assert_equal(i.operands[0].strides, (4, 48, 16)) assert_equal(i.operands[0].dtype, np.dtype('u4')) def test_iter_allocate_output_types_promotion(): # Check type promotion of automatic outputs i = nditer([array([3], dtype='f4'), array([0], dtype='f8'), None], [], [['readonly']]*2+[['writeonly', 'allocate']]) assert_equal(i.dtypes[2], np.dtype('f8')) i = nditer([array([3], dtype='i4'), array([0], dtype='f4'), None], [], [['readonly']]*2+[['writeonly', 'allocate']]) assert_equal(i.dtypes[2], np.dtype('f8')) i = nditer([array([3], dtype='f4'), array(0, dtype='f8'), None], [], [['readonly']]*2+[['writeonly', 'allocate']]) assert_equal(i.dtypes[2], np.dtype('f4')) i = nditer([array([3], dtype='u4'), array(0, dtype='i4'), None], [], [['readonly']]*2+[['writeonly', 'allocate']]) assert_equal(i.dtypes[2], np.dtype('u4')) i = nditer([array([3], dtype='u4'), array(-12, dtype='i4'), None], [], [['readonly']]*2+[['writeonly', 'allocate']]) assert_equal(i.dtypes[2], np.dtype('i8')) def test_iter_allocate_output_types_byte_order(): # Verify the rules for byte order changes # When there's just one input, the output type exactly matches a = array([3], dtype='u4').newbyteorder() i = nditer([a, None], [], [['readonly'], ['writeonly', 'allocate']]) assert_equal(i.dtypes[0], i.dtypes[1]) # With two or more inputs, the output type is in native byte order i = nditer([a, a, None], [], [['readonly'], ['readonly'], ['writeonly', 'allocate']]) assert_(i.dtypes[0] != i.dtypes[2]) assert_equal(i.dtypes[0].newbyteorder('='), i.dtypes[2]) def test_iter_allocate_output_types_scalar(): # If the inputs are all scalars, the output should be a scalar i = nditer([None, 1, 2.3, np.float32(12), np.complex128(3)], [], [['writeonly', 'allocate']] + [['readonly']]*4) assert_equal(i.operands[0].dtype, np.dtype('complex128')) assert_equal(i.operands[0].ndim, 0) def test_iter_allocate_output_subtype(): # Make sure that the subtype with priority wins # matrix vs ndarray a = np.matrix([[1, 2], [3, 4]]) b = np.arange(4).reshape(2, 2).T i = nditer([a, b, None], [], [['readonly'], ['readonly'], ['writeonly', 'allocate']]) assert_equal(type(a), type(i.operands[2])) assert_(type(b) != type(i.operands[2])) assert_equal(i.operands[2].shape, (2, 2)) # matrix always wants things to be 2D b = np.arange(4).reshape(1, 2, 2) assert_raises(RuntimeError, nditer, [a, b, None], [], [['readonly'], ['readonly'], ['writeonly', 'allocate']]) # but if subtypes are disabled, the result can still work i = nditer([a, b, None], [], [['readonly'], ['readonly'], ['writeonly', 'allocate', 'no_subtype']]) assert_equal(type(b), type(i.operands[2])) assert_(type(a) != type(i.operands[2])) assert_equal(i.operands[2].shape, (1, 2, 2)) def test_iter_allocate_output_errors(): # Check that the iterator will throw errors for bad output allocations # Need an input if no output data type is specified a = arange(6) assert_raises(TypeError, nditer, [a, None], [], [['writeonly'], ['writeonly', 'allocate']]) # Allocated output should be flagged for writing assert_raises(ValueError, nditer, [a, None], [], [['readonly'], ['allocate', 'readonly']]) # Allocated output can't have buffering without delayed bufalloc assert_raises(ValueError, nditer, [a, None], ['buffered'], ['allocate', 'readwrite']) # Must specify at least one input assert_raises(ValueError, nditer, [None, None], [], [['writeonly', 'allocate'], ['writeonly', 'allocate']], op_dtypes=[np.dtype('f4'), np.dtype('f4')]) # If using op_axes, must specify all the axes a = arange(24, dtype='i4').reshape(2, 3, 4) assert_raises(ValueError, nditer, [a, None], [], [['readonly'], ['writeonly', 'allocate']], op_dtypes=[None, np.dtype('f4')], op_axes=[None, [0, np.newaxis, 1]]) # If using op_axes, the axes must be within bounds assert_raises(ValueError, nditer, [a, None], [], [['readonly'], ['writeonly', 'allocate']], op_dtypes=[None, np.dtype('f4')], op_axes=[None, [0, 3, 1]]) # If using op_axes, there can't be duplicates assert_raises(ValueError, nditer, [a, None], [], [['readonly'], ['writeonly', 'allocate']], op_dtypes=[None, np.dtype('f4')], op_axes=[None, [0, 2, 1, 0]]) def test_iter_remove_axis(): a = arange(24).reshape(2, 3, 4) i = nditer(a, ['multi_index']) i.remove_axis(1) assert_equal([x for x in i], a[:, 0,:].ravel()) a = a[::-1,:,:] i = nditer(a, ['multi_index']) i.remove_axis(0) assert_equal([x for x in i], a[0,:,:].ravel()) def test_iter_remove_multi_index_inner_loop(): # Check that removing multi-index support works a = arange(24).reshape(2, 3, 4) i = nditer(a, ['multi_index']) assert_equal(i.ndim, 3) assert_equal(i.shape, (2, 3, 4)) assert_equal(i.itviews[0].shape, (2, 3, 4)) # Removing the multi-index tracking causes all dimensions to coalesce before = [x for x in i] i.remove_multi_index() after = [x for x in i] assert_equal(before, after) assert_equal(i.ndim, 1) assert_raises(ValueError, lambda i:i.shape, i) assert_equal(i.itviews[0].shape, (24,)) # Removing the inner loop means there's just one iteration i.reset() assert_equal(i.itersize, 24) assert_equal(i[0].shape, tuple()) i.enable_external_loop() assert_equal(i.itersize, 24) assert_equal(i[0].shape, (24,)) assert_equal(i.value, arange(24)) def test_iter_iterindex(): # Make sure iterindex works buffersize = 5 a = arange(24).reshape(4, 3, 2) for flags in ([], ['buffered']): i = nditer(a, flags, buffersize=buffersize) assert_equal(iter_iterindices(i), list(range(24))) i.iterindex = 2 assert_equal(iter_iterindices(i), list(range(2, 24))) i = nditer(a, flags, order='F', buffersize=buffersize) assert_equal(iter_iterindices(i), list(range(24))) i.iterindex = 5 assert_equal(iter_iterindices(i), list(range(5, 24))) i = nditer(a[::-1], flags, order='F', buffersize=buffersize) assert_equal(iter_iterindices(i), list(range(24))) i.iterindex = 9 assert_equal(iter_iterindices(i), list(range(9, 24))) i = nditer(a[::-1, ::-1], flags, order='C', buffersize=buffersize) assert_equal(iter_iterindices(i), list(range(24))) i.iterindex = 13 assert_equal(iter_iterindices(i), list(range(13, 24))) i = nditer(a[::1, ::-1], flags, buffersize=buffersize) assert_equal(iter_iterindices(i), list(range(24))) i.iterindex = 23 assert_equal(iter_iterindices(i), list(range(23, 24))) i.reset() i.iterindex = 2 assert_equal(iter_iterindices(i), list(range(2, 24))) def test_iter_iterrange(): # Make sure getting and resetting the iterrange works buffersize = 5 a = arange(24, dtype='i4').reshape(4, 3, 2) a_fort = a.ravel(order='F') i = nditer(a, ['ranged'], ['readonly'], order='F', buffersize=buffersize) assert_equal(i.iterrange, (0, 24)) assert_equal([x[()] for x in i], a_fort) for r in [(0, 24), (1, 2), (3, 24), (5, 5), (0, 20), (23, 24)]: i.iterrange = r assert_equal(i.iterrange, r) assert_equal([x[()] for x in i], a_fort[r[0]:r[1]]) i = nditer(a, ['ranged', 'buffered'], ['readonly'], order='F', op_dtypes='f8', buffersize=buffersize) assert_equal(i.iterrange, (0, 24)) assert_equal([x[()] for x in i], a_fort) for r in [(0, 24), (1, 2), (3, 24), (5, 5), (0, 20), (23, 24)]: i.iterrange = r assert_equal(i.iterrange, r) assert_equal([x[()] for x in i], a_fort[r[0]:r[1]]) def get_array(i): val = np.array([], dtype='f8') for x in i: val = np.concatenate((val, x)) return val i = nditer(a, ['ranged', 'buffered', 'external_loop'], ['readonly'], order='F', op_dtypes='f8', buffersize=buffersize) assert_equal(i.iterrange, (0, 24)) assert_equal(get_array(i), a_fort) for r in [(0, 24), (1, 2), (3, 24), (5, 5), (0, 20), (23, 24)]: i.iterrange = r assert_equal(i.iterrange, r) assert_equal(get_array(i), a_fort[r[0]:r[1]]) def test_iter_buffering(): # Test buffering with several buffer sizes and types arrays = [] # F-order swapped array arrays.append(np.arange(24, dtype='c16').reshape(2, 3, 4).T.newbyteorder().byteswap()) # Contiguous 1-dimensional array arrays.append(np.arange(10, dtype='f4')) # Unaligned array a = np.zeros((4*16+1,), dtype='i1')[1:] a.dtype = 'i4' a[:] = np.arange(16, dtype='i4') arrays.append(a) # 4-D F-order array arrays.append(np.arange(120, dtype='i4').reshape(5, 3, 2, 4).T) for a in arrays: for buffersize in (1, 2, 3, 5, 8, 11, 16, 1024): vals = [] i = nditer(a, ['buffered', 'external_loop'], [['readonly', 'nbo', 'aligned']], order='C', casting='equiv', buffersize=buffersize) while not i.finished: assert_(i[0].size <= buffersize) vals.append(i[0].copy()) i.iternext() assert_equal(np.concatenate(vals), a.ravel(order='C')) def test_iter_write_buffering(): # Test that buffering of writes is working # F-order swapped array a = np.arange(24).reshape(2, 3, 4).T.newbyteorder().byteswap() i = nditer(a, ['buffered'], [['readwrite', 'nbo', 'aligned']], casting='equiv', order='C', buffersize=16) x = 0 while not i.finished: i[0] = x x += 1 i.iternext() assert_equal(a.ravel(order='C'), np.arange(24)) def test_iter_buffering_delayed_alloc(): # Test that delaying buffer allocation works a = np.arange(6) b = np.arange(1, dtype='f4') i = nditer([a, b], ['buffered', 'delay_bufalloc', 'multi_index', 'reduce_ok'], ['readwrite'], casting='unsafe', op_dtypes='f4') assert_(i.has_delayed_bufalloc) assert_raises(ValueError, lambda i:i.multi_index, i) assert_raises(ValueError, lambda i:i[0], i) assert_raises(ValueError, lambda i:i[0:2], i) def assign_iter(i): i[0] = 0 assert_raises(ValueError, assign_iter, i) i.reset() assert_(not i.has_delayed_bufalloc) assert_equal(i.multi_index, (0,)) assert_equal(i[0], 0) i[1] = 1 assert_equal(i[0:2], [0, 1]) assert_equal([[x[0][()], x[1][()]] for x in i], list(zip(range(6), [1]*6))) def test_iter_buffered_cast_simple(): # Test that buffering can handle a simple cast a = np.arange(10, dtype='f4') i = nditer(a, ['buffered', 'external_loop'], [['readwrite', 'nbo', 'aligned']], casting='same_kind', op_dtypes=[np.dtype('f8')], buffersize=3) for v in i: v[...] *= 2 assert_equal(a, 2*np.arange(10, dtype='f4')) def test_iter_buffered_cast_byteswapped(): # Test that buffering can handle a cast which requires swap->cast->swap a = np.arange(10, dtype='f4').newbyteorder().byteswap() i = nditer(a, ['buffered', 'external_loop'], [['readwrite', 'nbo', 'aligned']], casting='same_kind', op_dtypes=[np.dtype('f8').newbyteorder()], buffersize=3) for v in i: v[...] *= 2 assert_equal(a, 2*np.arange(10, dtype='f4')) with suppress_warnings() as sup: sup.filter(np.ComplexWarning) a = np.arange(10, dtype='f8').newbyteorder().byteswap() i = nditer(a, ['buffered', 'external_loop'], [['readwrite', 'nbo', 'aligned']], casting='unsafe', op_dtypes=[np.dtype('c8').newbyteorder()], buffersize=3) for v in i: v[...] *= 2 assert_equal(a, 2*np.arange(10, dtype='f8')) def test_iter_buffered_cast_byteswapped_complex(): # Test that buffering can handle a cast which requires swap->cast->copy a = np.arange(10, dtype='c8').newbyteorder().byteswap() a += 2j i = nditer(a, ['buffered', 'external_loop'], [['readwrite', 'nbo', 'aligned']], casting='same_kind', op_dtypes=[np.dtype('c16')], buffersize=3) for v in i: v[...] *= 2 assert_equal(a, 2*np.arange(10, dtype='c8') + 4j) a = np.arange(10, dtype='c8') a += 2j i = nditer(a, ['buffered', 'external_loop'], [['readwrite', 'nbo', 'aligned']], casting='same_kind', op_dtypes=[np.dtype('c16').newbyteorder()], buffersize=3) for v in i: v[...] *= 2 assert_equal(a, 2*np.arange(10, dtype='c8') + 4j) a = np.arange(10, dtype=np.clongdouble).newbyteorder().byteswap() a += 2j i = nditer(a, ['buffered', 'external_loop'], [['readwrite', 'nbo', 'aligned']], casting='same_kind', op_dtypes=[np.dtype('c16')], buffersize=3) for v in i: v[...] *= 2 assert_equal(a, 2*np.arange(10, dtype=np.clongdouble) + 4j) a = np.arange(10, dtype=np.longdouble).newbyteorder().byteswap() i = nditer(a, ['buffered', 'external_loop'], [['readwrite', 'nbo', 'aligned']], casting='same_kind', op_dtypes=[np.dtype('f4')], buffersize=7) for v in i: v[...] *= 2 assert_equal(a, 2*np.arange(10, dtype=np.longdouble)) def test_iter_buffered_cast_structured_type(): # Tests buffering of structured types # simple -> struct type (duplicates the value) sdt = [('a', 'f4'), ('b', 'i8'), ('c', 'c8', (2, 3)), ('d', 'O')] a = np.arange(3, dtype='f4') + 0.5 i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt) vals = [np.array(x) for x in i] assert_equal(vals[0]['a'], 0.5) assert_equal(vals[0]['b'], 0) assert_equal(vals[0]['c'], [[(0.5)]*3]*2) assert_equal(vals[0]['d'], 0.5) assert_equal(vals[1]['a'], 1.5) assert_equal(vals[1]['b'], 1) assert_equal(vals[1]['c'], [[(1.5)]*3]*2) assert_equal(vals[1]['d'], 1.5) assert_equal(vals[0].dtype, np.dtype(sdt)) # object -> struct type sdt = [('a', 'f4'), ('b', 'i8'), ('c', 'c8', (2, 3)), ('d', 'O')] a = np.zeros((3,), dtype='O') a[0] = (0.5, 0.5, [[0.5, 0.5, 0.5], [0.5, 0.5, 0.5]], 0.5) a[1] = (1.5, 1.5, [[1.5, 1.5, 1.5], [1.5, 1.5, 1.5]], 1.5) a[2] = (2.5, 2.5, [[2.5, 2.5, 2.5], [2.5, 2.5, 2.5]], 2.5) if HAS_REFCOUNT: rc = sys.getrefcount(a[0]) i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt) vals = [x.copy() for x in i] assert_equal(vals[0]['a'], 0.5) assert_equal(vals[0]['b'], 0) assert_equal(vals[0]['c'], [[(0.5)]*3]*2) assert_equal(vals[0]['d'], 0.5) assert_equal(vals[1]['a'], 1.5) assert_equal(vals[1]['b'], 1) assert_equal(vals[1]['c'], [[(1.5)]*3]*2) assert_equal(vals[1]['d'], 1.5) assert_equal(vals[0].dtype, np.dtype(sdt)) vals, i, x = [None]*3 if HAS_REFCOUNT: assert_equal(sys.getrefcount(a[0]), rc) # single-field struct type -> simple sdt = [('a', 'f4')] a = np.array([(5.5,), (8,)], dtype=sdt) i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes='i4') assert_equal([x_[()] for x_ in i], [5, 8]) # make sure multi-field struct type -> simple doesn't work sdt = [('a', 'f4'), ('b', 'i8'), ('d', 'O')] a = np.array([(5.5, 7, 'test'), (8, 10, 11)], dtype=sdt) assert_raises(ValueError, lambda: ( nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes='i4'))) # struct type -> struct type (field-wise copy) sdt1 = [('a', 'f4'), ('b', 'i8'), ('d', 'O')] sdt2 = [('d', 'u2'), ('a', 'O'), ('b', 'f8')] a = np.array([(1, 2, 3), (4, 5, 6)], dtype=sdt1) i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt2) assert_equal(i[0].dtype, np.dtype(sdt2)) assert_equal([np.array(x_) for x_ in i], [np.array((1, 2, 3), dtype=sdt2), np.array((4, 5, 6), dtype=sdt2)]) # make sure struct type -> struct type with different # number of fields fails sdt1 = [('a', 'f4'), ('b', 'i8'), ('d', 'O')] sdt2 = [('b', 'O'), ('a', 'f8')] a = np.array([(1, 2, 3), (4, 5, 6)], dtype=sdt1) assert_raises(ValueError, lambda : ( nditer(a, ['buffered', 'refs_ok'], ['readwrite'], casting='unsafe', op_dtypes=sdt2))) def test_iter_buffered_cast_subarray(): # Tests buffering of subarrays # one element -> many (copies it to all) sdt1 = [('a', 'f4')] sdt2 = [('a', 'f8', (3, 2, 2))] a = np.zeros((6,), dtype=sdt1) a['a'] = np.arange(6) i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt2) assert_equal(i[0].dtype, np.dtype(sdt2)) for x, count in zip(i, list(range(6))): assert_(np.all(x['a'] == count)) # one element -> many -> back (copies it to all) sdt1 = [('a', 'O', (1, 1))] sdt2 = [('a', 'O', (3, 2, 2))] a = np.zeros((6,), dtype=sdt1) a['a'][:, 0, 0] = np.arange(6) i = nditer(a, ['buffered', 'refs_ok'], ['readwrite'], casting='unsafe', op_dtypes=sdt2) assert_equal(i[0].dtype, np.dtype(sdt2)) count = 0 for x in i: assert_(np.all(x['a'] == count)) x['a'][0] += 2 count += 1 assert_equal(a['a'], np.arange(6).reshape(6, 1, 1)+2) # many -> one element -> back (copies just element 0) sdt1 = [('a', 'O', (3, 2, 2))] sdt2 = [('a', 'O', (1,))] a = np.zeros((6,), dtype=sdt1) a['a'][:, 0, 0, 0] = np.arange(6) i = nditer(a, ['buffered', 'refs_ok'], ['readwrite'], casting='unsafe', op_dtypes=sdt2) assert_equal(i[0].dtype, np.dtype(sdt2)) count = 0 for x in i: assert_equal(x['a'], count) x['a'] += 2 count += 1 assert_equal(a['a'], np.arange(6).reshape(6, 1, 1, 1)*np.ones((1, 3, 2, 2))+2) # many -> one element -> back (copies just element 0) sdt1 = [('a', 'f8', (3, 2, 2))] sdt2 = [('a', 'O', (1,))] a = np.zeros((6,), dtype=sdt1) a['a'][:, 0, 0, 0] = np.arange(6) i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt2) assert_equal(i[0].dtype, np.dtype(sdt2)) count = 0 for x in i: assert_equal(x['a'], count) count += 1 # many -> one element (copies just element 0) sdt1 = [('a', 'O', (3, 2, 2))] sdt2 = [('a', 'f4', (1,))] a = np.zeros((6,), dtype=sdt1) a['a'][:, 0, 0, 0] = np.arange(6) i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt2) assert_equal(i[0].dtype, np.dtype(sdt2)) count = 0 for x in i: assert_equal(x['a'], count) count += 1 # many -> matching shape (straightforward copy) sdt1 = [('a', 'O', (3, 2, 2))] sdt2 = [('a', 'f4', (3, 2, 2))] a = np.zeros((6,), dtype=sdt1) a['a'] = np.arange(6*3*2*2).reshape(6, 3, 2, 2) i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt2) assert_equal(i[0].dtype, np.dtype(sdt2)) count = 0 for x in i: assert_equal(x['a'], a[count]['a']) count += 1 # vector -> smaller vector (truncates) sdt1 = [('a', 'f8', (6,))] sdt2 = [('a', 'f4', (2,))] a = np.zeros((6,), dtype=sdt1) a['a'] = np.arange(6*6).reshape(6, 6) i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt2) assert_equal(i[0].dtype, np.dtype(sdt2)) count = 0 for x in i: assert_equal(x['a'], a[count]['a'][:2]) count += 1 # vector -> bigger vector (pads with zeros) sdt1 = [('a', 'f8', (2,))] sdt2 = [('a', 'f4', (6,))] a = np.zeros((6,), dtype=sdt1) a['a'] = np.arange(6*2).reshape(6, 2) i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt2) assert_equal(i[0].dtype, np.dtype(sdt2)) count = 0 for x in i: assert_equal(x['a'][:2], a[count]['a']) assert_equal(x['a'][2:], [0, 0, 0, 0]) count += 1 # vector -> matrix (broadcasts) sdt1 = [('a', 'f8', (2,))] sdt2 = [('a', 'f4', (2, 2))] a = np.zeros((6,), dtype=sdt1) a['a'] = np.arange(6*2).reshape(6, 2) i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt2) assert_equal(i[0].dtype, np.dtype(sdt2)) count = 0 for x in i: assert_equal(x['a'][0], a[count]['a']) assert_equal(x['a'][1], a[count]['a']) count += 1 # vector -> matrix (broadcasts and zero-pads) sdt1 = [('a', 'f8', (2, 1))] sdt2 = [('a', 'f4', (3, 2))] a = np.zeros((6,), dtype=sdt1) a['a'] = np.arange(6*2).reshape(6, 2, 1) i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt2) assert_equal(i[0].dtype, np.dtype(sdt2)) count = 0 for x in i: assert_equal(x['a'][:2, 0], a[count]['a'][:, 0]) assert_equal(x['a'][:2, 1], a[count]['a'][:, 0]) assert_equal(x['a'][2,:], [0, 0]) count += 1 # matrix -> matrix (truncates and zero-pads) sdt1 = [('a', 'f8', (2, 3))] sdt2 = [('a', 'f4', (3, 2))] a = np.zeros((6,), dtype=sdt1) a['a'] = np.arange(6*2*3).reshape(6, 2, 3) i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt2) assert_equal(i[0].dtype, np.dtype(sdt2)) count = 0 for x in i: assert_equal(x['a'][:2, 0], a[count]['a'][:, 0]) assert_equal(x['a'][:2, 1], a[count]['a'][:, 1]) assert_equal(x['a'][2,:], [0, 0]) count += 1 def test_iter_buffering_badwriteback(): # Writing back from a buffer cannot combine elements # a needs write buffering, but had a broadcast dimension a = np.arange(6).reshape(2, 3, 1) b = np.arange(12).reshape(2, 3, 2) assert_raises(ValueError, nditer, [a, b], ['buffered', 'external_loop'], [['readwrite'], ['writeonly']], order='C') # But if a is readonly, it's fine nditer([a, b], ['buffered', 'external_loop'], [['readonly'], ['writeonly']], order='C') # If a has just one element, it's fine too (constant 0 stride, a reduction) a = np.arange(1).reshape(1, 1, 1) nditer([a, b], ['buffered', 'external_loop', 'reduce_ok'], [['readwrite'], ['writeonly']], order='C') # check that it fails on other dimensions too a = np.arange(6).reshape(1, 3, 2) assert_raises(ValueError, nditer, [a, b], ['buffered', 'external_loop'], [['readwrite'], ['writeonly']], order='C') a = np.arange(4).reshape(2, 1, 2) assert_raises(ValueError, nditer, [a, b], ['buffered', 'external_loop'], [['readwrite'], ['writeonly']], order='C') def test_iter_buffering_string(): # Safe casting disallows shrinking strings a = np.array(['abc', 'a', 'abcd'], dtype=np.bytes_) assert_equal(a.dtype, np.dtype('S4')) assert_raises(TypeError, nditer, a, ['buffered'], ['readonly'], op_dtypes='S2') i = nditer(a, ['buffered'], ['readonly'], op_dtypes='S6') assert_equal(i[0], b'abc') assert_equal(i[0].dtype, np.dtype('S6')) a = np.array(['abc', 'a', 'abcd'], dtype=np.unicode) assert_equal(a.dtype, np.dtype('U4')) assert_raises(TypeError, nditer, a, ['buffered'], ['readonly'], op_dtypes='U2') i = nditer(a, ['buffered'], ['readonly'], op_dtypes='U6') assert_equal(i[0], u'abc') assert_equal(i[0].dtype, np.dtype('U6')) def test_iter_buffering_growinner(): # Test that the inner loop grows when no buffering is needed a = np.arange(30) i = nditer(a, ['buffered', 'growinner', 'external_loop'], buffersize=5) # Should end up with just one inner loop here assert_equal(i[0].size, a.size) @dec.slow def test_iter_buffered_reduce_reuse(): # large enough array for all views, including negative strides. a = np.arange(2*3**5)[3**5:3**5+1] flags = ['buffered', 'delay_bufalloc', 'multi_index', 'reduce_ok', 'refs_ok'] op_flags = [('readonly',), ('readwrite', 'allocate')] op_axes_list = [[(0, 1, 2), (0, 1, -1)], [(0, 1, 2), (0, -1, -1)]] # wrong dtype to force buffering op_dtypes = [float, a.dtype] def get_params(): for xs in range(-3**2, 3**2 + 1): for ys in range(xs, 3**2 + 1): for op_axes in op_axes_list: # last stride is reduced and because of that not # important for this test, as it is the inner stride. strides = (xs * a.itemsize, ys * a.itemsize, a.itemsize) arr = np.lib.stride_tricks.as_strided(a, (3, 3, 3), strides) for skip in [0, 1]: yield arr, op_axes, skip for arr, op_axes, skip in get_params(): nditer2 = np.nditer([arr.copy(), None], op_axes=op_axes, flags=flags, op_flags=op_flags, op_dtypes=op_dtypes) nditer2.operands[-1][...] = 0 nditer2.reset() nditer2.iterindex = skip for (a2_in, b2_in) in nditer2: b2_in += a2_in.astype(np.int_) comp_res = nditer2.operands[-1] for bufsize in range(0, 3**3): nditer1 = np.nditer([arr, None], op_axes=op_axes, flags=flags, op_flags=op_flags, buffersize=bufsize, op_dtypes=op_dtypes) nditer1.operands[-1][...] = 0 nditer1.reset() nditer1.iterindex = skip for (a1_in, b1_in) in nditer1: b1_in += a1_in.astype(np.int_) res = nditer1.operands[-1] assert_array_equal(res, comp_res) def test_iter_no_broadcast(): # Test that the no_broadcast flag works a = np.arange(24).reshape(2, 3, 4) b = np.arange(6).reshape(2, 3, 1) c = np.arange(12).reshape(3, 4) nditer([a, b, c], [], [['readonly', 'no_broadcast'], ['readonly'], ['readonly']]) assert_raises(ValueError, nditer, [a, b, c], [], [['readonly'], ['readonly', 'no_broadcast'], ['readonly']]) assert_raises(ValueError, nditer, [a, b, c], [], [['readonly'], ['readonly'], ['readonly', 'no_broadcast']]) class TestIterNested(object): def test_basic(self): # Test nested iteration basic usage a = arange(12).reshape(2, 3, 2) i, j = np.nested_iters(a, [[0], [1, 2]]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 1, 2, 3, 4, 5], [6, 7, 8, 9, 10, 11]]) i, j = np.nested_iters(a, [[0, 1], [2]]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 1], [2, 3], [4, 5], [6, 7], [8, 9], [10, 11]]) i, j = np.nested_iters(a, [[0, 2], [1]]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 2, 4], [1, 3, 5], [6, 8, 10], [7, 9, 11]]) def test_reorder(self): # Test nested iteration basic usage a = arange(12).reshape(2, 3, 2) # In 'K' order (default), it gets reordered i, j = np.nested_iters(a, [[0], [2, 1]]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 1, 2, 3, 4, 5], [6, 7, 8, 9, 10, 11]]) i, j = np.nested_iters(a, [[1, 0], [2]]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 1], [2, 3], [4, 5], [6, 7], [8, 9], [10, 11]]) i, j = np.nested_iters(a, [[2, 0], [1]]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 2, 4], [1, 3, 5], [6, 8, 10], [7, 9, 11]]) # In 'C' order, it doesn't i, j = np.nested_iters(a, [[0], [2, 1]], order='C') vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 2, 4, 1, 3, 5], [6, 8, 10, 7, 9, 11]]) i, j = np.nested_iters(a, [[1, 0], [2]], order='C') vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 1], [6, 7], [2, 3], [8, 9], [4, 5], [10, 11]]) i, j = np.nested_iters(a, [[2, 0], [1]], order='C') vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 2, 4], [6, 8, 10], [1, 3, 5], [7, 9, 11]]) def test_flip_axes(self): # Test nested iteration with negative axes a = arange(12).reshape(2, 3, 2)[::-1, ::-1, ::-1] # In 'K' order (default), the axes all get flipped i, j = np.nested_iters(a, [[0], [1, 2]]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 1, 2, 3, 4, 5], [6, 7, 8, 9, 10, 11]]) i, j = np.nested_iters(a, [[0, 1], [2]]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 1], [2, 3], [4, 5], [6, 7], [8, 9], [10, 11]]) i, j = np.nested_iters(a, [[0, 2], [1]]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 2, 4], [1, 3, 5], [6, 8, 10], [7, 9, 11]]) # In 'C' order, flipping axes is disabled i, j = np.nested_iters(a, [[0], [1, 2]], order='C') vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[11, 10, 9, 8, 7, 6], [5, 4, 3, 2, 1, 0]]) i, j = np.nested_iters(a, [[0, 1], [2]], order='C') vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[11, 10], [9, 8], [7, 6], [5, 4], [3, 2], [1, 0]]) i, j = np.nested_iters(a, [[0, 2], [1]], order='C') vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[11, 9, 7], [10, 8, 6], [5, 3, 1], [4, 2, 0]]) def test_broadcast(self): # Test nested iteration with broadcasting a = arange(2).reshape(2, 1) b = arange(3).reshape(1, 3) i, j = np.nested_iters([a, b], [[0], [1]]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[[0, 0], [0, 1], [0, 2]], [[1, 0], [1, 1], [1, 2]]]) i, j = np.nested_iters([a, b], [[1], [0]]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[[0, 0], [1, 0]], [[0, 1], [1, 1]], [[0, 2], [1, 2]]]) def test_dtype_copy(self): # Test nested iteration with a copy to change dtype # copy a = arange(6, dtype='i4').reshape(2, 3) i, j = np.nested_iters(a, [[0], [1]], op_flags=['readonly', 'copy'], op_dtypes='f8') assert_equal(j[0].dtype, np.dtype('f8')) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 1, 2], [3, 4, 5]]) vals = None # updateifcopy a = arange(6, dtype='f4').reshape(2, 3) i, j = np.nested_iters(a, [[0], [1]], op_flags=['readwrite', 'updateifcopy'], casting='same_kind', op_dtypes='f8') assert_equal(j[0].dtype, np.dtype('f8')) for x in i: for y in j: y[...] += 1 assert_equal(a, [[0, 1, 2], [3, 4, 5]]) i, j, x, y = (None,)*4 # force the updateifcopy assert_equal(a, [[1, 2, 3], [4, 5, 6]]) def test_dtype_buffered(self): # Test nested iteration with buffering to change dtype a = arange(6, dtype='f4').reshape(2, 3) i, j = np.nested_iters(a, [[0], [1]], flags=['buffered'], op_flags=['readwrite'], casting='same_kind', op_dtypes='f8') assert_equal(j[0].dtype, np.dtype('f8')) for x in i: for y in j: y[...] += 1 assert_equal(a, [[1, 2, 3], [4, 5, 6]]) def test_0d(self): a = np.arange(12).reshape(2, 3, 2) i, j = np.nested_iters(a, [[], [1, 0, 2]]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11]]) i, j = np.nested_iters(a, [[1, 0, 2], []]) vals = [] for x in i: vals.append([y for y in j]) assert_equal(vals, [[0], [1], [2], [3], [4], [5], [6], [7], [8], [9], [10], [11]]) i, j, k = np.nested_iters(a, [[2, 0], [], [1]]) vals = [] for x in i: for y in j: vals.append([z for z in k]) assert_equal(vals, [[0, 2, 4], [1, 3, 5], [6, 8, 10], [7, 9, 11]]) def test_iter_reduction_error(): a = np.arange(6) assert_raises(ValueError, nditer, [a, None], [], [['readonly'], ['readwrite', 'allocate']], op_axes=[[0], [-1]]) a = np.arange(6).reshape(2, 3) assert_raises(ValueError, nditer, [a, None], ['external_loop'], [['readonly'], ['readwrite', 'allocate']], op_axes=[[0, 1], [-1, -1]]) def test_iter_reduction(): # Test doing reductions with the iterator a = np.arange(6) i = nditer([a, None], ['reduce_ok'], [['readonly'], ['readwrite', 'allocate']], op_axes=[[0], [-1]]) # Need to initialize the output operand to the addition unit i.operands[1][...] = 0 # Do the reduction for x, y in i: y[...] += x # Since no axes were specified, should have allocated a scalar assert_equal(i.operands[1].ndim, 0) assert_equal(i.operands[1], np.sum(a)) a = np.arange(6).reshape(2, 3) i = nditer([a, None], ['reduce_ok', 'external_loop'], [['readonly'], ['readwrite', 'allocate']], op_axes=[[0, 1], [-1, -1]]) # Need to initialize the output operand to the addition unit i.operands[1][...] = 0 # Reduction shape/strides for the output assert_equal(i[1].shape, (6,)) assert_equal(i[1].strides, (0,)) # Do the reduction for x, y in i: # Use a for loop instead of ``y[...] += x`` # (equivalent to ``y[...] = y[...].copy() + x``), # because y has zero strides we use for the reduction for j in range(len(y)): y[j] += x[j] # Since no axes were specified, should have allocated a scalar assert_equal(i.operands[1].ndim, 0) assert_equal(i.operands[1], np.sum(a)) # This is a tricky reduction case for the buffering double loop # to handle a = np.ones((2, 3, 5)) it1 = nditer([a, None], ['reduce_ok', 'external_loop'], [['readonly'], ['readwrite', 'allocate']], op_axes=[None, [0, -1, 1]]) it2 = nditer([a, None], ['reduce_ok', 'external_loop', 'buffered', 'delay_bufalloc'], [['readonly'], ['readwrite', 'allocate']], op_axes=[None, [0, -1, 1]], buffersize=10) it1.operands[1].fill(0) it2.operands[1].fill(0) it2.reset() for x in it1: x[1][...] += x[0] for x in it2: x[1][...] += x[0] assert_equal(it1.operands[1], it2.operands[1]) assert_equal(it2.operands[1].sum(), a.size) def test_iter_buffering_reduction(): # Test doing buffered reductions with the iterator a = np.arange(6) b = np.array(0., dtype='f8').byteswap().newbyteorder() i = nditer([a, b], ['reduce_ok', 'buffered'], [['readonly'], ['readwrite', 'nbo']], op_axes=[[0], [-1]]) assert_equal(i[1].dtype, np.dtype('f8')) assert_(i[1].dtype != b.dtype) # Do the reduction for x, y in i: y[...] += x # Since no axes were specified, should have allocated a scalar assert_equal(b, np.sum(a)) a = np.arange(6).reshape(2, 3) b = np.array([0, 0], dtype='f8').byteswap().newbyteorder() i = nditer([a, b], ['reduce_ok', 'external_loop', 'buffered'], [['readonly'], ['readwrite', 'nbo']], op_axes=[[0, 1], [0, -1]]) # Reduction shape/strides for the output assert_equal(i[1].shape, (3,)) assert_equal(i[1].strides, (0,)) # Do the reduction for x, y in i: # Use a for loop instead of ``y[...] += x`` # (equivalent to ``y[...] = y[...].copy() + x``), # because y has zero strides we use for the reduction for j in range(len(y)): y[j] += x[j] assert_equal(b, np.sum(a, axis=1)) # Iterator inner double loop was wrong on this one p = np.arange(2) + 1 it = np.nditer([p, None], ['delay_bufalloc', 'reduce_ok', 'buffered', 'external_loop'], [['readonly'], ['readwrite', 'allocate']], op_axes=[[-1, 0], [-1, -1]], itershape=(2, 2)) it.operands[1].fill(0) it.reset() assert_equal(it[0], [1, 2, 1, 2]) # Iterator inner loop should take argument contiguity into account x = np.ones((7, 13, 8), np.int8)[4:6,1:11:6,1:5].transpose(1, 2, 0) x[...] = np.arange(x.size).reshape(x.shape) y_base = np.arange(4*4, dtype=np.int8).reshape(4, 4) y_base_copy = y_base.copy() y = y_base[::2,:,None] it = np.nditer([y, x], ['buffered', 'external_loop', 'reduce_ok'], [['readwrite'], ['readonly']]) for a, b in it: a.fill(2) assert_equal(y_base[1::2], y_base_copy[1::2]) assert_equal(y_base[::2], 2) def test_iter_buffering_reduction_reuse_reduce_loops(): # There was a bug triggering reuse of the reduce loop inappropriately, # which caused processing to happen in unnecessarily small chunks # and overran the buffer. a = np.zeros((2, 7)) b = np.zeros((1, 7)) it = np.nditer([a, b], flags=['reduce_ok', 'external_loop', 'buffered'], op_flags=[['readonly'], ['readwrite']], buffersize=5) bufsizes = [] for x, y in it: bufsizes.append(x.shape[0]) assert_equal(bufsizes, [5, 2, 5, 2]) assert_equal(sum(bufsizes), a.size) def test_iter_writemasked_badinput(): a = np.zeros((2, 3)) b = np.zeros((3,)) m = np.array([[True, True, False], [False, True, False]]) m2 = np.array([True, True, False]) m3 = np.array([0, 1, 1], dtype='u1') mbad1 = np.array([0, 1, 1], dtype='i1') mbad2 = np.array([0, 1, 1], dtype='f4') # Need an 'arraymask' if any operand is 'writemasked' assert_raises(ValueError, nditer, [a, m], [], [['readwrite', 'writemasked'], ['readonly']]) # A 'writemasked' operand must not be readonly assert_raises(ValueError, nditer, [a, m], [], [['readonly', 'writemasked'], ['readonly', 'arraymask']]) # 'writemasked' and 'arraymask' may not be used together assert_raises(ValueError, nditer, [a, m], [], [['readonly'], ['readwrite', 'arraymask', 'writemasked']]) # 'arraymask' may only be specified once assert_raises(ValueError, nditer, [a, m, m2], [], [['readwrite', 'writemasked'], ['readonly', 'arraymask'], ['readonly', 'arraymask']]) # An 'arraymask' with nothing 'writemasked' also doesn't make sense assert_raises(ValueError, nditer, [a, m], [], [['readwrite'], ['readonly', 'arraymask']]) # A writemasked reduction requires a similarly smaller mask assert_raises(ValueError, nditer, [a, b, m], ['reduce_ok'], [['readonly'], ['readwrite', 'writemasked'], ['readonly', 'arraymask']]) # But this should work with a smaller/equal mask to the reduction operand np.nditer([a, b, m2], ['reduce_ok'], [['readonly'], ['readwrite', 'writemasked'], ['readonly', 'arraymask']]) # The arraymask itself cannot be a reduction assert_raises(ValueError, nditer, [a, b, m2], ['reduce_ok'], [['readonly'], ['readwrite', 'writemasked'], ['readwrite', 'arraymask']]) # A uint8 mask is ok too np.nditer([a, m3], ['buffered'], [['readwrite', 'writemasked'], ['readonly', 'arraymask']], op_dtypes=['f4', None], casting='same_kind') # An int8 mask isn't ok assert_raises(TypeError, np.nditer, [a, mbad1], ['buffered'], [['readwrite', 'writemasked'], ['readonly', 'arraymask']], op_dtypes=['f4', None], casting='same_kind') # A float32 mask isn't ok assert_raises(TypeError, np.nditer, [a, mbad2], ['buffered'], [['readwrite', 'writemasked'], ['readonly', 'arraymask']], op_dtypes=['f4', None], casting='same_kind') def test_iter_writemasked(): a = np.zeros((3,), dtype='f8') msk = np.array([True, True, False]) # When buffering is unused, 'writemasked' effectively does nothing. # It's up to the user of the iterator to obey the requested semantics. it = np.nditer([a, msk], [], [['readwrite', 'writemasked'], ['readonly', 'arraymask']]) for x, m in it: x[...] = 1 # Because we violated the semantics, all the values became 1 assert_equal(a, [1, 1, 1]) # Even if buffering is enabled, we still may be accessing the array # directly. it = np.nditer([a, msk], ['buffered'], [['readwrite', 'writemasked'], ['readonly', 'arraymask']]) for x, m in it: x[...] = 2.5 # Because we violated the semantics, all the values became 2.5 assert_equal(a, [2.5, 2.5, 2.5]) # If buffering will definitely happening, for instance because of # a cast, only the items selected by the mask will be copied back from # the buffer. it = np.nditer([a, msk], ['buffered'], [['readwrite', 'writemasked'], ['readonly', 'arraymask']], op_dtypes=['i8', None], casting='unsafe') for x, m in it: x[...] = 3 # Even though we violated the semantics, only the selected values # were copied back assert_equal(a, [3, 3, 2.5]) def test_iter_non_writable_attribute_deletion(): it = np.nditer(np.ones(2)) attr = ["value", "shape", "operands", "itviews", "has_delayed_bufalloc", "iterationneedsapi", "has_multi_index", "has_index", "dtypes", "ndim", "nop", "itersize", "finished"] for s in attr: assert_raises(AttributeError, delattr, it, s) def test_iter_writable_attribute_deletion(): it = np.nditer(np.ones(2)) attr = [ "multi_index", "index", "iterrange", "iterindex"] for s in attr: assert_raises(AttributeError, delattr, it, s) def test_iter_element_deletion(): it = np.nditer(np.ones(3)) try: del it[1] del it[1:2] except TypeError: pass except Exception: raise AssertionError def test_iter_allocated_array_dtypes(): # If the dtype of an allocated output has a shape, the shape gets # tacked onto the end of the result. it = np.nditer(([1, 3, 20], None), op_dtypes=[None, ('i4', (2,))]) for a, b in it: b[0] = a - 1 b[1] = a + 1 assert_equal(it.operands[1], [[0, 2], [2, 4], [19, 21]]) # Make sure this works for scalars too it = np.nditer((10, 2, None), op_dtypes=[None, None, ('i4', (2, 2))]) for a, b, c in it: c[0, 0] = a - b c[0, 1] = a + b c[1, 0] = a * b c[1, 1] = a / b assert_equal(it.operands[2], [[8, 12], [20, 5]]) def test_0d_iter(): # Basic test for iteration of 0-d arrays: i = nditer([2, 3], ['multi_index'], [['readonly']]*2) assert_equal(i.ndim, 0) assert_equal(next(i), (2, 3)) assert_equal(i.multi_index, ()) assert_equal(i.iterindex, 0) assert_raises(StopIteration, next, i) # test reset: i.reset() assert_equal(next(i), (2, 3)) assert_raises(StopIteration, next, i) # test forcing to 0-d i = nditer(np.arange(5), ['multi_index'], [['readonly']], op_axes=[()]) assert_equal(i.ndim, 0) assert_equal(len(i), 1) # note that itershape=(), still behaves like None due to the conversions # Test a more complex buffered casting case (same as another test above) sdt = [('a', 'f4'), ('b', 'i8'), ('c', 'c8', (2, 3)), ('d', 'O')] a = np.array(0.5, dtype='f4') i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], casting='unsafe', op_dtypes=sdt) vals = next(i) assert_equal(vals['a'], 0.5) assert_equal(vals['b'], 0) assert_equal(vals['c'], [[(0.5)]*3]*2) assert_equal(vals['d'], 0.5) def test_iter_too_large(): # The total size of the iterator must not exceed the maximum intp due # to broadcasting. Dividing by 1024 will keep it small enough to # give a legal array. size = np.iinfo(np.intp).max // 1024 arr = np.lib.stride_tricks.as_strided(np.zeros(1), (size,), (0,)) assert_raises(ValueError, nditer, (arr, arr[:, None])) # test the same for multiindex. That may get more interesting when # removing 0 dimensional axis is allowed (since an iterator can grow then) assert_raises(ValueError, nditer, (arr, arr[:, None]), flags=['multi_index']) def test_iter_too_large_with_multiindex(): # When a multi index is being tracked, the error is delayed this # checks the delayed error messages and getting below that by # removing an axis. base_size = 2**10 num = 1 while base_size**num < np.iinfo(np.intp).max: num += 1 shape_template = [1, 1] * num arrays = [] for i in range(num): shape = shape_template[:] shape[i * 2] = 2**10 arrays.append(np.empty(shape)) arrays = tuple(arrays) # arrays are now too large to be broadcast. The different modes test # different nditer functionality with or without GIL. for mode in range(6): assert_raises(ValueError, test_nditer_too_large, arrays, -1, mode) # but if we do nothing with the nditer, it can be constructed: test_nditer_too_large(arrays, -1, 7) # When an axis is removed, things should work again (half the time): for i in range(num): for mode in range(6): # an axis with size 1024 is removed: test_nditer_too_large(arrays, i*2, mode) # an axis with size 1 is removed: assert_raises(ValueError, test_nditer_too_large, arrays, i*2 + 1, mode) if __name__ == "__main__": run_module_suite()
106,132
38.076951
95
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_regression.py
from __future__ import division, absolute_import, print_function import copy import pickle import sys import platform import gc import warnings import tempfile from os import path from io import BytesIO from itertools import chain import numpy as np from numpy.testing import ( run_module_suite, assert_, assert_equal, IS_PYPY, assert_almost_equal, assert_array_equal, assert_array_almost_equal, assert_raises, assert_warns, dec, suppress_warnings, _assert_valid_refcount, HAS_REFCOUNT, ) from numpy.compat import asbytes, asunicode, long try: RecursionError except NameError: RecursionError = RuntimeError # python < 3.5 class TestRegression(object): def test_invalid_round(self): # Ticket #3 v = 4.7599999999999998 assert_array_equal(np.array([v]), np.array(v)) def test_mem_empty(self): # Ticket #7 np.empty((1,), dtype=[('x', np.int64)]) def test_pickle_transposed(self): # Ticket #16 a = np.transpose(np.array([[2, 9], [7, 0], [3, 8]])) f = BytesIO() pickle.dump(a, f) f.seek(0) b = pickle.load(f) f.close() assert_array_equal(a, b) def test_typeNA(self): # Ticket #31 assert_equal(np.typeNA[np.int64], 'Int64') assert_equal(np.typeNA[np.uint64], 'UInt64') def test_dtype_names(self): # Ticket #35 # Should succeed np.dtype([(('name', 'label'), np.int32, 3)]) def test_reduce(self): # Ticket #40 assert_almost_equal(np.add.reduce([1., .5], dtype=None), 1.5) def test_zeros_order(self): # Ticket #43 np.zeros([3], int, 'C') np.zeros([3], order='C') np.zeros([3], int, order='C') def test_asarray_with_order(self): # Check that nothing is done when order='F' and array C/F-contiguous a = np.ones(2) assert_(a is np.asarray(a, order='F')) def test_ravel_with_order(self): # Check that ravel works when order='F' and array C/F-contiguous a = np.ones(2) assert_(not a.ravel('F').flags.owndata) def test_sort_bigendian(self): # Ticket #47 a = np.linspace(0, 10, 11) c = a.astype(np.dtype('<f8')) c.sort() assert_array_almost_equal(c, a) def test_negative_nd_indexing(self): # Ticket #49 c = np.arange(125).reshape((5, 5, 5)) origidx = np.array([-1, 0, 1]) idx = np.array(origidx) c[idx] assert_array_equal(idx, origidx) def test_char_dump(self): # Ticket #50 f = BytesIO() ca = np.char.array(np.arange(1000, 1010), itemsize=4) ca.dump(f) f.seek(0) ca = np.load(f) f.close() def test_noncontiguous_fill(self): # Ticket #58. a = np.zeros((5, 3)) b = a[:, :2,] def rs(): b.shape = (10,) assert_raises(AttributeError, rs) def test_bool(self): # Ticket #60 np.bool_(1) # Should succeed def test_indexing1(self): # Ticket #64 descr = [('x', [('y', [('z', 'c16', (2,)),]),]),] buffer = ((([6j, 4j],),),) h = np.array(buffer, dtype=descr) h['x']['y']['z'] def test_indexing2(self): # Ticket #65 descr = [('x', 'i4', (2,))] buffer = ([3, 2],) h = np.array(buffer, dtype=descr) h['x'] def test_round(self): # Ticket #67 x = np.array([1+2j]) assert_almost_equal(x**(-1), [1/(1+2j)]) def test_scalar_compare(self): # Trac Ticket #72 # https://github.com/numpy/numpy/issues/565 a = np.array(['test', 'auto']) assert_array_equal(a == 'auto', np.array([False, True])) assert_(a[1] == 'auto') assert_(a[0] != 'auto') b = np.linspace(0, 10, 11) # This should return true for now, but will eventually raise an error: with suppress_warnings() as sup: sup.filter(FutureWarning) assert_(b != 'auto') assert_(b[0] != 'auto') def test_unicode_swapping(self): # Ticket #79 ulen = 1 ucs_value = u'\U0010FFFF' ua = np.array([[[ucs_value*ulen]*2]*3]*4, dtype='U%s' % ulen) ua.newbyteorder() # Should succeed. def test_object_array_fill(self): # Ticket #86 x = np.zeros(1, 'O') x.fill([]) def test_mem_dtype_align(self): # Ticket #93 assert_raises(TypeError, np.dtype, {'names':['a'], 'formats':['foo']}, align=1) def test_endian_bool_indexing(self): # Ticket #105 a = np.arange(10., dtype='>f8') b = np.arange(10., dtype='<f8') xa = np.where((a > 2) & (a < 6)) xb = np.where((b > 2) & (b < 6)) ya = ((a > 2) & (a < 6)) yb = ((b > 2) & (b < 6)) assert_array_almost_equal(xa, ya.nonzero()) assert_array_almost_equal(xb, yb.nonzero()) assert_(np.all(a[ya] > 0.5)) assert_(np.all(b[yb] > 0.5)) def test_endian_where(self): # GitHub issue #369 net = np.zeros(3, dtype='>f4') net[1] = 0.00458849 net[2] = 0.605202 max_net = net.max() test = np.where(net <= 0., max_net, net) correct = np.array([ 0.60520202, 0.00458849, 0.60520202]) assert_array_almost_equal(test, correct) def test_endian_recarray(self): # Ticket #2185 dt = np.dtype([ ('head', '>u4'), ('data', '>u4', 2), ]) buf = np.recarray(1, dtype=dt) buf[0]['head'] = 1 buf[0]['data'][:] = [1, 1] h = buf[0]['head'] d = buf[0]['data'][0] buf[0]['head'] = h buf[0]['data'][0] = d assert_(buf[0]['head'] == 1) def test_mem_dot(self): # Ticket #106 x = np.random.randn(0, 1) y = np.random.randn(10, 1) # Dummy array to detect bad memory access: _z = np.ones(10) _dummy = np.empty((0, 10)) z = np.lib.stride_tricks.as_strided(_z, _dummy.shape, _dummy.strides) np.dot(x, np.transpose(y), out=z) assert_equal(_z, np.ones(10)) # Do the same for the built-in dot: np.core.multiarray.dot(x, np.transpose(y), out=z) assert_equal(_z, np.ones(10)) def test_arange_endian(self): # Ticket #111 ref = np.arange(10) x = np.arange(10, dtype='<f8') assert_array_equal(ref, x) x = np.arange(10, dtype='>f8') assert_array_equal(ref, x) def test_argmax(self): # Ticket #119 a = np.random.normal(0, 1, (4, 5, 6, 7, 8)) for i in range(a.ndim): a.argmax(i) # Should succeed def test_mem_divmod(self): # Ticket #126 for i in range(10): divmod(np.array([i])[0], 10) def test_hstack_invalid_dims(self): # Ticket #128 x = np.arange(9).reshape((3, 3)) y = np.array([0, 0, 0]) assert_raises(ValueError, np.hstack, (x, y)) def test_squeeze_type(self): # Ticket #133 a = np.array([3]) b = np.array(3) assert_(type(a.squeeze()) is np.ndarray) assert_(type(b.squeeze()) is np.ndarray) def test_add_identity(self): # Ticket #143 assert_equal(0, np.add.identity) def test_numpy_float_python_long_addition(self): # Check that numpy float and python longs can be added correctly. a = np.float_(23.) + 2**135 assert_equal(a, 23. + 2**135) def test_binary_repr_0(self): # Ticket #151 assert_equal('0', np.binary_repr(0)) def test_rec_iterate(self): # Ticket #160 descr = np.dtype([('i', int), ('f', float), ('s', '|S3')]) x = np.rec.array([(1, 1.1, '1.0'), (2, 2.2, '2.0')], dtype=descr) x[0].tolist() [i for i in x[0]] def test_unicode_string_comparison(self): # Ticket #190 a = np.array('hello', np.unicode_) b = np.array('world') a == b def test_tobytes_FORTRANORDER_discontiguous(self): # Fix in r2836 # Create non-contiguous Fortran ordered array x = np.array(np.random.rand(3, 3), order='F')[:, :2] assert_array_almost_equal(x.ravel(), np.frombuffer(x.tobytes())) def test_flat_assignment(self): # Correct behaviour of ticket #194 x = np.empty((3, 1)) x.flat = np.arange(3) assert_array_almost_equal(x, [[0], [1], [2]]) x.flat = np.arange(3, dtype=float) assert_array_almost_equal(x, [[0], [1], [2]]) def test_broadcast_flat_assignment(self): # Ticket #194 x = np.empty((3, 1)) def bfa(): x[:] = np.arange(3) def bfb(): x[:] = np.arange(3, dtype=float) assert_raises(ValueError, bfa) assert_raises(ValueError, bfb) def test_nonarray_assignment(self): # See also Issue gh-2870, test for non-array assignment # and equivalent unsafe casted array assignment a = np.arange(10) b = np.ones(10, dtype=bool) r = np.arange(10) def assign(a, b, c): a[b] = c assert_raises(ValueError, assign, a, b, np.nan) a[b] = np.array(np.nan) # but not this. assert_raises(ValueError, assign, a, r, np.nan) a[r] = np.array(np.nan) def test_unpickle_dtype_with_object(self): # Implemented in r2840 dt = np.dtype([('x', int), ('y', np.object_), ('z', 'O')]) f = BytesIO() pickle.dump(dt, f) f.seek(0) dt_ = pickle.load(f) f.close() assert_equal(dt, dt_) def test_mem_array_creation_invalid_specification(self): # Ticket #196 dt = np.dtype([('x', int), ('y', np.object_)]) # Wrong way assert_raises(ValueError, np.array, [1, 'object'], dt) # Correct way np.array([(1, 'object')], dt) def test_recarray_single_element(self): # Ticket #202 a = np.array([1, 2, 3], dtype=np.int32) b = a.copy() r = np.rec.array(a, shape=1, formats=['3i4'], names=['d']) assert_array_equal(a, b) assert_equal(a, r[0][0]) def test_zero_sized_array_indexing(self): # Ticket #205 tmp = np.array([]) def index_tmp(): tmp[np.array(10)] assert_raises(IndexError, index_tmp) def test_chararray_rstrip(self): # Ticket #222 x = np.chararray((1,), 5) x[0] = b'a ' x = x.rstrip() assert_equal(x[0], b'a') def test_object_array_shape(self): # Ticket #239 assert_equal(np.array([[1, 2], 3, 4], dtype=object).shape, (3,)) assert_equal(np.array([[1, 2], [3, 4]], dtype=object).shape, (2, 2)) assert_equal(np.array([(1, 2), (3, 4)], dtype=object).shape, (2, 2)) assert_equal(np.array([], dtype=object).shape, (0,)) assert_equal(np.array([[], [], []], dtype=object).shape, (3, 0)) assert_equal(np.array([[3, 4], [5, 6], None], dtype=object).shape, (3,)) def test_mem_around(self): # Ticket #243 x = np.zeros((1,)) y = [0] decimal = 6 np.around(abs(x-y), decimal) <= 10.0**(-decimal) def test_character_array_strip(self): # Ticket #246 x = np.char.array(("x", "x ", "x ")) for c in x: assert_equal(c, "x") def test_lexsort(self): # Lexsort memory error v = np.array([1, 2, 3, 4, 5, 6, 7, 8, 9, 10]) assert_equal(np.lexsort(v), 0) def test_lexsort_invalid_sequence(self): # Issue gh-4123 class BuggySequence(object): def __len__(self): return 4 def __getitem__(self, key): raise KeyError assert_raises(KeyError, np.lexsort, BuggySequence()) def test_pickle_py2_bytes_encoding(self): # Check that arrays and scalars pickled on Py2 are # unpickleable on Py3 using encoding='bytes' test_data = [ # (original, py2_pickle) (np.unicode_('\u6f2c'), b"cnumpy.core.multiarray\nscalar\np0\n(cnumpy\ndtype\np1\n" b"(S'U1'\np2\nI0\nI1\ntp3\nRp4\n(I3\nS'<'\np5\nNNNI4\nI4\n" b"I0\ntp6\nbS',o\\x00\\x00'\np7\ntp8\nRp9\n."), (np.array([9e123], dtype=np.float64), b"cnumpy.core.multiarray\n_reconstruct\np0\n(cnumpy\nndarray\n" b"p1\n(I0\ntp2\nS'b'\np3\ntp4\nRp5\n(I1\n(I1\ntp6\ncnumpy\ndtype\n" b"p7\n(S'f8'\np8\nI0\nI1\ntp9\nRp10\n(I3\nS'<'\np11\nNNNI-1\nI-1\n" b"I0\ntp12\nbI00\nS'O\\x81\\xb7Z\\xaa:\\xabY'\np13\ntp14\nb."), (np.array([(9e123,)], dtype=[('name', float)]), b"cnumpy.core.multiarray\n_reconstruct\np0\n(cnumpy\nndarray\np1\n" b"(I0\ntp2\nS'b'\np3\ntp4\nRp5\n(I1\n(I1\ntp6\ncnumpy\ndtype\np7\n" b"(S'V8'\np8\nI0\nI1\ntp9\nRp10\n(I3\nS'|'\np11\nN(S'name'\np12\ntp13\n" b"(dp14\ng12\n(g7\n(S'f8'\np15\nI0\nI1\ntp16\nRp17\n(I3\nS'<'\np18\nNNNI-1\n" b"I-1\nI0\ntp19\nbI0\ntp20\nsI8\nI1\nI0\ntp21\n" b"bI00\nS'O\\x81\\xb7Z\\xaa:\\xabY'\np22\ntp23\nb."), ] if sys.version_info[:2] >= (3, 4): # encoding='bytes' was added in Py3.4 for original, data in test_data: result = pickle.loads(data, encoding='bytes') assert_equal(result, original) if isinstance(result, np.ndarray) and result.dtype.names: for name in result.dtype.names: assert_(isinstance(name, str)) def test_pickle_dtype(self): # Ticket #251 pickle.dumps(float) def test_swap_real(self): # Ticket #265 assert_equal(np.arange(4, dtype='>c8').imag.max(), 0.0) assert_equal(np.arange(4, dtype='<c8').imag.max(), 0.0) assert_equal(np.arange(4, dtype='>c8').real.max(), 3.0) assert_equal(np.arange(4, dtype='<c8').real.max(), 3.0) def test_object_array_from_list(self): # Ticket #270 assert_(np.array([1, 'A', None]).shape == (3,)) def test_multiple_assign(self): # Ticket #273 a = np.zeros((3, 1), int) a[[1, 2]] = 1 def test_empty_array_type(self): assert_equal(np.array([]).dtype, np.zeros(0).dtype) def test_void_copyswap(self): dt = np.dtype([('one', '<i4'), ('two', '<i4')]) x = np.array((1, 2), dtype=dt) x = x.byteswap() assert_(x['one'] > 1 and x['two'] > 2) def test_method_args(self): # Make sure methods and functions have same default axis # keyword and arguments funcs1 = ['argmax', 'argmin', 'sum', ('product', 'prod'), ('sometrue', 'any'), ('alltrue', 'all'), 'cumsum', ('cumproduct', 'cumprod'), 'ptp', 'cumprod', 'prod', 'std', 'var', 'mean', 'round', 'min', 'max', 'argsort', 'sort'] funcs2 = ['compress', 'take', 'repeat'] for func in funcs1: arr = np.random.rand(8, 7) arr2 = arr.copy() if isinstance(func, tuple): func_meth = func[1] func = func[0] else: func_meth = func res1 = getattr(arr, func_meth)() res2 = getattr(np, func)(arr2) if res1 is None: res1 = arr if res1.dtype.kind in 'uib': assert_((res1 == res2).all(), func) else: assert_(abs(res1-res2).max() < 1e-8, func) for func in funcs2: arr1 = np.random.rand(8, 7) arr2 = np.random.rand(8, 7) res1 = None if func == 'compress': arr1 = arr1.ravel() res1 = getattr(arr2, func)(arr1) else: arr2 = (15*arr2).astype(int).ravel() if res1 is None: res1 = getattr(arr1, func)(arr2) res2 = getattr(np, func)(arr1, arr2) assert_(abs(res1-res2).max() < 1e-8, func) def test_mem_lexsort_strings(self): # Ticket #298 lst = ['abc', 'cde', 'fgh'] np.lexsort((lst,)) def test_fancy_index(self): # Ticket #302 x = np.array([1, 2])[np.array([0])] assert_equal(x.shape, (1,)) def test_recarray_copy(self): # Ticket #312 dt = [('x', np.int16), ('y', np.float64)] ra = np.array([(1, 2.3)], dtype=dt) rb = np.rec.array(ra, dtype=dt) rb['x'] = 2. assert_(ra['x'] != rb['x']) def test_rec_fromarray(self): # Ticket #322 x1 = np.array([[1, 2], [3, 4], [5, 6]]) x2 = np.array(['a', 'dd', 'xyz']) x3 = np.array([1.1, 2, 3]) np.rec.fromarrays([x1, x2, x3], formats="(2,)i4,a3,f8") def test_object_array_assign(self): x = np.empty((2, 2), object) x.flat[2] = (1, 2, 3) assert_equal(x.flat[2], (1, 2, 3)) def test_ndmin_float64(self): # Ticket #324 x = np.array([1, 2, 3], dtype=np.float64) assert_equal(np.array(x, dtype=np.float32, ndmin=2).ndim, 2) assert_equal(np.array(x, dtype=np.float64, ndmin=2).ndim, 2) def test_ndmin_order(self): # Issue #465 and related checks assert_(np.array([1, 2], order='C', ndmin=3).flags.c_contiguous) assert_(np.array([1, 2], order='F', ndmin=3).flags.f_contiguous) assert_(np.array(np.ones((2, 2), order='F'), ndmin=3).flags.f_contiguous) assert_(np.array(np.ones((2, 2), order='C'), ndmin=3).flags.c_contiguous) def test_mem_axis_minimization(self): # Ticket #327 data = np.arange(5) data = np.add.outer(data, data) def test_mem_float_imag(self): # Ticket #330 np.float64(1.0).imag def test_dtype_tuple(self): # Ticket #334 assert_(np.dtype('i4') == np.dtype(('i4', ()))) def test_dtype_posttuple(self): # Ticket #335 np.dtype([('col1', '()i4')]) def test_numeric_carray_compare(self): # Ticket #341 assert_equal(np.array(['X'], 'c'), b'X') def test_string_array_size(self): # Ticket #342 assert_raises(ValueError, np.array, [['X'], ['X', 'X', 'X']], '|S1') def test_dtype_repr(self): # Ticket #344 dt1 = np.dtype(('uint32', 2)) dt2 = np.dtype(('uint32', (2,))) assert_equal(dt1.__repr__(), dt2.__repr__()) def test_reshape_order(self): # Make sure reshape order works. a = np.arange(6).reshape(2, 3, order='F') assert_equal(a, [[0, 2, 4], [1, 3, 5]]) a = np.array([[1, 2], [3, 4], [5, 6], [7, 8]]) b = a[:, 1] assert_equal(b.reshape(2, 2, order='F'), [[2, 6], [4, 8]]) def test_reshape_zero_strides(self): # Issue #380, test reshaping of zero strided arrays a = np.ones(1) a = np.lib.stride_tricks.as_strided(a, shape=(5,), strides=(0,)) assert_(a.reshape(5, 1).strides[0] == 0) def test_reshape_zero_size(self): # GitHub Issue #2700, setting shape failed for 0-sized arrays a = np.ones((0, 2)) a.shape = (-1, 2) # Cannot test if NPY_RELAXED_STRIDES_CHECKING changes the strides. # With NPY_RELAXED_STRIDES_CHECKING the test becomes superfluous. @dec.skipif(np.ones(1).strides[0] == np.iinfo(np.intp).max) def test_reshape_trailing_ones_strides(self): # GitHub issue gh-2949, bad strides for trailing ones of new shape a = np.zeros(12, dtype=np.int32)[::2] # not contiguous strides_c = (16, 8, 8, 8) strides_f = (8, 24, 48, 48) assert_equal(a.reshape(3, 2, 1, 1).strides, strides_c) assert_equal(a.reshape(3, 2, 1, 1, order='F').strides, strides_f) assert_equal(np.array(0, dtype=np.int32).reshape(1, 1).strides, (4, 4)) def test_repeat_discont(self): # Ticket #352 a = np.arange(12).reshape(4, 3)[:, 2] assert_equal(a.repeat(3), [2, 2, 2, 5, 5, 5, 8, 8, 8, 11, 11, 11]) def test_array_index(self): # Make sure optimization is not called in this case. a = np.array([1, 2, 3]) a2 = np.array([[1, 2, 3]]) assert_equal(a[np.where(a == 3)], a2[np.where(a2 == 3)]) def test_object_argmax(self): a = np.array([1, 2, 3], dtype=object) assert_(a.argmax() == 2) def test_recarray_fields(self): # Ticket #372 dt0 = np.dtype([('f0', 'i4'), ('f1', 'i4')]) dt1 = np.dtype([('f0', 'i8'), ('f1', 'i8')]) for a in [np.array([(1, 2), (3, 4)], "i4,i4"), np.rec.array([(1, 2), (3, 4)], "i4,i4"), np.rec.array([(1, 2), (3, 4)]), np.rec.fromarrays([(1, 2), (3, 4)], "i4,i4"), np.rec.fromarrays([(1, 2), (3, 4)])]: assert_(a.dtype in [dt0, dt1]) def test_random_shuffle(self): # Ticket #374 a = np.arange(5).reshape((5, 1)) b = a.copy() np.random.shuffle(b) assert_equal(np.sort(b, axis=0), a) def test_refcount_vdot(self): # Changeset #3443 _assert_valid_refcount(np.vdot) def test_startswith(self): ca = np.char.array(['Hi', 'There']) assert_equal(ca.startswith('H'), [True, False]) def test_noncommutative_reduce_accumulate(self): # Ticket #413 tosubtract = np.arange(5) todivide = np.array([2.0, 0.5, 0.25]) assert_equal(np.subtract.reduce(tosubtract), -10) assert_equal(np.divide.reduce(todivide), 16.0) assert_array_equal(np.subtract.accumulate(tosubtract), np.array([0, -1, -3, -6, -10])) assert_array_equal(np.divide.accumulate(todivide), np.array([2., 4., 16.])) def test_convolve_empty(self): # Convolve should raise an error for empty input array. assert_raises(ValueError, np.convolve, [], [1]) assert_raises(ValueError, np.convolve, [1], []) def test_multidim_byteswap(self): # Ticket #449 r = np.array([(1, (0, 1, 2))], dtype="i2,3i2") assert_array_equal(r.byteswap(), np.array([(256, (0, 256, 512))], r.dtype)) def test_string_NULL(self): # Changeset 3557 assert_equal(np.array("a\x00\x0b\x0c\x00").item(), 'a\x00\x0b\x0c') def test_junk_in_string_fields_of_recarray(self): # Ticket #483 r = np.array([[b'abc']], dtype=[('var1', '|S20')]) assert_(asbytes(r['var1'][0][0]) == b'abc') def test_take_output(self): # Ensure that 'take' honours output parameter. x = np.arange(12).reshape((3, 4)) a = np.take(x, [0, 2], axis=1) b = np.zeros_like(a) np.take(x, [0, 2], axis=1, out=b) assert_array_equal(a, b) def test_take_object_fail(self): # Issue gh-3001 d = 123. a = np.array([d, 1], dtype=object) if HAS_REFCOUNT: ref_d = sys.getrefcount(d) try: a.take([0, 100]) except IndexError: pass if HAS_REFCOUNT: assert_(ref_d == sys.getrefcount(d)) def test_array_str_64bit(self): # Ticket #501 s = np.array([1, np.nan], dtype=np.float64) with np.errstate(all='raise'): np.array_str(s) # Should succeed def test_frompyfunc_endian(self): # Ticket #503 from math import radians uradians = np.frompyfunc(radians, 1, 1) big_endian = np.array([83.4, 83.5], dtype='>f8') little_endian = np.array([83.4, 83.5], dtype='<f8') assert_almost_equal(uradians(big_endian).astype(float), uradians(little_endian).astype(float)) def test_mem_string_arr(self): # Ticket #514 s = "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa" t = [] np.hstack((t, s)) def test_arr_transpose(self): # Ticket #516 x = np.random.rand(*(2,)*16) x.transpose(list(range(16))) # Should succeed def test_string_mergesort(self): # Ticket #540 x = np.array(['a']*32) assert_array_equal(x.argsort(kind='m'), np.arange(32)) def test_argmax_byteorder(self): # Ticket #546 a = np.arange(3, dtype='>f') assert_(a[a.argmax()] == a.max()) def test_rand_seed(self): # Ticket #555 for l in np.arange(4): np.random.seed(l) def test_mem_deallocation_leak(self): # Ticket #562 a = np.zeros(5, dtype=float) b = np.array(a, dtype=float) del a, b def test_mem_on_invalid_dtype(self): "Ticket #583" assert_raises(ValueError, np.fromiter, [['12', ''], ['13', '']], str) def test_dot_negative_stride(self): # Ticket #588 x = np.array([[1, 5, 25, 125., 625]]) y = np.array([[20.], [160.], [640.], [1280.], [1024.]]) z = y[::-1].copy() y2 = y[::-1] assert_equal(np.dot(x, z), np.dot(x, y2)) def test_object_casting(self): # This used to trigger the object-type version of # the bitwise_or operation, because float64 -> object # casting succeeds def rs(): x = np.ones([484, 286]) y = np.zeros([484, 286]) x |= y assert_raises(TypeError, rs) def test_unicode_scalar(self): # Ticket #600 x = np.array(["DROND", "DROND1"], dtype="U6") el = x[1] new = pickle.loads(pickle.dumps(el)) assert_equal(new, el) def test_arange_non_native_dtype(self): # Ticket #616 for T in ('>f4', '<f4'): dt = np.dtype(T) assert_equal(np.arange(0, dtype=dt).dtype, dt) assert_equal(np.arange(0.5, dtype=dt).dtype, dt) assert_equal(np.arange(5, dtype=dt).dtype, dt) def test_bool_flat_indexing_invalid_nr_elements(self): s = np.ones(10, dtype=float) x = np.array((15,), dtype=float) def ia(x, s, v): x[(s > 0)] = v assert_raises(IndexError, ia, x, s, np.zeros(9, dtype=float)) assert_raises(IndexError, ia, x, s, np.zeros(11, dtype=float)) # Old special case (different code path): assert_raises(ValueError, ia, x.flat, s, np.zeros(9, dtype=float)) assert_raises(ValueError, ia, x.flat, s, np.zeros(11, dtype=float)) def test_mem_scalar_indexing(self): # Ticket #603 x = np.array([0], dtype=float) index = np.array(0, dtype=np.int32) x[index] def test_binary_repr_0_width(self): assert_equal(np.binary_repr(0, width=3), '000') def test_fromstring(self): assert_equal(np.fromstring("12:09:09", dtype=int, sep=":"), [12, 9, 9]) def test_searchsorted_variable_length(self): x = np.array(['a', 'aa', 'b']) y = np.array(['d', 'e']) assert_equal(x.searchsorted(y), [3, 3]) def test_string_argsort_with_zeros(self): # Check argsort for strings containing zeros. x = np.frombuffer(b"\x00\x02\x00\x01", dtype="|S2") assert_array_equal(x.argsort(kind='m'), np.array([1, 0])) assert_array_equal(x.argsort(kind='q'), np.array([1, 0])) def test_string_sort_with_zeros(self): # Check sort for strings containing zeros. x = np.frombuffer(b"\x00\x02\x00\x01", dtype="|S2") y = np.frombuffer(b"\x00\x01\x00\x02", dtype="|S2") assert_array_equal(np.sort(x, kind="q"), y) def test_copy_detection_zero_dim(self): # Ticket #658 np.indices((0, 3, 4)).T.reshape(-1, 3) def test_flat_byteorder(self): # Ticket #657 x = np.arange(10) assert_array_equal(x.astype('>i4'), x.astype('<i4').flat[:]) assert_array_equal(x.astype('>i4').flat[:], x.astype('<i4')) def test_sign_bit(self): x = np.array([0, -0.0, 0]) assert_equal(str(np.abs(x)), '[0. 0. 0.]') def test_flat_index_byteswap(self): for dt in (np.dtype('<i4'), np.dtype('>i4')): x = np.array([-1, 0, 1], dtype=dt) assert_equal(x.flat[0].dtype, x[0].dtype) def test_copy_detection_corner_case(self): # Ticket #658 np.indices((0, 3, 4)).T.reshape(-1, 3) # Cannot test if NPY_RELAXED_STRIDES_CHECKING changes the strides. # With NPY_RELAXED_STRIDES_CHECKING the test becomes superfluous, # 0-sized reshape itself is tested elsewhere. @dec.skipif(np.ones(1).strides[0] == np.iinfo(np.intp).max) def test_copy_detection_corner_case2(self): # Ticket #771: strides are not set correctly when reshaping 0-sized # arrays b = np.indices((0, 3, 4)).T.reshape(-1, 3) assert_equal(b.strides, (3 * b.itemsize, b.itemsize)) def test_object_array_refcounting(self): # Ticket #633 if not hasattr(sys, 'getrefcount'): return # NB. this is probably CPython-specific cnt = sys.getrefcount a = object() b = object() c = object() cnt0_a = cnt(a) cnt0_b = cnt(b) cnt0_c = cnt(c) # -- 0d -> 1-d broadcast slice assignment arr = np.zeros(5, dtype=np.object_) arr[:] = a assert_equal(cnt(a), cnt0_a + 5) arr[:] = b assert_equal(cnt(a), cnt0_a) assert_equal(cnt(b), cnt0_b + 5) arr[:2] = c assert_equal(cnt(b), cnt0_b + 3) assert_equal(cnt(c), cnt0_c + 2) del arr # -- 1-d -> 2-d broadcast slice assignment arr = np.zeros((5, 2), dtype=np.object_) arr0 = np.zeros(2, dtype=np.object_) arr0[0] = a assert_(cnt(a) == cnt0_a + 1) arr0[1] = b assert_(cnt(b) == cnt0_b + 1) arr[:, :] = arr0 assert_(cnt(a) == cnt0_a + 6) assert_(cnt(b) == cnt0_b + 6) arr[:, 0] = None assert_(cnt(a) == cnt0_a + 1) del arr, arr0 # -- 2-d copying + flattening arr = np.zeros((5, 2), dtype=np.object_) arr[:, 0] = a arr[:, 1] = b assert_(cnt(a) == cnt0_a + 5) assert_(cnt(b) == cnt0_b + 5) arr2 = arr.copy() assert_(cnt(a) == cnt0_a + 10) assert_(cnt(b) == cnt0_b + 10) arr2 = arr[:, 0].copy() assert_(cnt(a) == cnt0_a + 10) assert_(cnt(b) == cnt0_b + 5) arr2 = arr.flatten() assert_(cnt(a) == cnt0_a + 10) assert_(cnt(b) == cnt0_b + 10) del arr, arr2 # -- concatenate, repeat, take, choose arr1 = np.zeros((5, 1), dtype=np.object_) arr2 = np.zeros((5, 1), dtype=np.object_) arr1[...] = a arr2[...] = b assert_(cnt(a) == cnt0_a + 5) assert_(cnt(b) == cnt0_b + 5) tmp = np.concatenate((arr1, arr2)) assert_(cnt(a) == cnt0_a + 5 + 5) assert_(cnt(b) == cnt0_b + 5 + 5) tmp = arr1.repeat(3, axis=0) assert_(cnt(a) == cnt0_a + 5 + 3*5) tmp = arr1.take([1, 2, 3], axis=0) assert_(cnt(a) == cnt0_a + 5 + 3) x = np.array([[0], [1], [0], [1], [1]], int) tmp = x.choose(arr1, arr2) assert_(cnt(a) == cnt0_a + 5 + 2) assert_(cnt(b) == cnt0_b + 5 + 3) del tmp # Avoid pyflakes unused variable warning def test_mem_custom_float_to_array(self): # Ticket 702 class MyFloat(object): def __float__(self): return 1.0 tmp = np.atleast_1d([MyFloat()]) tmp.astype(float) # Should succeed def test_object_array_refcount_self_assign(self): # Ticket #711 class VictimObject(object): deleted = False def __del__(self): self.deleted = True d = VictimObject() arr = np.zeros(5, dtype=np.object_) arr[:] = d del d arr[:] = arr # refcount of 'd' might hit zero here assert_(not arr[0].deleted) arr[:] = arr # trying to induce a segfault by doing it again... assert_(not arr[0].deleted) def test_mem_fromiter_invalid_dtype_string(self): x = [1, 2, 3] assert_raises(ValueError, np.fromiter, [xi for xi in x], dtype='S') def test_reduce_big_object_array(self): # Ticket #713 oldsize = np.setbufsize(10*16) a = np.array([None]*161, object) assert_(not np.any(a)) np.setbufsize(oldsize) def test_mem_0d_array_index(self): # Ticket #714 np.zeros(10)[np.array(0)] def test_nonnative_endian_fill(self): # Non-native endian arrays were incorrectly filled with scalars # before r5034. if sys.byteorder == 'little': dtype = np.dtype('>i4') else: dtype = np.dtype('<i4') x = np.empty([1], dtype=dtype) x.fill(1) assert_equal(x, np.array([1], dtype=dtype)) def test_dot_alignment_sse2(self): # Test for ticket #551, changeset r5140 x = np.zeros((30, 40)) y = pickle.loads(pickle.dumps(x)) # y is now typically not aligned on a 8-byte boundary z = np.ones((1, y.shape[0])) # This shouldn't cause a segmentation fault: np.dot(z, y) def test_astype_copy(self): # Ticket #788, changeset r5155 # The test data file was generated by scipy.io.savemat. # The dtype is float64, but the isbuiltin attribute is 0. data_dir = path.join(path.dirname(__file__), 'data') filename = path.join(data_dir, "astype_copy.pkl") if sys.version_info[0] >= 3: f = open(filename, 'rb') xp = pickle.load(f, encoding='latin1') f.close() else: f = open(filename) xp = pickle.load(f) f.close() xpd = xp.astype(np.float64) assert_((xp.__array_interface__['data'][0] != xpd.__array_interface__['data'][0])) def test_compress_small_type(self): # Ticket #789, changeset 5217. # compress with out argument segfaulted if cannot cast safely import numpy as np a = np.array([[1, 2], [3, 4]]) b = np.zeros((2, 1), dtype=np.single) try: a.compress([True, False], axis=1, out=b) raise AssertionError("compress with an out which cannot be " "safely casted should not return " "successfully") except TypeError: pass def test_attributes(self): # Ticket #791 class TestArray(np.ndarray): def __new__(cls, data, info): result = np.array(data) result = result.view(cls) result.info = info return result def __array_finalize__(self, obj): self.info = getattr(obj, 'info', '') dat = TestArray([[1, 2, 3, 4], [5, 6, 7, 8]], 'jubba') assert_(dat.info == 'jubba') dat.resize((4, 2)) assert_(dat.info == 'jubba') dat.sort() assert_(dat.info == 'jubba') dat.fill(2) assert_(dat.info == 'jubba') dat.put([2, 3, 4], [6, 3, 4]) assert_(dat.info == 'jubba') dat.setfield(4, np.int32, 0) assert_(dat.info == 'jubba') dat.setflags() assert_(dat.info == 'jubba') assert_(dat.all(1).info == 'jubba') assert_(dat.any(1).info == 'jubba') assert_(dat.argmax(1).info == 'jubba') assert_(dat.argmin(1).info == 'jubba') assert_(dat.argsort(1).info == 'jubba') assert_(dat.astype(TestArray).info == 'jubba') assert_(dat.byteswap().info == 'jubba') assert_(dat.clip(2, 7).info == 'jubba') assert_(dat.compress([0, 1, 1]).info == 'jubba') assert_(dat.conj().info == 'jubba') assert_(dat.conjugate().info == 'jubba') assert_(dat.copy().info == 'jubba') dat2 = TestArray([2, 3, 1, 0], 'jubba') choices = [[0, 1, 2, 3], [10, 11, 12, 13], [20, 21, 22, 23], [30, 31, 32, 33]] assert_(dat2.choose(choices).info == 'jubba') assert_(dat.cumprod(1).info == 'jubba') assert_(dat.cumsum(1).info == 'jubba') assert_(dat.diagonal().info == 'jubba') assert_(dat.flatten().info == 'jubba') assert_(dat.getfield(np.int32, 0).info == 'jubba') assert_(dat.imag.info == 'jubba') assert_(dat.max(1).info == 'jubba') assert_(dat.mean(1).info == 'jubba') assert_(dat.min(1).info == 'jubba') assert_(dat.newbyteorder().info == 'jubba') assert_(dat.prod(1).info == 'jubba') assert_(dat.ptp(1).info == 'jubba') assert_(dat.ravel().info == 'jubba') assert_(dat.real.info == 'jubba') assert_(dat.repeat(2).info == 'jubba') assert_(dat.reshape((2, 4)).info == 'jubba') assert_(dat.round().info == 'jubba') assert_(dat.squeeze().info == 'jubba') assert_(dat.std(1).info == 'jubba') assert_(dat.sum(1).info == 'jubba') assert_(dat.swapaxes(0, 1).info == 'jubba') assert_(dat.take([2, 3, 5]).info == 'jubba') assert_(dat.transpose().info == 'jubba') assert_(dat.T.info == 'jubba') assert_(dat.var(1).info == 'jubba') assert_(dat.view(TestArray).info == 'jubba') # These methods do not preserve subclasses assert_(type(dat.nonzero()[0]) is np.ndarray) assert_(type(dat.nonzero()[1]) is np.ndarray) def test_recarray_tolist(self): # Ticket #793, changeset r5215 # Comparisons fail for NaN, so we can't use random memory # for the test. buf = np.zeros(40, dtype=np.int8) a = np.recarray(2, formats="i4,f8,f8", names="id,x,y", buf=buf) b = a.tolist() assert_( a[0].tolist() == b[0]) assert_( a[1].tolist() == b[1]) def test_nonscalar_item_method(self): # Make sure that .item() fails graciously when it should a = np.arange(5) assert_raises(ValueError, a.item) def test_char_array_creation(self): a = np.array('123', dtype='c') b = np.array([b'1', b'2', b'3']) assert_equal(a, b) def test_unaligned_unicode_access(self): # Ticket #825 for i in range(1, 9): msg = 'unicode offset: %d chars' % i t = np.dtype([('a', 'S%d' % i), ('b', 'U2')]) x = np.array([(b'a', u'b')], dtype=t) if sys.version_info[0] >= 3: assert_equal(str(x), "[(b'a', 'b')]", err_msg=msg) else: assert_equal(str(x), "[('a', u'b')]", err_msg=msg) def test_sign_for_complex_nan(self): # Ticket 794. with np.errstate(invalid='ignore'): C = np.array([-np.inf, -2+1j, 0, 2-1j, np.inf, np.nan]) have = np.sign(C) want = np.array([-1+0j, -1+0j, 0+0j, 1+0j, 1+0j, np.nan]) assert_equal(have, want) def test_for_equal_names(self): # Ticket #674 dt = np.dtype([('foo', float), ('bar', float)]) a = np.zeros(10, dt) b = list(a.dtype.names) b[0] = "notfoo" a.dtype.names = b assert_(a.dtype.names[0] == "notfoo") assert_(a.dtype.names[1] == "bar") def test_for_object_scalar_creation(self): # Ticket #816 a = np.object_() b = np.object_(3) b2 = np.object_(3.0) c = np.object_([4, 5]) d = np.object_([None, {}, []]) assert_(a is None) assert_(type(b) is int) assert_(type(b2) is float) assert_(type(c) is np.ndarray) assert_(c.dtype == object) assert_(d.dtype == object) def test_array_resize_method_system_error(self): # Ticket #840 - order should be an invalid keyword. x = np.array([[0, 1], [2, 3]]) assert_raises(TypeError, x.resize, (2, 2), order='C') def test_for_zero_length_in_choose(self): "Ticket #882" a = np.array(1) assert_raises(ValueError, lambda x: x.choose([]), a) def test_array_ndmin_overflow(self): "Ticket #947." assert_raises(ValueError, lambda: np.array([1], ndmin=33)) def test_void_scalar_with_titles(self): # No ticket data = [('john', 4), ('mary', 5)] dtype1 = [(('source:yy', 'name'), 'O'), (('source:xx', 'id'), int)] arr = np.array(data, dtype=dtype1) assert_(arr[0][0] == 'john') assert_(arr[0][1] == 4) def test_void_scalar_constructor(self): #Issue #1550 #Create test string data, construct void scalar from data and assert #that void scalar contains original data. test_string = np.array("test") test_string_void_scalar = np.core.multiarray.scalar( np.dtype(("V", test_string.dtype.itemsize)), test_string.tobytes()) assert_(test_string_void_scalar.view(test_string.dtype) == test_string) #Create record scalar, construct from data and assert that #reconstructed scalar is correct. test_record = np.ones((), "i,i") test_record_void_scalar = np.core.multiarray.scalar( test_record.dtype, test_record.tobytes()) assert_(test_record_void_scalar == test_record) #Test pickle and unpickle of void and record scalars assert_(pickle.loads(pickle.dumps(test_string)) == test_string) assert_(pickle.loads(pickle.dumps(test_record)) == test_record) def test_blasdot_uninitialized_memory(self): # Ticket #950 for m in [0, 1, 2]: for n in [0, 1, 2]: for k in range(3): # Try to ensure that x->data contains non-zero floats x = np.array([123456789e199], dtype=np.float64) if IS_PYPY: x.resize((m, 0), refcheck=False) else: x.resize((m, 0)) y = np.array([123456789e199], dtype=np.float64) if IS_PYPY: y.resize((0, n), refcheck=False) else: y.resize((0, n)) # `dot` should just return zero (m, n) matrix z = np.dot(x, y) assert_(np.all(z == 0)) assert_(z.shape == (m, n)) def test_zeros(self): # Regression test for #1061. # Set a size which cannot fit into a 64 bits signed integer sz = 2 ** 64 good = 'Maximum allowed dimension exceeded' try: np.empty(sz) except ValueError as e: if not str(e) == good: self.fail("Got msg '%s', expected '%s'" % (e, good)) except Exception as e: self.fail("Got exception of type %s instead of ValueError" % type(e)) def test_huge_arange(self): # Regression test for #1062. # Set a size which cannot fit into a 64 bits signed integer sz = 2 ** 64 good = 'Maximum allowed size exceeded' try: np.arange(sz) assert_(np.size == sz) except ValueError as e: if not str(e) == good: self.fail("Got msg '%s', expected '%s'" % (e, good)) except Exception as e: self.fail("Got exception of type %s instead of ValueError" % type(e)) def test_fromiter_bytes(self): # Ticket #1058 a = np.fromiter(list(range(10)), dtype='b') b = np.fromiter(list(range(10)), dtype='B') assert_(np.alltrue(a == np.array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]))) assert_(np.alltrue(b == np.array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]))) def test_array_from_sequence_scalar_array(self): # Ticket #1078: segfaults when creating an array with a sequence of # 0d arrays. a = np.array((np.ones(2), np.array(2))) assert_equal(a.shape, (2,)) assert_equal(a.dtype, np.dtype(object)) assert_equal(a[0], np.ones(2)) assert_equal(a[1], np.array(2)) a = np.array(((1,), np.array(1))) assert_equal(a.shape, (2,)) assert_equal(a.dtype, np.dtype(object)) assert_equal(a[0], (1,)) assert_equal(a[1], np.array(1)) def test_array_from_sequence_scalar_array2(self): # Ticket #1081: weird array with strange input... t = np.array([np.array([]), np.array(0, object)]) assert_equal(t.shape, (2,)) assert_equal(t.dtype, np.dtype(object)) def test_array_too_big(self): # Ticket #1080. assert_raises(ValueError, np.zeros, [975]*7, np.int8) assert_raises(ValueError, np.zeros, [26244]*5, np.int8) def test_dtype_keyerrors_(self): # Ticket #1106. dt = np.dtype([('f1', np.uint)]) assert_raises(KeyError, dt.__getitem__, "f2") assert_raises(IndexError, dt.__getitem__, 1) assert_raises(TypeError, dt.__getitem__, 0.0) def test_lexsort_buffer_length(self): # Ticket #1217, don't segfault. a = np.ones(100, dtype=np.int8) b = np.ones(100, dtype=np.int32) i = np.lexsort((a[::-1], b)) assert_equal(i, np.arange(100, dtype=int)) def test_object_array_to_fixed_string(self): # Ticket #1235. a = np.array(['abcdefgh', 'ijklmnop'], dtype=np.object_) b = np.array(a, dtype=(np.str_, 8)) assert_equal(a, b) c = np.array(a, dtype=(np.str_, 5)) assert_equal(c, np.array(['abcde', 'ijklm'])) d = np.array(a, dtype=(np.str_, 12)) assert_equal(a, d) e = np.empty((2, ), dtype=(np.str_, 8)) e[:] = a[:] assert_equal(a, e) def test_unicode_to_string_cast(self): # Ticket #1240. a = np.array([[u'abc', u'\u03a3'], [u'asdf', u'erw']], dtype='U') assert_raises(UnicodeEncodeError, np.array, a, 'S4') def test_mixed_string_unicode_array_creation(self): a = np.array(['1234', u'123']) assert_(a.itemsize == 16) a = np.array([u'123', '1234']) assert_(a.itemsize == 16) a = np.array(['1234', u'123', '12345']) assert_(a.itemsize == 20) a = np.array([u'123', '1234', u'12345']) assert_(a.itemsize == 20) a = np.array([u'123', '1234', u'1234']) assert_(a.itemsize == 16) def test_misaligned_objects_segfault(self): # Ticket #1198 and #1267 a1 = np.zeros((10,), dtype='O,c') a2 = np.array(['a', 'b', 'c', 'd', 'e', 'f', 'g', 'h', 'i', 'j'], 'S10') a1['f0'] = a2 repr(a1) np.argmax(a1['f0']) a1['f0'][1] = "FOO" a1['f0'] = "FOO" np.array(a1['f0'], dtype='S') np.nonzero(a1['f0']) a1.sort() copy.deepcopy(a1) def test_misaligned_scalars_segfault(self): # Ticket #1267 s1 = np.array(('a', 'Foo'), dtype='c,O') s2 = np.array(('b', 'Bar'), dtype='c,O') s1['f1'] = s2['f1'] s1['f1'] = 'Baz' def test_misaligned_dot_product_objects(self): # Ticket #1267 # This didn't require a fix, but it's worth testing anyway, because # it may fail if .dot stops enforcing the arrays to be BEHAVED a = np.array([[(1, 'a'), (0, 'a')], [(0, 'a'), (1, 'a')]], dtype='O,c') b = np.array([[(4, 'a'), (1, 'a')], [(2, 'a'), (2, 'a')]], dtype='O,c') np.dot(a['f0'], b['f0']) def test_byteswap_complex_scalar(self): # Ticket #1259 and gh-441 for dtype in [np.dtype('<'+t) for t in np.typecodes['Complex']]: z = np.array([2.2-1.1j], dtype) x = z[0] # always native-endian y = x.byteswap() if x.dtype.byteorder == z.dtype.byteorder: # little-endian machine assert_equal(x, np.frombuffer(y.tobytes(), dtype=dtype.newbyteorder())) else: # big-endian machine assert_equal(x, np.frombuffer(y.tobytes(), dtype=dtype)) # double check real and imaginary parts: assert_equal(x.real, y.real.byteswap()) assert_equal(x.imag, y.imag.byteswap()) def test_structured_arrays_with_objects1(self): # Ticket #1299 stra = 'aaaa' strb = 'bbbb' x = np.array([[(0, stra), (1, strb)]], 'i8,O') x[x.nonzero()] = x.ravel()[:1] assert_(x[0, 1] == x[0, 0]) @dec.skipif(not HAS_REFCOUNT, "python has no sys.getrefcount") def test_structured_arrays_with_objects2(self): # Ticket #1299 second test stra = 'aaaa' strb = 'bbbb' numb = sys.getrefcount(strb) numa = sys.getrefcount(stra) x = np.array([[(0, stra), (1, strb)]], 'i8,O') x[x.nonzero()] = x.ravel()[:1] assert_(sys.getrefcount(strb) == numb) assert_(sys.getrefcount(stra) == numa + 2) def test_duplicate_title_and_name(self): # Ticket #1254 dtspec = [(('a', 'a'), 'i'), ('b', 'i')] assert_raises(ValueError, np.dtype, dtspec) def test_signed_integer_division_overflow(self): # Ticket #1317. def test_type(t): min = np.array([np.iinfo(t).min]) min //= -1 with np.errstate(divide="ignore"): for t in (np.int8, np.int16, np.int32, np.int64, int, np.long): test_type(t) def test_buffer_hashlib(self): try: from hashlib import md5 except ImportError: from md5 import new as md5 x = np.array([1, 2, 3], dtype=np.dtype('<i4')) assert_equal(md5(x).hexdigest(), '2a1dd1e1e59d0a384c26951e316cd7e6') def test_0d_string_scalar(self): # Bug #1436; the following should succeed np.asarray('x', '>c') def test_log1p_compiler_shenanigans(self): # Check if log1p is behaving on 32 bit intel systems. assert_(np.isfinite(np.log1p(np.exp2(-53)))) def test_fromiter_comparison(self): a = np.fromiter(list(range(10)), dtype='b') b = np.fromiter(list(range(10)), dtype='B') assert_(np.alltrue(a == np.array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]))) assert_(np.alltrue(b == np.array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]))) def test_fromstring_crash(self): # Ticket #1345: the following should not cause a crash np.fromstring(b'aa, aa, 1.0', sep=',') def test_ticket_1539(self): dtypes = [x for x in np.typeDict.values() if (issubclass(x, np.number) and not issubclass(x, np.timedelta64))] a = np.array([], np.bool_) # not x[0] because it is unordered failures = [] for x in dtypes: b = a.astype(x) for y in dtypes: c = a.astype(y) try: np.dot(b, c) except TypeError: failures.append((x, y)) if failures: raise AssertionError("Failures: %r" % failures) def test_ticket_1538(self): x = np.finfo(np.float32) for name in 'eps epsneg max min resolution tiny'.split(): assert_equal(type(getattr(x, name)), np.float32, err_msg=name) def test_ticket_1434(self): # Check that the out= argument in var and std has an effect data = np.array(((1, 2, 3), (4, 5, 6), (7, 8, 9))) out = np.zeros((3,)) ret = data.var(axis=1, out=out) assert_(ret is out) assert_array_equal(ret, data.var(axis=1)) ret = data.std(axis=1, out=out) assert_(ret is out) assert_array_equal(ret, data.std(axis=1)) def test_complex_nan_maximum(self): cnan = complex(0, np.nan) assert_equal(np.maximum(1, cnan), cnan) def test_subclass_int_tuple_assignment(self): # ticket #1563 class Subclass(np.ndarray): def __new__(cls, i): return np.ones((i,)).view(cls) x = Subclass(5) x[(0,)] = 2 # shouldn't raise an exception assert_equal(x[0], 2) def test_ufunc_no_unnecessary_views(self): # ticket #1548 class Subclass(np.ndarray): pass x = np.array([1, 2, 3]).view(Subclass) y = np.add(x, x, x) assert_equal(id(x), id(y)) @dec.skipif(not HAS_REFCOUNT, "python has no sys.getrefcount") def test_take_refcount(self): # ticket #939 a = np.arange(16, dtype=float) a.shape = (4, 4) lut = np.ones((5 + 3, 4), float) rgba = np.empty(shape=a.shape + (4,), dtype=lut.dtype) c1 = sys.getrefcount(rgba) try: lut.take(a, axis=0, mode='clip', out=rgba) except TypeError: pass c2 = sys.getrefcount(rgba) assert_equal(c1, c2) def test_fromfile_tofile_seeks(self): # On Python 3, tofile/fromfile used to get (#1610) the Python # file handle out of sync f0 = tempfile.NamedTemporaryFile() f = f0.file f.write(np.arange(255, dtype='u1').tobytes()) f.seek(20) ret = np.fromfile(f, count=4, dtype='u1') assert_equal(ret, np.array([20, 21, 22, 23], dtype='u1')) assert_equal(f.tell(), 24) f.seek(40) np.array([1, 2, 3], dtype='u1').tofile(f) assert_equal(f.tell(), 43) f.seek(40) data = f.read(3) assert_equal(data, b"\x01\x02\x03") f.seek(80) f.read(4) data = np.fromfile(f, dtype='u1', count=4) assert_equal(data, np.array([84, 85, 86, 87], dtype='u1')) f.close() def test_complex_scalar_warning(self): for tp in [np.csingle, np.cdouble, np.clongdouble]: x = tp(1+2j) assert_warns(np.ComplexWarning, float, x) with suppress_warnings() as sup: sup.filter(np.ComplexWarning) assert_equal(float(x), float(x.real)) def test_complex_scalar_complex_cast(self): for tp in [np.csingle, np.cdouble, np.clongdouble]: x = tp(1+2j) assert_equal(complex(x), 1+2j) def test_complex_boolean_cast(self): # Ticket #2218 for tp in [np.csingle, np.cdouble, np.clongdouble]: x = np.array([0, 0+0.5j, 0.5+0j], dtype=tp) assert_equal(x.astype(bool), np.array([0, 1, 1], dtype=bool)) assert_(np.any(x)) assert_(np.all(x[1:])) def test_uint_int_conversion(self): x = 2**64 - 1 assert_equal(int(np.uint64(x)), x) def test_duplicate_field_names_assign(self): ra = np.fromiter(((i*3, i*2) for i in range(10)), dtype='i8,f8') ra.dtype.names = ('f1', 'f2') repr(ra) # should not cause a segmentation fault assert_raises(ValueError, setattr, ra.dtype, 'names', ('f1', 'f1')) def test_eq_string_and_object_array(self): # From e-mail thread "__eq__ with str and object" (Keith Goodman) a1 = np.array(['a', 'b'], dtype=object) a2 = np.array(['a', 'c']) assert_array_equal(a1 == a2, [True, False]) assert_array_equal(a2 == a1, [True, False]) def test_nonzero_byteswap(self): a = np.array([0x80000000, 0x00000080, 0], dtype=np.uint32) a.dtype = np.float32 assert_equal(a.nonzero()[0], [1]) a = a.byteswap().newbyteorder() assert_equal(a.nonzero()[0], [1]) # [0] if nonzero() ignores swap def test_find_common_type_boolean(self): # Ticket #1695 assert_(np.find_common_type([], ['?', '?']) == '?') def test_empty_mul(self): a = np.array([1.]) a[1:1] *= 2 assert_equal(a, [1.]) def test_array_side_effect(self): # The second use of itemsize was throwing an exception because in # ctors.c, discover_itemsize was calling PyObject_Length without # checking the return code. This failed to get the length of the # number 2, and the exception hung around until something checked # PyErr_Occurred() and returned an error. assert_equal(np.dtype('S10').itemsize, 10) np.array([['abc', 2], ['long ', '0123456789']], dtype=np.string_) assert_equal(np.dtype('S10').itemsize, 10) def test_any_float(self): # all and any for floats a = np.array([0.1, 0.9]) assert_(np.any(a)) assert_(np.all(a)) def test_large_float_sum(self): a = np.arange(10000, dtype='f') assert_equal(a.sum(dtype='d'), a.astype('d').sum()) def test_ufunc_casting_out(self): a = np.array(1.0, dtype=np.float32) b = np.array(1.0, dtype=np.float64) c = np.array(1.0, dtype=np.float32) np.add(a, b, out=c) assert_equal(c, 2.0) def test_array_scalar_contiguous(self): # Array scalars are both C and Fortran contiguous assert_(np.array(1.0).flags.c_contiguous) assert_(np.array(1.0).flags.f_contiguous) assert_(np.array(np.float32(1.0)).flags.c_contiguous) assert_(np.array(np.float32(1.0)).flags.f_contiguous) def test_squeeze_contiguous(self): # Similar to GitHub issue #387 a = np.zeros((1, 2)).squeeze() b = np.zeros((2, 2, 2), order='F')[:, :, ::2].squeeze() assert_(a.flags.c_contiguous) assert_(a.flags.f_contiguous) assert_(b.flags.f_contiguous) def test_reduce_contiguous(self): # GitHub issue #387 a = np.add.reduce(np.zeros((2, 1, 2)), (0, 1)) b = np.add.reduce(np.zeros((2, 1, 2)), 1) assert_(a.flags.c_contiguous) assert_(a.flags.f_contiguous) assert_(b.flags.c_contiguous) def test_object_array_self_reference(self): # Object arrays with references to themselves can cause problems a = np.array(0, dtype=object) a[()] = a assert_raises(RecursionError, int, a) assert_raises(RecursionError, long, a) assert_raises(RecursionError, float, a) if sys.version_info.major == 2: # in python 3, this falls back on operator.index, which fails on # on dtype=object assert_raises(RecursionError, oct, a) assert_raises(RecursionError, hex, a) a[()] = None def test_object_array_circular_reference(self): # Test the same for a circular reference. a = np.array(0, dtype=object) b = np.array(0, dtype=object) a[()] = b b[()] = a assert_raises(RecursionError, int, a) # NumPy has no tp_traverse currently, so circular references # cannot be detected. So resolve it: a[()] = None # This was causing a to become like the above a = np.array(0, dtype=object) a[...] += 1 assert_equal(a, 1) def test_object_array_nested(self): # but is fine with a reference to a different array a = np.array(0, dtype=object) b = np.array(0, dtype=object) a[()] = b assert_equal(int(a), int(0)) assert_equal(long(a), long(0)) assert_equal(float(a), float(0)) if sys.version_info.major == 2: # in python 3, this falls back on operator.index, which fails on # on dtype=object assert_equal(oct(a), oct(0)) assert_equal(hex(a), hex(0)) def test_object_array_self_copy(self): # An object array being copied into itself DECREF'ed before INCREF'ing # causing segmentation faults (gh-3787) a = np.array(object(), dtype=object) np.copyto(a, a) if HAS_REFCOUNT: assert_(sys.getrefcount(a[()]) == 2) a[()].__class__ # will segfault if object was deleted def test_zerosize_accumulate(self): "Ticket #1733" x = np.array([[42, 0]], dtype=np.uint32) assert_equal(np.add.accumulate(x[:-1, 0]), []) def test_objectarray_setfield(self): # Setfield should not overwrite Object fields with non-Object data x = np.array([1, 2, 3], dtype=object) assert_raises(TypeError, x.setfield, 4, np.int32, 0) def test_setting_rank0_string(self): "Ticket #1736" s1 = b"hello1" s2 = b"hello2" a = np.zeros((), dtype="S10") a[()] = s1 assert_equal(a, np.array(s1)) a[()] = np.array(s2) assert_equal(a, np.array(s2)) a = np.zeros((), dtype='f4') a[()] = 3 assert_equal(a, np.array(3)) a[()] = np.array(4) assert_equal(a, np.array(4)) def test_string_astype(self): "Ticket #1748" s1 = b'black' s2 = b'white' s3 = b'other' a = np.array([[s1], [s2], [s3]]) assert_equal(a.dtype, np.dtype('S5')) b = a.astype(np.dtype('S0')) assert_equal(b.dtype, np.dtype('S5')) def test_ticket_1756(self): # Ticket #1756 s = b'0123456789abcdef' a = np.array([s]*5) for i in range(1, 17): a1 = np.array(a, "|S%d" % i) a2 = np.array([s[:i]]*5) assert_equal(a1, a2) def test_fields_strides(self): "gh-2355" r = np.frombuffer(b'abcdefghijklmnop'*4*3, dtype='i4,(2,3)u2') assert_equal(r[0:3:2]['f1'], r['f1'][0:3:2]) assert_equal(r[0:3:2]['f1'][0], r[0:3:2][0]['f1']) assert_equal(r[0:3:2]['f1'][0][()], r[0:3:2][0]['f1'][()]) assert_equal(r[0:3:2]['f1'][0].strides, r[0:3:2][0]['f1'].strides) def test_alignment_update(self): # Check that alignment flag is updated on stride setting a = np.arange(10) assert_(a.flags.aligned) a.strides = 3 assert_(not a.flags.aligned) def test_ticket_1770(self): "Should not segfault on python 3k" import numpy as np try: a = np.zeros((1,), dtype=[('f1', 'f')]) a['f1'] = 1 a['f2'] = 1 except ValueError: pass except Exception: raise AssertionError def test_ticket_1608(self): "x.flat shouldn't modify data" x = np.array([[1, 2], [3, 4]]).T np.array(x.flat) assert_equal(x, [[1, 3], [2, 4]]) def test_pickle_string_overwrite(self): import re data = np.array([1], dtype='b') blob = pickle.dumps(data, protocol=1) data = pickle.loads(blob) # Check that loads does not clobber interned strings s = re.sub("a(.)", "\x01\\1", "a_") assert_equal(s[0], "\x01") data[0] = 0xbb s = re.sub("a(.)", "\x01\\1", "a_") assert_equal(s[0], "\x01") def test_pickle_bytes_overwrite(self): if sys.version_info[0] >= 3: data = np.array([1], dtype='b') data = pickle.loads(pickle.dumps(data)) data[0] = 0xdd bytestring = "\x01 ".encode('ascii') assert_equal(bytestring[0:1], '\x01'.encode('ascii')) def test_pickle_py2_array_latin1_hack(self): # Check that unpickling hacks in Py3 that support # encoding='latin1' work correctly. # Python2 output for pickle.dumps(numpy.array([129], dtype='b')) data = (b"cnumpy.core.multiarray\n_reconstruct\np0\n(cnumpy\nndarray\np1\n(I0\n" b"tp2\nS'b'\np3\ntp4\nRp5\n(I1\n(I1\ntp6\ncnumpy\ndtype\np7\n(S'i1'\np8\n" b"I0\nI1\ntp9\nRp10\n(I3\nS'|'\np11\nNNNI-1\nI-1\nI0\ntp12\nbI00\nS'\\x81'\n" b"p13\ntp14\nb.") if sys.version_info[0] >= 3: # This should work: result = pickle.loads(data, encoding='latin1') assert_array_equal(result, np.array([129], dtype='b')) # Should not segfault: assert_raises(Exception, pickle.loads, data, encoding='koi8-r') def test_pickle_py2_scalar_latin1_hack(self): # Check that scalar unpickling hack in Py3 that supports # encoding='latin1' work correctly. # Python2 output for pickle.dumps(...) datas = [ # (original, python2_pickle, koi8r_validity) (np.unicode_('\u6bd2'), (b"cnumpy.core.multiarray\nscalar\np0\n(cnumpy\ndtype\np1\n" b"(S'U1'\np2\nI0\nI1\ntp3\nRp4\n(I3\nS'<'\np5\nNNNI4\nI4\nI0\n" b"tp6\nbS'\\xd2k\\x00\\x00'\np7\ntp8\nRp9\n."), 'invalid'), (np.float64(9e123), (b"cnumpy.core.multiarray\nscalar\np0\n(cnumpy\ndtype\np1\n(S'f8'\n" b"p2\nI0\nI1\ntp3\nRp4\n(I3\nS'<'\np5\nNNNI-1\nI-1\nI0\ntp6\n" b"bS'O\\x81\\xb7Z\\xaa:\\xabY'\np7\ntp8\nRp9\n."), 'invalid'), (np.bytes_(b'\x9c'), # different 8-bit code point in KOI8-R vs latin1 (b"cnumpy.core.multiarray\nscalar\np0\n(cnumpy\ndtype\np1\n(S'S1'\np2\n" b"I0\nI1\ntp3\nRp4\n(I3\nS'|'\np5\nNNNI1\nI1\nI0\ntp6\nbS'\\x9c'\np7\n" b"tp8\nRp9\n."), 'different'), ] if sys.version_info[0] >= 3: for original, data, koi8r_validity in datas: result = pickle.loads(data, encoding='latin1') assert_equal(result, original) # Decoding under non-latin1 encoding (e.g.) KOI8-R can # produce bad results, but should not segfault. if koi8r_validity == 'different': # Unicode code points happen to lie within latin1, # but are different in koi8-r, resulting to silent # bogus results result = pickle.loads(data, encoding='koi8-r') assert_(result != original) elif koi8r_validity == 'invalid': # Unicode code points outside latin1, so results # to an encoding exception assert_raises(ValueError, pickle.loads, data, encoding='koi8-r') else: raise ValueError(koi8r_validity) def test_structured_type_to_object(self): a_rec = np.array([(0, 1), (3, 2)], dtype='i4,i8') a_obj = np.empty((2,), dtype=object) a_obj[0] = (0, 1) a_obj[1] = (3, 2) # astype records -> object assert_equal(a_rec.astype(object), a_obj) # '=' records -> object b = np.empty_like(a_obj) b[...] = a_rec assert_equal(b, a_obj) # '=' object -> records b = np.empty_like(a_rec) b[...] = a_obj assert_equal(b, a_rec) def test_assign_obj_listoflists(self): # Ticket # 1870 # The inner list should get assigned to the object elements a = np.zeros(4, dtype=object) b = a.copy() a[0] = [1] a[1] = [2] a[2] = [3] a[3] = [4] b[...] = [[1], [2], [3], [4]] assert_equal(a, b) # The first dimension should get broadcast a = np.zeros((2, 2), dtype=object) a[...] = [[1, 2]] assert_equal(a, [[1, 2], [1, 2]]) def test_memoryleak(self): # Ticket #1917 - ensure that array data doesn't leak for i in range(1000): # 100MB times 1000 would give 100GB of memory usage if it leaks a = np.empty((100000000,), dtype='i1') del a @dec.skipif(not HAS_REFCOUNT, "python has no sys.getrefcount") def test_ufunc_reduce_memoryleak(self): a = np.arange(6) acnt = sys.getrefcount(a) np.add.reduce(a) assert_equal(sys.getrefcount(a), acnt) def test_search_sorted_invalid_arguments(self): # Ticket #2021, should not segfault. x = np.arange(0, 4, dtype='datetime64[D]') assert_raises(TypeError, x.searchsorted, 1) def test_string_truncation(self): # Ticket #1990 - Data can be truncated in creation of an array from a # mixed sequence of numeric values and strings for val in [True, 1234, 123.4, complex(1, 234)]: for tostr in [asunicode, asbytes]: b = np.array([val, tostr('xx')]) assert_equal(tostr(b[0]), tostr(val)) b = np.array([tostr('xx'), val]) assert_equal(tostr(b[1]), tostr(val)) # test also with longer strings b = np.array([val, tostr('xxxxxxxxxx')]) assert_equal(tostr(b[0]), tostr(val)) b = np.array([tostr('xxxxxxxxxx'), val]) assert_equal(tostr(b[1]), tostr(val)) def test_string_truncation_ucs2(self): # Ticket #2081. Python compiled with two byte unicode # can lead to truncation if itemsize is not properly # adjusted for NumPy's four byte unicode. if sys.version_info[0] >= 3: a = np.array(['abcd']) else: a = np.array([u'abcd']) assert_equal(a.dtype.itemsize, 16) def test_unique_stable(self): # Ticket #2063 must always choose stable sort for argsort to # get consistent results v = np.array(([0]*5 + [1]*6 + [2]*6)*4) res = np.unique(v, return_index=True) tgt = (np.array([0, 1, 2]), np.array([ 0, 5, 11])) assert_equal(res, tgt) def test_unicode_alloc_dealloc_match(self): # Ticket #1578, the mismatch only showed up when running # python-debug for python versions >= 2.7, and then as # a core dump and error message. a = np.array(['abc'], dtype=np.unicode)[0] del a def test_refcount_error_in_clip(self): # Ticket #1588 a = np.zeros((2,), dtype='>i2').clip(min=0) x = a + a # This used to segfault: y = str(x) # Check the final string: assert_(y == "[0 0]") def test_searchsorted_wrong_dtype(self): # Ticket #2189, it used to segfault, so we check that it raises the # proper exception. a = np.array([('a', 1)], dtype='S1, int') assert_raises(TypeError, np.searchsorted, a, 1.2) # Ticket #2066, similar problem: dtype = np.format_parser(['i4', 'i4'], [], []) a = np.recarray((2, ), dtype) assert_raises(TypeError, np.searchsorted, a, 1) def test_complex64_alignment(self): # Issue gh-2668 (trac 2076), segfault on sparc due to misalignment dtt = np.complex64 arr = np.arange(10, dtype=dtt) # 2D array arr2 = np.reshape(arr, (2, 5)) # Fortran write followed by (C or F) read caused bus error data_str = arr2.tobytes('F') data_back = np.ndarray(arr2.shape, arr2.dtype, buffer=data_str, order='F') assert_array_equal(arr2, data_back) def test_structured_count_nonzero(self): arr = np.array([0, 1]).astype('i4, (2)i4')[:1] count = np.count_nonzero(arr) assert_equal(count, 0) def test_copymodule_preserves_f_contiguity(self): a = np.empty((2, 2), order='F') b = copy.copy(a) c = copy.deepcopy(a) assert_(b.flags.fortran) assert_(b.flags.f_contiguous) assert_(c.flags.fortran) assert_(c.flags.f_contiguous) def test_fortran_order_buffer(self): import numpy as np a = np.array([['Hello', 'Foob']], dtype='U5', order='F') arr = np.ndarray(shape=[1, 2, 5], dtype='U1', buffer=a) arr2 = np.array([[[u'H', u'e', u'l', u'l', u'o'], [u'F', u'o', u'o', u'b', u'']]]) assert_array_equal(arr, arr2) def test_assign_from_sequence_error(self): # Ticket #4024. arr = np.array([1, 2, 3]) assert_raises(ValueError, arr.__setitem__, slice(None), [9, 9]) arr.__setitem__(slice(None), [9]) assert_equal(arr, [9, 9, 9]) def test_format_on_flex_array_element(self): # Ticket #4369. dt = np.dtype([('date', '<M8[D]'), ('val', '<f8')]) arr = np.array([('2000-01-01', 1)], dt) formatted = '{0}'.format(arr[0]) assert_equal(formatted, str(arr[0])) def test_deepcopy_on_0d_array(self): # Ticket #3311. arr = np.array(3) arr_cp = copy.deepcopy(arr) assert_equal(arr, arr_cp) assert_equal(arr.shape, arr_cp.shape) assert_equal(int(arr), int(arr_cp)) assert_(arr is not arr_cp) assert_(isinstance(arr_cp, type(arr))) def test_deepcopy_F_order_object_array(self): # Ticket #6456. a = {'a': 1} b = {'b': 2} arr = np.array([[a, b], [a, b]], order='F') arr_cp = copy.deepcopy(arr) assert_equal(arr, arr_cp) assert_(arr is not arr_cp) # Ensure that we have actually copied the item. assert_(arr[0, 1] is not arr_cp[1, 1]) # Ensure we are allowed to have references to the same object. assert_(arr[0, 1] is arr[1, 1]) # Check the references hold for the copied objects. assert_(arr_cp[0, 1] is arr_cp[1, 1]) def test_deepcopy_empty_object_array(self): # Ticket #8536. # Deepcopy should succeed a = np.array([], dtype=object) b = copy.deepcopy(a) assert_(a.shape == b.shape) def test_bool_subscript_crash(self): # gh-4494 c = np.rec.array([(1, 2, 3), (4, 5, 6)]) masked = c[np.array([True, False])] base = masked.base del masked, c base.dtype def test_richcompare_crash(self): # gh-4613 import operator as op # dummy class where __array__ throws exception class Foo(object): __array_priority__ = 1002 def __array__(self, *args, **kwargs): raise Exception() rhs = Foo() lhs = np.array(1) for f in [op.lt, op.le, op.gt, op.ge]: if sys.version_info[0] >= 3: assert_raises(TypeError, f, lhs, rhs) elif not sys.py3kwarning: # With -3 switch in python 2, DeprecationWarning is raised # which we are not interested in f(lhs, rhs) assert_(not op.eq(lhs, rhs)) assert_(op.ne(lhs, rhs)) def test_richcompare_scalar_and_subclass(self): # gh-4709 class Foo(np.ndarray): def __eq__(self, other): return "OK" x = np.array([1, 2, 3]).view(Foo) assert_equal(10 == x, "OK") assert_equal(np.int32(10) == x, "OK") assert_equal(np.array([10]) == x, "OK") def test_pickle_empty_string(self): # gh-3926 import pickle test_string = np.string_('') assert_equal(pickle.loads(pickle.dumps(test_string)), test_string) def test_frompyfunc_many_args(self): # gh-5672 def passer(*args): pass assert_raises(ValueError, np.frompyfunc, passer, 32, 1) def test_repeat_broadcasting(self): # gh-5743 a = np.arange(60).reshape(3, 4, 5) for axis in chain(range(-a.ndim, a.ndim), [None]): assert_equal(a.repeat(2, axis=axis), a.repeat([2], axis=axis)) def test_frompyfunc_nout_0(self): # gh-2014 def f(x): x[0], x[-1] = x[-1], x[0] uf = np.frompyfunc(f, 1, 0) a = np.array([[1, 2, 3], [4, 5], [6, 7, 8, 9]]) assert_equal(uf(a), ()) assert_array_equal(a, [[3, 2, 1], [5, 4], [9, 7, 8, 6]]) @dec.skipif(not HAS_REFCOUNT, "python has no sys.getrefcount") def test_leak_in_structured_dtype_comparison(self): # gh-6250 recordtype = np.dtype([('a', np.float64), ('b', np.int32), ('d', (str, 5))]) # Simple case a = np.zeros(2, dtype=recordtype) for i in range(100): a == a assert_(sys.getrefcount(a) < 10) # The case in the bug report. before = sys.getrefcount(a) u, v = a[0], a[1] u == v del u, v gc.collect() after = sys.getrefcount(a) assert_equal(before, after) def test_empty_percentile(self): # gh-6530 / gh-6553 assert_array_equal(np.percentile(np.arange(10), []), np.array([])) def test_void_compare_segfault(self): # gh-6922. The following should not segfault a = np.ones(3, dtype=[('object', 'O'), ('int', '<i2')]) a.sort() def test_reshape_size_overflow(self): # gh-7455 a = np.ones(20)[::2] if np.dtype(np.intp).itemsize == 8: # 64 bit. The following are the prime factors of 2**63 + 5, # plus a leading 2, so when multiplied together as int64, # the result overflows to a total size of 10. new_shape = (2, 13, 419, 691, 823, 2977518503) else: # 32 bit. The following are the prime factors of 2**31 + 5, # plus a leading 2, so when multiplied together as int32, # the result overflows to a total size of 10. new_shape = (2, 7, 7, 43826197) assert_raises(ValueError, a.reshape, new_shape) def test_invalid_structured_dtypes(self): # gh-2865 # mapping python objects to other dtypes assert_raises(ValueError, np.dtype, ('O', [('name', 'i8')])) assert_raises(ValueError, np.dtype, ('i8', [('name', 'O')])) assert_raises(ValueError, np.dtype, ('i8', [('name', [('name', 'O')])])) assert_raises(ValueError, np.dtype, ([('a', 'i4'), ('b', 'i4')], 'O')) assert_raises(ValueError, np.dtype, ('i8', 'O')) # wrong number/type of tuple elements in dict assert_raises(ValueError, np.dtype, ('i', {'name': ('i', 0, 'title', 'oops')})) assert_raises(ValueError, np.dtype, ('i', {'name': ('i', 'wrongtype', 'title')})) # disallowed as of 1.13 assert_raises(ValueError, np.dtype, ([('a', 'O'), ('b', 'O')], [('c', 'O'), ('d', 'O')])) # allowed as a special case due to existing use, see gh-2798 a = np.ones(1, dtype=('O', [('name', 'O')])) assert_equal(a[0], 1) def test_correct_hash_dict(self): # gh-8887 - __hash__ would be None despite tp_hash being set all_types = set(np.typeDict.values()) - {np.void} for t in all_types: val = t() try: hash(val) except TypeError as e: assert_equal(t.__hash__, None) else: assert_(t.__hash__ != None) def test_scalar_copy(self): scalar_types = set(np.sctypeDict.values()) values = { np.void: b"a", np.bytes_: b"a", np.unicode_: "a", np.datetime64: "2017-08-25", } for sctype in scalar_types: item = sctype(values.get(sctype, 1)) item2 = copy.copy(item) assert_equal(item, item2) def test_void_item_memview(self): va = np.zeros(10, 'V4') # for now, there is just a futurewarning assert_warns(FutureWarning, va[:1].item) # in the future, test we got a bytes copy: #x = va[:1].item() #va[0] = b'\xff\xff\xff\xff' #del va #assert_equal(x, b'\x00\x00\x00\x00') def test_structarray_title(self): # The following used to segfault on pypy, due to NPY_TITLE_KEY # not working properly and resulting to double-decref of the # structured array field items: # See: https://bitbucket.org/pypy/pypy/issues/2789 for j in range(5): structure = np.array([1], dtype=[(('x', 'X'), np.object_)]) structure[0]['x'] = np.array([2]) gc.collect() if __name__ == "__main__": run_module_suite()
80,168
34.084902
93
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_errstate.py
from __future__ import division, absolute_import, print_function import platform import numpy as np from numpy.testing import assert_, run_module_suite, dec class TestErrstate(object): @dec.skipif(platform.machine() == "armv5tel", "See gh-413.") def test_invalid(self): with np.errstate(all='raise', under='ignore'): a = -np.arange(3) # This should work with np.errstate(invalid='ignore'): np.sqrt(a) # While this should fail! try: np.sqrt(a) except FloatingPointError: pass else: self.fail("Did not raise an invalid error") def test_divide(self): with np.errstate(all='raise', under='ignore'): a = -np.arange(3) # This should work with np.errstate(divide='ignore'): a // 0 # While this should fail! try: a // 0 except FloatingPointError: pass else: self.fail("Did not raise divide by zero error") def test_errcall(self): def foo(*args): print(args) olderrcall = np.geterrcall() with np.errstate(call=foo): assert_(np.geterrcall() is foo, 'call is not foo') with np.errstate(call=None): assert_(np.geterrcall() is None, 'call is not None') assert_(np.geterrcall() is olderrcall, 'call is not olderrcall') if __name__ == "__main__": run_module_suite()
1,576
28.754717
72
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_api.py
from __future__ import division, absolute_import, print_function import sys import numpy as np from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_array_equal, assert_raises, HAS_REFCOUNT ) # Switch between new behaviour when NPY_RELAXED_STRIDES_CHECKING is set. NPY_RELAXED_STRIDES_CHECKING = np.ones((10, 1), order='C').flags.f_contiguous def test_array_array(): tobj = type(object) ones11 = np.ones((1, 1), np.float64) tndarray = type(ones11) # Test is_ndarray assert_equal(np.array(ones11, dtype=np.float64), ones11) if HAS_REFCOUNT: old_refcount = sys.getrefcount(tndarray) np.array(ones11) assert_equal(old_refcount, sys.getrefcount(tndarray)) # test None assert_equal(np.array(None, dtype=np.float64), np.array(np.nan, dtype=np.float64)) if HAS_REFCOUNT: old_refcount = sys.getrefcount(tobj) np.array(None, dtype=np.float64) assert_equal(old_refcount, sys.getrefcount(tobj)) # test scalar assert_equal(np.array(1.0, dtype=np.float64), np.ones((), dtype=np.float64)) if HAS_REFCOUNT: old_refcount = sys.getrefcount(np.float64) np.array(np.array(1.0, dtype=np.float64), dtype=np.float64) assert_equal(old_refcount, sys.getrefcount(np.float64)) # test string S2 = np.dtype((str, 2)) S3 = np.dtype((str, 3)) S5 = np.dtype((str, 5)) assert_equal(np.array("1.0", dtype=np.float64), np.ones((), dtype=np.float64)) assert_equal(np.array("1.0").dtype, S3) assert_equal(np.array("1.0", dtype=str).dtype, S3) assert_equal(np.array("1.0", dtype=S2), np.array("1.")) assert_equal(np.array("1", dtype=S5), np.ones((), dtype=S5)) # test unicode _unicode = globals().get("unicode") if _unicode: U2 = np.dtype((_unicode, 2)) U3 = np.dtype((_unicode, 3)) U5 = np.dtype((_unicode, 5)) assert_equal(np.array(_unicode("1.0"), dtype=np.float64), np.ones((), dtype=np.float64)) assert_equal(np.array(_unicode("1.0")).dtype, U3) assert_equal(np.array(_unicode("1.0"), dtype=_unicode).dtype, U3) assert_equal(np.array(_unicode("1.0"), dtype=U2), np.array(_unicode("1."))) assert_equal(np.array(_unicode("1"), dtype=U5), np.ones((), dtype=U5)) builtins = getattr(__builtins__, '__dict__', __builtins__) assert_(hasattr(builtins, 'get')) # test buffer _buffer = builtins.get("buffer") if _buffer and sys.version_info[:3] >= (2, 7, 5): # This test fails for earlier versions of Python. # Evidently a bug got fixed in 2.7.5. dat = np.array(_buffer('1.0'), dtype=np.float64) assert_equal(dat, [49.0, 46.0, 48.0]) assert_(dat.dtype.type is np.float64) dat = np.array(_buffer(b'1.0')) assert_equal(dat, [49, 46, 48]) assert_(dat.dtype.type is np.uint8) # test memoryview, new version of buffer _memoryview = builtins.get("memoryview") if _memoryview: dat = np.array(_memoryview(b'1.0'), dtype=np.float64) assert_equal(dat, [49.0, 46.0, 48.0]) assert_(dat.dtype.type is np.float64) dat = np.array(_memoryview(b'1.0')) assert_equal(dat, [49, 46, 48]) assert_(dat.dtype.type is np.uint8) # test array interface a = np.array(100.0, dtype=np.float64) o = type("o", (object,), dict(__array_interface__=a.__array_interface__)) assert_equal(np.array(o, dtype=np.float64), a) # test array_struct interface a = np.array([(1, 4.0, 'Hello'), (2, 6.0, 'World')], dtype=[('f0', int), ('f1', float), ('f2', str)]) o = type("o", (object,), dict(__array_struct__=a.__array_struct__)) ## wasn't what I expected... is np.array(o) supposed to equal a ? ## instead we get a array([...], dtype=">V18") assert_equal(bytes(np.array(o).data), bytes(a.data)) # test array o = type("o", (object,), dict(__array__=lambda *x: np.array(100.0, dtype=np.float64)))() assert_equal(np.array(o, dtype=np.float64), np.array(100.0, np.float64)) # test recursion nested = 1.5 for i in range(np.MAXDIMS): nested = [nested] # no error np.array(nested) # Exceeds recursion limit assert_raises(ValueError, np.array, [nested], dtype=np.float64) # Try with lists... assert_equal(np.array([None] * 10, dtype=np.float64), np.full((10,), np.nan, dtype=np.float64)) assert_equal(np.array([[None]] * 10, dtype=np.float64), np.full((10, 1), np.nan, dtype=np.float64)) assert_equal(np.array([[None] * 10], dtype=np.float64), np.full((1, 10), np.nan, dtype=np.float64)) assert_equal(np.array([[None] * 10] * 10, dtype=np.float64), np.full((10, 10), np.nan, dtype=np.float64)) assert_equal(np.array([1.0] * 10, dtype=np.float64), np.ones((10,), dtype=np.float64)) assert_equal(np.array([[1.0]] * 10, dtype=np.float64), np.ones((10, 1), dtype=np.float64)) assert_equal(np.array([[1.0] * 10], dtype=np.float64), np.ones((1, 10), dtype=np.float64)) assert_equal(np.array([[1.0] * 10] * 10, dtype=np.float64), np.ones((10, 10), dtype=np.float64)) # Try with tuples assert_equal(np.array((None,) * 10, dtype=np.float64), np.full((10,), np.nan, dtype=np.float64)) assert_equal(np.array([(None,)] * 10, dtype=np.float64), np.full((10, 1), np.nan, dtype=np.float64)) assert_equal(np.array([(None,) * 10], dtype=np.float64), np.full((1, 10), np.nan, dtype=np.float64)) assert_equal(np.array([(None,) * 10] * 10, dtype=np.float64), np.full((10, 10), np.nan, dtype=np.float64)) assert_equal(np.array((1.0,) * 10, dtype=np.float64), np.ones((10,), dtype=np.float64)) assert_equal(np.array([(1.0,)] * 10, dtype=np.float64), np.ones((10, 1), dtype=np.float64)) assert_equal(np.array([(1.0,) * 10], dtype=np.float64), np.ones((1, 10), dtype=np.float64)) assert_equal(np.array([(1.0,) * 10] * 10, dtype=np.float64), np.ones((10, 10), dtype=np.float64)) def test_fastCopyAndTranspose(): # 0D array a = np.array(2) b = np.fastCopyAndTranspose(a) assert_equal(b, a.T) assert_(b.flags.owndata) # 1D array a = np.array([3, 2, 7, 0]) b = np.fastCopyAndTranspose(a) assert_equal(b, a.T) assert_(b.flags.owndata) # 2D array a = np.arange(6).reshape(2, 3) b = np.fastCopyAndTranspose(a) assert_equal(b, a.T) assert_(b.flags.owndata) def test_array_astype(): a = np.arange(6, dtype='f4').reshape(2, 3) # Default behavior: allows unsafe casts, keeps memory layout, # always copies. b = a.astype('i4') assert_equal(a, b) assert_equal(b.dtype, np.dtype('i4')) assert_equal(a.strides, b.strides) b = a.T.astype('i4') assert_equal(a.T, b) assert_equal(b.dtype, np.dtype('i4')) assert_equal(a.T.strides, b.strides) b = a.astype('f4') assert_equal(a, b) assert_(not (a is b)) # copy=False parameter can sometimes skip a copy b = a.astype('f4', copy=False) assert_(a is b) # order parameter allows overriding of the memory layout, # forcing a copy if the layout is wrong b = a.astype('f4', order='F', copy=False) assert_equal(a, b) assert_(not (a is b)) assert_(b.flags.f_contiguous) b = a.astype('f4', order='C', copy=False) assert_equal(a, b) assert_(a is b) assert_(b.flags.c_contiguous) # casting parameter allows catching bad casts b = a.astype('c8', casting='safe') assert_equal(a, b) assert_equal(b.dtype, np.dtype('c8')) assert_raises(TypeError, a.astype, 'i4', casting='safe') # subok=False passes through a non-subclassed array b = a.astype('f4', subok=0, copy=False) assert_(a is b) a = np.matrix([[0, 1, 2], [3, 4, 5]], dtype='f4') # subok=True passes through a matrix b = a.astype('f4', subok=True, copy=False) assert_(a is b) # subok=True is default, and creates a subtype on a cast b = a.astype('i4', copy=False) assert_equal(a, b) assert_equal(type(b), np.matrix) # subok=False never returns a matrix b = a.astype('f4', subok=False, copy=False) assert_equal(a, b) assert_(not (a is b)) assert_(type(b) is not np.matrix) # Make sure converting from string object to fixed length string # does not truncate. a = np.array([b'a'*100], dtype='O') b = a.astype('S') assert_equal(a, b) assert_equal(b.dtype, np.dtype('S100')) a = np.array([u'a'*100], dtype='O') b = a.astype('U') assert_equal(a, b) assert_equal(b.dtype, np.dtype('U100')) # Same test as above but for strings shorter than 64 characters a = np.array([b'a'*10], dtype='O') b = a.astype('S') assert_equal(a, b) assert_equal(b.dtype, np.dtype('S10')) a = np.array([u'a'*10], dtype='O') b = a.astype('U') assert_equal(a, b) assert_equal(b.dtype, np.dtype('U10')) a = np.array(123456789012345678901234567890, dtype='O').astype('S') assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30')) a = np.array(123456789012345678901234567890, dtype='O').astype('U') assert_array_equal(a, np.array(u'1234567890' * 3, dtype='U30')) a = np.array([123456789012345678901234567890], dtype='O').astype('S') assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30')) a = np.array([123456789012345678901234567890], dtype='O').astype('U') assert_array_equal(a, np.array(u'1234567890' * 3, dtype='U30')) a = np.array(123456789012345678901234567890, dtype='S') assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30')) a = np.array(123456789012345678901234567890, dtype='U') assert_array_equal(a, np.array(u'1234567890' * 3, dtype='U30')) a = np.array(u'a\u0140', dtype='U') b = np.ndarray(buffer=a, dtype='uint32', shape=2) assert_(b.size == 2) a = np.array([1000], dtype='i4') assert_raises(TypeError, a.astype, 'S1', casting='safe') a = np.array(1000, dtype='i4') assert_raises(TypeError, a.astype, 'U1', casting='safe') def test_copyto_fromscalar(): a = np.arange(6, dtype='f4').reshape(2, 3) # Simple copy np.copyto(a, 1.5) assert_equal(a, 1.5) np.copyto(a.T, 2.5) assert_equal(a, 2.5) # Where-masked copy mask = np.array([[0, 1, 0], [0, 0, 1]], dtype='?') np.copyto(a, 3.5, where=mask) assert_equal(a, [[2.5, 3.5, 2.5], [2.5, 2.5, 3.5]]) mask = np.array([[0, 1], [1, 1], [1, 0]], dtype='?') np.copyto(a.T, 4.5, where=mask) assert_equal(a, [[2.5, 4.5, 4.5], [4.5, 4.5, 3.5]]) def test_copyto(): a = np.arange(6, dtype='i4').reshape(2, 3) # Simple copy np.copyto(a, [[3, 1, 5], [6, 2, 1]]) assert_equal(a, [[3, 1, 5], [6, 2, 1]]) # Overlapping copy should work np.copyto(a[:, :2], a[::-1, 1::-1]) assert_equal(a, [[2, 6, 5], [1, 3, 1]]) # Defaults to 'same_kind' casting assert_raises(TypeError, np.copyto, a, 1.5) # Force a copy with 'unsafe' casting, truncating 1.5 to 1 np.copyto(a, 1.5, casting='unsafe') assert_equal(a, 1) # Copying with a mask np.copyto(a, 3, where=[True, False, True]) assert_equal(a, [[3, 1, 3], [3, 1, 3]]) # Casting rule still applies with a mask assert_raises(TypeError, np.copyto, a, 3.5, where=[True, False, True]) # Lists of integer 0's and 1's is ok too np.copyto(a, 4.0, casting='unsafe', where=[[0, 1, 1], [1, 0, 0]]) assert_equal(a, [[3, 4, 4], [4, 1, 3]]) # Overlapping copy with mask should work np.copyto(a[:, :2], a[::-1, 1::-1], where=[[0, 1], [1, 1]]) assert_equal(a, [[3, 4, 4], [4, 3, 3]]) # 'dst' must be an array assert_raises(TypeError, np.copyto, [1, 2, 3], [2, 3, 4]) def test_copyto_permut(): # test explicit overflow case pad = 500 l = [True] * pad + [True, True, True, True] r = np.zeros(len(l)-pad) d = np.ones(len(l)-pad) mask = np.array(l)[pad:] np.copyto(r, d, where=mask[::-1]) # test all permutation of possible masks, 9 should be sufficient for # current 4 byte unrolled code power = 9 d = np.ones(power) for i in range(2**power): r = np.zeros(power) l = [(i & x) != 0 for x in range(power)] mask = np.array(l) np.copyto(r, d, where=mask) assert_array_equal(r == 1, l) assert_equal(r.sum(), sum(l)) r = np.zeros(power) np.copyto(r, d, where=mask[::-1]) assert_array_equal(r == 1, l[::-1]) assert_equal(r.sum(), sum(l)) r = np.zeros(power) np.copyto(r[::2], d[::2], where=mask[::2]) assert_array_equal(r[::2] == 1, l[::2]) assert_equal(r[::2].sum(), sum(l[::2])) r = np.zeros(power) np.copyto(r[::2], d[::2], where=mask[::-2]) assert_array_equal(r[::2] == 1, l[::-2]) assert_equal(r[::2].sum(), sum(l[::-2])) for c in [0xFF, 0x7F, 0x02, 0x10]: r = np.zeros(power) mask = np.array(l) imask = np.array(l).view(np.uint8) imask[mask != 0] = c np.copyto(r, d, where=mask) assert_array_equal(r == 1, l) assert_equal(r.sum(), sum(l)) r = np.zeros(power) np.copyto(r, d, where=True) assert_equal(r.sum(), r.size) r = np.ones(power) d = np.zeros(power) np.copyto(r, d, where=False) assert_equal(r.sum(), r.size) def test_copy_order(): a = np.arange(24).reshape(2, 1, 3, 4) b = a.copy(order='F') c = np.arange(24).reshape(2, 1, 4, 3).swapaxes(2, 3) def check_copy_result(x, y, ccontig, fcontig, strides=False): assert_(not (x is y)) assert_equal(x, y) assert_equal(res.flags.c_contiguous, ccontig) assert_equal(res.flags.f_contiguous, fcontig) # This check is impossible only because # NPY_RELAXED_STRIDES_CHECKING changes the strides actively if not NPY_RELAXED_STRIDES_CHECKING: if strides: assert_equal(x.strides, y.strides) else: assert_(x.strides != y.strides) # Validate the initial state of a, b, and c assert_(a.flags.c_contiguous) assert_(not a.flags.f_contiguous) assert_(not b.flags.c_contiguous) assert_(b.flags.f_contiguous) assert_(not c.flags.c_contiguous) assert_(not c.flags.f_contiguous) # Copy with order='C' res = a.copy(order='C') check_copy_result(res, a, ccontig=True, fcontig=False, strides=True) res = b.copy(order='C') check_copy_result(res, b, ccontig=True, fcontig=False, strides=False) res = c.copy(order='C') check_copy_result(res, c, ccontig=True, fcontig=False, strides=False) res = np.copy(a, order='C') check_copy_result(res, a, ccontig=True, fcontig=False, strides=True) res = np.copy(b, order='C') check_copy_result(res, b, ccontig=True, fcontig=False, strides=False) res = np.copy(c, order='C') check_copy_result(res, c, ccontig=True, fcontig=False, strides=False) # Copy with order='F' res = a.copy(order='F') check_copy_result(res, a, ccontig=False, fcontig=True, strides=False) res = b.copy(order='F') check_copy_result(res, b, ccontig=False, fcontig=True, strides=True) res = c.copy(order='F') check_copy_result(res, c, ccontig=False, fcontig=True, strides=False) res = np.copy(a, order='F') check_copy_result(res, a, ccontig=False, fcontig=True, strides=False) res = np.copy(b, order='F') check_copy_result(res, b, ccontig=False, fcontig=True, strides=True) res = np.copy(c, order='F') check_copy_result(res, c, ccontig=False, fcontig=True, strides=False) # Copy with order='K' res = a.copy(order='K') check_copy_result(res, a, ccontig=True, fcontig=False, strides=True) res = b.copy(order='K') check_copy_result(res, b, ccontig=False, fcontig=True, strides=True) res = c.copy(order='K') check_copy_result(res, c, ccontig=False, fcontig=False, strides=True) res = np.copy(a, order='K') check_copy_result(res, a, ccontig=True, fcontig=False, strides=True) res = np.copy(b, order='K') check_copy_result(res, b, ccontig=False, fcontig=True, strides=True) res = np.copy(c, order='K') check_copy_result(res, c, ccontig=False, fcontig=False, strides=True) def test_contiguous_flags(): a = np.ones((4, 4, 1))[::2,:,:] if NPY_RELAXED_STRIDES_CHECKING: a.strides = a.strides[:2] + (-123,) b = np.ones((2, 2, 1, 2, 2)).swapaxes(3, 4) def check_contig(a, ccontig, fcontig): assert_(a.flags.c_contiguous == ccontig) assert_(a.flags.f_contiguous == fcontig) # Check if new arrays are correct: check_contig(a, False, False) check_contig(b, False, False) if NPY_RELAXED_STRIDES_CHECKING: check_contig(np.empty((2, 2, 0, 2, 2)), True, True) check_contig(np.array([[[1], [2]]], order='F'), True, True) else: check_contig(np.empty((2, 2, 0, 2, 2)), True, False) check_contig(np.array([[[1], [2]]], order='F'), False, True) check_contig(np.empty((2, 2)), True, False) check_contig(np.empty((2, 2), order='F'), False, True) # Check that np.array creates correct contiguous flags: check_contig(np.array(a, copy=False), False, False) check_contig(np.array(a, copy=False, order='C'), True, False) check_contig(np.array(a, ndmin=4, copy=False, order='F'), False, True) if NPY_RELAXED_STRIDES_CHECKING: # Check slicing update of flags and : check_contig(a[0], True, True) check_contig(a[None, ::4, ..., None], True, True) check_contig(b[0, 0, ...], False, True) check_contig(b[:,:, 0:0,:,:], True, True) else: # Check slicing update of flags: check_contig(a[0], True, False) # Would be nice if this was C-Contiguous: check_contig(a[None, 0, ..., None], False, False) check_contig(b[0, 0, 0, ...], False, True) # Test ravel and squeeze. check_contig(a.ravel(), True, True) check_contig(np.ones((1, 3, 1)).squeeze(), True, True) def test_broadcast_arrays(): # Test user defined dtypes a = np.array([(1, 2, 3)], dtype='u4,u4,u4') b = np.array([(1, 2, 3), (4, 5, 6), (7, 8, 9)], dtype='u4,u4,u4') result = np.broadcast_arrays(a, b) assert_equal(result[0], np.array([(1, 2, 3), (1, 2, 3), (1, 2, 3)], dtype='u4,u4,u4')) assert_equal(result[1], np.array([(1, 2, 3), (4, 5, 6), (7, 8, 9)], dtype='u4,u4,u4')) if __name__ == "__main__": run_module_suite()
18,906
35.5
90
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_deprecations.py
""" Tests related to deprecation warnings. Also a convenient place to document how deprecations should eventually be turned into errors. """ from __future__ import division, absolute_import, print_function import datetime import sys import operator import warnings import numpy as np from numpy.testing import ( run_module_suite, assert_raises, assert_warns, assert_no_warnings, assert_array_equal, assert_, dec) try: import pytz _has_pytz = True except ImportError: _has_pytz = False class _DeprecationTestCase(object): # Just as warning: warnings uses re.match, so the start of this message # must match. message = '' warning_cls = DeprecationWarning def setup(self): self.warn_ctx = warnings.catch_warnings(record=True) self.log = self.warn_ctx.__enter__() # Do *not* ignore other DeprecationWarnings. Ignoring warnings # can give very confusing results because of # http://bugs.python.org/issue4180 and it is probably simplest to # try to keep the tests cleanly giving only the right warning type. # (While checking them set to "error" those are ignored anyway) # We still have them show up, because otherwise they would be raised warnings.filterwarnings("always", category=self.warning_cls) warnings.filterwarnings("always", message=self.message, category=self.warning_cls) def teardown(self): self.warn_ctx.__exit__() def assert_deprecated(self, function, num=1, ignore_others=False, function_fails=False, exceptions=np._NoValue, args=(), kwargs={}): """Test if DeprecationWarnings are given and raised. This first checks if the function when called gives `num` DeprecationWarnings, after that it tries to raise these DeprecationWarnings and compares them with `exceptions`. The exceptions can be different for cases where this code path is simply not anticipated and the exception is replaced. Parameters ---------- function : callable The function to test num : int Number of DeprecationWarnings to expect. This should normally be 1. ignore_others : bool Whether warnings of the wrong type should be ignored (note that the message is not checked) function_fails : bool If the function would normally fail, setting this will check for warnings inside a try/except block. exceptions : Exception or tuple of Exceptions Exception to expect when turning the warnings into an error. The default checks for DeprecationWarnings. If exceptions is empty the function is expected to run successfully. args : tuple Arguments for `function` kwargs : dict Keyword arguments for `function` """ # reset the log self.log[:] = [] if exceptions is np._NoValue: exceptions = (self.warning_cls,) try: function(*args, **kwargs) except (Exception if function_fails else tuple()): pass # just in case, clear the registry num_found = 0 for warning in self.log: if warning.category is self.warning_cls: num_found += 1 elif not ignore_others: raise AssertionError( "expected %s but got: %s" % (self.warning_cls.__name__, warning.category)) if num is not None and num_found != num: msg = "%i warnings found but %i expected." % (len(self.log), num) lst = [str(w.category) for w in self.log] raise AssertionError("\n".join([msg] + lst)) with warnings.catch_warnings(): warnings.filterwarnings("error", message=self.message, category=self.warning_cls) try: function(*args, **kwargs) if exceptions != tuple(): raise AssertionError( "No error raised during function call") except exceptions: if exceptions == tuple(): raise AssertionError( "Error raised during function call") def assert_not_deprecated(self, function, args=(), kwargs={}): """Test that warnings are not raised. This is just a shorthand for: self.assert_deprecated(function, num=0, ignore_others=True, exceptions=tuple(), args=args, kwargs=kwargs) """ self.assert_deprecated(function, num=0, ignore_others=True, exceptions=tuple(), args=args, kwargs=kwargs) class _VisibleDeprecationTestCase(_DeprecationTestCase): warning_cls = np.VisibleDeprecationWarning class TestRankDeprecation(_DeprecationTestCase): """Test that np.rank is deprecated. The function should simply be removed. The VisibleDeprecationWarning may become unnecessary. """ def test(self): a = np.arange(10) assert_warns(np.VisibleDeprecationWarning, np.rank, a) class TestComparisonDeprecations(_DeprecationTestCase): """This tests the deprecation, for non-element-wise comparison logic. This used to mean that when an error occurred during element-wise comparison (i.e. broadcasting) NotImplemented was returned, but also in the comparison itself, False was given instead of the error. Also test FutureWarning for the None comparison. """ message = "elementwise.* comparison failed; .*" def test_normal_types(self): for op in (operator.eq, operator.ne): # Broadcasting errors: self.assert_deprecated(op, args=(np.zeros(3), [])) a = np.zeros(3, dtype='i,i') # (warning is issued a couple of times here) self.assert_deprecated(op, args=(a, a[:-1]), num=None) # Element comparison error (numpy array can't be compared). a = np.array([1, np.array([1,2,3])], dtype=object) b = np.array([1, np.array([1,2,3])], dtype=object) self.assert_deprecated(op, args=(a, b), num=None) def test_string(self): # For two string arrays, strings always raised the broadcasting error: a = np.array(['a', 'b']) b = np.array(['a', 'b', 'c']) assert_raises(ValueError, lambda x, y: x == y, a, b) # The empty list is not cast to string, as this is only to document # that fact (it likely should be changed). This means that the # following works (and returns False) due to dtype mismatch: a == [] def test_void_dtype_equality_failures(self): class NotArray(object): def __array__(self): raise TypeError # Needed so Python 3 does not raise DeprecationWarning twice. def __ne__(self, other): return NotImplemented self.assert_deprecated(lambda: np.arange(2) == NotArray()) self.assert_deprecated(lambda: np.arange(2) != NotArray()) struct1 = np.zeros(2, dtype="i4,i4") struct2 = np.zeros(2, dtype="i4,i4,i4") assert_warns(FutureWarning, lambda: struct1 == 1) assert_warns(FutureWarning, lambda: struct1 == struct2) assert_warns(FutureWarning, lambda: struct1 != 1) assert_warns(FutureWarning, lambda: struct1 != struct2) def test_array_richcompare_legacy_weirdness(self): # It doesn't really work to use assert_deprecated here, b/c part of # the point of assert_deprecated is to check that when warnings are # set to "error" mode then the error is propagated -- which is good! # But here we are testing a bunch of code that is deprecated *because* # it has the habit of swallowing up errors and converting them into # different warnings. So assert_warns will have to be sufficient. assert_warns(FutureWarning, lambda: np.arange(2) == "a") assert_warns(FutureWarning, lambda: np.arange(2) != "a") # No warning for scalar comparisons with warnings.catch_warnings(): warnings.filterwarnings("error") assert_(not (np.array(0) == "a")) assert_(np.array(0) != "a") assert_(not (np.int16(0) == "a")) assert_(np.int16(0) != "a") for arg1 in [np.asarray(0), np.int16(0)]: struct = np.zeros(2, dtype="i4,i4") for arg2 in [struct, "a"]: for f in [operator.lt, operator.le, operator.gt, operator.ge]: if sys.version_info[0] >= 3: # py3 with warnings.catch_warnings() as l: warnings.filterwarnings("always") assert_raises(TypeError, f, arg1, arg2) assert_(not l) else: # py2 assert_warns(DeprecationWarning, f, arg1, arg2) class TestDatetime64Timezone(_DeprecationTestCase): """Parsing of datetime64 with timezones deprecated in 1.11.0, because datetime64 is now timezone naive rather than UTC only. It will be quite a while before we can remove this, because, at the very least, a lot of existing code uses the 'Z' modifier to avoid conversion from local time to UTC, even if otherwise it handles time in a timezone naive fashion. """ def test_string(self): self.assert_deprecated(np.datetime64, args=('2000-01-01T00+01',)) self.assert_deprecated(np.datetime64, args=('2000-01-01T00Z',)) @dec.skipif(not _has_pytz, "The pytz module is not available.") def test_datetime(self): tz = pytz.timezone('US/Eastern') dt = datetime.datetime(2000, 1, 1, 0, 0, tzinfo=tz) self.assert_deprecated(np.datetime64, args=(dt,)) class TestNonCContiguousViewDeprecation(_DeprecationTestCase): """View of non-C-contiguous arrays deprecated in 1.11.0. The deprecation will not be raised for arrays that are both C and F contiguous, as C contiguous is dominant. There are more such arrays with relaxed stride checking than without so the deprecation is not as visible with relaxed stride checking in force. """ def test_fortran_contiguous(self): self.assert_deprecated(np.ones((2,2)).T.view, args=(complex,)) self.assert_deprecated(np.ones((2,2)).T.view, args=(np.int8,)) class TestInvalidOrderParameterInputForFlattenArrayDeprecation(_DeprecationTestCase): """Invalid arguments to the ORDER parameter in array.flatten() should not be allowed and should raise an error. However, in the interests of not breaking code that may inadvertently pass invalid arguments to this parameter, a DeprecationWarning will be issued instead for the time being to give developers time to refactor relevant code. """ def test_flatten_array_non_string_arg(self): x = np.zeros((3, 5)) self.message = ("Non-string object detected for " "the array ordering. Please pass " "in 'C', 'F', 'A', or 'K' instead") self.assert_deprecated(x.flatten, args=(np.pi,)) def test_flatten_array_invalid_string_arg(self): # Tests that a DeprecationWarning is raised # when a string of length greater than one # starting with "C", "F", "A", or "K" (case- # and unicode-insensitive) is passed in for # the ORDER parameter. Otherwise, a TypeError # will be raised! x = np.zeros((3, 5)) self.message = ("Non length-one string passed " "in for the array ordering. Please " "pass in 'C', 'F', 'A', or 'K' instead") self.assert_deprecated(x.flatten, args=("FACK",)) class TestArrayDataAttributeAssignmentDeprecation(_DeprecationTestCase): """Assigning the 'data' attribute of an ndarray is unsafe as pointed out in gh-7093. Eventually, such assignment should NOT be allowed, but in the interests of maintaining backwards compatibility, only a Deprecation- Warning will be raised instead for the time being to give developers time to refactor relevant code. """ def test_data_attr_assignment(self): a = np.arange(10) b = np.linspace(0, 1, 10) self.message = ("Assigning the 'data' attribute is an " "inherently unsafe operation and will " "be removed in the future.") self.assert_deprecated(a.__setattr__, args=('data', b.data)) class TestLinspaceInvalidNumParameter(_DeprecationTestCase): """Argument to the num parameter in linspace that cannot be safely interpreted as an integer is deprecated in 1.12.0. Argument to the num parameter in linspace that cannot be safely interpreted as an integer should not be allowed. In the interest of not breaking code that passes an argument that could still be interpreted as an integer, a DeprecationWarning will be issued for the time being to give developers time to refactor relevant code. """ def test_float_arg(self): # 2016-02-25, PR#7328 self.assert_deprecated(np.linspace, args=(0, 10, 2.5)) class TestBinaryReprInsufficientWidthParameterForRepresentation(_DeprecationTestCase): """ If a 'width' parameter is passed into ``binary_repr`` that is insufficient to represent the number in base 2 (positive) or 2's complement (negative) form, the function used to silently ignore the parameter and return a representation using the minimal number of bits needed for the form in question. Such behavior is now considered unsafe from a user perspective and will raise an error in the future. """ def test_insufficient_width_positive(self): args = (10,) kwargs = {'width': 2} self.message = ("Insufficient bit width provided. This behavior " "will raise an error in the future.") self.assert_deprecated(np.binary_repr, args=args, kwargs=kwargs) def test_insufficient_width_negative(self): args = (-5,) kwargs = {'width': 2} self.message = ("Insufficient bit width provided. This behavior " "will raise an error in the future.") self.assert_deprecated(np.binary_repr, args=args, kwargs=kwargs) class TestNumericStyleTypecodes(_DeprecationTestCase): """ Deprecate the old numeric-style dtypes, which are especially confusing for complex types, e.g. Complex32 -> complex64. When the deprecation cycle is complete, the check for the strings should be removed from PyArray_DescrConverter in descriptor.c, and the deprecated keys should not be added as capitalized aliases in _add_aliases in numerictypes.py. """ def test_all_dtypes(self): deprecated_types = [ 'Bool', 'Complex32', 'Complex64', 'Float16', 'Float32', 'Float64', 'Int8', 'Int16', 'Int32', 'Int64', 'Object0', 'Timedelta64', 'UInt8', 'UInt16', 'UInt32', 'UInt64', 'Void0' ] if sys.version_info[0] < 3: deprecated_types.extend(['Unicode0', 'String0']) for dt in deprecated_types: self.assert_deprecated(np.dtype, exceptions=(TypeError,), args=(dt,)) class TestTestDeprecated(object): def test_assert_deprecated(self): test_case_instance = _DeprecationTestCase() test_case_instance.setup() assert_raises(AssertionError, test_case_instance.assert_deprecated, lambda: None) def foo(): warnings.warn("foo", category=DeprecationWarning, stacklevel=2) test_case_instance.assert_deprecated(foo) test_case_instance.teardown() class TestClassicIntDivision(_DeprecationTestCase): """ See #7949. Deprecate the numeric-style dtypes with -3 flag in python 2 if used for division List of data types: http://docs.scipy.org/doc/numpy/user/basics.types.html """ def test_int_dtypes(self): #scramble types and do some mix and match testing deprecated_types = [ 'bool_', 'int_', 'intc', 'uint8', 'int8', 'uint64', 'int32', 'uint16', 'intp', 'int64', 'uint32', 'int16' ] if sys.version_info[0] < 3 and sys.py3kwarning: import operator as op dt2 = 'bool_' for dt1 in deprecated_types: a = np.array([1,2,3], dtype=dt1) b = np.array([1,2,3], dtype=dt2) self.assert_deprecated(op.div, args=(a,b)) dt2 = dt1 class TestNonNumericConjugate(_DeprecationTestCase): """ Deprecate no-op behavior of ndarray.conjugate on non-numeric dtypes, which conflicts with the error behavior of np.conjugate. """ def test_conjugate(self): for a in np.array(5), np.array(5j): self.assert_not_deprecated(a.conjugate) for a in (np.array('s'), np.array('2016', 'M'), np.array((1, 2), [('a', int), ('b', int)])): self.assert_deprecated(a.conjugate) class TestNPY_CHAR(_DeprecationTestCase): # 2017-05-03, 1.13.0 def test_npy_char_deprecation(self): from numpy.core.multiarray_tests import npy_char_deprecation self.assert_deprecated(npy_char_deprecation) assert_(npy_char_deprecation() == 'S1') class Test_UPDATEIFCOPY(_DeprecationTestCase): """ v1.14 deprecates creating an array with the UPDATEIFCOPY flag, use WRITEBACKIFCOPY instead """ def test_npy_updateifcopy_deprecation(self): from numpy.core.multiarray_tests import npy_updateifcopy_deprecation arr = np.arange(9).reshape(3, 3) v = arr.T self.assert_deprecated(npy_updateifcopy_deprecation, args=(v,)) class TestDatetimeEvent(_DeprecationTestCase): # 2017-08-11, 1.14.0 def test_3_tuple(self): for cls in (np.datetime64, np.timedelta64): # two valid uses - (unit, num) and (unit, num, den, None) self.assert_not_deprecated(cls, args=(1, ('ms', 2))) self.assert_not_deprecated(cls, args=(1, ('ms', 2, 1, None))) # trying to use the event argument, removed in 1.7.0, is deprecated # it used to be a uint8 self.assert_deprecated(cls, args=(1, ('ms', 2, 'event'))) self.assert_deprecated(cls, args=(1, ('ms', 2, 63))) self.assert_deprecated(cls, args=(1, ('ms', 2, 1, 'event'))) self.assert_deprecated(cls, args=(1, ('ms', 2, 1, 63))) class TestTruthTestingEmptyArrays(_DeprecationTestCase): # 2017-09-25, 1.14.0 message = '.*truth value of an empty array is ambiguous.*' def test_1d(self): self.assert_deprecated(bool, args=(np.array([]),)) def test_2d(self): self.assert_deprecated(bool, args=(np.zeros((1, 0)),)) self.assert_deprecated(bool, args=(np.zeros((0, 1)),)) self.assert_deprecated(bool, args=(np.zeros((0, 0)),)) class TestBincount(_DeprecationTestCase): # 2017-06-01, 1.14.0 def test_bincount_minlength(self): self.assert_deprecated(lambda: np.bincount([1, 2, 3], minlength=None)) if __name__ == "__main__": run_module_suite()
19,598
39.32716
91
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_indexerrors.py
from __future__ import division, absolute_import, print_function import numpy as np from numpy.testing import run_module_suite, assert_raises class TestIndexErrors(object): '''Tests to exercise indexerrors not covered by other tests.''' def test_arraytypes_fasttake(self): 'take from a 0-length dimension' x = np.empty((2, 3, 0, 4)) assert_raises(IndexError, x.take, [0], axis=2) assert_raises(IndexError, x.take, [1], axis=2) assert_raises(IndexError, x.take, [0], axis=2, mode='wrap') assert_raises(IndexError, x.take, [0], axis=2, mode='clip') def test_take_from_object(self): # Check exception taking from object array d = np.zeros(5, dtype=object) assert_raises(IndexError, d.take, [6]) # Check exception taking from 0-d array d = np.zeros((5, 0), dtype=object) assert_raises(IndexError, d.take, [1], axis=1) assert_raises(IndexError, d.take, [0], axis=1) assert_raises(IndexError, d.take, [0]) assert_raises(IndexError, d.take, [0], mode='wrap') assert_raises(IndexError, d.take, [0], mode='clip') def test_multiindex_exceptions(self): a = np.empty(5, dtype=object) assert_raises(IndexError, a.item, 20) a = np.empty((5, 0), dtype=object) assert_raises(IndexError, a.item, (0, 0)) a = np.empty(5, dtype=object) assert_raises(IndexError, a.itemset, 20, 0) a = np.empty((5, 0), dtype=object) assert_raises(IndexError, a.itemset, (0, 0), 0) def test_put_exceptions(self): a = np.zeros((5, 5)) assert_raises(IndexError, a.put, 100, 0) a = np.zeros((5, 5), dtype=object) assert_raises(IndexError, a.put, 100, 0) a = np.zeros((5, 5, 0)) assert_raises(IndexError, a.put, 100, 0) a = np.zeros((5, 5, 0), dtype=object) assert_raises(IndexError, a.put, 100, 0) def test_iterators_exceptions(self): "cases in iterators.c" def assign(obj, ind, val): obj[ind] = val a = np.zeros([1, 2, 3]) assert_raises(IndexError, lambda: a[0, 5, None, 2]) assert_raises(IndexError, lambda: a[0, 5, 0, 2]) assert_raises(IndexError, lambda: assign(a, (0, 5, None, 2), 1)) assert_raises(IndexError, lambda: assign(a, (0, 5, 0, 2), 1)) a = np.zeros([1, 0, 3]) assert_raises(IndexError, lambda: a[0, 0, None, 2]) assert_raises(IndexError, lambda: assign(a, (0, 0, None, 2), 1)) a = np.zeros([1, 2, 3]) assert_raises(IndexError, lambda: a.flat[10]) assert_raises(IndexError, lambda: assign(a.flat, 10, 5)) a = np.zeros([1, 0, 3]) assert_raises(IndexError, lambda: a.flat[10]) assert_raises(IndexError, lambda: assign(a.flat, 10, 5)) a = np.zeros([1, 2, 3]) assert_raises(IndexError, lambda: a.flat[np.array(10)]) assert_raises(IndexError, lambda: assign(a.flat, np.array(10), 5)) a = np.zeros([1, 0, 3]) assert_raises(IndexError, lambda: a.flat[np.array(10)]) assert_raises(IndexError, lambda: assign(a.flat, np.array(10), 5)) a = np.zeros([1, 2, 3]) assert_raises(IndexError, lambda: a.flat[np.array([10])]) assert_raises(IndexError, lambda: assign(a.flat, np.array([10]), 5)) a = np.zeros([1, 0, 3]) assert_raises(IndexError, lambda: a.flat[np.array([10])]) assert_raises(IndexError, lambda: assign(a.flat, np.array([10]), 5)) def test_mapping(self): "cases from mapping.c" def assign(obj, ind, val): obj[ind] = val a = np.zeros((0, 10)) assert_raises(IndexError, lambda: a[12]) a = np.zeros((3, 5)) assert_raises(IndexError, lambda: a[(10, 20)]) assert_raises(IndexError, lambda: assign(a, (10, 20), 1)) a = np.zeros((3, 0)) assert_raises(IndexError, lambda: a[(1, 0)]) assert_raises(IndexError, lambda: assign(a, (1, 0), 1)) a = np.zeros((10,)) assert_raises(IndexError, lambda: assign(a, 10, 1)) a = np.zeros((0,)) assert_raises(IndexError, lambda: assign(a, 10, 1)) a = np.zeros((3, 5)) assert_raises(IndexError, lambda: a[(1, [1, 20])]) assert_raises(IndexError, lambda: assign(a, (1, [1, 20]), 1)) a = np.zeros((3, 0)) assert_raises(IndexError, lambda: a[(1, [0, 1])]) assert_raises(IndexError, lambda: assign(a, (1, [0, 1]), 1)) def test_methods(self): "cases from methods.c" a = np.zeros((3, 3)) assert_raises(IndexError, lambda: a.item(100)) assert_raises(IndexError, lambda: a.itemset(100, 1)) a = np.zeros((0, 3)) assert_raises(IndexError, lambda: a.item(100)) assert_raises(IndexError, lambda: a.itemset(100, 1)) if __name__ == "__main__": run_module_suite()
4,926
37.795276
76
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_half.py
from __future__ import division, absolute_import, print_function import platform import numpy as np from numpy import uint16, float16, float32, float64 from numpy.testing import run_module_suite, assert_, assert_equal, dec def assert_raises_fpe(strmatch, callable, *args, **kwargs): try: callable(*args, **kwargs) except FloatingPointError as exc: assert_(str(exc).find(strmatch) >= 0, "Did not raise floating point %s error" % strmatch) else: assert_(False, "Did not raise floating point %s error" % strmatch) class TestHalf(object): def setup(self): # An array of all possible float16 values self.all_f16 = np.arange(0x10000, dtype=uint16) self.all_f16.dtype = float16 self.all_f32 = np.array(self.all_f16, dtype=float32) self.all_f64 = np.array(self.all_f16, dtype=float64) # An array of all non-NaN float16 values, in sorted order self.nonan_f16 = np.concatenate( (np.arange(0xfc00, 0x7fff, -1, dtype=uint16), np.arange(0x0000, 0x7c01, 1, dtype=uint16))) self.nonan_f16.dtype = float16 self.nonan_f32 = np.array(self.nonan_f16, dtype=float32) self.nonan_f64 = np.array(self.nonan_f16, dtype=float64) # An array of all finite float16 values, in sorted order self.finite_f16 = self.nonan_f16[1:-1] self.finite_f32 = self.nonan_f32[1:-1] self.finite_f64 = self.nonan_f64[1:-1] def test_half_conversions(self): """Checks that all 16-bit values survive conversion to/from 32-bit and 64-bit float""" # Because the underlying routines preserve the NaN bits, every # value is preserved when converting to/from other floats. # Convert from float32 back to float16 b = np.array(self.all_f32, dtype=float16) assert_equal(self.all_f16.view(dtype=uint16), b.view(dtype=uint16)) # Convert from float64 back to float16 b = np.array(self.all_f64, dtype=float16) assert_equal(self.all_f16.view(dtype=uint16), b.view(dtype=uint16)) # Convert float16 to longdouble and back # This doesn't necessarily preserve the extra NaN bits, # so exclude NaNs. a_ld = np.array(self.nonan_f16, dtype=np.longdouble) b = np.array(a_ld, dtype=float16) assert_equal(self.nonan_f16.view(dtype=uint16), b.view(dtype=uint16)) # Check the range for which all integers can be represented i_int = np.arange(-2048, 2049) i_f16 = np.array(i_int, dtype=float16) j = np.array(i_f16, dtype=int) assert_equal(i_int, j) def test_nans_infs(self): with np.errstate(all='ignore'): # Check some of the ufuncs assert_equal(np.isnan(self.all_f16), np.isnan(self.all_f32)) assert_equal(np.isinf(self.all_f16), np.isinf(self.all_f32)) assert_equal(np.isfinite(self.all_f16), np.isfinite(self.all_f32)) assert_equal(np.signbit(self.all_f16), np.signbit(self.all_f32)) assert_equal(np.spacing(float16(65504)), np.inf) # Check comparisons of all values with NaN nan = float16(np.nan) assert_(not (self.all_f16 == nan).any()) assert_(not (nan == self.all_f16).any()) assert_((self.all_f16 != nan).all()) assert_((nan != self.all_f16).all()) assert_(not (self.all_f16 < nan).any()) assert_(not (nan < self.all_f16).any()) assert_(not (self.all_f16 <= nan).any()) assert_(not (nan <= self.all_f16).any()) assert_(not (self.all_f16 > nan).any()) assert_(not (nan > self.all_f16).any()) assert_(not (self.all_f16 >= nan).any()) assert_(not (nan >= self.all_f16).any()) def test_half_values(self): """Confirms a small number of known half values""" a = np.array([1.0, -1.0, 2.0, -2.0, 0.0999755859375, 0.333251953125, # 1/10, 1/3 65504, -65504, # Maximum magnitude 2.0**(-14), -2.0**(-14), # Minimum normal 2.0**(-24), -2.0**(-24), # Minimum subnormal 0, -1/1e1000, # Signed zeros np.inf, -np.inf]) b = np.array([0x3c00, 0xbc00, 0x4000, 0xc000, 0x2e66, 0x3555, 0x7bff, 0xfbff, 0x0400, 0x8400, 0x0001, 0x8001, 0x0000, 0x8000, 0x7c00, 0xfc00], dtype=uint16) b.dtype = float16 assert_equal(a, b) def test_half_rounding(self): """Checks that rounding when converting to half is correct""" a = np.array([2.0**-25 + 2.0**-35, # Rounds to minimum subnormal 2.0**-25, # Underflows to zero (nearest even mode) 2.0**-26, # Underflows to zero 1.0+2.0**-11 + 2.0**-16, # rounds to 1.0+2**(-10) 1.0+2.0**-11, # rounds to 1.0 (nearest even mode) 1.0+2.0**-12, # rounds to 1.0 65519, # rounds to 65504 65520], # rounds to inf dtype=float64) rounded = [2.0**-24, 0.0, 0.0, 1.0+2.0**(-10), 1.0, 1.0, 65504, np.inf] # Check float64->float16 rounding b = np.array(a, dtype=float16) assert_equal(b, rounded) # Check float32->float16 rounding a = np.array(a, dtype=float32) b = np.array(a, dtype=float16) assert_equal(b, rounded) def test_half_correctness(self): """Take every finite float16, and check the casting functions with a manual conversion.""" # Create an array of all finite float16s a_bits = self.finite_f16.view(dtype=uint16) # Convert to 64-bit float manually a_sgn = (-1.0)**((a_bits & 0x8000) >> 15) a_exp = np.array((a_bits & 0x7c00) >> 10, dtype=np.int32) - 15 a_man = (a_bits & 0x03ff) * 2.0**(-10) # Implicit bit of normalized floats a_man[a_exp != -15] += 1 # Denormalized exponent is -14 a_exp[a_exp == -15] = -14 a_manual = a_sgn * a_man * 2.0**a_exp a32_fail = np.nonzero(self.finite_f32 != a_manual)[0] if len(a32_fail) != 0: bad_index = a32_fail[0] assert_equal(self.finite_f32, a_manual, "First non-equal is half value %x -> %g != %g" % (self.finite_f16[bad_index], self.finite_f32[bad_index], a_manual[bad_index])) a64_fail = np.nonzero(self.finite_f64 != a_manual)[0] if len(a64_fail) != 0: bad_index = a64_fail[0] assert_equal(self.finite_f64, a_manual, "First non-equal is half value %x -> %g != %g" % (self.finite_f16[bad_index], self.finite_f64[bad_index], a_manual[bad_index])) def test_half_ordering(self): """Make sure comparisons are working right""" # All non-NaN float16 values in reverse order a = self.nonan_f16[::-1].copy() # 32-bit float copy b = np.array(a, dtype=float32) # Should sort the same a.sort() b.sort() assert_equal(a, b) # Comparisons should work assert_((a[:-1] <= a[1:]).all()) assert_(not (a[:-1] > a[1:]).any()) assert_((a[1:] >= a[:-1]).all()) assert_(not (a[1:] < a[:-1]).any()) # All != except for +/-0 assert_equal(np.nonzero(a[:-1] < a[1:])[0].size, a.size-2) assert_equal(np.nonzero(a[1:] > a[:-1])[0].size, a.size-2) def test_half_funcs(self): """Test the various ArrFuncs""" # fill assert_equal(np.arange(10, dtype=float16), np.arange(10, dtype=float32)) # fillwithscalar a = np.zeros((5,), dtype=float16) a.fill(1) assert_equal(a, np.ones((5,), dtype=float16)) # nonzero and copyswap a = np.array([0, 0, -1, -1/1e20, 0, 2.0**-24, 7.629e-6], dtype=float16) assert_equal(a.nonzero()[0], [2, 5, 6]) a = a.byteswap().newbyteorder() assert_equal(a.nonzero()[0], [2, 5, 6]) # dot a = np.arange(0, 10, 0.5, dtype=float16) b = np.ones((20,), dtype=float16) assert_equal(np.dot(a, b), 95) # argmax a = np.array([0, -np.inf, -2, 0.5, 12.55, 7.3, 2.1, 12.4], dtype=float16) assert_equal(a.argmax(), 4) a = np.array([0, -np.inf, -2, np.inf, 12.55, np.nan, 2.1, 12.4], dtype=float16) assert_equal(a.argmax(), 5) # getitem a = np.arange(10, dtype=float16) for i in range(10): assert_equal(a.item(i), i) def test_spacing_nextafter(self): """Test np.spacing and np.nextafter""" # All non-negative finite #'s a = np.arange(0x7c00, dtype=uint16) hinf = np.array((np.inf,), dtype=float16) a_f16 = a.view(dtype=float16) assert_equal(np.spacing(a_f16[:-1]), a_f16[1:]-a_f16[:-1]) assert_equal(np.nextafter(a_f16[:-1], hinf), a_f16[1:]) assert_equal(np.nextafter(a_f16[0], -hinf), -a_f16[1]) assert_equal(np.nextafter(a_f16[1:], -hinf), a_f16[:-1]) # switch to negatives a |= 0x8000 assert_equal(np.spacing(a_f16[0]), np.spacing(a_f16[1])) assert_equal(np.spacing(a_f16[1:]), a_f16[:-1]-a_f16[1:]) assert_equal(np.nextafter(a_f16[0], hinf), -a_f16[1]) assert_equal(np.nextafter(a_f16[1:], hinf), a_f16[:-1]) assert_equal(np.nextafter(a_f16[:-1], -hinf), a_f16[1:]) def test_half_ufuncs(self): """Test the various ufuncs""" a = np.array([0, 1, 2, 4, 2], dtype=float16) b = np.array([-2, 5, 1, 4, 3], dtype=float16) c = np.array([0, -1, -np.inf, np.nan, 6], dtype=float16) assert_equal(np.add(a, b), [-2, 6, 3, 8, 5]) assert_equal(np.subtract(a, b), [2, -4, 1, 0, -1]) assert_equal(np.multiply(a, b), [0, 5, 2, 16, 6]) assert_equal(np.divide(a, b), [0, 0.199951171875, 2, 1, 0.66650390625]) assert_equal(np.equal(a, b), [False, False, False, True, False]) assert_equal(np.not_equal(a, b), [True, True, True, False, True]) assert_equal(np.less(a, b), [False, True, False, False, True]) assert_equal(np.less_equal(a, b), [False, True, False, True, True]) assert_equal(np.greater(a, b), [True, False, True, False, False]) assert_equal(np.greater_equal(a, b), [True, False, True, True, False]) assert_equal(np.logical_and(a, b), [False, True, True, True, True]) assert_equal(np.logical_or(a, b), [True, True, True, True, True]) assert_equal(np.logical_xor(a, b), [True, False, False, False, False]) assert_equal(np.logical_not(a), [True, False, False, False, False]) assert_equal(np.isnan(c), [False, False, False, True, False]) assert_equal(np.isinf(c), [False, False, True, False, False]) assert_equal(np.isfinite(c), [True, True, False, False, True]) assert_equal(np.signbit(b), [True, False, False, False, False]) assert_equal(np.copysign(b, a), [2, 5, 1, 4, 3]) assert_equal(np.maximum(a, b), [0, 5, 2, 4, 3]) x = np.maximum(b, c) assert_(np.isnan(x[3])) x[3] = 0 assert_equal(x, [0, 5, 1, 0, 6]) assert_equal(np.minimum(a, b), [-2, 1, 1, 4, 2]) x = np.minimum(b, c) assert_(np.isnan(x[3])) x[3] = 0 assert_equal(x, [-2, -1, -np.inf, 0, 3]) assert_equal(np.fmax(a, b), [0, 5, 2, 4, 3]) assert_equal(np.fmax(b, c), [0, 5, 1, 4, 6]) assert_equal(np.fmin(a, b), [-2, 1, 1, 4, 2]) assert_equal(np.fmin(b, c), [-2, -1, -np.inf, 4, 3]) assert_equal(np.floor_divide(a, b), [0, 0, 2, 1, 0]) assert_equal(np.remainder(a, b), [0, 1, 0, 0, 2]) assert_equal(np.divmod(a, b), ([0, 0, 2, 1, 0], [0, 1, 0, 0, 2])) assert_equal(np.square(b), [4, 25, 1, 16, 9]) assert_equal(np.reciprocal(b), [-0.5, 0.199951171875, 1, 0.25, 0.333251953125]) assert_equal(np.ones_like(b), [1, 1, 1, 1, 1]) assert_equal(np.conjugate(b), b) assert_equal(np.absolute(b), [2, 5, 1, 4, 3]) assert_equal(np.negative(b), [2, -5, -1, -4, -3]) assert_equal(np.positive(b), b) assert_equal(np.sign(b), [-1, 1, 1, 1, 1]) assert_equal(np.modf(b), ([0, 0, 0, 0, 0], b)) assert_equal(np.frexp(b), ([-0.5, 0.625, 0.5, 0.5, 0.75], [2, 3, 1, 3, 2])) assert_equal(np.ldexp(b, [0, 1, 2, 4, 2]), [-2, 10, 4, 64, 12]) def test_half_coercion(self): """Test that half gets coerced properly with the other types""" a16 = np.array((1,), dtype=float16) a32 = np.array((1,), dtype=float32) b16 = float16(1) b32 = float32(1) assert_equal(np.power(a16, 2).dtype, float16) assert_equal(np.power(a16, 2.0).dtype, float16) assert_equal(np.power(a16, b16).dtype, float16) assert_equal(np.power(a16, b32).dtype, float16) assert_equal(np.power(a16, a16).dtype, float16) assert_equal(np.power(a16, a32).dtype, float32) assert_equal(np.power(b16, 2).dtype, float64) assert_equal(np.power(b16, 2.0).dtype, float64) assert_equal(np.power(b16, b16).dtype, float16) assert_equal(np.power(b16, b32).dtype, float32) assert_equal(np.power(b16, a16).dtype, float16) assert_equal(np.power(b16, a32).dtype, float32) assert_equal(np.power(a32, a16).dtype, float32) assert_equal(np.power(a32, b16).dtype, float32) assert_equal(np.power(b32, a16).dtype, float16) assert_equal(np.power(b32, b16).dtype, float32) @dec.skipif(platform.machine() == "armv5tel", "See gh-413.") def test_half_fpe(self): with np.errstate(all='raise'): sx16 = np.array((1e-4,), dtype=float16) bx16 = np.array((1e4,), dtype=float16) sy16 = float16(1e-4) by16 = float16(1e4) # Underflow errors assert_raises_fpe('underflow', lambda a, b:a*b, sx16, sx16) assert_raises_fpe('underflow', lambda a, b:a*b, sx16, sy16) assert_raises_fpe('underflow', lambda a, b:a*b, sy16, sx16) assert_raises_fpe('underflow', lambda a, b:a*b, sy16, sy16) assert_raises_fpe('underflow', lambda a, b:a/b, sx16, bx16) assert_raises_fpe('underflow', lambda a, b:a/b, sx16, by16) assert_raises_fpe('underflow', lambda a, b:a/b, sy16, bx16) assert_raises_fpe('underflow', lambda a, b:a/b, sy16, by16) assert_raises_fpe('underflow', lambda a, b:a/b, float16(2.**-14), float16(2**11)) assert_raises_fpe('underflow', lambda a, b:a/b, float16(-2.**-14), float16(2**11)) assert_raises_fpe('underflow', lambda a, b:a/b, float16(2.**-14+2**-24), float16(2)) assert_raises_fpe('underflow', lambda a, b:a/b, float16(-2.**-14-2**-24), float16(2)) assert_raises_fpe('underflow', lambda a, b:a/b, float16(2.**-14+2**-23), float16(4)) # Overflow errors assert_raises_fpe('overflow', lambda a, b:a*b, bx16, bx16) assert_raises_fpe('overflow', lambda a, b:a*b, bx16, by16) assert_raises_fpe('overflow', lambda a, b:a*b, by16, bx16) assert_raises_fpe('overflow', lambda a, b:a*b, by16, by16) assert_raises_fpe('overflow', lambda a, b:a/b, bx16, sx16) assert_raises_fpe('overflow', lambda a, b:a/b, bx16, sy16) assert_raises_fpe('overflow', lambda a, b:a/b, by16, sx16) assert_raises_fpe('overflow', lambda a, b:a/b, by16, sy16) assert_raises_fpe('overflow', lambda a, b:a+b, float16(65504), float16(17)) assert_raises_fpe('overflow', lambda a, b:a-b, float16(-65504), float16(17)) assert_raises_fpe('overflow', np.nextafter, float16(65504), float16(np.inf)) assert_raises_fpe('overflow', np.nextafter, float16(-65504), float16(-np.inf)) assert_raises_fpe('overflow', np.spacing, float16(65504)) # Invalid value errors assert_raises_fpe('invalid', np.divide, float16(np.inf), float16(np.inf)) assert_raises_fpe('invalid', np.spacing, float16(np.inf)) assert_raises_fpe('invalid', np.spacing, float16(np.nan)) assert_raises_fpe('invalid', np.nextafter, float16(np.inf), float16(0)) assert_raises_fpe('invalid', np.nextafter, float16(-np.inf), float16(0)) assert_raises_fpe('invalid', np.nextafter, float16(0), float16(np.nan)) # These should not raise float16(65472)+float16(32) float16(2**-13)/float16(2) float16(2**-14)/float16(2**10) np.spacing(float16(-65504)) np.nextafter(float16(65504), float16(-np.inf)) np.nextafter(float16(-65504), float16(np.inf)) float16(2**-14)/float16(2**10) float16(-2**-14)/float16(2**10) float16(2**-14+2**-23)/float16(2) float16(-2**-14-2**-23)/float16(2) def test_half_array_interface(self): """Test that half is compatible with __array_interface__""" class Dummy: pass a = np.ones((1,), dtype=float16) b = Dummy() b.__array_interface__ = a.__array_interface__ c = np.array(b) assert_(c.dtype == float16) assert_equal(a, c) if __name__ == "__main__": run_module_suite()
18,627
41.52968
90
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_memmap.py
from __future__ import division, absolute_import, print_function import sys import os import shutil from tempfile import NamedTemporaryFile, TemporaryFile, mktemp, mkdtemp import mmap from numpy import ( memmap, sum, average, product, ndarray, isscalar, add, subtract, multiply) from numpy.compat import Path from numpy import arange, allclose, asarray from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_array_equal, dec, suppress_warnings ) class TestMemmap(object): def setup(self): self.tmpfp = NamedTemporaryFile(prefix='mmap') self.tempdir = mkdtemp() self.shape = (3, 4) self.dtype = 'float32' self.data = arange(12, dtype=self.dtype) self.data.resize(self.shape) def teardown(self): self.tmpfp.close() shutil.rmtree(self.tempdir) def test_roundtrip(self): # Write data to file fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+', shape=self.shape) fp[:] = self.data[:] del fp # Test __del__ machinery, which handles cleanup # Read data back from file newfp = memmap(self.tmpfp, dtype=self.dtype, mode='r', shape=self.shape) assert_(allclose(self.data, newfp)) assert_array_equal(self.data, newfp) assert_equal(newfp.flags.writeable, False) def test_open_with_filename(self): tmpname = mktemp('', 'mmap', dir=self.tempdir) fp = memmap(tmpname, dtype=self.dtype, mode='w+', shape=self.shape) fp[:] = self.data[:] del fp def test_unnamed_file(self): with TemporaryFile() as f: fp = memmap(f, dtype=self.dtype, shape=self.shape) del fp def test_attributes(self): offset = 1 mode = "w+" fp = memmap(self.tmpfp, dtype=self.dtype, mode=mode, shape=self.shape, offset=offset) assert_equal(offset, fp.offset) assert_equal(mode, fp.mode) del fp def test_filename(self): tmpname = mktemp('', 'mmap', dir=self.tempdir) fp = memmap(tmpname, dtype=self.dtype, mode='w+', shape=self.shape) abspath = os.path.abspath(tmpname) fp[:] = self.data[:] assert_equal(abspath, fp.filename) b = fp[:1] assert_equal(abspath, b.filename) del b del fp @dec.skipif(Path is None, "No pathlib.Path") def test_path(self): tmpname = mktemp('', 'mmap', dir=self.tempdir) fp = memmap(Path(tmpname), dtype=self.dtype, mode='w+', shape=self.shape) abspath = os.path.realpath(os.path.abspath(tmpname)) fp[:] = self.data[:] assert_equal(abspath, str(fp.filename.resolve())) b = fp[:1] assert_equal(abspath, str(b.filename.resolve())) del b del fp def test_filename_fileobj(self): fp = memmap(self.tmpfp, dtype=self.dtype, mode="w+", shape=self.shape) assert_equal(fp.filename, self.tmpfp.name) @dec.knownfailureif(sys.platform == 'gnu0', "This test is known to fail on hurd") def test_flush(self): fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+', shape=self.shape) fp[:] = self.data[:] assert_equal(fp[0], self.data[0]) fp.flush() def test_del(self): # Make sure a view does not delete the underlying mmap fp_base = memmap(self.tmpfp, dtype=self.dtype, mode='w+', shape=self.shape) fp_base[0] = 5 fp_view = fp_base[0:1] assert_equal(fp_view[0], 5) del fp_view # Should still be able to access and assign values after # deleting the view assert_equal(fp_base[0], 5) fp_base[0] = 6 assert_equal(fp_base[0], 6) def test_arithmetic_drops_references(self): fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+', shape=self.shape) tmp = (fp + 10) if isinstance(tmp, memmap): assert_(tmp._mmap is not fp._mmap) def test_indexing_drops_references(self): fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+', shape=self.shape) tmp = fp[[(1, 2), (2, 3)]] if isinstance(tmp, memmap): assert_(tmp._mmap is not fp._mmap) def test_slicing_keeps_references(self): fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+', shape=self.shape) assert_(fp[:2, :2]._mmap is fp._mmap) def test_view(self): fp = memmap(self.tmpfp, dtype=self.dtype, shape=self.shape) new1 = fp.view() new2 = new1.view() assert_(new1.base is fp) assert_(new2.base is fp) new_array = asarray(fp) assert_(new_array.base is fp) def test_ufunc_return_ndarray(self): fp = memmap(self.tmpfp, dtype=self.dtype, shape=self.shape) fp[:] = self.data with suppress_warnings() as sup: sup.filter(FutureWarning, "np.average currently does not preserve") for unary_op in [sum, average, product]: result = unary_op(fp) assert_(isscalar(result)) assert_(result.__class__ is self.data[0, 0].__class__) assert_(unary_op(fp, axis=0).__class__ is ndarray) assert_(unary_op(fp, axis=1).__class__ is ndarray) for binary_op in [add, subtract, multiply]: assert_(binary_op(fp, self.data).__class__ is ndarray) assert_(binary_op(self.data, fp).__class__ is ndarray) assert_(binary_op(fp, fp).__class__ is ndarray) fp += 1 assert(fp.__class__ is memmap) add(fp, 1, out=fp) assert(fp.__class__ is memmap) def test_getitem(self): fp = memmap(self.tmpfp, dtype=self.dtype, shape=self.shape) fp[:] = self.data assert_(fp[1:, :-1].__class__ is memmap) # Fancy indexing returns a copy that is not memmapped assert_(fp[[0, 1]].__class__ is ndarray) def test_memmap_subclass(self): class MemmapSubClass(memmap): pass fp = MemmapSubClass(self.tmpfp, dtype=self.dtype, shape=self.shape) fp[:] = self.data # We keep previous behavior for subclasses of memmap, i.e. the # ufunc and __getitem__ output is never turned into a ndarray assert_(sum(fp, axis=0).__class__ is MemmapSubClass) assert_(sum(fp).__class__ is MemmapSubClass) assert_(fp[1:, :-1].__class__ is MemmapSubClass) assert(fp[[0, 1]].__class__ is MemmapSubClass) def test_mmap_offset_greater_than_allocation_granularity(self): size = 5 * mmap.ALLOCATIONGRANULARITY offset = mmap.ALLOCATIONGRANULARITY + 1 fp = memmap(self.tmpfp, shape=size, mode='w+', offset=offset) assert_(fp.offset == offset) if __name__ == "__main__": run_module_suite()
7,031
33.985075
85
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_numeric.py
from __future__ import division, absolute_import, print_function import sys import warnings import itertools import platform from decimal import Decimal import numpy as np from numpy.core import umath from numpy.random import rand, randint, randn from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_raises, assert_raises_regex, assert_array_equal, assert_almost_equal, assert_array_almost_equal, dec, HAS_REFCOUNT, suppress_warnings ) class TestResize(object): def test_copies(self): A = np.array([[1, 2], [3, 4]]) Ar1 = np.array([[1, 2, 3, 4], [1, 2, 3, 4]]) assert_equal(np.resize(A, (2, 4)), Ar1) Ar2 = np.array([[1, 2], [3, 4], [1, 2], [3, 4]]) assert_equal(np.resize(A, (4, 2)), Ar2) Ar3 = np.array([[1, 2, 3], [4, 1, 2], [3, 4, 1], [2, 3, 4]]) assert_equal(np.resize(A, (4, 3)), Ar3) def test_zeroresize(self): A = np.array([[1, 2], [3, 4]]) Ar = np.resize(A, (0,)) assert_array_equal(Ar, np.array([])) assert_equal(A.dtype, Ar.dtype) Ar = np.resize(A, (0, 2)) assert_equal(Ar.shape, (0, 2)) Ar = np.resize(A, (2, 0)) assert_equal(Ar.shape, (2, 0)) def test_reshape_from_zero(self): # See also gh-6740 A = np.zeros(0, dtype=[('a', np.float32, 1)]) Ar = np.resize(A, (2, 1)) assert_array_equal(Ar, np.zeros((2, 1), Ar.dtype)) assert_equal(A.dtype, Ar.dtype) class TestNonarrayArgs(object): # check that non-array arguments to functions wrap them in arrays def test_choose(self): choices = [[0, 1, 2], [3, 4, 5], [5, 6, 7]] tgt = [5, 1, 5] a = [2, 0, 1] out = np.choose(a, choices) assert_equal(out, tgt) def test_clip(self): arr = [-1, 5, 2, 3, 10, -4, -9] out = np.clip(arr, 2, 7) tgt = [2, 5, 2, 3, 7, 2, 2] assert_equal(out, tgt) def test_compress(self): arr = [[0, 1, 2, 3, 4], [5, 6, 7, 8, 9]] tgt = [[5, 6, 7, 8, 9]] out = np.compress([0, 1], arr, axis=0) assert_equal(out, tgt) def test_count_nonzero(self): arr = [[0, 1, 7, 0, 0], [3, 0, 0, 2, 19]] tgt = np.array([2, 3]) out = np.count_nonzero(arr, axis=1) assert_equal(out, tgt) def test_cumproduct(self): A = [[1, 2, 3], [4, 5, 6]] assert_(np.all(np.cumproduct(A) == np.array([1, 2, 6, 24, 120, 720]))) def test_diagonal(self): a = [[0, 1, 2, 3], [4, 5, 6, 7], [8, 9, 10, 11]] out = np.diagonal(a) tgt = [0, 5, 10] assert_equal(out, tgt) def test_mean(self): A = [[1, 2, 3], [4, 5, 6]] assert_(np.mean(A) == 3.5) assert_(np.all(np.mean(A, 0) == np.array([2.5, 3.5, 4.5]))) assert_(np.all(np.mean(A, 1) == np.array([2., 5.]))) with warnings.catch_warnings(record=True) as w: warnings.filterwarnings('always', '', RuntimeWarning) assert_(np.isnan(np.mean([]))) assert_(w[0].category is RuntimeWarning) def test_ptp(self): a = [3, 4, 5, 10, -3, -5, 6.0] assert_equal(np.ptp(a, axis=0), 15.0) def test_prod(self): arr = [[1, 2, 3, 4], [5, 6, 7, 9], [10, 3, 4, 5]] tgt = [24, 1890, 600] assert_equal(np.prod(arr, axis=-1), tgt) def test_ravel(self): a = [[1, 2, 3], [4, 5, 6], [7, 8, 9], [10, 11, 12]] tgt = [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12] assert_equal(np.ravel(a), tgt) def test_repeat(self): a = [1, 2, 3] tgt = [1, 1, 2, 2, 3, 3] out = np.repeat(a, 2) assert_equal(out, tgt) def test_reshape(self): arr = [[1, 2, 3], [4, 5, 6], [7, 8, 9], [10, 11, 12]] tgt = [[1, 2, 3, 4, 5, 6], [7, 8, 9, 10, 11, 12]] assert_equal(np.reshape(arr, (2, 6)), tgt) def test_round(self): arr = [1.56, 72.54, 6.35, 3.25] tgt = [1.6, 72.5, 6.4, 3.2] assert_equal(np.around(arr, decimals=1), tgt) def test_searchsorted(self): arr = [-8, -5, -1, 3, 6, 10] out = np.searchsorted(arr, 0) assert_equal(out, 3) def test_size(self): A = [[1, 2, 3], [4, 5, 6]] assert_(np.size(A) == 6) assert_(np.size(A, 0) == 2) assert_(np.size(A, 1) == 3) def test_squeeze(self): A = [[[1, 1, 1], [2, 2, 2], [3, 3, 3]]] assert_(np.squeeze(A).shape == (3, 3)) def test_std(self): A = [[1, 2, 3], [4, 5, 6]] assert_almost_equal(np.std(A), 1.707825127659933) assert_almost_equal(np.std(A, 0), np.array([1.5, 1.5, 1.5])) assert_almost_equal(np.std(A, 1), np.array([0.81649658, 0.81649658])) with warnings.catch_warnings(record=True) as w: warnings.filterwarnings('always', '', RuntimeWarning) assert_(np.isnan(np.std([]))) assert_(w[0].category is RuntimeWarning) def test_swapaxes(self): tgt = [[[0, 4], [2, 6]], [[1, 5], [3, 7]]] a = [[[0, 1], [2, 3]], [[4, 5], [6, 7]]] out = np.swapaxes(a, 0, 2) assert_equal(out, tgt) def test_sum(self): m = [[1, 2, 3], [4, 5, 6], [7, 8, 9]] tgt = [[6], [15], [24]] out = np.sum(m, axis=1, keepdims=True) assert_equal(tgt, out) def test_take(self): tgt = [2, 3, 5] indices = [1, 2, 4] a = [1, 2, 3, 4, 5] out = np.take(a, indices) assert_equal(out, tgt) def test_trace(self): c = [[1, 2], [3, 4], [5, 6]] assert_equal(np.trace(c), 5) def test_transpose(self): arr = [[1, 2], [3, 4], [5, 6]] tgt = [[1, 3, 5], [2, 4, 6]] assert_equal(np.transpose(arr, (1, 0)), tgt) def test_var(self): A = [[1, 2, 3], [4, 5, 6]] assert_almost_equal(np.var(A), 2.9166666666666665) assert_almost_equal(np.var(A, 0), np.array([2.25, 2.25, 2.25])) assert_almost_equal(np.var(A, 1), np.array([0.66666667, 0.66666667])) with warnings.catch_warnings(record=True) as w: warnings.filterwarnings('always', '', RuntimeWarning) assert_(np.isnan(np.var([]))) assert_(w[0].category is RuntimeWarning) class TestIsscalar(object): def test_isscalar(self): assert_(np.isscalar(3.1)) assert_(np.isscalar(np.int16(12345))) assert_(np.isscalar(False)) assert_(np.isscalar('numpy')) assert_(not np.isscalar([3.1])) assert_(not np.isscalar(None)) # PEP 3141 from fractions import Fraction assert_(np.isscalar(Fraction(5, 17))) from numbers import Number assert_(np.isscalar(Number())) class TestBoolScalar(object): def test_logical(self): f = np.False_ t = np.True_ s = "xyz" assert_((t and s) is s) assert_((f and s) is f) def test_bitwise_or(self): f = np.False_ t = np.True_ assert_((t | t) is t) assert_((f | t) is t) assert_((t | f) is t) assert_((f | f) is f) def test_bitwise_and(self): f = np.False_ t = np.True_ assert_((t & t) is t) assert_((f & t) is f) assert_((t & f) is f) assert_((f & f) is f) def test_bitwise_xor(self): f = np.False_ t = np.True_ assert_((t ^ t) is f) assert_((f ^ t) is t) assert_((t ^ f) is t) assert_((f ^ f) is f) class TestBoolArray(object): def setup(self): # offset for simd tests self.t = np.array([True] * 41, dtype=bool)[1::] self.f = np.array([False] * 41, dtype=bool)[1::] self.o = np.array([False] * 42, dtype=bool)[2::] self.nm = self.f.copy() self.im = self.t.copy() self.nm[3] = True self.nm[-2] = True self.im[3] = False self.im[-2] = False def test_all_any(self): assert_(self.t.all()) assert_(self.t.any()) assert_(not self.f.all()) assert_(not self.f.any()) assert_(self.nm.any()) assert_(self.im.any()) assert_(not self.nm.all()) assert_(not self.im.all()) # check bad element in all positions for i in range(256 - 7): d = np.array([False] * 256, dtype=bool)[7::] d[i] = True assert_(np.any(d)) e = np.array([True] * 256, dtype=bool)[7::] e[i] = False assert_(not np.all(e)) assert_array_equal(e, ~d) # big array test for blocked libc loops for i in list(range(9, 6000, 507)) + [7764, 90021, -10]: d = np.array([False] * 100043, dtype=bool) d[i] = True assert_(np.any(d), msg="%r" % i) e = np.array([True] * 100043, dtype=bool) e[i] = False assert_(not np.all(e), msg="%r" % i) def test_logical_not_abs(self): assert_array_equal(~self.t, self.f) assert_array_equal(np.abs(~self.t), self.f) assert_array_equal(np.abs(~self.f), self.t) assert_array_equal(np.abs(self.f), self.f) assert_array_equal(~np.abs(self.f), self.t) assert_array_equal(~np.abs(self.t), self.f) assert_array_equal(np.abs(~self.nm), self.im) np.logical_not(self.t, out=self.o) assert_array_equal(self.o, self.f) np.abs(self.t, out=self.o) assert_array_equal(self.o, self.t) def test_logical_and_or_xor(self): assert_array_equal(self.t | self.t, self.t) assert_array_equal(self.f | self.f, self.f) assert_array_equal(self.t | self.f, self.t) assert_array_equal(self.f | self.t, self.t) np.logical_or(self.t, self.t, out=self.o) assert_array_equal(self.o, self.t) assert_array_equal(self.t & self.t, self.t) assert_array_equal(self.f & self.f, self.f) assert_array_equal(self.t & self.f, self.f) assert_array_equal(self.f & self.t, self.f) np.logical_and(self.t, self.t, out=self.o) assert_array_equal(self.o, self.t) assert_array_equal(self.t ^ self.t, self.f) assert_array_equal(self.f ^ self.f, self.f) assert_array_equal(self.t ^ self.f, self.t) assert_array_equal(self.f ^ self.t, self.t) np.logical_xor(self.t, self.t, out=self.o) assert_array_equal(self.o, self.f) assert_array_equal(self.nm & self.t, self.nm) assert_array_equal(self.im & self.f, False) assert_array_equal(self.nm & True, self.nm) assert_array_equal(self.im & False, self.f) assert_array_equal(self.nm | self.t, self.t) assert_array_equal(self.im | self.f, self.im) assert_array_equal(self.nm | True, self.t) assert_array_equal(self.im | False, self.im) assert_array_equal(self.nm ^ self.t, self.im) assert_array_equal(self.im ^ self.f, self.im) assert_array_equal(self.nm ^ True, self.im) assert_array_equal(self.im ^ False, self.im) class TestBoolCmp(object): def setup(self): self.f = np.ones(256, dtype=np.float32) self.ef = np.ones(self.f.size, dtype=bool) self.d = np.ones(128, dtype=np.float64) self.ed = np.ones(self.d.size, dtype=bool) # generate values for all permutation of 256bit simd vectors s = 0 for i in range(32): self.f[s:s+8] = [i & 2**x for x in range(8)] self.ef[s:s+8] = [(i & 2**x) != 0 for x in range(8)] s += 8 s = 0 for i in range(16): self.d[s:s+4] = [i & 2**x for x in range(4)] self.ed[s:s+4] = [(i & 2**x) != 0 for x in range(4)] s += 4 self.nf = self.f.copy() self.nd = self.d.copy() self.nf[self.ef] = np.nan self.nd[self.ed] = np.nan self.inff = self.f.copy() self.infd = self.d.copy() self.inff[::3][self.ef[::3]] = np.inf self.infd[::3][self.ed[::3]] = np.inf self.inff[1::3][self.ef[1::3]] = -np.inf self.infd[1::3][self.ed[1::3]] = -np.inf self.inff[2::3][self.ef[2::3]] = np.nan self.infd[2::3][self.ed[2::3]] = np.nan self.efnonan = self.ef.copy() self.efnonan[2::3] = False self.ednonan = self.ed.copy() self.ednonan[2::3] = False self.signf = self.f.copy() self.signd = self.d.copy() self.signf[self.ef] *= -1. self.signd[self.ed] *= -1. self.signf[1::6][self.ef[1::6]] = -np.inf self.signd[1::6][self.ed[1::6]] = -np.inf self.signf[3::6][self.ef[3::6]] = -np.nan self.signd[3::6][self.ed[3::6]] = -np.nan self.signf[4::6][self.ef[4::6]] = -0. self.signd[4::6][self.ed[4::6]] = -0. def test_float(self): # offset for alignment test for i in range(4): assert_array_equal(self.f[i:] > 0, self.ef[i:]) assert_array_equal(self.f[i:] - 1 >= 0, self.ef[i:]) assert_array_equal(self.f[i:] == 0, ~self.ef[i:]) assert_array_equal(-self.f[i:] < 0, self.ef[i:]) assert_array_equal(-self.f[i:] + 1 <= 0, self.ef[i:]) r = self.f[i:] != 0 assert_array_equal(r, self.ef[i:]) r2 = self.f[i:] != np.zeros_like(self.f[i:]) r3 = 0 != self.f[i:] assert_array_equal(r, r2) assert_array_equal(r, r3) # check bool == 0x1 assert_array_equal(r.view(np.int8), r.astype(np.int8)) assert_array_equal(r2.view(np.int8), r2.astype(np.int8)) assert_array_equal(r3.view(np.int8), r3.astype(np.int8)) # isnan on amd64 takes the same code path assert_array_equal(np.isnan(self.nf[i:]), self.ef[i:]) assert_array_equal(np.isfinite(self.nf[i:]), ~self.ef[i:]) assert_array_equal(np.isfinite(self.inff[i:]), ~self.ef[i:]) assert_array_equal(np.isinf(self.inff[i:]), self.efnonan[i:]) assert_array_equal(np.signbit(self.signf[i:]), self.ef[i:]) def test_double(self): # offset for alignment test for i in range(2): assert_array_equal(self.d[i:] > 0, self.ed[i:]) assert_array_equal(self.d[i:] - 1 >= 0, self.ed[i:]) assert_array_equal(self.d[i:] == 0, ~self.ed[i:]) assert_array_equal(-self.d[i:] < 0, self.ed[i:]) assert_array_equal(-self.d[i:] + 1 <= 0, self.ed[i:]) r = self.d[i:] != 0 assert_array_equal(r, self.ed[i:]) r2 = self.d[i:] != np.zeros_like(self.d[i:]) r3 = 0 != self.d[i:] assert_array_equal(r, r2) assert_array_equal(r, r3) # check bool == 0x1 assert_array_equal(r.view(np.int8), r.astype(np.int8)) assert_array_equal(r2.view(np.int8), r2.astype(np.int8)) assert_array_equal(r3.view(np.int8), r3.astype(np.int8)) # isnan on amd64 takes the same code path assert_array_equal(np.isnan(self.nd[i:]), self.ed[i:]) assert_array_equal(np.isfinite(self.nd[i:]), ~self.ed[i:]) assert_array_equal(np.isfinite(self.infd[i:]), ~self.ed[i:]) assert_array_equal(np.isinf(self.infd[i:]), self.ednonan[i:]) assert_array_equal(np.signbit(self.signd[i:]), self.ed[i:]) class TestSeterr(object): def test_default(self): err = np.geterr() assert_equal(err, dict(divide='warn', invalid='warn', over='warn', under='ignore') ) def test_set(self): with np.errstate(): err = np.seterr() old = np.seterr(divide='print') assert_(err == old) new = np.seterr() assert_(new['divide'] == 'print') np.seterr(over='raise') assert_(np.geterr()['over'] == 'raise') assert_(new['divide'] == 'print') np.seterr(**old) assert_(np.geterr() == old) @dec.skipif(platform.machine() == "armv5tel", "See gh-413.") def test_divide_err(self): with np.errstate(divide='raise'): try: np.array([1.]) / np.array([0.]) except FloatingPointError: pass else: self.fail() np.seterr(divide='ignore') np.array([1.]) / np.array([0.]) def test_errobj(self): olderrobj = np.geterrobj() self.called = 0 try: with warnings.catch_warnings(record=True) as w: warnings.simplefilter("always") with np.errstate(divide='warn'): np.seterrobj([20000, 1, None]) np.array([1.]) / np.array([0.]) assert_equal(len(w), 1) def log_err(*args): self.called += 1 extobj_err = args assert_(len(extobj_err) == 2) assert_("divide" in extobj_err[0]) with np.errstate(divide='ignore'): np.seterrobj([20000, 3, log_err]) np.array([1.]) / np.array([0.]) assert_equal(self.called, 1) np.seterrobj(olderrobj) with np.errstate(divide='ignore'): np.divide(1., 0., extobj=[20000, 3, log_err]) assert_equal(self.called, 2) finally: np.seterrobj(olderrobj) del self.called def test_errobj_noerrmask(self): # errmask = 0 has a special code path for the default olderrobj = np.geterrobj() try: # set errobj to something non default np.seterrobj([umath.UFUNC_BUFSIZE_DEFAULT, umath.ERR_DEFAULT + 1, None]) # call a ufunc np.isnan(np.array([6])) # same with the default, lots of times to get rid of possible # pre-existing stack in the code for i in range(10000): np.seterrobj([umath.UFUNC_BUFSIZE_DEFAULT, umath.ERR_DEFAULT, None]) np.isnan(np.array([6])) finally: np.seterrobj(olderrobj) class TestFloatExceptions(object): def assert_raises_fpe(self, fpeerr, flop, x, y): ftype = type(x) try: flop(x, y) assert_(False, "Type %s did not raise fpe error '%s'." % (ftype, fpeerr)) except FloatingPointError as exc: assert_(str(exc).find(fpeerr) >= 0, "Type %s raised wrong fpe error '%s'." % (ftype, exc)) def assert_op_raises_fpe(self, fpeerr, flop, sc1, sc2): # Check that fpe exception is raised. # # Given a floating operation `flop` and two scalar values, check that # the operation raises the floating point exception specified by # `fpeerr`. Tests all variants with 0-d array scalars as well. self.assert_raises_fpe(fpeerr, flop, sc1, sc2) self.assert_raises_fpe(fpeerr, flop, sc1[()], sc2) self.assert_raises_fpe(fpeerr, flop, sc1, sc2[()]) self.assert_raises_fpe(fpeerr, flop, sc1[()], sc2[()]) @dec.knownfailureif(True, "See ticket #2350") def test_floating_exceptions(self): # Test basic arithmetic function errors with np.errstate(all='raise'): # Test for all real and complex float types for typecode in np.typecodes['AllFloat']: ftype = np.obj2sctype(typecode) if np.dtype(ftype).kind == 'f': # Get some extreme values for the type fi = np.finfo(ftype) ft_tiny = fi.tiny ft_max = fi.max ft_eps = fi.eps underflow = 'underflow' divbyzero = 'divide by zero' else: # 'c', complex, corresponding real dtype rtype = type(ftype(0).real) fi = np.finfo(rtype) ft_tiny = ftype(fi.tiny) ft_max = ftype(fi.max) ft_eps = ftype(fi.eps) # The complex types raise different exceptions underflow = '' divbyzero = '' overflow = 'overflow' invalid = 'invalid' self.assert_raises_fpe(underflow, lambda a, b: a/b, ft_tiny, ft_max) self.assert_raises_fpe(underflow, lambda a, b: a*b, ft_tiny, ft_tiny) self.assert_raises_fpe(overflow, lambda a, b: a*b, ft_max, ftype(2)) self.assert_raises_fpe(overflow, lambda a, b: a/b, ft_max, ftype(0.5)) self.assert_raises_fpe(overflow, lambda a, b: a+b, ft_max, ft_max*ft_eps) self.assert_raises_fpe(overflow, lambda a, b: a-b, -ft_max, ft_max*ft_eps) self.assert_raises_fpe(overflow, np.power, ftype(2), ftype(2**fi.nexp)) self.assert_raises_fpe(divbyzero, lambda a, b: a/b, ftype(1), ftype(0)) self.assert_raises_fpe(invalid, lambda a, b: a/b, ftype(np.inf), ftype(np.inf)) self.assert_raises_fpe(invalid, lambda a, b: a/b, ftype(0), ftype(0)) self.assert_raises_fpe(invalid, lambda a, b: a-b, ftype(np.inf), ftype(np.inf)) self.assert_raises_fpe(invalid, lambda a, b: a+b, ftype(np.inf), ftype(-np.inf)) self.assert_raises_fpe(invalid, lambda a, b: a*b, ftype(0), ftype(np.inf)) def test_warnings(self): # test warning code path with warnings.catch_warnings(record=True) as w: warnings.simplefilter("always") with np.errstate(all="warn"): np.divide(1, 0.) assert_equal(len(w), 1) assert_("divide by zero" in str(w[0].message)) np.array(1e300) * np.array(1e300) assert_equal(len(w), 2) assert_("overflow" in str(w[-1].message)) np.array(np.inf) - np.array(np.inf) assert_equal(len(w), 3) assert_("invalid value" in str(w[-1].message)) np.array(1e-300) * np.array(1e-300) assert_equal(len(w), 4) assert_("underflow" in str(w[-1].message)) class TestTypes(object): def check_promotion_cases(self, promote_func): # tests that the scalars get coerced correctly. b = np.bool_(0) i8, i16, i32, i64 = np.int8(0), np.int16(0), np.int32(0), np.int64(0) u8, u16, u32, u64 = np.uint8(0), np.uint16(0), np.uint32(0), np.uint64(0) f32, f64, fld = np.float32(0), np.float64(0), np.longdouble(0) c64, c128, cld = np.complex64(0), np.complex128(0), np.clongdouble(0) # coercion within the same kind assert_equal(promote_func(i8, i16), np.dtype(np.int16)) assert_equal(promote_func(i32, i8), np.dtype(np.int32)) assert_equal(promote_func(i16, i64), np.dtype(np.int64)) assert_equal(promote_func(u8, u32), np.dtype(np.uint32)) assert_equal(promote_func(f32, f64), np.dtype(np.float64)) assert_equal(promote_func(fld, f32), np.dtype(np.longdouble)) assert_equal(promote_func(f64, fld), np.dtype(np.longdouble)) assert_equal(promote_func(c128, c64), np.dtype(np.complex128)) assert_equal(promote_func(cld, c128), np.dtype(np.clongdouble)) assert_equal(promote_func(c64, fld), np.dtype(np.clongdouble)) # coercion between kinds assert_equal(promote_func(b, i32), np.dtype(np.int32)) assert_equal(promote_func(b, u8), np.dtype(np.uint8)) assert_equal(promote_func(i8, u8), np.dtype(np.int16)) assert_equal(promote_func(u8, i32), np.dtype(np.int32)) assert_equal(promote_func(i64, u32), np.dtype(np.int64)) assert_equal(promote_func(u64, i32), np.dtype(np.float64)) assert_equal(promote_func(i32, f32), np.dtype(np.float64)) assert_equal(promote_func(i64, f32), np.dtype(np.float64)) assert_equal(promote_func(f32, i16), np.dtype(np.float32)) assert_equal(promote_func(f32, u32), np.dtype(np.float64)) assert_equal(promote_func(f32, c64), np.dtype(np.complex64)) assert_equal(promote_func(c128, f32), np.dtype(np.complex128)) assert_equal(promote_func(cld, f64), np.dtype(np.clongdouble)) # coercion between scalars and 1-D arrays assert_equal(promote_func(np.array([b]), i8), np.dtype(np.int8)) assert_equal(promote_func(np.array([b]), u8), np.dtype(np.uint8)) assert_equal(promote_func(np.array([b]), i32), np.dtype(np.int32)) assert_equal(promote_func(np.array([b]), u32), np.dtype(np.uint32)) assert_equal(promote_func(np.array([i8]), i64), np.dtype(np.int8)) assert_equal(promote_func(u64, np.array([i32])), np.dtype(np.int32)) assert_equal(promote_func(i64, np.array([u32])), np.dtype(np.uint32)) assert_equal(promote_func(np.int32(-1), np.array([u64])), np.dtype(np.float64)) assert_equal(promote_func(f64, np.array([f32])), np.dtype(np.float32)) assert_equal(promote_func(fld, np.array([f32])), np.dtype(np.float32)) assert_equal(promote_func(np.array([f64]), fld), np.dtype(np.float64)) assert_equal(promote_func(fld, np.array([c64])), np.dtype(np.complex64)) assert_equal(promote_func(c64, np.array([f64])), np.dtype(np.complex128)) assert_equal(promote_func(np.complex64(3j), np.array([f64])), np.dtype(np.complex128)) # coercion between scalars and 1-D arrays, where # the scalar has greater kind than the array assert_equal(promote_func(np.array([b]), f64), np.dtype(np.float64)) assert_equal(promote_func(np.array([b]), i64), np.dtype(np.int64)) assert_equal(promote_func(np.array([b]), u64), np.dtype(np.uint64)) assert_equal(promote_func(np.array([i8]), f64), np.dtype(np.float64)) assert_equal(promote_func(np.array([u16]), f64), np.dtype(np.float64)) # uint and int are treated as the same "kind" for # the purposes of array-scalar promotion. assert_equal(promote_func(np.array([u16]), i32), np.dtype(np.uint16)) # float and complex are treated as the same "kind" for # the purposes of array-scalar promotion, so that you can do # (0j + float32array) to get a complex64 array instead of # a complex128 array. assert_equal(promote_func(np.array([f32]), c128), np.dtype(np.complex64)) def test_coercion(self): def res_type(a, b): return np.add(a, b).dtype self.check_promotion_cases(res_type) # Use-case: float/complex scalar * bool/int8 array # shouldn't narrow the float/complex type for a in [np.array([True, False]), np.array([-3, 12], dtype=np.int8)]: b = 1.234 * a assert_equal(b.dtype, np.dtype('f8'), "array type %s" % a.dtype) b = np.longdouble(1.234) * a assert_equal(b.dtype, np.dtype(np.longdouble), "array type %s" % a.dtype) b = np.float64(1.234) * a assert_equal(b.dtype, np.dtype('f8'), "array type %s" % a.dtype) b = np.float32(1.234) * a assert_equal(b.dtype, np.dtype('f4'), "array type %s" % a.dtype) b = np.float16(1.234) * a assert_equal(b.dtype, np.dtype('f2'), "array type %s" % a.dtype) b = 1.234j * a assert_equal(b.dtype, np.dtype('c16'), "array type %s" % a.dtype) b = np.clongdouble(1.234j) * a assert_equal(b.dtype, np.dtype(np.clongdouble), "array type %s" % a.dtype) b = np.complex128(1.234j) * a assert_equal(b.dtype, np.dtype('c16'), "array type %s" % a.dtype) b = np.complex64(1.234j) * a assert_equal(b.dtype, np.dtype('c8'), "array type %s" % a.dtype) # The following use-case is problematic, and to resolve its # tricky side-effects requires more changes. # # Use-case: (1-t)*a, where 't' is a boolean array and 'a' is # a float32, shouldn't promote to float64 # # a = np.array([1.0, 1.5], dtype=np.float32) # t = np.array([True, False]) # b = t*a # assert_equal(b, [1.0, 0.0]) # assert_equal(b.dtype, np.dtype('f4')) # b = (1-t)*a # assert_equal(b, [0.0, 1.5]) # assert_equal(b.dtype, np.dtype('f4')) # # Probably ~t (bitwise negation) is more proper to use here, # but this is arguably less intuitive to understand at a glance, and # would fail if 't' is actually an integer array instead of boolean: # # b = (~t)*a # assert_equal(b, [0.0, 1.5]) # assert_equal(b.dtype, np.dtype('f4')) def test_result_type(self): self.check_promotion_cases(np.result_type) assert_(np.result_type(None) == np.dtype(None)) def test_promote_types_endian(self): # promote_types should always return native-endian types assert_equal(np.promote_types('<i8', '<i8'), np.dtype('i8')) assert_equal(np.promote_types('>i8', '>i8'), np.dtype('i8')) assert_equal(np.promote_types('>i8', '>U16'), np.dtype('U21')) assert_equal(np.promote_types('<i8', '<U16'), np.dtype('U21')) assert_equal(np.promote_types('>U16', '>i8'), np.dtype('U21')) assert_equal(np.promote_types('<U16', '<i8'), np.dtype('U21')) assert_equal(np.promote_types('<S5', '<U8'), np.dtype('U8')) assert_equal(np.promote_types('>S5', '>U8'), np.dtype('U8')) assert_equal(np.promote_types('<U8', '<S5'), np.dtype('U8')) assert_equal(np.promote_types('>U8', '>S5'), np.dtype('U8')) assert_equal(np.promote_types('<U5', '<U8'), np.dtype('U8')) assert_equal(np.promote_types('>U8', '>U5'), np.dtype('U8')) assert_equal(np.promote_types('<M8', '<M8'), np.dtype('M8')) assert_equal(np.promote_types('>M8', '>M8'), np.dtype('M8')) assert_equal(np.promote_types('<m8', '<m8'), np.dtype('m8')) assert_equal(np.promote_types('>m8', '>m8'), np.dtype('m8')) def test_promote_types_strings(self): assert_equal(np.promote_types('bool', 'S'), np.dtype('S5')) assert_equal(np.promote_types('b', 'S'), np.dtype('S4')) assert_equal(np.promote_types('u1', 'S'), np.dtype('S3')) assert_equal(np.promote_types('u2', 'S'), np.dtype('S5')) assert_equal(np.promote_types('u4', 'S'), np.dtype('S10')) assert_equal(np.promote_types('u8', 'S'), np.dtype('S20')) assert_equal(np.promote_types('i1', 'S'), np.dtype('S4')) assert_equal(np.promote_types('i2', 'S'), np.dtype('S6')) assert_equal(np.promote_types('i4', 'S'), np.dtype('S11')) assert_equal(np.promote_types('i8', 'S'), np.dtype('S21')) assert_equal(np.promote_types('bool', 'U'), np.dtype('U5')) assert_equal(np.promote_types('b', 'U'), np.dtype('U4')) assert_equal(np.promote_types('u1', 'U'), np.dtype('U3')) assert_equal(np.promote_types('u2', 'U'), np.dtype('U5')) assert_equal(np.promote_types('u4', 'U'), np.dtype('U10')) assert_equal(np.promote_types('u8', 'U'), np.dtype('U20')) assert_equal(np.promote_types('i1', 'U'), np.dtype('U4')) assert_equal(np.promote_types('i2', 'U'), np.dtype('U6')) assert_equal(np.promote_types('i4', 'U'), np.dtype('U11')) assert_equal(np.promote_types('i8', 'U'), np.dtype('U21')) assert_equal(np.promote_types('bool', 'S1'), np.dtype('S5')) assert_equal(np.promote_types('bool', 'S30'), np.dtype('S30')) assert_equal(np.promote_types('b', 'S1'), np.dtype('S4')) assert_equal(np.promote_types('b', 'S30'), np.dtype('S30')) assert_equal(np.promote_types('u1', 'S1'), np.dtype('S3')) assert_equal(np.promote_types('u1', 'S30'), np.dtype('S30')) assert_equal(np.promote_types('u2', 'S1'), np.dtype('S5')) assert_equal(np.promote_types('u2', 'S30'), np.dtype('S30')) assert_equal(np.promote_types('u4', 'S1'), np.dtype('S10')) assert_equal(np.promote_types('u4', 'S30'), np.dtype('S30')) assert_equal(np.promote_types('u8', 'S1'), np.dtype('S20')) assert_equal(np.promote_types('u8', 'S30'), np.dtype('S30')) def test_can_cast(self): assert_(np.can_cast(np.int32, np.int64)) assert_(np.can_cast(np.float64, complex)) assert_(not np.can_cast(complex, float)) assert_(np.can_cast('i8', 'f8')) assert_(not np.can_cast('i8', 'f4')) assert_(np.can_cast('i4', 'S11')) assert_(np.can_cast('i8', 'i8', 'no')) assert_(not np.can_cast('<i8', '>i8', 'no')) assert_(np.can_cast('<i8', '>i8', 'equiv')) assert_(not np.can_cast('<i4', '>i8', 'equiv')) assert_(np.can_cast('<i4', '>i8', 'safe')) assert_(not np.can_cast('<i8', '>i4', 'safe')) assert_(np.can_cast('<i8', '>i4', 'same_kind')) assert_(not np.can_cast('<i8', '>u4', 'same_kind')) assert_(np.can_cast('<i8', '>u4', 'unsafe')) assert_(np.can_cast('bool', 'S5')) assert_(not np.can_cast('bool', 'S4')) assert_(np.can_cast('b', 'S4')) assert_(not np.can_cast('b', 'S3')) assert_(np.can_cast('u1', 'S3')) assert_(not np.can_cast('u1', 'S2')) assert_(np.can_cast('u2', 'S5')) assert_(not np.can_cast('u2', 'S4')) assert_(np.can_cast('u4', 'S10')) assert_(not np.can_cast('u4', 'S9')) assert_(np.can_cast('u8', 'S20')) assert_(not np.can_cast('u8', 'S19')) assert_(np.can_cast('i1', 'S4')) assert_(not np.can_cast('i1', 'S3')) assert_(np.can_cast('i2', 'S6')) assert_(not np.can_cast('i2', 'S5')) assert_(np.can_cast('i4', 'S11')) assert_(not np.can_cast('i4', 'S10')) assert_(np.can_cast('i8', 'S21')) assert_(not np.can_cast('i8', 'S20')) assert_(np.can_cast('bool', 'S5')) assert_(not np.can_cast('bool', 'S4')) assert_(np.can_cast('b', 'U4')) assert_(not np.can_cast('b', 'U3')) assert_(np.can_cast('u1', 'U3')) assert_(not np.can_cast('u1', 'U2')) assert_(np.can_cast('u2', 'U5')) assert_(not np.can_cast('u2', 'U4')) assert_(np.can_cast('u4', 'U10')) assert_(not np.can_cast('u4', 'U9')) assert_(np.can_cast('u8', 'U20')) assert_(not np.can_cast('u8', 'U19')) assert_(np.can_cast('i1', 'U4')) assert_(not np.can_cast('i1', 'U3')) assert_(np.can_cast('i2', 'U6')) assert_(not np.can_cast('i2', 'U5')) assert_(np.can_cast('i4', 'U11')) assert_(not np.can_cast('i4', 'U10')) assert_(np.can_cast('i8', 'U21')) assert_(not np.can_cast('i8', 'U20')) assert_raises(TypeError, np.can_cast, 'i4', None) assert_raises(TypeError, np.can_cast, None, 'i4') # Also test keyword arguments assert_(np.can_cast(from_=np.int32, to=np.int64)) def test_can_cast_values(self): # gh-5917 for dt in np.sctypes['int'] + np.sctypes['uint']: ii = np.iinfo(dt) assert_(np.can_cast(ii.min, dt)) assert_(np.can_cast(ii.max, dt)) assert_(not np.can_cast(ii.min - 1, dt)) assert_(not np.can_cast(ii.max + 1, dt)) for dt in np.sctypes['float']: fi = np.finfo(dt) assert_(np.can_cast(fi.min, dt)) assert_(np.can_cast(fi.max, dt)) # Custom exception class to test exception propagation in fromiter class NIterError(Exception): pass class TestFromiter(object): def makegen(self): for x in range(24): yield x**2 def test_types(self): ai32 = np.fromiter(self.makegen(), np.int32) ai64 = np.fromiter(self.makegen(), np.int64) af = np.fromiter(self.makegen(), float) assert_(ai32.dtype == np.dtype(np.int32)) assert_(ai64.dtype == np.dtype(np.int64)) assert_(af.dtype == np.dtype(float)) def test_lengths(self): expected = np.array(list(self.makegen())) a = np.fromiter(self.makegen(), int) a20 = np.fromiter(self.makegen(), int, 20) assert_(len(a) == len(expected)) assert_(len(a20) == 20) assert_raises(ValueError, np.fromiter, self.makegen(), int, len(expected) + 10) def test_values(self): expected = np.array(list(self.makegen())) a = np.fromiter(self.makegen(), int) a20 = np.fromiter(self.makegen(), int, 20) assert_(np.alltrue(a == expected, axis=0)) assert_(np.alltrue(a20 == expected[:20], axis=0)) def load_data(self, n, eindex): # Utility method for the issue 2592 tests. # Raise an exception at the desired index in the iterator. for e in range(n): if e == eindex: raise NIterError('error at index %s' % eindex) yield e def test_2592(self): # Test iteration exceptions are correctly raised. count, eindex = 10, 5 assert_raises(NIterError, np.fromiter, self.load_data(count, eindex), dtype=int, count=count) def test_2592_edge(self): # Test iter. exceptions, edge case (exception at end of iterator). count = 10 eindex = count-1 assert_raises(NIterError, np.fromiter, self.load_data(count, eindex), dtype=int, count=count) class TestNonzero(object): def test_nonzero_trivial(self): assert_equal(np.count_nonzero(np.array([])), 0) assert_equal(np.count_nonzero(np.array([], dtype='?')), 0) assert_equal(np.nonzero(np.array([])), ([],)) assert_equal(np.count_nonzero(np.array(0)), 0) assert_equal(np.count_nonzero(np.array(0, dtype='?')), 0) assert_equal(np.nonzero(np.array(0)), ([],)) assert_equal(np.count_nonzero(np.array(1)), 1) assert_equal(np.count_nonzero(np.array(1, dtype='?')), 1) assert_equal(np.nonzero(np.array(1)), ([0],)) def test_nonzero_onedim(self): x = np.array([1, 0, 2, -1, 0, 0, 8]) assert_equal(np.count_nonzero(x), 4) assert_equal(np.count_nonzero(x), 4) assert_equal(np.nonzero(x), ([0, 2, 3, 6],)) x = np.array([(1, 2), (0, 0), (1, 1), (-1, 3), (0, 7)], dtype=[('a', 'i4'), ('b', 'i2')]) assert_equal(np.count_nonzero(x['a']), 3) assert_equal(np.count_nonzero(x['b']), 4) assert_equal(np.nonzero(x['a']), ([0, 2, 3],)) assert_equal(np.nonzero(x['b']), ([0, 2, 3, 4],)) def test_nonzero_twodim(self): x = np.array([[0, 1, 0], [2, 0, 3]]) assert_equal(np.count_nonzero(x), 3) assert_equal(np.nonzero(x), ([0, 1, 1], [1, 0, 2])) x = np.eye(3) assert_equal(np.count_nonzero(x), 3) assert_equal(np.nonzero(x), ([0, 1, 2], [0, 1, 2])) x = np.array([[(0, 1), (0, 0), (1, 11)], [(1, 1), (1, 0), (0, 0)], [(0, 0), (1, 5), (0, 1)]], dtype=[('a', 'f4'), ('b', 'u1')]) assert_equal(np.count_nonzero(x['a']), 4) assert_equal(np.count_nonzero(x['b']), 5) assert_equal(np.nonzero(x['a']), ([0, 1, 1, 2], [2, 0, 1, 1])) assert_equal(np.nonzero(x['b']), ([0, 0, 1, 2, 2], [0, 2, 0, 1, 2])) assert_(not x['a'].T.flags.aligned) assert_equal(np.count_nonzero(x['a'].T), 4) assert_equal(np.count_nonzero(x['b'].T), 5) assert_equal(np.nonzero(x['a'].T), ([0, 1, 1, 2], [1, 1, 2, 0])) assert_equal(np.nonzero(x['b'].T), ([0, 0, 1, 2, 2], [0, 1, 2, 0, 2])) def test_sparse(self): # test special sparse condition boolean code path for i in range(20): c = np.zeros(200, dtype=bool) c[i::20] = True assert_equal(np.nonzero(c)[0], np.arange(i, 200 + i, 20)) c = np.zeros(400, dtype=bool) c[10 + i:20 + i] = True c[20 + i*2] = True assert_equal(np.nonzero(c)[0], np.concatenate((np.arange(10 + i, 20 + i), [20 + i*2]))) def test_return_type(self): class C(np.ndarray): pass for view in (C, np.ndarray): for nd in range(1, 4): shape = tuple(range(2, 2+nd)) x = np.arange(np.prod(shape)).reshape(shape).view(view) for nzx in (np.nonzero(x), x.nonzero()): for nzx_i in nzx: assert_(type(nzx_i) is np.ndarray) assert_(nzx_i.flags.writeable) def test_count_nonzero_axis(self): # Basic check of functionality m = np.array([[0, 1, 7, 0, 0], [3, 0, 0, 2, 19]]) expected = np.array([1, 1, 1, 1, 1]) assert_equal(np.count_nonzero(m, axis=0), expected) expected = np.array([2, 3]) assert_equal(np.count_nonzero(m, axis=1), expected) assert_raises(ValueError, np.count_nonzero, m, axis=(1, 1)) assert_raises(TypeError, np.count_nonzero, m, axis='foo') assert_raises(np.AxisError, np.count_nonzero, m, axis=3) assert_raises(TypeError, np.count_nonzero, m, axis=np.array([[1], [2]])) def test_count_nonzero_axis_all_dtypes(self): # More thorough test that the axis argument is respected # for all dtypes and responds correctly when presented with # either integer or tuple arguments for axis msg = "Mismatch for dtype: %s" def assert_equal_w_dt(a, b, err_msg): assert_equal(a.dtype, b.dtype, err_msg=err_msg) assert_equal(a, b, err_msg=err_msg) for dt in np.typecodes['All']: err_msg = msg % (np.dtype(dt).name,) if dt != 'V': if dt != 'M': m = np.zeros((3, 3), dtype=dt) n = np.ones(1, dtype=dt) m[0, 0] = n[0] m[1, 0] = n[0] else: # np.zeros doesn't work for np.datetime64 m = np.array(['1970-01-01'] * 9) m = m.reshape((3, 3)) m[0, 0] = '1970-01-12' m[1, 0] = '1970-01-12' m = m.astype(dt) expected = np.array([2, 0, 0], dtype=np.intp) assert_equal_w_dt(np.count_nonzero(m, axis=0), expected, err_msg=err_msg) expected = np.array([1, 1, 0], dtype=np.intp) assert_equal_w_dt(np.count_nonzero(m, axis=1), expected, err_msg=err_msg) expected = np.array(2) assert_equal(np.count_nonzero(m, axis=(0, 1)), expected, err_msg=err_msg) assert_equal(np.count_nonzero(m, axis=None), expected, err_msg=err_msg) assert_equal(np.count_nonzero(m), expected, err_msg=err_msg) if dt == 'V': # There are no 'nonzero' objects for np.void, so the testing # setup is slightly different for this dtype m = np.array([np.void(1)] * 6).reshape((2, 3)) expected = np.array([0, 0, 0], dtype=np.intp) assert_equal_w_dt(np.count_nonzero(m, axis=0), expected, err_msg=err_msg) expected = np.array([0, 0], dtype=np.intp) assert_equal_w_dt(np.count_nonzero(m, axis=1), expected, err_msg=err_msg) expected = np.array(0) assert_equal(np.count_nonzero(m, axis=(0, 1)), expected, err_msg=err_msg) assert_equal(np.count_nonzero(m, axis=None), expected, err_msg=err_msg) assert_equal(np.count_nonzero(m), expected, err_msg=err_msg) def test_count_nonzero_axis_consistent(self): # Check that the axis behaviour for valid axes in # non-special cases is consistent (and therefore # correct) by checking it against an integer array # that is then casted to the generic object dtype from itertools import combinations, permutations axis = (0, 1, 2, 3) size = (5, 5, 5, 5) msg = "Mismatch for axis: %s" rng = np.random.RandomState(1234) m = rng.randint(-100, 100, size=size) n = m.astype(object) for length in range(len(axis)): for combo in combinations(axis, length): for perm in permutations(combo): assert_equal( np.count_nonzero(m, axis=perm), np.count_nonzero(n, axis=perm), err_msg=msg % (perm,)) def test_countnonzero_axis_empty(self): a = np.array([[0, 0, 1], [1, 0, 1]]) assert_equal(np.count_nonzero(a, axis=()), a.astype(bool)) def test_array_method(self): # Tests that the array method # call to nonzero works m = np.array([[1, 0, 0], [4, 0, 6]]) tgt = [[0, 1, 1], [0, 0, 2]] assert_equal(m.nonzero(), tgt) def test_nonzero_invalid_object(self): # gh-9295 a = np.array([np.array([1, 2]), 3]) assert_raises(ValueError, np.nonzero, a) class BoolErrors: def __bool__(self): raise ValueError("Not allowed") def __nonzero__(self): raise ValueError("Not allowed") assert_raises(ValueError, np.nonzero, np.array([BoolErrors()])) class TestIndex(object): def test_boolean(self): a = rand(3, 5, 8) V = rand(5, 8) g1 = randint(0, 5, size=15) g2 = randint(0, 8, size=15) V[g1, g2] = -V[g1, g2] assert_((np.array([a[0][V > 0], a[1][V > 0], a[2][V > 0]]) == a[:, V > 0]).all()) def test_boolean_edgecase(self): a = np.array([], dtype='int32') b = np.array([], dtype='bool') c = a[b] assert_equal(c, []) assert_equal(c.dtype, np.dtype('int32')) class TestBinaryRepr(object): def test_zero(self): assert_equal(np.binary_repr(0), '0') def test_positive(self): assert_equal(np.binary_repr(10), '1010') assert_equal(np.binary_repr(12522), '11000011101010') assert_equal(np.binary_repr(10736848), '101000111101010011010000') def test_negative(self): assert_equal(np.binary_repr(-1), '-1') assert_equal(np.binary_repr(-10), '-1010') assert_equal(np.binary_repr(-12522), '-11000011101010') assert_equal(np.binary_repr(-10736848), '-101000111101010011010000') def test_sufficient_width(self): assert_equal(np.binary_repr(0, width=5), '00000') assert_equal(np.binary_repr(10, width=7), '0001010') assert_equal(np.binary_repr(-5, width=7), '1111011') def test_neg_width_boundaries(self): # see gh-8670 # Ensure that the example in the issue does not # break before proceeding to a more thorough test. assert_equal(np.binary_repr(-128, width=8), '10000000') for width in range(1, 11): num = -2**(width - 1) exp = '1' + (width - 1) * '0' assert_equal(np.binary_repr(num, width=width), exp) class TestBaseRepr(object): def test_base3(self): assert_equal(np.base_repr(3**5, 3), '100000') def test_positive(self): assert_equal(np.base_repr(12, 10), '12') assert_equal(np.base_repr(12, 10, 4), '000012') assert_equal(np.base_repr(12, 4), '30') assert_equal(np.base_repr(3731624803700888, 36), '10QR0ROFCEW') def test_negative(self): assert_equal(np.base_repr(-12, 10), '-12') assert_equal(np.base_repr(-12, 10, 4), '-000012') assert_equal(np.base_repr(-12, 4), '-30') def test_base_range(self): with assert_raises(ValueError): np.base_repr(1, 1) with assert_raises(ValueError): np.base_repr(1, 37) class TestArrayComparisons(object): def test_array_equal(self): res = np.array_equal(np.array([1, 2]), np.array([1, 2])) assert_(res) assert_(type(res) is bool) res = np.array_equal(np.array([1, 2]), np.array([1, 2, 3])) assert_(not res) assert_(type(res) is bool) res = np.array_equal(np.array([1, 2]), np.array([3, 4])) assert_(not res) assert_(type(res) is bool) res = np.array_equal(np.array([1, 2]), np.array([1, 3])) assert_(not res) assert_(type(res) is bool) res = np.array_equal(np.array(['a'], dtype='S1'), np.array(['a'], dtype='S1')) assert_(res) assert_(type(res) is bool) res = np.array_equal(np.array([('a', 1)], dtype='S1,u4'), np.array([('a', 1)], dtype='S1,u4')) assert_(res) assert_(type(res) is bool) def test_none_compares_elementwise(self): a = np.array([None, 1, None], dtype=object) assert_equal(a == None, [True, False, True]) assert_equal(a != None, [False, True, False]) a = np.ones(3) assert_equal(a == None, [False, False, False]) assert_equal(a != None, [True, True, True]) def test_array_equiv(self): res = np.array_equiv(np.array([1, 2]), np.array([1, 2])) assert_(res) assert_(type(res) is bool) res = np.array_equiv(np.array([1, 2]), np.array([1, 2, 3])) assert_(not res) assert_(type(res) is bool) res = np.array_equiv(np.array([1, 2]), np.array([3, 4])) assert_(not res) assert_(type(res) is bool) res = np.array_equiv(np.array([1, 2]), np.array([1, 3])) assert_(not res) assert_(type(res) is bool) res = np.array_equiv(np.array([1, 1]), np.array([1])) assert_(res) assert_(type(res) is bool) res = np.array_equiv(np.array([1, 1]), np.array([[1], [1]])) assert_(res) assert_(type(res) is bool) res = np.array_equiv(np.array([1, 2]), np.array([2])) assert_(not res) assert_(type(res) is bool) res = np.array_equiv(np.array([1, 2]), np.array([[1], [2]])) assert_(not res) assert_(type(res) is bool) res = np.array_equiv(np.array([1, 2]), np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]])) assert_(not res) assert_(type(res) is bool) def assert_array_strict_equal(x, y): assert_array_equal(x, y) # Check flags, 32 bit arches typically don't provide 16 byte alignment if ((x.dtype.alignment <= 8 or np.intp().dtype.itemsize != 4) and sys.platform != 'win32'): assert_(x.flags == y.flags) else: assert_(x.flags.owndata == y.flags.owndata) assert_(x.flags.writeable == y.flags.writeable) assert_(x.flags.c_contiguous == y.flags.c_contiguous) assert_(x.flags.f_contiguous == y.flags.f_contiguous) assert_(x.flags.writebackifcopy == y.flags.writebackifcopy) # check endianness assert_(x.dtype.isnative == y.dtype.isnative) class TestClip(object): def setup(self): self.nr = 5 self.nc = 3 def fastclip(self, a, m, M, out=None): if out is None: return a.clip(m, M) else: return a.clip(m, M, out) def clip(self, a, m, M, out=None): # use slow-clip selector = np.less(a, m) + 2*np.greater(a, M) return selector.choose((a, m, M), out=out) # Handy functions def _generate_data(self, n, m): return randn(n, m) def _generate_data_complex(self, n, m): return randn(n, m) + 1.j * rand(n, m) def _generate_flt_data(self, n, m): return (randn(n, m)).astype(np.float32) def _neg_byteorder(self, a): a = np.asarray(a) if sys.byteorder == 'little': a = a.astype(a.dtype.newbyteorder('>')) else: a = a.astype(a.dtype.newbyteorder('<')) return a def _generate_non_native_data(self, n, m): data = randn(n, m) data = self._neg_byteorder(data) assert_(not data.dtype.isnative) return data def _generate_int_data(self, n, m): return (10 * rand(n, m)).astype(np.int64) def _generate_int32_data(self, n, m): return (10 * rand(n, m)).astype(np.int32) # Now the real test cases def test_simple_double(self): # Test native double input with scalar min/max. a = self._generate_data(self.nr, self.nc) m = 0.1 M = 0.6 ac = self.fastclip(a, m, M) act = self.clip(a, m, M) assert_array_strict_equal(ac, act) def test_simple_int(self): # Test native int input with scalar min/max. a = self._generate_int_data(self.nr, self.nc) a = a.astype(int) m = -2 M = 4 ac = self.fastclip(a, m, M) act = self.clip(a, m, M) assert_array_strict_equal(ac, act) def test_array_double(self): # Test native double input with array min/max. a = self._generate_data(self.nr, self.nc) m = np.zeros(a.shape) M = m + 0.5 ac = self.fastclip(a, m, M) act = self.clip(a, m, M) assert_array_strict_equal(ac, act) def test_simple_nonnative(self): # Test non native double input with scalar min/max. # Test native double input with non native double scalar min/max. a = self._generate_non_native_data(self.nr, self.nc) m = -0.5 M = 0.6 ac = self.fastclip(a, m, M) act = self.clip(a, m, M) assert_array_equal(ac, act) # Test native double input with non native double scalar min/max. a = self._generate_data(self.nr, self.nc) m = -0.5 M = self._neg_byteorder(0.6) assert_(not M.dtype.isnative) ac = self.fastclip(a, m, M) act = self.clip(a, m, M) assert_array_equal(ac, act) def test_simple_complex(self): # Test native complex input with native double scalar min/max. # Test native input with complex double scalar min/max. a = 3 * self._generate_data_complex(self.nr, self.nc) m = -0.5 M = 1. ac = self.fastclip(a, m, M) act = self.clip(a, m, M) assert_array_strict_equal(ac, act) # Test native input with complex double scalar min/max. a = 3 * self._generate_data(self.nr, self.nc) m = -0.5 + 1.j M = 1. + 2.j ac = self.fastclip(a, m, M) act = self.clip(a, m, M) assert_array_strict_equal(ac, act) def test_clip_complex(self): # Address Issue gh-5354 for clipping complex arrays # Test native complex input without explicit min/max # ie, either min=None or max=None a = np.ones(10, dtype=complex) m = a.min() M = a.max() am = self.fastclip(a, m, None) aM = self.fastclip(a, None, M) assert_array_strict_equal(am, a) assert_array_strict_equal(aM, a) def test_clip_non_contig(self): # Test clip for non contiguous native input and native scalar min/max. a = self._generate_data(self.nr * 2, self.nc * 3) a = a[::2, ::3] assert_(not a.flags['F_CONTIGUOUS']) assert_(not a.flags['C_CONTIGUOUS']) ac = self.fastclip(a, -1.6, 1.7) act = self.clip(a, -1.6, 1.7) assert_array_strict_equal(ac, act) def test_simple_out(self): # Test native double input with scalar min/max. a = self._generate_data(self.nr, self.nc) m = -0.5 M = 0.6 ac = np.zeros(a.shape) act = np.zeros(a.shape) self.fastclip(a, m, M, ac) self.clip(a, m, M, act) assert_array_strict_equal(ac, act) def test_simple_int32_inout(self): # Test native int32 input with double min/max and int32 out. a = self._generate_int32_data(self.nr, self.nc) m = np.float64(0) M = np.float64(2) ac = np.zeros(a.shape, dtype=np.int32) act = ac.copy() self.fastclip(a, m, M, ac) self.clip(a, m, M, act) assert_array_strict_equal(ac, act) def test_simple_int64_out(self): # Test native int32 input with int32 scalar min/max and int64 out. a = self._generate_int32_data(self.nr, self.nc) m = np.int32(-1) M = np.int32(1) ac = np.zeros(a.shape, dtype=np.int64) act = ac.copy() self.fastclip(a, m, M, ac) self.clip(a, m, M, act) assert_array_strict_equal(ac, act) def test_simple_int64_inout(self): # Test native int32 input with double array min/max and int32 out. a = self._generate_int32_data(self.nr, self.nc) m = np.zeros(a.shape, np.float64) M = np.float64(1) ac = np.zeros(a.shape, dtype=np.int32) act = ac.copy() self.fastclip(a, m, M, ac) self.clip(a, m, M, act) assert_array_strict_equal(ac, act) def test_simple_int32_out(self): # Test native double input with scalar min/max and int out. a = self._generate_data(self.nr, self.nc) m = -1.0 M = 2.0 ac = np.zeros(a.shape, dtype=np.int32) act = ac.copy() self.fastclip(a, m, M, ac) self.clip(a, m, M, act) assert_array_strict_equal(ac, act) def test_simple_inplace_01(self): # Test native double input with array min/max in-place. a = self._generate_data(self.nr, self.nc) ac = a.copy() m = np.zeros(a.shape) M = 1.0 self.fastclip(a, m, M, a) self.clip(a, m, M, ac) assert_array_strict_equal(a, ac) def test_simple_inplace_02(self): # Test native double input with scalar min/max in-place. a = self._generate_data(self.nr, self.nc) ac = a.copy() m = -0.5 M = 0.6 self.fastclip(a, m, M, a) self.clip(a, m, M, ac) assert_array_strict_equal(a, ac) def test_noncontig_inplace(self): # Test non contiguous double input with double scalar min/max in-place. a = self._generate_data(self.nr * 2, self.nc * 3) a = a[::2, ::3] assert_(not a.flags['F_CONTIGUOUS']) assert_(not a.flags['C_CONTIGUOUS']) ac = a.copy() m = -0.5 M = 0.6 self.fastclip(a, m, M, a) self.clip(a, m, M, ac) assert_array_equal(a, ac) def test_type_cast_01(self): # Test native double input with scalar min/max. a = self._generate_data(self.nr, self.nc) m = -0.5 M = 0.6 ac = self.fastclip(a, m, M) act = self.clip(a, m, M) assert_array_strict_equal(ac, act) def test_type_cast_02(self): # Test native int32 input with int32 scalar min/max. a = self._generate_int_data(self.nr, self.nc) a = a.astype(np.int32) m = -2 M = 4 ac = self.fastclip(a, m, M) act = self.clip(a, m, M) assert_array_strict_equal(ac, act) def test_type_cast_03(self): # Test native int32 input with float64 scalar min/max. a = self._generate_int32_data(self.nr, self.nc) m = -2 M = 4 ac = self.fastclip(a, np.float64(m), np.float64(M)) act = self.clip(a, np.float64(m), np.float64(M)) assert_array_strict_equal(ac, act) def test_type_cast_04(self): # Test native int32 input with float32 scalar min/max. a = self._generate_int32_data(self.nr, self.nc) m = np.float32(-2) M = np.float32(4) act = self.fastclip(a, m, M) ac = self.clip(a, m, M) assert_array_strict_equal(ac, act) def test_type_cast_05(self): # Test native int32 with double arrays min/max. a = self._generate_int_data(self.nr, self.nc) m = -0.5 M = 1. ac = self.fastclip(a, m * np.zeros(a.shape), M) act = self.clip(a, m * np.zeros(a.shape), M) assert_array_strict_equal(ac, act) def test_type_cast_06(self): # Test native with NON native scalar min/max. a = self._generate_data(self.nr, self.nc) m = 0.5 m_s = self._neg_byteorder(m) M = 1. act = self.clip(a, m_s, M) ac = self.fastclip(a, m_s, M) assert_array_strict_equal(ac, act) def test_type_cast_07(self): # Test NON native with native array min/max. a = self._generate_data(self.nr, self.nc) m = -0.5 * np.ones(a.shape) M = 1. a_s = self._neg_byteorder(a) assert_(not a_s.dtype.isnative) act = a_s.clip(m, M) ac = self.fastclip(a_s, m, M) assert_array_strict_equal(ac, act) def test_type_cast_08(self): # Test NON native with native scalar min/max. a = self._generate_data(self.nr, self.nc) m = -0.5 M = 1. a_s = self._neg_byteorder(a) assert_(not a_s.dtype.isnative) ac = self.fastclip(a_s, m, M) act = a_s.clip(m, M) assert_array_strict_equal(ac, act) def test_type_cast_09(self): # Test native with NON native array min/max. a = self._generate_data(self.nr, self.nc) m = -0.5 * np.ones(a.shape) M = 1. m_s = self._neg_byteorder(m) assert_(not m_s.dtype.isnative) ac = self.fastclip(a, m_s, M) act = self.clip(a, m_s, M) assert_array_strict_equal(ac, act) def test_type_cast_10(self): # Test native int32 with float min/max and float out for output argument. a = self._generate_int_data(self.nr, self.nc) b = np.zeros(a.shape, dtype=np.float32) m = np.float32(-0.5) M = np.float32(1) act = self.clip(a, m, M, out=b) ac = self.fastclip(a, m, M, out=b) assert_array_strict_equal(ac, act) def test_type_cast_11(self): # Test non native with native scalar, min/max, out non native a = self._generate_non_native_data(self.nr, self.nc) b = a.copy() b = b.astype(b.dtype.newbyteorder('>')) bt = b.copy() m = -0.5 M = 1. self.fastclip(a, m, M, out=b) self.clip(a, m, M, out=bt) assert_array_strict_equal(b, bt) def test_type_cast_12(self): # Test native int32 input and min/max and float out a = self._generate_int_data(self.nr, self.nc) b = np.zeros(a.shape, dtype=np.float32) m = np.int32(0) M = np.int32(1) act = self.clip(a, m, M, out=b) ac = self.fastclip(a, m, M, out=b) assert_array_strict_equal(ac, act) def test_clip_with_out_simple(self): # Test native double input with scalar min/max a = self._generate_data(self.nr, self.nc) m = -0.5 M = 0.6 ac = np.zeros(a.shape) act = np.zeros(a.shape) self.fastclip(a, m, M, ac) self.clip(a, m, M, act) assert_array_strict_equal(ac, act) def test_clip_with_out_simple2(self): # Test native int32 input with double min/max and int32 out a = self._generate_int32_data(self.nr, self.nc) m = np.float64(0) M = np.float64(2) ac = np.zeros(a.shape, dtype=np.int32) act = ac.copy() self.fastclip(a, m, M, ac) self.clip(a, m, M, act) assert_array_strict_equal(ac, act) def test_clip_with_out_simple_int32(self): # Test native int32 input with int32 scalar min/max and int64 out a = self._generate_int32_data(self.nr, self.nc) m = np.int32(-1) M = np.int32(1) ac = np.zeros(a.shape, dtype=np.int64) act = ac.copy() self.fastclip(a, m, M, ac) self.clip(a, m, M, act) assert_array_strict_equal(ac, act) def test_clip_with_out_array_int32(self): # Test native int32 input with double array min/max and int32 out a = self._generate_int32_data(self.nr, self.nc) m = np.zeros(a.shape, np.float64) M = np.float64(1) ac = np.zeros(a.shape, dtype=np.int32) act = ac.copy() self.fastclip(a, m, M, ac) self.clip(a, m, M, act) assert_array_strict_equal(ac, act) def test_clip_with_out_array_outint32(self): # Test native double input with scalar min/max and int out a = self._generate_data(self.nr, self.nc) m = -1.0 M = 2.0 ac = np.zeros(a.shape, dtype=np.int32) act = ac.copy() self.fastclip(a, m, M, ac) self.clip(a, m, M, act) assert_array_strict_equal(ac, act) def test_clip_inplace_array(self): # Test native double input with array min/max a = self._generate_data(self.nr, self.nc) ac = a.copy() m = np.zeros(a.shape) M = 1.0 self.fastclip(a, m, M, a) self.clip(a, m, M, ac) assert_array_strict_equal(a, ac) def test_clip_inplace_simple(self): # Test native double input with scalar min/max a = self._generate_data(self.nr, self.nc) ac = a.copy() m = -0.5 M = 0.6 self.fastclip(a, m, M, a) self.clip(a, m, M, ac) assert_array_strict_equal(a, ac) def test_clip_func_takes_out(self): # Ensure that the clip() function takes an out=argument. a = self._generate_data(self.nr, self.nc) ac = a.copy() m = -0.5 M = 0.6 a2 = np.clip(a, m, M, out=a) self.clip(a, m, M, ac) assert_array_strict_equal(a2, ac) assert_(a2 is a) def test_clip_nan(self): d = np.arange(7.) assert_equal(d.clip(min=np.nan), d) assert_equal(d.clip(max=np.nan), d) assert_equal(d.clip(min=np.nan, max=np.nan), d) assert_equal(d.clip(min=-2, max=np.nan), d) assert_equal(d.clip(min=np.nan, max=10), d) class TestAllclose(object): rtol = 1e-5 atol = 1e-8 def setup(self): self.olderr = np.seterr(invalid='ignore') def teardown(self): np.seterr(**self.olderr) def tst_allclose(self, x, y): assert_(np.allclose(x, y), "%s and %s not close" % (x, y)) def tst_not_allclose(self, x, y): assert_(not np.allclose(x, y), "%s and %s shouldn't be close" % (x, y)) def test_ip_allclose(self): # Parametric test factory. arr = np.array([100, 1000]) aran = np.arange(125).reshape((5, 5, 5)) atol = self.atol rtol = self.rtol data = [([1, 0], [1, 0]), ([atol], [0]), ([1], [1+rtol+atol]), (arr, arr + arr*rtol), (arr, arr + arr*rtol + atol*2), (aran, aran + aran*rtol), (np.inf, np.inf), (np.inf, [np.inf])] for (x, y) in data: yield (self.tst_allclose, x, y) def test_ip_not_allclose(self): # Parametric test factory. aran = np.arange(125).reshape((5, 5, 5)) atol = self.atol rtol = self.rtol data = [([np.inf, 0], [1, np.inf]), ([np.inf, 0], [1, 0]), ([np.inf, np.inf], [1, np.inf]), ([np.inf, np.inf], [1, 0]), ([-np.inf, 0], [np.inf, 0]), ([np.nan, 0], [np.nan, 0]), ([atol*2], [0]), ([1], [1+rtol+atol*2]), (aran, aran + aran*atol + atol*2), (np.array([np.inf, 1]), np.array([0, np.inf]))] for (x, y) in data: yield (self.tst_not_allclose, x, y) def test_no_parameter_modification(self): x = np.array([np.inf, 1]) y = np.array([0, np.inf]) np.allclose(x, y) assert_array_equal(x, np.array([np.inf, 1])) assert_array_equal(y, np.array([0, np.inf])) def test_min_int(self): # Could make problems because of abs(min_int) == min_int min_int = np.iinfo(np.int_).min a = np.array([min_int], dtype=np.int_) assert_(np.allclose(a, a)) def test_equalnan(self): x = np.array([1.0, np.nan]) assert_(np.allclose(x, x, equal_nan=True)) def test_return_class_is_ndarray(self): # Issue gh-6475 # Check that allclose does not preserve subtypes class Foo(np.ndarray): def __new__(cls, *args, **kwargs): return np.array(*args, **kwargs).view(cls) a = Foo([1]) assert_(type(np.allclose(a, a)) is bool) class TestIsclose(object): rtol = 1e-5 atol = 1e-8 def setup(self): atol = self.atol rtol = self.rtol arr = np.array([100, 1000]) aran = np.arange(125).reshape((5, 5, 5)) self.all_close_tests = [ ([1, 0], [1, 0]), ([atol], [0]), ([1], [1 + rtol + atol]), (arr, arr + arr*rtol), (arr, arr + arr*rtol + atol), (aran, aran + aran*rtol), (np.inf, np.inf), (np.inf, [np.inf]), ([np.inf, -np.inf], [np.inf, -np.inf]), ] self.none_close_tests = [ ([np.inf, 0], [1, np.inf]), ([np.inf, -np.inf], [1, 0]), ([np.inf, np.inf], [1, -np.inf]), ([np.inf, np.inf], [1, 0]), ([np.nan, 0], [np.nan, -np.inf]), ([atol*2], [0]), ([1], [1 + rtol + atol*2]), (aran, aran + rtol*1.1*aran + atol*1.1), (np.array([np.inf, 1]), np.array([0, np.inf])), ] self.some_close_tests = [ ([np.inf, 0], [np.inf, atol*2]), ([atol, 1, 1e6*(1 + 2*rtol) + atol], [0, np.nan, 1e6]), (np.arange(3), [0, 1, 2.1]), (np.nan, [np.nan, np.nan, np.nan]), ([0], [atol, np.inf, -np.inf, np.nan]), (0, [atol, np.inf, -np.inf, np.nan]), ] self.some_close_results = [ [True, False], [True, False, False], [True, True, False], [False, False, False], [True, False, False, False], [True, False, False, False], ] def test_ip_isclose(self): self.setup() tests = self.some_close_tests results = self.some_close_results for (x, y), result in zip(tests, results): yield (assert_array_equal, np.isclose(x, y), result) def tst_all_isclose(self, x, y): assert_(np.all(np.isclose(x, y)), "%s and %s not close" % (x, y)) def tst_none_isclose(self, x, y): msg = "%s and %s shouldn't be close" assert_(not np.any(np.isclose(x, y)), msg % (x, y)) def tst_isclose_allclose(self, x, y): msg = "isclose.all() and allclose aren't same for %s and %s" msg2 = "isclose and allclose aren't same for %s and %s" if np.isscalar(x) and np.isscalar(y): assert_(np.isclose(x, y) == np.allclose(x, y), msg=msg2 % (x, y)) else: assert_array_equal(np.isclose(x, y).all(), np.allclose(x, y), msg % (x, y)) def test_ip_all_isclose(self): self.setup() for (x, y) in self.all_close_tests: yield (self.tst_all_isclose, x, y) def test_ip_none_isclose(self): self.setup() for (x, y) in self.none_close_tests: yield (self.tst_none_isclose, x, y) def test_ip_isclose_allclose(self): self.setup() tests = (self.all_close_tests + self.none_close_tests + self.some_close_tests) for (x, y) in tests: yield (self.tst_isclose_allclose, x, y) def test_equal_nan(self): assert_array_equal(np.isclose(np.nan, np.nan, equal_nan=True), [True]) arr = np.array([1.0, np.nan]) assert_array_equal(np.isclose(arr, arr, equal_nan=True), [True, True]) def test_masked_arrays(self): # Make sure to test the output type when arguments are interchanged. x = np.ma.masked_where([True, True, False], np.arange(3)) assert_(type(x) is type(np.isclose(2, x))) assert_(type(x) is type(np.isclose(x, 2))) x = np.ma.masked_where([True, True, False], [np.nan, np.inf, np.nan]) assert_(type(x) is type(np.isclose(np.inf, x))) assert_(type(x) is type(np.isclose(x, np.inf))) x = np.ma.masked_where([True, True, False], [np.nan, np.nan, np.nan]) y = np.isclose(np.nan, x, equal_nan=True) assert_(type(x) is type(y)) # Ensure that the mask isn't modified... assert_array_equal([True, True, False], y.mask) y = np.isclose(x, np.nan, equal_nan=True) assert_(type(x) is type(y)) # Ensure that the mask isn't modified... assert_array_equal([True, True, False], y.mask) x = np.ma.masked_where([True, True, False], [np.nan, np.nan, np.nan]) y = np.isclose(x, x, equal_nan=True) assert_(type(x) is type(y)) # Ensure that the mask isn't modified... assert_array_equal([True, True, False], y.mask) def test_scalar_return(self): assert_(np.isscalar(np.isclose(1, 1))) def test_no_parameter_modification(self): x = np.array([np.inf, 1]) y = np.array([0, np.inf]) np.isclose(x, y) assert_array_equal(x, np.array([np.inf, 1])) assert_array_equal(y, np.array([0, np.inf])) def test_non_finite_scalar(self): # GH7014, when two scalars are compared the output should also be a # scalar assert_(np.isclose(np.inf, -np.inf) is np.False_) assert_(np.isclose(0, np.inf) is np.False_) assert_(type(np.isclose(0, np.inf)) is np.bool_) class TestStdVar(object): def setup(self): self.A = np.array([1, -1, 1, -1]) self.real_var = 1 def test_basic(self): assert_almost_equal(np.var(self.A), self.real_var) assert_almost_equal(np.std(self.A)**2, self.real_var) def test_scalars(self): assert_equal(np.var(1), 0) assert_equal(np.std(1), 0) def test_ddof1(self): assert_almost_equal(np.var(self.A, ddof=1), self.real_var*len(self.A)/float(len(self.A)-1)) assert_almost_equal(np.std(self.A, ddof=1)**2, self.real_var*len(self.A)/float(len(self.A)-1)) def test_ddof2(self): assert_almost_equal(np.var(self.A, ddof=2), self.real_var*len(self.A)/float(len(self.A)-2)) assert_almost_equal(np.std(self.A, ddof=2)**2, self.real_var*len(self.A)/float(len(self.A)-2)) def test_out_scalar(self): d = np.arange(10) out = np.array(0.) r = np.std(d, out=out) assert_(r is out) assert_array_equal(r, out) r = np.var(d, out=out) assert_(r is out) assert_array_equal(r, out) r = np.mean(d, out=out) assert_(r is out) assert_array_equal(r, out) class TestStdVarComplex(object): def test_basic(self): A = np.array([1, 1.j, -1, -1.j]) real_var = 1 assert_almost_equal(np.var(A), real_var) assert_almost_equal(np.std(A)**2, real_var) def test_scalars(self): assert_equal(np.var(1j), 0) assert_equal(np.std(1j), 0) class TestCreationFuncs(object): # Test ones, zeros, empty and full. def setup(self): dtypes = {np.dtype(tp) for tp in itertools.chain(*np.sctypes.values())} # void, bytes, str variable_sized = {tp for tp in dtypes if tp.str.endswith('0')} self.dtypes = sorted(dtypes - variable_sized | {np.dtype(tp.str.replace("0", str(i))) for tp in variable_sized for i in range(1, 10)}, key=lambda dtype: dtype.str) self.orders = {'C': 'c_contiguous', 'F': 'f_contiguous'} self.ndims = 10 def check_function(self, func, fill_value=None): par = ((0, 1, 2), range(self.ndims), self.orders, self.dtypes) fill_kwarg = {} if fill_value is not None: fill_kwarg = {'fill_value': fill_value} for size, ndims, order, dtype in itertools.product(*par): shape = ndims * [size] # do not fill void type if fill_kwarg and dtype.str.startswith('|V'): continue arr = func(shape, order=order, dtype=dtype, **fill_kwarg) assert_equal(arr.dtype, dtype) assert_(getattr(arr.flags, self.orders[order])) if fill_value is not None: if dtype.str.startswith('|S'): val = str(fill_value) else: val = fill_value assert_equal(arr, dtype.type(val)) def test_zeros(self): self.check_function(np.zeros) def test_ones(self): self.check_function(np.zeros) def test_empty(self): self.check_function(np.empty) def test_full(self): self.check_function(np.full, 0) self.check_function(np.full, 1) @dec.skipif(not HAS_REFCOUNT, "python has no sys.getrefcount") def test_for_reference_leak(self): # Make sure we have an object for reference dim = 1 beg = sys.getrefcount(dim) np.zeros([dim]*10) assert_(sys.getrefcount(dim) == beg) np.ones([dim]*10) assert_(sys.getrefcount(dim) == beg) np.empty([dim]*10) assert_(sys.getrefcount(dim) == beg) np.full([dim]*10, 0) assert_(sys.getrefcount(dim) == beg) class TestLikeFuncs(object): '''Test ones_like, zeros_like, empty_like and full_like''' def setup(self): self.data = [ # Array scalars (np.array(3.), None), (np.array(3), 'f8'), # 1D arrays (np.arange(6, dtype='f4'), None), (np.arange(6), 'c16'), # 2D C-layout arrays (np.arange(6).reshape(2, 3), None), (np.arange(6).reshape(3, 2), 'i1'), # 2D F-layout arrays (np.arange(6).reshape((2, 3), order='F'), None), (np.arange(6).reshape((3, 2), order='F'), 'i1'), # 3D C-layout arrays (np.arange(24).reshape(2, 3, 4), None), (np.arange(24).reshape(4, 3, 2), 'f4'), # 3D F-layout arrays (np.arange(24).reshape((2, 3, 4), order='F'), None), (np.arange(24).reshape((4, 3, 2), order='F'), 'f4'), # 3D non-C/F-layout arrays (np.arange(24).reshape(2, 3, 4).swapaxes(0, 1), None), (np.arange(24).reshape(4, 3, 2).swapaxes(0, 1), '?'), ] def compare_array_value(self, dz, value, fill_value): if value is not None: if fill_value: try: z = dz.dtype.type(value) except OverflowError: pass else: assert_(np.all(dz == z)) else: assert_(np.all(dz == value)) def check_like_function(self, like_function, value, fill_value=False): if fill_value: fill_kwarg = {'fill_value': value} else: fill_kwarg = {} for d, dtype in self.data: # default (K) order, dtype dz = like_function(d, dtype=dtype, **fill_kwarg) assert_equal(dz.shape, d.shape) assert_equal(np.array(dz.strides)*d.dtype.itemsize, np.array(d.strides)*dz.dtype.itemsize) assert_equal(d.flags.c_contiguous, dz.flags.c_contiguous) assert_equal(d.flags.f_contiguous, dz.flags.f_contiguous) if dtype is None: assert_equal(dz.dtype, d.dtype) else: assert_equal(dz.dtype, np.dtype(dtype)) self.compare_array_value(dz, value, fill_value) # C order, default dtype dz = like_function(d, order='C', dtype=dtype, **fill_kwarg) assert_equal(dz.shape, d.shape) assert_(dz.flags.c_contiguous) if dtype is None: assert_equal(dz.dtype, d.dtype) else: assert_equal(dz.dtype, np.dtype(dtype)) self.compare_array_value(dz, value, fill_value) # F order, default dtype dz = like_function(d, order='F', dtype=dtype, **fill_kwarg) assert_equal(dz.shape, d.shape) assert_(dz.flags.f_contiguous) if dtype is None: assert_equal(dz.dtype, d.dtype) else: assert_equal(dz.dtype, np.dtype(dtype)) self.compare_array_value(dz, value, fill_value) # A order dz = like_function(d, order='A', dtype=dtype, **fill_kwarg) assert_equal(dz.shape, d.shape) if d.flags.f_contiguous: assert_(dz.flags.f_contiguous) else: assert_(dz.flags.c_contiguous) if dtype is None: assert_equal(dz.dtype, d.dtype) else: assert_equal(dz.dtype, np.dtype(dtype)) self.compare_array_value(dz, value, fill_value) # Test the 'subok' parameter a = np.matrix([[1, 2], [3, 4]]) b = like_function(a, **fill_kwarg) assert_(type(b) is np.matrix) b = like_function(a, subok=False, **fill_kwarg) assert_(type(b) is not np.matrix) def test_ones_like(self): self.check_like_function(np.ones_like, 1) def test_zeros_like(self): self.check_like_function(np.zeros_like, 0) def test_empty_like(self): self.check_like_function(np.empty_like, None) def test_filled_like(self): self.check_like_function(np.full_like, 0, True) self.check_like_function(np.full_like, 1, True) self.check_like_function(np.full_like, 1000, True) self.check_like_function(np.full_like, 123.456, True) self.check_like_function(np.full_like, np.inf, True) class TestCorrelate(object): def _setup(self, dt): self.x = np.array([1, 2, 3, 4, 5], dtype=dt) self.xs = np.arange(1, 20)[::3] self.y = np.array([-1, -2, -3], dtype=dt) self.z1 = np.array([ -3., -8., -14., -20., -26., -14., -5.], dtype=dt) self.z1_4 = np.array([-2., -5., -8., -11., -14., -5.], dtype=dt) self.z1r = np.array([-15., -22., -22., -16., -10., -4., -1.], dtype=dt) self.z2 = np.array([-5., -14., -26., -20., -14., -8., -3.], dtype=dt) self.z2r = np.array([-1., -4., -10., -16., -22., -22., -15.], dtype=dt) self.zs = np.array([-3., -14., -30., -48., -66., -84., -102., -54., -19.], dtype=dt) def test_float(self): self._setup(float) z = np.correlate(self.x, self.y, 'full') assert_array_almost_equal(z, self.z1) z = np.correlate(self.x, self.y[:-1], 'full') assert_array_almost_equal(z, self.z1_4) z = np.correlate(self.y, self.x, 'full') assert_array_almost_equal(z, self.z2) z = np.correlate(self.x[::-1], self.y, 'full') assert_array_almost_equal(z, self.z1r) z = np.correlate(self.y, self.x[::-1], 'full') assert_array_almost_equal(z, self.z2r) z = np.correlate(self.xs, self.y, 'full') assert_array_almost_equal(z, self.zs) def test_object(self): self._setup(Decimal) z = np.correlate(self.x, self.y, 'full') assert_array_almost_equal(z, self.z1) z = np.correlate(self.y, self.x, 'full') assert_array_almost_equal(z, self.z2) def test_no_overwrite(self): d = np.ones(100) k = np.ones(3) np.correlate(d, k) assert_array_equal(d, np.ones(100)) assert_array_equal(k, np.ones(3)) def test_complex(self): x = np.array([1, 2, 3, 4+1j], dtype=complex) y = np.array([-1, -2j, 3+1j], dtype=complex) r_z = np.array([3-1j, 6, 8+1j, 11+5j, -5+8j, -4-1j], dtype=complex) r_z = r_z[::-1].conjugate() z = np.correlate(y, x, mode='full') assert_array_almost_equal(z, r_z) class TestConvolve(object): def test_object(self): d = [1.] * 100 k = [1.] * 3 assert_array_almost_equal(np.convolve(d, k)[2:-2], np.full(98, 3)) def test_no_overwrite(self): d = np.ones(100) k = np.ones(3) np.convolve(d, k) assert_array_equal(d, np.ones(100)) assert_array_equal(k, np.ones(3)) class TestArgwhere(object): def test_2D(self): x = np.arange(6).reshape((2, 3)) assert_array_equal(np.argwhere(x > 1), [[0, 2], [1, 0], [1, 1], [1, 2]]) def test_list(self): assert_equal(np.argwhere([4, 0, 2, 1, 3]), [[0], [2], [3], [4]]) class TestStringFunction(object): def test_set_string_function(self): a = np.array([1]) np.set_string_function(lambda x: "FOO", repr=True) assert_equal(repr(a), "FOO") np.set_string_function(None, repr=True) assert_equal(repr(a), "array([1])") np.set_string_function(lambda x: "FOO", repr=False) assert_equal(str(a), "FOO") np.set_string_function(None, repr=False) assert_equal(str(a), "[1]") class TestRoll(object): def test_roll1d(self): x = np.arange(10) xr = np.roll(x, 2) assert_equal(xr, np.array([8, 9, 0, 1, 2, 3, 4, 5, 6, 7])) def test_roll2d(self): x2 = np.reshape(np.arange(10), (2, 5)) x2r = np.roll(x2, 1) assert_equal(x2r, np.array([[9, 0, 1, 2, 3], [4, 5, 6, 7, 8]])) x2r = np.roll(x2, 1, axis=0) assert_equal(x2r, np.array([[5, 6, 7, 8, 9], [0, 1, 2, 3, 4]])) x2r = np.roll(x2, 1, axis=1) assert_equal(x2r, np.array([[4, 0, 1, 2, 3], [9, 5, 6, 7, 8]])) # Roll multiple axes at once. x2r = np.roll(x2, 1, axis=(0, 1)) assert_equal(x2r, np.array([[9, 5, 6, 7, 8], [4, 0, 1, 2, 3]])) x2r = np.roll(x2, (1, 0), axis=(0, 1)) assert_equal(x2r, np.array([[5, 6, 7, 8, 9], [0, 1, 2, 3, 4]])) x2r = np.roll(x2, (-1, 0), axis=(0, 1)) assert_equal(x2r, np.array([[5, 6, 7, 8, 9], [0, 1, 2, 3, 4]])) x2r = np.roll(x2, (0, 1), axis=(0, 1)) assert_equal(x2r, np.array([[4, 0, 1, 2, 3], [9, 5, 6, 7, 8]])) x2r = np.roll(x2, (0, -1), axis=(0, 1)) assert_equal(x2r, np.array([[1, 2, 3, 4, 0], [6, 7, 8, 9, 5]])) x2r = np.roll(x2, (1, 1), axis=(0, 1)) assert_equal(x2r, np.array([[9, 5, 6, 7, 8], [4, 0, 1, 2, 3]])) x2r = np.roll(x2, (-1, -1), axis=(0, 1)) assert_equal(x2r, np.array([[6, 7, 8, 9, 5], [1, 2, 3, 4, 0]])) # Roll the same axis multiple times. x2r = np.roll(x2, 1, axis=(0, 0)) assert_equal(x2r, np.array([[0, 1, 2, 3, 4], [5, 6, 7, 8, 9]])) x2r = np.roll(x2, 1, axis=(1, 1)) assert_equal(x2r, np.array([[3, 4, 0, 1, 2], [8, 9, 5, 6, 7]])) # Roll more than one turn in either direction. x2r = np.roll(x2, 6, axis=1) assert_equal(x2r, np.array([[4, 0, 1, 2, 3], [9, 5, 6, 7, 8]])) x2r = np.roll(x2, -4, axis=1) assert_equal(x2r, np.array([[4, 0, 1, 2, 3], [9, 5, 6, 7, 8]])) def test_roll_empty(self): x = np.array([]) assert_equal(np.roll(x, 1), np.array([])) class TestRollaxis(object): # expected shape indexed by (axis, start) for array of # shape (1, 2, 3, 4) tgtshape = {(0, 0): (1, 2, 3, 4), (0, 1): (1, 2, 3, 4), (0, 2): (2, 1, 3, 4), (0, 3): (2, 3, 1, 4), (0, 4): (2, 3, 4, 1), (1, 0): (2, 1, 3, 4), (1, 1): (1, 2, 3, 4), (1, 2): (1, 2, 3, 4), (1, 3): (1, 3, 2, 4), (1, 4): (1, 3, 4, 2), (2, 0): (3, 1, 2, 4), (2, 1): (1, 3, 2, 4), (2, 2): (1, 2, 3, 4), (2, 3): (1, 2, 3, 4), (2, 4): (1, 2, 4, 3), (3, 0): (4, 1, 2, 3), (3, 1): (1, 4, 2, 3), (3, 2): (1, 2, 4, 3), (3, 3): (1, 2, 3, 4), (3, 4): (1, 2, 3, 4)} def test_exceptions(self): a = np.arange(1*2*3*4).reshape(1, 2, 3, 4) assert_raises(np.AxisError, np.rollaxis, a, -5, 0) assert_raises(np.AxisError, np.rollaxis, a, 0, -5) assert_raises(np.AxisError, np.rollaxis, a, 4, 0) assert_raises(np.AxisError, np.rollaxis, a, 0, 5) def test_results(self): a = np.arange(1*2*3*4).reshape(1, 2, 3, 4).copy() aind = np.indices(a.shape) assert_(a.flags['OWNDATA']) for (i, j) in self.tgtshape: # positive axis, positive start res = np.rollaxis(a, axis=i, start=j) i0, i1, i2, i3 = aind[np.array(res.shape) - 1] assert_(np.all(res[i0, i1, i2, i3] == a)) assert_(res.shape == self.tgtshape[(i, j)], str((i,j))) assert_(not res.flags['OWNDATA']) # negative axis, positive start ip = i + 1 res = np.rollaxis(a, axis=-ip, start=j) i0, i1, i2, i3 = aind[np.array(res.shape) - 1] assert_(np.all(res[i0, i1, i2, i3] == a)) assert_(res.shape == self.tgtshape[(4 - ip, j)]) assert_(not res.flags['OWNDATA']) # positive axis, negative start jp = j + 1 if j < 4 else j res = np.rollaxis(a, axis=i, start=-jp) i0, i1, i2, i3 = aind[np.array(res.shape) - 1] assert_(np.all(res[i0, i1, i2, i3] == a)) assert_(res.shape == self.tgtshape[(i, 4 - jp)]) assert_(not res.flags['OWNDATA']) # negative axis, negative start ip = i + 1 jp = j + 1 if j < 4 else j res = np.rollaxis(a, axis=-ip, start=-jp) i0, i1, i2, i3 = aind[np.array(res.shape) - 1] assert_(np.all(res[i0, i1, i2, i3] == a)) assert_(res.shape == self.tgtshape[(4 - ip, 4 - jp)]) assert_(not res.flags['OWNDATA']) class TestMoveaxis(object): def test_move_to_end(self): x = np.random.randn(5, 6, 7) for source, expected in [(0, (6, 7, 5)), (1, (5, 7, 6)), (2, (5, 6, 7)), (-1, (5, 6, 7))]: actual = np.moveaxis(x, source, -1).shape assert_(actual, expected) def test_move_new_position(self): x = np.random.randn(1, 2, 3, 4) for source, destination, expected in [ (0, 1, (2, 1, 3, 4)), (1, 2, (1, 3, 2, 4)), (1, -1, (1, 3, 4, 2)), ]: actual = np.moveaxis(x, source, destination).shape assert_(actual, expected) def test_preserve_order(self): x = np.zeros((1, 2, 3, 4)) for source, destination in [ (0, 0), (3, -1), (-1, 3), ([0, -1], [0, -1]), ([2, 0], [2, 0]), (range(4), range(4)), ]: actual = np.moveaxis(x, source, destination).shape assert_(actual, (1, 2, 3, 4)) def test_move_multiples(self): x = np.zeros((0, 1, 2, 3)) for source, destination, expected in [ ([0, 1], [2, 3], (2, 3, 0, 1)), ([2, 3], [0, 1], (2, 3, 0, 1)), ([0, 1, 2], [2, 3, 0], (2, 3, 0, 1)), ([3, 0], [1, 0], (0, 3, 1, 2)), ([0, 3], [0, 1], (0, 3, 1, 2)), ]: actual = np.moveaxis(x, source, destination).shape assert_(actual, expected) def test_errors(self): x = np.random.randn(1, 2, 3) assert_raises_regex(np.AxisError, 'source.*out of bounds', np.moveaxis, x, 3, 0) assert_raises_regex(np.AxisError, 'source.*out of bounds', np.moveaxis, x, -4, 0) assert_raises_regex(np.AxisError, 'destination.*out of bounds', np.moveaxis, x, 0, 5) assert_raises_regex(ValueError, 'repeated axis in `source`', np.moveaxis, x, [0, 0], [0, 1]) assert_raises_regex(ValueError, 'repeated axis in `destination`', np.moveaxis, x, [0, 1], [1, 1]) assert_raises_regex(ValueError, 'must have the same number', np.moveaxis, x, 0, [0, 1]) assert_raises_regex(ValueError, 'must have the same number', np.moveaxis, x, [0, 1], [0]) def test_array_likes(self): x = np.ma.zeros((1, 2, 3)) result = np.moveaxis(x, 0, 0) assert_(x.shape, result.shape) assert_(isinstance(result, np.ma.MaskedArray)) x = [1, 2, 3] result = np.moveaxis(x, 0, 0) assert_(x, list(result)) assert_(isinstance(result, np.ndarray)) class TestCross(object): def test_2x2(self): u = [1, 2] v = [3, 4] z = -2 cp = np.cross(u, v) assert_equal(cp, z) cp = np.cross(v, u) assert_equal(cp, -z) def test_2x3(self): u = [1, 2] v = [3, 4, 5] z = np.array([10, -5, -2]) cp = np.cross(u, v) assert_equal(cp, z) cp = np.cross(v, u) assert_equal(cp, -z) def test_3x3(self): u = [1, 2, 3] v = [4, 5, 6] z = np.array([-3, 6, -3]) cp = np.cross(u, v) assert_equal(cp, z) cp = np.cross(v, u) assert_equal(cp, -z) def test_broadcasting(self): # Ticket #2624 (Trac #2032) u = np.tile([1, 2], (11, 1)) v = np.tile([3, 4], (11, 1)) z = -2 assert_equal(np.cross(u, v), z) assert_equal(np.cross(v, u), -z) assert_equal(np.cross(u, u), 0) u = np.tile([1, 2], (11, 1)).T v = np.tile([3, 4, 5], (11, 1)) z = np.tile([10, -5, -2], (11, 1)) assert_equal(np.cross(u, v, axisa=0), z) assert_equal(np.cross(v, u.T), -z) assert_equal(np.cross(v, v), 0) u = np.tile([1, 2, 3], (11, 1)).T v = np.tile([3, 4], (11, 1)).T z = np.tile([-12, 9, -2], (11, 1)) assert_equal(np.cross(u, v, axisa=0, axisb=0), z) assert_equal(np.cross(v.T, u.T), -z) assert_equal(np.cross(u.T, u.T), 0) u = np.tile([1, 2, 3], (5, 1)) v = np.tile([4, 5, 6], (5, 1)).T z = np.tile([-3, 6, -3], (5, 1)) assert_equal(np.cross(u, v, axisb=0), z) assert_equal(np.cross(v.T, u), -z) assert_equal(np.cross(u, u), 0) def test_broadcasting_shapes(self): u = np.ones((2, 1, 3)) v = np.ones((5, 3)) assert_equal(np.cross(u, v).shape, (2, 5, 3)) u = np.ones((10, 3, 5)) v = np.ones((2, 5)) assert_equal(np.cross(u, v, axisa=1, axisb=0).shape, (10, 5, 3)) assert_raises(np.AxisError, np.cross, u, v, axisa=1, axisb=2) assert_raises(np.AxisError, np.cross, u, v, axisa=3, axisb=0) u = np.ones((10, 3, 5, 7)) v = np.ones((5, 7, 2)) assert_equal(np.cross(u, v, axisa=1, axisc=2).shape, (10, 5, 3, 7)) assert_raises(np.AxisError, np.cross, u, v, axisa=-5, axisb=2) assert_raises(np.AxisError, np.cross, u, v, axisa=1, axisb=-4) # gh-5885 u = np.ones((3, 4, 2)) for axisc in range(-2, 2): assert_equal(np.cross(u, u, axisc=axisc).shape, (3, 4)) def test_outer_out_param(): arr1 = np.ones((5,)) arr2 = np.ones((2,)) arr3 = np.linspace(-2, 2, 5) out1 = np.ndarray(shape=(5,5)) out2 = np.ndarray(shape=(2, 5)) res1 = np.outer(arr1, arr3, out1) assert_equal(res1, out1) assert_equal(np.outer(arr2, arr3, out2), out2) class TestRequire(object): flag_names = ['C', 'C_CONTIGUOUS', 'CONTIGUOUS', 'F', 'F_CONTIGUOUS', 'FORTRAN', 'A', 'ALIGNED', 'W', 'WRITEABLE', 'O', 'OWNDATA'] def generate_all_false(self, dtype): arr = np.zeros((2, 2), [('junk', 'i1'), ('a', dtype)]) arr.setflags(write=False) a = arr['a'] assert_(not a.flags['C']) assert_(not a.flags['F']) assert_(not a.flags['O']) assert_(not a.flags['W']) assert_(not a.flags['A']) return a def set_and_check_flag(self, flag, dtype, arr): if dtype is None: dtype = arr.dtype b = np.require(arr, dtype, [flag]) assert_(b.flags[flag]) assert_(b.dtype == dtype) # a further call to np.require ought to return the same array # unless OWNDATA is specified. c = np.require(b, None, [flag]) if flag[0] != 'O': assert_(c is b) else: assert_(c.flags[flag]) def test_require_each(self): id = ['f8', 'i4'] fd = [None, 'f8', 'c16'] for idtype, fdtype, flag in itertools.product(id, fd, self.flag_names): a = self.generate_all_false(idtype) yield self.set_and_check_flag, flag, fdtype, a def test_unknown_requirement(self): a = self.generate_all_false('f8') assert_raises(KeyError, np.require, a, None, 'Q') def test_non_array_input(self): a = np.require([1, 2, 3, 4], 'i4', ['C', 'A', 'O']) assert_(a.flags['O']) assert_(a.flags['C']) assert_(a.flags['A']) assert_(a.dtype == 'i4') assert_equal(a, [1, 2, 3, 4]) def test_C_and_F_simul(self): a = self.generate_all_false('f8') assert_raises(ValueError, np.require, a, None, ['C', 'F']) def test_ensure_array(self): class ArraySubclass(np.ndarray): pass a = ArraySubclass((2, 2)) b = np.require(a, None, ['E']) assert_(type(b) is np.ndarray) def test_preserve_subtype(self): class ArraySubclass(np.ndarray): pass for flag in self.flag_names: a = ArraySubclass((2, 2)) yield self.set_and_check_flag, flag, None, a class TestBroadcast(object): def test_broadcast_in_args(self): # gh-5881 arrs = [np.empty((6, 7)), np.empty((5, 6, 1)), np.empty((7,)), np.empty((5, 1, 7))] mits = [np.broadcast(*arrs), np.broadcast(np.broadcast(*arrs[:2]), np.broadcast(*arrs[2:])), np.broadcast(arrs[0], np.broadcast(*arrs[1:-1]), arrs[-1])] for mit in mits: assert_equal(mit.shape, (5, 6, 7)) assert_equal(mit.ndim, 3) assert_equal(mit.nd, 3) assert_equal(mit.numiter, 4) for a, ia in zip(arrs, mit.iters): assert_(a is ia.base) def test_broadcast_single_arg(self): # gh-6899 arrs = [np.empty((5, 6, 7))] mit = np.broadcast(*arrs) assert_equal(mit.shape, (5, 6, 7)) assert_equal(mit.ndim, 3) assert_equal(mit.nd, 3) assert_equal(mit.numiter, 1) assert_(arrs[0] is mit.iters[0].base) def test_number_of_arguments(self): arr = np.empty((5,)) for j in range(35): arrs = [arr] * j if j < 1 or j > 32: assert_raises(ValueError, np.broadcast, *arrs) else: mit = np.broadcast(*arrs) assert_equal(mit.numiter, j) class TestKeepdims(object): class sub_array(np.ndarray): def sum(self, axis=None, dtype=None, out=None): return np.ndarray.sum(self, axis, dtype, out, keepdims=True) def test_raise(self): sub_class = self.sub_array x = np.arange(30).view(sub_class) assert_raises(TypeError, np.sum, x, keepdims=True) class TestTensordot(object): def test_zero_dimension(self): # Test resolution to issue #5663 a = np.ndarray((3,0)) b = np.ndarray((0,4)) td = np.tensordot(a, b, (1, 0)) assert_array_equal(td, np.dot(a, b)) assert_array_equal(td, np.einsum('ij,jk', a, b)) if __name__ == "__main__": run_module_suite()
102,126
36.272628
91
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_dtype.py
from __future__ import division, absolute_import, print_function import pickle import sys import operator import numpy as np from numpy.core.test_rational import rational from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_raises, dec ) def assert_dtype_equal(a, b): assert_equal(a, b) assert_equal(hash(a), hash(b), "two equivalent types do not hash to the same value !") def assert_dtype_not_equal(a, b): assert_(a != b) assert_(hash(a) != hash(b), "two different types hash to the same value !") class TestBuiltin(object): def test_run(self): """Only test hash runs at all.""" for t in [int, float, complex, np.int32, str, object, np.unicode]: dt = np.dtype(t) hash(dt) def test_dtype(self): # Make sure equivalent byte order char hash the same (e.g. < and = on # little endian) for t in [int, float]: dt = np.dtype(t) dt2 = dt.newbyteorder("<") dt3 = dt.newbyteorder(">") if dt == dt2: assert_(dt.byteorder != dt2.byteorder, "bogus test") assert_dtype_equal(dt, dt2) else: assert_(dt.byteorder != dt3.byteorder, "bogus test") assert_dtype_equal(dt, dt3) def test_equivalent_dtype_hashing(self): # Make sure equivalent dtypes with different type num hash equal uintp = np.dtype(np.uintp) if uintp.itemsize == 4: left = uintp right = np.dtype(np.uint32) else: left = uintp right = np.dtype(np.ulonglong) assert_(left == right) assert_(hash(left) == hash(right)) def test_invalid_types(self): # Make sure invalid type strings raise an error assert_raises(TypeError, np.dtype, 'O3') assert_raises(TypeError, np.dtype, 'O5') assert_raises(TypeError, np.dtype, 'O7') assert_raises(TypeError, np.dtype, 'b3') assert_raises(TypeError, np.dtype, 'h4') assert_raises(TypeError, np.dtype, 'I5') assert_raises(TypeError, np.dtype, 'e3') assert_raises(TypeError, np.dtype, 'f5') if np.dtype('g').itemsize == 8 or np.dtype('g').itemsize == 16: assert_raises(TypeError, np.dtype, 'g12') elif np.dtype('g').itemsize == 12: assert_raises(TypeError, np.dtype, 'g16') if np.dtype('l').itemsize == 8: assert_raises(TypeError, np.dtype, 'l4') assert_raises(TypeError, np.dtype, 'L4') else: assert_raises(TypeError, np.dtype, 'l8') assert_raises(TypeError, np.dtype, 'L8') if np.dtype('q').itemsize == 8: assert_raises(TypeError, np.dtype, 'q4') assert_raises(TypeError, np.dtype, 'Q4') else: assert_raises(TypeError, np.dtype, 'q8') assert_raises(TypeError, np.dtype, 'Q8') def test_bad_param(self): # Can't give a size that's too small assert_raises(ValueError, np.dtype, {'names':['f0', 'f1'], 'formats':['i4', 'i1'], 'offsets':[0, 4], 'itemsize':4}) # If alignment is enabled, the alignment (4) must divide the itemsize assert_raises(ValueError, np.dtype, {'names':['f0', 'f1'], 'formats':['i4', 'i1'], 'offsets':[0, 4], 'itemsize':9}, align=True) # If alignment is enabled, the individual fields must be aligned assert_raises(ValueError, np.dtype, {'names':['f0', 'f1'], 'formats':['i1', 'f4'], 'offsets':[0, 2]}, align=True) def test_field_order_equality(self): x = np.dtype({'names': ['A', 'B'], 'formats': ['i4', 'f4'], 'offsets': [0, 4]}) y = np.dtype({'names': ['B', 'A'], 'formats': ['f4', 'i4'], 'offsets': [4, 0]}) assert_equal(x == y, False) class TestRecord(object): def test_equivalent_record(self): """Test whether equivalent record dtypes hash the same.""" a = np.dtype([('yo', int)]) b = np.dtype([('yo', int)]) assert_dtype_equal(a, b) def test_different_names(self): # In theory, they may hash the same (collision) ? a = np.dtype([('yo', int)]) b = np.dtype([('ye', int)]) assert_dtype_not_equal(a, b) def test_different_titles(self): # In theory, they may hash the same (collision) ? a = np.dtype({'names': ['r', 'b'], 'formats': ['u1', 'u1'], 'titles': ['Red pixel', 'Blue pixel']}) b = np.dtype({'names': ['r', 'b'], 'formats': ['u1', 'u1'], 'titles': ['RRed pixel', 'Blue pixel']}) assert_dtype_not_equal(a, b) def test_mutate(self): # Mutating a dtype should reset the cached hash value a = np.dtype([('yo', int)]) b = np.dtype([('yo', int)]) c = np.dtype([('ye', int)]) assert_dtype_equal(a, b) assert_dtype_not_equal(a, c) a.names = ['ye'] assert_dtype_equal(a, c) assert_dtype_not_equal(a, b) state = b.__reduce__()[2] a.__setstate__(state) assert_dtype_equal(a, b) assert_dtype_not_equal(a, c) def test_not_lists(self): """Test if an appropriate exception is raised when passing bad values to the dtype constructor. """ assert_raises(TypeError, np.dtype, dict(names=set(['A', 'B']), formats=['f8', 'i4'])) assert_raises(TypeError, np.dtype, dict(names=['A', 'B'], formats=set(['f8', 'i4']))) def test_aligned_size(self): # Check that structured dtypes get padded to an aligned size dt = np.dtype('i4, i1', align=True) assert_equal(dt.itemsize, 8) dt = np.dtype([('f0', 'i4'), ('f1', 'i1')], align=True) assert_equal(dt.itemsize, 8) dt = np.dtype({'names':['f0', 'f1'], 'formats':['i4', 'u1'], 'offsets':[0, 4]}, align=True) assert_equal(dt.itemsize, 8) dt = np.dtype({'f0': ('i4', 0), 'f1':('u1', 4)}, align=True) assert_equal(dt.itemsize, 8) # Nesting should preserve that alignment dt1 = np.dtype([('f0', 'i4'), ('f1', [('f1', 'i1'), ('f2', 'i4'), ('f3', 'i1')]), ('f2', 'i1')], align=True) assert_equal(dt1.itemsize, 20) dt2 = np.dtype({'names':['f0', 'f1', 'f2'], 'formats':['i4', [('f1', 'i1'), ('f2', 'i4'), ('f3', 'i1')], 'i1'], 'offsets':[0, 4, 16]}, align=True) assert_equal(dt2.itemsize, 20) dt3 = np.dtype({'f0': ('i4', 0), 'f1': ([('f1', 'i1'), ('f2', 'i4'), ('f3', 'i1')], 4), 'f2': ('i1', 16)}, align=True) assert_equal(dt3.itemsize, 20) assert_equal(dt1, dt2) assert_equal(dt2, dt3) # Nesting should preserve packing dt1 = np.dtype([('f0', 'i4'), ('f1', [('f1', 'i1'), ('f2', 'i4'), ('f3', 'i1')]), ('f2', 'i1')], align=False) assert_equal(dt1.itemsize, 11) dt2 = np.dtype({'names':['f0', 'f1', 'f2'], 'formats':['i4', [('f1', 'i1'), ('f2', 'i4'), ('f3', 'i1')], 'i1'], 'offsets':[0, 4, 10]}, align=False) assert_equal(dt2.itemsize, 11) dt3 = np.dtype({'f0': ('i4', 0), 'f1': ([('f1', 'i1'), ('f2', 'i4'), ('f3', 'i1')], 4), 'f2': ('i1', 10)}, align=False) assert_equal(dt3.itemsize, 11) assert_equal(dt1, dt2) assert_equal(dt2, dt3) def test_union_struct(self): # Should be able to create union dtypes dt = np.dtype({'names':['f0', 'f1', 'f2'], 'formats':['<u4', '<u2', '<u2'], 'offsets':[0, 0, 2]}, align=True) assert_equal(dt.itemsize, 4) a = np.array([3], dtype='<u4').view(dt) a['f1'] = 10 a['f2'] = 36 assert_equal(a['f0'], 10 + 36*256*256) # Should be able to specify fields out of order dt = np.dtype({'names':['f0', 'f1', 'f2'], 'formats':['<u4', '<u2', '<u2'], 'offsets':[4, 0, 2]}, align=True) assert_equal(dt.itemsize, 8) # field name should not matter: assignment is by position dt2 = np.dtype({'names':['f2', 'f0', 'f1'], 'formats':['<u4', '<u2', '<u2'], 'offsets':[4, 0, 2]}, align=True) vals = [(0, 1, 2), (3, -1, 4)] vals2 = [(0, 1, 2), (3, -1, 4)] a = np.array(vals, dt) b = np.array(vals2, dt2) assert_equal(a.astype(dt2), b) assert_equal(b.astype(dt), a) assert_equal(a.view(dt2), b) assert_equal(b.view(dt), a) # Should not be able to overlap objects with other types assert_raises(TypeError, np.dtype, {'names':['f0', 'f1'], 'formats':['O', 'i1'], 'offsets':[0, 2]}) assert_raises(TypeError, np.dtype, {'names':['f0', 'f1'], 'formats':['i4', 'O'], 'offsets':[0, 3]}) assert_raises(TypeError, np.dtype, {'names':['f0', 'f1'], 'formats':[[('a', 'O')], 'i1'], 'offsets':[0, 2]}) assert_raises(TypeError, np.dtype, {'names':['f0', 'f1'], 'formats':['i4', [('a', 'O')]], 'offsets':[0, 3]}) # Out of order should still be ok, however dt = np.dtype({'names':['f0', 'f1'], 'formats':['i1', 'O'], 'offsets':[np.dtype('intp').itemsize, 0]}) def test_comma_datetime(self): dt = np.dtype('M8[D],datetime64[Y],i8') assert_equal(dt, np.dtype([('f0', 'M8[D]'), ('f1', 'datetime64[Y]'), ('f2', 'i8')])) def test_from_dictproxy(self): # Tests for PR #5920 dt = np.dtype({'names': ['a', 'b'], 'formats': ['i4', 'f4']}) assert_dtype_equal(dt, np.dtype(dt.fields)) dt2 = np.dtype((np.void, dt.fields)) assert_equal(dt2.fields, dt.fields) def test_from_dict_with_zero_width_field(self): # Regression test for #6430 / #2196 dt = np.dtype([('val1', np.float32, (0,)), ('val2', int)]) dt2 = np.dtype({'names': ['val1', 'val2'], 'formats': [(np.float32, (0,)), int]}) assert_dtype_equal(dt, dt2) assert_equal(dt.fields['val1'][0].itemsize, 0) assert_equal(dt.itemsize, dt.fields['val2'][0].itemsize) def test_bool_commastring(self): d = np.dtype('?,?,?') # raises? assert_equal(len(d.names), 3) for n in d.names: assert_equal(d.fields[n][0], np.dtype('?')) def test_nonint_offsets(self): # gh-8059 def make_dtype(off): return np.dtype({'names': ['A'], 'formats': ['i4'], 'offsets': [off]}) assert_raises(TypeError, make_dtype, 'ASD') assert_raises(OverflowError, make_dtype, 2**70) assert_raises(TypeError, make_dtype, 2.3) assert_raises(ValueError, make_dtype, -10) # no errors here: dt = make_dtype(np.uint32(0)) np.zeros(1, dtype=dt)[0].item() def test_fields_by_index(self): dt = np.dtype([('a', np.int8), ('b', np.float32, 3)]) assert_dtype_equal(dt[0], np.dtype(np.int8)) assert_dtype_equal(dt[1], np.dtype((np.float32, 3))) assert_dtype_equal(dt[-1], dt[1]) assert_dtype_equal(dt[-2], dt[0]) assert_raises(IndexError, lambda: dt[-3]) assert_raises(TypeError, operator.getitem, dt, 3.0) assert_raises(TypeError, operator.getitem, dt, []) assert_equal(dt[1], dt[np.int8(1)]) class TestSubarray(object): def test_single_subarray(self): a = np.dtype((int, (2))) b = np.dtype((int, (2,))) assert_dtype_equal(a, b) assert_equal(type(a.subdtype[1]), tuple) assert_equal(type(b.subdtype[1]), tuple) def test_equivalent_record(self): """Test whether equivalent subarray dtypes hash the same.""" a = np.dtype((int, (2, 3))) b = np.dtype((int, (2, 3))) assert_dtype_equal(a, b) def test_nonequivalent_record(self): """Test whether different subarray dtypes hash differently.""" a = np.dtype((int, (2, 3))) b = np.dtype((int, (3, 2))) assert_dtype_not_equal(a, b) a = np.dtype((int, (2, 3))) b = np.dtype((int, (2, 2))) assert_dtype_not_equal(a, b) a = np.dtype((int, (1, 2, 3))) b = np.dtype((int, (1, 2))) assert_dtype_not_equal(a, b) def test_shape_equal(self): """Test some data types that are equal""" assert_dtype_equal(np.dtype('f8'), np.dtype(('f8', tuple()))) assert_dtype_equal(np.dtype('f8'), np.dtype(('f8', 1))) assert_dtype_equal(np.dtype((int, 2)), np.dtype((int, (2,)))) assert_dtype_equal(np.dtype(('<f4', (3, 2))), np.dtype(('<f4', (3, 2)))) d = ([('a', 'f4', (1, 2)), ('b', 'f8', (3, 1))], (3, 2)) assert_dtype_equal(np.dtype(d), np.dtype(d)) def test_shape_simple(self): """Test some simple cases that shouldn't be equal""" assert_dtype_not_equal(np.dtype('f8'), np.dtype(('f8', (1,)))) assert_dtype_not_equal(np.dtype(('f8', (1,))), np.dtype(('f8', (1, 1)))) assert_dtype_not_equal(np.dtype(('f4', (3, 2))), np.dtype(('f4', (2, 3)))) def test_shape_monster(self): """Test some more complicated cases that shouldn't be equal""" assert_dtype_not_equal( np.dtype(([('a', 'f4', (2, 1)), ('b', 'f8', (1, 3))], (2, 2))), np.dtype(([('a', 'f4', (1, 2)), ('b', 'f8', (1, 3))], (2, 2)))) assert_dtype_not_equal( np.dtype(([('a', 'f4', (2, 1)), ('b', 'f8', (1, 3))], (2, 2))), np.dtype(([('a', 'f4', (2, 1)), ('b', 'i8', (1, 3))], (2, 2)))) assert_dtype_not_equal( np.dtype(([('a', 'f4', (2, 1)), ('b', 'f8', (1, 3))], (2, 2))), np.dtype(([('e', 'f8', (1, 3)), ('d', 'f4', (2, 1))], (2, 2)))) assert_dtype_not_equal( np.dtype(([('a', [('a', 'i4', 6)], (2, 1)), ('b', 'f8', (1, 3))], (2, 2))), np.dtype(([('a', [('a', 'u4', 6)], (2, 1)), ('b', 'f8', (1, 3))], (2, 2)))) def test_shape_sequence(self): # Any sequence of integers should work as shape, but the result # should be a tuple (immutable) of base type integers. a = np.array([1, 2, 3], dtype=np.int16) l = [1, 2, 3] # Array gets converted dt = np.dtype([('a', 'f4', a)]) assert_(isinstance(dt['a'].shape, tuple)) assert_(isinstance(dt['a'].shape[0], int)) # List gets converted dt = np.dtype([('a', 'f4', l)]) assert_(isinstance(dt['a'].shape, tuple)) # class IntLike(object): def __index__(self): return 3 def __int__(self): # (a PyNumber_Check fails without __int__) return 3 dt = np.dtype([('a', 'f4', IntLike())]) assert_(isinstance(dt['a'].shape, tuple)) assert_(isinstance(dt['a'].shape[0], int)) dt = np.dtype([('a', 'f4', (IntLike(),))]) assert_(isinstance(dt['a'].shape, tuple)) assert_(isinstance(dt['a'].shape[0], int)) def test_shape_matches_ndim(self): dt = np.dtype([('a', 'f4', ())]) assert_equal(dt['a'].shape, ()) assert_equal(dt['a'].ndim, 0) dt = np.dtype([('a', 'f4')]) assert_equal(dt['a'].shape, ()) assert_equal(dt['a'].ndim, 0) dt = np.dtype([('a', 'f4', 4)]) assert_equal(dt['a'].shape, (4,)) assert_equal(dt['a'].ndim, 1) dt = np.dtype([('a', 'f4', (1, 2, 3))]) assert_equal(dt['a'].shape, (1, 2, 3)) assert_equal(dt['a'].ndim, 3) def test_shape_invalid(self): # Check that the shape is valid. max_int = np.iinfo(np.intc).max max_intp = np.iinfo(np.intp).max # Too large values (the datatype is part of this) assert_raises(ValueError, np.dtype, [('a', 'f4', max_int // 4 + 1)]) assert_raises(ValueError, np.dtype, [('a', 'f4', max_int + 1)]) assert_raises(ValueError, np.dtype, [('a', 'f4', (max_int, 2))]) # Takes a different code path (fails earlier: assert_raises(ValueError, np.dtype, [('a', 'f4', max_intp + 1)]) # Negative values assert_raises(ValueError, np.dtype, [('a', 'f4', -1)]) assert_raises(ValueError, np.dtype, [('a', 'f4', (-1, -1))]) def test_alignment(self): #Check that subarrays are aligned t1 = np.dtype('1i4', align=True) t2 = np.dtype('2i4', align=True) assert_equal(t1.alignment, t2.alignment) class TestMonsterType(object): """Test deeply nested subtypes.""" def test1(self): simple1 = np.dtype({'names': ['r', 'b'], 'formats': ['u1', 'u1'], 'titles': ['Red pixel', 'Blue pixel']}) a = np.dtype([('yo', int), ('ye', simple1), ('yi', np.dtype((int, (3, 2))))]) b = np.dtype([('yo', int), ('ye', simple1), ('yi', np.dtype((int, (3, 2))))]) assert_dtype_equal(a, b) c = np.dtype([('yo', int), ('ye', simple1), ('yi', np.dtype((a, (3, 2))))]) d = np.dtype([('yo', int), ('ye', simple1), ('yi', np.dtype((a, (3, 2))))]) assert_dtype_equal(c, d) class TestMetadata(object): def test_no_metadata(self): d = np.dtype(int) assert_(d.metadata is None) def test_metadata_takes_dict(self): d = np.dtype(int, metadata={'datum': 1}) assert_(d.metadata == {'datum': 1}) def test_metadata_rejects_nondict(self): assert_raises(TypeError, np.dtype, int, metadata='datum') assert_raises(TypeError, np.dtype, int, metadata=1) assert_raises(TypeError, np.dtype, int, metadata=None) def test_nested_metadata(self): d = np.dtype([('a', np.dtype(int, metadata={'datum': 1}))]) assert_(d['a'].metadata == {'datum': 1}) def test_base_metadata_copied(self): d = np.dtype((np.void, np.dtype('i4,i4', metadata={'datum': 1}))) assert_(d.metadata == {'datum': 1}) class TestString(object): def test_complex_dtype_str(self): dt = np.dtype([('top', [('tiles', ('>f4', (64, 64)), (1,)), ('rtile', '>f4', (64, 36))], (3,)), ('bottom', [('bleft', ('>f4', (8, 64)), (1,)), ('bright', '>f4', (8, 36))])]) assert_equal(str(dt), "[('top', [('tiles', ('>f4', (64, 64)), (1,)), " "('rtile', '>f4', (64, 36))], (3,)), " "('bottom', [('bleft', ('>f4', (8, 64)), (1,)), " "('bright', '>f4', (8, 36))])]") # If the sticky aligned flag is set to True, it makes the # str() function use a dict representation with an 'aligned' flag dt = np.dtype([('top', [('tiles', ('>f4', (64, 64)), (1,)), ('rtile', '>f4', (64, 36))], (3,)), ('bottom', [('bleft', ('>f4', (8, 64)), (1,)), ('bright', '>f4', (8, 36))])], align=True) assert_equal(str(dt), "{'names':['top','bottom'], " "'formats':[([('tiles', ('>f4', (64, 64)), (1,)), " "('rtile', '>f4', (64, 36))], (3,))," "[('bleft', ('>f4', (8, 64)), (1,)), " "('bright', '>f4', (8, 36))]], " "'offsets':[0,76800], " "'itemsize':80000, " "'aligned':True}") assert_equal(np.dtype(eval(str(dt))), dt) dt = np.dtype({'names': ['r', 'g', 'b'], 'formats': ['u1', 'u1', 'u1'], 'offsets': [0, 1, 2], 'titles': ['Red pixel', 'Green pixel', 'Blue pixel']}) assert_equal(str(dt), "[(('Red pixel', 'r'), 'u1'), " "(('Green pixel', 'g'), 'u1'), " "(('Blue pixel', 'b'), 'u1')]") dt = np.dtype({'names': ['rgba', 'r', 'g', 'b'], 'formats': ['<u4', 'u1', 'u1', 'u1'], 'offsets': [0, 0, 1, 2], 'titles': ['Color', 'Red pixel', 'Green pixel', 'Blue pixel']}) assert_equal(str(dt), "{'names':['rgba','r','g','b']," " 'formats':['<u4','u1','u1','u1']," " 'offsets':[0,0,1,2]," " 'titles':['Color','Red pixel'," "'Green pixel','Blue pixel']," " 'itemsize':4}") dt = np.dtype({'names': ['r', 'b'], 'formats': ['u1', 'u1'], 'offsets': [0, 2], 'titles': ['Red pixel', 'Blue pixel']}) assert_equal(str(dt), "{'names':['r','b']," " 'formats':['u1','u1']," " 'offsets':[0,2]," " 'titles':['Red pixel','Blue pixel']," " 'itemsize':3}") dt = np.dtype([('a', '<m8[D]'), ('b', '<M8[us]')]) assert_equal(str(dt), "[('a', '<m8[D]'), ('b', '<M8[us]')]") def test_complex_dtype_repr(self): dt = np.dtype([('top', [('tiles', ('>f4', (64, 64)), (1,)), ('rtile', '>f4', (64, 36))], (3,)), ('bottom', [('bleft', ('>f4', (8, 64)), (1,)), ('bright', '>f4', (8, 36))])]) assert_equal(repr(dt), "dtype([('top', [('tiles', ('>f4', (64, 64)), (1,)), " "('rtile', '>f4', (64, 36))], (3,)), " "('bottom', [('bleft', ('>f4', (8, 64)), (1,)), " "('bright', '>f4', (8, 36))])])") dt = np.dtype({'names': ['r', 'g', 'b'], 'formats': ['u1', 'u1', 'u1'], 'offsets': [0, 1, 2], 'titles': ['Red pixel', 'Green pixel', 'Blue pixel']}, align=True) assert_equal(repr(dt), "dtype([(('Red pixel', 'r'), 'u1'), " "(('Green pixel', 'g'), 'u1'), " "(('Blue pixel', 'b'), 'u1')], align=True)") dt = np.dtype({'names': ['rgba', 'r', 'g', 'b'], 'formats': ['<u4', 'u1', 'u1', 'u1'], 'offsets': [0, 0, 1, 2], 'titles': ['Color', 'Red pixel', 'Green pixel', 'Blue pixel']}, align=True) assert_equal(repr(dt), "dtype({'names':['rgba','r','g','b']," " 'formats':['<u4','u1','u1','u1']," " 'offsets':[0,0,1,2]," " 'titles':['Color','Red pixel'," "'Green pixel','Blue pixel']," " 'itemsize':4}, align=True)") dt = np.dtype({'names': ['r', 'b'], 'formats': ['u1', 'u1'], 'offsets': [0, 2], 'titles': ['Red pixel', 'Blue pixel'], 'itemsize': 4}) assert_equal(repr(dt), "dtype({'names':['r','b'], " "'formats':['u1','u1'], " "'offsets':[0,2], " "'titles':['Red pixel','Blue pixel'], " "'itemsize':4})") dt = np.dtype([('a', '<M8[D]'), ('b', '<m8[us]')]) assert_equal(repr(dt), "dtype([('a', '<M8[D]'), ('b', '<m8[us]')])") @dec.skipif(sys.version_info[0] >= 3) def test_dtype_str_with_long_in_shape(self): # Pull request #376, should not error np.dtype('(1L,)i4') def test_base_dtype_with_object_type(self): # Issue gh-2798, should not error. np.array(['a'], dtype="O").astype(("O", [("name", "O")])) def test_empty_string_to_object(self): # Pull request #4722 np.array(["", ""]).astype(object) class TestDtypeAttributeDeletion(object): def test_dtype_non_writable_attributes_deletion(self): dt = np.dtype(np.double) attr = ["subdtype", "descr", "str", "name", "base", "shape", "isbuiltin", "isnative", "isalignedstruct", "fields", "metadata", "hasobject"] for s in attr: assert_raises(AttributeError, delattr, dt, s) def test_dtype_writable_attributes_deletion(self): dt = np.dtype(np.double) attr = ["names"] for s in attr: assert_raises(AttributeError, delattr, dt, s) class TestDtypeAttributes(object): def test_descr_has_trailing_void(self): # see gh-6359 dtype = np.dtype({ 'names': ['A', 'B'], 'formats': ['f4', 'f4'], 'offsets': [0, 8], 'itemsize': 16}) new_dtype = np.dtype(dtype.descr) assert_equal(new_dtype.itemsize, 16) def test_name_builtin(self): for t in np.typeDict.values(): name = t.__name__ if name.endswith('_'): name = name[:-1] assert_equal(np.dtype(t).name, name) def test_name_dtype_subclass(self): # Ticket #4357 class user_def_subcls(np.void): pass assert_equal(np.dtype(user_def_subcls).name, 'user_def_subcls') class TestPickling(object): def check_pickling(self, dtype): for proto in range(pickle.HIGHEST_PROTOCOL + 1): pickled = pickle.loads(pickle.dumps(dtype, proto)) assert_equal(pickled, dtype) assert_equal(pickled.descr, dtype.descr) if dtype.metadata is not None: assert_equal(pickled.metadata, dtype.metadata) # Check the reconstructed dtype is functional x = np.zeros(3, dtype=dtype) y = np.zeros(3, dtype=pickled) assert_equal(x, y) assert_equal(x[0], y[0]) def test_builtin(self): for t in [int, float, complex, np.int32, str, object, np.unicode, bool]: self.check_pickling(np.dtype(t)) def test_structured(self): dt = np.dtype(([('a', '>f4', (2, 1)), ('b', '<f8', (1, 3))], (2, 2))) self.check_pickling(dt) dt = np.dtype('i4, i1', align=True) self.check_pickling(dt) dt = np.dtype('i4, i1', align=False) self.check_pickling(dt) dt = np.dtype({ 'names': ['A', 'B'], 'formats': ['f4', 'f4'], 'offsets': [0, 8], 'itemsize': 16}) self.check_pickling(dt) dt = np.dtype({'names': ['r', 'b'], 'formats': ['u1', 'u1'], 'titles': ['Red pixel', 'Blue pixel']}) self.check_pickling(dt) def test_datetime(self): for base in ['m8', 'M8']: for unit in ['', 'Y', 'M', 'W', 'D', 'h', 'm', 's', 'ms', 'us', 'ns', 'ps', 'fs', 'as']: dt = np.dtype('%s[%s]' % (base, unit) if unit else base) self.check_pickling(dt) if unit: dt = np.dtype('%s[7%s]' % (base, unit)) self.check_pickling(dt) def test_metadata(self): dt = np.dtype(int, metadata={'datum': 1}) self.check_pickling(dt) def test_rational_dtype(): # test for bug gh-5719 a = np.array([1111], dtype=rational).astype assert_raises(OverflowError, a, 'int8') # test that dtype detection finds user-defined types x = rational(1) assert_equal(np.array([x,x]).dtype, np.dtype(rational)) def test_dtypes_are_true(): # test for gh-6294 assert bool(np.dtype('f8')) assert bool(np.dtype('i8')) assert bool(np.dtype([('a', 'i8'), ('b', 'f4')])) def test_invalid_dtype_string(): # test for gh-10440 assert_raises(TypeError, np.dtype, 'f8,i8,[f8,i8]') if __name__ == "__main__": run_module_suite()
29,072
38.880658
87
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_scalarmath.py
from __future__ import division, absolute_import, print_function import sys import warnings import itertools import operator import platform import numpy as np from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_raises, assert_almost_equal, assert_allclose, assert_array_equal, IS_PYPY, suppress_warnings, dec, _gen_alignment_data, ) types = [np.bool_, np.byte, np.ubyte, np.short, np.ushort, np.intc, np.uintc, np.int_, np.uint, np.longlong, np.ulonglong, np.single, np.double, np.longdouble, np.csingle, np.cdouble, np.clongdouble] floating_types = np.floating.__subclasses__() complex_floating_types = np.complexfloating.__subclasses__() # This compares scalarmath against ufuncs. class TestTypes(object): def test_types(self): for atype in types: a = atype(1) assert_(a == 1, "error with %r: got %r" % (atype, a)) def test_type_add(self): # list of types for k, atype in enumerate(types): a_scalar = atype(3) a_array = np.array([3], dtype=atype) for l, btype in enumerate(types): b_scalar = btype(1) b_array = np.array([1], dtype=btype) c_scalar = a_scalar + b_scalar c_array = a_array + b_array # It was comparing the type numbers, but the new ufunc # function-finding mechanism finds the lowest function # to which both inputs can be cast - which produces 'l' # when you do 'q' + 'b'. The old function finding mechanism # skipped ahead based on the first argument, but that # does not produce properly symmetric results... assert_equal(c_scalar.dtype, c_array.dtype, "error with types (%d/'%c' + %d/'%c')" % (k, np.dtype(atype).char, l, np.dtype(btype).char)) def test_type_create(self): for k, atype in enumerate(types): a = np.array([1, 2, 3], atype) b = atype([1, 2, 3]) assert_equal(a, b) def test_leak(self): # test leak of scalar objects # a leak would show up in valgrind as still-reachable of ~2.6MB for i in range(200000): np.add(1, 1) class TestBaseMath(object): def test_blocked(self): # test alignments offsets for simd instructions # alignments for vz + 2 * (vs - 1) + 1 for dt, sz in [(np.float32, 11), (np.float64, 7), (np.int32, 11)]: for out, inp1, inp2, msg in _gen_alignment_data(dtype=dt, type='binary', max_size=sz): exp1 = np.ones_like(inp1) inp1[...] = np.ones_like(inp1) inp2[...] = np.zeros_like(inp2) assert_almost_equal(np.add(inp1, inp2), exp1, err_msg=msg) assert_almost_equal(np.add(inp1, 2), exp1 + 2, err_msg=msg) assert_almost_equal(np.add(1, inp2), exp1, err_msg=msg) np.add(inp1, inp2, out=out) assert_almost_equal(out, exp1, err_msg=msg) inp2[...] += np.arange(inp2.size, dtype=dt) + 1 assert_almost_equal(np.square(inp2), np.multiply(inp2, inp2), err_msg=msg) # skip true divide for ints if dt != np.int32 or (sys.version_info.major < 3 and not sys.py3kwarning): assert_almost_equal(np.reciprocal(inp2), np.divide(1, inp2), err_msg=msg) inp1[...] = np.ones_like(inp1) np.add(inp1, 2, out=out) assert_almost_equal(out, exp1 + 2, err_msg=msg) inp2[...] = np.ones_like(inp2) np.add(2, inp2, out=out) assert_almost_equal(out, exp1 + 2, err_msg=msg) def test_lower_align(self): # check data that is not aligned to element size # i.e doubles are aligned to 4 bytes on i386 d = np.zeros(23 * 8, dtype=np.int8)[4:-4].view(np.float64) o = np.zeros(23 * 8, dtype=np.int8)[4:-4].view(np.float64) assert_almost_equal(d + d, d * 2) np.add(d, d, out=o) np.add(np.ones_like(d), d, out=o) np.add(d, np.ones_like(d), out=o) np.add(np.ones_like(d), d) np.add(d, np.ones_like(d)) class TestPower(object): def test_small_types(self): for t in [np.int8, np.int16, np.float16]: a = t(3) b = a ** 4 assert_(b == 81, "error with %r: got %r" % (t, b)) def test_large_types(self): for t in [np.int32, np.int64, np.float32, np.float64, np.longdouble]: a = t(51) b = a ** 4 msg = "error with %r: got %r" % (t, b) if np.issubdtype(t, np.integer): assert_(b == 6765201, msg) else: assert_almost_equal(b, 6765201, err_msg=msg) def test_integers_to_negative_integer_power(self): # Note that the combination of uint64 with a signed integer # has common type np.float64. The other combinations should all # raise a ValueError for integer ** negative integer. exp = [np.array(-1, dt)[()] for dt in 'bhilq'] # 1 ** -1 possible special case base = [np.array(1, dt)[()] for dt in 'bhilqBHILQ'] for i1, i2 in itertools.product(base, exp): if i1.dtype.name != 'uint64': assert_raises(ValueError, operator.pow, i1, i2) else: res = operator.pow(i1, i2) assert_(res.dtype.type is np.float64) assert_almost_equal(res, 1.) # -1 ** -1 possible special case base = [np.array(-1, dt)[()] for dt in 'bhilq'] for i1, i2 in itertools.product(base, exp): if i1.dtype.name != 'uint64': assert_raises(ValueError, operator.pow, i1, i2) else: res = operator.pow(i1, i2) assert_(res.dtype.type is np.float64) assert_almost_equal(res, -1.) # 2 ** -1 perhaps generic base = [np.array(2, dt)[()] for dt in 'bhilqBHILQ'] for i1, i2 in itertools.product(base, exp): if i1.dtype.name != 'uint64': assert_raises(ValueError, operator.pow, i1, i2) else: res = operator.pow(i1, i2) assert_(res.dtype.type is np.float64) assert_almost_equal(res, .5) def test_mixed_types(self): typelist = [np.int8, np.int16, np.float16, np.float32, np.float64, np.int8, np.int16, np.int32, np.int64] for t1 in typelist: for t2 in typelist: a = t1(3) b = t2(2) result = a**b msg = ("error with %r and %r:" "got %r, expected %r") % (t1, t2, result, 9) if np.issubdtype(np.dtype(result), np.integer): assert_(result == 9, msg) else: assert_almost_equal(result, 9, err_msg=msg) def test_modular_power(self): # modular power is not implemented, so ensure it errors a = 5 b = 4 c = 10 expected = pow(a, b, c) for t in (np.int32, np.float32, np.complex64): # note that 3-operand power only dispatches on the first argument assert_raises(TypeError, operator.pow, t(a), b, c) assert_raises(TypeError, operator.pow, np.array(t(a)), b, c) def floordiv_and_mod(x, y): return (x // y, x % y) def _signs(dt): if dt in np.typecodes['UnsignedInteger']: return (+1,) else: return (+1, -1) class TestModulus(object): def test_modulus_basic(self): dt = np.typecodes['AllInteger'] + np.typecodes['Float'] for op in [floordiv_and_mod, divmod]: for dt1, dt2 in itertools.product(dt, dt): for sg1, sg2 in itertools.product(_signs(dt1), _signs(dt2)): fmt = 'op: %s, dt1: %s, dt2: %s, sg1: %s, sg2: %s' msg = fmt % (op.__name__, dt1, dt2, sg1, sg2) a = np.array(sg1*71, dtype=dt1)[()] b = np.array(sg2*19, dtype=dt2)[()] div, rem = op(a, b) assert_equal(div*b + rem, a, err_msg=msg) if sg2 == -1: assert_(b < rem <= 0, msg) else: assert_(b > rem >= 0, msg) def test_float_modulus_exact(self): # test that float results are exact for small integers. This also # holds for the same integers scaled by powers of two. nlst = list(range(-127, 0)) plst = list(range(1, 128)) dividend = nlst + [0] + plst divisor = nlst + plst arg = list(itertools.product(dividend, divisor)) tgt = list(divmod(*t) for t in arg) a, b = np.array(arg, dtype=int).T # convert exact integer results from Python to float so that # signed zero can be used, it is checked. tgtdiv, tgtrem = np.array(tgt, dtype=float).T tgtdiv = np.where((tgtdiv == 0.0) & ((b < 0) ^ (a < 0)), -0.0, tgtdiv) tgtrem = np.where((tgtrem == 0.0) & (b < 0), -0.0, tgtrem) for op in [floordiv_and_mod, divmod]: for dt in np.typecodes['Float']: msg = 'op: %s, dtype: %s' % (op.__name__, dt) fa = a.astype(dt) fb = b.astype(dt) # use list comprehension so a_ and b_ are scalars div, rem = zip(*[op(a_, b_) for a_, b_ in zip(fa, fb)]) assert_equal(div, tgtdiv, err_msg=msg) assert_equal(rem, tgtrem, err_msg=msg) def test_float_modulus_roundoff(self): # gh-6127 dt = np.typecodes['Float'] for op in [floordiv_and_mod, divmod]: for dt1, dt2 in itertools.product(dt, dt): for sg1, sg2 in itertools.product((+1, -1), (+1, -1)): fmt = 'op: %s, dt1: %s, dt2: %s, sg1: %s, sg2: %s' msg = fmt % (op.__name__, dt1, dt2, sg1, sg2) a = np.array(sg1*78*6e-8, dtype=dt1)[()] b = np.array(sg2*6e-8, dtype=dt2)[()] div, rem = op(a, b) # Equal assertion should hold when fmod is used assert_equal(div*b + rem, a, err_msg=msg) if sg2 == -1: assert_(b < rem <= 0, msg) else: assert_(b > rem >= 0, msg) def test_float_modulus_corner_cases(self): # Check remainder magnitude. for dt in np.typecodes['Float']: b = np.array(1.0, dtype=dt) a = np.nextafter(np.array(0.0, dtype=dt), -b) rem = operator.mod(a, b) assert_(rem <= b, 'dt: %s' % dt) rem = operator.mod(-a, -b) assert_(rem >= -b, 'dt: %s' % dt) # Check nans, inf with suppress_warnings() as sup: sup.filter(RuntimeWarning, "invalid value encountered in remainder") for dt in np.typecodes['Float']: fone = np.array(1.0, dtype=dt) fzer = np.array(0.0, dtype=dt) finf = np.array(np.inf, dtype=dt) fnan = np.array(np.nan, dtype=dt) rem = operator.mod(fone, fzer) assert_(np.isnan(rem), 'dt: %s' % dt) # MSVC 2008 returns NaN here, so disable the check. #rem = operator.mod(fone, finf) #assert_(rem == fone, 'dt: %s' % dt) rem = operator.mod(fone, fnan) assert_(np.isnan(rem), 'dt: %s' % dt) rem = operator.mod(finf, fone) assert_(np.isnan(rem), 'dt: %s' % dt) class TestComplexDivision(object): def test_zero_division(self): with np.errstate(all="ignore"): for t in [np.complex64, np.complex128]: a = t(0.0) b = t(1.0) assert_(np.isinf(b/a)) b = t(complex(np.inf, np.inf)) assert_(np.isinf(b/a)) b = t(complex(np.inf, np.nan)) assert_(np.isinf(b/a)) b = t(complex(np.nan, np.inf)) assert_(np.isinf(b/a)) b = t(complex(np.nan, np.nan)) assert_(np.isnan(b/a)) b = t(0.) assert_(np.isnan(b/a)) def test_signed_zeros(self): with np.errstate(all="ignore"): for t in [np.complex64, np.complex128]: # tupled (numerator, denominator, expected) # for testing as expected == numerator/denominator data = ( (( 0.0,-1.0), ( 0.0, 1.0), (-1.0,-0.0)), (( 0.0,-1.0), ( 0.0,-1.0), ( 1.0,-0.0)), (( 0.0,-1.0), (-0.0,-1.0), ( 1.0, 0.0)), (( 0.0,-1.0), (-0.0, 1.0), (-1.0, 0.0)), (( 0.0, 1.0), ( 0.0,-1.0), (-1.0, 0.0)), (( 0.0,-1.0), ( 0.0,-1.0), ( 1.0,-0.0)), ((-0.0,-1.0), ( 0.0,-1.0), ( 1.0,-0.0)), ((-0.0, 1.0), ( 0.0,-1.0), (-1.0,-0.0)) ) for cases in data: n = cases[0] d = cases[1] ex = cases[2] result = t(complex(n[0], n[1])) / t(complex(d[0], d[1])) # check real and imag parts separately to avoid comparison # in array context, which does not account for signed zeros assert_equal(result.real, ex[0]) assert_equal(result.imag, ex[1]) def test_branches(self): with np.errstate(all="ignore"): for t in [np.complex64, np.complex128]: # tupled (numerator, denominator, expected) # for testing as expected == numerator/denominator data = list() # trigger branch: real(fabs(denom)) > imag(fabs(denom)) # followed by else condition as neither are == 0 data.append((( 2.0, 1.0), ( 2.0, 1.0), (1.0, 0.0))) # trigger branch: real(fabs(denom)) > imag(fabs(denom)) # followed by if condition as both are == 0 # is performed in test_zero_division(), so this is skipped # trigger else if branch: real(fabs(denom)) < imag(fabs(denom)) data.append((( 1.0, 2.0), ( 1.0, 2.0), (1.0, 0.0))) for cases in data: n = cases[0] d = cases[1] ex = cases[2] result = t(complex(n[0], n[1])) / t(complex(d[0], d[1])) # check real and imag parts separately to avoid comparison # in array context, which does not account for signed zeros assert_equal(result.real, ex[0]) assert_equal(result.imag, ex[1]) class TestConversion(object): def test_int_from_long(self): l = [1e6, 1e12, 1e18, -1e6, -1e12, -1e18] li = [10**6, 10**12, 10**18, -10**6, -10**12, -10**18] for T in [None, np.float64, np.int64]: a = np.array(l, dtype=T) assert_equal([int(_m) for _m in a], li) a = np.array(l[:3], dtype=np.uint64) assert_equal([int(_m) for _m in a], li[:3]) def test_iinfo_long_values(self): for code in 'bBhH': res = np.array(np.iinfo(code).max + 1, dtype=code) tgt = np.iinfo(code).min assert_(res == tgt) for code in np.typecodes['AllInteger']: res = np.array(np.iinfo(code).max, dtype=code) tgt = np.iinfo(code).max assert_(res == tgt) for code in np.typecodes['AllInteger']: res = np.typeDict[code](np.iinfo(code).max) tgt = np.iinfo(code).max assert_(res == tgt) def test_int_raise_behaviour(self): def overflow_error_func(dtype): np.typeDict[dtype](np.iinfo(dtype).max + 1) for code in 'lLqQ': assert_raises(OverflowError, overflow_error_func, code) def test_int_from_infinite_longdouble(self): # gh-627 x = np.longdouble(np.inf) assert_raises(OverflowError, int, x) with suppress_warnings() as sup: sup.record(np.ComplexWarning) x = np.clongdouble(np.inf) assert_raises(OverflowError, int, x) assert_equal(len(sup.log), 1) @dec.knownfailureif(not IS_PYPY, "__int__ is not the same as int in cpython (gh-9972)") def test_int_from_infinite_longdouble___int__(self): x = np.longdouble(np.inf) assert_raises(OverflowError, x.__int__) with suppress_warnings() as sup: sup.record(np.ComplexWarning) x = np.clongdouble(np.inf) assert_raises(OverflowError, x.__int__) assert_equal(len(sup.log), 1) @dec.knownfailureif(platform.machine().startswith("ppc64")) @dec.skipif(np.finfo(np.double) == np.finfo(np.longdouble)) def test_int_from_huge_longdouble(self): # Produce a longdouble that would overflow a double, # use exponent that avoids bug in Darwin pow function. exp = np.finfo(np.double).maxexp - 1 huge_ld = 2 * 1234 * np.longdouble(2) ** exp huge_i = 2 * 1234 * 2 ** exp assert_(huge_ld != np.inf) assert_equal(int(huge_ld), huge_i) def test_int_from_longdouble(self): x = np.longdouble(1.5) assert_equal(int(x), 1) x = np.longdouble(-10.5) assert_equal(int(x), -10) def test_numpy_scalar_relational_operators(self): # All integer for dt1 in np.typecodes['AllInteger']: assert_(1 > np.array(0, dtype=dt1)[()], "type %s failed" % (dt1,)) assert_(not 1 < np.array(0, dtype=dt1)[()], "type %s failed" % (dt1,)) for dt2 in np.typecodes['AllInteger']: assert_(np.array(1, dtype=dt1)[()] > np.array(0, dtype=dt2)[()], "type %s and %s failed" % (dt1, dt2)) assert_(not np.array(1, dtype=dt1)[()] < np.array(0, dtype=dt2)[()], "type %s and %s failed" % (dt1, dt2)) #Unsigned integers for dt1 in 'BHILQP': assert_(-1 < np.array(1, dtype=dt1)[()], "type %s failed" % (dt1,)) assert_(not -1 > np.array(1, dtype=dt1)[()], "type %s failed" % (dt1,)) assert_(-1 != np.array(1, dtype=dt1)[()], "type %s failed" % (dt1,)) #unsigned vs signed for dt2 in 'bhilqp': assert_(np.array(1, dtype=dt1)[()] > np.array(-1, dtype=dt2)[()], "type %s and %s failed" % (dt1, dt2)) assert_(not np.array(1, dtype=dt1)[()] < np.array(-1, dtype=dt2)[()], "type %s and %s failed" % (dt1, dt2)) assert_(np.array(1, dtype=dt1)[()] != np.array(-1, dtype=dt2)[()], "type %s and %s failed" % (dt1, dt2)) #Signed integers and floats for dt1 in 'bhlqp' + np.typecodes['Float']: assert_(1 > np.array(-1, dtype=dt1)[()], "type %s failed" % (dt1,)) assert_(not 1 < np.array(-1, dtype=dt1)[()], "type %s failed" % (dt1,)) assert_(-1 == np.array(-1, dtype=dt1)[()], "type %s failed" % (dt1,)) for dt2 in 'bhlqp' + np.typecodes['Float']: assert_(np.array(1, dtype=dt1)[()] > np.array(-1, dtype=dt2)[()], "type %s and %s failed" % (dt1, dt2)) assert_(not np.array(1, dtype=dt1)[()] < np.array(-1, dtype=dt2)[()], "type %s and %s failed" % (dt1, dt2)) assert_(np.array(-1, dtype=dt1)[()] == np.array(-1, dtype=dt2)[()], "type %s and %s failed" % (dt1, dt2)) def test_scalar_comparison_to_none(self): # Scalars should just return False and not give a warnings. # The comparisons are flagged by pep8, ignore that. with warnings.catch_warnings(record=True) as w: warnings.filterwarnings('always', '', FutureWarning) assert_(not np.float32(1) == None) assert_(not np.str_('test') == None) # This is dubious (see below): assert_(not np.datetime64('NaT') == None) assert_(np.float32(1) != None) assert_(np.str_('test') != None) # This is dubious (see below): assert_(np.datetime64('NaT') != None) assert_(len(w) == 0) # For documentation purposes, this is why the datetime is dubious. # At the time of deprecation this was no behaviour change, but # it has to be considered when the deprecations are done. assert_(np.equal(np.datetime64('NaT'), None)) #class TestRepr(object): # def test_repr(self): # for t in types: # val = t(1197346475.0137341) # val_repr = repr(val) # val2 = eval(val_repr) # assert_equal( val, val2 ) class TestRepr(object): def _test_type_repr(self, t): finfo = np.finfo(t) last_fraction_bit_idx = finfo.nexp + finfo.nmant last_exponent_bit_idx = finfo.nexp storage_bytes = np.dtype(t).itemsize*8 # could add some more types to the list below for which in ['small denorm', 'small norm']: # Values from http://en.wikipedia.org/wiki/IEEE_754 constr = np.array([0x00]*storage_bytes, dtype=np.uint8) if which == 'small denorm': byte = last_fraction_bit_idx // 8 bytebit = 7-(last_fraction_bit_idx % 8) constr[byte] = 1 << bytebit elif which == 'small norm': byte = last_exponent_bit_idx // 8 bytebit = 7-(last_exponent_bit_idx % 8) constr[byte] = 1 << bytebit else: raise ValueError('hmm') val = constr.view(t)[0] val_repr = repr(val) val2 = t(eval(val_repr)) if not (val2 == 0 and val < 1e-100): assert_equal(val, val2) def test_float_repr(self): # long double test cannot work, because eval goes through a python # float for t in [np.float32, np.float64]: yield self._test_type_repr, t if not IS_PYPY: # sys.getsizeof() is not valid on PyPy class TestSizeOf(object): def test_equal_nbytes(self): for type in types: x = type(0) assert_(sys.getsizeof(x) > x.nbytes) def test_error(self): d = np.float32() assert_raises(TypeError, d.__sizeof__, "a") class TestMultiply(object): def test_seq_repeat(self): # Test that basic sequences get repeated when multiplied with # numpy integers. And errors are raised when multiplied with others. # Some of this behaviour may be controversial and could be open for # change. for seq_type in (list, tuple): seq = seq_type([1, 2, 3]) for numpy_type in np.typecodes["AllInteger"]: i = np.dtype(numpy_type).type(2) assert_equal(seq * i, seq * int(i)) assert_equal(i * seq, int(i) * seq) for numpy_type in np.typecodes["All"].replace("V", ""): if numpy_type in np.typecodes["AllInteger"]: continue i = np.dtype(numpy_type).type() assert_raises(TypeError, operator.mul, seq, i) assert_raises(TypeError, operator.mul, i, seq) def test_no_seq_repeat_basic_array_like(self): # Test that an array-like which does not know how to be multiplied # does not attempt sequence repeat (raise TypeError). # See also gh-7428. class ArrayLike(object): def __init__(self, arr): self.arr = arr def __array__(self): return self.arr # Test for simple ArrayLike above and memoryviews (original report) for arr_like in (ArrayLike(np.ones(3)), memoryview(np.ones(3))): assert_array_equal(arr_like * np.float32(3.), np.full(3, 3.)) assert_array_equal(np.float32(3.) * arr_like, np.full(3, 3.)) assert_array_equal(arr_like * np.int_(3), np.full(3, 3)) assert_array_equal(np.int_(3) * arr_like, np.full(3, 3)) class TestNegative(object): def test_exceptions(self): a = np.ones((), dtype=np.bool_)[()] assert_raises(TypeError, operator.neg, a) def test_result(self): types = np.typecodes['AllInteger'] + np.typecodes['AllFloat'] with suppress_warnings() as sup: sup.filter(RuntimeWarning) for dt in types: a = np.ones((), dtype=dt)[()] assert_equal(operator.neg(a) + a, 0) class TestSubtract(object): def test_exceptions(self): a = np.ones((), dtype=np.bool_)[()] assert_raises(TypeError, operator.sub, a, a) def test_result(self): types = np.typecodes['AllInteger'] + np.typecodes['AllFloat'] with suppress_warnings() as sup: sup.filter(RuntimeWarning) for dt in types: a = np.ones((), dtype=dt)[()] assert_equal(operator.sub(a, a), 0) class TestAbs(object): def _test_abs_func(self, absfunc): for tp in floating_types + complex_floating_types: x = tp(-1.5) assert_equal(absfunc(x), 1.5) x = tp(0.0) res = absfunc(x) # assert_equal() checks zero signedness assert_equal(res, 0.0) x = tp(-0.0) res = absfunc(x) assert_equal(res, 0.0) x = tp(np.finfo(tp).max) assert_equal(absfunc(x), x.real) x = tp(np.finfo(tp).tiny) assert_equal(absfunc(x), x.real) x = tp(np.finfo(tp).min) assert_equal(absfunc(x), -x.real) def test_builtin_abs(self): self._test_abs_func(abs) def test_numpy_abs(self): self._test_abs_func(np.abs) if __name__ == "__main__": run_module_suite()
26,706
39.649924
90
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_scalar_ctors.py
""" Test the scalar contructors, which also do type-coercion """ from __future__ import division, absolute_import, print_function import sys import platform import numpy as np from numpy.testing import ( run_module_suite, assert_equal, assert_almost_equal, assert_raises, assert_warns, dec ) class TestFromString(object): def test_floating(self): # Ticket #640, floats from string fsingle = np.single('1.234') fdouble = np.double('1.234') flongdouble = np.longdouble('1.234') assert_almost_equal(fsingle, 1.234) assert_almost_equal(fdouble, 1.234) assert_almost_equal(flongdouble, 1.234) def test_floating_overflow(self): """ Strings containing an unrepresentable float overflow """ fhalf = np.half('1e10000') assert_equal(fhalf, np.inf) fsingle = np.single('1e10000') assert_equal(fsingle, np.inf) fdouble = np.double('1e10000') assert_equal(fdouble, np.inf) flongdouble = assert_warns(RuntimeWarning, np.longdouble, '1e10000') assert_equal(flongdouble, np.inf) fhalf = np.half('-1e10000') assert_equal(fhalf, -np.inf) fsingle = np.single('-1e10000') assert_equal(fsingle, -np.inf) fdouble = np.double('-1e10000') assert_equal(fdouble, -np.inf) flongdouble = assert_warns(RuntimeWarning, np.longdouble, '-1e10000') assert_equal(flongdouble, -np.inf) @dec.knownfailureif((sys.version_info[0] >= 3) or (sys.platform == "win32" and platform.architecture()[0] == "64bit"), "numpy.intp('0xff', 16) not supported on Py3, " "as it does not inherit from Python int") def test_intp(self): # Ticket #99 i_width = np.int_(0).nbytes*2 - 1 np.intp('0x' + 'f'*i_width, 16) assert_raises(OverflowError, np.intp, '0x' + 'f'*(i_width+1), 16) assert_raises(ValueError, np.intp, '0x1', 32) assert_equal(255, np.intp('0xFF', 16)) class TestFromInt(object): def test_intp(self): # Ticket #99 assert_equal(1024, np.intp(1024)) def test_uint64_from_negative(self): assert_equal(np.uint64(-2), np.uint64(18446744073709551614)) if __name__ == "__main__": run_module_suite()
2,362
32.28169
77
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_scalarinherit.py
# -*- coding: utf-8 -*- """ Test printing of scalar types. """ from __future__ import division, absolute_import, print_function import numpy as np from numpy.testing import run_module_suite, assert_ class A(object): pass class B(A, np.float64): pass class C(B): pass class D(C, B): pass class B0(np.float64, A): pass class C0(B0): pass class TestInherit(object): def test_init(self): x = B(1.0) assert_(str(x) == '1.0') y = C(2.0) assert_(str(y) == '2.0') z = D(3.0) assert_(str(z) == '3.0') def test_init2(self): x = B0(1.0) assert_(str(x) == '1.0') y = C0(2.0) assert_(str(y) == '2.0') class TestCharacter(object): def test_char_radd(self): # GH issue 9620, reached gentype_add and raise TypeError np_s = np.string_('abc') np_u = np.unicode_('abc') s = b'def' u = u'def' assert_(np_s.__radd__(np_s) is NotImplemented) assert_(np_s.__radd__(np_u) is NotImplemented) assert_(np_s.__radd__(s) is NotImplemented) assert_(np_s.__radd__(u) is NotImplemented) assert_(np_u.__radd__(np_s) is NotImplemented) assert_(np_u.__radd__(np_u) is NotImplemented) assert_(np_u.__radd__(s) is NotImplemented) assert_(np_u.__radd__(u) is NotImplemented) assert_(s + np_s == b'defabc') assert_(u + np_u == u'defabc') class Mystr(str, np.generic): # would segfault pass ret = s + Mystr('abc') assert_(type(ret) is type(s)) def test_char_repeat(self): np_s = np.string_('abc') np_u = np.unicode_('abc') np_i = np.int(5) res_np = np_s * np_i res_s = b'abc' * 5 assert_(res_np == res_s) if __name__ == "__main__": run_module_suite()
1,867
22.64557
64
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_getlimits.py
""" Test functions for limits module. """ from __future__ import division, absolute_import, print_function import numpy as np from numpy.core import finfo, iinfo from numpy import half, single, double, longdouble from numpy.testing import ( run_module_suite, assert_equal, assert_, assert_raises ) from numpy.core.getlimits import (_discovered_machar, _float16_ma, _float32_ma, _float64_ma, _float128_ma, _float80_ma) ################################################## class TestPythonFloat(object): def test_singleton(self): ftype = finfo(float) ftype2 = finfo(float) assert_equal(id(ftype), id(ftype2)) class TestHalf(object): def test_singleton(self): ftype = finfo(half) ftype2 = finfo(half) assert_equal(id(ftype), id(ftype2)) class TestSingle(object): def test_singleton(self): ftype = finfo(single) ftype2 = finfo(single) assert_equal(id(ftype), id(ftype2)) class TestDouble(object): def test_singleton(self): ftype = finfo(double) ftype2 = finfo(double) assert_equal(id(ftype), id(ftype2)) class TestLongdouble(object): def test_singleton(self): ftype = finfo(longdouble) ftype2 = finfo(longdouble) assert_equal(id(ftype), id(ftype2)) class TestFinfo(object): def test_basic(self): dts = list(zip(['f2', 'f4', 'f8', 'c8', 'c16'], [np.float16, np.float32, np.float64, np.complex64, np.complex128])) for dt1, dt2 in dts: for attr in ('bits', 'eps', 'epsneg', 'iexp', 'machar', 'machep', 'max', 'maxexp', 'min', 'minexp', 'negep', 'nexp', 'nmant', 'precision', 'resolution', 'tiny'): assert_equal(getattr(finfo(dt1), attr), getattr(finfo(dt2), attr), attr) assert_raises(ValueError, finfo, 'i4') class TestIinfo(object): def test_basic(self): dts = list(zip(['i1', 'i2', 'i4', 'i8', 'u1', 'u2', 'u4', 'u8'], [np.int8, np.int16, np.int32, np.int64, np.uint8, np.uint16, np.uint32, np.uint64])) for dt1, dt2 in dts: for attr in ('bits', 'min', 'max'): assert_equal(getattr(iinfo(dt1), attr), getattr(iinfo(dt2), attr), attr) assert_raises(ValueError, iinfo, 'f4') def test_unsigned_max(self): types = np.sctypes['uint'] for T in types: assert_equal(iinfo(T).max, T(-1)) class TestRepr(object): def test_iinfo_repr(self): expected = "iinfo(min=-32768, max=32767, dtype=int16)" assert_equal(repr(np.iinfo(np.int16)), expected) def test_finfo_repr(self): expected = "finfo(resolution=1e-06, min=-3.4028235e+38," + \ " max=3.4028235e+38, dtype=float32)" assert_equal(repr(np.finfo(np.float32)), expected) def test_instances(): iinfo(10) finfo(3.0) def assert_ma_equal(discovered, ma_like): # Check MachAr-like objects same as calculated MachAr instances for key, value in discovered.__dict__.items(): assert_equal(value, getattr(ma_like, key)) if hasattr(value, 'shape'): assert_equal(value.shape, getattr(ma_like, key).shape) assert_equal(value.dtype, getattr(ma_like, key).dtype) def test_known_types(): # Test we are correctly compiling parameters for known types for ftype, ma_like in ((np.float16, _float16_ma), (np.float32, _float32_ma), (np.float64, _float64_ma)): assert_ma_equal(_discovered_machar(ftype), ma_like) # Suppress warning for broken discovery of double double on PPC with np.errstate(all='ignore'): ld_ma = _discovered_machar(np.longdouble) bytes = np.dtype(np.longdouble).itemsize if (ld_ma.it, ld_ma.maxexp) == (63, 16384) and bytes in (12, 16): # 80-bit extended precision assert_ma_equal(ld_ma, _float80_ma) elif (ld_ma.it, ld_ma.maxexp) == (112, 16384) and bytes == 16: # IEE 754 128-bit assert_ma_equal(ld_ma, _float128_ma) def test_plausible_finfo(): # Assert that finfo returns reasonable results for all types for ftype in np.sctypes['float'] + np.sctypes['complex']: info = np.finfo(ftype) assert_(info.nmant > 1) assert_(info.minexp < -1) assert_(info.maxexp > 1) if __name__ == "__main__": run_module_suite()
4,586
34.015267
79
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_unicode.py
from __future__ import division, absolute_import, print_function import sys import numpy as np from numpy.compat import unicode from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_array_equal) # Guess the UCS length for this python interpreter if sys.version_info[:2] >= (3, 3): # Python 3.3 uses a flexible string representation ucs4 = False def buffer_length(arr): if isinstance(arr, unicode): arr = str(arr) if not arr: charmax = 0 else: charmax = max([ord(c) for c in arr]) if charmax < 256: size = 1 elif charmax < 65536: size = 2 else: size = 4 return size * len(arr) v = memoryview(arr) if v.shape is None: return len(v) * v.itemsize else: return np.prod(v.shape) * v.itemsize else: if len(buffer(u'u')) == 4: ucs4 = True else: ucs4 = False def buffer_length(arr): if isinstance(arr, np.ndarray): return len(arr.data) return len(buffer(arr)) # In both cases below we need to make sure that the byte swapped value (as # UCS4) is still a valid unicode: # Value that can be represented in UCS2 interpreters ucs2_value = u'\u0900' # Value that cannot be represented in UCS2 interpreters (but can in UCS4) ucs4_value = u'\U00100900' def test_string_cast(): str_arr = np.array(["1234", "1234\0\0"], dtype='S') uni_arr1 = str_arr.astype('>U') uni_arr2 = str_arr.astype('<U') if sys.version_info[0] < 3: assert_array_equal(str_arr, uni_arr1) assert_array_equal(str_arr, uni_arr2) else: assert_(str_arr != uni_arr1) assert_(str_arr != uni_arr2) assert_array_equal(uni_arr1, uni_arr2) ############################################################ # Creation tests ############################################################ class CreateZeros(object): """Check the creation of zero-valued arrays""" def content_check(self, ua, ua_scalar, nbytes): # Check the length of the unicode base type assert_(int(ua.dtype.str[2:]) == self.ulen) # Check the length of the data buffer assert_(buffer_length(ua) == nbytes) # Small check that data in array element is ok assert_(ua_scalar == u'') # Encode to ascii and double check assert_(ua_scalar.encode('ascii') == b'') # Check buffer lengths for scalars if ucs4: assert_(buffer_length(ua_scalar) == 0) else: assert_(buffer_length(ua_scalar) == 0) def test_zeros0D(self): # Check creation of 0-dimensional objects ua = np.zeros((), dtype='U%s' % self.ulen) self.content_check(ua, ua[()], 4*self.ulen) def test_zerosSD(self): # Check creation of single-dimensional objects ua = np.zeros((2,), dtype='U%s' % self.ulen) self.content_check(ua, ua[0], 4*self.ulen*2) self.content_check(ua, ua[1], 4*self.ulen*2) def test_zerosMD(self): # Check creation of multi-dimensional objects ua = np.zeros((2, 3, 4), dtype='U%s' % self.ulen) self.content_check(ua, ua[0, 0, 0], 4*self.ulen*2*3*4) self.content_check(ua, ua[-1, -1, -1], 4*self.ulen*2*3*4) class TestCreateZeros_1(CreateZeros): """Check the creation of zero-valued arrays (size 1)""" ulen = 1 class TestCreateZeros_2(CreateZeros): """Check the creation of zero-valued arrays (size 2)""" ulen = 2 class TestCreateZeros_1009(CreateZeros): """Check the creation of zero-valued arrays (size 1009)""" ulen = 1009 class CreateValues(object): """Check the creation of unicode arrays with values""" def content_check(self, ua, ua_scalar, nbytes): # Check the length of the unicode base type assert_(int(ua.dtype.str[2:]) == self.ulen) # Check the length of the data buffer assert_(buffer_length(ua) == nbytes) # Small check that data in array element is ok assert_(ua_scalar == self.ucs_value*self.ulen) # Encode to UTF-8 and double check assert_(ua_scalar.encode('utf-8') == (self.ucs_value*self.ulen).encode('utf-8')) # Check buffer lengths for scalars if ucs4: assert_(buffer_length(ua_scalar) == 4*self.ulen) else: if self.ucs_value == ucs4_value: # In UCS2, the \U0010FFFF will be represented using a # surrogate *pair* assert_(buffer_length(ua_scalar) == 2*2*self.ulen) else: # In UCS2, the \uFFFF will be represented using a # regular 2-byte word assert_(buffer_length(ua_scalar) == 2*self.ulen) def test_values0D(self): # Check creation of 0-dimensional objects with values ua = np.array(self.ucs_value*self.ulen, dtype='U%s' % self.ulen) self.content_check(ua, ua[()], 4*self.ulen) def test_valuesSD(self): # Check creation of single-dimensional objects with values ua = np.array([self.ucs_value*self.ulen]*2, dtype='U%s' % self.ulen) self.content_check(ua, ua[0], 4*self.ulen*2) self.content_check(ua, ua[1], 4*self.ulen*2) def test_valuesMD(self): # Check creation of multi-dimensional objects with values ua = np.array([[[self.ucs_value*self.ulen]*2]*3]*4, dtype='U%s' % self.ulen) self.content_check(ua, ua[0, 0, 0], 4*self.ulen*2*3*4) self.content_check(ua, ua[-1, -1, -1], 4*self.ulen*2*3*4) class TestCreateValues_1_UCS2(CreateValues): """Check the creation of valued arrays (size 1, UCS2 values)""" ulen = 1 ucs_value = ucs2_value class TestCreateValues_1_UCS4(CreateValues): """Check the creation of valued arrays (size 1, UCS4 values)""" ulen = 1 ucs_value = ucs4_value class TestCreateValues_2_UCS2(CreateValues): """Check the creation of valued arrays (size 2, UCS2 values)""" ulen = 2 ucs_value = ucs2_value class TestCreateValues_2_UCS4(CreateValues): """Check the creation of valued arrays (size 2, UCS4 values)""" ulen = 2 ucs_value = ucs4_value class TestCreateValues_1009_UCS2(CreateValues): """Check the creation of valued arrays (size 1009, UCS2 values)""" ulen = 1009 ucs_value = ucs2_value class TestCreateValues_1009_UCS4(CreateValues): """Check the creation of valued arrays (size 1009, UCS4 values)""" ulen = 1009 ucs_value = ucs4_value ############################################################ # Assignment tests ############################################################ class AssignValues(object): """Check the assignment of unicode arrays with values""" def content_check(self, ua, ua_scalar, nbytes): # Check the length of the unicode base type assert_(int(ua.dtype.str[2:]) == self.ulen) # Check the length of the data buffer assert_(buffer_length(ua) == nbytes) # Small check that data in array element is ok assert_(ua_scalar == self.ucs_value*self.ulen) # Encode to UTF-8 and double check assert_(ua_scalar.encode('utf-8') == (self.ucs_value*self.ulen).encode('utf-8')) # Check buffer lengths for scalars if ucs4: assert_(buffer_length(ua_scalar) == 4*self.ulen) else: if self.ucs_value == ucs4_value: # In UCS2, the \U0010FFFF will be represented using a # surrogate *pair* assert_(buffer_length(ua_scalar) == 2*2*self.ulen) else: # In UCS2, the \uFFFF will be represented using a # regular 2-byte word assert_(buffer_length(ua_scalar) == 2*self.ulen) def test_values0D(self): # Check assignment of 0-dimensional objects with values ua = np.zeros((), dtype='U%s' % self.ulen) ua[()] = self.ucs_value*self.ulen self.content_check(ua, ua[()], 4*self.ulen) def test_valuesSD(self): # Check assignment of single-dimensional objects with values ua = np.zeros((2,), dtype='U%s' % self.ulen) ua[0] = self.ucs_value*self.ulen self.content_check(ua, ua[0], 4*self.ulen*2) ua[1] = self.ucs_value*self.ulen self.content_check(ua, ua[1], 4*self.ulen*2) def test_valuesMD(self): # Check assignment of multi-dimensional objects with values ua = np.zeros((2, 3, 4), dtype='U%s' % self.ulen) ua[0, 0, 0] = self.ucs_value*self.ulen self.content_check(ua, ua[0, 0, 0], 4*self.ulen*2*3*4) ua[-1, -1, -1] = self.ucs_value*self.ulen self.content_check(ua, ua[-1, -1, -1], 4*self.ulen*2*3*4) class TestAssignValues_1_UCS2(AssignValues): """Check the assignment of valued arrays (size 1, UCS2 values)""" ulen = 1 ucs_value = ucs2_value class TestAssignValues_1_UCS4(AssignValues): """Check the assignment of valued arrays (size 1, UCS4 values)""" ulen = 1 ucs_value = ucs4_value class TestAssignValues_2_UCS2(AssignValues): """Check the assignment of valued arrays (size 2, UCS2 values)""" ulen = 2 ucs_value = ucs2_value class TestAssignValues_2_UCS4(AssignValues): """Check the assignment of valued arrays (size 2, UCS4 values)""" ulen = 2 ucs_value = ucs4_value class TestAssignValues_1009_UCS2(AssignValues): """Check the assignment of valued arrays (size 1009, UCS2 values)""" ulen = 1009 ucs_value = ucs2_value class TestAssignValues_1009_UCS4(AssignValues): """Check the assignment of valued arrays (size 1009, UCS4 values)""" ulen = 1009 ucs_value = ucs4_value ############################################################ # Byteorder tests ############################################################ class ByteorderValues(object): """Check the byteorder of unicode arrays in round-trip conversions""" def test_values0D(self): # Check byteorder of 0-dimensional objects ua = np.array(self.ucs_value*self.ulen, dtype='U%s' % self.ulen) ua2 = ua.newbyteorder() # This changes the interpretation of the data region (but not the # actual data), therefore the returned scalars are not # the same (they are byte-swapped versions of each other). assert_(ua[()] != ua2[()]) ua3 = ua2.newbyteorder() # Arrays must be equal after the round-trip assert_equal(ua, ua3) def test_valuesSD(self): # Check byteorder of single-dimensional objects ua = np.array([self.ucs_value*self.ulen]*2, dtype='U%s' % self.ulen) ua2 = ua.newbyteorder() assert_((ua != ua2).all()) assert_(ua[-1] != ua2[-1]) ua3 = ua2.newbyteorder() # Arrays must be equal after the round-trip assert_equal(ua, ua3) def test_valuesMD(self): # Check byteorder of multi-dimensional objects ua = np.array([[[self.ucs_value*self.ulen]*2]*3]*4, dtype='U%s' % self.ulen) ua2 = ua.newbyteorder() assert_((ua != ua2).all()) assert_(ua[-1, -1, -1] != ua2[-1, -1, -1]) ua3 = ua2.newbyteorder() # Arrays must be equal after the round-trip assert_equal(ua, ua3) def test_values_cast(self): # Check byteorder of when casting the array for a strided and # contiguous array: test1 = np.array([self.ucs_value*self.ulen]*2, dtype='U%s' % self.ulen) test2 = np.repeat(test1, 2)[::2] for ua in (test1, test2): ua2 = ua.astype(dtype=ua.dtype.newbyteorder()) assert_((ua == ua2).all()) assert_(ua[-1] == ua2[-1]) ua3 = ua2.astype(dtype=ua.dtype) # Arrays must be equal after the round-trip assert_equal(ua, ua3) def test_values_updowncast(self): # Check byteorder of when casting the array to a longer and shorter # string length for strided and contiguous arrays test1 = np.array([self.ucs_value*self.ulen]*2, dtype='U%s' % self.ulen) test2 = np.repeat(test1, 2)[::2] for ua in (test1, test2): # Cast to a longer type with zero padding longer_type = np.dtype('U%s' % (self.ulen+1)).newbyteorder() ua2 = ua.astype(dtype=longer_type) assert_((ua == ua2).all()) assert_(ua[-1] == ua2[-1]) # Cast back again with truncating: ua3 = ua2.astype(dtype=ua.dtype) # Arrays must be equal after the round-trip assert_equal(ua, ua3) class TestByteorder_1_UCS2(ByteorderValues): """Check the byteorder in unicode (size 1, UCS2 values)""" ulen = 1 ucs_value = ucs2_value class TestByteorder_1_UCS4(ByteorderValues): """Check the byteorder in unicode (size 1, UCS4 values)""" ulen = 1 ucs_value = ucs4_value class TestByteorder_2_UCS2(ByteorderValues): """Check the byteorder in unicode (size 2, UCS2 values)""" ulen = 2 ucs_value = ucs2_value class TestByteorder_2_UCS4(ByteorderValues): """Check the byteorder in unicode (size 2, UCS4 values)""" ulen = 2 ucs_value = ucs4_value class TestByteorder_1009_UCS2(ByteorderValues): """Check the byteorder in unicode (size 1009, UCS2 values)""" ulen = 1009 ucs_value = ucs2_value class TestByteorder_1009_UCS4(ByteorderValues): """Check the byteorder in unicode (size 1009, UCS4 values)""" ulen = 1009 ucs_value = ucs4_value if __name__ == "__main__": run_module_suite()
13,733
33.164179
84
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_item_selection.py
from __future__ import division, absolute_import, print_function import sys import numpy as np from numpy.testing import ( run_module_suite, assert_, assert_raises, assert_array_equal, HAS_REFCOUNT ) class TestTake(object): def test_simple(self): a = [[1, 2], [3, 4]] a_str = [[b'1', b'2'], [b'3', b'4']] modes = ['raise', 'wrap', 'clip'] indices = [-1, 4] index_arrays = [np.empty(0, dtype=np.intp), np.empty(tuple(), dtype=np.intp), np.empty((1, 1), dtype=np.intp)] real_indices = {'raise': {-1: 1, 4: IndexError}, 'wrap': {-1: 1, 4: 0}, 'clip': {-1: 0, 4: 1}} # Currently all types but object, use the same function generation. # So it should not be necessary to test all. However test also a non # refcounted struct on top of object. types = int, object, np.dtype([('', 'i', 2)]) for t in types: # ta works, even if the array may be odd if buffer interface is used ta = np.array(a if np.issubdtype(t, np.number) else a_str, dtype=t) tresult = list(ta.T.copy()) for index_array in index_arrays: if index_array.size != 0: tresult[0].shape = (2,) + index_array.shape tresult[1].shape = (2,) + index_array.shape for mode in modes: for index in indices: real_index = real_indices[mode][index] if real_index is IndexError and index_array.size != 0: index_array.put(0, index) assert_raises(IndexError, ta.take, index_array, mode=mode, axis=1) elif index_array.size != 0: index_array.put(0, index) res = ta.take(index_array, mode=mode, axis=1) assert_array_equal(res, tresult[real_index]) else: res = ta.take(index_array, mode=mode, axis=1) assert_(res.shape == (2,) + index_array.shape) def test_refcounting(self): objects = [object() for i in range(10)] for mode in ('raise', 'clip', 'wrap'): a = np.array(objects) b = np.array([2, 2, 4, 5, 3, 5]) a.take(b, out=a[:6], mode=mode) del a if HAS_REFCOUNT: assert_(all(sys.getrefcount(o) == 3 for o in objects)) # not contiguous, example: a = np.array(objects * 2)[::2] a.take(b, out=a[:6], mode=mode) del a if HAS_REFCOUNT: assert_(all(sys.getrefcount(o) == 3 for o in objects)) def test_unicode_mode(self): d = np.arange(10) k = b'\xc3\xa4'.decode("UTF8") assert_raises(ValueError, d.take, 5, mode=k) def test_empty_partition(self): # In reference to github issue #6530 a_original = np.array([0, 2, 4, 6, 8, 10]) a = a_original.copy() # An empty partition should be a successful no-op a.partition(np.array([], dtype=np.int16)) assert_array_equal(a, a_original) def test_empty_argpartition(self): # In reference to github issue #6530 a = np.array([0, 2, 4, 6, 8, 10]) a = a.argpartition(np.array([], dtype=np.int16)) b = np.array([0, 1, 2, 3, 4, 5]) assert_array_equal(a, b) if __name__ == "__main__": run_module_suite()
3,669
38.462366
80
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_indexing.py
from __future__ import division, absolute_import, print_function import sys import warnings import functools import operator import numpy as np from numpy.core.multiarray_tests import array_indexing from itertools import product from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_raises, assert_array_equal, assert_warns, dec, HAS_REFCOUNT, suppress_warnings, ) try: cdll = None if hasattr(sys, 'gettotalrefcount'): try: cdll = np.ctypeslib.load_library('multiarray_d', np.core.multiarray.__file__) except OSError: pass if cdll is None: cdll = np.ctypeslib.load_library('multiarray', np.core.multiarray.__file__) _HAS_CTYPE = True except ImportError: _HAS_CTYPE = False class TestIndexing(object): def test_index_no_floats(self): a = np.array([[[5]]]) assert_raises(IndexError, lambda: a[0.0]) assert_raises(IndexError, lambda: a[0, 0.0]) assert_raises(IndexError, lambda: a[0.0, 0]) assert_raises(IndexError, lambda: a[0.0,:]) assert_raises(IndexError, lambda: a[:, 0.0]) assert_raises(IndexError, lambda: a[:, 0.0,:]) assert_raises(IndexError, lambda: a[0.0,:,:]) assert_raises(IndexError, lambda: a[0, 0, 0.0]) assert_raises(IndexError, lambda: a[0.0, 0, 0]) assert_raises(IndexError, lambda: a[0, 0.0, 0]) assert_raises(IndexError, lambda: a[-1.4]) assert_raises(IndexError, lambda: a[0, -1.4]) assert_raises(IndexError, lambda: a[-1.4, 0]) assert_raises(IndexError, lambda: a[-1.4,:]) assert_raises(IndexError, lambda: a[:, -1.4]) assert_raises(IndexError, lambda: a[:, -1.4,:]) assert_raises(IndexError, lambda: a[-1.4,:,:]) assert_raises(IndexError, lambda: a[0, 0, -1.4]) assert_raises(IndexError, lambda: a[-1.4, 0, 0]) assert_raises(IndexError, lambda: a[0, -1.4, 0]) assert_raises(IndexError, lambda: a[0.0:, 0.0]) assert_raises(IndexError, lambda: a[0.0:, 0.0,:]) def test_slicing_no_floats(self): a = np.array([[5]]) # start as float. assert_raises(TypeError, lambda: a[0.0:]) assert_raises(TypeError, lambda: a[0:, 0.0:2]) assert_raises(TypeError, lambda: a[0.0::2, :0]) assert_raises(TypeError, lambda: a[0.0:1:2,:]) assert_raises(TypeError, lambda: a[:, 0.0:]) # stop as float. assert_raises(TypeError, lambda: a[:0.0]) assert_raises(TypeError, lambda: a[:0, 1:2.0]) assert_raises(TypeError, lambda: a[:0.0:2, :0]) assert_raises(TypeError, lambda: a[:0.0,:]) assert_raises(TypeError, lambda: a[:, 0:4.0:2]) # step as float. assert_raises(TypeError, lambda: a[::1.0]) assert_raises(TypeError, lambda: a[0:, :2:2.0]) assert_raises(TypeError, lambda: a[1::4.0, :0]) assert_raises(TypeError, lambda: a[::5.0,:]) assert_raises(TypeError, lambda: a[:, 0:4:2.0]) # mixed. assert_raises(TypeError, lambda: a[1.0:2:2.0]) assert_raises(TypeError, lambda: a[1.0::2.0]) assert_raises(TypeError, lambda: a[0:, :2.0:2.0]) assert_raises(TypeError, lambda: a[1.0:1:4.0, :0]) assert_raises(TypeError, lambda: a[1.0:5.0:5.0,:]) assert_raises(TypeError, lambda: a[:, 0.4:4.0:2.0]) # should still get the DeprecationWarning if step = 0. assert_raises(TypeError, lambda: a[::0.0]) def test_index_no_array_to_index(self): # No non-scalar arrays. a = np.array([[[1]]]) assert_raises(TypeError, lambda: a[a:a:a]) def test_none_index(self): # `None` index adds newaxis a = np.array([1, 2, 3]) assert_equal(a[None], a[np.newaxis]) assert_equal(a[None].ndim, a.ndim + 1) def test_empty_tuple_index(self): # Empty tuple index creates a view a = np.array([1, 2, 3]) assert_equal(a[()], a) assert_(a[()].base is a) a = np.array(0) assert_(isinstance(a[()], np.int_)) def test_void_scalar_empty_tuple(self): s = np.zeros((), dtype='V4') assert_equal(s[()].dtype, s.dtype) assert_equal(s[()], s) assert_equal(type(s[...]), np.ndarray) def test_same_kind_index_casting(self): # Indexes should be cast with same-kind and not safe, even if that # is somewhat unsafe. So test various different code paths. index = np.arange(5) u_index = index.astype(np.uintp) arr = np.arange(10) assert_array_equal(arr[index], arr[u_index]) arr[u_index] = np.arange(5) assert_array_equal(arr, np.arange(10)) arr = np.arange(10).reshape(5, 2) assert_array_equal(arr[index], arr[u_index]) arr[u_index] = np.arange(5)[:,None] assert_array_equal(arr, np.arange(5)[:,None].repeat(2, axis=1)) arr = np.arange(25).reshape(5, 5) assert_array_equal(arr[u_index, u_index], arr[index, index]) def test_empty_fancy_index(self): # Empty list index creates an empty array # with the same dtype (but with weird shape) a = np.array([1, 2, 3]) assert_equal(a[[]], []) assert_equal(a[[]].dtype, a.dtype) b = np.array([], dtype=np.intp) assert_equal(a[[]], []) assert_equal(a[[]].dtype, a.dtype) b = np.array([]) assert_raises(IndexError, a.__getitem__, b) def test_ellipsis_index(self): a = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]]) assert_(a[...] is not a) assert_equal(a[...], a) # `a[...]` was `a` in numpy <1.9. assert_(a[...].base is a) # Slicing with ellipsis can skip an # arbitrary number of dimensions assert_equal(a[0, ...], a[0]) assert_equal(a[0, ...], a[0,:]) assert_equal(a[..., 0], a[:, 0]) # Slicing with ellipsis always results # in an array, not a scalar assert_equal(a[0, ..., 1], np.array(2)) # Assignment with `(Ellipsis,)` on 0-d arrays b = np.array(1) b[(Ellipsis,)] = 2 assert_equal(b, 2) def test_single_int_index(self): # Single integer index selects one row a = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]]) assert_equal(a[0], [1, 2, 3]) assert_equal(a[-1], [7, 8, 9]) # Index out of bounds produces IndexError assert_raises(IndexError, a.__getitem__, 1 << 30) # Index overflow produces IndexError assert_raises(IndexError, a.__getitem__, 1 << 64) def test_single_bool_index(self): # Single boolean index a = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]]) assert_equal(a[np.array(True)], a[None]) assert_equal(a[np.array(False)], a[None][0:0]) def test_boolean_shape_mismatch(self): arr = np.ones((5, 4, 3)) index = np.array([True]) assert_raises(IndexError, arr.__getitem__, index) index = np.array([False] * 6) assert_raises(IndexError, arr.__getitem__, index) index = np.zeros((4, 4), dtype=bool) assert_raises(IndexError, arr.__getitem__, index) assert_raises(IndexError, arr.__getitem__, (slice(None), index)) def test_boolean_indexing_onedim(self): # Indexing a 2-dimensional array with # boolean array of length one a = np.array([[ 0., 0., 0.]]) b = np.array([ True], dtype=bool) assert_equal(a[b], a) # boolean assignment a[b] = 1. assert_equal(a, [[1., 1., 1.]]) def test_boolean_assignment_value_mismatch(self): # A boolean assignment should fail when the shape of the values # cannot be broadcast to the subscription. (see also gh-3458) a = np.arange(4) def f(a, v): a[a > -1] = v assert_raises(ValueError, f, a, []) assert_raises(ValueError, f, a, [1, 2, 3]) assert_raises(ValueError, f, a[:1], [1, 2, 3]) def test_boolean_assignment_needs_api(self): # See also gh-7666 # This caused a segfault on Python 2 due to the GIL not being # held when the iterator does not need it, but the transfer function # does arr = np.zeros(1000) indx = np.zeros(1000, dtype=bool) indx[:100] = True arr[indx] = np.ones(100, dtype=object) expected = np.zeros(1000) expected[:100] = 1 assert_array_equal(arr, expected) def test_boolean_indexing_twodim(self): # Indexing a 2-dimensional array with # 2-dimensional boolean array a = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]]) b = np.array([[ True, False, True], [False, True, False], [ True, False, True]]) assert_equal(a[b], [1, 3, 5, 7, 9]) assert_equal(a[b[1]], [[4, 5, 6]]) assert_equal(a[b[0]], a[b[2]]) # boolean assignment a[b] = 0 assert_equal(a, [[0, 2, 0], [4, 0, 6], [0, 8, 0]]) def test_reverse_strides_and_subspace_bufferinit(self): # This tests that the strides are not reversed for simple and # subspace fancy indexing. a = np.ones(5) b = np.zeros(5, dtype=np.intp)[::-1] c = np.arange(5)[::-1] a[b] = c # If the strides are not reversed, the 0 in the arange comes last. assert_equal(a[0], 0) # This also tests that the subspace buffer is initialized: a = np.ones((5, 2)) c = np.arange(10).reshape(5, 2)[::-1] a[b, :] = c assert_equal(a[0], [0, 1]) def test_reversed_strides_result_allocation(self): # Test a bug when calculating the output strides for a result array # when the subspace size was 1 (and test other cases as well) a = np.arange(10)[:, None] i = np.arange(10)[::-1] assert_array_equal(a[i], a[i.copy('C')]) a = np.arange(20).reshape(-1, 2) def test_uncontiguous_subspace_assignment(self): # During development there was a bug activating a skip logic # based on ndim instead of size. a = np.full((3, 4, 2), -1) b = np.full((3, 4, 2), -1) a[[0, 1]] = np.arange(2 * 4 * 2).reshape(2, 4, 2).T b[[0, 1]] = np.arange(2 * 4 * 2).reshape(2, 4, 2).T.copy() assert_equal(a, b) def test_too_many_fancy_indices_special_case(self): # Just documents behaviour, this is a small limitation. a = np.ones((1,) * 32) # 32 is NPY_MAXDIMS assert_raises(IndexError, a.__getitem__, (np.array([0]),) * 32) def test_scalar_array_bool(self): # NumPy bools can be used as boolean index (python ones as of yet not) a = np.array(1) assert_equal(a[np.bool_(True)], a[np.array(True)]) assert_equal(a[np.bool_(False)], a[np.array(False)]) # After deprecating bools as integers: #a = np.array([0,1,2]) #assert_equal(a[True, :], a[None, :]) #assert_equal(a[:, True], a[:, None]) # #assert_(not np.may_share_memory(a, a[True, :])) def test_everything_returns_views(self): # Before `...` would return a itself. a = np.arange(5) assert_(a is not a[()]) assert_(a is not a[...]) assert_(a is not a[:]) def test_broaderrors_indexing(self): a = np.zeros((5, 5)) assert_raises(IndexError, a.__getitem__, ([0, 1], [0, 1, 2])) assert_raises(IndexError, a.__setitem__, ([0, 1], [0, 1, 2]), 0) def test_trivial_fancy_out_of_bounds(self): a = np.zeros(5) ind = np.ones(20, dtype=np.intp) ind[-1] = 10 assert_raises(IndexError, a.__getitem__, ind) assert_raises(IndexError, a.__setitem__, ind, 0) ind = np.ones(20, dtype=np.intp) ind[0] = 11 assert_raises(IndexError, a.__getitem__, ind) assert_raises(IndexError, a.__setitem__, ind, 0) def test_nonbaseclass_values(self): class SubClass(np.ndarray): def __array_finalize__(self, old): # Have array finalize do funny things self.fill(99) a = np.zeros((5, 5)) s = a.copy().view(type=SubClass) s.fill(1) a[[0, 1, 2, 3, 4], :] = s assert_((a == 1).all()) # Subspace is last, so transposing might want to finalize a[:, [0, 1, 2, 3, 4]] = s assert_((a == 1).all()) a.fill(0) a[...] = s assert_((a == 1).all()) def test_subclass_writeable(self): d = np.rec.array([('NGC1001', 11), ('NGC1002', 1.), ('NGC1003', 1.)], dtype=[('target', 'S20'), ('V_mag', '>f4')]) ind = np.array([False, True, True], dtype=bool) assert_(d[ind].flags.writeable) ind = np.array([0, 1]) assert_(d[ind].flags.writeable) assert_(d[...].flags.writeable) assert_(d[0].flags.writeable) def test_memory_order(self): # This is not necessary to preserve. Memory layouts for # more complex indices are not as simple. a = np.arange(10) b = np.arange(10).reshape(5,2).T assert_(a[b].flags.f_contiguous) # Takes a different implementation branch: a = a.reshape(-1, 1) assert_(a[b, 0].flags.f_contiguous) def test_scalar_return_type(self): # Full scalar indices should return scalars and object # arrays should not call PyArray_Return on their items class Zero(object): # The most basic valid indexing def __index__(self): return 0 z = Zero() class ArrayLike(object): # Simple array, should behave like the array def __array__(self): return np.array(0) a = np.zeros(()) assert_(isinstance(a[()], np.float_)) a = np.zeros(1) assert_(isinstance(a[z], np.float_)) a = np.zeros((1, 1)) assert_(isinstance(a[z, np.array(0)], np.float_)) assert_(isinstance(a[z, ArrayLike()], np.float_)) # And object arrays do not call it too often: b = np.array(0) a = np.array(0, dtype=object) a[()] = b assert_(isinstance(a[()], np.ndarray)) a = np.array([b, None]) assert_(isinstance(a[z], np.ndarray)) a = np.array([[b, None]]) assert_(isinstance(a[z, np.array(0)], np.ndarray)) assert_(isinstance(a[z, ArrayLike()], np.ndarray)) def test_small_regressions(self): # Reference count of intp for index checks a = np.array([0]) if HAS_REFCOUNT: refcount = sys.getrefcount(np.dtype(np.intp)) # item setting always checks indices in separate function: a[np.array([0], dtype=np.intp)] = 1 a[np.array([0], dtype=np.uint8)] = 1 assert_raises(IndexError, a.__setitem__, np.array([1], dtype=np.intp), 1) assert_raises(IndexError, a.__setitem__, np.array([1], dtype=np.uint8), 1) if HAS_REFCOUNT: assert_equal(sys.getrefcount(np.dtype(np.intp)), refcount) def test_unaligned(self): v = (np.zeros(64, dtype=np.int8) + ord('a'))[1:-7] d = v.view(np.dtype("S8")) # unaligned source x = (np.zeros(16, dtype=np.int8) + ord('a'))[1:-7] x = x.view(np.dtype("S8")) x[...] = np.array("b" * 8, dtype="S") b = np.arange(d.size) #trivial assert_equal(d[b], d) d[b] = x # nontrivial # unaligned index array b = np.zeros(d.size + 1).view(np.int8)[1:-(np.intp(0).itemsize - 1)] b = b.view(np.intp)[:d.size] b[...] = np.arange(d.size) assert_equal(d[b.astype(np.int16)], d) d[b.astype(np.int16)] = x # boolean d[b % 2 == 0] d[b % 2 == 0] = x[::2] def test_tuple_subclass(self): arr = np.ones((5, 5)) # A tuple subclass should also be an nd-index class TupleSubclass(tuple): pass index = ([1], [1]) index = TupleSubclass(index) assert_(arr[index].shape == (1,)) # Unlike the non nd-index: assert_(arr[index,].shape != (1,)) def test_broken_sequence_not_nd_index(self): # See gh-5063: # If we have an object which claims to be a sequence, but fails # on item getting, this should not be converted to an nd-index (tuple) # If this object happens to be a valid index otherwise, it should work # This object here is very dubious and probably bad though: class SequenceLike(object): def __index__(self): return 0 def __len__(self): return 1 def __getitem__(self, item): raise IndexError('Not possible') arr = np.arange(10) assert_array_equal(arr[SequenceLike()], arr[SequenceLike(),]) # also test that field indexing does not segfault # for a similar reason, by indexing a structured array arr = np.zeros((1,), dtype=[('f1', 'i8'), ('f2', 'i8')]) assert_array_equal(arr[SequenceLike()], arr[SequenceLike(),]) def test_indexing_array_weird_strides(self): # See also gh-6221 # the shapes used here come from the issue and create the correct # size for the iterator buffering size. x = np.ones(10) x2 = np.ones((10, 2)) ind = np.arange(10)[:, None, None, None] ind = np.broadcast_to(ind, (10, 55, 4, 4)) # single advanced index case assert_array_equal(x[ind], x[ind.copy()]) # higher dimensional advanced index zind = np.zeros(4, dtype=np.intp) assert_array_equal(x2[ind, zind], x2[ind.copy(), zind]) def test_indexing_array_negative_strides(self): # From gh-8264, # core dumps if negative strides are used in iteration arro = np.zeros((4, 4)) arr = arro[::-1, ::-1] slices = [slice(None), [0, 1, 2, 3]] arr[slices] = 10 assert_array_equal(arr, 10.) class TestFieldIndexing(object): def test_scalar_return_type(self): # Field access on an array should return an array, even if it # is 0-d. a = np.zeros((), [('a','f8')]) assert_(isinstance(a['a'], np.ndarray)) assert_(isinstance(a[['a']], np.ndarray)) class TestBroadcastedAssignments(object): def assign(self, a, ind, val): a[ind] = val return a def test_prepending_ones(self): a = np.zeros((3, 2)) a[...] = np.ones((1, 3, 2)) # Fancy with subspace with and without transpose a[[0, 1, 2], :] = np.ones((1, 3, 2)) a[:, [0, 1]] = np.ones((1, 3, 2)) # Fancy without subspace (with broadcasting) a[[[0], [1], [2]], [0, 1]] = np.ones((1, 3, 2)) def test_prepend_not_one(self): assign = self.assign s_ = np.s_ a = np.zeros(5) # Too large and not only ones. assert_raises(ValueError, assign, a, s_[...], np.ones((2, 1))) assert_raises(ValueError, assign, a, s_[[1, 2, 3],], np.ones((2, 1))) assert_raises(ValueError, assign, a, s_[[[1], [2]],], np.ones((2,2,1))) def test_simple_broadcasting_errors(self): assign = self.assign s_ = np.s_ a = np.zeros((5, 1)) assert_raises(ValueError, assign, a, s_[...], np.zeros((5, 2))) assert_raises(ValueError, assign, a, s_[...], np.zeros((5, 0))) assert_raises(ValueError, assign, a, s_[:, [0]], np.zeros((5, 2))) assert_raises(ValueError, assign, a, s_[:, [0]], np.zeros((5, 0))) assert_raises(ValueError, assign, a, s_[[0], :], np.zeros((2, 1))) def test_index_is_larger(self): # Simple case of fancy index broadcasting of the index. a = np.zeros((5, 5)) a[[[0], [1], [2]], [0, 1, 2]] = [2, 3, 4] assert_((a[:3, :3] == [2, 3, 4]).all()) def test_broadcast_subspace(self): a = np.zeros((100, 100)) v = np.arange(100)[:,None] b = np.arange(100)[::-1] a[b] = v assert_((a[::-1] == v).all()) class TestSubclasses(object): def test_basic(self): class SubClass(np.ndarray): pass s = np.arange(5).view(SubClass) assert_(isinstance(s[:3], SubClass)) assert_(s[:3].base is s) assert_(isinstance(s[[0, 1, 2]], SubClass)) assert_(isinstance(s[s > 0], SubClass)) def test_matrix_fancy(self): # The matrix class messes with the shape. While this is always # weird (getitem is not used, it does not have setitem nor knows # about fancy indexing), this tests gh-3110 m = np.matrix([[1, 2], [3, 4]]) assert_(isinstance(m[[0,1,0], :], np.matrix)) # gh-3110. Note the transpose currently because matrices do *not* # support dimension fixing for fancy indexing correctly. x = np.asmatrix(np.arange(50).reshape(5,10)) assert_equal(x[:2, np.array(-1)], x[:2, -1].T) def test_finalize_gets_full_info(self): # Array finalize should be called on the filled array. class SubClass(np.ndarray): def __array_finalize__(self, old): self.finalize_status = np.array(self) self.old = old s = np.arange(10).view(SubClass) new_s = s[:3] assert_array_equal(new_s.finalize_status, new_s) assert_array_equal(new_s.old, s) new_s = s[[0,1,2,3]] assert_array_equal(new_s.finalize_status, new_s) assert_array_equal(new_s.old, s) new_s = s[s > 0] assert_array_equal(new_s.finalize_status, new_s) assert_array_equal(new_s.old, s) @dec.skipif(not HAS_REFCOUNT) def test_slice_decref_getsetslice(self): # See gh-10066, a temporary slice object should be discarted. # This test is only really interesting on Python 2 since # it goes through `__set/getslice__` here and can probably be # removed. Use 0:7 to make sure it is never None:7. class KeepIndexObject(np.ndarray): def __getitem__(self, indx): self.indx = indx if indx == slice(0, 7): raise ValueError def __setitem__(self, indx, val): self.indx = indx if indx == slice(0, 4): raise ValueError k = np.array([1]).view(KeepIndexObject) k[0:5] assert_equal(k.indx, slice(0, 5)) assert_equal(sys.getrefcount(k.indx), 2) try: k[0:7] raise AssertionError except ValueError: # The exception holds a reference to the slice so clear on Py2 if hasattr(sys, 'exc_clear'): with suppress_warnings() as sup: sup.filter(DeprecationWarning) sys.exc_clear() assert_equal(k.indx, slice(0, 7)) assert_equal(sys.getrefcount(k.indx), 2) k[0:3] = 6 assert_equal(k.indx, slice(0, 3)) assert_equal(sys.getrefcount(k.indx), 2) try: k[0:4] = 2 raise AssertionError except ValueError: # The exception holds a reference to the slice so clear on Py2 if hasattr(sys, 'exc_clear'): with suppress_warnings() as sup: sup.filter(DeprecationWarning) sys.exc_clear() assert_equal(k.indx, slice(0, 4)) assert_equal(sys.getrefcount(k.indx), 2) class TestFancyIndexingCast(object): def test_boolean_index_cast_assign(self): # Setup the boolean index and float arrays. shape = (8, 63) bool_index = np.zeros(shape).astype(bool) bool_index[0, 1] = True zero_array = np.zeros(shape) # Assigning float is fine. zero_array[bool_index] = np.array([1]) assert_equal(zero_array[0, 1], 1) # Fancy indexing works, although we get a cast warning. assert_warns(np.ComplexWarning, zero_array.__setitem__, ([0], [1]), np.array([2 + 1j])) assert_equal(zero_array[0, 1], 2) # No complex part # Cast complex to float, throwing away the imaginary portion. assert_warns(np.ComplexWarning, zero_array.__setitem__, bool_index, np.array([1j])) assert_equal(zero_array[0, 1], 0) class TestFancyIndexingEquivalence(object): def test_object_assign(self): # Check that the field and object special case using copyto is active. # The right hand side cannot be converted to an array here. a = np.arange(5, dtype=object) b = a.copy() a[:3] = [1, (1,2), 3] b[[0, 1, 2]] = [1, (1,2), 3] assert_array_equal(a, b) # test same for subspace fancy indexing b = np.arange(5, dtype=object)[None, :] b[[0], :3] = [[1, (1,2), 3]] assert_array_equal(a, b[0]) # Check that swapping of axes works. # There was a bug that made the later assignment throw a ValueError # do to an incorrectly transposed temporary right hand side (gh-5714) b = b.T b[:3, [0]] = [[1], [(1,2)], [3]] assert_array_equal(a, b[:, 0]) # Another test for the memory order of the subspace arr = np.ones((3, 4, 5), dtype=object) # Equivalent slicing assignment for comparison cmp_arr = arr.copy() cmp_arr[:1, ...] = [[[1], [2], [3], [4]]] arr[[0], ...] = [[[1], [2], [3], [4]]] assert_array_equal(arr, cmp_arr) arr = arr.copy('F') arr[[0], ...] = [[[1], [2], [3], [4]]] assert_array_equal(arr, cmp_arr) def test_cast_equivalence(self): # Yes, normal slicing uses unsafe casting. a = np.arange(5) b = a.copy() a[:3] = np.array(['2', '-3', '-1']) b[[0, 2, 1]] = np.array(['2', '-1', '-3']) assert_array_equal(a, b) # test the same for subspace fancy indexing b = np.arange(5)[None, :] b[[0], :3] = np.array([['2', '-3', '-1']]) assert_array_equal(a, b[0]) class TestMultiIndexingAutomated(object): """ These tests use code to mimic the C-Code indexing for selection. NOTE: * This still lacks tests for complex item setting. * If you change behavior of indexing, you might want to modify these tests to try more combinations. * Behavior was written to match numpy version 1.8. (though a first version matched 1.7.) * Only tuple indices are supported by the mimicking code. (and tested as of writing this) * Error types should match most of the time as long as there is only one error. For multiple errors, what gets raised will usually not be the same one. They are *not* tested. Update 2016-11-30: It is probably not worth maintaining this test indefinitely and it can be dropped if maintenance becomes a burden. """ def setup(self): self.a = np.arange(np.prod([3, 1, 5, 6])).reshape(3, 1, 5, 6) self.b = np.empty((3, 0, 5, 6)) self.complex_indices = ['skip', Ellipsis, 0, # Boolean indices, up to 3-d for some special cases of eating up # dimensions, also need to test all False np.array([True, False, False]), np.array([[True, False], [False, True]]), np.array([[[False, False], [False, False]]]), # Some slices: slice(-5, 5, 2), slice(1, 1, 100), slice(4, -1, -2), slice(None, None, -3), # Some Fancy indexes: np.empty((0, 1, 1), dtype=np.intp), # empty and can be broadcast np.array([0, 1, -2]), np.array([[2], [0], [1]]), np.array([[0, -1], [0, 1]], dtype=np.dtype('intp').newbyteorder()), np.array([2, -1], dtype=np.int8), np.zeros([1]*31, dtype=int), # trigger too large array. np.array([0., 1.])] # invalid datatype # Some simpler indices that still cover a bit more self.simple_indices = [Ellipsis, None, -1, [1], np.array([True]), 'skip'] # Very simple ones to fill the rest: self.fill_indices = [slice(None, None), 0] def _get_multi_index(self, arr, indices): """Mimic multi dimensional indexing. Parameters ---------- arr : ndarray Array to be indexed. indices : tuple of index objects Returns ------- out : ndarray An array equivalent to the indexing operation (but always a copy). `arr[indices]` should be identical. no_copy : bool Whether the indexing operation requires a copy. If this is `True`, `np.may_share_memory(arr, arr[indicies])` should be `True` (with some exceptions for scalars and possibly 0-d arrays). Notes ----- While the function may mostly match the errors of normal indexing this is generally not the case. """ in_indices = list(indices) indices = [] # if False, this is a fancy or boolean index no_copy = True # number of fancy/scalar indexes that are not consecutive num_fancy = 0 # number of dimensions indexed by a "fancy" index fancy_dim = 0 # NOTE: This is a funny twist (and probably OK to change). # The boolean array has illegal indexes, but this is # allowed if the broadcast fancy-indices are 0-sized. # This variable is to catch that case. error_unless_broadcast_to_empty = False # We need to handle Ellipsis and make arrays from indices, also # check if this is fancy indexing (set no_copy). ndim = 0 ellipsis_pos = None # define here mostly to replace all but first. for i, indx in enumerate(in_indices): if indx is None: continue if isinstance(indx, np.ndarray) and indx.dtype == bool: no_copy = False if indx.ndim == 0: raise IndexError # boolean indices can have higher dimensions ndim += indx.ndim fancy_dim += indx.ndim continue if indx is Ellipsis: if ellipsis_pos is None: ellipsis_pos = i continue # do not increment ndim counter raise IndexError if isinstance(indx, slice): ndim += 1 continue if not isinstance(indx, np.ndarray): # This could be open for changes in numpy. # numpy should maybe raise an error if casting to intp # is not safe. It rejects np.array([1., 2.]) but not # [1., 2.] as index (same for ie. np.take). # (Note the importance of empty lists if changing this here) indx = np.array(indx, dtype=np.intp) in_indices[i] = indx elif indx.dtype.kind != 'b' and indx.dtype.kind != 'i': raise IndexError('arrays used as indices must be of ' 'integer (or boolean) type') if indx.ndim != 0: no_copy = False ndim += 1 fancy_dim += 1 if arr.ndim - ndim < 0: # we can't take more dimensions then we have, not even for 0-d # arrays. since a[()] makes sense, but not a[(),]. We will # raise an error later on, unless a broadcasting error occurs # first. raise IndexError if ndim == 0 and None not in in_indices: # Well we have no indexes or one Ellipsis. This is legal. return arr.copy(), no_copy if ellipsis_pos is not None: in_indices[ellipsis_pos:ellipsis_pos+1] = ([slice(None, None)] * (arr.ndim - ndim)) for ax, indx in enumerate(in_indices): if isinstance(indx, slice): # convert to an index array indx = np.arange(*indx.indices(arr.shape[ax])) indices.append(['s', indx]) continue elif indx is None: # this is like taking a slice with one element from a new axis: indices.append(['n', np.array([0], dtype=np.intp)]) arr = arr.reshape((arr.shape[:ax] + (1,) + arr.shape[ax:])) continue if isinstance(indx, np.ndarray) and indx.dtype == bool: if indx.shape != arr.shape[ax:ax+indx.ndim]: raise IndexError try: flat_indx = np.ravel_multi_index(np.nonzero(indx), arr.shape[ax:ax+indx.ndim], mode='raise') except Exception: error_unless_broadcast_to_empty = True # fill with 0s instead, and raise error later flat_indx = np.array([0]*indx.sum(), dtype=np.intp) # concatenate axis into a single one: if indx.ndim != 0: arr = arr.reshape((arr.shape[:ax] + (np.prod(arr.shape[ax:ax+indx.ndim]),) + arr.shape[ax+indx.ndim:])) indx = flat_indx else: # This could be changed, a 0-d boolean index can # make sense (even outside the 0-d indexed array case) # Note that originally this is could be interpreted as # integer in the full integer special case. raise IndexError else: # If the index is a singleton, the bounds check is done # before the broadcasting. This used to be different in <1.9 if indx.ndim == 0: if indx >= arr.shape[ax] or indx < -arr.shape[ax]: raise IndexError if indx.ndim == 0: # The index is a scalar. This used to be two fold, but if # fancy indexing was active, the check was done later, # possibly after broadcasting it away (1.7. or earlier). # Now it is always done. if indx >= arr.shape[ax] or indx < - arr.shape[ax]: raise IndexError if (len(indices) > 0 and indices[-1][0] == 'f' and ax != ellipsis_pos): # NOTE: There could still have been a 0-sized Ellipsis # between them. Checked that with ellipsis_pos. indices[-1].append(indx) else: # We have a fancy index that is not after an existing one. # NOTE: A 0-d array triggers this as well, while one may # expect it to not trigger it, since a scalar would not be # considered fancy indexing. num_fancy += 1 indices.append(['f', indx]) if num_fancy > 1 and not no_copy: # We have to flush the fancy indexes left new_indices = indices[:] axes = list(range(arr.ndim)) fancy_axes = [] new_indices.insert(0, ['f']) ni = 0 ai = 0 for indx in indices: ni += 1 if indx[0] == 'f': new_indices[0].extend(indx[1:]) del new_indices[ni] ni -= 1 for ax in range(ai, ai + len(indx[1:])): fancy_axes.append(ax) axes.remove(ax) ai += len(indx) - 1 # axis we are at indices = new_indices # and now we need to transpose arr: arr = arr.transpose(*(fancy_axes + axes)) # We only have one 'f' index now and arr is transposed accordingly. # Now handle newaxis by reshaping... ax = 0 for indx in indices: if indx[0] == 'f': if len(indx) == 1: continue # First of all, reshape arr to combine fancy axes into one: orig_shape = arr.shape orig_slice = orig_shape[ax:ax + len(indx[1:])] arr = arr.reshape((arr.shape[:ax] + (np.prod(orig_slice).astype(int),) + arr.shape[ax + len(indx[1:]):])) # Check if broadcasting works res = np.broadcast(*indx[1:]) # unfortunately the indices might be out of bounds. So check # that first, and use mode='wrap' then. However only if # there are any indices... if res.size != 0: if error_unless_broadcast_to_empty: raise IndexError for _indx, _size in zip(indx[1:], orig_slice): if _indx.size == 0: continue if np.any(_indx >= _size) or np.any(_indx < -_size): raise IndexError if len(indx[1:]) == len(orig_slice): if np.product(orig_slice) == 0: # Work around for a crash or IndexError with 'wrap' # in some 0-sized cases. try: mi = np.ravel_multi_index(indx[1:], orig_slice, mode='raise') except Exception: # This happens with 0-sized orig_slice (sometimes?) # here it is a ValueError, but indexing gives a: raise IndexError('invalid index into 0-sized') else: mi = np.ravel_multi_index(indx[1:], orig_slice, mode='wrap') else: # Maybe never happens... raise ValueError arr = arr.take(mi.ravel(), axis=ax) arr = arr.reshape((arr.shape[:ax] + mi.shape + arr.shape[ax+1:])) ax += mi.ndim continue # If we are here, we have a 1D array for take: arr = arr.take(indx[1], axis=ax) ax += 1 return arr, no_copy def _check_multi_index(self, arr, index): """Check a multi index item getting and simple setting. Parameters ---------- arr : ndarray Array to be indexed, must be a reshaped arange. index : tuple of indexing objects Index being tested. """ # Test item getting try: mimic_get, no_copy = self._get_multi_index(arr, index) except Exception as e: if HAS_REFCOUNT: prev_refcount = sys.getrefcount(arr) assert_raises(Exception, arr.__getitem__, index) assert_raises(Exception, arr.__setitem__, index, 0) if HAS_REFCOUNT: assert_equal(prev_refcount, sys.getrefcount(arr)) return self._compare_index_result(arr, index, mimic_get, no_copy) def _check_single_index(self, arr, index): """Check a single index item getting and simple setting. Parameters ---------- arr : ndarray Array to be indexed, must be an arange. index : indexing object Index being tested. Must be a single index and not a tuple of indexing objects (see also `_check_multi_index`). """ try: mimic_get, no_copy = self._get_multi_index(arr, (index,)) except Exception as e: if HAS_REFCOUNT: prev_refcount = sys.getrefcount(arr) assert_raises(Exception, arr.__getitem__, index) assert_raises(Exception, arr.__setitem__, index, 0) if HAS_REFCOUNT: assert_equal(prev_refcount, sys.getrefcount(arr)) return self._compare_index_result(arr, index, mimic_get, no_copy) def _compare_index_result(self, arr, index, mimic_get, no_copy): """Compare mimicked result to indexing result. """ arr = arr.copy() indexed_arr = arr[index] assert_array_equal(indexed_arr, mimic_get) # Check if we got a view, unless its a 0-sized or 0-d array. # (then its not a view, and that does not matter) if indexed_arr.size != 0 and indexed_arr.ndim != 0: assert_(np.may_share_memory(indexed_arr, arr) == no_copy) # Check reference count of the original array if HAS_REFCOUNT: if no_copy: # refcount increases by one: assert_equal(sys.getrefcount(arr), 3) else: assert_equal(sys.getrefcount(arr), 2) # Test non-broadcast setitem: b = arr.copy() b[index] = mimic_get + 1000 if b.size == 0: return # nothing to compare here... if no_copy and indexed_arr.ndim != 0: # change indexed_arr in-place to manipulate original: indexed_arr += 1000 assert_array_equal(arr, b) return # Use the fact that the array is originally an arange: arr.flat[indexed_arr.ravel()] += 1000 assert_array_equal(arr, b) def test_boolean(self): a = np.array(5) assert_equal(a[np.array(True)], 5) a[np.array(True)] = 1 assert_equal(a, 1) # NOTE: This is different from normal broadcasting, as # arr[boolean_array] works like in a multi index. Which means # it is aligned to the left. This is probably correct for # consistency with arr[boolean_array,] also no broadcasting # is done at all self._check_multi_index( self.a, (np.zeros_like(self.a, dtype=bool),)) self._check_multi_index( self.a, (np.zeros_like(self.a, dtype=bool)[..., 0],)) self._check_multi_index( self.a, (np.zeros_like(self.a, dtype=bool)[None, ...],)) def test_multidim(self): # Automatically test combinations with complex indexes on 2nd (or 1st) # spot and the simple ones in one other spot. with warnings.catch_warnings(): # This is so that np.array(True) is not accepted in a full integer # index, when running the file separately. warnings.filterwarnings('error', '', DeprecationWarning) warnings.filterwarnings('error', '', np.VisibleDeprecationWarning) def isskip(idx): return isinstance(idx, str) and idx == "skip" for simple_pos in [0, 2, 3]: tocheck = [self.fill_indices, self.complex_indices, self.fill_indices, self.fill_indices] tocheck[simple_pos] = self.simple_indices for index in product(*tocheck): index = tuple(i for i in index if not isskip(i)) self._check_multi_index(self.a, index) self._check_multi_index(self.b, index) # Check very simple item getting: self._check_multi_index(self.a, (0, 0, 0, 0)) self._check_multi_index(self.b, (0, 0, 0, 0)) # Also check (simple cases of) too many indices: assert_raises(IndexError, self.a.__getitem__, (0, 0, 0, 0, 0)) assert_raises(IndexError, self.a.__setitem__, (0, 0, 0, 0, 0), 0) assert_raises(IndexError, self.a.__getitem__, (0, 0, [1], 0, 0)) assert_raises(IndexError, self.a.__setitem__, (0, 0, [1], 0, 0), 0) def test_1d(self): a = np.arange(10) with warnings.catch_warnings(): warnings.filterwarnings('error', '', np.VisibleDeprecationWarning) for index in self.complex_indices: self._check_single_index(a, index) class TestFloatNonIntegerArgument(object): """ These test that ``TypeError`` is raised when you try to use non-integers as arguments to for indexing and slicing e.g. ``a[0.0:5]`` and ``a[0.5]``, or other functions like ``array.reshape(1., -1)``. """ def test_valid_indexing(self): # These should raise no errors. a = np.array([[[5]]]) a[np.array([0])] a[[0, 0]] a[:, [0, 0]] a[:, 0,:] a[:,:,:] def test_valid_slicing(self): # These should raise no errors. a = np.array([[[5]]]) a[::] a[0:] a[:2] a[0:2] a[::2] a[1::2] a[:2:2] a[1:2:2] def test_non_integer_argument_errors(self): a = np.array([[5]]) assert_raises(TypeError, np.reshape, a, (1., 1., -1)) assert_raises(TypeError, np.reshape, a, (np.array(1.), -1)) assert_raises(TypeError, np.take, a, [0], 1.) assert_raises(TypeError, np.take, a, [0], np.float64(1.)) def test_non_integer_sequence_multiplication(self): # NumPy scalar sequence multiply should not work with non-integers def mult(a, b): return a * b assert_raises(TypeError, mult, [1], np.float_(3)) # following should be OK mult([1], np.int_(3)) def test_reduce_axis_float_index(self): d = np.zeros((3,3,3)) assert_raises(TypeError, np.min, d, 0.5) assert_raises(TypeError, np.min, d, (0.5, 1)) assert_raises(TypeError, np.min, d, (1, 2.2)) assert_raises(TypeError, np.min, d, (.2, 1.2)) class TestBooleanIndexing(object): # Using a boolean as integer argument/indexing is an error. def test_bool_as_int_argument_errors(self): a = np.array([[[1]]]) assert_raises(TypeError, np.reshape, a, (True, -1)) assert_raises(TypeError, np.reshape, a, (np.bool_(True), -1)) # Note that operator.index(np.array(True)) does not work, a boolean # array is thus also deprecated, but not with the same message: assert_raises(TypeError, operator.index, np.array(True)) assert_warns(DeprecationWarning, operator.index, np.True_) assert_raises(TypeError, np.take, args=(a, [0], False)) def test_boolean_indexing_weirdness(self): # Weird boolean indexing things a = np.ones((2, 3, 4)) a[False, True, ...].shape == (0, 2, 3, 4) a[True, [0, 1], True, True, [1], [[2]]] == (1, 2) assert_raises(IndexError, lambda: a[False, [0, 1], ...]) class TestArrayToIndexDeprecation(object): """Creating an an index from array not 0-D is an error. """ def test_array_to_index_error(self): # so no exception is expected. The raising is effectively tested above. a = np.array([[[1]]]) assert_raises(TypeError, operator.index, np.array([1])) assert_raises(TypeError, np.reshape, a, (a, -1)) assert_raises(TypeError, np.take, a, [0], a) class TestNonIntegerArrayLike(object): """Tests that array_likes only valid if can safely cast to integer. For instance, lists give IndexError when they cannot be safely cast to an integer. """ def test_basic(self): a = np.arange(10) assert_raises(IndexError, a.__getitem__, [0.5, 1.5]) assert_raises(IndexError, a.__getitem__, (['1', '2'],)) # The following is valid a.__getitem__([]) class TestMultipleEllipsisError(object): """An index can only have a single ellipsis. """ def test_basic(self): a = np.arange(10) assert_raises(IndexError, lambda: a[..., ...]) assert_raises(IndexError, a.__getitem__, ((Ellipsis,) * 2,)) assert_raises(IndexError, a.__getitem__, ((Ellipsis,) * 3,)) class TestCApiAccess(object): def test_getitem(self): subscript = functools.partial(array_indexing, 0) # 0-d arrays don't work: assert_raises(IndexError, subscript, np.ones(()), 0) # Out of bound values: assert_raises(IndexError, subscript, np.ones(10), 11) assert_raises(IndexError, subscript, np.ones(10), -11) assert_raises(IndexError, subscript, np.ones((10, 10)), 11) assert_raises(IndexError, subscript, np.ones((10, 10)), -11) a = np.arange(10) assert_array_equal(a[4], subscript(a, 4)) a = a.reshape(5, 2) assert_array_equal(a[-4], subscript(a, -4)) def test_setitem(self): assign = functools.partial(array_indexing, 1) # Deletion is impossible: assert_raises(ValueError, assign, np.ones(10), 0) # 0-d arrays don't work: assert_raises(IndexError, assign, np.ones(()), 0, 0) # Out of bound values: assert_raises(IndexError, assign, np.ones(10), 11, 0) assert_raises(IndexError, assign, np.ones(10), -11, 0) assert_raises(IndexError, assign, np.ones((10, 10)), 11, 0) assert_raises(IndexError, assign, np.ones((10, 10)), -11, 0) a = np.arange(10) assign(a, 4, 10) assert_(a[4] == 10) a = a.reshape(5, 2) assign(a, 4, 10) assert_array_equal(a[-1], [10, 10]) if __name__ == "__main__": run_module_suite()
50,084
36.971948
89
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_function_base.py
from __future__ import division, absolute_import, print_function from numpy import (logspace, linspace, geomspace, dtype, array, sctypes, arange, isnan, ndarray, sqrt, nextafter) from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_raises, assert_array_equal, assert_allclose, suppress_warnings ) class PhysicalQuantity(float): def __new__(cls, value): return float.__new__(cls, value) def __add__(self, x): assert_(isinstance(x, PhysicalQuantity)) return PhysicalQuantity(float(x) + float(self)) __radd__ = __add__ def __sub__(self, x): assert_(isinstance(x, PhysicalQuantity)) return PhysicalQuantity(float(self) - float(x)) def __rsub__(self, x): assert_(isinstance(x, PhysicalQuantity)) return PhysicalQuantity(float(x) - float(self)) def __mul__(self, x): return PhysicalQuantity(float(x) * float(self)) __rmul__ = __mul__ def __div__(self, x): return PhysicalQuantity(float(self) / float(x)) def __rdiv__(self, x): return PhysicalQuantity(float(x) / float(self)) class PhysicalQuantity2(ndarray): __array_priority__ = 10 class TestLogspace(object): def test_basic(self): y = logspace(0, 6) assert_(len(y) == 50) y = logspace(0, 6, num=100) assert_(y[-1] == 10 ** 6) y = logspace(0, 6, endpoint=0) assert_(y[-1] < 10 ** 6) y = logspace(0, 6, num=7) assert_array_equal(y, [1, 10, 100, 1e3, 1e4, 1e5, 1e6]) def test_dtype(self): y = logspace(0, 6, dtype='float32') assert_equal(y.dtype, dtype('float32')) y = logspace(0, 6, dtype='float64') assert_equal(y.dtype, dtype('float64')) y = logspace(0, 6, dtype='int32') assert_equal(y.dtype, dtype('int32')) def test_physical_quantities(self): a = PhysicalQuantity(1.0) b = PhysicalQuantity(5.0) assert_equal(logspace(a, b), logspace(1.0, 5.0)) def test_subclass(self): a = array(1).view(PhysicalQuantity2) b = array(7).view(PhysicalQuantity2) ls = logspace(a, b) assert type(ls) is PhysicalQuantity2 assert_equal(ls, logspace(1.0, 7.0)) ls = logspace(a, b, 1) assert type(ls) is PhysicalQuantity2 assert_equal(ls, logspace(1.0, 7.0, 1)) class TestGeomspace(object): def test_basic(self): y = geomspace(1, 1e6) assert_(len(y) == 50) y = geomspace(1, 1e6, num=100) assert_(y[-1] == 10 ** 6) y = geomspace(1, 1e6, endpoint=False) assert_(y[-1] < 10 ** 6) y = geomspace(1, 1e6, num=7) assert_array_equal(y, [1, 10, 100, 1e3, 1e4, 1e5, 1e6]) y = geomspace(8, 2, num=3) assert_allclose(y, [8, 4, 2]) assert_array_equal(y.imag, 0) y = geomspace(-1, -100, num=3) assert_array_equal(y, [-1, -10, -100]) assert_array_equal(y.imag, 0) y = geomspace(-100, -1, num=3) assert_array_equal(y, [-100, -10, -1]) assert_array_equal(y.imag, 0) def test_complex(self): # Purely imaginary y = geomspace(1j, 16j, num=5) assert_allclose(y, [1j, 2j, 4j, 8j, 16j]) assert_array_equal(y.real, 0) y = geomspace(-4j, -324j, num=5) assert_allclose(y, [-4j, -12j, -36j, -108j, -324j]) assert_array_equal(y.real, 0) y = geomspace(1+1j, 1000+1000j, num=4) assert_allclose(y, [1+1j, 10+10j, 100+100j, 1000+1000j]) y = geomspace(-1+1j, -1000+1000j, num=4) assert_allclose(y, [-1+1j, -10+10j, -100+100j, -1000+1000j]) # Logarithmic spirals y = geomspace(-1, 1, num=3, dtype=complex) assert_allclose(y, [-1, 1j, +1]) y = geomspace(0+3j, -3+0j, 3) assert_allclose(y, [0+3j, -3/sqrt(2)+3j/sqrt(2), -3+0j]) y = geomspace(0+3j, 3+0j, 3) assert_allclose(y, [0+3j, 3/sqrt(2)+3j/sqrt(2), 3+0j]) y = geomspace(-3+0j, 0-3j, 3) assert_allclose(y, [-3+0j, -3/sqrt(2)-3j/sqrt(2), 0-3j]) y = geomspace(0+3j, -3+0j, 3) assert_allclose(y, [0+3j, -3/sqrt(2)+3j/sqrt(2), -3+0j]) y = geomspace(-2-3j, 5+7j, 7) assert_allclose(y, [-2-3j, -0.29058977-4.15771027j, 2.08885354-4.34146838j, 4.58345529-3.16355218j, 6.41401745-0.55233457j, 6.75707386+3.11795092j, 5+7j]) # Type promotion should prevent the -5 from becoming a NaN y = geomspace(3j, -5, 2) assert_allclose(y, [3j, -5]) y = geomspace(-5, 3j, 2) assert_allclose(y, [-5, 3j]) def test_dtype(self): y = geomspace(1, 1e6, dtype='float32') assert_equal(y.dtype, dtype('float32')) y = geomspace(1, 1e6, dtype='float64') assert_equal(y.dtype, dtype('float64')) y = geomspace(1, 1e6, dtype='int32') assert_equal(y.dtype, dtype('int32')) # Native types y = geomspace(1, 1e6, dtype=float) assert_equal(y.dtype, dtype('float_')) y = geomspace(1, 1e6, dtype=complex) assert_equal(y.dtype, dtype('complex')) def test_array_scalar(self): lim1 = array([120, 100], dtype="int8") lim2 = array([-120, -100], dtype="int8") lim3 = array([1200, 1000], dtype="uint16") t1 = geomspace(lim1[0], lim1[1], 5) t2 = geomspace(lim2[0], lim2[1], 5) t3 = geomspace(lim3[0], lim3[1], 5) t4 = geomspace(120.0, 100.0, 5) t5 = geomspace(-120.0, -100.0, 5) t6 = geomspace(1200.0, 1000.0, 5) # t3 uses float32, t6 uses float64 assert_allclose(t1, t4, rtol=1e-2) assert_allclose(t2, t5, rtol=1e-2) assert_allclose(t3, t6, rtol=1e-5) def test_physical_quantities(self): a = PhysicalQuantity(1.0) b = PhysicalQuantity(5.0) assert_equal(geomspace(a, b), geomspace(1.0, 5.0)) def test_subclass(self): a = array(1).view(PhysicalQuantity2) b = array(7).view(PhysicalQuantity2) gs = geomspace(a, b) assert type(gs) is PhysicalQuantity2 assert_equal(gs, geomspace(1.0, 7.0)) gs = geomspace(a, b, 1) assert type(gs) is PhysicalQuantity2 assert_equal(gs, geomspace(1.0, 7.0, 1)) def test_bounds(self): assert_raises(ValueError, geomspace, 0, 10) assert_raises(ValueError, geomspace, 10, 0) assert_raises(ValueError, geomspace, 0, 0) class TestLinspace(object): def test_basic(self): y = linspace(0, 10) assert_(len(y) == 50) y = linspace(2, 10, num=100) assert_(y[-1] == 10) y = linspace(2, 10, endpoint=0) assert_(y[-1] < 10) assert_raises(ValueError, linspace, 0, 10, num=-1) def test_corner(self): y = list(linspace(0, 1, 1)) assert_(y == [0.0], y) with suppress_warnings() as sup: sup.filter(DeprecationWarning, ".*safely interpreted as an integer") y = list(linspace(0, 1, 2.5)) assert_(y == [0.0, 1.0]) def test_type(self): t1 = linspace(0, 1, 0).dtype t2 = linspace(0, 1, 1).dtype t3 = linspace(0, 1, 2).dtype assert_equal(t1, t2) assert_equal(t2, t3) def test_dtype(self): y = linspace(0, 6, dtype='float32') assert_equal(y.dtype, dtype('float32')) y = linspace(0, 6, dtype='float64') assert_equal(y.dtype, dtype('float64')) y = linspace(0, 6, dtype='int32') assert_equal(y.dtype, dtype('int32')) def test_array_scalar(self): lim1 = array([-120, 100], dtype="int8") lim2 = array([120, -100], dtype="int8") lim3 = array([1200, 1000], dtype="uint16") t1 = linspace(lim1[0], lim1[1], 5) t2 = linspace(lim2[0], lim2[1], 5) t3 = linspace(lim3[0], lim3[1], 5) t4 = linspace(-120.0, 100.0, 5) t5 = linspace(120.0, -100.0, 5) t6 = linspace(1200.0, 1000.0, 5) assert_equal(t1, t4) assert_equal(t2, t5) assert_equal(t3, t6) def test_complex(self): lim1 = linspace(1 + 2j, 3 + 4j, 5) t1 = array([1.0+2.j, 1.5+2.5j, 2.0+3j, 2.5+3.5j, 3.0+4j]) lim2 = linspace(1j, 10, 5) t2 = array([0.0+1.j, 2.5+0.75j, 5.0+0.5j, 7.5+0.25j, 10.0+0j]) assert_equal(lim1, t1) assert_equal(lim2, t2) def test_physical_quantities(self): a = PhysicalQuantity(0.0) b = PhysicalQuantity(1.0) assert_equal(linspace(a, b), linspace(0.0, 1.0)) def test_subclass(self): a = array(0).view(PhysicalQuantity2) b = array(1).view(PhysicalQuantity2) ls = linspace(a, b) assert type(ls) is PhysicalQuantity2 assert_equal(ls, linspace(0.0, 1.0)) ls = linspace(a, b, 1) assert type(ls) is PhysicalQuantity2 assert_equal(ls, linspace(0.0, 1.0, 1)) def test_array_interface(self): # Regression test for https://github.com/numpy/numpy/pull/6659 # Ensure that start/stop can be objects that implement # __array_interface__ and are convertible to numeric scalars class Arrayish(object): """ A generic object that supports the __array_interface__ and hence can in principle be converted to a numeric scalar, but is not otherwise recognized as numeric, but also happens to support multiplication by floats. Data should be an object that implements the buffer interface, and contains at least 4 bytes. """ def __init__(self, data): self._data = data @property def __array_interface__(self): # Ideally should be `'shape': ()` but the current interface # does not allow that return {'shape': (1,), 'typestr': '<i4', 'data': self._data, 'version': 3} def __mul__(self, other): # For the purposes of this test any multiplication is an # identity operation :) return self one = Arrayish(array(1, dtype='<i4')) five = Arrayish(array(5, dtype='<i4')) assert_equal(linspace(one, five), linspace(1, 5)) def test_denormal_numbers(self): # Regression test for gh-5437. Will probably fail when compiled # with ICC, which flushes denormals to zero for ftype in sctypes['float']: stop = nextafter(ftype(0), ftype(1)) * 5 # A denormal number assert_(any(linspace(0, stop, 10, endpoint=False, dtype=ftype))) def test_equivalent_to_arange(self): for j in range(1000): assert_equal(linspace(0, j, j+1, dtype=int), arange(j+1, dtype=int)) def test_retstep(self): y = linspace(0, 1, 2, retstep=True) assert_(isinstance(y, tuple) and len(y) == 2) for num in (0, 1): for ept in (False, True): y = linspace(0, 1, num, endpoint=ept, retstep=True) assert_(isinstance(y, tuple) and len(y) == 2 and len(y[0]) == num and isnan(y[1]), 'num={0}, endpoint={1}'.format(num, ept)) if __name__ == "__main__": run_module_suite()
11,413
34.01227
80
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_einsum.py
from __future__ import division, absolute_import, print_function import numpy as np from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_array_equal, assert_almost_equal, assert_raises, suppress_warnings ) # Setup for optimize einsum chars = 'abcdefghij' sizes = np.array([2, 3, 4, 5, 4, 3, 2, 6, 5, 4, 3]) global_size_dict = {} for size, char in zip(sizes, chars): global_size_dict[char] = size class TestEinSum(object): def test_einsum_errors(self): for do_opt in [True, False]: # Need enough arguments assert_raises(ValueError, np.einsum, optimize=do_opt) assert_raises(ValueError, np.einsum, "", optimize=do_opt) # subscripts must be a string assert_raises(TypeError, np.einsum, 0, 0, optimize=do_opt) # out parameter must be an array assert_raises(TypeError, np.einsum, "", 0, out='test', optimize=do_opt) # order parameter must be a valid order assert_raises(TypeError, np.einsum, "", 0, order='W', optimize=do_opt) # casting parameter must be a valid casting assert_raises(ValueError, np.einsum, "", 0, casting='blah', optimize=do_opt) # dtype parameter must be a valid dtype assert_raises(TypeError, np.einsum, "", 0, dtype='bad_data_type', optimize=do_opt) # other keyword arguments are rejected assert_raises(TypeError, np.einsum, "", 0, bad_arg=0, optimize=do_opt) # issue 4528 revealed a segfault with this call assert_raises(TypeError, np.einsum, *(None,)*63, optimize=do_opt) # number of operands must match count in subscripts string assert_raises(ValueError, np.einsum, "", 0, 0, optimize=do_opt) assert_raises(ValueError, np.einsum, ",", 0, [0], [0], optimize=do_opt) assert_raises(ValueError, np.einsum, ",", [0], optimize=do_opt) # can't have more subscripts than dimensions in the operand assert_raises(ValueError, np.einsum, "i", 0, optimize=do_opt) assert_raises(ValueError, np.einsum, "ij", [0, 0], optimize=do_opt) assert_raises(ValueError, np.einsum, "...i", 0, optimize=do_opt) assert_raises(ValueError, np.einsum, "i...j", [0, 0], optimize=do_opt) assert_raises(ValueError, np.einsum, "i...", 0, optimize=do_opt) assert_raises(ValueError, np.einsum, "ij...", [0, 0], optimize=do_opt) # invalid ellipsis assert_raises(ValueError, np.einsum, "i..", [0, 0], optimize=do_opt) assert_raises(ValueError, np.einsum, ".i...", [0, 0], optimize=do_opt) assert_raises(ValueError, np.einsum, "j->..j", [0, 0], optimize=do_opt) assert_raises(ValueError, np.einsum, "j->.j...", [0, 0], optimize=do_opt) # invalid subscript character assert_raises(ValueError, np.einsum, "i%...", [0, 0], optimize=do_opt) assert_raises(ValueError, np.einsum, "...j$", [0, 0], optimize=do_opt) assert_raises(ValueError, np.einsum, "i->&", [0, 0], optimize=do_opt) # output subscripts must appear in input assert_raises(ValueError, np.einsum, "i->ij", [0, 0], optimize=do_opt) # output subscripts may only be specified once assert_raises(ValueError, np.einsum, "ij->jij", [[0, 0], [0, 0]], optimize=do_opt) # dimensions much match when being collapsed assert_raises(ValueError, np.einsum, "ii", np.arange(6).reshape(2, 3), optimize=do_opt) assert_raises(ValueError, np.einsum, "ii->i", np.arange(6).reshape(2, 3), optimize=do_opt) # broadcasting to new dimensions must be enabled explicitly assert_raises(ValueError, np.einsum, "i", np.arange(6).reshape(2, 3), optimize=do_opt) assert_raises(ValueError, np.einsum, "i->i", [[0, 1], [0, 1]], out=np.arange(4).reshape(2, 2), optimize=do_opt) def test_einsum_views(self): # pass-through for do_opt in [True, False]: a = np.arange(6) a.shape = (2, 3) b = np.einsum("...", a, optimize=do_opt) assert_(b.base is a) b = np.einsum(a, [Ellipsis], optimize=do_opt) assert_(b.base is a) b = np.einsum("ij", a, optimize=do_opt) assert_(b.base is a) assert_equal(b, a) b = np.einsum(a, [0, 1], optimize=do_opt) assert_(b.base is a) assert_equal(b, a) # output is writeable whenever input is writeable b = np.einsum("...", a, optimize=do_opt) assert_(b.flags['WRITEABLE']) a.flags['WRITEABLE'] = False b = np.einsum("...", a, optimize=do_opt) assert_(not b.flags['WRITEABLE']) # transpose a = np.arange(6) a.shape = (2, 3) b = np.einsum("ji", a, optimize=do_opt) assert_(b.base is a) assert_equal(b, a.T) b = np.einsum(a, [1, 0], optimize=do_opt) assert_(b.base is a) assert_equal(b, a.T) # diagonal a = np.arange(9) a.shape = (3, 3) b = np.einsum("ii->i", a, optimize=do_opt) assert_(b.base is a) assert_equal(b, [a[i, i] for i in range(3)]) b = np.einsum(a, [0, 0], [0], optimize=do_opt) assert_(b.base is a) assert_equal(b, [a[i, i] for i in range(3)]) # diagonal with various ways of broadcasting an additional dimension a = np.arange(27) a.shape = (3, 3, 3) b = np.einsum("...ii->...i", a, optimize=do_opt) assert_(b.base is a) assert_equal(b, [[x[i, i] for i in range(3)] for x in a]) b = np.einsum(a, [Ellipsis, 0, 0], [Ellipsis, 0], optimize=do_opt) assert_(b.base is a) assert_equal(b, [[x[i, i] for i in range(3)] for x in a]) b = np.einsum("ii...->...i", a, optimize=do_opt) assert_(b.base is a) assert_equal(b, [[x[i, i] for i in range(3)] for x in a.transpose(2, 0, 1)]) b = np.einsum(a, [0, 0, Ellipsis], [Ellipsis, 0], optimize=do_opt) assert_(b.base is a) assert_equal(b, [[x[i, i] for i in range(3)] for x in a.transpose(2, 0, 1)]) b = np.einsum("...ii->i...", a, optimize=do_opt) assert_(b.base is a) assert_equal(b, [a[:, i, i] for i in range(3)]) b = np.einsum(a, [Ellipsis, 0, 0], [0, Ellipsis], optimize=do_opt) assert_(b.base is a) assert_equal(b, [a[:, i, i] for i in range(3)]) b = np.einsum("jii->ij", a, optimize=do_opt) assert_(b.base is a) assert_equal(b, [a[:, i, i] for i in range(3)]) b = np.einsum(a, [1, 0, 0], [0, 1], optimize=do_opt) assert_(b.base is a) assert_equal(b, [a[:, i, i] for i in range(3)]) b = np.einsum("ii...->i...", a, optimize=do_opt) assert_(b.base is a) assert_equal(b, [a.transpose(2, 0, 1)[:, i, i] for i in range(3)]) b = np.einsum(a, [0, 0, Ellipsis], [0, Ellipsis], optimize=do_opt) assert_(b.base is a) assert_equal(b, [a.transpose(2, 0, 1)[:, i, i] for i in range(3)]) b = np.einsum("i...i->i...", a, optimize=do_opt) assert_(b.base is a) assert_equal(b, [a.transpose(1, 0, 2)[:, i, i] for i in range(3)]) b = np.einsum(a, [0, Ellipsis, 0], [0, Ellipsis], optimize=do_opt) assert_(b.base is a) assert_equal(b, [a.transpose(1, 0, 2)[:, i, i] for i in range(3)]) b = np.einsum("i...i->...i", a, optimize=do_opt) assert_(b.base is a) assert_equal(b, [[x[i, i] for i in range(3)] for x in a.transpose(1, 0, 2)]) b = np.einsum(a, [0, Ellipsis, 0], [Ellipsis, 0], optimize=do_opt) assert_(b.base is a) assert_equal(b, [[x[i, i] for i in range(3)] for x in a.transpose(1, 0, 2)]) # triple diagonal a = np.arange(27) a.shape = (3, 3, 3) b = np.einsum("iii->i", a, optimize=do_opt) assert_(b.base is a) assert_equal(b, [a[i, i, i] for i in range(3)]) b = np.einsum(a, [0, 0, 0], [0], optimize=do_opt) assert_(b.base is a) assert_equal(b, [a[i, i, i] for i in range(3)]) # swap axes a = np.arange(24) a.shape = (2, 3, 4) b = np.einsum("ijk->jik", a, optimize=do_opt) assert_(b.base is a) assert_equal(b, a.swapaxes(0, 1)) b = np.einsum(a, [0, 1, 2], [1, 0, 2], optimize=do_opt) assert_(b.base is a) assert_equal(b, a.swapaxes(0, 1)) def check_einsum_sums(self, dtype, do_opt=False): # Check various sums. Does many sizes to exercise unrolled loops. # sum(a, axis=-1) for n in range(1, 17): a = np.arange(n, dtype=dtype) assert_equal(np.einsum("i->", a, optimize=do_opt), np.sum(a, axis=-1).astype(dtype)) assert_equal(np.einsum(a, [0], [], optimize=do_opt), np.sum(a, axis=-1).astype(dtype)) for n in range(1, 17): a = np.arange(2*3*n, dtype=dtype).reshape(2, 3, n) assert_equal(np.einsum("...i->...", a, optimize=do_opt), np.sum(a, axis=-1).astype(dtype)) assert_equal(np.einsum(a, [Ellipsis, 0], [Ellipsis], optimize=do_opt), np.sum(a, axis=-1).astype(dtype)) # sum(a, axis=0) for n in range(1, 17): a = np.arange(2*n, dtype=dtype).reshape(2, n) assert_equal(np.einsum("i...->...", a, optimize=do_opt), np.sum(a, axis=0).astype(dtype)) assert_equal(np.einsum(a, [0, Ellipsis], [Ellipsis], optimize=do_opt), np.sum(a, axis=0).astype(dtype)) for n in range(1, 17): a = np.arange(2*3*n, dtype=dtype).reshape(2, 3, n) assert_equal(np.einsum("i...->...", a, optimize=do_opt), np.sum(a, axis=0).astype(dtype)) assert_equal(np.einsum(a, [0, Ellipsis], [Ellipsis], optimize=do_opt), np.sum(a, axis=0).astype(dtype)) # trace(a) for n in range(1, 17): a = np.arange(n*n, dtype=dtype).reshape(n, n) assert_equal(np.einsum("ii", a, optimize=do_opt), np.trace(a).astype(dtype)) assert_equal(np.einsum(a, [0, 0], optimize=do_opt), np.trace(a).astype(dtype)) # multiply(a, b) assert_equal(np.einsum("..., ...", 3, 4), 12) # scalar case for n in range(1, 17): a = np.arange(3 * n, dtype=dtype).reshape(3, n) b = np.arange(2 * 3 * n, dtype=dtype).reshape(2, 3, n) assert_equal(np.einsum("..., ...", a, b, optimize=do_opt), np.multiply(a, b)) assert_equal(np.einsum(a, [Ellipsis], b, [Ellipsis], optimize=do_opt), np.multiply(a, b)) # inner(a,b) for n in range(1, 17): a = np.arange(2 * 3 * n, dtype=dtype).reshape(2, 3, n) b = np.arange(n, dtype=dtype) assert_equal(np.einsum("...i, ...i", a, b, optimize=do_opt), np.inner(a, b)) assert_equal(np.einsum(a, [Ellipsis, 0], b, [Ellipsis, 0], optimize=do_opt), np.inner(a, b)) for n in range(1, 11): a = np.arange(n * 3 * 2, dtype=dtype).reshape(n, 3, 2) b = np.arange(n, dtype=dtype) assert_equal(np.einsum("i..., i...", a, b, optimize=do_opt), np.inner(a.T, b.T).T) assert_equal(np.einsum(a, [0, Ellipsis], b, [0, Ellipsis], optimize=do_opt), np.inner(a.T, b.T).T) # outer(a,b) for n in range(1, 17): a = np.arange(3, dtype=dtype)+1 b = np.arange(n, dtype=dtype)+1 assert_equal(np.einsum("i,j", a, b, optimize=do_opt), np.outer(a, b)) assert_equal(np.einsum(a, [0], b, [1], optimize=do_opt), np.outer(a, b)) # Suppress the complex warnings for the 'as f8' tests with suppress_warnings() as sup: sup.filter(np.ComplexWarning) # matvec(a,b) / a.dot(b) where a is matrix, b is vector for n in range(1, 17): a = np.arange(4*n, dtype=dtype).reshape(4, n) b = np.arange(n, dtype=dtype) assert_equal(np.einsum("ij, j", a, b, optimize=do_opt), np.dot(a, b)) assert_equal(np.einsum(a, [0, 1], b, [1], optimize=do_opt), np.dot(a, b)) c = np.arange(4, dtype=dtype) np.einsum("ij,j", a, b, out=c, dtype='f8', casting='unsafe', optimize=do_opt) assert_equal(c, np.dot(a.astype('f8'), b.astype('f8')).astype(dtype)) c[...] = 0 np.einsum(a, [0, 1], b, [1], out=c, dtype='f8', casting='unsafe', optimize=do_opt) assert_equal(c, np.dot(a.astype('f8'), b.astype('f8')).astype(dtype)) for n in range(1, 17): a = np.arange(4*n, dtype=dtype).reshape(4, n) b = np.arange(n, dtype=dtype) assert_equal(np.einsum("ji,j", a.T, b.T, optimize=do_opt), np.dot(b.T, a.T)) assert_equal(np.einsum(a.T, [1, 0], b.T, [1], optimize=do_opt), np.dot(b.T, a.T)) c = np.arange(4, dtype=dtype) np.einsum("ji,j", a.T, b.T, out=c, dtype='f8', casting='unsafe', optimize=do_opt) assert_equal(c, np.dot(b.T.astype('f8'), a.T.astype('f8')).astype(dtype)) c[...] = 0 np.einsum(a.T, [1, 0], b.T, [1], out=c, dtype='f8', casting='unsafe', optimize=do_opt) assert_equal(c, np.dot(b.T.astype('f8'), a.T.astype('f8')).astype(dtype)) # matmat(a,b) / a.dot(b) where a is matrix, b is matrix for n in range(1, 17): if n < 8 or dtype != 'f2': a = np.arange(4*n, dtype=dtype).reshape(4, n) b = np.arange(n*6, dtype=dtype).reshape(n, 6) assert_equal(np.einsum("ij,jk", a, b, optimize=do_opt), np.dot(a, b)) assert_equal(np.einsum(a, [0, 1], b, [1, 2], optimize=do_opt), np.dot(a, b)) for n in range(1, 17): a = np.arange(4*n, dtype=dtype).reshape(4, n) b = np.arange(n*6, dtype=dtype).reshape(n, 6) c = np.arange(24, dtype=dtype).reshape(4, 6) np.einsum("ij,jk", a, b, out=c, dtype='f8', casting='unsafe', optimize=do_opt) assert_equal(c, np.dot(a.astype('f8'), b.astype('f8')).astype(dtype)) c[...] = 0 np.einsum(a, [0, 1], b, [1, 2], out=c, dtype='f8', casting='unsafe', optimize=do_opt) assert_equal(c, np.dot(a.astype('f8'), b.astype('f8')).astype(dtype)) # matrix triple product (note this is not currently an efficient # way to multiply 3 matrices) a = np.arange(12, dtype=dtype).reshape(3, 4) b = np.arange(20, dtype=dtype).reshape(4, 5) c = np.arange(30, dtype=dtype).reshape(5, 6) if dtype != 'f2': assert_equal(np.einsum("ij,jk,kl", a, b, c, optimize=do_opt), a.dot(b).dot(c)) assert_equal(np.einsum(a, [0, 1], b, [1, 2], c, [2, 3], optimize=do_opt), a.dot(b).dot(c)) d = np.arange(18, dtype=dtype).reshape(3, 6) np.einsum("ij,jk,kl", a, b, c, out=d, dtype='f8', casting='unsafe', optimize=do_opt) tgt = a.astype('f8').dot(b.astype('f8')) tgt = tgt.dot(c.astype('f8')).astype(dtype) assert_equal(d, tgt) d[...] = 0 np.einsum(a, [0, 1], b, [1, 2], c, [2, 3], out=d, dtype='f8', casting='unsafe', optimize=do_opt) tgt = a.astype('f8').dot(b.astype('f8')) tgt = tgt.dot(c.astype('f8')).astype(dtype) assert_equal(d, tgt) # tensordot(a, b) if np.dtype(dtype) != np.dtype('f2'): a = np.arange(60, dtype=dtype).reshape(3, 4, 5) b = np.arange(24, dtype=dtype).reshape(4, 3, 2) assert_equal(np.einsum("ijk, jil -> kl", a, b), np.tensordot(a, b, axes=([1, 0], [0, 1]))) assert_equal(np.einsum(a, [0, 1, 2], b, [1, 0, 3], [2, 3]), np.tensordot(a, b, axes=([1, 0], [0, 1]))) c = np.arange(10, dtype=dtype).reshape(5, 2) np.einsum("ijk,jil->kl", a, b, out=c, dtype='f8', casting='unsafe', optimize=do_opt) assert_equal(c, np.tensordot(a.astype('f8'), b.astype('f8'), axes=([1, 0], [0, 1])).astype(dtype)) c[...] = 0 np.einsum(a, [0, 1, 2], b, [1, 0, 3], [2, 3], out=c, dtype='f8', casting='unsafe', optimize=do_opt) assert_equal(c, np.tensordot(a.astype('f8'), b.astype('f8'), axes=([1, 0], [0, 1])).astype(dtype)) # logical_and(logical_and(a!=0, b!=0), c!=0) a = np.array([1, 3, -2, 0, 12, 13, 0, 1], dtype=dtype) b = np.array([0, 3.5, 0., -2, 0, 1, 3, 12], dtype=dtype) c = np.array([True, True, False, True, True, False, True, True]) assert_equal(np.einsum("i,i,i->i", a, b, c, dtype='?', casting='unsafe', optimize=do_opt), np.logical_and(np.logical_and(a != 0, b != 0), c != 0)) assert_equal(np.einsum(a, [0], b, [0], c, [0], [0], dtype='?', casting='unsafe'), np.logical_and(np.logical_and(a != 0, b != 0), c != 0)) a = np.arange(9, dtype=dtype) assert_equal(np.einsum(",i->", 3, a), 3*np.sum(a)) assert_equal(np.einsum(3, [], a, [0], []), 3*np.sum(a)) assert_equal(np.einsum("i,->", a, 3), 3*np.sum(a)) assert_equal(np.einsum(a, [0], 3, [], []), 3*np.sum(a)) # Various stride0, contiguous, and SSE aligned variants for n in range(1, 25): a = np.arange(n, dtype=dtype) if np.dtype(dtype).itemsize > 1: assert_equal(np.einsum("...,...", a, a, optimize=do_opt), np.multiply(a, a)) assert_equal(np.einsum("i,i", a, a, optimize=do_opt), np.dot(a, a)) assert_equal(np.einsum("i,->i", a, 2, optimize=do_opt), 2*a) assert_equal(np.einsum(",i->i", 2, a, optimize=do_opt), 2*a) assert_equal(np.einsum("i,->", a, 2, optimize=do_opt), 2*np.sum(a)) assert_equal(np.einsum(",i->", 2, a, optimize=do_opt), 2*np.sum(a)) assert_equal(np.einsum("...,...", a[1:], a[:-1], optimize=do_opt), np.multiply(a[1:], a[:-1])) assert_equal(np.einsum("i,i", a[1:], a[:-1], optimize=do_opt), np.dot(a[1:], a[:-1])) assert_equal(np.einsum("i,->i", a[1:], 2, optimize=do_opt), 2*a[1:]) assert_equal(np.einsum(",i->i", 2, a[1:], optimize=do_opt), 2*a[1:]) assert_equal(np.einsum("i,->", a[1:], 2, optimize=do_opt), 2*np.sum(a[1:])) assert_equal(np.einsum(",i->", 2, a[1:], optimize=do_opt), 2*np.sum(a[1:])) # An object array, summed as the data type a = np.arange(9, dtype=object) b = np.einsum("i->", a, dtype=dtype, casting='unsafe') assert_equal(b, np.sum(a)) assert_equal(b.dtype, np.dtype(dtype)) b = np.einsum(a, [0], [], dtype=dtype, casting='unsafe') assert_equal(b, np.sum(a)) assert_equal(b.dtype, np.dtype(dtype)) # A case which was failing (ticket #1885) p = np.arange(2) + 1 q = np.arange(4).reshape(2, 2) + 3 r = np.arange(4).reshape(2, 2) + 7 assert_equal(np.einsum('z,mz,zm->', p, q, r), 253) # singleton dimensions broadcast (gh-10343) p = np.ones((10,2)) q = np.ones((1,2)) assert_array_equal(np.einsum('ij,ij->j', p, q, optimize=True), np.einsum('ij,ij->j', p, q, optimize=False)) assert_array_equal(np.einsum('ij,ij->j', p, q, optimize=True), [10.] * 2) # a blas-compatible contraction broadcasting case which was failing # for optimize=True (ticket #10930) x = np.array([2., 3.]) y = np.array([4.]) assert_array_equal(np.einsum("i, i", x, y, optimize=False), 20.) assert_array_equal(np.einsum("i, i", x, y, optimize=True), 20.) # all-ones array was bypassing bug (ticket #10930) p = np.ones((1, 5)) / 2 q = np.ones((5, 5)) / 2 for optimize in (True, False): assert_array_equal(np.einsum("...ij,...jk->...ik", p, p, optimize=optimize), np.einsum("...ij,...jk->...ik", p, q, optimize=optimize)) assert_array_equal(np.einsum("...ij,...jk->...ik", p, q, optimize=optimize), np.full((1, 5), 1.25)) def test_einsum_sums_int8(self): self.check_einsum_sums('i1') def test_einsum_sums_uint8(self): self.check_einsum_sums('u1') def test_einsum_sums_int16(self): self.check_einsum_sums('i2') def test_einsum_sums_uint16(self): self.check_einsum_sums('u2') def test_einsum_sums_int32(self): self.check_einsum_sums('i4') self.check_einsum_sums('i4', True) def test_einsum_sums_uint32(self): self.check_einsum_sums('u4') self.check_einsum_sums('u4', True) def test_einsum_sums_int64(self): self.check_einsum_sums('i8') def test_einsum_sums_uint64(self): self.check_einsum_sums('u8') def test_einsum_sums_float16(self): self.check_einsum_sums('f2') def test_einsum_sums_float32(self): self.check_einsum_sums('f4') def test_einsum_sums_float64(self): self.check_einsum_sums('f8') self.check_einsum_sums('f8', True) def test_einsum_sums_longdouble(self): self.check_einsum_sums(np.longdouble) def test_einsum_sums_cfloat64(self): self.check_einsum_sums('c8') self.check_einsum_sums('c8', True) def test_einsum_sums_cfloat128(self): self.check_einsum_sums('c16') def test_einsum_sums_clongdouble(self): self.check_einsum_sums(np.clongdouble) def test_einsum_misc(self): # This call used to crash because of a bug in # PyArray_AssignZero a = np.ones((1, 2)) b = np.ones((2, 2, 1)) assert_equal(np.einsum('ij...,j...->i...', a, b), [[[2], [2]]]) assert_equal(np.einsum('ij...,j...->i...', a, b, optimize=True), [[[2], [2]]]) # Regression test for issue #10369 (test unicode inputs with Python 2) assert_equal(np.einsum(u'ij...,j...->i...', a, b), [[[2], [2]]]) assert_equal(np.einsum('...i,...i', [1, 2, 3], [2, 3, 4]), 20) assert_equal(np.einsum(u'...i,...i', [1, 2, 3], [2, 3, 4]), 20) assert_equal(np.einsum('...i,...i', [1, 2, 3], [2, 3, 4], optimize=u'greedy'), 20) # The iterator had an issue with buffering this reduction a = np.ones((5, 12, 4, 2, 3), np.int64) b = np.ones((5, 12, 11), np.int64) assert_equal(np.einsum('ijklm,ijn,ijn->', a, b, b), np.einsum('ijklm,ijn->', a, b)) assert_equal(np.einsum('ijklm,ijn,ijn->', a, b, b, optimize=True), np.einsum('ijklm,ijn->', a, b, optimize=True)) # Issue #2027, was a problem in the contiguous 3-argument # inner loop implementation a = np.arange(1, 3) b = np.arange(1, 5).reshape(2, 2) c = np.arange(1, 9).reshape(4, 2) assert_equal(np.einsum('x,yx,zx->xzy', a, b, c), [[[1, 3], [3, 9], [5, 15], [7, 21]], [[8, 16], [16, 32], [24, 48], [32, 64]]]) assert_equal(np.einsum('x,yx,zx->xzy', a, b, c, optimize=True), [[[1, 3], [3, 9], [5, 15], [7, 21]], [[8, 16], [16, 32], [24, 48], [32, 64]]]) def test_einsum_broadcast(self): # Issue #2455 change in handling ellipsis # remove the 'middle broadcast' error # only use the 'RIGHT' iteration in prepare_op_axes # adds auto broadcast on left where it belongs # broadcast on right has to be explicit # We need to test the optimized parsing as well A = np.arange(2 * 3 * 4).reshape(2, 3, 4) B = np.arange(3) ref = np.einsum('ijk,j->ijk', A, B, optimize=False) for opt in [True, False]: assert_equal(np.einsum('ij...,j...->ij...', A, B, optimize=opt), ref) assert_equal(np.einsum('ij...,...j->ij...', A, B, optimize=opt), ref) assert_equal(np.einsum('ij...,j->ij...', A, B, optimize=opt), ref) # used to raise error A = np.arange(12).reshape((4, 3)) B = np.arange(6).reshape((3, 2)) ref = np.einsum('ik,kj->ij', A, B, optimize=False) for opt in [True, False]: assert_equal(np.einsum('ik...,k...->i...', A, B, optimize=opt), ref) assert_equal(np.einsum('ik...,...kj->i...j', A, B, optimize=opt), ref) assert_equal(np.einsum('...k,kj', A, B, optimize=opt), ref) # used to raise error assert_equal(np.einsum('ik,k...->i...', A, B, optimize=opt), ref) # used to raise error dims = [2, 3, 4, 5] a = np.arange(np.prod(dims)).reshape(dims) v = np.arange(dims[2]) ref = np.einsum('ijkl,k->ijl', a, v, optimize=False) for opt in [True, False]: assert_equal(np.einsum('ijkl,k', a, v, optimize=opt), ref) assert_equal(np.einsum('...kl,k', a, v, optimize=opt), ref) # used to raise error assert_equal(np.einsum('...kl,k...', a, v, optimize=opt), ref) J, K, M = 160, 160, 120 A = np.arange(J * K * M).reshape(1, 1, 1, J, K, M) B = np.arange(J * K * M * 3).reshape(J, K, M, 3) ref = np.einsum('...lmn,...lmno->...o', A, B, optimize=False) for opt in [True, False]: assert_equal(np.einsum('...lmn,lmno->...o', A, B, optimize=opt), ref) # used to raise error def test_einsum_fixedstridebug(self): # Issue #4485 obscure einsum bug # This case revealed a bug in nditer where it reported a stride # as 'fixed' (0) when it was in fact not fixed during processing # (0 or 4). The reason for the bug was that the check for a fixed # stride was using the information from the 2D inner loop reuse # to restrict the iteration dimensions it had to validate to be # the same, but that 2D inner loop reuse logic is only triggered # during the buffer copying step, and hence it was invalid to # rely on those values. The fix is to check all the dimensions # of the stride in question, which in the test case reveals that # the stride is not fixed. # # NOTE: This test is triggered by the fact that the default buffersize, # used by einsum, is 8192, and 3*2731 = 8193, is larger than that # and results in a mismatch between the buffering and the # striding for operand A. A = np.arange(2 * 3).reshape(2, 3).astype(np.float32) B = np.arange(2 * 3 * 2731).reshape(2, 3, 2731).astype(np.int16) es = np.einsum('cl, cpx->lpx', A, B) tp = np.tensordot(A, B, axes=(0, 0)) assert_equal(es, tp) # The following is the original test case from the bug report, # made repeatable by changing random arrays to aranges. A = np.arange(3 * 3).reshape(3, 3).astype(np.float64) B = np.arange(3 * 3 * 64 * 64).reshape(3, 3, 64, 64).astype(np.float32) es = np.einsum('cl, cpxy->lpxy', A, B) tp = np.tensordot(A, B, axes=(0, 0)) assert_equal(es, tp) def test_einsum_fixed_collapsingbug(self): # Issue #5147. # The bug only occurred when output argument of einssum was used. x = np.random.normal(0, 1, (5, 5, 5, 5)) y1 = np.zeros((5, 5)) np.einsum('aabb->ab', x, out=y1) idx = np.arange(5) y2 = x[idx[:, None], idx[:, None], idx, idx] assert_equal(y1, y2) def test_einsum_all_contig_non_contig_output(self): # Issue gh-5907, tests that the all contiguous special case # actually checks the contiguity of the output x = np.ones((5, 5)) out = np.ones(10)[::2] correct_base = np.ones(10) correct_base[::2] = 5 # Always worked (inner iteration is done with 0-stride): np.einsum('mi,mi,mi->m', x, x, x, out=out) assert_array_equal(out.base, correct_base) # Example 1: out = np.ones(10)[::2] np.einsum('im,im,im->m', x, x, x, out=out) assert_array_equal(out.base, correct_base) # Example 2, buffering causes x to be contiguous but # special cases do not catch the operation before: out = np.ones((2, 2, 2))[..., 0] correct_base = np.ones((2, 2, 2)) correct_base[..., 0] = 2 x = np.ones((2, 2), np.float32) np.einsum('ij,jk->ik', x, x, out=out) assert_array_equal(out.base, correct_base) def test_small_boolean_arrays(self): # See gh-5946. # Use array of True embedded in False. a = np.zeros((16, 1, 1), dtype=np.bool_)[:2] a[...] = True out = np.zeros((16, 1, 1), dtype=np.bool_)[:2] tgt = np.ones((2, 1, 1), dtype=np.bool_) res = np.einsum('...ij,...jk->...ik', a, a, out=out) assert_equal(res, tgt) def optimize_compare(self, string): # Tests all paths of the optimization function against # conventional einsum operands = [string] terms = string.split('->')[0].split(',') for term in terms: dims = [global_size_dict[x] for x in term] operands.append(np.random.rand(*dims)) noopt = np.einsum(*operands, optimize=False) opt = np.einsum(*operands, optimize='greedy') assert_almost_equal(opt, noopt) opt = np.einsum(*operands, optimize='optimal') assert_almost_equal(opt, noopt) def test_hadamard_like_products(self): # Hadamard outer products self.optimize_compare('a,ab,abc->abc') self.optimize_compare('a,b,ab->ab') def test_index_transformations(self): # Simple index transformation cases self.optimize_compare('ea,fb,gc,hd,abcd->efgh') self.optimize_compare('ea,fb,abcd,gc,hd->efgh') self.optimize_compare('abcd,ea,fb,gc,hd->efgh') def test_complex(self): # Long test cases self.optimize_compare('acdf,jbje,gihb,hfac,gfac,gifabc,hfac') self.optimize_compare('acdf,jbje,gihb,hfac,gfac,gifabc,hfac') self.optimize_compare('cd,bdhe,aidb,hgca,gc,hgibcd,hgac') self.optimize_compare('abhe,hidj,jgba,hiab,gab') self.optimize_compare('bde,cdh,agdb,hica,ibd,hgicd,hiac') self.optimize_compare('chd,bde,agbc,hiad,hgc,hgi,hiad') self.optimize_compare('chd,bde,agbc,hiad,bdi,cgh,agdb') self.optimize_compare('bdhe,acad,hiab,agac,hibd') def test_collapse(self): # Inner products self.optimize_compare('ab,ab,c->') self.optimize_compare('ab,ab,c->c') self.optimize_compare('ab,ab,cd,cd->') self.optimize_compare('ab,ab,cd,cd->ac') self.optimize_compare('ab,ab,cd,cd->cd') self.optimize_compare('ab,ab,cd,cd,ef,ef->') def test_expand(self): # Outer products self.optimize_compare('ab,cd,ef->abcdef') self.optimize_compare('ab,cd,ef->acdf') self.optimize_compare('ab,cd,de->abcde') self.optimize_compare('ab,cd,de->be') self.optimize_compare('ab,bcd,cd->abcd') self.optimize_compare('ab,bcd,cd->abd') def test_edge_cases(self): # Difficult edge cases for optimization self.optimize_compare('eb,cb,fb->cef') self.optimize_compare('dd,fb,be,cdb->cef') self.optimize_compare('bca,cdb,dbf,afc->') self.optimize_compare('dcc,fce,ea,dbf->ab') self.optimize_compare('fdf,cdd,ccd,afe->ae') self.optimize_compare('abcd,ad') self.optimize_compare('ed,fcd,ff,bcf->be') self.optimize_compare('baa,dcf,af,cde->be') self.optimize_compare('bd,db,eac->ace') self.optimize_compare('fff,fae,bef,def->abd') self.optimize_compare('efc,dbc,acf,fd->abe') self.optimize_compare('ba,ac,da->bcd') def test_inner_product(self): # Inner products self.optimize_compare('ab,ab') self.optimize_compare('ab,ba') self.optimize_compare('abc,abc') self.optimize_compare('abc,bac') self.optimize_compare('abc,cba') def test_random_cases(self): # Randomly built test cases self.optimize_compare('aab,fa,df,ecc->bde') self.optimize_compare('ecb,fef,bad,ed->ac') self.optimize_compare('bcf,bbb,fbf,fc->') self.optimize_compare('bb,ff,be->e') self.optimize_compare('bcb,bb,fc,fff->') self.optimize_compare('fbb,dfd,fc,fc->') self.optimize_compare('afd,ba,cc,dc->bf') self.optimize_compare('adb,bc,fa,cfc->d') self.optimize_compare('bbd,bda,fc,db->acf') self.optimize_compare('dba,ead,cad->bce') self.optimize_compare('aef,fbc,dca->bde') class TestEinSumPath(object): def build_operands(self, string, size_dict=global_size_dict): # Builds views based off initial operands operands = [string] terms = string.split('->')[0].split(',') for term in terms: dims = [size_dict[x] for x in term] operands.append(np.random.rand(*dims)) return operands def assert_path_equal(self, comp, benchmark): # Checks if list of tuples are equivalent ret = (len(comp) == len(benchmark)) assert_(ret) for pos in range(len(comp) - 1): ret &= isinstance(comp[pos + 1], tuple) ret &= (comp[pos + 1] == benchmark[pos + 1]) assert_(ret) def test_memory_contraints(self): # Ensure memory constraints are satisfied outer_test = self.build_operands('a,b,c->abc') path, path_str = np.einsum_path(*outer_test, optimize=('greedy', 0)) self.assert_path_equal(path, ['einsum_path', (0, 1, 2)]) path, path_str = np.einsum_path(*outer_test, optimize=('optimal', 0)) self.assert_path_equal(path, ['einsum_path', (0, 1, 2)]) long_test = self.build_operands('acdf,jbje,gihb,hfac') path, path_str = np.einsum_path(*long_test, optimize=('greedy', 0)) self.assert_path_equal(path, ['einsum_path', (0, 1, 2, 3)]) path, path_str = np.einsum_path(*long_test, optimize=('optimal', 0)) self.assert_path_equal(path, ['einsum_path', (0, 1, 2, 3)]) def test_long_paths(self): # Long complex cases # Long test 1 long_test1 = self.build_operands('acdf,jbje,gihb,hfac,gfac,gifabc,hfac') path, path_str = np.einsum_path(*long_test1, optimize='greedy') self.assert_path_equal(path, ['einsum_path', (1, 4), (2, 4), (1, 4), (1, 3), (1, 2), (0, 1)]) path, path_str = np.einsum_path(*long_test1, optimize='optimal') self.assert_path_equal(path, ['einsum_path', (3, 6), (3, 4), (2, 4), (2, 3), (0, 2), (0, 1)]) # Long test 2 long_test2 = self.build_operands('chd,bde,agbc,hiad,bdi,cgh,agdb') path, path_str = np.einsum_path(*long_test2, optimize='greedy') self.assert_path_equal(path, ['einsum_path', (3, 4), (0, 3), (3, 4), (1, 3), (1, 2), (0, 1)]) path, path_str = np.einsum_path(*long_test2, optimize='optimal') self.assert_path_equal(path, ['einsum_path', (0, 5), (1, 4), (3, 4), (1, 3), (1, 2), (0, 1)]) def test_edge_paths(self): # Difficult edge cases # Edge test1 edge_test1 = self.build_operands('eb,cb,fb->cef') path, path_str = np.einsum_path(*edge_test1, optimize='greedy') self.assert_path_equal(path, ['einsum_path', (0, 2), (0, 1)]) path, path_str = np.einsum_path(*edge_test1, optimize='optimal') self.assert_path_equal(path, ['einsum_path', (0, 2), (0, 1)]) # Edge test2 edge_test2 = self.build_operands('dd,fb,be,cdb->cef') path, path_str = np.einsum_path(*edge_test2, optimize='greedy') self.assert_path_equal(path, ['einsum_path', (0, 3), (0, 1), (0, 1)]) path, path_str = np.einsum_path(*edge_test2, optimize='optimal') self.assert_path_equal(path, ['einsum_path', (0, 3), (0, 1), (0, 1)]) # Edge test3 edge_test3 = self.build_operands('bca,cdb,dbf,afc->') path, path_str = np.einsum_path(*edge_test3, optimize='greedy') self.assert_path_equal(path, ['einsum_path', (1, 2), (0, 2), (0, 1)]) path, path_str = np.einsum_path(*edge_test3, optimize='optimal') self.assert_path_equal(path, ['einsum_path', (1, 2), (0, 2), (0, 1)]) # Edge test4 edge_test4 = self.build_operands('dcc,fce,ea,dbf->ab') path, path_str = np.einsum_path(*edge_test4, optimize='greedy') self.assert_path_equal(path, ['einsum_path', (0, 3), (0, 2), (0, 1)]) path, path_str = np.einsum_path(*edge_test4, optimize='optimal') self.assert_path_equal(path, ['einsum_path', (1, 2), (0, 2), (0, 1)]) # Edge test5 edge_test4 = self.build_operands('a,ac,ab,ad,cd,bd,bc->', size_dict={"a": 20, "b": 20, "c": 20, "d": 20}) path, path_str = np.einsum_path(*edge_test4, optimize='greedy') self.assert_path_equal(path, ['einsum_path', (0, 1), (0, 1, 2, 3, 4, 5)]) path, path_str = np.einsum_path(*edge_test4, optimize='optimal') self.assert_path_equal(path, ['einsum_path', (0, 1), (0, 1, 2, 3, 4, 5)]) def test_path_type_input(self): # Test explicit path handeling path_test = self.build_operands('dcc,fce,ea,dbf->ab') path, path_str = np.einsum_path(*path_test, optimize=False) self.assert_path_equal(path, ['einsum_path', (0, 1, 2, 3)]) path, path_str = np.einsum_path(*path_test, optimize=True) self.assert_path_equal(path, ['einsum_path', (0, 3), (0, 2), (0, 1)]) exp_path = ['einsum_path', (0, 2), (0, 2), (0, 1)] path, path_str = np.einsum_path(*path_test, optimize=exp_path) self.assert_path_equal(path, exp_path) # Double check einsum works on the input path noopt = np.einsum(*path_test, optimize=False) opt = np.einsum(*path_test, optimize=exp_path) assert_almost_equal(noopt, opt) if __name__ == "__main__": run_module_suite()
41,230
43.23927
101
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_datetime.py
from __future__ import division, absolute_import, print_function import pickle import numpy import numpy as np import datetime from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_raises, assert_warns, dec, suppress_warnings ) # Use pytz to test out various time zones if available try: from pytz import timezone as tz _has_pytz = True except ImportError: _has_pytz = False class TestDateTime(object): def test_datetime_dtype_creation(self): for unit in ['Y', 'M', 'W', 'D', 'h', 'm', 's', 'ms', 'us', 'ns', 'ps', 'fs', 'as']: dt1 = np.dtype('M8[750%s]' % unit) assert_(dt1 == np.dtype('datetime64[750%s]' % unit)) dt2 = np.dtype('m8[%s]' % unit) assert_(dt2 == np.dtype('timedelta64[%s]' % unit)) # Generic units shouldn't add [] to the end assert_equal(str(np.dtype("M8")), "datetime64") # Should be possible to specify the endianness assert_equal(np.dtype("=M8"), np.dtype("M8")) assert_equal(np.dtype("=M8[s]"), np.dtype("M8[s]")) assert_(np.dtype(">M8") == np.dtype("M8") or np.dtype("<M8") == np.dtype("M8")) assert_(np.dtype(">M8[D]") == np.dtype("M8[D]") or np.dtype("<M8[D]") == np.dtype("M8[D]")) assert_(np.dtype(">M8") != np.dtype("<M8")) assert_equal(np.dtype("=m8"), np.dtype("m8")) assert_equal(np.dtype("=m8[s]"), np.dtype("m8[s]")) assert_(np.dtype(">m8") == np.dtype("m8") or np.dtype("<m8") == np.dtype("m8")) assert_(np.dtype(">m8[D]") == np.dtype("m8[D]") or np.dtype("<m8[D]") == np.dtype("m8[D]")) assert_(np.dtype(">m8") != np.dtype("<m8")) # Check that the parser rejects bad datetime types assert_raises(TypeError, np.dtype, 'M8[badunit]') assert_raises(TypeError, np.dtype, 'm8[badunit]') assert_raises(TypeError, np.dtype, 'M8[YY]') assert_raises(TypeError, np.dtype, 'm8[YY]') assert_raises(TypeError, np.dtype, 'm4') assert_raises(TypeError, np.dtype, 'M7') assert_raises(TypeError, np.dtype, 'm7') assert_raises(TypeError, np.dtype, 'M16') assert_raises(TypeError, np.dtype, 'm16') def test_datetime_casting_rules(self): # Cannot cast safely/same_kind between timedelta and datetime assert_(not np.can_cast('m8', 'M8', casting='same_kind')) assert_(not np.can_cast('M8', 'm8', casting='same_kind')) assert_(not np.can_cast('m8', 'M8', casting='safe')) assert_(not np.can_cast('M8', 'm8', casting='safe')) # Can cast safely/same_kind from integer to timedelta assert_(np.can_cast('i8', 'm8', casting='same_kind')) assert_(np.can_cast('i8', 'm8', casting='safe')) # Cannot cast safely/same_kind from float to timedelta assert_(not np.can_cast('f4', 'm8', casting='same_kind')) assert_(not np.can_cast('f4', 'm8', casting='safe')) # Cannot cast safely/same_kind from integer to datetime assert_(not np.can_cast('i8', 'M8', casting='same_kind')) assert_(not np.can_cast('i8', 'M8', casting='safe')) # Cannot cast safely/same_kind from bool to datetime assert_(not np.can_cast('b1', 'M8', casting='same_kind')) assert_(not np.can_cast('b1', 'M8', casting='safe')) # Can cast safely/same_kind from bool to timedelta assert_(np.can_cast('b1', 'm8', casting='same_kind')) assert_(np.can_cast('b1', 'm8', casting='safe')) # Can cast datetime safely from months/years to days assert_(np.can_cast('M8[M]', 'M8[D]', casting='safe')) assert_(np.can_cast('M8[Y]', 'M8[D]', casting='safe')) # Cannot cast timedelta safely from months/years to days assert_(not np.can_cast('m8[M]', 'm8[D]', casting='safe')) assert_(not np.can_cast('m8[Y]', 'm8[D]', casting='safe')) # Can cast datetime same_kind from months/years to days assert_(np.can_cast('M8[M]', 'M8[D]', casting='same_kind')) assert_(np.can_cast('M8[Y]', 'M8[D]', casting='same_kind')) # Can't cast timedelta same_kind from months/years to days assert_(not np.can_cast('m8[M]', 'm8[D]', casting='same_kind')) assert_(not np.can_cast('m8[Y]', 'm8[D]', casting='same_kind')) # Can cast datetime same_kind across the date/time boundary assert_(np.can_cast('M8[D]', 'M8[h]', casting='same_kind')) # Can cast timedelta same_kind across the date/time boundary assert_(np.can_cast('m8[D]', 'm8[h]', casting='same_kind')) assert_(np.can_cast('m8[h]', 'm8[D]', casting='same_kind')) # Cannot cast safely if the integer multiplier doesn't divide assert_(not np.can_cast('M8[7h]', 'M8[3h]', casting='safe')) assert_(not np.can_cast('M8[3h]', 'M8[6h]', casting='safe')) # But can cast same_kind assert_(np.can_cast('M8[7h]', 'M8[3h]', casting='same_kind')) # Can cast safely if the integer multiplier does divide assert_(np.can_cast('M8[6h]', 'M8[3h]', casting='safe')) # We can always cast types with generic units (corresponding to NaT) to # more specific types assert_(np.can_cast('m8', 'm8[h]', casting='same_kind')) assert_(np.can_cast('m8', 'm8[h]', casting='safe')) assert_(np.can_cast('M8', 'M8[h]', casting='same_kind')) assert_(np.can_cast('M8', 'M8[h]', casting='safe')) # but not the other way around assert_(not np.can_cast('m8[h]', 'm8', casting='same_kind')) assert_(not np.can_cast('m8[h]', 'm8', casting='safe')) assert_(not np.can_cast('M8[h]', 'M8', casting='same_kind')) assert_(not np.can_cast('M8[h]', 'M8', casting='safe')) def test_compare_generic_nat(self): # regression tests for GH6452 assert_equal(np.datetime64('NaT'), np.datetime64('2000') + np.timedelta64('NaT')) # nb. we may want to make NaT != NaT true in the future with suppress_warnings() as sup: sup.filter(FutureWarning, ".*NAT ==") assert_(np.datetime64('NaT') == np.datetime64('NaT', 'us')) assert_(np.datetime64('NaT', 'us') == np.datetime64('NaT')) def test_datetime_scalar_construction(self): # Construct with different units assert_equal(np.datetime64('1950-03-12', 'D'), np.datetime64('1950-03-12')) assert_equal(np.datetime64('1950-03-12T13', 's'), np.datetime64('1950-03-12T13', 'm')) # Default construction means NaT assert_equal(np.datetime64(), np.datetime64('NaT')) # Some basic strings and repr assert_equal(str(np.datetime64('NaT')), 'NaT') assert_equal(repr(np.datetime64('NaT')), "numpy.datetime64('NaT')") assert_equal(str(np.datetime64('2011-02')), '2011-02') assert_equal(repr(np.datetime64('2011-02')), "numpy.datetime64('2011-02')") # None gets constructed as NaT assert_equal(np.datetime64(None), np.datetime64('NaT')) # Default construction of NaT is in generic units assert_equal(np.datetime64().dtype, np.dtype('M8')) assert_equal(np.datetime64('NaT').dtype, np.dtype('M8')) # Construction from integers requires a specified unit assert_raises(ValueError, np.datetime64, 17) # When constructing from a scalar or zero-dimensional array, # it either keeps the units or you can override them. a = np.datetime64('2000-03-18T16', 'h') b = np.array('2000-03-18T16', dtype='M8[h]') assert_equal(a.dtype, np.dtype('M8[h]')) assert_equal(b.dtype, np.dtype('M8[h]')) assert_equal(np.datetime64(a), a) assert_equal(np.datetime64(a).dtype, np.dtype('M8[h]')) assert_equal(np.datetime64(b), a) assert_equal(np.datetime64(b).dtype, np.dtype('M8[h]')) assert_equal(np.datetime64(a, 's'), a) assert_equal(np.datetime64(a, 's').dtype, np.dtype('M8[s]')) assert_equal(np.datetime64(b, 's'), a) assert_equal(np.datetime64(b, 's').dtype, np.dtype('M8[s]')) # Construction from datetime.date assert_equal(np.datetime64('1945-03-25'), np.datetime64(datetime.date(1945, 3, 25))) assert_equal(np.datetime64('2045-03-25', 'D'), np.datetime64(datetime.date(2045, 3, 25), 'D')) # Construction from datetime.datetime assert_equal(np.datetime64('1980-01-25T14:36:22.5'), np.datetime64(datetime.datetime(1980, 1, 25, 14, 36, 22, 500000))) # Construction with time units from a date is okay assert_equal(np.datetime64('1920-03-13', 'h'), np.datetime64('1920-03-13T00')) assert_equal(np.datetime64('1920-03', 'm'), np.datetime64('1920-03-01T00:00')) assert_equal(np.datetime64('1920', 's'), np.datetime64('1920-01-01T00:00:00')) assert_equal(np.datetime64(datetime.date(2045, 3, 25), 'ms'), np.datetime64('2045-03-25T00:00:00.000')) # Construction with date units from a datetime is also okay assert_equal(np.datetime64('1920-03-13T18', 'D'), np.datetime64('1920-03-13')) assert_equal(np.datetime64('1920-03-13T18:33:12', 'M'), np.datetime64('1920-03')) assert_equal(np.datetime64('1920-03-13T18:33:12.5', 'Y'), np.datetime64('1920')) def test_datetime_scalar_construction_timezone(self): # verify that supplying an explicit timezone works, but is deprecated with assert_warns(DeprecationWarning): assert_equal(np.datetime64('2000-01-01T00Z'), np.datetime64('2000-01-01T00')) with assert_warns(DeprecationWarning): assert_equal(np.datetime64('2000-01-01T00-08'), np.datetime64('2000-01-01T08')) def test_datetime_array_find_type(self): dt = np.datetime64('1970-01-01', 'M') arr = np.array([dt]) assert_equal(arr.dtype, np.dtype('M8[M]')) # at the moment, we don't automatically convert these to datetime64 dt = datetime.date(1970, 1, 1) arr = np.array([dt]) assert_equal(arr.dtype, np.dtype('O')) dt = datetime.datetime(1970, 1, 1, 12, 30, 40) arr = np.array([dt]) assert_equal(arr.dtype, np.dtype('O')) # find "supertype" for non-dates and dates b = np.bool_(True) dt = np.datetime64('1970-01-01', 'M') arr = np.array([b, dt]) assert_equal(arr.dtype, np.dtype('O')) dt = datetime.date(1970, 1, 1) arr = np.array([b, dt]) assert_equal(arr.dtype, np.dtype('O')) dt = datetime.datetime(1970, 1, 1, 12, 30, 40) arr = np.array([b, dt]) assert_equal(arr.dtype, np.dtype('O')) def test_timedelta_scalar_construction(self): # Construct with different units assert_equal(np.timedelta64(7, 'D'), np.timedelta64(1, 'W')) assert_equal(np.timedelta64(120, 's'), np.timedelta64(2, 'm')) # Default construction means 0 assert_equal(np.timedelta64(), np.timedelta64(0)) # None gets constructed as NaT assert_equal(np.timedelta64(None), np.timedelta64('NaT')) # Some basic strings and repr assert_equal(str(np.timedelta64('NaT')), 'NaT') assert_equal(repr(np.timedelta64('NaT')), "numpy.timedelta64('NaT')") assert_equal(str(np.timedelta64(3, 's')), '3 seconds') assert_equal(repr(np.timedelta64(-3, 's')), "numpy.timedelta64(-3,'s')") assert_equal(repr(np.timedelta64(12)), "numpy.timedelta64(12)") # Construction from an integer produces generic units assert_equal(np.timedelta64(12).dtype, np.dtype('m8')) # When constructing from a scalar or zero-dimensional array, # it either keeps the units or you can override them. a = np.timedelta64(2, 'h') b = np.array(2, dtype='m8[h]') assert_equal(a.dtype, np.dtype('m8[h]')) assert_equal(b.dtype, np.dtype('m8[h]')) assert_equal(np.timedelta64(a), a) assert_equal(np.timedelta64(a).dtype, np.dtype('m8[h]')) assert_equal(np.timedelta64(b), a) assert_equal(np.timedelta64(b).dtype, np.dtype('m8[h]')) assert_equal(np.timedelta64(a, 's'), a) assert_equal(np.timedelta64(a, 's').dtype, np.dtype('m8[s]')) assert_equal(np.timedelta64(b, 's'), a) assert_equal(np.timedelta64(b, 's').dtype, np.dtype('m8[s]')) # Construction from datetime.timedelta assert_equal(np.timedelta64(5, 'D'), np.timedelta64(datetime.timedelta(days=5))) assert_equal(np.timedelta64(102347621, 's'), np.timedelta64(datetime.timedelta(seconds=102347621))) assert_equal(np.timedelta64(-10234760000, 'us'), np.timedelta64(datetime.timedelta( microseconds=-10234760000))) assert_equal(np.timedelta64(10234760000, 'us'), np.timedelta64(datetime.timedelta( microseconds=10234760000))) assert_equal(np.timedelta64(1023476, 'ms'), np.timedelta64(datetime.timedelta(milliseconds=1023476))) assert_equal(np.timedelta64(10, 'm'), np.timedelta64(datetime.timedelta(minutes=10))) assert_equal(np.timedelta64(281, 'h'), np.timedelta64(datetime.timedelta(hours=281))) assert_equal(np.timedelta64(28, 'W'), np.timedelta64(datetime.timedelta(weeks=28))) # Cannot construct across nonlinear time unit boundaries a = np.timedelta64(3, 's') assert_raises(TypeError, np.timedelta64, a, 'M') assert_raises(TypeError, np.timedelta64, a, 'Y') a = np.timedelta64(6, 'M') assert_raises(TypeError, np.timedelta64, a, 'D') assert_raises(TypeError, np.timedelta64, a, 'h') a = np.timedelta64(1, 'Y') assert_raises(TypeError, np.timedelta64, a, 'D') assert_raises(TypeError, np.timedelta64, a, 'm') def test_timedelta_scalar_construction_units(self): # String construction detecting units assert_equal(np.datetime64('2010').dtype, np.dtype('M8[Y]')) assert_equal(np.datetime64('2010-03').dtype, np.dtype('M8[M]')) assert_equal(np.datetime64('2010-03-12').dtype, np.dtype('M8[D]')) assert_equal(np.datetime64('2010-03-12T17').dtype, np.dtype('M8[h]')) assert_equal(np.datetime64('2010-03-12T17:15').dtype, np.dtype('M8[m]')) assert_equal(np.datetime64('2010-03-12T17:15:08').dtype, np.dtype('M8[s]')) assert_equal(np.datetime64('2010-03-12T17:15:08.1').dtype, np.dtype('M8[ms]')) assert_equal(np.datetime64('2010-03-12T17:15:08.12').dtype, np.dtype('M8[ms]')) assert_equal(np.datetime64('2010-03-12T17:15:08.123').dtype, np.dtype('M8[ms]')) assert_equal(np.datetime64('2010-03-12T17:15:08.1234').dtype, np.dtype('M8[us]')) assert_equal(np.datetime64('2010-03-12T17:15:08.12345').dtype, np.dtype('M8[us]')) assert_equal(np.datetime64('2010-03-12T17:15:08.123456').dtype, np.dtype('M8[us]')) assert_equal(np.datetime64('1970-01-01T00:00:02.1234567').dtype, np.dtype('M8[ns]')) assert_equal(np.datetime64('1970-01-01T00:00:02.12345678').dtype, np.dtype('M8[ns]')) assert_equal(np.datetime64('1970-01-01T00:00:02.123456789').dtype, np.dtype('M8[ns]')) assert_equal(np.datetime64('1970-01-01T00:00:02.1234567890').dtype, np.dtype('M8[ps]')) assert_equal(np.datetime64('1970-01-01T00:00:02.12345678901').dtype, np.dtype('M8[ps]')) assert_equal(np.datetime64('1970-01-01T00:00:02.123456789012').dtype, np.dtype('M8[ps]')) assert_equal(np.datetime64( '1970-01-01T00:00:02.1234567890123').dtype, np.dtype('M8[fs]')) assert_equal(np.datetime64( '1970-01-01T00:00:02.12345678901234').dtype, np.dtype('M8[fs]')) assert_equal(np.datetime64( '1970-01-01T00:00:02.123456789012345').dtype, np.dtype('M8[fs]')) assert_equal(np.datetime64( '1970-01-01T00:00:02.1234567890123456').dtype, np.dtype('M8[as]')) assert_equal(np.datetime64( '1970-01-01T00:00:02.12345678901234567').dtype, np.dtype('M8[as]')) assert_equal(np.datetime64( '1970-01-01T00:00:02.123456789012345678').dtype, np.dtype('M8[as]')) # Python date object assert_equal(np.datetime64(datetime.date(2010, 4, 16)).dtype, np.dtype('M8[D]')) # Python datetime object assert_equal(np.datetime64( datetime.datetime(2010, 4, 16, 13, 45, 18)).dtype, np.dtype('M8[us]')) # 'today' special value assert_equal(np.datetime64('today').dtype, np.dtype('M8[D]')) # 'now' special value assert_equal(np.datetime64('now').dtype, np.dtype('M8[s]')) def test_datetime_nat_casting(self): a = np.array('NaT', dtype='M8[D]') b = np.datetime64('NaT', '[D]') # Arrays assert_equal(a.astype('M8[s]'), np.array('NaT', dtype='M8[s]')) assert_equal(a.astype('M8[ms]'), np.array('NaT', dtype='M8[ms]')) assert_equal(a.astype('M8[M]'), np.array('NaT', dtype='M8[M]')) assert_equal(a.astype('M8[Y]'), np.array('NaT', dtype='M8[Y]')) assert_equal(a.astype('M8[W]'), np.array('NaT', dtype='M8[W]')) # Scalars -> Scalars assert_equal(np.datetime64(b, '[s]'), np.datetime64('NaT', '[s]')) assert_equal(np.datetime64(b, '[ms]'), np.datetime64('NaT', '[ms]')) assert_equal(np.datetime64(b, '[M]'), np.datetime64('NaT', '[M]')) assert_equal(np.datetime64(b, '[Y]'), np.datetime64('NaT', '[Y]')) assert_equal(np.datetime64(b, '[W]'), np.datetime64('NaT', '[W]')) # Arrays -> Scalars assert_equal(np.datetime64(a, '[s]'), np.datetime64('NaT', '[s]')) assert_equal(np.datetime64(a, '[ms]'), np.datetime64('NaT', '[ms]')) assert_equal(np.datetime64(a, '[M]'), np.datetime64('NaT', '[M]')) assert_equal(np.datetime64(a, '[Y]'), np.datetime64('NaT', '[Y]')) assert_equal(np.datetime64(a, '[W]'), np.datetime64('NaT', '[W]')) def test_days_creation(self): assert_equal(np.array('1599', dtype='M8[D]').astype('i8'), (1600-1970)*365 - (1972-1600)/4 + 3 - 365) assert_equal(np.array('1600', dtype='M8[D]').astype('i8'), (1600-1970)*365 - (1972-1600)/4 + 3) assert_equal(np.array('1601', dtype='M8[D]').astype('i8'), (1600-1970)*365 - (1972-1600)/4 + 3 + 366) assert_equal(np.array('1900', dtype='M8[D]').astype('i8'), (1900-1970)*365 - (1970-1900)//4) assert_equal(np.array('1901', dtype='M8[D]').astype('i8'), (1900-1970)*365 - (1970-1900)//4 + 365) assert_equal(np.array('1967', dtype='M8[D]').astype('i8'), -3*365 - 1) assert_equal(np.array('1968', dtype='M8[D]').astype('i8'), -2*365 - 1) assert_equal(np.array('1969', dtype='M8[D]').astype('i8'), -1*365) assert_equal(np.array('1970', dtype='M8[D]').astype('i8'), 0*365) assert_equal(np.array('1971', dtype='M8[D]').astype('i8'), 1*365) assert_equal(np.array('1972', dtype='M8[D]').astype('i8'), 2*365) assert_equal(np.array('1973', dtype='M8[D]').astype('i8'), 3*365 + 1) assert_equal(np.array('1974', dtype='M8[D]').astype('i8'), 4*365 + 1) assert_equal(np.array('2000', dtype='M8[D]').astype('i8'), (2000 - 1970)*365 + (2000 - 1972)//4) assert_equal(np.array('2001', dtype='M8[D]').astype('i8'), (2000 - 1970)*365 + (2000 - 1972)//4 + 366) assert_equal(np.array('2400', dtype='M8[D]').astype('i8'), (2400 - 1970)*365 + (2400 - 1972)//4 - 3) assert_equal(np.array('2401', dtype='M8[D]').astype('i8'), (2400 - 1970)*365 + (2400 - 1972)//4 - 3 + 366) assert_equal(np.array('1600-02-29', dtype='M8[D]').astype('i8'), (1600-1970)*365 - (1972-1600)//4 + 3 + 31 + 28) assert_equal(np.array('1600-03-01', dtype='M8[D]').astype('i8'), (1600-1970)*365 - (1972-1600)//4 + 3 + 31 + 29) assert_equal(np.array('2000-02-29', dtype='M8[D]').astype('i8'), (2000 - 1970)*365 + (2000 - 1972)//4 + 31 + 28) assert_equal(np.array('2000-03-01', dtype='M8[D]').astype('i8'), (2000 - 1970)*365 + (2000 - 1972)//4 + 31 + 29) assert_equal(np.array('2001-03-22', dtype='M8[D]').astype('i8'), (2000 - 1970)*365 + (2000 - 1972)//4 + 366 + 31 + 28 + 21) def test_days_to_pydate(self): assert_equal(np.array('1599', dtype='M8[D]').astype('O'), datetime.date(1599, 1, 1)) assert_equal(np.array('1600', dtype='M8[D]').astype('O'), datetime.date(1600, 1, 1)) assert_equal(np.array('1601', dtype='M8[D]').astype('O'), datetime.date(1601, 1, 1)) assert_equal(np.array('1900', dtype='M8[D]').astype('O'), datetime.date(1900, 1, 1)) assert_equal(np.array('1901', dtype='M8[D]').astype('O'), datetime.date(1901, 1, 1)) assert_equal(np.array('2000', dtype='M8[D]').astype('O'), datetime.date(2000, 1, 1)) assert_equal(np.array('2001', dtype='M8[D]').astype('O'), datetime.date(2001, 1, 1)) assert_equal(np.array('1600-02-29', dtype='M8[D]').astype('O'), datetime.date(1600, 2, 29)) assert_equal(np.array('1600-03-01', dtype='M8[D]').astype('O'), datetime.date(1600, 3, 1)) assert_equal(np.array('2001-03-22', dtype='M8[D]').astype('O'), datetime.date(2001, 3, 22)) def test_dtype_comparison(self): assert_(not (np.dtype('M8[us]') == np.dtype('M8[ms]'))) assert_(np.dtype('M8[us]') != np.dtype('M8[ms]')) assert_(np.dtype('M8[2D]') != np.dtype('M8[D]')) assert_(np.dtype('M8[D]') != np.dtype('M8[2D]')) def test_pydatetime_creation(self): a = np.array(['1960-03-12', datetime.date(1960, 3, 12)], dtype='M8[D]') assert_equal(a[0], a[1]) a = np.array(['1999-12-31', datetime.date(1999, 12, 31)], dtype='M8[D]') assert_equal(a[0], a[1]) a = np.array(['2000-01-01', datetime.date(2000, 1, 1)], dtype='M8[D]') assert_equal(a[0], a[1]) # Will fail if the date changes during the exact right moment a = np.array(['today', datetime.date.today()], dtype='M8[D]') assert_equal(a[0], a[1]) # datetime.datetime.now() returns local time, not UTC #a = np.array(['now', datetime.datetime.now()], dtype='M8[s]') #assert_equal(a[0], a[1]) # we can give a datetime.date time units assert_equal(np.array(datetime.date(1960, 3, 12), dtype='M8[s]'), np.array(np.datetime64('1960-03-12T00:00:00'))) def test_datetime_string_conversion(self): a = ['2011-03-16', '1920-01-01', '2013-05-19'] str_a = np.array(a, dtype='S') uni_a = np.array(a, dtype='U') dt_a = np.array(a, dtype='M') # String to datetime assert_equal(dt_a, str_a.astype('M')) assert_equal(dt_a.dtype, str_a.astype('M').dtype) dt_b = np.empty_like(dt_a) dt_b[...] = str_a assert_equal(dt_a, dt_b) # Datetime to string assert_equal(str_a, dt_a.astype('S0')) str_b = np.empty_like(str_a) str_b[...] = dt_a assert_equal(str_a, str_b) # Unicode to datetime assert_equal(dt_a, uni_a.astype('M')) assert_equal(dt_a.dtype, uni_a.astype('M').dtype) dt_b = np.empty_like(dt_a) dt_b[...] = uni_a assert_equal(dt_a, dt_b) # Datetime to unicode assert_equal(uni_a, dt_a.astype('U')) uni_b = np.empty_like(uni_a) uni_b[...] = dt_a assert_equal(uni_a, uni_b) # Datetime to long string - gh-9712 assert_equal(str_a, dt_a.astype((np.string_, 128))) str_b = np.empty(str_a.shape, dtype=(np.string_, 128)) str_b[...] = dt_a assert_equal(str_a, str_b) def test_datetime_array_str(self): a = np.array(['2011-03-16', '1920-01-01', '2013-05-19'], dtype='M') assert_equal(str(a), "['2011-03-16' '1920-01-01' '2013-05-19']") a = np.array(['2011-03-16T13:55', '1920-01-01T03:12'], dtype='M') assert_equal(np.array2string(a, separator=', ', formatter={'datetime': lambda x: "'%s'" % np.datetime_as_string(x, timezone='UTC')}), "['2011-03-16T13:55Z', '1920-01-01T03:12Z']") # Check that one NaT doesn't corrupt subsequent entries a = np.array(['2010', 'NaT', '2030']).astype('M') assert_equal(str(a), "['2010' 'NaT' '2030']") def test_timedelta_array_str(self): a = np.array([-1, 0, 100], dtype='m') assert_equal(str(a), "[ -1 0 100]") a = np.array(['NaT', 'NaT'], dtype='m') assert_equal(str(a), "['NaT' 'NaT']") # Check right-alignment with NaTs a = np.array([-1, 'NaT', 0], dtype='m') assert_equal(str(a), "[ -1 'NaT' 0]") a = np.array([-1, 'NaT', 1234567], dtype='m') assert_equal(str(a), "[ -1 'NaT' 1234567]") # Test with other byteorder: a = np.array([-1, 'NaT', 1234567], dtype='>m') assert_equal(str(a), "[ -1 'NaT' 1234567]") a = np.array([-1, 'NaT', 1234567], dtype='<m') assert_equal(str(a), "[ -1 'NaT' 1234567]") def test_pickle(self): # Check that pickle roundtripping works dt = np.dtype('M8[7D]') assert_equal(pickle.loads(pickle.dumps(dt)), dt) dt = np.dtype('M8[W]') assert_equal(pickle.loads(pickle.dumps(dt)), dt) # Check that loading pickles from 1.6 works pkl = b"cnumpy\ndtype\np0\n(S'M8'\np1\nI0\nI1\ntp2\nRp3\n" + \ b"(I4\nS'<'\np4\nNNNI-1\nI-1\nI0\n((dp5\n(S'D'\np6\n" + \ b"I7\nI1\nI1\ntp7\ntp8\ntp9\nb." assert_equal(pickle.loads(pkl), np.dtype('<M8[7D]')) pkl = b"cnumpy\ndtype\np0\n(S'M8'\np1\nI0\nI1\ntp2\nRp3\n" + \ b"(I4\nS'<'\np4\nNNNI-1\nI-1\nI0\n((dp5\n(S'W'\np6\n" + \ b"I1\nI1\nI1\ntp7\ntp8\ntp9\nb." assert_equal(pickle.loads(pkl), np.dtype('<M8[W]')) pkl = b"cnumpy\ndtype\np0\n(S'M8'\np1\nI0\nI1\ntp2\nRp3\n" + \ b"(I4\nS'>'\np4\nNNNI-1\nI-1\nI0\n((dp5\n(S'us'\np6\n" + \ b"I1\nI1\nI1\ntp7\ntp8\ntp9\nb." assert_equal(pickle.loads(pkl), np.dtype('>M8[us]')) def test_setstate(self): "Verify that datetime dtype __setstate__ can handle bad arguments" dt = np.dtype('>M8[us]') assert_raises(ValueError, dt.__setstate__, (4, '>', None, None, None, -1, -1, 0, 1)) assert_(dt.__reduce__()[2] == np.dtype('>M8[us]').__reduce__()[2]) assert_raises(TypeError, dt.__setstate__, (4, '>', None, None, None, -1, -1, 0, ({}, 'xxx'))) assert_(dt.__reduce__()[2] == np.dtype('>M8[us]').__reduce__()[2]) def test_dtype_promotion(self): # datetime <op> datetime computes the metadata gcd # timedelta <op> timedelta computes the metadata gcd for mM in ['m', 'M']: assert_equal( np.promote_types(np.dtype(mM+'8[2Y]'), np.dtype(mM+'8[2Y]')), np.dtype(mM+'8[2Y]')) assert_equal( np.promote_types(np.dtype(mM+'8[12Y]'), np.dtype(mM+'8[15Y]')), np.dtype(mM+'8[3Y]')) assert_equal( np.promote_types(np.dtype(mM+'8[62M]'), np.dtype(mM+'8[24M]')), np.dtype(mM+'8[2M]')) assert_equal( np.promote_types(np.dtype(mM+'8[1W]'), np.dtype(mM+'8[2D]')), np.dtype(mM+'8[1D]')) assert_equal( np.promote_types(np.dtype(mM+'8[W]'), np.dtype(mM+'8[13s]')), np.dtype(mM+'8[s]')) assert_equal( np.promote_types(np.dtype(mM+'8[13W]'), np.dtype(mM+'8[49s]')), np.dtype(mM+'8[7s]')) # timedelta <op> timedelta raises when there is no reasonable gcd assert_raises(TypeError, np.promote_types, np.dtype('m8[Y]'), np.dtype('m8[D]')) assert_raises(TypeError, np.promote_types, np.dtype('m8[M]'), np.dtype('m8[W]')) # timedelta <op> timedelta may overflow with big unit ranges assert_raises(OverflowError, np.promote_types, np.dtype('m8[W]'), np.dtype('m8[fs]')) assert_raises(OverflowError, np.promote_types, np.dtype('m8[s]'), np.dtype('m8[as]')) def test_cast_overflow(self): # gh-4486 def cast(): numpy.datetime64("1971-01-01 00:00:00.000000000000000").astype("<M8[D]") assert_raises(OverflowError, cast) def cast2(): numpy.datetime64("2014").astype("<M8[fs]") assert_raises(OverflowError, cast2) def test_pyobject_roundtrip(self): # All datetime types should be able to roundtrip through object a = np.array([0, 0, 0, 0, 0, 0, 0, 0, 0, -1020040340, -2942398, -1, 0, 1, 234523453, 1199164176], dtype=np.int64) # With date units for unit in ['M8[D]', 'M8[W]', 'M8[M]', 'M8[Y]']: b = a.copy().view(dtype=unit) b[0] = '-0001-01-01' b[1] = '-0001-12-31' b[2] = '0000-01-01' b[3] = '0001-01-01' b[4] = '1969-12-31' b[5] = '1970-01-01' b[6] = '9999-12-31' b[7] = '10000-01-01' b[8] = 'NaT' assert_equal(b.astype(object).astype(unit), b, "Error roundtripping unit %s" % unit) # With time units for unit in ['M8[as]', 'M8[16fs]', 'M8[ps]', 'M8[us]', 'M8[300as]', 'M8[20us]']: b = a.copy().view(dtype=unit) b[0] = '-0001-01-01T00' b[1] = '-0001-12-31T00' b[2] = '0000-01-01T00' b[3] = '0001-01-01T00' b[4] = '1969-12-31T23:59:59.999999' b[5] = '1970-01-01T00' b[6] = '9999-12-31T23:59:59.999999' b[7] = '10000-01-01T00' b[8] = 'NaT' assert_equal(b.astype(object).astype(unit), b, "Error roundtripping unit %s" % unit) def test_month_truncation(self): # Make sure that months are truncating correctly assert_equal(np.array('1945-03-01', dtype='M8[M]'), np.array('1945-03-31', dtype='M8[M]')) assert_equal(np.array('1969-11-01', dtype='M8[M]'), np.array('1969-11-30T23:59:59.99999', dtype='M').astype('M8[M]')) assert_equal(np.array('1969-12-01', dtype='M8[M]'), np.array('1969-12-31T23:59:59.99999', dtype='M').astype('M8[M]')) assert_equal(np.array('1970-01-01', dtype='M8[M]'), np.array('1970-01-31T23:59:59.99999', dtype='M').astype('M8[M]')) assert_equal(np.array('1980-02-01', dtype='M8[M]'), np.array('1980-02-29T23:59:59.99999', dtype='M').astype('M8[M]')) def test_different_unit_comparison(self): # Check some years with date units for unit1 in ['Y', 'M', 'D']: dt1 = np.dtype('M8[%s]' % unit1) for unit2 in ['Y', 'M', 'D']: dt2 = np.dtype('M8[%s]' % unit2) assert_equal(np.array('1945', dtype=dt1), np.array('1945', dtype=dt2)) assert_equal(np.array('1970', dtype=dt1), np.array('1970', dtype=dt2)) assert_equal(np.array('9999', dtype=dt1), np.array('9999', dtype=dt2)) assert_equal(np.array('10000', dtype=dt1), np.array('10000-01-01', dtype=dt2)) assert_equal(np.datetime64('1945', unit1), np.datetime64('1945', unit2)) assert_equal(np.datetime64('1970', unit1), np.datetime64('1970', unit2)) assert_equal(np.datetime64('9999', unit1), np.datetime64('9999', unit2)) assert_equal(np.datetime64('10000', unit1), np.datetime64('10000-01-01', unit2)) # Check some datetimes with time units for unit1 in ['6h', 'h', 'm', 's', '10ms', 'ms', 'us']: dt1 = np.dtype('M8[%s]' % unit1) for unit2 in ['h', 'm', 's', 'ms', 'us']: dt2 = np.dtype('M8[%s]' % unit2) assert_equal(np.array('1945-03-12T18', dtype=dt1), np.array('1945-03-12T18', dtype=dt2)) assert_equal(np.array('1970-03-12T18', dtype=dt1), np.array('1970-03-12T18', dtype=dt2)) assert_equal(np.array('9999-03-12T18', dtype=dt1), np.array('9999-03-12T18', dtype=dt2)) assert_equal(np.array('10000-01-01T00', dtype=dt1), np.array('10000-01-01T00', dtype=dt2)) assert_equal(np.datetime64('1945-03-12T18', unit1), np.datetime64('1945-03-12T18', unit2)) assert_equal(np.datetime64('1970-03-12T18', unit1), np.datetime64('1970-03-12T18', unit2)) assert_equal(np.datetime64('9999-03-12T18', unit1), np.datetime64('9999-03-12T18', unit2)) assert_equal(np.datetime64('10000-01-01T00', unit1), np.datetime64('10000-01-01T00', unit2)) # Check some days with units that won't overflow for unit1 in ['D', '12h', 'h', 'm', 's', '4s', 'ms', 'us']: dt1 = np.dtype('M8[%s]' % unit1) for unit2 in ['D', 'h', 'm', 's', 'ms', 'us']: dt2 = np.dtype('M8[%s]' % unit2) assert_(np.equal(np.array('1932-02-17', dtype='M').astype(dt1), np.array('1932-02-17T00:00:00', dtype='M').astype(dt2), casting='unsafe')) assert_(np.equal(np.array('10000-04-27', dtype='M').astype(dt1), np.array('10000-04-27T00:00:00', dtype='M').astype(dt2), casting='unsafe')) # Shouldn't be able to compare datetime and timedelta # TODO: Changing to 'same_kind' or 'safe' casting in the ufuncs by # default is needed to properly catch this kind of thing... a = np.array('2012-12-21', dtype='M8[D]') b = np.array(3, dtype='m8[D]') #assert_raises(TypeError, np.less, a, b) assert_raises(TypeError, np.less, a, b, casting='same_kind') def test_datetime_like(self): a = np.array([3], dtype='m8[4D]') b = np.array(['2012-12-21'], dtype='M8[D]') assert_equal(np.ones_like(a).dtype, a.dtype) assert_equal(np.zeros_like(a).dtype, a.dtype) assert_equal(np.empty_like(a).dtype, a.dtype) assert_equal(np.ones_like(b).dtype, b.dtype) assert_equal(np.zeros_like(b).dtype, b.dtype) assert_equal(np.empty_like(b).dtype, b.dtype) def test_datetime_unary(self): for tda, tdb, tdzero, tdone, tdmone in \ [ # One-dimensional arrays (np.array([3], dtype='m8[D]'), np.array([-3], dtype='m8[D]'), np.array([0], dtype='m8[D]'), np.array([1], dtype='m8[D]'), np.array([-1], dtype='m8[D]')), # NumPy scalars (np.timedelta64(3, '[D]'), np.timedelta64(-3, '[D]'), np.timedelta64(0, '[D]'), np.timedelta64(1, '[D]'), np.timedelta64(-1, '[D]'))]: # negative ufunc assert_equal(-tdb, tda) assert_equal((-tdb).dtype, tda.dtype) assert_equal(np.negative(tdb), tda) assert_equal(np.negative(tdb).dtype, tda.dtype) # positive ufunc assert_equal(np.positive(tda), tda) assert_equal(np.positive(tda).dtype, tda.dtype) assert_equal(np.positive(tdb), tdb) assert_equal(np.positive(tdb).dtype, tdb.dtype) # absolute ufunc assert_equal(np.absolute(tdb), tda) assert_equal(np.absolute(tdb).dtype, tda.dtype) # sign ufunc assert_equal(np.sign(tda), tdone) assert_equal(np.sign(tdb), tdmone) assert_equal(np.sign(tdzero), tdzero) assert_equal(np.sign(tda).dtype, tda.dtype) # The ufuncs always produce native-endian results assert_ def test_datetime_add(self): for dta, dtb, dtc, dtnat, tda, tdb, tdc in \ [ # One-dimensional arrays (np.array(['2012-12-21'], dtype='M8[D]'), np.array(['2012-12-24'], dtype='M8[D]'), np.array(['2012-12-21T11'], dtype='M8[h]'), np.array(['NaT'], dtype='M8[D]'), np.array([3], dtype='m8[D]'), np.array([11], dtype='m8[h]'), np.array([3*24 + 11], dtype='m8[h]')), # NumPy scalars (np.datetime64('2012-12-21', '[D]'), np.datetime64('2012-12-24', '[D]'), np.datetime64('2012-12-21T11', '[h]'), np.datetime64('NaT', '[D]'), np.timedelta64(3, '[D]'), np.timedelta64(11, '[h]'), np.timedelta64(3*24 + 11, '[h]'))]: # m8 + m8 assert_equal(tda + tdb, tdc) assert_equal((tda + tdb).dtype, np.dtype('m8[h]')) # m8 + bool assert_equal(tdb + True, tdb + 1) assert_equal((tdb + True).dtype, np.dtype('m8[h]')) # m8 + int assert_equal(tdb + 3*24, tdc) assert_equal((tdb + 3*24).dtype, np.dtype('m8[h]')) # bool + m8 assert_equal(False + tdb, tdb) assert_equal((False + tdb).dtype, np.dtype('m8[h]')) # int + m8 assert_equal(3*24 + tdb, tdc) assert_equal((3*24 + tdb).dtype, np.dtype('m8[h]')) # M8 + bool assert_equal(dta + True, dta + 1) assert_equal(dtnat + True, dtnat) assert_equal((dta + True).dtype, np.dtype('M8[D]')) # M8 + int assert_equal(dta + 3, dtb) assert_equal(dtnat + 3, dtnat) assert_equal((dta + 3).dtype, np.dtype('M8[D]')) # bool + M8 assert_equal(False + dta, dta) assert_equal(False + dtnat, dtnat) assert_equal((False + dta).dtype, np.dtype('M8[D]')) # int + M8 assert_equal(3 + dta, dtb) assert_equal(3 + dtnat, dtnat) assert_equal((3 + dta).dtype, np.dtype('M8[D]')) # M8 + m8 assert_equal(dta + tda, dtb) assert_equal(dtnat + tda, dtnat) assert_equal((dta + tda).dtype, np.dtype('M8[D]')) # m8 + M8 assert_equal(tda + dta, dtb) assert_equal(tda + dtnat, dtnat) assert_equal((tda + dta).dtype, np.dtype('M8[D]')) # In M8 + m8, the result goes to higher precision assert_equal(np.add(dta, tdb, casting='unsafe'), dtc) assert_equal(np.add(dta, tdb, casting='unsafe').dtype, np.dtype('M8[h]')) assert_equal(np.add(tdb, dta, casting='unsafe'), dtc) assert_equal(np.add(tdb, dta, casting='unsafe').dtype, np.dtype('M8[h]')) # M8 + M8 assert_raises(TypeError, np.add, dta, dtb) def test_datetime_subtract(self): for dta, dtb, dtc, dtd, dte, dtnat, tda, tdb, tdc in \ [ # One-dimensional arrays (np.array(['2012-12-21'], dtype='M8[D]'), np.array(['2012-12-24'], dtype='M8[D]'), np.array(['1940-12-24'], dtype='M8[D]'), np.array(['1940-12-24T00'], dtype='M8[h]'), np.array(['1940-12-23T13'], dtype='M8[h]'), np.array(['NaT'], dtype='M8[D]'), np.array([3], dtype='m8[D]'), np.array([11], dtype='m8[h]'), np.array([3*24 - 11], dtype='m8[h]')), # NumPy scalars (np.datetime64('2012-12-21', '[D]'), np.datetime64('2012-12-24', '[D]'), np.datetime64('1940-12-24', '[D]'), np.datetime64('1940-12-24T00', '[h]'), np.datetime64('1940-12-23T13', '[h]'), np.datetime64('NaT', '[D]'), np.timedelta64(3, '[D]'), np.timedelta64(11, '[h]'), np.timedelta64(3*24 - 11, '[h]'))]: # m8 - m8 assert_equal(tda - tdb, tdc) assert_equal((tda - tdb).dtype, np.dtype('m8[h]')) assert_equal(tdb - tda, -tdc) assert_equal((tdb - tda).dtype, np.dtype('m8[h]')) # m8 - bool assert_equal(tdc - True, tdc - 1) assert_equal((tdc - True).dtype, np.dtype('m8[h]')) # m8 - int assert_equal(tdc - 3*24, -tdb) assert_equal((tdc - 3*24).dtype, np.dtype('m8[h]')) # int - m8 assert_equal(False - tdb, -tdb) assert_equal((False - tdb).dtype, np.dtype('m8[h]')) # int - m8 assert_equal(3*24 - tdb, tdc) assert_equal((3*24 - tdb).dtype, np.dtype('m8[h]')) # M8 - bool assert_equal(dtb - True, dtb - 1) assert_equal(dtnat - True, dtnat) assert_equal((dtb - True).dtype, np.dtype('M8[D]')) # M8 - int assert_equal(dtb - 3, dta) assert_equal(dtnat - 3, dtnat) assert_equal((dtb - 3).dtype, np.dtype('M8[D]')) # M8 - m8 assert_equal(dtb - tda, dta) assert_equal(dtnat - tda, dtnat) assert_equal((dtb - tda).dtype, np.dtype('M8[D]')) # In M8 - m8, the result goes to higher precision assert_equal(np.subtract(dtc, tdb, casting='unsafe'), dte) assert_equal(np.subtract(dtc, tdb, casting='unsafe').dtype, np.dtype('M8[h]')) # M8 - M8 with different goes to higher precision assert_equal(np.subtract(dtc, dtd, casting='unsafe'), np.timedelta64(0, 'h')) assert_equal(np.subtract(dtc, dtd, casting='unsafe').dtype, np.dtype('m8[h]')) assert_equal(np.subtract(dtd, dtc, casting='unsafe'), np.timedelta64(0, 'h')) assert_equal(np.subtract(dtd, dtc, casting='unsafe').dtype, np.dtype('m8[h]')) # m8 - M8 assert_raises(TypeError, np.subtract, tda, dta) # bool - M8 assert_raises(TypeError, np.subtract, False, dta) # int - M8 assert_raises(TypeError, np.subtract, 3, dta) def test_datetime_multiply(self): for dta, tda, tdb, tdc in \ [ # One-dimensional arrays (np.array(['2012-12-21'], dtype='M8[D]'), np.array([6], dtype='m8[h]'), np.array([9], dtype='m8[h]'), np.array([12], dtype='m8[h]')), # NumPy scalars (np.datetime64('2012-12-21', '[D]'), np.timedelta64(6, '[h]'), np.timedelta64(9, '[h]'), np.timedelta64(12, '[h]'))]: # m8 * int assert_equal(tda * 2, tdc) assert_equal((tda * 2).dtype, np.dtype('m8[h]')) # int * m8 assert_equal(2 * tda, tdc) assert_equal((2 * tda).dtype, np.dtype('m8[h]')) # m8 * float assert_equal(tda * 1.5, tdb) assert_equal((tda * 1.5).dtype, np.dtype('m8[h]')) # float * m8 assert_equal(1.5 * tda, tdb) assert_equal((1.5 * tda).dtype, np.dtype('m8[h]')) # m8 * m8 assert_raises(TypeError, np.multiply, tda, tdb) # m8 * M8 assert_raises(TypeError, np.multiply, dta, tda) # M8 * m8 assert_raises(TypeError, np.multiply, tda, dta) # M8 * int assert_raises(TypeError, np.multiply, dta, 2) # int * M8 assert_raises(TypeError, np.multiply, 2, dta) # M8 * float assert_raises(TypeError, np.multiply, dta, 1.5) # float * M8 assert_raises(TypeError, np.multiply, 1.5, dta) # NaTs with suppress_warnings() as sup: sup.filter(RuntimeWarning, "invalid value encountered in multiply") nat = np.timedelta64('NaT') def check(a, b, res): assert_equal(a * b, res) assert_equal(b * a, res) for tp in (int, float): check(nat, tp(2), nat) check(nat, tp(0), nat) for f in (float('inf'), float('nan')): check(np.timedelta64(1), f, nat) check(np.timedelta64(0), f, nat) check(nat, f, nat) def test_datetime_divide(self): for dta, tda, tdb, tdc, tdd in \ [ # One-dimensional arrays (np.array(['2012-12-21'], dtype='M8[D]'), np.array([6], dtype='m8[h]'), np.array([9], dtype='m8[h]'), np.array([12], dtype='m8[h]'), np.array([6], dtype='m8[m]')), # NumPy scalars (np.datetime64('2012-12-21', '[D]'), np.timedelta64(6, '[h]'), np.timedelta64(9, '[h]'), np.timedelta64(12, '[h]'), np.timedelta64(6, '[m]'))]: # m8 / int assert_equal(tdc / 2, tda) assert_equal((tdc / 2).dtype, np.dtype('m8[h]')) # m8 / float assert_equal(tda / 0.5, tdc) assert_equal((tda / 0.5).dtype, np.dtype('m8[h]')) # m8 / m8 assert_equal(tda / tdb, 6.0 / 9.0) assert_equal(np.divide(tda, tdb), 6.0 / 9.0) assert_equal(np.true_divide(tda, tdb), 6.0 / 9.0) assert_equal(tdb / tda, 9.0 / 6.0) assert_equal((tda / tdb).dtype, np.dtype('f8')) assert_equal(tda / tdd, 60.0) assert_equal(tdd / tda, 1.0 / 60.0) # m8 // m8 assert_raises(TypeError, np.floor_divide, tda, tdb) # int / m8 assert_raises(TypeError, np.divide, 2, tdb) # float / m8 assert_raises(TypeError, np.divide, 0.5, tdb) # m8 / M8 assert_raises(TypeError, np.divide, dta, tda) # M8 / m8 assert_raises(TypeError, np.divide, tda, dta) # M8 / int assert_raises(TypeError, np.divide, dta, 2) # int / M8 assert_raises(TypeError, np.divide, 2, dta) # M8 / float assert_raises(TypeError, np.divide, dta, 1.5) # float / M8 assert_raises(TypeError, np.divide, 1.5, dta) # NaTs with suppress_warnings() as sup: sup.filter(RuntimeWarning, r".*encountered in true\_divide") nat = np.timedelta64('NaT') for tp in (int, float): assert_equal(np.timedelta64(1) / tp(0), nat) assert_equal(np.timedelta64(0) / tp(0), nat) assert_equal(nat / tp(0), nat) assert_equal(nat / tp(2), nat) # Division by inf assert_equal(np.timedelta64(1) / float('inf'), np.timedelta64(0)) assert_equal(np.timedelta64(0) / float('inf'), np.timedelta64(0)) assert_equal(nat / float('inf'), nat) # Division by nan assert_equal(np.timedelta64(1) / float('nan'), nat) assert_equal(np.timedelta64(0) / float('nan'), nat) assert_equal(nat / float('nan'), nat) def test_datetime_compare(self): # Test all the comparison operators a = np.datetime64('2000-03-12T18:00:00.000000') b = np.array(['2000-03-12T18:00:00.000000', '2000-03-12T17:59:59.999999', '2000-03-12T18:00:00.000001', '1970-01-11T12:00:00.909090', '2016-01-11T12:00:00.909090'], dtype='datetime64[us]') assert_equal(np.equal(a, b), [1, 0, 0, 0, 0]) assert_equal(np.not_equal(a, b), [0, 1, 1, 1, 1]) assert_equal(np.less(a, b), [0, 0, 1, 0, 1]) assert_equal(np.less_equal(a, b), [1, 0, 1, 0, 1]) assert_equal(np.greater(a, b), [0, 1, 0, 1, 0]) assert_equal(np.greater_equal(a, b), [1, 1, 0, 1, 0]) def test_datetime_compare_nat(self): dt_nat = np.datetime64('NaT', 'D') dt_other = np.datetime64('2000-01-01') td_nat = np.timedelta64('NaT', 'h') td_other = np.timedelta64(1, 'h') with suppress_warnings() as sup: # The assert warns contexts will again see the warning: sup.filter(FutureWarning, ".*NAT") for op in [np.equal, np.less, np.less_equal, np.greater, np.greater_equal]: if op(dt_nat, dt_nat): assert_warns(FutureWarning, op, dt_nat, dt_nat) if op(dt_nat, dt_other): assert_warns(FutureWarning, op, dt_nat, dt_other) if op(dt_other, dt_nat): assert_warns(FutureWarning, op, dt_other, dt_nat) if op(td_nat, td_nat): assert_warns(FutureWarning, op, td_nat, td_nat) if op(td_nat, td_other): assert_warns(FutureWarning, op, td_nat, td_other) if op(td_other, td_nat): assert_warns(FutureWarning, op, td_other, td_nat) assert_warns(FutureWarning, np.not_equal, dt_nat, dt_nat) assert_warns(FutureWarning, np.not_equal, td_nat, td_nat) with suppress_warnings() as sup: sup.record(FutureWarning) assert_(np.not_equal(dt_nat, dt_other)) assert_(np.not_equal(dt_other, dt_nat)) assert_(np.not_equal(td_nat, td_other)) assert_(np.not_equal(td_other, td_nat)) assert_equal(len(sup.log), 0) def test_datetime_futurewarning_once_nat(self): # Test that the futurewarning is only given once per inner loop arr1 = np.array(['NaT', 'NaT', '2000-01-01'] * 2, dtype='M8[s]') arr2 = np.array(['NaT', '2000-01-01', 'NaT'] * 2, dtype='M8[s]') # All except less, because for less it can't be wrong (NaT is min) for op in [np.equal, np.less, np.less_equal, np.greater, np.greater_equal]: with suppress_warnings() as sup: rec = sup.record(FutureWarning, ".*NAT") op(arr1, arr2) assert_(len(rec) == 1, "failed for {}".format(op)) def test_datetime_minmax(self): # The metadata of the result should become the GCD # of the operand metadata a = np.array('1999-03-12T13', dtype='M8[2m]') b = np.array('1999-03-12T12', dtype='M8[s]') assert_equal(np.minimum(a, b), b) assert_equal(np.minimum(a, b).dtype, np.dtype('M8[s]')) assert_equal(np.fmin(a, b), b) assert_equal(np.fmin(a, b).dtype, np.dtype('M8[s]')) assert_equal(np.maximum(a, b), a) assert_equal(np.maximum(a, b).dtype, np.dtype('M8[s]')) assert_equal(np.fmax(a, b), a) assert_equal(np.fmax(a, b).dtype, np.dtype('M8[s]')) # Viewed as integers, the comparison is opposite because # of the units chosen assert_equal(np.minimum(a.view('i8'), b.view('i8')), a.view('i8')) # Interaction with NaT a = np.array('1999-03-12T13', dtype='M8[2m]') dtnat = np.array('NaT', dtype='M8[h]') assert_equal(np.minimum(a, dtnat), a) assert_equal(np.minimum(dtnat, a), a) assert_equal(np.maximum(a, dtnat), a) assert_equal(np.maximum(dtnat, a), a) # Also do timedelta a = np.array(3, dtype='m8[h]') b = np.array(3*3600 - 3, dtype='m8[s]') assert_equal(np.minimum(a, b), b) assert_equal(np.minimum(a, b).dtype, np.dtype('m8[s]')) assert_equal(np.fmin(a, b), b) assert_equal(np.fmin(a, b).dtype, np.dtype('m8[s]')) assert_equal(np.maximum(a, b), a) assert_equal(np.maximum(a, b).dtype, np.dtype('m8[s]')) assert_equal(np.fmax(a, b), a) assert_equal(np.fmax(a, b).dtype, np.dtype('m8[s]')) # Viewed as integers, the comparison is opposite because # of the units chosen assert_equal(np.minimum(a.view('i8'), b.view('i8')), a.view('i8')) # should raise between datetime and timedelta # # TODO: Allowing unsafe casting by # default in ufuncs strikes again... :( a = np.array(3, dtype='m8[h]') b = np.array('1999-03-12T12', dtype='M8[s]') #assert_raises(TypeError, np.minimum, a, b) #assert_raises(TypeError, np.maximum, a, b) #assert_raises(TypeError, np.fmin, a, b) #assert_raises(TypeError, np.fmax, a, b) assert_raises(TypeError, np.minimum, a, b, casting='same_kind') assert_raises(TypeError, np.maximum, a, b, casting='same_kind') assert_raises(TypeError, np.fmin, a, b, casting='same_kind') assert_raises(TypeError, np.fmax, a, b, casting='same_kind') def test_hours(self): t = np.ones(3, dtype='M8[s]') t[0] = 60*60*24 + 60*60*10 assert_(t[0].item().hour == 10) def test_divisor_conversion_year(self): assert_(np.dtype('M8[Y/4]') == np.dtype('M8[3M]')) assert_(np.dtype('M8[Y/13]') == np.dtype('M8[4W]')) assert_(np.dtype('M8[3Y/73]') == np.dtype('M8[15D]')) def test_divisor_conversion_month(self): assert_(np.dtype('M8[M/2]') == np.dtype('M8[2W]')) assert_(np.dtype('M8[M/15]') == np.dtype('M8[2D]')) assert_(np.dtype('M8[3M/40]') == np.dtype('M8[54h]')) def test_divisor_conversion_week(self): assert_(np.dtype('m8[W/7]') == np.dtype('m8[D]')) assert_(np.dtype('m8[3W/14]') == np.dtype('m8[36h]')) assert_(np.dtype('m8[5W/140]') == np.dtype('m8[360m]')) def test_divisor_conversion_day(self): assert_(np.dtype('M8[D/12]') == np.dtype('M8[2h]')) assert_(np.dtype('M8[D/120]') == np.dtype('M8[12m]')) assert_(np.dtype('M8[3D/960]') == np.dtype('M8[270s]')) def test_divisor_conversion_hour(self): assert_(np.dtype('m8[h/30]') == np.dtype('m8[2m]')) assert_(np.dtype('m8[3h/300]') == np.dtype('m8[36s]')) def test_divisor_conversion_minute(self): assert_(np.dtype('m8[m/30]') == np.dtype('m8[2s]')) assert_(np.dtype('m8[3m/300]') == np.dtype('m8[600ms]')) def test_divisor_conversion_second(self): assert_(np.dtype('m8[s/100]') == np.dtype('m8[10ms]')) assert_(np.dtype('m8[3s/10000]') == np.dtype('m8[300us]')) def test_divisor_conversion_fs(self): assert_(np.dtype('M8[fs/100]') == np.dtype('M8[10as]')) assert_raises(ValueError, lambda: np.dtype('M8[3fs/10000]')) def test_divisor_conversion_as(self): assert_raises(ValueError, lambda: np.dtype('M8[as/10]')) def test_string_parser_variants(self): # Allow space instead of 'T' between date and time assert_equal(np.array(['1980-02-29T01:02:03'], np.dtype('M8[s]')), np.array(['1980-02-29 01:02:03'], np.dtype('M8[s]'))) # Allow negative years assert_equal(np.array(['-1980-02-29T01:02:03'], np.dtype('M8[s]')), np.array(['-1980-02-29 01:02:03'], np.dtype('M8[s]'))) # UTC specifier with assert_warns(DeprecationWarning): assert_equal( np.array(['-1980-02-29T01:02:03'], np.dtype('M8[s]')), np.array(['-1980-02-29 01:02:03Z'], np.dtype('M8[s]'))) # Time zone offset with assert_warns(DeprecationWarning): assert_equal( np.array(['1980-02-29T02:02:03'], np.dtype('M8[s]')), np.array(['1980-02-29 00:32:03-0130'], np.dtype('M8[s]'))) with assert_warns(DeprecationWarning): assert_equal( np.array(['1980-02-28T22:32:03'], np.dtype('M8[s]')), np.array(['1980-02-29 00:02:03+01:30'], np.dtype('M8[s]'))) with assert_warns(DeprecationWarning): assert_equal( np.array(['1980-02-29T02:32:03.506'], np.dtype('M8[s]')), np.array(['1980-02-29 00:32:03.506-02'], np.dtype('M8[s]'))) with assert_warns(DeprecationWarning): assert_equal(np.datetime64('1977-03-02T12:30-0230'), np.datetime64('1977-03-02T15:00')) def test_string_parser_error_check(self): # Arbitrary bad string assert_raises(ValueError, np.array, ['badvalue'], np.dtype('M8[us]')) # Character after year must be '-' assert_raises(ValueError, np.array, ['1980X'], np.dtype('M8[us]')) # Cannot have trailing '-' assert_raises(ValueError, np.array, ['1980-'], np.dtype('M8[us]')) # Month must be in range [1,12] assert_raises(ValueError, np.array, ['1980-00'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-13'], np.dtype('M8[us]')) # Month must have two digits assert_raises(ValueError, np.array, ['1980-1'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-1-02'], np.dtype('M8[us]')) # 'Mor' is not a valid month assert_raises(ValueError, np.array, ['1980-Mor'], np.dtype('M8[us]')) # Cannot have trailing '-' assert_raises(ValueError, np.array, ['1980-01-'], np.dtype('M8[us]')) # Day must be in range [1,len(month)] assert_raises(ValueError, np.array, ['1980-01-0'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-01-00'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-01-32'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1979-02-29'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-02-30'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-03-32'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-04-31'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-05-32'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-06-31'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-07-32'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-08-32'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-09-31'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-10-32'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-11-31'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-12-32'], np.dtype('M8[us]')) # Cannot have trailing characters assert_raises(ValueError, np.array, ['1980-02-03%'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-02-03 q'], np.dtype('M8[us]')) # Hours must be in range [0, 23] assert_raises(ValueError, np.array, ['1980-02-03 25'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-02-03T25'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-02-03 24:01'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-02-03T24:01'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-02-03 -1'], np.dtype('M8[us]')) # No trailing ':' assert_raises(ValueError, np.array, ['1980-02-03 01:'], np.dtype('M8[us]')) # Minutes must be in range [0, 59] assert_raises(ValueError, np.array, ['1980-02-03 01:-1'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-02-03 01:60'], np.dtype('M8[us]')) # No trailing ':' assert_raises(ValueError, np.array, ['1980-02-03 01:60:'], np.dtype('M8[us]')) # Seconds must be in range [0, 59] assert_raises(ValueError, np.array, ['1980-02-03 01:10:-1'], np.dtype('M8[us]')) assert_raises(ValueError, np.array, ['1980-02-03 01:01:60'], np.dtype('M8[us]')) # Timezone offset must within a reasonable range with assert_warns(DeprecationWarning): assert_raises(ValueError, np.array, ['1980-02-03 01:01:00+0661'], np.dtype('M8[us]')) with assert_warns(DeprecationWarning): assert_raises(ValueError, np.array, ['1980-02-03 01:01:00+2500'], np.dtype('M8[us]')) with assert_warns(DeprecationWarning): assert_raises(ValueError, np.array, ['1980-02-03 01:01:00-0070'], np.dtype('M8[us]')) with assert_warns(DeprecationWarning): assert_raises(ValueError, np.array, ['1980-02-03 01:01:00-3000'], np.dtype('M8[us]')) with assert_warns(DeprecationWarning): assert_raises(ValueError, np.array, ['1980-02-03 01:01:00-25:00'], np.dtype('M8[us]')) def test_creation_overflow(self): date = '1980-03-23 20:00:00' timesteps = np.array([date], dtype='datetime64[s]')[0].astype(np.int64) for unit in ['ms', 'us', 'ns']: timesteps *= 1000 x = np.array([date], dtype='datetime64[%s]' % unit) assert_equal(timesteps, x[0].astype(np.int64), err_msg='Datetime conversion error for unit %s' % unit) assert_equal(x[0].astype(np.int64), 322689600000000000) def test_datetime_as_string(self): # Check all the units with default string conversion date = '1959-10-13' datetime = '1959-10-13T12:34:56.789012345678901234' assert_equal(np.datetime_as_string(np.datetime64(date, 'Y')), '1959') assert_equal(np.datetime_as_string(np.datetime64(date, 'M')), '1959-10') assert_equal(np.datetime_as_string(np.datetime64(date, 'D')), '1959-10-13') assert_equal(np.datetime_as_string(np.datetime64(datetime, 'h')), '1959-10-13T12') assert_equal(np.datetime_as_string(np.datetime64(datetime, 'm')), '1959-10-13T12:34') assert_equal(np.datetime_as_string(np.datetime64(datetime, 's')), '1959-10-13T12:34:56') assert_equal(np.datetime_as_string(np.datetime64(datetime, 'ms')), '1959-10-13T12:34:56.789') assert_equal(np.datetime_as_string(np.datetime64(datetime, 'us')), '1959-10-13T12:34:56.789012') datetime = '1969-12-31T23:34:56.789012345678901234' assert_equal(np.datetime_as_string(np.datetime64(datetime, 'ns')), '1969-12-31T23:34:56.789012345') assert_equal(np.datetime_as_string(np.datetime64(datetime, 'ps')), '1969-12-31T23:34:56.789012345678') assert_equal(np.datetime_as_string(np.datetime64(datetime, 'fs')), '1969-12-31T23:34:56.789012345678901') datetime = '1969-12-31T23:59:57.789012345678901234' assert_equal(np.datetime_as_string(np.datetime64(datetime, 'as')), datetime) datetime = '1970-01-01T00:34:56.789012345678901234' assert_equal(np.datetime_as_string(np.datetime64(datetime, 'ns')), '1970-01-01T00:34:56.789012345') assert_equal(np.datetime_as_string(np.datetime64(datetime, 'ps')), '1970-01-01T00:34:56.789012345678') assert_equal(np.datetime_as_string(np.datetime64(datetime, 'fs')), '1970-01-01T00:34:56.789012345678901') datetime = '1970-01-01T00:00:05.789012345678901234' assert_equal(np.datetime_as_string(np.datetime64(datetime, 'as')), datetime) # String conversion with the unit= parameter a = np.datetime64('2032-07-18T12:23:34.123456', 'us') assert_equal(np.datetime_as_string(a, unit='Y', casting='unsafe'), '2032') assert_equal(np.datetime_as_string(a, unit='M', casting='unsafe'), '2032-07') assert_equal(np.datetime_as_string(a, unit='W', casting='unsafe'), '2032-07-18') assert_equal(np.datetime_as_string(a, unit='D', casting='unsafe'), '2032-07-18') assert_equal(np.datetime_as_string(a, unit='h'), '2032-07-18T12') assert_equal(np.datetime_as_string(a, unit='m'), '2032-07-18T12:23') assert_equal(np.datetime_as_string(a, unit='s'), '2032-07-18T12:23:34') assert_equal(np.datetime_as_string(a, unit='ms'), '2032-07-18T12:23:34.123') assert_equal(np.datetime_as_string(a, unit='us'), '2032-07-18T12:23:34.123456') assert_equal(np.datetime_as_string(a, unit='ns'), '2032-07-18T12:23:34.123456000') assert_equal(np.datetime_as_string(a, unit='ps'), '2032-07-18T12:23:34.123456000000') assert_equal(np.datetime_as_string(a, unit='fs'), '2032-07-18T12:23:34.123456000000000') assert_equal(np.datetime_as_string(a, unit='as'), '2032-07-18T12:23:34.123456000000000000') # unit='auto' parameter assert_equal(np.datetime_as_string( np.datetime64('2032-07-18T12:23:34.123456', 'us'), unit='auto'), '2032-07-18T12:23:34.123456') assert_equal(np.datetime_as_string( np.datetime64('2032-07-18T12:23:34.12', 'us'), unit='auto'), '2032-07-18T12:23:34.120') assert_equal(np.datetime_as_string( np.datetime64('2032-07-18T12:23:34', 'us'), unit='auto'), '2032-07-18T12:23:34') assert_equal(np.datetime_as_string( np.datetime64('2032-07-18T12:23:00', 'us'), unit='auto'), '2032-07-18T12:23') # 'auto' doesn't split up hour and minute assert_equal(np.datetime_as_string( np.datetime64('2032-07-18T12:00:00', 'us'), unit='auto'), '2032-07-18T12:00') assert_equal(np.datetime_as_string( np.datetime64('2032-07-18T00:00:00', 'us'), unit='auto'), '2032-07-18') # 'auto' doesn't split up the date assert_equal(np.datetime_as_string( np.datetime64('2032-07-01T00:00:00', 'us'), unit='auto'), '2032-07-01') assert_equal(np.datetime_as_string( np.datetime64('2032-01-01T00:00:00', 'us'), unit='auto'), '2032-01-01') @dec.skipif(not _has_pytz, "The pytz module is not available.") def test_datetime_as_string_timezone(self): # timezone='local' vs 'UTC' a = np.datetime64('2010-03-15T06:30', 'm') assert_equal(np.datetime_as_string(a), '2010-03-15T06:30') assert_equal(np.datetime_as_string(a, timezone='naive'), '2010-03-15T06:30') assert_equal(np.datetime_as_string(a, timezone='UTC'), '2010-03-15T06:30Z') assert_(np.datetime_as_string(a, timezone='local') != '2010-03-15T06:30') b = np.datetime64('2010-02-15T06:30', 'm') assert_equal(np.datetime_as_string(a, timezone=tz('US/Central')), '2010-03-15T01:30-0500') assert_equal(np.datetime_as_string(a, timezone=tz('US/Eastern')), '2010-03-15T02:30-0400') assert_equal(np.datetime_as_string(a, timezone=tz('US/Pacific')), '2010-03-14T23:30-0700') assert_equal(np.datetime_as_string(b, timezone=tz('US/Central')), '2010-02-15T00:30-0600') assert_equal(np.datetime_as_string(b, timezone=tz('US/Eastern')), '2010-02-15T01:30-0500') assert_equal(np.datetime_as_string(b, timezone=tz('US/Pacific')), '2010-02-14T22:30-0800') # Dates to strings with a timezone attached is disabled by default assert_raises(TypeError, np.datetime_as_string, a, unit='D', timezone=tz('US/Pacific')) # Check that we can print out the date in the specified time zone assert_equal(np.datetime_as_string(a, unit='D', timezone=tz('US/Pacific'), casting='unsafe'), '2010-03-14') assert_equal(np.datetime_as_string(b, unit='D', timezone=tz('US/Central'), casting='unsafe'), '2010-02-15') def test_datetime_arange(self): # With two datetimes provided as strings a = np.arange('2010-01-05', '2010-01-10', dtype='M8[D]') assert_equal(a.dtype, np.dtype('M8[D]')) assert_equal(a, np.array(['2010-01-05', '2010-01-06', '2010-01-07', '2010-01-08', '2010-01-09'], dtype='M8[D]')) a = np.arange('1950-02-10', '1950-02-06', -1, dtype='M8[D]') assert_equal(a.dtype, np.dtype('M8[D]')) assert_equal(a, np.array(['1950-02-10', '1950-02-09', '1950-02-08', '1950-02-07'], dtype='M8[D]')) # Unit should be detected as months here a = np.arange('1969-05', '1970-05', 2, dtype='M8') assert_equal(a.dtype, np.dtype('M8[M]')) assert_equal(a, np.datetime64('1969-05') + np.arange(12, step=2)) # datetime, integer|timedelta works as well # produces arange (start, start + stop) in this case a = np.arange('1969', 18, 3, dtype='M8') assert_equal(a.dtype, np.dtype('M8[Y]')) assert_equal(a, np.datetime64('1969') + np.arange(18, step=3)) a = np.arange('1969-12-19', 22, np.timedelta64(2), dtype='M8') assert_equal(a.dtype, np.dtype('M8[D]')) assert_equal(a, np.datetime64('1969-12-19') + np.arange(22, step=2)) # Step of 0 is disallowed assert_raises(ValueError, np.arange, np.datetime64('today'), np.datetime64('today') + 3, 0) # Promotion across nonlinear unit boundaries is disallowed assert_raises(TypeError, np.arange, np.datetime64('2011-03-01', 'D'), np.timedelta64(5, 'M')) assert_raises(TypeError, np.arange, np.datetime64('2012-02-03T14', 's'), np.timedelta64(5, 'Y')) def test_datetime_arange_no_dtype(self): d = np.array('2010-01-04', dtype="M8[D]") assert_equal(np.arange(d, d + 1), d) assert_raises(ValueError, np.arange, d) def test_timedelta_arange(self): a = np.arange(3, 10, dtype='m8') assert_equal(a.dtype, np.dtype('m8')) assert_equal(a, np.timedelta64(0) + np.arange(3, 10)) a = np.arange(np.timedelta64(3, 's'), 10, 2, dtype='m8') assert_equal(a.dtype, np.dtype('m8[s]')) assert_equal(a, np.timedelta64(0, 's') + np.arange(3, 10, 2)) # Step of 0 is disallowed assert_raises(ValueError, np.arange, np.timedelta64(0), np.timedelta64(5), 0) # Promotion across nonlinear unit boundaries is disallowed assert_raises(TypeError, np.arange, np.timedelta64(0, 'D'), np.timedelta64(5, 'M')) assert_raises(TypeError, np.arange, np.timedelta64(0, 'Y'), np.timedelta64(5, 'D')) def test_timedelta_arange_no_dtype(self): d = np.array(5, dtype="m8[D]") assert_equal(np.arange(d, d + 1), d) assert_raises(ValueError, np.arange, d) def test_datetime_maximum_reduce(self): a = np.array(['2010-01-02', '1999-03-14', '1833-03'], dtype='M8[D]') assert_equal(np.maximum.reduce(a).dtype, np.dtype('M8[D]')) assert_equal(np.maximum.reduce(a), np.datetime64('2010-01-02')) a = np.array([1, 4, 0, 7, 2], dtype='m8[s]') assert_equal(np.maximum.reduce(a).dtype, np.dtype('m8[s]')) assert_equal(np.maximum.reduce(a), np.timedelta64(7, 's')) def test_datetime_busday_offset(self): # First Monday in June assert_equal( np.busday_offset('2011-06', 0, roll='forward', weekmask='Mon'), np.datetime64('2011-06-06')) # Last Monday in June assert_equal( np.busday_offset('2011-07', -1, roll='forward', weekmask='Mon'), np.datetime64('2011-06-27')) assert_equal( np.busday_offset('2011-07', -1, roll='forward', weekmask='Mon'), np.datetime64('2011-06-27')) # Default M-F business days, different roll modes assert_equal(np.busday_offset('2010-08', 0, roll='backward'), np.datetime64('2010-07-30')) assert_equal(np.busday_offset('2010-08', 0, roll='preceding'), np.datetime64('2010-07-30')) assert_equal(np.busday_offset('2010-08', 0, roll='modifiedpreceding'), np.datetime64('2010-08-02')) assert_equal(np.busday_offset('2010-08', 0, roll='modifiedfollowing'), np.datetime64('2010-08-02')) assert_equal(np.busday_offset('2010-08', 0, roll='forward'), np.datetime64('2010-08-02')) assert_equal(np.busday_offset('2010-08', 0, roll='following'), np.datetime64('2010-08-02')) assert_equal(np.busday_offset('2010-10-30', 0, roll='following'), np.datetime64('2010-11-01')) assert_equal( np.busday_offset('2010-10-30', 0, roll='modifiedfollowing'), np.datetime64('2010-10-29')) assert_equal( np.busday_offset('2010-10-30', 0, roll='modifiedpreceding'), np.datetime64('2010-10-29')) assert_equal( np.busday_offset('2010-10-16', 0, roll='modifiedfollowing'), np.datetime64('2010-10-18')) assert_equal( np.busday_offset('2010-10-16', 0, roll='modifiedpreceding'), np.datetime64('2010-10-15')) # roll='raise' by default assert_raises(ValueError, np.busday_offset, '2011-06-04', 0) # Bigger offset values assert_equal(np.busday_offset('2006-02-01', 25), np.datetime64('2006-03-08')) assert_equal(np.busday_offset('2006-03-08', -25), np.datetime64('2006-02-01')) assert_equal(np.busday_offset('2007-02-25', 11, weekmask='SatSun'), np.datetime64('2007-04-07')) assert_equal(np.busday_offset('2007-04-07', -11, weekmask='SatSun'), np.datetime64('2007-02-25')) # NaT values when roll is not raise assert_equal(np.busday_offset(np.datetime64('NaT'), 1, roll='nat'), np.datetime64('NaT')) assert_equal(np.busday_offset(np.datetime64('NaT'), 1, roll='following'), np.datetime64('NaT')) assert_equal(np.busday_offset(np.datetime64('NaT'), 1, roll='preceding'), np.datetime64('NaT')) def test_datetime_busdaycalendar(self): # Check that it removes NaT, duplicates, and weekends # and sorts the result. bdd = np.busdaycalendar( holidays=['NaT', '2011-01-17', '2011-03-06', 'NaT', '2011-12-26', '2011-05-30', '2011-01-17']) assert_equal(bdd.holidays, np.array(['2011-01-17', '2011-05-30', '2011-12-26'], dtype='M8')) # Default M-F weekmask assert_equal(bdd.weekmask, np.array([1, 1, 1, 1, 1, 0, 0], dtype='?')) # Check string weekmask with varying whitespace. bdd = np.busdaycalendar(weekmask="Sun TueWed Thu\tFri") assert_equal(bdd.weekmask, np.array([0, 1, 1, 1, 1, 0, 1], dtype='?')) # Check length 7 0/1 string bdd = np.busdaycalendar(weekmask="0011001") assert_equal(bdd.weekmask, np.array([0, 0, 1, 1, 0, 0, 1], dtype='?')) # Check length 7 string weekmask. bdd = np.busdaycalendar(weekmask="Mon Tue") assert_equal(bdd.weekmask, np.array([1, 1, 0, 0, 0, 0, 0], dtype='?')) # All-zeros weekmask should raise assert_raises(ValueError, np.busdaycalendar, weekmask=[0, 0, 0, 0, 0, 0, 0]) # weekday names must be correct case assert_raises(ValueError, np.busdaycalendar, weekmask="satsun") # All-zeros weekmask should raise assert_raises(ValueError, np.busdaycalendar, weekmask="") # Invalid weekday name codes should raise assert_raises(ValueError, np.busdaycalendar, weekmask="Mon Tue We") assert_raises(ValueError, np.busdaycalendar, weekmask="Max") assert_raises(ValueError, np.busdaycalendar, weekmask="Monday Tue") def test_datetime_busday_holidays_offset(self): # With exactly one holiday assert_equal( np.busday_offset('2011-11-10', 1, holidays=['2011-11-11']), np.datetime64('2011-11-14')) assert_equal( np.busday_offset('2011-11-04', 5, holidays=['2011-11-11']), np.datetime64('2011-11-14')) assert_equal( np.busday_offset('2011-11-10', 5, holidays=['2011-11-11']), np.datetime64('2011-11-18')) assert_equal( np.busday_offset('2011-11-14', -1, holidays=['2011-11-11']), np.datetime64('2011-11-10')) assert_equal( np.busday_offset('2011-11-18', -5, holidays=['2011-11-11']), np.datetime64('2011-11-10')) assert_equal( np.busday_offset('2011-11-14', -5, holidays=['2011-11-11']), np.datetime64('2011-11-04')) # With the holiday appearing twice assert_equal( np.busday_offset('2011-11-10', 1, holidays=['2011-11-11', '2011-11-11']), np.datetime64('2011-11-14')) assert_equal( np.busday_offset('2011-11-14', -1, holidays=['2011-11-11', '2011-11-11']), np.datetime64('2011-11-10')) # With a NaT holiday assert_equal( np.busday_offset('2011-11-10', 1, holidays=['2011-11-11', 'NaT']), np.datetime64('2011-11-14')) assert_equal( np.busday_offset('2011-11-14', -1, holidays=['NaT', '2011-11-11']), np.datetime64('2011-11-10')) # With another holiday after assert_equal( np.busday_offset('2011-11-10', 1, holidays=['2011-11-11', '2011-11-24']), np.datetime64('2011-11-14')) assert_equal( np.busday_offset('2011-11-14', -1, holidays=['2011-11-11', '2011-11-24']), np.datetime64('2011-11-10')) # With another holiday before assert_equal( np.busday_offset('2011-11-10', 1, holidays=['2011-10-10', '2011-11-11']), np.datetime64('2011-11-14')) assert_equal( np.busday_offset('2011-11-14', -1, holidays=['2011-10-10', '2011-11-11']), np.datetime64('2011-11-10')) # With another holiday before and after assert_equal( np.busday_offset('2011-11-10', 1, holidays=['2011-10-10', '2011-11-11', '2011-11-24']), np.datetime64('2011-11-14')) assert_equal( np.busday_offset('2011-11-14', -1, holidays=['2011-10-10', '2011-11-11', '2011-11-24']), np.datetime64('2011-11-10')) # A bigger forward jump across more than one week/holiday holidays = ['2011-10-10', '2011-11-11', '2011-11-24', '2011-12-25', '2011-05-30', '2011-02-21', '2011-12-26', '2012-01-02'] bdd = np.busdaycalendar(weekmask='1111100', holidays=holidays) assert_equal( np.busday_offset('2011-10-03', 4, holidays=holidays), np.busday_offset('2011-10-03', 4)) assert_equal( np.busday_offset('2011-10-03', 5, holidays=holidays), np.busday_offset('2011-10-03', 5 + 1)) assert_equal( np.busday_offset('2011-10-03', 27, holidays=holidays), np.busday_offset('2011-10-03', 27 + 1)) assert_equal( np.busday_offset('2011-10-03', 28, holidays=holidays), np.busday_offset('2011-10-03', 28 + 2)) assert_equal( np.busday_offset('2011-10-03', 35, holidays=holidays), np.busday_offset('2011-10-03', 35 + 2)) assert_equal( np.busday_offset('2011-10-03', 36, holidays=holidays), np.busday_offset('2011-10-03', 36 + 3)) assert_equal( np.busday_offset('2011-10-03', 56, holidays=holidays), np.busday_offset('2011-10-03', 56 + 3)) assert_equal( np.busday_offset('2011-10-03', 57, holidays=holidays), np.busday_offset('2011-10-03', 57 + 4)) assert_equal( np.busday_offset('2011-10-03', 60, holidays=holidays), np.busday_offset('2011-10-03', 60 + 4)) assert_equal( np.busday_offset('2011-10-03', 61, holidays=holidays), np.busday_offset('2011-10-03', 61 + 5)) assert_equal( np.busday_offset('2011-10-03', 61, busdaycal=bdd), np.busday_offset('2011-10-03', 61 + 5)) # A bigger backward jump across more than one week/holiday assert_equal( np.busday_offset('2012-01-03', -1, holidays=holidays), np.busday_offset('2012-01-03', -1 - 1)) assert_equal( np.busday_offset('2012-01-03', -4, holidays=holidays), np.busday_offset('2012-01-03', -4 - 1)) assert_equal( np.busday_offset('2012-01-03', -5, holidays=holidays), np.busday_offset('2012-01-03', -5 - 2)) assert_equal( np.busday_offset('2012-01-03', -25, holidays=holidays), np.busday_offset('2012-01-03', -25 - 2)) assert_equal( np.busday_offset('2012-01-03', -26, holidays=holidays), np.busday_offset('2012-01-03', -26 - 3)) assert_equal( np.busday_offset('2012-01-03', -33, holidays=holidays), np.busday_offset('2012-01-03', -33 - 3)) assert_equal( np.busday_offset('2012-01-03', -34, holidays=holidays), np.busday_offset('2012-01-03', -34 - 4)) assert_equal( np.busday_offset('2012-01-03', -56, holidays=holidays), np.busday_offset('2012-01-03', -56 - 4)) assert_equal( np.busday_offset('2012-01-03', -57, holidays=holidays), np.busday_offset('2012-01-03', -57 - 5)) assert_equal( np.busday_offset('2012-01-03', -57, busdaycal=bdd), np.busday_offset('2012-01-03', -57 - 5)) # Can't supply both a weekmask/holidays and busdaycal assert_raises(ValueError, np.busday_offset, '2012-01-03', -15, weekmask='1111100', busdaycal=bdd) assert_raises(ValueError, np.busday_offset, '2012-01-03', -15, holidays=holidays, busdaycal=bdd) # Roll with the holidays assert_equal( np.busday_offset('2011-12-25', 0, roll='forward', holidays=holidays), np.datetime64('2011-12-27')) assert_equal( np.busday_offset('2011-12-26', 0, roll='forward', holidays=holidays), np.datetime64('2011-12-27')) assert_equal( np.busday_offset('2011-12-26', 0, roll='backward', holidays=holidays), np.datetime64('2011-12-23')) assert_equal( np.busday_offset('2012-02-27', 0, roll='modifiedfollowing', holidays=['2012-02-27', '2012-02-26', '2012-02-28', '2012-03-01', '2012-02-29']), np.datetime64('2012-02-24')) assert_equal( np.busday_offset('2012-03-06', 0, roll='modifiedpreceding', holidays=['2012-03-02', '2012-03-03', '2012-03-01', '2012-03-05', '2012-03-07', '2012-03-06']), np.datetime64('2012-03-08')) def test_datetime_busday_holidays_count(self): holidays = ['2011-01-01', '2011-10-10', '2011-11-11', '2011-11-24', '2011-12-25', '2011-05-30', '2011-02-21', '2011-01-17', '2011-12-26', '2012-01-02', '2011-02-21', '2011-05-30', '2011-07-01', '2011-07-04', '2011-09-05', '2011-10-10'] bdd = np.busdaycalendar(weekmask='1111100', holidays=holidays) # Validate against busday_offset broadcast against # a range of offsets dates = np.busday_offset('2011-01-01', np.arange(366), roll='forward', busdaycal=bdd) assert_equal(np.busday_count('2011-01-01', dates, busdaycal=bdd), np.arange(366)) # Returns negative value when reversed assert_equal(np.busday_count(dates, '2011-01-01', busdaycal=bdd), -np.arange(366)) dates = np.busday_offset('2011-12-31', -np.arange(366), roll='forward', busdaycal=bdd) assert_equal(np.busday_count(dates, '2011-12-31', busdaycal=bdd), np.arange(366)) # Returns negative value when reversed assert_equal(np.busday_count('2011-12-31', dates, busdaycal=bdd), -np.arange(366)) # Can't supply both a weekmask/holidays and busdaycal assert_raises(ValueError, np.busday_offset, '2012-01-03', '2012-02-03', weekmask='1111100', busdaycal=bdd) assert_raises(ValueError, np.busday_offset, '2012-01-03', '2012-02-03', holidays=holidays, busdaycal=bdd) # Number of Mondays in March 2011 assert_equal(np.busday_count('2011-03', '2011-04', weekmask='Mon'), 4) # Returns negative value when reversed assert_equal(np.busday_count('2011-04', '2011-03', weekmask='Mon'), -4) def test_datetime_is_busday(self): holidays = ['2011-01-01', '2011-10-10', '2011-11-11', '2011-11-24', '2011-12-25', '2011-05-30', '2011-02-21', '2011-01-17', '2011-12-26', '2012-01-02', '2011-02-21', '2011-05-30', '2011-07-01', '2011-07-04', '2011-09-05', '2011-10-10', 'NaT'] bdd = np.busdaycalendar(weekmask='1111100', holidays=holidays) # Weekend/weekday tests assert_equal(np.is_busday('2011-01-01'), False) assert_equal(np.is_busday('2011-01-02'), False) assert_equal(np.is_busday('2011-01-03'), True) # All the holidays are not business days assert_equal(np.is_busday(holidays, busdaycal=bdd), np.zeros(len(holidays), dtype='?')) def test_datetime_y2038(self): # Test parsing on either side of the Y2038 boundary a = np.datetime64('2038-01-19T03:14:07') assert_equal(a.view(np.int64), 2**31 - 1) a = np.datetime64('2038-01-19T03:14:08') assert_equal(a.view(np.int64), 2**31) # Test parsing on either side of the Y2038 boundary with # a manually specified timezone offset with assert_warns(DeprecationWarning): a = np.datetime64('2038-01-19T04:14:07+0100') assert_equal(a.view(np.int64), 2**31 - 1) with assert_warns(DeprecationWarning): a = np.datetime64('2038-01-19T04:14:08+0100') assert_equal(a.view(np.int64), 2**31) # Test parsing a date after Y2038 a = np.datetime64('2038-01-20T13:21:14') assert_equal(str(a), '2038-01-20T13:21:14') def test_isnat(self): assert_(np.isnat(np.datetime64('NaT', 'ms'))) assert_(np.isnat(np.datetime64('NaT', 'ns'))) assert_(not np.isnat(np.datetime64('2038-01-19T03:14:07'))) assert_(np.isnat(np.timedelta64('NaT', "ms"))) assert_(not np.isnat(np.timedelta64(34, "ms"))) res = np.array([False, False, True]) for unit in ['Y', 'M', 'W', 'D', 'h', 'm', 's', 'ms', 'us', 'ns', 'ps', 'fs', 'as']: arr = np.array([123, -321, "NaT"], dtype='<datetime64[%s]' % unit) assert_equal(np.isnat(arr), res) arr = np.array([123, -321, "NaT"], dtype='>datetime64[%s]' % unit) assert_equal(np.isnat(arr), res) arr = np.array([123, -321, "NaT"], dtype='<timedelta64[%s]' % unit) assert_equal(np.isnat(arr), res) arr = np.array([123, -321, "NaT"], dtype='>timedelta64[%s]' % unit) assert_equal(np.isnat(arr), res) def test_isnat_error(self): # Test that only datetime dtype arrays are accepted for t in np.typecodes["All"]: if t in np.typecodes["Datetime"]: continue assert_raises(TypeError, np.isnat, np.zeros(10, t)) class TestDateTimeData(object): def test_basic(self): a = np.array(['1980-03-23'], dtype=np.datetime64) assert_equal(np.datetime_data(a.dtype), ('D', 1)) if __name__ == "__main__": run_module_suite()
93,390
46.238746
101
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_ufunc.py
from __future__ import division, absolute_import, print_function import warnings import itertools import numpy as np import numpy.core.umath_tests as umt import numpy.core.operand_flag_tests as opflag_tests from numpy.core.test_rational import rational, test_add, test_add_rationals from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_raises, assert_array_equal, assert_almost_equal, assert_array_almost_equal, assert_no_warnings, assert_allclose, ) class TestUfuncKwargs(object): def test_kwarg_exact(self): assert_raises(TypeError, np.add, 1, 2, castingx='safe') assert_raises(TypeError, np.add, 1, 2, dtypex=int) assert_raises(TypeError, np.add, 1, 2, extobjx=[4096]) assert_raises(TypeError, np.add, 1, 2, outx=None) assert_raises(TypeError, np.add, 1, 2, sigx='ii->i') assert_raises(TypeError, np.add, 1, 2, signaturex='ii->i') assert_raises(TypeError, np.add, 1, 2, subokx=False) assert_raises(TypeError, np.add, 1, 2, wherex=[True]) def test_sig_signature(self): assert_raises(ValueError, np.add, 1, 2, sig='ii->i', signature='ii->i') def test_sig_dtype(self): assert_raises(RuntimeError, np.add, 1, 2, sig='ii->i', dtype=int) assert_raises(RuntimeError, np.add, 1, 2, signature='ii->i', dtype=int) class TestUfunc(object): def test_pickle(self): import pickle assert_(pickle.loads(pickle.dumps(np.sin)) is np.sin) # Check that ufunc not defined in the top level numpy namespace such as # numpy.core.test_rational.test_add can also be pickled assert_(pickle.loads(pickle.dumps(test_add)) is test_add) def test_pickle_withstring(self): import pickle astring = (b"cnumpy.core\n_ufunc_reconstruct\np0\n" b"(S'numpy.core.umath'\np1\nS'cos'\np2\ntp3\nRp4\n.") assert_(pickle.loads(astring) is np.cos) def test_reduceat_shifting_sum(self): L = 6 x = np.arange(L) idx = np.array(list(zip(np.arange(L - 2), np.arange(L - 2) + 2))).ravel() assert_array_equal(np.add.reduceat(x, idx)[::2], [1, 3, 5, 7]) def test_generic_loops(self): """Test generic loops. The loops to be tested are: PyUFunc_ff_f_As_dd_d PyUFunc_ff_f PyUFunc_dd_d PyUFunc_gg_g PyUFunc_FF_F_As_DD_D PyUFunc_DD_D PyUFunc_FF_F PyUFunc_GG_G PyUFunc_OO_O PyUFunc_OO_O_method PyUFunc_f_f_As_d_d PyUFunc_d_d PyUFunc_f_f PyUFunc_g_g PyUFunc_F_F_As_D_D PyUFunc_F_F PyUFunc_D_D PyUFunc_G_G PyUFunc_O_O PyUFunc_O_O_method PyUFunc_On_Om Where: f -- float d -- double g -- long double F -- complex float D -- complex double G -- complex long double O -- python object It is difficult to assure that each of these loops is entered from the Python level as the special cased loops are a moving target and the corresponding types are architecture dependent. We probably need to define C level testing ufuncs to get at them. For the time being, I've just looked at the signatures registered in the build directory to find relevant functions. Fixme, currently untested: PyUFunc_ff_f_As_dd_d PyUFunc_FF_F_As_DD_D PyUFunc_f_f_As_d_d PyUFunc_F_F_As_D_D PyUFunc_On_Om """ fone = np.exp ftwo = lambda x, y: x**y fone_val = 1 ftwo_val = 1 # check unary PyUFunc_f_f. msg = "PyUFunc_f_f" x = np.zeros(10, dtype=np.single)[0::2] assert_almost_equal(fone(x), fone_val, err_msg=msg) # check unary PyUFunc_d_d. msg = "PyUFunc_d_d" x = np.zeros(10, dtype=np.double)[0::2] assert_almost_equal(fone(x), fone_val, err_msg=msg) # check unary PyUFunc_g_g. msg = "PyUFunc_g_g" x = np.zeros(10, dtype=np.longdouble)[0::2] assert_almost_equal(fone(x), fone_val, err_msg=msg) # check unary PyUFunc_F_F. msg = "PyUFunc_F_F" x = np.zeros(10, dtype=np.csingle)[0::2] assert_almost_equal(fone(x), fone_val, err_msg=msg) # check unary PyUFunc_D_D. msg = "PyUFunc_D_D" x = np.zeros(10, dtype=np.cdouble)[0::2] assert_almost_equal(fone(x), fone_val, err_msg=msg) # check unary PyUFunc_G_G. msg = "PyUFunc_G_G" x = np.zeros(10, dtype=np.clongdouble)[0::2] assert_almost_equal(fone(x), fone_val, err_msg=msg) # check binary PyUFunc_ff_f. msg = "PyUFunc_ff_f" x = np.ones(10, dtype=np.single)[0::2] assert_almost_equal(ftwo(x, x), ftwo_val, err_msg=msg) # check binary PyUFunc_dd_d. msg = "PyUFunc_dd_d" x = np.ones(10, dtype=np.double)[0::2] assert_almost_equal(ftwo(x, x), ftwo_val, err_msg=msg) # check binary PyUFunc_gg_g. msg = "PyUFunc_gg_g" x = np.ones(10, dtype=np.longdouble)[0::2] assert_almost_equal(ftwo(x, x), ftwo_val, err_msg=msg) # check binary PyUFunc_FF_F. msg = "PyUFunc_FF_F" x = np.ones(10, dtype=np.csingle)[0::2] assert_almost_equal(ftwo(x, x), ftwo_val, err_msg=msg) # check binary PyUFunc_DD_D. msg = "PyUFunc_DD_D" x = np.ones(10, dtype=np.cdouble)[0::2] assert_almost_equal(ftwo(x, x), ftwo_val, err_msg=msg) # check binary PyUFunc_GG_G. msg = "PyUFunc_GG_G" x = np.ones(10, dtype=np.clongdouble)[0::2] assert_almost_equal(ftwo(x, x), ftwo_val, err_msg=msg) # class to use in testing object method loops class foo(object): def conjugate(self): return np.bool_(1) def logical_xor(self, obj): return np.bool_(1) # check unary PyUFunc_O_O msg = "PyUFunc_O_O" x = np.ones(10, dtype=object)[0::2] assert_(np.all(np.abs(x) == 1), msg) # check unary PyUFunc_O_O_method msg = "PyUFunc_O_O_method" x = np.zeros(10, dtype=object)[0::2] for i in range(len(x)): x[i] = foo() assert_(np.all(np.conjugate(x) == True), msg) # check binary PyUFunc_OO_O msg = "PyUFunc_OO_O" x = np.ones(10, dtype=object)[0::2] assert_(np.all(np.add(x, x) == 2), msg) # check binary PyUFunc_OO_O_method msg = "PyUFunc_OO_O_method" x = np.zeros(10, dtype=object)[0::2] for i in range(len(x)): x[i] = foo() assert_(np.all(np.logical_xor(x, x)), msg) # check PyUFunc_On_Om # fixme -- I don't know how to do this yet def test_all_ufunc(self): """Try to check presence and results of all ufuncs. The list of ufuncs comes from generate_umath.py and is as follows: ===== ==== ============= =============== ======================== done args function types notes ===== ==== ============= =============== ======================== n 1 conjugate nums + O n 1 absolute nums + O complex -> real n 1 negative nums + O n 1 sign nums + O -> int n 1 invert bool + ints + O flts raise an error n 1 degrees real + M cmplx raise an error n 1 radians real + M cmplx raise an error n 1 arccos flts + M n 1 arccosh flts + M n 1 arcsin flts + M n 1 arcsinh flts + M n 1 arctan flts + M n 1 arctanh flts + M n 1 cos flts + M n 1 sin flts + M n 1 tan flts + M n 1 cosh flts + M n 1 sinh flts + M n 1 tanh flts + M n 1 exp flts + M n 1 expm1 flts + M n 1 log flts + M n 1 log10 flts + M n 1 log1p flts + M n 1 sqrt flts + M real x < 0 raises error n 1 ceil real + M n 1 trunc real + M n 1 floor real + M n 1 fabs real + M n 1 rint flts + M n 1 isnan flts -> bool n 1 isinf flts -> bool n 1 isfinite flts -> bool n 1 signbit real -> bool n 1 modf real -> (frac, int) n 1 logical_not bool + nums + M -> bool n 2 left_shift ints + O flts raise an error n 2 right_shift ints + O flts raise an error n 2 add bool + nums + O boolean + is || n 2 subtract bool + nums + O boolean - is ^ n 2 multiply bool + nums + O boolean * is & n 2 divide nums + O n 2 floor_divide nums + O n 2 true_divide nums + O bBhH -> f, iIlLqQ -> d n 2 fmod nums + M n 2 power nums + O n 2 greater bool + nums + O -> bool n 2 greater_equal bool + nums + O -> bool n 2 less bool + nums + O -> bool n 2 less_equal bool + nums + O -> bool n 2 equal bool + nums + O -> bool n 2 not_equal bool + nums + O -> bool n 2 logical_and bool + nums + M -> bool n 2 logical_or bool + nums + M -> bool n 2 logical_xor bool + nums + M -> bool n 2 maximum bool + nums + O n 2 minimum bool + nums + O n 2 bitwise_and bool + ints + O flts raise an error n 2 bitwise_or bool + ints + O flts raise an error n 2 bitwise_xor bool + ints + O flts raise an error n 2 arctan2 real + M n 2 remainder ints + real + O n 2 hypot real + M ===== ==== ============= =============== ======================== Types other than those listed will be accepted, but they are cast to the smallest compatible type for which the function is defined. The casting rules are: bool -> int8 -> float32 ints -> double """ pass def test_signature(self): # the arguments to test_signature are: nin, nout, core_signature # pass assert_equal(umt.test_signature(2, 1, "(i),(i)->()"), 1) # pass. empty core signature; treat as plain ufunc (with trivial core) assert_equal(umt.test_signature(2, 1, "(),()->()"), 0) # in the following calls, a ValueError should be raised because # of error in core signature # FIXME These should be using assert_raises # error: extra parenthesis msg = "core_sig: extra parenthesis" try: ret = umt.test_signature(2, 1, "((i)),(i)->()") assert_equal(ret, None, err_msg=msg) except ValueError: pass # error: parenthesis matching msg = "core_sig: parenthesis matching" try: ret = umt.test_signature(2, 1, "(i),)i(->()") assert_equal(ret, None, err_msg=msg) except ValueError: pass # error: incomplete signature. letters outside of parenthesis are ignored msg = "core_sig: incomplete signature" try: ret = umt.test_signature(2, 1, "(i),->()") assert_equal(ret, None, err_msg=msg) except ValueError: pass # error: incomplete signature. 2 output arguments are specified msg = "core_sig: incomplete signature" try: ret = umt.test_signature(2, 2, "(i),(i)->()") assert_equal(ret, None, err_msg=msg) except ValueError: pass # more complicated names for variables assert_equal(umt.test_signature(2, 1, "(i1,i2),(J_1)->(_kAB)"), 1) def test_get_signature(self): assert_equal(umt.inner1d.signature, "(i),(i)->()") def test_forced_sig(self): a = 0.5*np.arange(3, dtype='f8') assert_equal(np.add(a, 0.5), [0.5, 1, 1.5]) assert_equal(np.add(a, 0.5, sig='i', casting='unsafe'), [0, 0, 1]) assert_equal(np.add(a, 0.5, sig='ii->i', casting='unsafe'), [0, 0, 1]) assert_equal(np.add(a, 0.5, sig=('i4',), casting='unsafe'), [0, 0, 1]) assert_equal(np.add(a, 0.5, sig=('i4', 'i4', 'i4'), casting='unsafe'), [0, 0, 1]) b = np.zeros((3,), dtype='f8') np.add(a, 0.5, out=b) assert_equal(b, [0.5, 1, 1.5]) b[:] = 0 np.add(a, 0.5, sig='i', out=b, casting='unsafe') assert_equal(b, [0, 0, 1]) b[:] = 0 np.add(a, 0.5, sig='ii->i', out=b, casting='unsafe') assert_equal(b, [0, 0, 1]) b[:] = 0 np.add(a, 0.5, sig=('i4',), out=b, casting='unsafe') assert_equal(b, [0, 0, 1]) b[:] = 0 np.add(a, 0.5, sig=('i4', 'i4', 'i4'), out=b, casting='unsafe') assert_equal(b, [0, 0, 1]) def test_true_divide(self): a = np.array(10) b = np.array(20) tgt = np.array(0.5) for tc in 'bhilqBHILQefdgFDG': dt = np.dtype(tc) aa = a.astype(dt) bb = b.astype(dt) # Check result value and dtype. for x, y in itertools.product([aa, -aa], [bb, -bb]): # Check with no output type specified if tc in 'FDG': tgt = complex(x)/complex(y) else: tgt = float(x)/float(y) res = np.true_divide(x, y) rtol = max(np.finfo(res).resolution, 1e-15) assert_allclose(res, tgt, rtol=rtol) if tc in 'bhilqBHILQ': assert_(res.dtype.name == 'float64') else: assert_(res.dtype.name == dt.name ) # Check with output type specified. This also checks for the # incorrect casts in issue gh-3484 because the unary '-' does # not change types, even for unsigned types, Hence casts in the # ufunc from signed to unsigned and vice versa will lead to # errors in the values. for tcout in 'bhilqBHILQ': dtout = np.dtype(tcout) assert_raises(TypeError, np.true_divide, x, y, dtype=dtout) for tcout in 'efdg': dtout = np.dtype(tcout) if tc in 'FDG': # Casting complex to float is not allowed assert_raises(TypeError, np.true_divide, x, y, dtype=dtout) else: tgt = float(x)/float(y) rtol = max(np.finfo(dtout).resolution, 1e-15) atol = max(np.finfo(dtout).tiny, 3e-308) # Some test values result in invalid for float16. with np.errstate(invalid='ignore'): res = np.true_divide(x, y, dtype=dtout) if not np.isfinite(res) and tcout == 'e': continue assert_allclose(res, tgt, rtol=rtol, atol=atol) assert_(res.dtype.name == dtout.name) for tcout in 'FDG': dtout = np.dtype(tcout) tgt = complex(x)/complex(y) rtol = max(np.finfo(dtout).resolution, 1e-15) atol = max(np.finfo(dtout).tiny, 3e-308) res = np.true_divide(x, y, dtype=dtout) if not np.isfinite(res): continue assert_allclose(res, tgt, rtol=rtol, atol=atol) assert_(res.dtype.name == dtout.name) # Check booleans a = np.ones((), dtype=np.bool_) res = np.true_divide(a, a) assert_(res == 1.0) assert_(res.dtype.name == 'float64') res = np.true_divide(~a, a) assert_(res == 0.0) assert_(res.dtype.name == 'float64') def test_sum_stability(self): a = np.ones(500, dtype=np.float32) assert_almost_equal((a / 10.).sum() - a.size / 10., 0, 4) a = np.ones(500, dtype=np.float64) assert_almost_equal((a / 10.).sum() - a.size / 10., 0, 13) def test_sum(self): for dt in (int, np.float16, np.float32, np.float64, np.longdouble): for v in (0, 1, 2, 7, 8, 9, 15, 16, 19, 127, 128, 1024, 1235): tgt = dt(v * (v + 1) / 2) d = np.arange(1, v + 1, dtype=dt) # warning if sum overflows, which it does in float16 overflow = not np.isfinite(tgt) with warnings.catch_warnings(record=True) as w: warnings.simplefilter("always") assert_almost_equal(np.sum(d), tgt) assert_equal(len(w), 1 * overflow) assert_almost_equal(np.sum(d[::-1]), tgt) assert_equal(len(w), 2 * overflow) d = np.ones(500, dtype=dt) assert_almost_equal(np.sum(d[::2]), 250.) assert_almost_equal(np.sum(d[1::2]), 250.) assert_almost_equal(np.sum(d[::3]), 167.) assert_almost_equal(np.sum(d[1::3]), 167.) assert_almost_equal(np.sum(d[::-2]), 250.) assert_almost_equal(np.sum(d[-1::-2]), 250.) assert_almost_equal(np.sum(d[::-3]), 167.) assert_almost_equal(np.sum(d[-1::-3]), 167.) # sum with first reduction entry != 0 d = np.ones((1,), dtype=dt) d += d assert_almost_equal(d, 2.) def test_sum_complex(self): for dt in (np.complex64, np.complex128, np.clongdouble): for v in (0, 1, 2, 7, 8, 9, 15, 16, 19, 127, 128, 1024, 1235): tgt = dt(v * (v + 1) / 2) - dt((v * (v + 1) / 2) * 1j) d = np.empty(v, dtype=dt) d.real = np.arange(1, v + 1) d.imag = -np.arange(1, v + 1) assert_almost_equal(np.sum(d), tgt) assert_almost_equal(np.sum(d[::-1]), tgt) d = np.ones(500, dtype=dt) + 1j assert_almost_equal(np.sum(d[::2]), 250. + 250j) assert_almost_equal(np.sum(d[1::2]), 250. + 250j) assert_almost_equal(np.sum(d[::3]), 167. + 167j) assert_almost_equal(np.sum(d[1::3]), 167. + 167j) assert_almost_equal(np.sum(d[::-2]), 250. + 250j) assert_almost_equal(np.sum(d[-1::-2]), 250. + 250j) assert_almost_equal(np.sum(d[::-3]), 167. + 167j) assert_almost_equal(np.sum(d[-1::-3]), 167. + 167j) # sum with first reduction entry != 0 d = np.ones((1,), dtype=dt) + 1j d += d assert_almost_equal(d, 2. + 2j) def test_inner1d(self): a = np.arange(6).reshape((2, 3)) assert_array_equal(umt.inner1d(a, a), np.sum(a*a, axis=-1)) a = np.arange(6) assert_array_equal(umt.inner1d(a, a), np.sum(a*a)) def test_broadcast(self): msg = "broadcast" a = np.arange(4).reshape((2, 1, 2)) b = np.arange(4).reshape((1, 2, 2)) assert_array_equal(umt.inner1d(a, b), np.sum(a*b, axis=-1), err_msg=msg) msg = "extend & broadcast loop dimensions" b = np.arange(4).reshape((2, 2)) assert_array_equal(umt.inner1d(a, b), np.sum(a*b, axis=-1), err_msg=msg) # Broadcast in core dimensions should fail a = np.arange(8).reshape((4, 2)) b = np.arange(4).reshape((4, 1)) assert_raises(ValueError, umt.inner1d, a, b) # Extend core dimensions should fail a = np.arange(8).reshape((4, 2)) b = np.array(7) assert_raises(ValueError, umt.inner1d, a, b) # Broadcast should fail a = np.arange(2).reshape((2, 1, 1)) b = np.arange(3).reshape((3, 1, 1)) assert_raises(ValueError, umt.inner1d, a, b) def test_type_cast(self): msg = "type cast" a = np.arange(6, dtype='short').reshape((2, 3)) assert_array_equal(umt.inner1d(a, a), np.sum(a*a, axis=-1), err_msg=msg) msg = "type cast on one argument" a = np.arange(6).reshape((2, 3)) b = a + 0.1 assert_array_almost_equal(umt.inner1d(a, b), np.sum(a*b, axis=-1), err_msg=msg) def test_endian(self): msg = "big endian" a = np.arange(6, dtype='>i4').reshape((2, 3)) assert_array_equal(umt.inner1d(a, a), np.sum(a*a, axis=-1), err_msg=msg) msg = "little endian" a = np.arange(6, dtype='<i4').reshape((2, 3)) assert_array_equal(umt.inner1d(a, a), np.sum(a*a, axis=-1), err_msg=msg) # Output should always be native-endian Ba = np.arange(1, dtype='>f8') La = np.arange(1, dtype='<f8') assert_equal((Ba+Ba).dtype, np.dtype('f8')) assert_equal((Ba+La).dtype, np.dtype('f8')) assert_equal((La+Ba).dtype, np.dtype('f8')) assert_equal((La+La).dtype, np.dtype('f8')) assert_equal(np.absolute(La).dtype, np.dtype('f8')) assert_equal(np.absolute(Ba).dtype, np.dtype('f8')) assert_equal(np.negative(La).dtype, np.dtype('f8')) assert_equal(np.negative(Ba).dtype, np.dtype('f8')) def test_incontiguous_array(self): msg = "incontiguous memory layout of array" x = np.arange(64).reshape((2, 2, 2, 2, 2, 2)) a = x[:, 0,:, 0,:, 0] b = x[:, 1,:, 1,:, 1] a[0, 0, 0] = -1 msg2 = "make sure it references to the original array" assert_equal(x[0, 0, 0, 0, 0, 0], -1, err_msg=msg2) assert_array_equal(umt.inner1d(a, b), np.sum(a*b, axis=-1), err_msg=msg) x = np.arange(24).reshape(2, 3, 4) a = x.T b = x.T a[0, 0, 0] = -1 assert_equal(x[0, 0, 0], -1, err_msg=msg2) assert_array_equal(umt.inner1d(a, b), np.sum(a*b, axis=-1), err_msg=msg) def test_output_argument(self): msg = "output argument" a = np.arange(12).reshape((2, 3, 2)) b = np.arange(4).reshape((2, 1, 2)) + 1 c = np.zeros((2, 3), dtype='int') umt.inner1d(a, b, c) assert_array_equal(c, np.sum(a*b, axis=-1), err_msg=msg) c[:] = -1 umt.inner1d(a, b, out=c) assert_array_equal(c, np.sum(a*b, axis=-1), err_msg=msg) msg = "output argument with type cast" c = np.zeros((2, 3), dtype='int16') umt.inner1d(a, b, c) assert_array_equal(c, np.sum(a*b, axis=-1), err_msg=msg) c[:] = -1 umt.inner1d(a, b, out=c) assert_array_equal(c, np.sum(a*b, axis=-1), err_msg=msg) msg = "output argument with incontiguous layout" c = np.zeros((2, 3, 4), dtype='int16') umt.inner1d(a, b, c[..., 0]) assert_array_equal(c[..., 0], np.sum(a*b, axis=-1), err_msg=msg) c[:] = -1 umt.inner1d(a, b, out=c[..., 0]) assert_array_equal(c[..., 0], np.sum(a*b, axis=-1), err_msg=msg) def test_innerwt(self): a = np.arange(6).reshape((2, 3)) b = np.arange(10, 16).reshape((2, 3)) w = np.arange(20, 26).reshape((2, 3)) assert_array_equal(umt.innerwt(a, b, w), np.sum(a*b*w, axis=-1)) a = np.arange(100, 124).reshape((2, 3, 4)) b = np.arange(200, 224).reshape((2, 3, 4)) w = np.arange(300, 324).reshape((2, 3, 4)) assert_array_equal(umt.innerwt(a, b, w), np.sum(a*b*w, axis=-1)) def test_innerwt_empty(self): """Test generalized ufunc with zero-sized operands""" a = np.array([], dtype='f8') b = np.array([], dtype='f8') w = np.array([], dtype='f8') assert_array_equal(umt.innerwt(a, b, w), np.sum(a*b*w, axis=-1)) def test_matrix_multiply(self): self.compare_matrix_multiply_results(np.long) self.compare_matrix_multiply_results(np.double) def test_matrix_multiply_umath_empty(self): res = umt.matrix_multiply(np.ones((0, 10)), np.ones((10, 0))) assert_array_equal(res, np.zeros((0, 0))) res = umt.matrix_multiply(np.ones((10, 0)), np.ones((0, 10))) assert_array_equal(res, np.zeros((10, 10))) def compare_matrix_multiply_results(self, tp): d1 = np.array(np.random.rand(2, 3, 4), dtype=tp) d2 = np.array(np.random.rand(2, 3, 4), dtype=tp) msg = "matrix multiply on type %s" % d1.dtype.name def permute_n(n): if n == 1: return ([0],) ret = () base = permute_n(n-1) for perm in base: for i in range(n): new = perm + [n-1] new[n-1] = new[i] new[i] = n-1 ret += (new,) return ret def slice_n(n): if n == 0: return ((),) ret = () base = slice_n(n-1) for sl in base: ret += (sl+(slice(None),),) ret += (sl+(slice(0, 1),),) return ret def broadcastable(s1, s2): return s1 == s2 or s1 == 1 or s2 == 1 permute_3 = permute_n(3) slice_3 = slice_n(3) + ((slice(None, None, -1),)*3,) ref = True for p1 in permute_3: for p2 in permute_3: for s1 in slice_3: for s2 in slice_3: a1 = d1.transpose(p1)[s1] a2 = d2.transpose(p2)[s2] ref = ref and a1.base is not None ref = ref and a2.base is not None if (a1.shape[-1] == a2.shape[-2] and broadcastable(a1.shape[0], a2.shape[0])): assert_array_almost_equal( umt.matrix_multiply(a1, a2), np.sum(a2[..., np.newaxis].swapaxes(-3, -1) * a1[..., np.newaxis,:], axis=-1), err_msg=msg + ' %s %s' % (str(a1.shape), str(a2.shape))) assert_equal(ref, True, err_msg="reference check") def test_euclidean_pdist(self): a = np.arange(12, dtype=float).reshape(4, 3) out = np.empty((a.shape[0] * (a.shape[0] - 1) // 2,), dtype=a.dtype) umt.euclidean_pdist(a, out) b = np.sqrt(np.sum((a[:, None] - a)**2, axis=-1)) b = b[~np.tri(a.shape[0], dtype=bool)] assert_almost_equal(out, b) # An output array is required to determine p with signature (n,d)->(p) assert_raises(ValueError, umt.euclidean_pdist, a) def test_object_logical(self): a = np.array([3, None, True, False, "test", ""], dtype=object) assert_equal(np.logical_or(a, None), np.array([x or None for x in a], dtype=object)) assert_equal(np.logical_or(a, True), np.array([x or True for x in a], dtype=object)) assert_equal(np.logical_or(a, 12), np.array([x or 12 for x in a], dtype=object)) assert_equal(np.logical_or(a, "blah"), np.array([x or "blah" for x in a], dtype=object)) assert_equal(np.logical_and(a, None), np.array([x and None for x in a], dtype=object)) assert_equal(np.logical_and(a, True), np.array([x and True for x in a], dtype=object)) assert_equal(np.logical_and(a, 12), np.array([x and 12 for x in a], dtype=object)) assert_equal(np.logical_and(a, "blah"), np.array([x and "blah" for x in a], dtype=object)) assert_equal(np.logical_not(a), np.array([not x for x in a], dtype=object)) assert_equal(np.logical_or.reduce(a), 3) assert_equal(np.logical_and.reduce(a), None) def test_object_array_reduction(self): # Reductions on object arrays a = np.array(['a', 'b', 'c'], dtype=object) assert_equal(np.sum(a), 'abc') assert_equal(np.max(a), 'c') assert_equal(np.min(a), 'a') a = np.array([True, False, True], dtype=object) assert_equal(np.sum(a), 2) assert_equal(np.prod(a), 0) assert_equal(np.any(a), True) assert_equal(np.all(a), False) assert_equal(np.max(a), True) assert_equal(np.min(a), False) assert_equal(np.array([[1]], dtype=object).sum(), 1) assert_equal(np.array([[[1, 2]]], dtype=object).sum((0, 1)), [1, 2]) def test_object_array_accumulate_inplace(self): # Checks that in-place accumulates work, see also gh-7402 arr = np.ones(4, dtype=object) arr[:] = [[1] for i in range(4)] # Twice reproduced also for tuples: np.add.accumulate(arr, out=arr) np.add.accumulate(arr, out=arr) assert_array_equal(arr, np.array([[1]*i for i in [1, 3, 6, 10]])) # And the same if the axis argument is used arr = np.ones((2, 4), dtype=object) arr[0, :] = [[2] for i in range(4)] np.add.accumulate(arr, out=arr, axis=-1) np.add.accumulate(arr, out=arr, axis=-1) assert_array_equal(arr[0, :], np.array([[2]*i for i in [1, 3, 6, 10]])) def test_object_array_reduceat_inplace(self): # Checks that in-place reduceats work, see also gh-7465 arr = np.empty(4, dtype=object) arr[:] = [[1] for i in range(4)] out = np.empty(4, dtype=object) out[:] = [[1] for i in range(4)] np.add.reduceat(arr, np.arange(4), out=arr) np.add.reduceat(arr, np.arange(4), out=arr) assert_array_equal(arr, out) # And the same if the axis argument is used arr = np.ones((2, 4), dtype=object) arr[0, :] = [[2] for i in range(4)] out = np.ones((2, 4), dtype=object) out[0, :] = [[2] for i in range(4)] np.add.reduceat(arr, np.arange(4), out=arr, axis=-1) np.add.reduceat(arr, np.arange(4), out=arr, axis=-1) assert_array_equal(arr, out) def test_object_scalar_multiply(self): # Tickets #2469 and #4482 arr = np.matrix([1, 2], dtype=object) desired = np.matrix([[3, 6]], dtype=object) assert_equal(np.multiply(arr, 3), desired) assert_equal(np.multiply(3, arr), desired) def test_zerosize_reduction(self): # Test with default dtype and object dtype for a in [[], np.array([], dtype=object)]: assert_equal(np.sum(a), 0) assert_equal(np.prod(a), 1) assert_equal(np.any(a), False) assert_equal(np.all(a), True) assert_raises(ValueError, np.max, a) assert_raises(ValueError, np.min, a) def test_axis_out_of_bounds(self): a = np.array([False, False]) assert_raises(np.AxisError, a.all, axis=1) a = np.array([False, False]) assert_raises(np.AxisError, a.all, axis=-2) a = np.array([False, False]) assert_raises(np.AxisError, a.any, axis=1) a = np.array([False, False]) assert_raises(np.AxisError, a.any, axis=-2) def test_scalar_reduction(self): # The functions 'sum', 'prod', etc allow specifying axis=0 # even for scalars assert_equal(np.sum(3, axis=0), 3) assert_equal(np.prod(3.5, axis=0), 3.5) assert_equal(np.any(True, axis=0), True) assert_equal(np.all(False, axis=0), False) assert_equal(np.max(3, axis=0), 3) assert_equal(np.min(2.5, axis=0), 2.5) # Check scalar behaviour for ufuncs without an identity assert_equal(np.power.reduce(3), 3) # Make sure that scalars are coming out from this operation assert_(type(np.prod(np.float32(2.5), axis=0)) is np.float32) assert_(type(np.sum(np.float32(2.5), axis=0)) is np.float32) assert_(type(np.max(np.float32(2.5), axis=0)) is np.float32) assert_(type(np.min(np.float32(2.5), axis=0)) is np.float32) # check if scalars/0-d arrays get cast assert_(type(np.any(0, axis=0)) is np.bool_) # assert that 0-d arrays get wrapped class MyArray(np.ndarray): pass a = np.array(1).view(MyArray) assert_(type(np.any(a)) is MyArray) def test_casting_out_param(self): # Test that it's possible to do casts on output a = np.ones((200, 100), np.int64) b = np.ones((200, 100), np.int64) c = np.ones((200, 100), np.float64) np.add(a, b, out=c) assert_equal(c, 2) a = np.zeros(65536) b = np.zeros(65536, dtype=np.float32) np.subtract(a, 0, out=b) assert_equal(b, 0) def test_where_param(self): # Test that the where= ufunc parameter works with regular arrays a = np.arange(7) b = np.ones(7) c = np.zeros(7) np.add(a, b, out=c, where=(a % 2 == 1)) assert_equal(c, [0, 2, 0, 4, 0, 6, 0]) a = np.arange(4).reshape(2, 2) + 2 np.power(a, [2, 3], out=a, where=[[0, 1], [1, 0]]) assert_equal(a, [[2, 27], [16, 5]]) # Broadcasting the where= parameter np.subtract(a, 2, out=a, where=[True, False]) assert_equal(a, [[0, 27], [14, 5]]) def test_where_param_buffer_output(self): # This test is temporarily skipped because it requires # adding masking features to the nditer to work properly # With casting on output a = np.ones(10, np.int64) b = np.ones(10, np.int64) c = 1.5 * np.ones(10, np.float64) np.add(a, b, out=c, where=[1, 0, 0, 1, 0, 0, 1, 1, 1, 0]) assert_equal(c, [2, 1.5, 1.5, 2, 1.5, 1.5, 2, 2, 2, 1.5]) def test_where_param_alloc(self): # With casting and allocated output a = np.array([1], dtype=np.int64) m = np.array([True], dtype=bool) assert_equal(np.sqrt(a, where=m), [1]) # No casting and allocated output a = np.array([1], dtype=np.float64) m = np.array([True], dtype=bool) assert_equal(np.sqrt(a, where=m), [1]) def check_identityless_reduction(self, a): # np.minimum.reduce is a identityless reduction # Verify that it sees the zero at various positions a[...] = 1 a[1, 0, 0] = 0 assert_equal(np.minimum.reduce(a, axis=None), 0) assert_equal(np.minimum.reduce(a, axis=(0, 1)), [0, 1, 1, 1]) assert_equal(np.minimum.reduce(a, axis=(0, 2)), [0, 1, 1]) assert_equal(np.minimum.reduce(a, axis=(1, 2)), [1, 0]) assert_equal(np.minimum.reduce(a, axis=0), [[0, 1, 1, 1], [1, 1, 1, 1], [1, 1, 1, 1]]) assert_equal(np.minimum.reduce(a, axis=1), [[1, 1, 1, 1], [0, 1, 1, 1]]) assert_equal(np.minimum.reduce(a, axis=2), [[1, 1, 1], [0, 1, 1]]) assert_equal(np.minimum.reduce(a, axis=()), a) a[...] = 1 a[0, 1, 0] = 0 assert_equal(np.minimum.reduce(a, axis=None), 0) assert_equal(np.minimum.reduce(a, axis=(0, 1)), [0, 1, 1, 1]) assert_equal(np.minimum.reduce(a, axis=(0, 2)), [1, 0, 1]) assert_equal(np.minimum.reduce(a, axis=(1, 2)), [0, 1]) assert_equal(np.minimum.reduce(a, axis=0), [[1, 1, 1, 1], [0, 1, 1, 1], [1, 1, 1, 1]]) assert_equal(np.minimum.reduce(a, axis=1), [[0, 1, 1, 1], [1, 1, 1, 1]]) assert_equal(np.minimum.reduce(a, axis=2), [[1, 0, 1], [1, 1, 1]]) assert_equal(np.minimum.reduce(a, axis=()), a) a[...] = 1 a[0, 0, 1] = 0 assert_equal(np.minimum.reduce(a, axis=None), 0) assert_equal(np.minimum.reduce(a, axis=(0, 1)), [1, 0, 1, 1]) assert_equal(np.minimum.reduce(a, axis=(0, 2)), [0, 1, 1]) assert_equal(np.minimum.reduce(a, axis=(1, 2)), [0, 1]) assert_equal(np.minimum.reduce(a, axis=0), [[1, 0, 1, 1], [1, 1, 1, 1], [1, 1, 1, 1]]) assert_equal(np.minimum.reduce(a, axis=1), [[1, 0, 1, 1], [1, 1, 1, 1]]) assert_equal(np.minimum.reduce(a, axis=2), [[0, 1, 1], [1, 1, 1]]) assert_equal(np.minimum.reduce(a, axis=()), a) def test_identityless_reduction_corder(self): a = np.empty((2, 3, 4), order='C') self.check_identityless_reduction(a) def test_identityless_reduction_forder(self): a = np.empty((2, 3, 4), order='F') self.check_identityless_reduction(a) def test_identityless_reduction_otherorder(self): a = np.empty((2, 4, 3), order='C').swapaxes(1, 2) self.check_identityless_reduction(a) def test_identityless_reduction_noncontig(self): a = np.empty((3, 5, 4), order='C').swapaxes(1, 2) a = a[1:, 1:, 1:] self.check_identityless_reduction(a) def test_identityless_reduction_noncontig_unaligned(self): a = np.empty((3*4*5*8 + 1,), dtype='i1') a = a[1:].view(dtype='f8') a.shape = (3, 4, 5) a = a[1:, 1:, 1:] self.check_identityless_reduction(a) def test_identityless_reduction_nonreorderable(self): a = np.array([[8.0, 2.0, 2.0], [1.0, 0.5, 0.25]]) res = np.divide.reduce(a, axis=0) assert_equal(res, [8.0, 4.0, 8.0]) res = np.divide.reduce(a, axis=1) assert_equal(res, [2.0, 8.0]) res = np.divide.reduce(a, axis=()) assert_equal(res, a) assert_raises(ValueError, np.divide.reduce, a, axis=(0, 1)) def test_reduce_zero_axis(self): # If we have a n x m array and do a reduction with axis=1, then we are # doing n reductions, and each reduction takes an m-element array. For # a reduction operation without an identity, then: # n > 0, m > 0: fine # n = 0, m > 0: fine, doing 0 reductions of m-element arrays # n > 0, m = 0: can't reduce a 0-element array, ValueError # n = 0, m = 0: can't reduce a 0-element array, ValueError (for # consistency with the above case) # This test doesn't actually look at return values, it just checks to # make sure that error we get an error in exactly those cases where we # expect one, and assumes the calculations themselves are done # correctly. def ok(f, *args, **kwargs): f(*args, **kwargs) def err(f, *args, **kwargs): assert_raises(ValueError, f, *args, **kwargs) def t(expect, func, n, m): expect(func, np.zeros((n, m)), axis=1) expect(func, np.zeros((m, n)), axis=0) expect(func, np.zeros((n // 2, n // 2, m)), axis=2) expect(func, np.zeros((n // 2, m, n // 2)), axis=1) expect(func, np.zeros((n, m // 2, m // 2)), axis=(1, 2)) expect(func, np.zeros((m // 2, n, m // 2)), axis=(0, 2)) expect(func, np.zeros((m // 3, m // 3, m // 3, n // 2, n // 2)), axis=(0, 1, 2)) # Check what happens if the inner (resp. outer) dimensions are a # mix of zero and non-zero: expect(func, np.zeros((10, m, n)), axis=(0, 1)) expect(func, np.zeros((10, n, m)), axis=(0, 2)) expect(func, np.zeros((m, 10, n)), axis=0) expect(func, np.zeros((10, m, n)), axis=1) expect(func, np.zeros((10, n, m)), axis=2) # np.maximum is just an arbitrary ufunc with no reduction identity assert_equal(np.maximum.identity, None) t(ok, np.maximum.reduce, 30, 30) t(ok, np.maximum.reduce, 0, 30) t(err, np.maximum.reduce, 30, 0) t(err, np.maximum.reduce, 0, 0) err(np.maximum.reduce, []) np.maximum.reduce(np.zeros((0, 0)), axis=()) # all of the combinations are fine for a reduction that has an # identity t(ok, np.add.reduce, 30, 30) t(ok, np.add.reduce, 0, 30) t(ok, np.add.reduce, 30, 0) t(ok, np.add.reduce, 0, 0) np.add.reduce([]) np.add.reduce(np.zeros((0, 0)), axis=()) # OTOH, accumulate always makes sense for any combination of n and m, # because it maps an m-element array to an m-element array. These # tests are simpler because accumulate doesn't accept multiple axes. for uf in (np.maximum, np.add): uf.accumulate(np.zeros((30, 0)), axis=0) uf.accumulate(np.zeros((0, 30)), axis=0) uf.accumulate(np.zeros((30, 30)), axis=0) uf.accumulate(np.zeros((0, 0)), axis=0) def test_safe_casting(self): # In old versions of numpy, in-place operations used the 'unsafe' # casting rules. In versions >= 1.10, 'same_kind' is the # default and an exception is raised instead of a warning. # when 'same_kind' is not satisfied. a = np.array([1, 2, 3], dtype=int) # Non-in-place addition is fine assert_array_equal(assert_no_warnings(np.add, a, 1.1), [2.1, 3.1, 4.1]) assert_raises(TypeError, np.add, a, 1.1, out=a) def add_inplace(a, b): a += b assert_raises(TypeError, add_inplace, a, 1.1) # Make sure that explicitly overriding the exception is allowed: assert_no_warnings(np.add, a, 1.1, out=a, casting="unsafe") assert_array_equal(a, [2, 3, 4]) def test_ufunc_custom_out(self): # Test ufunc with built in input types and custom output type a = np.array([0, 1, 2], dtype='i8') b = np.array([0, 1, 2], dtype='i8') c = np.empty(3, dtype=rational) # Output must be specified so numpy knows what # ufunc signature to look for result = test_add(a, b, c) assert_equal(result, np.array([0, 2, 4], dtype=rational)) # no output type should raise TypeError assert_raises(TypeError, test_add, a, b) def test_operand_flags(self): a = np.arange(16, dtype='l').reshape(4, 4) b = np.arange(9, dtype='l').reshape(3, 3) opflag_tests.inplace_add(a[:-1, :-1], b) assert_equal(a, np.array([[0, 2, 4, 3], [7, 9, 11, 7], [14, 16, 18, 11], [12, 13, 14, 15]], dtype='l')) a = np.array(0) opflag_tests.inplace_add(a, 3) assert_equal(a, 3) opflag_tests.inplace_add(a, [3, 4]) assert_equal(a, 10) def test_struct_ufunc(self): import numpy.core.struct_ufunc_test as struct_ufunc a = np.array([(1, 2, 3)], dtype='u8,u8,u8') b = np.array([(1, 2, 3)], dtype='u8,u8,u8') result = struct_ufunc.add_triplet(a, b) assert_equal(result, np.array([(2, 4, 6)], dtype='u8,u8,u8')) def test_custom_ufunc(self): a = np.array([rational(1, 2), rational(1, 3), rational(1, 4)], dtype=rational) b = np.array([rational(1, 2), rational(1, 3), rational(1, 4)], dtype=rational) result = test_add_rationals(a, b) expected = np.array([rational(1), rational(2, 3), rational(1, 2)], dtype=rational) assert_equal(result, expected) def test_custom_ufunc_forced_sig(self): # gh-9351 - looking for a non-first userloop would previously hang assert_raises(TypeError, np.multiply, rational(1), 1, signature=(rational, int, None)) def test_custom_array_like(self): class MyThing(object): __array_priority__ = 1000 rmul_count = 0 getitem_count = 0 def __init__(self, shape): self.shape = shape def __len__(self): return self.shape[0] def __getitem__(self, i): MyThing.getitem_count += 1 if not isinstance(i, tuple): i = (i,) if len(i) > self.ndim: raise IndexError("boo") return MyThing(self.shape[len(i):]) def __rmul__(self, other): MyThing.rmul_count += 1 return self np.float64(5)*MyThing((3, 3)) assert_(MyThing.rmul_count == 1, MyThing.rmul_count) assert_(MyThing.getitem_count <= 2, MyThing.getitem_count) def test_inplace_fancy_indexing(self): a = np.arange(10) np.add.at(a, [2, 5, 2], 1) assert_equal(a, [0, 1, 4, 3, 4, 6, 6, 7, 8, 9]) a = np.arange(10) b = np.array([100, 100, 100]) np.add.at(a, [2, 5, 2], b) assert_equal(a, [0, 1, 202, 3, 4, 105, 6, 7, 8, 9]) a = np.arange(9).reshape(3, 3) b = np.array([[100, 100, 100], [200, 200, 200], [300, 300, 300]]) np.add.at(a, (slice(None), [1, 2, 1]), b) assert_equal(a, [[0, 201, 102], [3, 404, 205], [6, 607, 308]]) a = np.arange(27).reshape(3, 3, 3) b = np.array([100, 200, 300]) np.add.at(a, (slice(None), slice(None), [1, 2, 1]), b) assert_equal(a, [[[0, 401, 202], [3, 404, 205], [6, 407, 208]], [[9, 410, 211], [12, 413, 214], [15, 416, 217]], [[18, 419, 220], [21, 422, 223], [24, 425, 226]]]) a = np.arange(9).reshape(3, 3) b = np.array([[100, 100, 100], [200, 200, 200], [300, 300, 300]]) np.add.at(a, ([1, 2, 1], slice(None)), b) assert_equal(a, [[0, 1, 2], [403, 404, 405], [206, 207, 208]]) a = np.arange(27).reshape(3, 3, 3) b = np.array([100, 200, 300]) np.add.at(a, (slice(None), [1, 2, 1], slice(None)), b) assert_equal(a, [[[0, 1, 2], [203, 404, 605], [106, 207, 308]], [[9, 10, 11], [212, 413, 614], [115, 216, 317]], [[18, 19, 20], [221, 422, 623], [124, 225, 326]]]) a = np.arange(9).reshape(3, 3) b = np.array([100, 200, 300]) np.add.at(a, (0, [1, 2, 1]), b) assert_equal(a, [[0, 401, 202], [3, 4, 5], [6, 7, 8]]) a = np.arange(27).reshape(3, 3, 3) b = np.array([100, 200, 300]) np.add.at(a, ([1, 2, 1], 0, slice(None)), b) assert_equal(a, [[[0, 1, 2], [3, 4, 5], [6, 7, 8]], [[209, 410, 611], [12, 13, 14], [15, 16, 17]], [[118, 219, 320], [21, 22, 23], [24, 25, 26]]]) a = np.arange(27).reshape(3, 3, 3) b = np.array([100, 200, 300]) np.add.at(a, (slice(None), slice(None), slice(None)), b) assert_equal(a, [[[100, 201, 302], [103, 204, 305], [106, 207, 308]], [[109, 210, 311], [112, 213, 314], [115, 216, 317]], [[118, 219, 320], [121, 222, 323], [124, 225, 326]]]) a = np.arange(10) np.negative.at(a, [2, 5, 2]) assert_equal(a, [0, 1, 2, 3, 4, -5, 6, 7, 8, 9]) # Test 0-dim array a = np.array(0) np.add.at(a, (), 1) assert_equal(a, 1) assert_raises(IndexError, np.add.at, a, 0, 1) assert_raises(IndexError, np.add.at, a, [], 1) # Test mixed dtypes a = np.arange(10) np.power.at(a, [1, 2, 3, 2], 3.5) assert_equal(a, np.array([0, 1, 4414, 46, 4, 5, 6, 7, 8, 9])) # Test boolean indexing and boolean ufuncs a = np.arange(10) index = a % 2 == 0 np.equal.at(a, index, [0, 2, 4, 6, 8]) assert_equal(a, [1, 1, 1, 3, 1, 5, 1, 7, 1, 9]) # Test unary operator a = np.arange(10, dtype='u4') np.invert.at(a, [2, 5, 2]) assert_equal(a, [0, 1, 2, 3, 4, 5 ^ 0xffffffff, 6, 7, 8, 9]) # Test empty subspace orig = np.arange(4) a = orig[:, None][:, 0:0] np.add.at(a, [0, 1], 3) assert_array_equal(orig, np.arange(4)) # Test with swapped byte order index = np.array([1, 2, 1], np.dtype('i').newbyteorder()) values = np.array([1, 2, 3, 4], np.dtype('f').newbyteorder()) np.add.at(values, index, 3) assert_array_equal(values, [1, 8, 6, 4]) # Test exception thrown values = np.array(['a', 1], dtype=object) assert_raises(TypeError, np.add.at, values, [0, 1], 1) assert_array_equal(values, np.array(['a', 1], dtype=object)) # Test multiple output ufuncs raise error, gh-5665 assert_raises(ValueError, np.modf.at, np.arange(10), [1]) def test_reduce_arguments(self): f = np.add.reduce d = np.ones((5,2), dtype=int) o = np.ones((2,), dtype=d.dtype) r = o * 5 assert_equal(f(d), r) # a, axis=0, dtype=None, out=None, keepdims=False assert_equal(f(d, axis=0), r) assert_equal(f(d, 0), r) assert_equal(f(d, 0, dtype=None), r) assert_equal(f(d, 0, dtype='i'), r) assert_equal(f(d, 0, 'i'), r) assert_equal(f(d, 0, None), r) assert_equal(f(d, 0, None, out=None), r) assert_equal(f(d, 0, None, out=o), r) assert_equal(f(d, 0, None, o), r) assert_equal(f(d, 0, None, None), r) assert_equal(f(d, 0, None, None, keepdims=False), r) assert_equal(f(d, 0, None, None, True), r.reshape((1,) + r.shape)) # multiple keywords assert_equal(f(d, axis=0, dtype=None, out=None, keepdims=False), r) assert_equal(f(d, 0, dtype=None, out=None, keepdims=False), r) assert_equal(f(d, 0, None, out=None, keepdims=False), r) # too little assert_raises(TypeError, f) # too much assert_raises(TypeError, f, d, 0, None, None, False, 1) # invalid axis assert_raises(TypeError, f, d, "invalid") assert_raises(TypeError, f, d, axis="invalid") assert_raises(TypeError, f, d, axis="invalid", dtype=None, keepdims=True) # invalid dtype assert_raises(TypeError, f, d, 0, "invalid") assert_raises(TypeError, f, d, dtype="invalid") assert_raises(TypeError, f, d, dtype="invalid", out=None) # invalid out assert_raises(TypeError, f, d, 0, None, "invalid") assert_raises(TypeError, f, d, out="invalid") assert_raises(TypeError, f, d, out="invalid", dtype=None) # keepdims boolean, no invalid value # assert_raises(TypeError, f, d, 0, None, None, "invalid") # assert_raises(TypeError, f, d, keepdims="invalid", axis=0, dtype=None) # invalid mix assert_raises(TypeError, f, d, 0, keepdims="invalid", dtype="invalid", out=None) # invalid keyord assert_raises(TypeError, f, d, axis=0, dtype=None, invalid=0) assert_raises(TypeError, f, d, invalid=0) assert_raises(TypeError, f, d, 0, keepdims=True, invalid="invalid", out=None) assert_raises(TypeError, f, d, axis=0, dtype=None, keepdims=True, out=None, invalid=0) assert_raises(TypeError, f, d, axis=0, dtype=None, out=None, invalid=0) def test_structured_equal(self): # https://github.com/numpy/numpy/issues/4855 class MyA(np.ndarray): def __array_ufunc__(self, ufunc, method, *inputs, **kwargs): return getattr(ufunc, method)(*(input.view(np.ndarray) for input in inputs), **kwargs) a = np.arange(12.).reshape(4,3) ra = a.view(dtype=('f8,f8,f8')).squeeze() mra = ra.view(MyA) target = np.array([ True, False, False, False], dtype=bool) assert_equal(np.all(target == (mra == ra[0])), True) def test_NotImplemented_not_returned(self): # See gh-5964 and gh-2091. Some of these functions are not operator # related and were fixed for other reasons in the past. binary_funcs = [ np.power, np.add, np.subtract, np.multiply, np.divide, np.true_divide, np.floor_divide, np.bitwise_and, np.bitwise_or, np.bitwise_xor, np.left_shift, np.right_shift, np.fmax, np.fmin, np.fmod, np.hypot, np.logaddexp, np.logaddexp2, np.logical_and, np.logical_or, np.logical_xor, np.maximum, np.minimum, np.mod ] # These functions still return NotImplemented. Will be fixed in # future. # bad = [np.greater, np.greater_equal, np.less, np.less_equal, np.not_equal] a = np.array('1') b = 1 for f in binary_funcs: assert_raises(TypeError, f, a, b) def test_reduce_noncontig_output(self): # Check that reduction deals with non-contiguous output arrays # appropriately. # # gh-8036 x = np.arange(7*13*8, dtype=np.int16).reshape(7, 13, 8) x = x[4:6,1:11:6,1:5].transpose(1, 2, 0) y_base = np.arange(4*4, dtype=np.int16).reshape(4, 4) y = y_base[::2,:] y_base_copy = y_base.copy() r0 = np.add.reduce(x, out=y.copy(), axis=2) r1 = np.add.reduce(x, out=y, axis=2) # The results should match, and y_base shouldn't get clobbered assert_equal(r0, r1) assert_equal(y_base[1,:], y_base_copy[1,:]) assert_equal(y_base[3,:], y_base_copy[3,:]) def test_no_doc_string(self): # gh-9337 assert_('\n' not in umt.inner1d_no_doc.__doc__) if __name__ == "__main__": run_module_suite()
55,288
38.919856
84
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_umath_complex.py
from __future__ import division, absolute_import, print_function import sys import platform import numpy as np import numpy.core.umath as ncu from numpy.testing import ( run_module_suite, assert_raises, assert_equal, assert_array_equal, assert_almost_equal, dec ) # TODO: branch cuts (use Pauli code) # TODO: conj 'symmetry' # TODO: FPU exceptions # At least on Windows the results of many complex functions are not conforming # to the C99 standard. See ticket 1574. # Ditto for Solaris (ticket 1642) and OS X on PowerPC. with np.errstate(all='ignore'): functions_seem_flaky = ((np.exp(complex(np.inf, 0)).imag != 0) or (np.log(complex(np.NZERO, 0)).imag != np.pi)) # TODO: replace with a check on whether platform-provided C99 funcs are used skip_complex_tests = (not sys.platform.startswith('linux') or functions_seem_flaky) def platform_skip(func): return dec.skipif(skip_complex_tests, "Numpy is using complex functions (e.g. sqrt) provided by your" "platform's C library. However, they do not seem to behave according" "to C99 -- so C99 tests are skipped.")(func) class TestCexp(object): def test_simple(self): check = check_complex_value f = np.exp yield check, f, 1, 0, np.exp(1), 0, False yield check, f, 0, 1, np.cos(1), np.sin(1), False ref = np.exp(1) * complex(np.cos(1), np.sin(1)) yield check, f, 1, 1, ref.real, ref.imag, False @platform_skip def test_special_values(self): # C99: Section G 6.3.1 check = check_complex_value f = np.exp # cexp(+-0 + 0i) is 1 + 0i yield check, f, np.PZERO, 0, 1, 0, False yield check, f, np.NZERO, 0, 1, 0, False # cexp(x + infi) is nan + nani for finite x and raises 'invalid' FPU # exception yield check, f, 1, np.inf, np.nan, np.nan yield check, f, -1, np.inf, np.nan, np.nan yield check, f, 0, np.inf, np.nan, np.nan # cexp(inf + 0i) is inf + 0i yield check, f, np.inf, 0, np.inf, 0 # cexp(-inf + yi) is +0 * (cos(y) + i sin(y)) for finite y yield check, f, -np.inf, 1, np.PZERO, np.PZERO yield check, f, -np.inf, 0.75 * np.pi, np.NZERO, np.PZERO # cexp(inf + yi) is +inf * (cos(y) + i sin(y)) for finite y yield check, f, np.inf, 1, np.inf, np.inf yield check, f, np.inf, 0.75 * np.pi, -np.inf, np.inf # cexp(-inf + inf i) is +-0 +- 0i (signs unspecified) def _check_ninf_inf(dummy): msgform = "cexp(-inf, inf) is (%f, %f), expected (+-0, +-0)" with np.errstate(invalid='ignore'): z = f(np.array(complex(-np.inf, np.inf))) if z.real != 0 or z.imag != 0: raise AssertionError(msgform % (z.real, z.imag)) yield _check_ninf_inf, None # cexp(inf + inf i) is +-inf + NaNi and raised invalid FPU ex. def _check_inf_inf(dummy): msgform = "cexp(inf, inf) is (%f, %f), expected (+-inf, nan)" with np.errstate(invalid='ignore'): z = f(np.array(complex(np.inf, np.inf))) if not np.isinf(z.real) or not np.isnan(z.imag): raise AssertionError(msgform % (z.real, z.imag)) yield _check_inf_inf, None # cexp(-inf + nan i) is +-0 +- 0i def _check_ninf_nan(dummy): msgform = "cexp(-inf, nan) is (%f, %f), expected (+-0, +-0)" with np.errstate(invalid='ignore'): z = f(np.array(complex(-np.inf, np.nan))) if z.real != 0 or z.imag != 0: raise AssertionError(msgform % (z.real, z.imag)) yield _check_ninf_nan, None # cexp(inf + nan i) is +-inf + nan def _check_inf_nan(dummy): msgform = "cexp(-inf, nan) is (%f, %f), expected (+-inf, nan)" with np.errstate(invalid='ignore'): z = f(np.array(complex(np.inf, np.nan))) if not np.isinf(z.real) or not np.isnan(z.imag): raise AssertionError(msgform % (z.real, z.imag)) yield _check_inf_nan, None # cexp(nan + yi) is nan + nani for y != 0 (optional: raises invalid FPU # ex) yield check, f, np.nan, 1, np.nan, np.nan yield check, f, np.nan, -1, np.nan, np.nan yield check, f, np.nan, np.inf, np.nan, np.nan yield check, f, np.nan, -np.inf, np.nan, np.nan # cexp(nan + nani) is nan + nani yield check, f, np.nan, np.nan, np.nan, np.nan @dec.knownfailureif(True, "cexp(nan + 0I) is wrong on most implementations") def test_special_values2(self): # XXX: most implementations get it wrong here (including glibc <= 2.10) # cexp(nan + 0i) is nan + 0i check = check_complex_value f = np.exp yield check, f, np.nan, 0, np.nan, 0 class TestClog(object): def test_simple(self): x = np.array([1+0j, 1+2j]) y_r = np.log(np.abs(x)) + 1j * np.angle(x) y = np.log(x) for i in range(len(x)): assert_almost_equal(y[i], y_r[i]) @platform_skip @dec.skipif(platform.machine() == "armv5tel", "See gh-413.") def test_special_values(self): xl = [] yl = [] # From C99 std (Sec 6.3.2) # XXX: check exceptions raised # --- raise for invalid fails. # clog(-0 + i0) returns -inf + i pi and raises the 'divide-by-zero' # floating-point exception. with np.errstate(divide='raise'): x = np.array([np.NZERO], dtype=complex) y = complex(-np.inf, np.pi) assert_raises(FloatingPointError, np.log, x) with np.errstate(divide='ignore'): assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) # clog(+0 + i0) returns -inf + i0 and raises the 'divide-by-zero' # floating-point exception. with np.errstate(divide='raise'): x = np.array([0], dtype=complex) y = complex(-np.inf, 0) assert_raises(FloatingPointError, np.log, x) with np.errstate(divide='ignore'): assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) # clog(x + i inf returns +inf + i pi /2, for finite x. x = np.array([complex(1, np.inf)], dtype=complex) y = complex(np.inf, 0.5 * np.pi) assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) x = np.array([complex(-1, np.inf)], dtype=complex) assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) # clog(x + iNaN) returns NaN + iNaN and optionally raises the # 'invalid' floating- point exception, for finite x. with np.errstate(invalid='raise'): x = np.array([complex(1., np.nan)], dtype=complex) y = complex(np.nan, np.nan) #assert_raises(FloatingPointError, np.log, x) with np.errstate(invalid='ignore'): assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) with np.errstate(invalid='raise'): x = np.array([np.inf + 1j * np.nan], dtype=complex) #assert_raises(FloatingPointError, np.log, x) with np.errstate(invalid='ignore'): assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) # clog(- inf + iy) returns +inf + ipi , for finite positive-signed y. x = np.array([-np.inf + 1j], dtype=complex) y = complex(np.inf, np.pi) assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) # clog(+ inf + iy) returns +inf + i0, for finite positive-signed y. x = np.array([np.inf + 1j], dtype=complex) y = complex(np.inf, 0) assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) # clog(- inf + i inf) returns +inf + i3pi /4. x = np.array([complex(-np.inf, np.inf)], dtype=complex) y = complex(np.inf, 0.75 * np.pi) assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) # clog(+ inf + i inf) returns +inf + ipi /4. x = np.array([complex(np.inf, np.inf)], dtype=complex) y = complex(np.inf, 0.25 * np.pi) assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) # clog(+/- inf + iNaN) returns +inf + iNaN. x = np.array([complex(np.inf, np.nan)], dtype=complex) y = complex(np.inf, np.nan) assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) x = np.array([complex(-np.inf, np.nan)], dtype=complex) assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) # clog(NaN + iy) returns NaN + iNaN and optionally raises the # 'invalid' floating-point exception, for finite y. x = np.array([complex(np.nan, 1)], dtype=complex) y = complex(np.nan, np.nan) assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) # clog(NaN + i inf) returns +inf + iNaN. x = np.array([complex(np.nan, np.inf)], dtype=complex) y = complex(np.inf, np.nan) assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) # clog(NaN + iNaN) returns NaN + iNaN. x = np.array([complex(np.nan, np.nan)], dtype=complex) y = complex(np.nan, np.nan) assert_almost_equal(np.log(x), y) xl.append(x) yl.append(y) # clog(conj(z)) = conj(clog(z)). xa = np.array(xl, dtype=complex) ya = np.array(yl, dtype=complex) with np.errstate(divide='ignore'): for i in range(len(xa)): assert_almost_equal(np.log(xa[i].conj()), ya[i].conj()) class TestCsqrt(object): def test_simple(self): # sqrt(1) yield check_complex_value, np.sqrt, 1, 0, 1, 0 # sqrt(1i) yield check_complex_value, np.sqrt, 0, 1, 0.5*np.sqrt(2), 0.5*np.sqrt(2), False # sqrt(-1) yield check_complex_value, np.sqrt, -1, 0, 0, 1 def test_simple_conjugate(self): ref = np.conj(np.sqrt(complex(1, 1))) def f(z): return np.sqrt(np.conj(z)) yield check_complex_value, f, 1, 1, ref.real, ref.imag, False #def test_branch_cut(self): # _check_branch_cut(f, -1, 0, 1, -1) @platform_skip def test_special_values(self): # C99: Sec G 6.4.2 check = check_complex_value f = np.sqrt # csqrt(+-0 + 0i) is 0 + 0i yield check, f, np.PZERO, 0, 0, 0 yield check, f, np.NZERO, 0, 0, 0 # csqrt(x + infi) is inf + infi for any x (including NaN) yield check, f, 1, np.inf, np.inf, np.inf yield check, f, -1, np.inf, np.inf, np.inf yield check, f, np.PZERO, np.inf, np.inf, np.inf yield check, f, np.NZERO, np.inf, np.inf, np.inf yield check, f, np.inf, np.inf, np.inf, np.inf yield check, f, -np.inf, np.inf, np.inf, np.inf yield check, f, -np.nan, np.inf, np.inf, np.inf # csqrt(x + nani) is nan + nani for any finite x yield check, f, 1, np.nan, np.nan, np.nan yield check, f, -1, np.nan, np.nan, np.nan yield check, f, 0, np.nan, np.nan, np.nan # csqrt(-inf + yi) is +0 + infi for any finite y > 0 yield check, f, -np.inf, 1, np.PZERO, np.inf # csqrt(inf + yi) is +inf + 0i for any finite y > 0 yield check, f, np.inf, 1, np.inf, np.PZERO # csqrt(-inf + nani) is nan +- infi (both +i infi are valid) def _check_ninf_nan(dummy): msgform = "csqrt(-inf, nan) is (%f, %f), expected (nan, +-inf)" z = np.sqrt(np.array(complex(-np.inf, np.nan))) #Fixme: ugly workaround for isinf bug. with np.errstate(invalid='ignore'): if not (np.isnan(z.real) and np.isinf(z.imag)): raise AssertionError(msgform % (z.real, z.imag)) yield _check_ninf_nan, None # csqrt(+inf + nani) is inf + nani yield check, f, np.inf, np.nan, np.inf, np.nan # csqrt(nan + yi) is nan + nani for any finite y (infinite handled in x # + nani) yield check, f, np.nan, 0, np.nan, np.nan yield check, f, np.nan, 1, np.nan, np.nan yield check, f, np.nan, np.nan, np.nan, np.nan # XXX: check for conj(csqrt(z)) == csqrt(conj(z)) (need to fix branch # cuts first) class TestCpow(object): def setUp(self): self.olderr = np.seterr(invalid='ignore') def tearDown(self): np.seterr(**self.olderr) def test_simple(self): x = np.array([1+1j, 0+2j, 1+2j, np.inf, np.nan]) y_r = x ** 2 y = np.power(x, 2) for i in range(len(x)): assert_almost_equal(y[i], y_r[i]) def test_scalar(self): x = np.array([1, 1j, 2, 2.5+.37j, np.inf, np.nan]) y = np.array([1, 1j, -0.5+1.5j, -0.5+1.5j, 2, 3]) lx = list(range(len(x))) # Compute the values for complex type in python p_r = [complex(x[i]) ** complex(y[i]) for i in lx] # Substitute a result allowed by C99 standard p_r[4] = complex(np.inf, np.nan) # Do the same with numpy complex scalars n_r = [x[i] ** y[i] for i in lx] for i in lx: assert_almost_equal(n_r[i], p_r[i], err_msg='Loop %d\n' % i) def test_array(self): x = np.array([1, 1j, 2, 2.5+.37j, np.inf, np.nan]) y = np.array([1, 1j, -0.5+1.5j, -0.5+1.5j, 2, 3]) lx = list(range(len(x))) # Compute the values for complex type in python p_r = [complex(x[i]) ** complex(y[i]) for i in lx] # Substitute a result allowed by C99 standard p_r[4] = complex(np.inf, np.nan) # Do the same with numpy arrays n_r = x ** y for i in lx: assert_almost_equal(n_r[i], p_r[i], err_msg='Loop %d\n' % i) class TestCabs(object): def setUp(self): self.olderr = np.seterr(invalid='ignore') def tearDown(self): np.seterr(**self.olderr) def test_simple(self): x = np.array([1+1j, 0+2j, 1+2j, np.inf, np.nan]) y_r = np.array([np.sqrt(2.), 2, np.sqrt(5), np.inf, np.nan]) y = np.abs(x) for i in range(len(x)): assert_almost_equal(y[i], y_r[i]) def test_fabs(self): # Test that np.abs(x +- 0j) == np.abs(x) (as mandated by C99 for cabs) x = np.array([1+0j], dtype=complex) assert_array_equal(np.abs(x), np.real(x)) x = np.array([complex(1, np.NZERO)], dtype=complex) assert_array_equal(np.abs(x), np.real(x)) x = np.array([complex(np.inf, np.NZERO)], dtype=complex) assert_array_equal(np.abs(x), np.real(x)) x = np.array([complex(np.nan, np.NZERO)], dtype=complex) assert_array_equal(np.abs(x), np.real(x)) def test_cabs_inf_nan(self): x, y = [], [] # cabs(+-nan + nani) returns nan x.append(np.nan) y.append(np.nan) yield check_real_value, np.abs, np.nan, np.nan, np.nan x.append(np.nan) y.append(-np.nan) yield check_real_value, np.abs, -np.nan, np.nan, np.nan # According to C99 standard, if exactly one of the real/part is inf and # the other nan, then cabs should return inf x.append(np.inf) y.append(np.nan) yield check_real_value, np.abs, np.inf, np.nan, np.inf x.append(-np.inf) y.append(np.nan) yield check_real_value, np.abs, -np.inf, np.nan, np.inf # cabs(conj(z)) == conj(cabs(z)) (= cabs(z)) def f(a): return np.abs(np.conj(a)) def g(a, b): return np.abs(complex(a, b)) xa = np.array(x, dtype=complex) for i in range(len(xa)): ref = g(x[i], y[i]) yield check_real_value, f, x[i], y[i], ref class TestCarg(object): def test_simple(self): check_real_value(ncu._arg, 1, 0, 0, False) check_real_value(ncu._arg, 0, 1, 0.5*np.pi, False) check_real_value(ncu._arg, 1, 1, 0.25*np.pi, False) check_real_value(ncu._arg, np.PZERO, np.PZERO, np.PZERO) @dec.knownfailureif(True, "Complex arithmetic with signed zero is buggy on most implementation") def test_zero(self): # carg(-0 +- 0i) returns +- pi yield check_real_value, ncu._arg, np.NZERO, np.PZERO, np.pi, False yield check_real_value, ncu._arg, np.NZERO, np.NZERO, -np.pi, False # carg(+0 +- 0i) returns +- 0 yield check_real_value, ncu._arg, np.PZERO, np.PZERO, np.PZERO yield check_real_value, ncu._arg, np.PZERO, np.NZERO, np.NZERO # carg(x +- 0i) returns +- 0 for x > 0 yield check_real_value, ncu._arg, 1, np.PZERO, np.PZERO, False yield check_real_value, ncu._arg, 1, np.NZERO, np.NZERO, False # carg(x +- 0i) returns +- pi for x < 0 yield check_real_value, ncu._arg, -1, np.PZERO, np.pi, False yield check_real_value, ncu._arg, -1, np.NZERO, -np.pi, False # carg(+- 0 + yi) returns pi/2 for y > 0 yield check_real_value, ncu._arg, np.PZERO, 1, 0.5 * np.pi, False yield check_real_value, ncu._arg, np.NZERO, 1, 0.5 * np.pi, False # carg(+- 0 + yi) returns -pi/2 for y < 0 yield check_real_value, ncu._arg, np.PZERO, -1, 0.5 * np.pi, False yield check_real_value, ncu._arg, np.NZERO, -1, -0.5 * np.pi, False #def test_branch_cuts(self): # _check_branch_cut(ncu._arg, -1, 1j, -1, 1) def test_special_values(self): # carg(-np.inf +- yi) returns +-pi for finite y > 0 yield check_real_value, ncu._arg, -np.inf, 1, np.pi, False yield check_real_value, ncu._arg, -np.inf, -1, -np.pi, False # carg(np.inf +- yi) returns +-0 for finite y > 0 yield check_real_value, ncu._arg, np.inf, 1, np.PZERO, False yield check_real_value, ncu._arg, np.inf, -1, np.NZERO, False # carg(x +- np.infi) returns +-pi/2 for finite x yield check_real_value, ncu._arg, 1, np.inf, 0.5 * np.pi, False yield check_real_value, ncu._arg, 1, -np.inf, -0.5 * np.pi, False # carg(-np.inf +- np.infi) returns +-3pi/4 yield check_real_value, ncu._arg, -np.inf, np.inf, 0.75 * np.pi, False yield check_real_value, ncu._arg, -np.inf, -np.inf, -0.75 * np.pi, False # carg(np.inf +- np.infi) returns +-pi/4 yield check_real_value, ncu._arg, np.inf, np.inf, 0.25 * np.pi, False yield check_real_value, ncu._arg, np.inf, -np.inf, -0.25 * np.pi, False # carg(x + yi) returns np.nan if x or y is nan yield check_real_value, ncu._arg, np.nan, 0, np.nan, False yield check_real_value, ncu._arg, 0, np.nan, np.nan, False yield check_real_value, ncu._arg, np.nan, np.inf, np.nan, False yield check_real_value, ncu._arg, np.inf, np.nan, np.nan, False def check_real_value(f, x1, y1, x, exact=True): z1 = np.array([complex(x1, y1)]) if exact: assert_equal(f(z1), x) else: assert_almost_equal(f(z1), x) def check_complex_value(f, x1, y1, x2, y2, exact=True): z1 = np.array([complex(x1, y1)]) z2 = complex(x2, y2) with np.errstate(invalid='ignore'): if exact: assert_equal(f(z1), z2) else: assert_almost_equal(f(z1), z2) if __name__ == "__main__": run_module_suite()
19,656
35.469388
87
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_records.py
from __future__ import division, absolute_import, print_function import sys import collections import pickle import warnings import textwrap from os import path import numpy as np from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_array_equal, assert_array_almost_equal, assert_raises, assert_warns ) class TestFromrecords(object): def test_fromrecords(self): r = np.rec.fromrecords([[456, 'dbe', 1.2], [2, 'de', 1.3]], names='col1,col2,col3') assert_equal(r[0].item(), (456, 'dbe', 1.2)) assert_equal(r['col1'].dtype.kind, 'i') if sys.version_info[0] >= 3: assert_equal(r['col2'].dtype.kind, 'U') assert_equal(r['col2'].dtype.itemsize, 12) else: assert_equal(r['col2'].dtype.kind, 'S') assert_equal(r['col2'].dtype.itemsize, 3) assert_equal(r['col3'].dtype.kind, 'f') def test_fromrecords_0len(self): """ Verify fromrecords works with a 0-length input """ dtype = [('a', float), ('b', float)] r = np.rec.fromrecords([], dtype=dtype) assert_equal(r.shape, (0,)) def test_fromrecords_2d(self): data = [ [(1, 2), (3, 4), (5, 6)], [(6, 5), (4, 3), (2, 1)] ] expected_a = [[1, 3, 5], [6, 4, 2]] expected_b = [[2, 4, 6], [5, 3, 1]] # try with dtype r1 = np.rec.fromrecords(data, dtype=[('a', int), ('b', int)]) assert_equal(r1['a'], expected_a) assert_equal(r1['b'], expected_b) # try with names r2 = np.rec.fromrecords(data, names=['a', 'b']) assert_equal(r2['a'], expected_a) assert_equal(r2['b'], expected_b) assert_equal(r1, r2) def test_fromrecords_list_of_lists(self): # gh-10870 : For numpy 1.14 we keep the deprecated behavior # that 1d list-of-lists input is accepted by fromrecords expected = np.rec.array([(1, 1.5), (2, 2.5)], dtype='i8,f8') with assert_warns(FutureWarning): r = np.rec.fromrecords([[1, 1.5], [2, 2.5]], dtype='i8,f8') assert_equal(r, expected) def test_method_array(self): r = np.rec.array(b'abcdefg' * 100, formats='i2,a3,i4', shape=3, byteorder='big') assert_equal(r[1].item(), (25444, b'efg', 1633837924)) def test_method_array2(self): r = np.rec.array([(1, 11, 'a'), (2, 22, 'b'), (3, 33, 'c'), (4, 44, 'd'), (5, 55, 'ex'), (6, 66, 'f'), (7, 77, 'g')], formats='u1,f4,a1') assert_equal(r[1].item(), (2, 22.0, b'b')) def test_recarray_slices(self): r = np.rec.array([(1, 11, 'a'), (2, 22, 'b'), (3, 33, 'c'), (4, 44, 'd'), (5, 55, 'ex'), (6, 66, 'f'), (7, 77, 'g')], formats='u1,f4,a1') assert_equal(r[1::2][1].item(), (4, 44.0, b'd')) def test_recarray_fromarrays(self): x1 = np.array([1, 2, 3, 4]) x2 = np.array(['a', 'dd', 'xyz', '12']) x3 = np.array([1.1, 2, 3, 4]) r = np.rec.fromarrays([x1, x2, x3], names='a,b,c') assert_equal(r[1].item(), (2, 'dd', 2.0)) x1[1] = 34 assert_equal(r.a, np.array([1, 2, 3, 4])) def test_recarray_fromfile(self): data_dir = path.join(path.dirname(__file__), 'data') filename = path.join(data_dir, 'recarray_from_file.fits') fd = open(filename, 'rb') fd.seek(2880 * 2) r1 = np.rec.fromfile(fd, formats='f8,i4,a5', shape=3, byteorder='big') fd.seek(2880 * 2) r2 = np.rec.array(fd, formats='f8,i4,a5', shape=3, byteorder='big') fd.close() assert_equal(r1, r2) def test_recarray_from_obj(self): count = 10 a = np.zeros(count, dtype='O') b = np.zeros(count, dtype='f8') c = np.zeros(count, dtype='f8') for i in range(len(a)): a[i] = list(range(1, 10)) mine = np.rec.fromarrays([a, b, c], names='date,data1,data2') for i in range(len(a)): assert_((mine.date[i] == list(range(1, 10)))) assert_((mine.data1[i] == 0.0)) assert_((mine.data2[i] == 0.0)) def test_recarray_repr(self): a = np.array([(1, 0.1), (2, 0.2)], dtype=[('foo', '<i4'), ('bar', '<f8')]) a = np.rec.array(a) assert_equal( repr(a), textwrap.dedent("""\ rec.array([(1, 0.1), (2, 0.2)], dtype=[('foo', '<i4'), ('bar', '<f8')])""") ) # make sure non-structured dtypes also show up as rec.array a = np.array(np.ones(4, dtype='f8')) assert_(repr(np.rec.array(a)).startswith('rec.array')) # check that the 'np.record' part of the dtype isn't shown a = np.rec.array(np.ones(3, dtype='i4,i4')) assert_equal(repr(a).find('numpy.record'), -1) a = np.rec.array(np.ones(3, dtype='i4')) assert_(repr(a).find('dtype=int32') != -1) def test_0d_recarray_repr(self): arr_0d = np.rec.array((1, 2.0, '2003'), dtype='<i4,<f8,<M8[Y]') assert_equal(repr(arr_0d), textwrap.dedent("""\ rec.array((1, 2., '2003'), dtype=[('f0', '<i4'), ('f1', '<f8'), ('f2', '<M8[Y]')])""")) record = arr_0d[()] assert_equal(repr(record), "(1, 2., '2003')") # 1.13 converted to python scalars before the repr try: np.set_printoptions(legacy='1.13') assert_equal(repr(record), '(1, 2.0, datetime.date(2003, 1, 1))') finally: np.set_printoptions(legacy=False) def test_recarray_from_repr(self): a = np.array([(1,'ABC'), (2, "DEF")], dtype=[('foo', int), ('bar', 'S4')]) recordarr = np.rec.array(a) recarr = a.view(np.recarray) recordview = a.view(np.dtype((np.record, a.dtype))) recordarr_r = eval("numpy." + repr(recordarr), {'numpy': np}) recarr_r = eval("numpy." + repr(recarr), {'numpy': np}) recordview_r = eval("numpy." + repr(recordview), {'numpy': np}) assert_equal(type(recordarr_r), np.recarray) assert_equal(recordarr_r.dtype.type, np.record) assert_equal(recordarr, recordarr_r) assert_equal(type(recarr_r), np.recarray) assert_equal(recarr_r.dtype.type, np.record) assert_equal(recarr, recarr_r) assert_equal(type(recordview_r), np.ndarray) assert_equal(recordview.dtype.type, np.record) assert_equal(recordview, recordview_r) def test_recarray_views(self): a = np.array([(1,'ABC'), (2, "DEF")], dtype=[('foo', int), ('bar', 'S4')]) b = np.array([1,2,3,4,5], dtype=np.int64) #check that np.rec.array gives right dtypes assert_equal(np.rec.array(a).dtype.type, np.record) assert_equal(type(np.rec.array(a)), np.recarray) assert_equal(np.rec.array(b).dtype.type, np.int64) assert_equal(type(np.rec.array(b)), np.recarray) #check that viewing as recarray does the same assert_equal(a.view(np.recarray).dtype.type, np.record) assert_equal(type(a.view(np.recarray)), np.recarray) assert_equal(b.view(np.recarray).dtype.type, np.int64) assert_equal(type(b.view(np.recarray)), np.recarray) #check that view to non-structured dtype preserves type=np.recarray r = np.rec.array(np.ones(4, dtype="f4,i4")) rv = r.view('f8').view('f4,i4') assert_equal(type(rv), np.recarray) assert_equal(rv.dtype.type, np.record) #check that getitem also preserves np.recarray and np.record r = np.rec.array(np.ones(4, dtype=[('a', 'i4'), ('b', 'i4'), ('c', 'i4,i4')])) assert_equal(r['c'].dtype.type, np.record) assert_equal(type(r['c']), np.recarray) #and that it preserves subclasses (gh-6949) class C(np.recarray): pass c = r.view(C) assert_equal(type(c['c']), C) # check that accessing nested structures keep record type, but # not for subarrays, non-void structures, non-structured voids test_dtype = [('a', 'f4,f4'), ('b', 'V8'), ('c', ('f4',2)), ('d', ('i8', 'i4,i4'))] r = np.rec.array([((1,1), b'11111111', [1,1], 1), ((1,1), b'11111111', [1,1], 1)], dtype=test_dtype) assert_equal(r.a.dtype.type, np.record) assert_equal(r.b.dtype.type, np.void) assert_equal(r.c.dtype.type, np.float32) assert_equal(r.d.dtype.type, np.int64) # check the same, but for views r = np.rec.array(np.ones(4, dtype='i4,i4')) assert_equal(r.view('f4,f4').dtype.type, np.record) assert_equal(r.view(('i4',2)).dtype.type, np.int32) assert_equal(r.view('V8').dtype.type, np.void) assert_equal(r.view(('i8', 'i4,i4')).dtype.type, np.int64) #check that we can undo the view arrs = [np.ones(4, dtype='f4,i4'), np.ones(4, dtype='f8')] for arr in arrs: rec = np.rec.array(arr) # recommended way to view as an ndarray: arr2 = rec.view(rec.dtype.fields or rec.dtype, np.ndarray) assert_equal(arr2.dtype.type, arr.dtype.type) assert_equal(type(arr2), type(arr)) def test_recarray_from_names(self): ra = np.rec.array([ (1, 'abc', 3.7000002861022949, 0), (2, 'xy', 6.6999998092651367, 1), (0, ' ', 0.40000000596046448, 0)], names='c1, c2, c3, c4') pa = np.rec.fromrecords([ (1, 'abc', 3.7000002861022949, 0), (2, 'xy', 6.6999998092651367, 1), (0, ' ', 0.40000000596046448, 0)], names='c1, c2, c3, c4') assert_(ra.dtype == pa.dtype) assert_(ra.shape == pa.shape) for k in range(len(ra)): assert_(ra[k].item() == pa[k].item()) def test_recarray_conflict_fields(self): ra = np.rec.array([(1, 'abc', 2.3), (2, 'xyz', 4.2), (3, 'wrs', 1.3)], names='field, shape, mean') ra.mean = [1.1, 2.2, 3.3] assert_array_almost_equal(ra['mean'], [1.1, 2.2, 3.3]) assert_(type(ra.mean) is type(ra.var)) ra.shape = (1, 3) assert_(ra.shape == (1, 3)) ra.shape = ['A', 'B', 'C'] assert_array_equal(ra['shape'], [['A', 'B', 'C']]) ra.field = 5 assert_array_equal(ra['field'], [[5, 5, 5]]) assert_(isinstance(ra.field, collections.Callable)) def test_fromrecords_with_explicit_dtype(self): a = np.rec.fromrecords([(1, 'a'), (2, 'bbb')], dtype=[('a', int), ('b', object)]) assert_equal(a.a, [1, 2]) assert_equal(a[0].a, 1) assert_equal(a.b, ['a', 'bbb']) assert_equal(a[-1].b, 'bbb') # ndtype = np.dtype([('a', int), ('b', object)]) a = np.rec.fromrecords([(1, 'a'), (2, 'bbb')], dtype=ndtype) assert_equal(a.a, [1, 2]) assert_equal(a[0].a, 1) assert_equal(a.b, ['a', 'bbb']) assert_equal(a[-1].b, 'bbb') def test_recarray_stringtypes(self): # Issue #3993 a = np.array([('abc ', 1), ('abc', 2)], dtype=[('foo', 'S4'), ('bar', int)]) a = a.view(np.recarray) assert_equal(a.foo[0] == a.foo[1], False) def test_recarray_returntypes(self): qux_fields = {'C': (np.dtype('S5'), 0), 'D': (np.dtype('S5'), 6)} a = np.rec.array([('abc ', (1,1), 1, ('abcde', 'fgehi')), ('abc', (2,3), 1, ('abcde', 'jklmn'))], dtype=[('foo', 'S4'), ('bar', [('A', int), ('B', int)]), ('baz', int), ('qux', qux_fields)]) assert_equal(type(a.foo), np.ndarray) assert_equal(type(a['foo']), np.ndarray) assert_equal(type(a.bar), np.recarray) assert_equal(type(a['bar']), np.recarray) assert_equal(a.bar.dtype.type, np.record) assert_equal(type(a['qux']), np.recarray) assert_equal(a.qux.dtype.type, np.record) assert_equal(dict(a.qux.dtype.fields), qux_fields) assert_equal(type(a.baz), np.ndarray) assert_equal(type(a['baz']), np.ndarray) assert_equal(type(a[0].bar), np.record) assert_equal(type(a[0]['bar']), np.record) assert_equal(a[0].bar.A, 1) assert_equal(a[0].bar['A'], 1) assert_equal(a[0]['bar'].A, 1) assert_equal(a[0]['bar']['A'], 1) assert_equal(a[0].qux.D, b'fgehi') assert_equal(a[0].qux['D'], b'fgehi') assert_equal(a[0]['qux'].D, b'fgehi') assert_equal(a[0]['qux']['D'], b'fgehi') def test_zero_width_strings(self): # Test for #6430, based on the test case from #1901 cols = [['test'] * 3, [''] * 3] rec = np.rec.fromarrays(cols) assert_equal(rec['f0'], ['test', 'test', 'test']) assert_equal(rec['f1'], ['', '', '']) dt = np.dtype([('f0', '|S4'), ('f1', '|S')]) rec = np.rec.fromarrays(cols, dtype=dt) assert_equal(rec.itemsize, 4) assert_equal(rec['f0'], [b'test', b'test', b'test']) assert_equal(rec['f1'], [b'', b'', b'']) class TestRecord(object): def setup(self): self.data = np.rec.fromrecords([(1, 2, 3), (4, 5, 6)], dtype=[("col1", "<i4"), ("col2", "<i4"), ("col3", "<i4")]) def test_assignment1(self): a = self.data assert_equal(a.col1[0], 1) a[0].col1 = 0 assert_equal(a.col1[0], 0) def test_assignment2(self): a = self.data assert_equal(a.col1[0], 1) a.col1[0] = 0 assert_equal(a.col1[0], 0) def test_invalid_assignment(self): a = self.data def assign_invalid_column(x): x[0].col5 = 1 assert_raises(AttributeError, assign_invalid_column, a) def test_nonwriteable_setfield(self): # gh-8171 r = np.rec.array([(0,), (1,)], dtype=[('f', 'i4')]) r.flags.writeable = False with assert_raises(ValueError): r.f = [2, 3] with assert_raises(ValueError): r.setfield([2,3], *r.dtype.fields['f']) def test_out_of_order_fields(self): dt = np.dtype({'names': ['a', 'b'], 'formats': ['i4', 'i4'], 'offsets': [4, 0]}) y = np.rec.fromrecords([(1, 2), (4, 5)], dtype=dt) assert_raises(ValueError, lambda: y.dtype.descr) def test_pickle_1(self): # Issue #1529 a = np.array([(1, [])], dtype=[('a', np.int32), ('b', np.int32, 0)]) assert_equal(a, pickle.loads(pickle.dumps(a))) assert_equal(a[0], pickle.loads(pickle.dumps(a[0]))) def test_pickle_2(self): a = self.data assert_equal(a, pickle.loads(pickle.dumps(a))) assert_equal(a[0], pickle.loads(pickle.dumps(a[0]))) def test_pickle_3(self): # Issue #7140 a = self.data pa = pickle.loads(pickle.dumps(a[0])) assert_(pa.flags.c_contiguous) assert_(pa.flags.f_contiguous) assert_(pa.flags.writeable) assert_(pa.flags.aligned) def test_objview_record(self): # https://github.com/numpy/numpy/issues/2599 dt = np.dtype([('foo', 'i8'), ('bar', 'O')]) r = np.zeros((1,3), dtype=dt).view(np.recarray) r.foo = np.array([1, 2, 3]) # TypeError? # https://github.com/numpy/numpy/issues/3256 ra = np.recarray((2,), dtype=[('x', object), ('y', float), ('z', int)]) with assert_warns(FutureWarning): ra[['x','y']] # TypeError? def test_record_scalar_setitem(self): # https://github.com/numpy/numpy/issues/3561 rec = np.recarray(1, dtype=[('x', float, 5)]) rec[0].x = 1 assert_equal(rec[0].x, np.ones(5)) def test_missing_field(self): # https://github.com/numpy/numpy/issues/4806 arr = np.zeros((3,), dtype=[('x', int), ('y', int)]) assert_raises(ValueError, lambda: arr[['nofield']]) def test_find_duplicate(): l1 = [1, 2, 3, 4, 5, 6] assert_(np.rec.find_duplicate(l1) == []) l2 = [1, 2, 1, 4, 5, 6] assert_(np.rec.find_duplicate(l2) == [1]) l3 = [1, 2, 1, 4, 1, 6, 2, 3] assert_(np.rec.find_duplicate(l3) == [1, 2]) l3 = [2, 2, 1, 4, 1, 6, 2, 3] assert_(np.rec.find_duplicate(l3) == [2, 1]) if __name__ == "__main__": run_module_suite()
16,692
37.82093
96
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_machar.py
""" Test machar. Given recent changes to hardcode type data, we might want to get rid of both MachAr and this test at some point. """ from __future__ import division, absolute_import, print_function from numpy.core.machar import MachAr import numpy.core.numerictypes as ntypes from numpy import errstate, array from numpy.testing import run_module_suite class TestMachAr(object): def _run_machar_highprec(self): # Instantiate MachAr instance with high enough precision to cause # underflow try: hiprec = ntypes.float96 MachAr(lambda v:array([v], hiprec)) except AttributeError: # Fixme, this needs to raise a 'skip' exception. "Skipping test: no ntypes.float96 available on this platform." def test_underlow(self): # Regression test for #759: # instantiating MachAr for dtype = np.float96 raises spurious warning. with errstate(all='raise'): try: self._run_machar_highprec() except FloatingPointError as e: msg = "Caught %s exception, should not have been raised." % e raise AssertionError(msg) if __name__ == "__main__": run_module_suite()
1,235
32.405405
78
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/__init__.py
0
0
0
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_numerictypes.py
from __future__ import division, absolute_import, print_function import sys import itertools import numpy as np from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_raises ) # This is the structure of the table used for plain objects: # # +-+-+-+ # |x|y|z| # +-+-+-+ # Structure of a plain array description: Pdescr = [ ('x', 'i4', (2,)), ('y', 'f8', (2, 2)), ('z', 'u1')] # A plain list of tuples with values for testing: PbufferT = [ # x y z ([3, 2], [[6., 4.], [6., 4.]], 8), ([4, 3], [[7., 5.], [7., 5.]], 9), ] # This is the structure of the table used for nested objects (DON'T PANIC!): # # +-+---------------------------------+-----+----------+-+-+ # |x|Info |color|info |y|z| # | +-----+--+----------------+----+--+ +----+-----+ | | # | |value|y2|Info2 |name|z2| |Name|Value| | | # | | | +----+-----+--+--+ | | | | | | | # | | | |name|value|y3|z3| | | | | | | | # +-+-----+--+----+-----+--+--+----+--+-----+----+-----+-+-+ # # The corresponding nested array description: Ndescr = [ ('x', 'i4', (2,)), ('Info', [ ('value', 'c16'), ('y2', 'f8'), ('Info2', [ ('name', 'S2'), ('value', 'c16', (2,)), ('y3', 'f8', (2,)), ('z3', 'u4', (2,))]), ('name', 'S2'), ('z2', 'b1')]), ('color', 'S2'), ('info', [ ('Name', 'U8'), ('Value', 'c16')]), ('y', 'f8', (2, 2)), ('z', 'u1')] NbufferT = [ # x Info color info y z # value y2 Info2 name z2 Name Value # name value y3 z3 ([3, 2], (6j, 6., (b'nn', [6j, 4j], [6., 4.], [1, 2]), b'NN', True), b'cc', (u'NN', 6j), [[6., 4.], [6., 4.]], 8), ([4, 3], (7j, 7., (b'oo', [7j, 5j], [7., 5.], [2, 1]), b'OO', False), b'dd', (u'OO', 7j), [[7., 5.], [7., 5.]], 9), ] byteorder = {'little':'<', 'big':'>'}[sys.byteorder] def normalize_descr(descr): "Normalize a description adding the platform byteorder." out = [] for item in descr: dtype = item[1] if isinstance(dtype, str): if dtype[0] not in ['|', '<', '>']: onebyte = dtype[1:] == "1" if onebyte or dtype[0] in ['S', 'V', 'b']: dtype = "|" + dtype else: dtype = byteorder + dtype if len(item) > 2 and np.prod(item[2]) > 1: nitem = (item[0], dtype, item[2]) else: nitem = (item[0], dtype) out.append(nitem) elif isinstance(item[1], list): l = [] for j in normalize_descr(item[1]): l.append(j) out.append((item[0], l)) else: raise ValueError("Expected a str or list and got %s" % (type(item))) return out ############################################################ # Creation tests ############################################################ class CreateZeros(object): """Check the creation of heterogeneous arrays zero-valued""" def test_zeros0D(self): """Check creation of 0-dimensional objects""" h = np.zeros((), dtype=self._descr) assert_(normalize_descr(self._descr) == h.dtype.descr) assert_(h.dtype.fields['x'][0].name[:4] == 'void') assert_(h.dtype.fields['x'][0].char == 'V') assert_(h.dtype.fields['x'][0].type == np.void) # A small check that data is ok assert_equal(h['z'], np.zeros((), dtype='u1')) def test_zerosSD(self): """Check creation of single-dimensional objects""" h = np.zeros((2,), dtype=self._descr) assert_(normalize_descr(self._descr) == h.dtype.descr) assert_(h.dtype['y'].name[:4] == 'void') assert_(h.dtype['y'].char == 'V') assert_(h.dtype['y'].type == np.void) # A small check that data is ok assert_equal(h['z'], np.zeros((2,), dtype='u1')) def test_zerosMD(self): """Check creation of multi-dimensional objects""" h = np.zeros((2, 3), dtype=self._descr) assert_(normalize_descr(self._descr) == h.dtype.descr) assert_(h.dtype['z'].name == 'uint8') assert_(h.dtype['z'].char == 'B') assert_(h.dtype['z'].type == np.uint8) # A small check that data is ok assert_equal(h['z'], np.zeros((2, 3), dtype='u1')) class TestCreateZerosPlain(CreateZeros): """Check the creation of heterogeneous arrays zero-valued (plain)""" _descr = Pdescr class TestCreateZerosNested(CreateZeros): """Check the creation of heterogeneous arrays zero-valued (nested)""" _descr = Ndescr class CreateValues(object): """Check the creation of heterogeneous arrays with values""" def test_tuple(self): """Check creation from tuples""" h = np.array(self._buffer, dtype=self._descr) assert_(normalize_descr(self._descr) == h.dtype.descr) if self.multiple_rows: assert_(h.shape == (2,)) else: assert_(h.shape == ()) def test_list_of_tuple(self): """Check creation from list of tuples""" h = np.array([self._buffer], dtype=self._descr) assert_(normalize_descr(self._descr) == h.dtype.descr) if self.multiple_rows: assert_(h.shape == (1, 2)) else: assert_(h.shape == (1,)) def test_list_of_list_of_tuple(self): """Check creation from list of list of tuples""" h = np.array([[self._buffer]], dtype=self._descr) assert_(normalize_descr(self._descr) == h.dtype.descr) if self.multiple_rows: assert_(h.shape == (1, 1, 2)) else: assert_(h.shape == (1, 1)) class TestCreateValuesPlainSingle(CreateValues): """Check the creation of heterogeneous arrays (plain, single row)""" _descr = Pdescr multiple_rows = 0 _buffer = PbufferT[0] class TestCreateValuesPlainMultiple(CreateValues): """Check the creation of heterogeneous arrays (plain, multiple rows)""" _descr = Pdescr multiple_rows = 1 _buffer = PbufferT class TestCreateValuesNestedSingle(CreateValues): """Check the creation of heterogeneous arrays (nested, single row)""" _descr = Ndescr multiple_rows = 0 _buffer = NbufferT[0] class TestCreateValuesNestedMultiple(CreateValues): """Check the creation of heterogeneous arrays (nested, multiple rows)""" _descr = Ndescr multiple_rows = 1 _buffer = NbufferT ############################################################ # Reading tests ############################################################ class ReadValuesPlain(object): """Check the reading of values in heterogeneous arrays (plain)""" def test_access_fields(self): h = np.array(self._buffer, dtype=self._descr) if not self.multiple_rows: assert_(h.shape == ()) assert_equal(h['x'], np.array(self._buffer[0], dtype='i4')) assert_equal(h['y'], np.array(self._buffer[1], dtype='f8')) assert_equal(h['z'], np.array(self._buffer[2], dtype='u1')) else: assert_(len(h) == 2) assert_equal(h['x'], np.array([self._buffer[0][0], self._buffer[1][0]], dtype='i4')) assert_equal(h['y'], np.array([self._buffer[0][1], self._buffer[1][1]], dtype='f8')) assert_equal(h['z'], np.array([self._buffer[0][2], self._buffer[1][2]], dtype='u1')) class TestReadValuesPlainSingle(ReadValuesPlain): """Check the creation of heterogeneous arrays (plain, single row)""" _descr = Pdescr multiple_rows = 0 _buffer = PbufferT[0] class TestReadValuesPlainMultiple(ReadValuesPlain): """Check the values of heterogeneous arrays (plain, multiple rows)""" _descr = Pdescr multiple_rows = 1 _buffer = PbufferT class ReadValuesNested(object): """Check the reading of values in heterogeneous arrays (nested)""" def test_access_top_fields(self): """Check reading the top fields of a nested array""" h = np.array(self._buffer, dtype=self._descr) if not self.multiple_rows: assert_(h.shape == ()) assert_equal(h['x'], np.array(self._buffer[0], dtype='i4')) assert_equal(h['y'], np.array(self._buffer[4], dtype='f8')) assert_equal(h['z'], np.array(self._buffer[5], dtype='u1')) else: assert_(len(h) == 2) assert_equal(h['x'], np.array([self._buffer[0][0], self._buffer[1][0]], dtype='i4')) assert_equal(h['y'], np.array([self._buffer[0][4], self._buffer[1][4]], dtype='f8')) assert_equal(h['z'], np.array([self._buffer[0][5], self._buffer[1][5]], dtype='u1')) def test_nested1_acessors(self): """Check reading the nested fields of a nested array (1st level)""" h = np.array(self._buffer, dtype=self._descr) if not self.multiple_rows: assert_equal(h['Info']['value'], np.array(self._buffer[1][0], dtype='c16')) assert_equal(h['Info']['y2'], np.array(self._buffer[1][1], dtype='f8')) assert_equal(h['info']['Name'], np.array(self._buffer[3][0], dtype='U2')) assert_equal(h['info']['Value'], np.array(self._buffer[3][1], dtype='c16')) else: assert_equal(h['Info']['value'], np.array([self._buffer[0][1][0], self._buffer[1][1][0]], dtype='c16')) assert_equal(h['Info']['y2'], np.array([self._buffer[0][1][1], self._buffer[1][1][1]], dtype='f8')) assert_equal(h['info']['Name'], np.array([self._buffer[0][3][0], self._buffer[1][3][0]], dtype='U2')) assert_equal(h['info']['Value'], np.array([self._buffer[0][3][1], self._buffer[1][3][1]], dtype='c16')) def test_nested2_acessors(self): """Check reading the nested fields of a nested array (2nd level)""" h = np.array(self._buffer, dtype=self._descr) if not self.multiple_rows: assert_equal(h['Info']['Info2']['value'], np.array(self._buffer[1][2][1], dtype='c16')) assert_equal(h['Info']['Info2']['z3'], np.array(self._buffer[1][2][3], dtype='u4')) else: assert_equal(h['Info']['Info2']['value'], np.array([self._buffer[0][1][2][1], self._buffer[1][1][2][1]], dtype='c16')) assert_equal(h['Info']['Info2']['z3'], np.array([self._buffer[0][1][2][3], self._buffer[1][1][2][3]], dtype='u4')) def test_nested1_descriptor(self): """Check access nested descriptors of a nested array (1st level)""" h = np.array(self._buffer, dtype=self._descr) assert_(h.dtype['Info']['value'].name == 'complex128') assert_(h.dtype['Info']['y2'].name == 'float64') if sys.version_info[0] >= 3: assert_(h.dtype['info']['Name'].name == 'str256') else: assert_(h.dtype['info']['Name'].name == 'unicode256') assert_(h.dtype['info']['Value'].name == 'complex128') def test_nested2_descriptor(self): """Check access nested descriptors of a nested array (2nd level)""" h = np.array(self._buffer, dtype=self._descr) assert_(h.dtype['Info']['Info2']['value'].name == 'void256') assert_(h.dtype['Info']['Info2']['z3'].name == 'void64') class TestReadValuesNestedSingle(ReadValuesNested): """Check the values of heterogeneous arrays (nested, single row)""" _descr = Ndescr multiple_rows = False _buffer = NbufferT[0] class TestReadValuesNestedMultiple(ReadValuesNested): """Check the values of heterogeneous arrays (nested, multiple rows)""" _descr = Ndescr multiple_rows = True _buffer = NbufferT class TestEmptyField(object): def test_assign(self): a = np.arange(10, dtype=np.float32) a.dtype = [("int", "<0i4"), ("float", "<2f4")] assert_(a['int'].shape == (5, 0)) assert_(a['float'].shape == (5, 2)) class TestCommonType(object): def test_scalar_loses1(self): res = np.find_common_type(['f4', 'f4', 'i2'], ['f8']) assert_(res == 'f4') def test_scalar_loses2(self): res = np.find_common_type(['f4', 'f4'], ['i8']) assert_(res == 'f4') def test_scalar_wins(self): res = np.find_common_type(['f4', 'f4', 'i2'], ['c8']) assert_(res == 'c8') def test_scalar_wins2(self): res = np.find_common_type(['u4', 'i4', 'i4'], ['f4']) assert_(res == 'f8') def test_scalar_wins3(self): # doesn't go up to 'f16' on purpose res = np.find_common_type(['u8', 'i8', 'i8'], ['f8']) assert_(res == 'f8') class TestMultipleFields(object): def setup(self): self.ary = np.array([(1, 2, 3, 4), (5, 6, 7, 8)], dtype='i4,f4,i2,c8') def _bad_call(self): return self.ary['f0', 'f1'] def test_no_tuple(self): assert_raises(IndexError, self._bad_call) def test_return(self): res = self.ary[['f0', 'f2']].tolist() assert_(res == [(1, 3), (5, 7)]) class TestIsSubDType(object): # scalar types can be promoted into dtypes wrappers = [np.dtype, lambda x: x] def test_both_abstract(self): assert_(np.issubdtype(np.floating, np.inexact)) assert_(not np.issubdtype(np.inexact, np.floating)) def test_same(self): for cls in (np.float32, np.int32): for w1, w2 in itertools.product(self.wrappers, repeat=2): assert_(np.issubdtype(w1(cls), w2(cls))) def test_subclass(self): # note we cannot promote floating to a dtype, as it would turn into a # concrete type for w in self.wrappers: assert_(np.issubdtype(w(np.float32), np.floating)) assert_(np.issubdtype(w(np.float64), np.floating)) def test_subclass_backwards(self): for w in self.wrappers: assert_(not np.issubdtype(np.floating, w(np.float32))) assert_(not np.issubdtype(np.floating, w(np.float64))) def test_sibling_class(self): for w1, w2 in itertools.product(self.wrappers, repeat=2): assert_(not np.issubdtype(w1(np.float32), w2(np.float64))) assert_(not np.issubdtype(w1(np.float64), w2(np.float32))) if __name__ == "__main__": run_module_suite()
15,412
36.229469
119
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_scalarprint.py
# -*- coding: utf-8 -*- """ Test printing of scalar types. """ from __future__ import division, absolute_import, print_function import code, sys from tempfile import TemporaryFile import numpy as np from numpy.testing import assert_, assert_equal, suppress_warnings,\ run_module_suite import sys, tempfile class TestRealScalars(object): def test_str(self): svals = [0.0, -0.0, 1, -1, np.inf, -np.inf, np.nan] styps = [np.float16, np.float32, np.float64, np.longdouble] wanted = [ ['0.0', '0.0', '0.0', '0.0' ], ['-0.0', '-0.0', '-0.0', '-0.0'], ['1.0', '1.0', '1.0', '1.0' ], ['-1.0', '-1.0', '-1.0', '-1.0'], ['inf', 'inf', 'inf', 'inf' ], ['-inf', '-inf', '-inf', '-inf'], ['nan', 'nan', 'nan', 'nan']] for wants, val in zip(wanted, svals): for want, styp in zip(wants, styps): msg = 'for str({}({}))'.format(np.dtype(styp).name, repr(val)) assert_equal(str(styp(val)), want, err_msg=msg) def test_scalar_cutoffs(self): # test that both the str and repr of np.float64 behaves # like python floats in python3. Note that in python2 # the str has truncated digits, but we do not do this def check(v): # we compare str to repr, to avoid python2 truncation behavior assert_equal(str(np.float64(v)), repr(v)) assert_equal(repr(np.float64(v)), repr(v)) # check we use the same number of significant digits check(1.12345678901234567890) check(0.0112345678901234567890) # check switch from scientific output to positional and back check(1e-5) check(1e-4) check(1e15) check(1e16) def test_py2_float_print(self): # gh-10753 # In python2, the python float type implements an obsolte method # tp_print, which overrides tp_repr and tp_str when using the "print" # keyword/method to output to a "real file" (ie, not a StringIO). Make # sure we don't inherit it. x = np.double(0.1999999999999) with TemporaryFile('r+t') as f: print(x, file=f) f.seek(0) output = f.read() assert_equal(output, str(x) + '\n') # In python2 the value float('0.1999999999999') prints with reduced # precision as '0.2', but we want numpy's np.double('0.1999999999999') # to print the unique value, '0.1999999999999'. # gh-11031 # Only in the python2 interactive shell and when stdout is a "real" # file, the output of the last command is printed to stdout without # Py_PRINT_RAW (unlike the print statement) so `>>> x` and `>>> print # x` are potentially different. Make sure they are the same. The only # way I found to get prompt-like output is using an actual prompt from # the 'code' module. Again, must use tempfile to get a "real" file. # dummy user-input which enters one line and then ctrl-Ds. def userinput(): yield 'np.sqrt(2)' raise EOFError gen = userinput() input_func = lambda prompt="": next(gen) with TemporaryFile('r+t') as fo, TemporaryFile('r+t') as fe: orig_stdout, orig_stderr = sys.stdout, sys.stderr sys.stdout, sys.stderr = fo, fe # py2 code.interact sends irrelevant internal DeprecationWarnings with suppress_warnings() as sup: sup.filter(DeprecationWarning) code.interact(local={'np': np}, readfunc=input_func, banner='') sys.stdout, sys.stderr = orig_stdout, orig_stderr fo.seek(0) capture = fo.read().strip() assert_equal(capture, repr(np.sqrt(2))) def test_dragon4(self): # these tests are adapted from Ryan Juckett's dragon4 implementation, # see dragon4.c for details. fpos32 = lambda x, **k: np.format_float_positional(np.float32(x), **k) fsci32 = lambda x, **k: np.format_float_scientific(np.float32(x), **k) fpos64 = lambda x, **k: np.format_float_positional(np.float64(x), **k) fsci64 = lambda x, **k: np.format_float_scientific(np.float64(x), **k) preckwd = lambda prec: {'unique': False, 'precision': prec} assert_equal(fpos32('1.0'), "1.") assert_equal(fsci32('1.0'), "1.e+00") assert_equal(fpos32('10.234'), "10.234") assert_equal(fpos32('-10.234'), "-10.234") assert_equal(fsci32('10.234'), "1.0234e+01") assert_equal(fsci32('-10.234'), "-1.0234e+01") assert_equal(fpos32('1000.0'), "1000.") assert_equal(fpos32('1.0', precision=0), "1.") assert_equal(fsci32('1.0', precision=0), "1.e+00") assert_equal(fpos32('10.234', precision=0), "10.") assert_equal(fpos32('-10.234', precision=0), "-10.") assert_equal(fsci32('10.234', precision=0), "1.e+01") assert_equal(fsci32('-10.234', precision=0), "-1.e+01") assert_equal(fpos32('10.234', precision=2), "10.23") assert_equal(fsci32('-10.234', precision=2), "-1.02e+01") assert_equal(fsci64('9.9999999999999995e-08', **preckwd(16)), '9.9999999999999995e-08') assert_equal(fsci64('9.8813129168249309e-324', **preckwd(16)), '9.8813129168249309e-324') assert_equal(fsci64('9.9999999999999694e-311', **preckwd(16)), '9.9999999999999694e-311') # test rounding # 3.1415927410 is closest float32 to np.pi assert_equal(fpos32('3.14159265358979323846', **preckwd(10)), "3.1415927410") assert_equal(fsci32('3.14159265358979323846', **preckwd(10)), "3.1415927410e+00") assert_equal(fpos64('3.14159265358979323846', **preckwd(10)), "3.1415926536") assert_equal(fsci64('3.14159265358979323846', **preckwd(10)), "3.1415926536e+00") # 299792448 is closest float32 to 299792458 assert_equal(fpos32('299792458.0', **preckwd(5)), "299792448.00000") assert_equal(fsci32('299792458.0', **preckwd(5)), "2.99792e+08") assert_equal(fpos64('299792458.0', **preckwd(5)), "299792458.00000") assert_equal(fsci64('299792458.0', **preckwd(5)), "2.99792e+08") assert_equal(fpos32('3.14159265358979323846', **preckwd(25)), "3.1415927410125732421875000") assert_equal(fpos64('3.14159265358979323846', **preckwd(50)), "3.14159265358979311599796346854418516159057617187500") assert_equal(fpos64('3.14159265358979323846'), "3.141592653589793") # smallest numbers assert_equal(fpos32(0.5**(126 + 23), unique=False, precision=149), "0.00000000000000000000000000000000000000000000140129846432" "4817070923729583289916131280261941876515771757068283889791" "08268586060148663818836212158203125") assert_equal(fpos64(0.5**(1022 + 52), unique=False, precision=1074), "0.00000000000000000000000000000000000000000000000000000000" "0000000000000000000000000000000000000000000000000000000000" "0000000000000000000000000000000000000000000000000000000000" "0000000000000000000000000000000000000000000000000000000000" "0000000000000000000000000000000000000000000000000000000000" "0000000000000000000000000000000000049406564584124654417656" "8792868221372365059802614324764425585682500675507270208751" "8652998363616359923797965646954457177309266567103559397963" "9877479601078187812630071319031140452784581716784898210368" "8718636056998730723050006387409153564984387312473397273169" "6151400317153853980741262385655911710266585566867681870395" "6031062493194527159149245532930545654440112748012970999954" "1931989409080416563324524757147869014726780159355238611550" "1348035264934720193790268107107491703332226844753335720832" "4319360923828934583680601060115061698097530783422773183292" "4790498252473077637592724787465608477820373446969953364701" "7972677717585125660551199131504891101451037862738167250955" "8373897335989936648099411642057026370902792427675445652290" "87538682506419718265533447265625") # largest numbers assert_equal(fpos32(np.finfo(np.float32).max, **preckwd(0)), "340282346638528859811704183484516925440.") assert_equal(fpos64(np.finfo(np.float64).max, **preckwd(0)), "1797693134862315708145274237317043567980705675258449965989" "1747680315726078002853876058955863276687817154045895351438" "2464234321326889464182768467546703537516986049910576551282" "0762454900903893289440758685084551339423045832369032229481" "6580855933212334827479782620414472316873817718091929988125" "0404026184124858368.") # Warning: In unique mode only the integer digits necessary for # uniqueness are computed, the rest are 0. Should we change this? assert_equal(fpos32(np.finfo(np.float32).max, precision=0), "340282350000000000000000000000000000000.") # test trailing zeros assert_equal(fpos32('1.0', unique=False, precision=3), "1.000") assert_equal(fpos64('1.0', unique=False, precision=3), "1.000") assert_equal(fsci32('1.0', unique=False, precision=3), "1.000e+00") assert_equal(fsci64('1.0', unique=False, precision=3), "1.000e+00") assert_equal(fpos32('1.5', unique=False, precision=3), "1.500") assert_equal(fpos64('1.5', unique=False, precision=3), "1.500") assert_equal(fsci32('1.5', unique=False, precision=3), "1.500e+00") assert_equal(fsci64('1.5', unique=False, precision=3), "1.500e+00") # gh-10713 assert_equal(fpos64('324', unique=False, precision=5, fractional=False), "324.00") def test_dragon4_interface(self): tps = [np.float16, np.float32, np.float64] if hasattr(np, 'float128'): tps.append(np.float128) fpos = np.format_float_positional fsci = np.format_float_scientific for tp in tps: # test padding assert_equal(fpos(tp('1.0'), pad_left=4, pad_right=4), " 1. ") assert_equal(fpos(tp('-1.0'), pad_left=4, pad_right=4), " -1. ") assert_equal(fpos(tp('-10.2'), pad_left=4, pad_right=4), " -10.2 ") # test exp_digits assert_equal(fsci(tp('1.23e1'), exp_digits=5), "1.23e+00001") # test fixed (non-unique) mode assert_equal(fpos(tp('1.0'), unique=False, precision=4), "1.0000") assert_equal(fsci(tp('1.0'), unique=False, precision=4), "1.0000e+00") # test trimming # trim of 'k' or '.' only affects non-unique mode, since unique # mode will not output trailing 0s. assert_equal(fpos(tp('1.'), unique=False, precision=4, trim='k'), "1.0000") assert_equal(fpos(tp('1.'), unique=False, precision=4, trim='.'), "1.") assert_equal(fpos(tp('1.2'), unique=False, precision=4, trim='.'), "1.2" if tp != np.float16 else "1.2002") assert_equal(fpos(tp('1.'), unique=False, precision=4, trim='0'), "1.0") assert_equal(fpos(tp('1.2'), unique=False, precision=4, trim='0'), "1.2" if tp != np.float16 else "1.2002") assert_equal(fpos(tp('1.'), trim='0'), "1.0") assert_equal(fpos(tp('1.'), unique=False, precision=4, trim='-'), "1") assert_equal(fpos(tp('1.2'), unique=False, precision=4, trim='-'), "1.2" if tp != np.float16 else "1.2002") assert_equal(fpos(tp('1.'), trim='-'), "1") def float32_roundtrip(self): # gh-9360 x = np.float32(1024 - 2**-14) y = np.float32(1024 - 2**-13) assert_(repr(x) != repr(y)) assert_equal(np.float32(repr(x)), x) assert_equal(np.float32(repr(y)), y) def float64_vs_python(self): # gh-2643, gh-6136, gh-6908 assert_equal(repr(np.float64(0.1)), repr(0.1)) assert_(repr(np.float64(0.20000000000000004)) != repr(0.2)) if __name__ == "__main__": run_module_suite()
13,011
47.371747
90
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_multiarray.py
from __future__ import division, absolute_import, print_function import collections import tempfile import sys import shutil import warnings import operator import io import itertools import functools import ctypes import os import gc from contextlib import contextmanager if sys.version_info[0] >= 3: import builtins else: import __builtin__ as builtins from decimal import Decimal from unittest import TestCase import numpy as np from numpy.compat import strchar, unicode from numpy.core.tests.test_print import in_foreign_locale from numpy.core.multiarray_tests import ( test_neighborhood_iterator, test_neighborhood_iterator_oob, test_pydatamem_seteventhook_start, test_pydatamem_seteventhook_end, test_inplace_increment, get_buffer_info, test_as_c_array, ) from numpy.testing import ( run_module_suite, assert_, assert_raises, assert_warns, assert_equal, assert_almost_equal, assert_array_equal, assert_raises_regex, assert_array_almost_equal, assert_allclose, IS_PYPY, HAS_REFCOUNT, assert_array_less, runstring, dec, SkipTest, temppath, suppress_warnings ) # Need to test an object that does not fully implement math interface from datetime import timedelta, datetime if sys.version_info[:2] > (3, 2): # In Python 3.3 the representation of empty shape, strides and sub-offsets # is an empty tuple instead of None. # http://docs.python.org/dev/whatsnew/3.3.html#api-changes EMPTY = () else: EMPTY = None def _aligned_zeros(shape, dtype=float, order="C", align=None): """Allocate a new ndarray with aligned memory.""" dtype = np.dtype(dtype) if dtype == np.dtype(object): # Can't do this, fall back to standard allocation (which # should always be sufficiently aligned) if align is not None: raise ValueError("object array alignment not supported") return np.zeros(shape, dtype=dtype, order=order) if align is None: align = dtype.alignment if not hasattr(shape, '__len__'): shape = (shape,) size = functools.reduce(operator.mul, shape) * dtype.itemsize buf = np.empty(size + align + 1, np.uint8) offset = buf.__array_interface__['data'][0] % align if offset != 0: offset = align - offset # Note: slices producing 0-size arrays do not necessarily change # data pointer --- so we use and allocate size+1 buf = buf[offset:offset+size+1][:-1] data = np.ndarray(shape, dtype, buf, order=order) data.fill(0) return data class TestFlags(object): def setup(self): self.a = np.arange(10) def test_writeable(self): mydict = locals() self.a.flags.writeable = False assert_raises(ValueError, runstring, 'self.a[0] = 3', mydict) assert_raises(ValueError, runstring, 'self.a[0:1].itemset(3)', mydict) self.a.flags.writeable = True self.a[0] = 5 self.a[0] = 0 def test_otherflags(self): assert_equal(self.a.flags.carray, True) assert_equal(self.a.flags['C'], True) assert_equal(self.a.flags.farray, False) assert_equal(self.a.flags.behaved, True) assert_equal(self.a.flags.fnc, False) assert_equal(self.a.flags.forc, True) assert_equal(self.a.flags.owndata, True) assert_equal(self.a.flags.writeable, True) assert_equal(self.a.flags.aligned, True) with assert_warns(DeprecationWarning): assert_equal(self.a.flags.updateifcopy, False) with assert_warns(DeprecationWarning): assert_equal(self.a.flags['U'], False) assert_equal(self.a.flags['UPDATEIFCOPY'], False) assert_equal(self.a.flags.writebackifcopy, False) assert_equal(self.a.flags['X'], False) assert_equal(self.a.flags['WRITEBACKIFCOPY'], False) def test_string_align(self): a = np.zeros(4, dtype=np.dtype('|S4')) assert_(a.flags.aligned) # not power of two are accessed byte-wise and thus considered aligned a = np.zeros(5, dtype=np.dtype('|S4')) assert_(a.flags.aligned) def test_void_align(self): a = np.zeros(4, dtype=np.dtype([("a", "i4"), ("b", "i4")])) assert_(a.flags.aligned) class TestHash(object): # see #3793 def test_int(self): for st, ut, s in [(np.int8, np.uint8, 8), (np.int16, np.uint16, 16), (np.int32, np.uint32, 32), (np.int64, np.uint64, 64)]: for i in range(1, s): assert_equal(hash(st(-2**i)), hash(-2**i), err_msg="%r: -2**%d" % (st, i)) assert_equal(hash(st(2**(i - 1))), hash(2**(i - 1)), err_msg="%r: 2**%d" % (st, i - 1)) assert_equal(hash(st(2**i - 1)), hash(2**i - 1), err_msg="%r: 2**%d - 1" % (st, i)) i = max(i - 1, 1) assert_equal(hash(ut(2**(i - 1))), hash(2**(i - 1)), err_msg="%r: 2**%d" % (ut, i - 1)) assert_equal(hash(ut(2**i - 1)), hash(2**i - 1), err_msg="%r: 2**%d - 1" % (ut, i)) class TestAttributes(object): def setup(self): self.one = np.arange(10) self.two = np.arange(20).reshape(4, 5) self.three = np.arange(60, dtype=np.float64).reshape(2, 5, 6) def test_attributes(self): assert_equal(self.one.shape, (10,)) assert_equal(self.two.shape, (4, 5)) assert_equal(self.three.shape, (2, 5, 6)) self.three.shape = (10, 3, 2) assert_equal(self.three.shape, (10, 3, 2)) self.three.shape = (2, 5, 6) assert_equal(self.one.strides, (self.one.itemsize,)) num = self.two.itemsize assert_equal(self.two.strides, (5*num, num)) num = self.three.itemsize assert_equal(self.three.strides, (30*num, 6*num, num)) assert_equal(self.one.ndim, 1) assert_equal(self.two.ndim, 2) assert_equal(self.three.ndim, 3) num = self.two.itemsize assert_equal(self.two.size, 20) assert_equal(self.two.nbytes, 20*num) assert_equal(self.two.itemsize, self.two.dtype.itemsize) assert_equal(self.two.base, np.arange(20)) def test_dtypeattr(self): assert_equal(self.one.dtype, np.dtype(np.int_)) assert_equal(self.three.dtype, np.dtype(np.float_)) assert_equal(self.one.dtype.char, 'l') assert_equal(self.three.dtype.char, 'd') assert_(self.three.dtype.str[0] in '<>') assert_equal(self.one.dtype.str[1], 'i') assert_equal(self.three.dtype.str[1], 'f') def test_int_subclassing(self): # Regression test for https://github.com/numpy/numpy/pull/3526 numpy_int = np.int_(0) if sys.version_info[0] >= 3: # On Py3k int_ should not inherit from int, because it's not # fixed-width anymore assert_equal(isinstance(numpy_int, int), False) else: # Otherwise, it should inherit from int... assert_equal(isinstance(numpy_int, int), True) # ... and fast-path checks on C-API level should also work from numpy.core.multiarray_tests import test_int_subclass assert_equal(test_int_subclass(numpy_int), True) def test_stridesattr(self): x = self.one def make_array(size, offset, strides): return np.ndarray(size, buffer=x, dtype=int, offset=offset*x.itemsize, strides=strides*x.itemsize) assert_equal(make_array(4, 4, -1), np.array([4, 3, 2, 1])) assert_raises(ValueError, make_array, 4, 4, -2) assert_raises(ValueError, make_array, 4, 2, -1) assert_raises(ValueError, make_array, 8, 3, 1) assert_equal(make_array(8, 3, 0), np.array([3]*8)) # Check behavior reported in gh-2503: assert_raises(ValueError, make_array, (2, 3), 5, np.array([-2, -3])) make_array(0, 0, 10) def test_set_stridesattr(self): x = self.one def make_array(size, offset, strides): try: r = np.ndarray([size], dtype=int, buffer=x, offset=offset*x.itemsize) except Exception as e: raise RuntimeError(e) r.strides = strides = strides*x.itemsize return r assert_equal(make_array(4, 4, -1), np.array([4, 3, 2, 1])) assert_equal(make_array(7, 3, 1), np.array([3, 4, 5, 6, 7, 8, 9])) assert_raises(ValueError, make_array, 4, 4, -2) assert_raises(ValueError, make_array, 4, 2, -1) assert_raises(RuntimeError, make_array, 8, 3, 1) # Check that the true extent of the array is used. # Test relies on as_strided base not exposing a buffer. x = np.lib.stride_tricks.as_strided(np.arange(1), (10, 10), (0, 0)) def set_strides(arr, strides): arr.strides = strides assert_raises(ValueError, set_strides, x, (10*x.itemsize, x.itemsize)) # Test for offset calculations: x = np.lib.stride_tricks.as_strided(np.arange(10, dtype=np.int8)[-1], shape=(10,), strides=(-1,)) assert_raises(ValueError, set_strides, x[::-1], -1) a = x[::-1] a.strides = 1 a[::2].strides = 2 def test_fill(self): for t in "?bhilqpBHILQPfdgFDGO": x = np.empty((3, 2, 1), t) y = np.empty((3, 2, 1), t) x.fill(1) y[...] = 1 assert_equal(x, y) def test_fill_max_uint64(self): x = np.empty((3, 2, 1), dtype=np.uint64) y = np.empty((3, 2, 1), dtype=np.uint64) value = 2**64 - 1 y[...] = value x.fill(value) assert_array_equal(x, y) def test_fill_struct_array(self): # Filling from a scalar x = np.array([(0, 0.0), (1, 1.0)], dtype='i4,f8') x.fill(x[0]) assert_equal(x['f1'][1], x['f1'][0]) # Filling from a tuple that can be converted # to a scalar x = np.zeros(2, dtype=[('a', 'f8'), ('b', 'i4')]) x.fill((3.5, -2)) assert_array_equal(x['a'], [3.5, 3.5]) assert_array_equal(x['b'], [-2, -2]) class TestArrayConstruction(object): def test_array(self): d = np.ones(6) r = np.array([d, d]) assert_equal(r, np.ones((2, 6))) d = np.ones(6) tgt = np.ones((2, 6)) r = np.array([d, d]) assert_equal(r, tgt) tgt[1] = 2 r = np.array([d, d + 1]) assert_equal(r, tgt) d = np.ones(6) r = np.array([[d, d]]) assert_equal(r, np.ones((1, 2, 6))) d = np.ones(6) r = np.array([[d, d], [d, d]]) assert_equal(r, np.ones((2, 2, 6))) d = np.ones((6, 6)) r = np.array([d, d]) assert_equal(r, np.ones((2, 6, 6))) d = np.ones((6, )) r = np.array([[d, d + 1], d + 2]) assert_equal(len(r), 2) assert_equal(r[0], [d, d + 1]) assert_equal(r[1], d + 2) tgt = np.ones((2, 3), dtype=bool) tgt[0, 2] = False tgt[1, 0:2] = False r = np.array([[True, True, False], [False, False, True]]) assert_equal(r, tgt) r = np.array([[True, False], [True, False], [False, True]]) assert_equal(r, tgt.T) def test_array_empty(self): assert_raises(TypeError, np.array) def test_array_copy_false(self): d = np.array([1, 2, 3]) e = np.array(d, copy=False) d[1] = 3 assert_array_equal(e, [1, 3, 3]) e = np.array(d, copy=False, order='F') d[1] = 4 assert_array_equal(e, [1, 4, 3]) e[2] = 7 assert_array_equal(d, [1, 4, 7]) def test_array_copy_true(self): d = np.array([[1,2,3], [1, 2, 3]]) e = np.array(d, copy=True) d[0, 1] = 3 e[0, 2] = -7 assert_array_equal(e, [[1, 2, -7], [1, 2, 3]]) assert_array_equal(d, [[1, 3, 3], [1, 2, 3]]) e = np.array(d, copy=True, order='F') d[0, 1] = 5 e[0, 2] = 7 assert_array_equal(e, [[1, 3, 7], [1, 2, 3]]) assert_array_equal(d, [[1, 5, 3], [1,2,3]]) def test_array_cont(self): d = np.ones(10)[::2] assert_(np.ascontiguousarray(d).flags.c_contiguous) assert_(np.ascontiguousarray(d).flags.f_contiguous) assert_(np.asfortranarray(d).flags.c_contiguous) assert_(np.asfortranarray(d).flags.f_contiguous) d = np.ones((10, 10))[::2,::2] assert_(np.ascontiguousarray(d).flags.c_contiguous) assert_(np.asfortranarray(d).flags.f_contiguous) class TestAssignment(object): def test_assignment_broadcasting(self): a = np.arange(6).reshape(2, 3) # Broadcasting the input to the output a[...] = np.arange(3) assert_equal(a, [[0, 1, 2], [0, 1, 2]]) a[...] = np.arange(2).reshape(2, 1) assert_equal(a, [[0, 0, 0], [1, 1, 1]]) # For compatibility with <= 1.5, a limited version of broadcasting # the output to the input. # # This behavior is inconsistent with NumPy broadcasting # in general, because it only uses one of the two broadcasting # rules (adding a new "1" dimension to the left of the shape), # applied to the output instead of an input. In NumPy 2.0, this kind # of broadcasting assignment will likely be disallowed. a[...] = np.arange(6)[::-1].reshape(1, 2, 3) assert_equal(a, [[5, 4, 3], [2, 1, 0]]) # The other type of broadcasting would require a reduction operation. def assign(a, b): a[...] = b assert_raises(ValueError, assign, a, np.arange(12).reshape(2, 2, 3)) def test_assignment_errors(self): # Address issue #2276 class C: pass a = np.zeros(1) def assign(v): a[0] = v assert_raises((AttributeError, TypeError), assign, C()) assert_raises(ValueError, assign, [1]) def test_unicode_assignment(self): # gh-5049 from numpy.core.numeric import set_string_function @contextmanager def inject_str(s): """ replace ndarray.__str__ temporarily """ set_string_function(lambda x: s, repr=False) try: yield finally: set_string_function(None, repr=False) a1d = np.array([u'test']) a0d = np.array(u'done') with inject_str(u'bad'): a1d[0] = a0d # previously this would invoke __str__ assert_equal(a1d[0], u'done') # this would crash for the same reason np.array([np.array(u'\xe5\xe4\xf6')]) def test_stringlike_empty_list(self): # gh-8902 u = np.array([u'done']) b = np.array([b'done']) class bad_sequence(object): def __getitem__(self): pass def __len__(self): raise RuntimeError assert_raises(ValueError, operator.setitem, u, 0, []) assert_raises(ValueError, operator.setitem, b, 0, []) assert_raises(ValueError, operator.setitem, u, 0, bad_sequence()) assert_raises(ValueError, operator.setitem, b, 0, bad_sequence()) def test_longdouble_assignment(self): # only relevant if longdouble is larger than float # we're looking for loss of precision for dtype in (np.longdouble, np.longcomplex): # gh-8902 tinyb = np.nextafter(np.longdouble(0), 1).astype(dtype) tinya = np.nextafter(np.longdouble(0), -1).astype(dtype) # construction tiny1d = np.array([tinya]) assert_equal(tiny1d[0], tinya) # scalar = scalar tiny1d[0] = tinyb assert_equal(tiny1d[0], tinyb) # 0d = scalar tiny1d[0, ...] = tinya assert_equal(tiny1d[0], tinya) # 0d = 0d tiny1d[0, ...] = tinyb[...] assert_equal(tiny1d[0], tinyb) # scalar = 0d tiny1d[0] = tinyb[...] assert_equal(tiny1d[0], tinyb) arr = np.array([np.array(tinya)]) assert_equal(arr[0], tinya) def test_cast_to_string(self): # cast to str should do "str(scalar)", not "str(scalar.item())" # Example: In python2, str(float) is truncated, so we want to avoid # str(np.float64(...).item()) as this would incorrectly truncate. a = np.zeros(1, dtype='S20') a[:] = np.array(['1.12345678901234567890'], dtype='f8') assert_equal(a[0], b"1.1234567890123457") class TestDtypedescr(object): def test_construction(self): d1 = np.dtype('i4') assert_equal(d1, np.dtype(np.int32)) d2 = np.dtype('f8') assert_equal(d2, np.dtype(np.float64)) def test_byteorders(self): assert_(np.dtype('<i4') != np.dtype('>i4')) assert_(np.dtype([('a', '<i4')]) != np.dtype([('a', '>i4')])) def test_structured_non_void(self): fields = [('a', '<i2'), ('b', '<i2')] dt_int = np.dtype(('i4', fields)) assert_equal(str(dt_int), "(numpy.int32, [('a', '<i2'), ('b', '<i2')])") # gh-9821 arr_int = np.zeros(4, dt_int) assert_equal(repr(arr_int), "array([0, 0, 0, 0], dtype=(numpy.int32, [('a', '<i2'), ('b', '<i2')]))") class TestZeroRank(object): def setup(self): self.d = np.array(0), np.array('x', object) def test_ellipsis_subscript(self): a, b = self.d assert_equal(a[...], 0) assert_equal(b[...], 'x') assert_(a[...].base is a) # `a[...] is a` in numpy <1.9. assert_(b[...].base is b) # `b[...] is b` in numpy <1.9. def test_empty_subscript(self): a, b = self.d assert_equal(a[()], 0) assert_equal(b[()], 'x') assert_(type(a[()]) is a.dtype.type) assert_(type(b[()]) is str) def test_invalid_subscript(self): a, b = self.d assert_raises(IndexError, lambda x: x[0], a) assert_raises(IndexError, lambda x: x[0], b) assert_raises(IndexError, lambda x: x[np.array([], int)], a) assert_raises(IndexError, lambda x: x[np.array([], int)], b) def test_ellipsis_subscript_assignment(self): a, b = self.d a[...] = 42 assert_equal(a, 42) b[...] = '' assert_equal(b.item(), '') def test_empty_subscript_assignment(self): a, b = self.d a[()] = 42 assert_equal(a, 42) b[()] = '' assert_equal(b.item(), '') def test_invalid_subscript_assignment(self): a, b = self.d def assign(x, i, v): x[i] = v assert_raises(IndexError, assign, a, 0, 42) assert_raises(IndexError, assign, b, 0, '') assert_raises(ValueError, assign, a, (), '') def test_newaxis(self): a, b = self.d assert_equal(a[np.newaxis].shape, (1,)) assert_equal(a[..., np.newaxis].shape, (1,)) assert_equal(a[np.newaxis, ...].shape, (1,)) assert_equal(a[..., np.newaxis].shape, (1,)) assert_equal(a[np.newaxis, ..., np.newaxis].shape, (1, 1)) assert_equal(a[..., np.newaxis, np.newaxis].shape, (1, 1)) assert_equal(a[np.newaxis, np.newaxis, ...].shape, (1, 1)) assert_equal(a[(np.newaxis,)*10].shape, (1,)*10) def test_invalid_newaxis(self): a, b = self.d def subscript(x, i): x[i] assert_raises(IndexError, subscript, a, (np.newaxis, 0)) assert_raises(IndexError, subscript, a, (np.newaxis,)*50) def test_constructor(self): x = np.ndarray(()) x[()] = 5 assert_equal(x[()], 5) y = np.ndarray((), buffer=x) y[()] = 6 assert_equal(x[()], 6) def test_output(self): x = np.array(2) assert_raises(ValueError, np.add, x, [1], x) class TestScalarIndexing(object): def setup(self): self.d = np.array([0, 1])[0] def test_ellipsis_subscript(self): a = self.d assert_equal(a[...], 0) assert_equal(a[...].shape, ()) def test_empty_subscript(self): a = self.d assert_equal(a[()], 0) assert_equal(a[()].shape, ()) def test_invalid_subscript(self): a = self.d assert_raises(IndexError, lambda x: x[0], a) assert_raises(IndexError, lambda x: x[np.array([], int)], a) def test_invalid_subscript_assignment(self): a = self.d def assign(x, i, v): x[i] = v assert_raises(TypeError, assign, a, 0, 42) def test_newaxis(self): a = self.d assert_equal(a[np.newaxis].shape, (1,)) assert_equal(a[..., np.newaxis].shape, (1,)) assert_equal(a[np.newaxis, ...].shape, (1,)) assert_equal(a[..., np.newaxis].shape, (1,)) assert_equal(a[np.newaxis, ..., np.newaxis].shape, (1, 1)) assert_equal(a[..., np.newaxis, np.newaxis].shape, (1, 1)) assert_equal(a[np.newaxis, np.newaxis, ...].shape, (1, 1)) assert_equal(a[(np.newaxis,)*10].shape, (1,)*10) def test_invalid_newaxis(self): a = self.d def subscript(x, i): x[i] assert_raises(IndexError, subscript, a, (np.newaxis, 0)) assert_raises(IndexError, subscript, a, (np.newaxis,)*50) def test_overlapping_assignment(self): # With positive strides a = np.arange(4) a[:-1] = a[1:] assert_equal(a, [1, 2, 3, 3]) a = np.arange(4) a[1:] = a[:-1] assert_equal(a, [0, 0, 1, 2]) # With positive and negative strides a = np.arange(4) a[:] = a[::-1] assert_equal(a, [3, 2, 1, 0]) a = np.arange(6).reshape(2, 3) a[::-1,:] = a[:, ::-1] assert_equal(a, [[5, 4, 3], [2, 1, 0]]) a = np.arange(6).reshape(2, 3) a[::-1, ::-1] = a[:, ::-1] assert_equal(a, [[3, 4, 5], [0, 1, 2]]) # With just one element overlapping a = np.arange(5) a[:3] = a[2:] assert_equal(a, [2, 3, 4, 3, 4]) a = np.arange(5) a[2:] = a[:3] assert_equal(a, [0, 1, 0, 1, 2]) a = np.arange(5) a[2::-1] = a[2:] assert_equal(a, [4, 3, 2, 3, 4]) a = np.arange(5) a[2:] = a[2::-1] assert_equal(a, [0, 1, 2, 1, 0]) a = np.arange(5) a[2::-1] = a[:1:-1] assert_equal(a, [2, 3, 4, 3, 4]) a = np.arange(5) a[:1:-1] = a[2::-1] assert_equal(a, [0, 1, 0, 1, 2]) class TestCreation(object): def test_from_attribute(self): class x(object): def __array__(self, dtype=None): pass assert_raises(ValueError, np.array, x()) def test_from_string(self): types = np.typecodes['AllInteger'] + np.typecodes['Float'] nstr = ['123', '123'] result = np.array([123, 123], dtype=int) for type in types: msg = 'String conversion for %s' % type assert_equal(np.array(nstr, dtype=type), result, err_msg=msg) def test_void(self): arr = np.array([], dtype='V') assert_equal(arr.dtype.kind, 'V') def test_too_big_error(self): # 45341 is the smallest integer greater than sqrt(2**31 - 1). # 3037000500 is the smallest integer greater than sqrt(2**63 - 1). # We want to make sure that the square byte array with those dimensions # is too big on 32 or 64 bit systems respectively. if np.iinfo('intp').max == 2**31 - 1: shape = (46341, 46341) elif np.iinfo('intp').max == 2**63 - 1: shape = (3037000500, 3037000500) else: return assert_raises(ValueError, np.empty, shape, dtype=np.int8) assert_raises(ValueError, np.zeros, shape, dtype=np.int8) assert_raises(ValueError, np.ones, shape, dtype=np.int8) def test_zeros(self): types = np.typecodes['AllInteger'] + np.typecodes['AllFloat'] for dt in types: d = np.zeros((13,), dtype=dt) assert_equal(np.count_nonzero(d), 0) # true for ieee floats assert_equal(d.sum(), 0) assert_(not d.any()) d = np.zeros(2, dtype='(2,4)i4') assert_equal(np.count_nonzero(d), 0) assert_equal(d.sum(), 0) assert_(not d.any()) d = np.zeros(2, dtype='4i4') assert_equal(np.count_nonzero(d), 0) assert_equal(d.sum(), 0) assert_(not d.any()) d = np.zeros(2, dtype='(2,4)i4, (2,4)i4') assert_equal(np.count_nonzero(d), 0) @dec.slow def test_zeros_big(self): # test big array as they might be allocated different by the system types = np.typecodes['AllInteger'] + np.typecodes['AllFloat'] for dt in types: d = np.zeros((30 * 1024**2,), dtype=dt) assert_(not d.any()) # This test can fail on 32-bit systems due to insufficient # contiguous memory. Deallocating the previous array increases the # chance of success. del(d) def test_zeros_obj(self): # test initialization from PyLong(0) d = np.zeros((13,), dtype=object) assert_array_equal(d, [0] * 13) assert_equal(np.count_nonzero(d), 0) def test_zeros_obj_obj(self): d = np.zeros(10, dtype=[('k', object, 2)]) assert_array_equal(d['k'], 0) def test_zeros_like_like_zeros(self): # test zeros_like returns the same as zeros for c in np.typecodes['All']: if c == 'V': continue d = np.zeros((3,3), dtype=c) assert_array_equal(np.zeros_like(d), d) assert_equal(np.zeros_like(d).dtype, d.dtype) # explicitly check some special cases d = np.zeros((3,3), dtype='S5') assert_array_equal(np.zeros_like(d), d) assert_equal(np.zeros_like(d).dtype, d.dtype) d = np.zeros((3,3), dtype='U5') assert_array_equal(np.zeros_like(d), d) assert_equal(np.zeros_like(d).dtype, d.dtype) d = np.zeros((3,3), dtype='<i4') assert_array_equal(np.zeros_like(d), d) assert_equal(np.zeros_like(d).dtype, d.dtype) d = np.zeros((3,3), dtype='>i4') assert_array_equal(np.zeros_like(d), d) assert_equal(np.zeros_like(d).dtype, d.dtype) d = np.zeros((3,3), dtype='<M8[s]') assert_array_equal(np.zeros_like(d), d) assert_equal(np.zeros_like(d).dtype, d.dtype) d = np.zeros((3,3), dtype='>M8[s]') assert_array_equal(np.zeros_like(d), d) assert_equal(np.zeros_like(d).dtype, d.dtype) d = np.zeros((3,3), dtype='f4,f4') assert_array_equal(np.zeros_like(d), d) assert_equal(np.zeros_like(d).dtype, d.dtype) def test_empty_unicode(self): # don't throw decode errors on garbage memory for i in range(5, 100, 5): d = np.empty(i, dtype='U') str(d) def test_sequence_non_homogenous(self): assert_equal(np.array([4, 2**80]).dtype, object) assert_equal(np.array([4, 2**80, 4]).dtype, object) assert_equal(np.array([2**80, 4]).dtype, object) assert_equal(np.array([2**80] * 3).dtype, object) assert_equal(np.array([[1, 1],[1j, 1j]]).dtype, complex) assert_equal(np.array([[1j, 1j],[1, 1]]).dtype, complex) assert_equal(np.array([[1, 1, 1],[1, 1j, 1.], [1, 1, 1]]).dtype, complex) @dec.skipif(sys.version_info[0] >= 3) def test_sequence_long(self): assert_equal(np.array([long(4), long(4)]).dtype, np.long) assert_equal(np.array([long(4), 2**80]).dtype, object) assert_equal(np.array([long(4), 2**80, long(4)]).dtype, object) assert_equal(np.array([2**80, long(4)]).dtype, object) def test_non_sequence_sequence(self): """Should not segfault. Class Fail breaks the sequence protocol for new style classes, i.e., those derived from object. Class Map is a mapping type indicated by raising a ValueError. At some point we may raise a warning instead of an error in the Fail case. """ class Fail(object): def __len__(self): return 1 def __getitem__(self, index): raise ValueError() class Map(object): def __len__(self): return 1 def __getitem__(self, index): raise KeyError() a = np.array([Map()]) assert_(a.shape == (1,)) assert_(a.dtype == np.dtype(object)) assert_raises(ValueError, np.array, [Fail()]) def test_no_len_object_type(self): # gh-5100, want object array from iterable object without len() class Point2: def __init__(self): pass def __getitem__(self, ind): if ind in [0, 1]: return ind else: raise IndexError() d = np.array([Point2(), Point2(), Point2()]) assert_equal(d.dtype, np.dtype(object)) def test_false_len_sequence(self): # gh-7264, segfault for this example class C: def __getitem__(self, i): raise IndexError def __len__(self): return 42 assert_raises(ValueError, np.array, C()) # segfault? def test_failed_len_sequence(self): # gh-7393 class A(object): def __init__(self, data): self._data = data def __getitem__(self, item): return type(self)(self._data[item]) def __len__(self): return len(self._data) # len(d) should give 3, but len(d[0]) will fail d = A([1,2,3]) assert_equal(len(np.array(d)), 3) def test_array_too_big(self): # Test that array creation succeeds for arrays addressable by intp # on the byte level and fails for too large arrays. buf = np.zeros(100) max_bytes = np.iinfo(np.intp).max for dtype in ["intp", "S20", "b"]: dtype = np.dtype(dtype) itemsize = dtype.itemsize np.ndarray(buffer=buf, strides=(0,), shape=(max_bytes//itemsize,), dtype=dtype) assert_raises(ValueError, np.ndarray, buffer=buf, strides=(0,), shape=(max_bytes//itemsize + 1,), dtype=dtype) class TestStructured(object): def test_subarray_field_access(self): a = np.zeros((3, 5), dtype=[('a', ('i4', (2, 2)))]) a['a'] = np.arange(60).reshape(3, 5, 2, 2) # Since the subarray is always in C-order, a transpose # does not swap the subarray: assert_array_equal(a.T['a'], a['a'].transpose(1, 0, 2, 3)) # In Fortran order, the subarray gets appended # like in all other cases, not prepended as a special case b = a.copy(order='F') assert_equal(a['a'].shape, b['a'].shape) assert_equal(a.T['a'].shape, a.T.copy()['a'].shape) def test_subarray_comparison(self): # Check that comparisons between record arrays with # multi-dimensional field types work properly a = np.rec.fromrecords( [([1, 2, 3], 'a', [[1, 2], [3, 4]]), ([3, 3, 3], 'b', [[0, 0], [0, 0]])], dtype=[('a', ('f4', 3)), ('b', object), ('c', ('i4', (2, 2)))]) b = a.copy() assert_equal(a == b, [True, True]) assert_equal(a != b, [False, False]) b[1].b = 'c' assert_equal(a == b, [True, False]) assert_equal(a != b, [False, True]) for i in range(3): b[0].a = a[0].a b[0].a[i] = 5 assert_equal(a == b, [False, False]) assert_equal(a != b, [True, True]) for i in range(2): for j in range(2): b = a.copy() b[0].c[i, j] = 10 assert_equal(a == b, [False, True]) assert_equal(a != b, [True, False]) # Check that broadcasting with a subarray works a = np.array([[(0,)], [(1,)]], dtype=[('a', 'f8')]) b = np.array([(0,), (0,), (1,)], dtype=[('a', 'f8')]) assert_equal(a == b, [[True, True, False], [False, False, True]]) assert_equal(b == a, [[True, True, False], [False, False, True]]) a = np.array([[(0,)], [(1,)]], dtype=[('a', 'f8', (1,))]) b = np.array([(0,), (0,), (1,)], dtype=[('a', 'f8', (1,))]) assert_equal(a == b, [[True, True, False], [False, False, True]]) assert_equal(b == a, [[True, True, False], [False, False, True]]) a = np.array([[([0, 0],)], [([1, 1],)]], dtype=[('a', 'f8', (2,))]) b = np.array([([0, 0],), ([0, 1],), ([1, 1],)], dtype=[('a', 'f8', (2,))]) assert_equal(a == b, [[True, False, False], [False, False, True]]) assert_equal(b == a, [[True, False, False], [False, False, True]]) # Check that broadcasting Fortran-style arrays with a subarray work a = np.array([[([0, 0],)], [([1, 1],)]], dtype=[('a', 'f8', (2,))], order='F') b = np.array([([0, 0],), ([0, 1],), ([1, 1],)], dtype=[('a', 'f8', (2,))]) assert_equal(a == b, [[True, False, False], [False, False, True]]) assert_equal(b == a, [[True, False, False], [False, False, True]]) # Check that incompatible sub-array shapes don't result to broadcasting x = np.zeros((1,), dtype=[('a', ('f4', (1, 2))), ('b', 'i1')]) y = np.zeros((1,), dtype=[('a', ('f4', (2,))), ('b', 'i1')]) # This comparison invokes deprecated behaviour, and will probably # start raising an error eventually. What we really care about in this # test is just that it doesn't return True. with suppress_warnings() as sup: sup.filter(FutureWarning, "elementwise == comparison failed") assert_equal(x == y, False) x = np.zeros((1,), dtype=[('a', ('f4', (2, 1))), ('b', 'i1')]) y = np.zeros((1,), dtype=[('a', ('f4', (2,))), ('b', 'i1')]) # This comparison invokes deprecated behaviour, and will probably # start raising an error eventually. What we really care about in this # test is just that it doesn't return True. with suppress_warnings() as sup: sup.filter(FutureWarning, "elementwise == comparison failed") assert_equal(x == y, False) # Check that structured arrays that are different only in # byte-order work a = np.array([(5, 42), (10, 1)], dtype=[('a', '>i8'), ('b', '<f8')]) b = np.array([(5, 43), (10, 1)], dtype=[('a', '<i8'), ('b', '>f8')]) assert_equal(a == b, [False, True]) def test_casting(self): # Check that casting a structured array to change its byte order # works a = np.array([(1,)], dtype=[('a', '<i4')]) assert_(np.can_cast(a.dtype, [('a', '>i4')], casting='unsafe')) b = a.astype([('a', '>i4')]) assert_equal(b, a.byteswap().newbyteorder()) assert_equal(a['a'][0], b['a'][0]) # Check that equality comparison works on structured arrays if # they are 'equiv'-castable a = np.array([(5, 42), (10, 1)], dtype=[('a', '>i4'), ('b', '<f8')]) b = np.array([(5, 42), (10, 1)], dtype=[('a', '<i4'), ('b', '>f8')]) assert_(np.can_cast(a.dtype, b.dtype, casting='equiv')) assert_equal(a == b, [True, True]) # Check that 'equiv' casting can change byte order assert_(np.can_cast(a.dtype, b.dtype, casting='equiv')) c = a.astype(b.dtype, casting='equiv') assert_equal(a == c, [True, True]) # Check that 'safe' casting can change byte order and up-cast # fields t = [('a', '<i8'), ('b', '>f8')] assert_(np.can_cast(a.dtype, t, casting='safe')) c = a.astype(t, casting='safe') assert_equal((c == np.array([(5, 42), (10, 1)], dtype=t)), [True, True]) # Check that 'same_kind' casting can change byte order and # change field widths within a "kind" t = [('a', '<i4'), ('b', '>f4')] assert_(np.can_cast(a.dtype, t, casting='same_kind')) c = a.astype(t, casting='same_kind') assert_equal((c == np.array([(5, 42), (10, 1)], dtype=t)), [True, True]) # Check that casting fails if the casting rule should fail on # any of the fields t = [('a', '>i8'), ('b', '<f4')] assert_(not np.can_cast(a.dtype, t, casting='safe')) assert_raises(TypeError, a.astype, t, casting='safe') t = [('a', '>i2'), ('b', '<f8')] assert_(not np.can_cast(a.dtype, t, casting='equiv')) assert_raises(TypeError, a.astype, t, casting='equiv') t = [('a', '>i8'), ('b', '<i2')] assert_(not np.can_cast(a.dtype, t, casting='same_kind')) assert_raises(TypeError, a.astype, t, casting='same_kind') assert_(not np.can_cast(a.dtype, b.dtype, casting='no')) assert_raises(TypeError, a.astype, b.dtype, casting='no') # Check that non-'unsafe' casting can't change the set of field names for casting in ['no', 'safe', 'equiv', 'same_kind']: t = [('a', '>i4')] assert_(not np.can_cast(a.dtype, t, casting=casting)) t = [('a', '>i4'), ('b', '<f8'), ('c', 'i4')] assert_(not np.can_cast(a.dtype, t, casting=casting)) def test_objview(self): # https://github.com/numpy/numpy/issues/3286 a = np.array([], dtype=[('a', 'f'), ('b', 'f'), ('c', 'O')]) a[['a', 'b']] # TypeError? # https://github.com/numpy/numpy/issues/3253 dat2 = np.zeros(3, [('A', 'i'), ('B', '|O')]) dat2[['B', 'A']] # TypeError? def test_setfield(self): # https://github.com/numpy/numpy/issues/3126 struct_dt = np.dtype([('elem', 'i4', 5),]) dt = np.dtype([('field', 'i4', 10),('struct', struct_dt)]) x = np.zeros(1, dt) x[0]['field'] = np.ones(10, dtype='i4') x[0]['struct'] = np.ones(1, dtype=struct_dt) assert_equal(x[0]['field'], np.ones(10, dtype='i4')) def test_setfield_object(self): # make sure object field assignment with ndarray value # on void scalar mimics setitem behavior b = np.zeros(1, dtype=[('x', 'O')]) # next line should work identically to b['x'][0] = np.arange(3) b[0]['x'] = np.arange(3) assert_equal(b[0]['x'], np.arange(3)) # check that broadcasting check still works c = np.zeros(1, dtype=[('x', 'O', 5)]) def testassign(): c[0]['x'] = np.arange(3) assert_raises(ValueError, testassign) def test_zero_width_string(self): # Test for PR #6430 / issues #473, #4955, #2585 dt = np.dtype([('I', int), ('S', 'S0')]) x = np.zeros(4, dtype=dt) assert_equal(x['S'], [b'', b'', b'', b'']) assert_equal(x['S'].itemsize, 0) x['S'] = ['a', 'b', 'c', 'd'] assert_equal(x['S'], [b'', b'', b'', b'']) assert_equal(x['I'], [0, 0, 0, 0]) # Variation on test case from #4955 x['S'][x['I'] == 0] = 'hello' assert_equal(x['S'], [b'', b'', b'', b'']) assert_equal(x['I'], [0, 0, 0, 0]) # Variation on test case from #2585 x['S'] = 'A' assert_equal(x['S'], [b'', b'', b'', b'']) assert_equal(x['I'], [0, 0, 0, 0]) # Allow zero-width dtypes in ndarray constructor y = np.ndarray(4, dtype=x['S'].dtype) assert_equal(y.itemsize, 0) assert_equal(x['S'], y) # More tests for indexing an array with zero-width fields assert_equal(np.zeros(4, dtype=[('a', 'S0,S0'), ('b', 'u1')])['a'].itemsize, 0) assert_equal(np.empty(3, dtype='S0,S0').itemsize, 0) assert_equal(np.zeros(4, dtype='S0,u1')['f0'].itemsize, 0) xx = x['S'].reshape((2, 2)) assert_equal(xx.itemsize, 0) assert_equal(xx, [[b'', b''], [b'', b'']]) # check for no uninitialized memory due to viewing S0 array assert_equal(xx[:].dtype, xx.dtype) assert_array_equal(eval(repr(xx), dict(array=np.array)), xx) b = io.BytesIO() np.save(b, xx) b.seek(0) yy = np.load(b) assert_equal(yy.itemsize, 0) assert_equal(xx, yy) with temppath(suffix='.npy') as tmp: np.save(tmp, xx) yy = np.load(tmp) assert_equal(yy.itemsize, 0) assert_equal(xx, yy) def test_base_attr(self): a = np.zeros(3, dtype='i4,f4') b = a[0] assert_(b.base is a) def test_assignment(self): def testassign(arr, v): c = arr.copy() c[0] = v # assign using setitem c[1:] = v # assign using "dtype_transfer" code paths return c dt = np.dtype([('foo', 'i8'), ('bar', 'i8')]) arr = np.ones(2, dt) v1 = np.array([(2,3)], dtype=[('foo', 'i8'), ('bar', 'i8')]) v2 = np.array([(2,3)], dtype=[('bar', 'i8'), ('foo', 'i8')]) v3 = np.array([(2,3)], dtype=[('bar', 'i8'), ('baz', 'i8')]) v4 = np.array([(2,)], dtype=[('bar', 'i8')]) v5 = np.array([(2,3)], dtype=[('foo', 'f8'), ('bar', 'f8')]) w = arr.view({'names': ['bar'], 'formats': ['i8'], 'offsets': [8]}) ans = np.array([(2,3),(2,3)], dtype=dt) assert_equal(testassign(arr, v1), ans) assert_equal(testassign(arr, v2), ans) assert_equal(testassign(arr, v3), ans) assert_raises(ValueError, lambda: testassign(arr, v4)) assert_equal(testassign(arr, v5), ans) w[:] = 4 assert_equal(arr, np.array([(1,4),(1,4)], dtype=dt)) # test field-reordering, assignment by position, and self-assignment a = np.array([(1,2,3)], dtype=[('foo', 'i8'), ('bar', 'i8'), ('baz', 'f4')]) a[['foo', 'bar']] = a[['bar', 'foo']] assert_equal(a[0].item(), (2,1,3)) # test that this works even for 'simple_unaligned' structs # (ie, that PyArray_EquivTypes cares about field order too) a = np.array([(1,2)], dtype=[('a', 'i4'), ('b', 'i4')]) a[['a', 'b']] = a[['b', 'a']] assert_equal(a[0].item(), (2,1)) def test_structuredscalar_indexing(self): # test gh-7262 x = np.empty(shape=1, dtype="(2)3S,(2)3U") assert_equal(x[["f0","f1"]][0], x[0][["f0","f1"]]) assert_equal(x[0], x[0][()]) def test_multiindex_titles(self): a = np.zeros(4, dtype=[(('a', 'b'), 'i'), ('c', 'i'), ('d', 'i')]) assert_raises(KeyError, lambda : a[['a','c']]) assert_raises(KeyError, lambda : a[['a','a']]) assert_raises(ValueError, lambda : a[['b','b']]) # field exists, but repeated a[['b','c']] # no exception class TestBool(object): def test_test_interning(self): a0 = np.bool_(0) b0 = np.bool_(False) assert_(a0 is b0) a1 = np.bool_(1) b1 = np.bool_(True) assert_(a1 is b1) assert_(np.array([True])[0] is a1) assert_(np.array(True)[()] is a1) def test_sum(self): d = np.ones(101, dtype=bool) assert_equal(d.sum(), d.size) assert_equal(d[::2].sum(), d[::2].size) assert_equal(d[::-2].sum(), d[::-2].size) d = np.frombuffer(b'\xff\xff' * 100, dtype=bool) assert_equal(d.sum(), d.size) assert_equal(d[::2].sum(), d[::2].size) assert_equal(d[::-2].sum(), d[::-2].size) def check_count_nonzero(self, power, length): powers = [2 ** i for i in range(length)] for i in range(2**power): l = [(i & x) != 0 for x in powers] a = np.array(l, dtype=bool) c = builtins.sum(l) assert_equal(np.count_nonzero(a), c) av = a.view(np.uint8) av *= 3 assert_equal(np.count_nonzero(a), c) av *= 4 assert_equal(np.count_nonzero(a), c) av[av != 0] = 0xFF assert_equal(np.count_nonzero(a), c) def test_count_nonzero(self): # check all 12 bit combinations in a length 17 array # covers most cases of the 16 byte unrolled code self.check_count_nonzero(12, 17) @dec.slow def test_count_nonzero_all(self): # check all combinations in a length 17 array # covers all cases of the 16 byte unrolled code self.check_count_nonzero(17, 17) def test_count_nonzero_unaligned(self): # prevent mistakes as e.g. gh-4060 for o in range(7): a = np.zeros((18,), dtype=bool)[o+1:] a[:o] = True assert_equal(np.count_nonzero(a), builtins.sum(a.tolist())) a = np.ones((18,), dtype=bool)[o+1:] a[:o] = False assert_equal(np.count_nonzero(a), builtins.sum(a.tolist())) def _test_cast_from_flexible(self, dtype): # empty string -> false for n in range(3): v = np.array(b'', (dtype, n)) assert_equal(bool(v), False) assert_equal(bool(v[()]), False) assert_equal(v.astype(bool), False) assert_(isinstance(v.astype(bool), np.ndarray)) assert_(v[()].astype(bool) is np.False_) # anything else -> true for n in range(1, 4): for val in [b'a', b'0', b' ']: v = np.array(val, (dtype, n)) assert_equal(bool(v), True) assert_equal(bool(v[()]), True) assert_equal(v.astype(bool), True) assert_(isinstance(v.astype(bool), np.ndarray)) assert_(v[()].astype(bool) is np.True_) def test_cast_from_void(self): self._test_cast_from_flexible(np.void) @dec.knownfailureif(True, "See gh-9847") def test_cast_from_unicode(self): self._test_cast_from_flexible(np.unicode_) @dec.knownfailureif(True, "See gh-9847") def test_cast_from_bytes(self): self._test_cast_from_flexible(np.bytes_) class TestZeroSizeFlexible(object): @staticmethod def _zeros(shape, dtype=str): dtype = np.dtype(dtype) if dtype == np.void: return np.zeros(shape, dtype=(dtype, 0)) # not constructable directly dtype = np.dtype([('x', dtype, 0)]) return np.zeros(shape, dtype=dtype)['x'] def test_create(self): zs = self._zeros(10, bytes) assert_equal(zs.itemsize, 0) zs = self._zeros(10, np.void) assert_equal(zs.itemsize, 0) zs = self._zeros(10, unicode) assert_equal(zs.itemsize, 0) def _test_sort_partition(self, name, kinds, **kwargs): # Previously, these would all hang for dt in [bytes, np.void, unicode]: zs = self._zeros(10, dt) sort_method = getattr(zs, name) sort_func = getattr(np, name) for kind in kinds: sort_method(kind=kind, **kwargs) sort_func(zs, kind=kind, **kwargs) def test_sort(self): self._test_sort_partition('sort', kinds='qhm') def test_argsort(self): self._test_sort_partition('argsort', kinds='qhm') def test_partition(self): self._test_sort_partition('partition', kinds=['introselect'], kth=2) def test_argpartition(self): self._test_sort_partition('argpartition', kinds=['introselect'], kth=2) def test_resize(self): # previously an error for dt in [bytes, np.void, unicode]: zs = self._zeros(10, dt) zs.resize(25) zs.resize((10, 10)) def test_view(self): for dt in [bytes, np.void, unicode]: zs = self._zeros(10, dt) # viewing as itself should be allowed assert_equal(zs.view(dt).dtype, np.dtype(dt)) # viewing as any non-empty type gives an empty result assert_equal(zs.view((dt, 1)).shape, (0,)) def test_pickle(self): import pickle for dt in [bytes, np.void, unicode]: zs = self._zeros(10, dt) p = pickle.dumps(zs) zs2 = pickle.loads(p) assert_equal(zs.dtype, zs2.dtype) class TestMethods(object): def test_compress(self): tgt = [[5, 6, 7, 8, 9]] arr = np.arange(10).reshape(2, 5) out = arr.compress([0, 1], axis=0) assert_equal(out, tgt) tgt = [[1, 3], [6, 8]] out = arr.compress([0, 1, 0, 1, 0], axis=1) assert_equal(out, tgt) tgt = [[1], [6]] arr = np.arange(10).reshape(2, 5) out = arr.compress([0, 1], axis=1) assert_equal(out, tgt) arr = np.arange(10).reshape(2, 5) out = arr.compress([0, 1]) assert_equal(out, 1) def test_choose(self): x = 2*np.ones((3,), dtype=int) y = 3*np.ones((3,), dtype=int) x2 = 2*np.ones((2, 3), dtype=int) y2 = 3*np.ones((2, 3), dtype=int) ind = np.array([0, 0, 1]) A = ind.choose((x, y)) assert_equal(A, [2, 2, 3]) A = ind.choose((x2, y2)) assert_equal(A, [[2, 2, 3], [2, 2, 3]]) A = ind.choose((x, y2)) assert_equal(A, [[2, 2, 3], [2, 2, 3]]) def test_prod(self): ba = [1, 2, 10, 11, 6, 5, 4] ba2 = [[1, 2, 3, 4], [5, 6, 7, 9], [10, 3, 4, 5]] for ctype in [np.int16, np.uint16, np.int32, np.uint32, np.float32, np.float64, np.complex64, np.complex128]: a = np.array(ba, ctype) a2 = np.array(ba2, ctype) if ctype in ['1', 'b']: assert_raises(ArithmeticError, a.prod) assert_raises(ArithmeticError, a2.prod, axis=1) else: assert_equal(a.prod(axis=0), 26400) assert_array_equal(a2.prod(axis=0), np.array([50, 36, 84, 180], ctype)) assert_array_equal(a2.prod(axis=-1), np.array([24, 1890, 600], ctype)) def test_repeat(self): m = np.array([1, 2, 3, 4, 5, 6]) m_rect = m.reshape((2, 3)) A = m.repeat([1, 3, 2, 1, 1, 2]) assert_equal(A, [1, 2, 2, 2, 3, 3, 4, 5, 6, 6]) A = m.repeat(2) assert_equal(A, [1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6]) A = m_rect.repeat([2, 1], axis=0) assert_equal(A, [[1, 2, 3], [1, 2, 3], [4, 5, 6]]) A = m_rect.repeat([1, 3, 2], axis=1) assert_equal(A, [[1, 2, 2, 2, 3, 3], [4, 5, 5, 5, 6, 6]]) A = m_rect.repeat(2, axis=0) assert_equal(A, [[1, 2, 3], [1, 2, 3], [4, 5, 6], [4, 5, 6]]) A = m_rect.repeat(2, axis=1) assert_equal(A, [[1, 1, 2, 2, 3, 3], [4, 4, 5, 5, 6, 6]]) def test_reshape(self): arr = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9], [10, 11, 12]]) tgt = [[1, 2, 3, 4, 5, 6], [7, 8, 9, 10, 11, 12]] assert_equal(arr.reshape(2, 6), tgt) tgt = [[1, 2, 3, 4], [5, 6, 7, 8], [9, 10, 11, 12]] assert_equal(arr.reshape(3, 4), tgt) tgt = [[1, 10, 8, 6], [4, 2, 11, 9], [7, 5, 3, 12]] assert_equal(arr.reshape((3, 4), order='F'), tgt) tgt = [[1, 4, 7, 10], [2, 5, 8, 11], [3, 6, 9, 12]] assert_equal(arr.T.reshape((3, 4), order='C'), tgt) def test_round(self): def check_round(arr, expected, *round_args): assert_equal(arr.round(*round_args), expected) # With output array out = np.zeros_like(arr) res = arr.round(*round_args, out=out) assert_equal(out, expected) assert_equal(out, res) check_round(np.array([1.2, 1.5]), [1, 2]) check_round(np.array(1.5), 2) check_round(np.array([12.2, 15.5]), [10, 20], -1) check_round(np.array([12.15, 15.51]), [12.2, 15.5], 1) # Complex rounding check_round(np.array([4.5 + 1.5j]), [4 + 2j]) check_round(np.array([12.5 + 15.5j]), [10 + 20j], -1) def test_squeeze(self): a = np.array([[[1], [2], [3]]]) assert_equal(a.squeeze(), [1, 2, 3]) assert_equal(a.squeeze(axis=(0,)), [[1], [2], [3]]) assert_raises(ValueError, a.squeeze, axis=(1,)) assert_equal(a.squeeze(axis=(2,)), [[1, 2, 3]]) def test_transpose(self): a = np.array([[1, 2], [3, 4]]) assert_equal(a.transpose(), [[1, 3], [2, 4]]) assert_raises(ValueError, lambda: a.transpose(0)) assert_raises(ValueError, lambda: a.transpose(0, 0)) assert_raises(ValueError, lambda: a.transpose(0, 1, 2)) def test_sort(self): # test ordering for floats and complex containing nans. It is only # necessary to check the less-than comparison, so sorts that # only follow the insertion sort path are sufficient. We only # test doubles and complex doubles as the logic is the same. # check doubles msg = "Test real sort order with nans" a = np.array([np.nan, 1, 0]) b = np.sort(a) assert_equal(b, a[::-1], msg) # check complex msg = "Test complex sort order with nans" a = np.zeros(9, dtype=np.complex128) a.real += [np.nan, np.nan, np.nan, 1, 0, 1, 1, 0, 0] a.imag += [np.nan, 1, 0, np.nan, np.nan, 1, 0, 1, 0] b = np.sort(a) assert_equal(b, a[::-1], msg) # all c scalar sorts use the same code with different types # so it suffices to run a quick check with one type. The number # of sorted items must be greater than ~50 to check the actual # algorithm because quick and merge sort fall over to insertion # sort for small arrays. a = np.arange(101) b = a[::-1].copy() for kind in ['q', 'm', 'h']: msg = "scalar sort, kind=%s" % kind c = a.copy() c.sort(kind=kind) assert_equal(c, a, msg) c = b.copy() c.sort(kind=kind) assert_equal(c, a, msg) # test complex sorts. These use the same code as the scalars # but the compare function differs. ai = a*1j + 1 bi = b*1j + 1 for kind in ['q', 'm', 'h']: msg = "complex sort, real part == 1, kind=%s" % kind c = ai.copy() c.sort(kind=kind) assert_equal(c, ai, msg) c = bi.copy() c.sort(kind=kind) assert_equal(c, ai, msg) ai = a + 1j bi = b + 1j for kind in ['q', 'm', 'h']: msg = "complex sort, imag part == 1, kind=%s" % kind c = ai.copy() c.sort(kind=kind) assert_equal(c, ai, msg) c = bi.copy() c.sort(kind=kind) assert_equal(c, ai, msg) # test sorting of complex arrays requiring byte-swapping, gh-5441 for endianess in '<>': for dt in np.typecodes['Complex']: arr = np.array([1+3.j, 2+2.j, 3+1.j], dtype=endianess + dt) c = arr.copy() c.sort() msg = 'byte-swapped complex sort, dtype={0}'.format(dt) assert_equal(c, arr, msg) # test string sorts. s = 'aaaaaaaa' a = np.array([s + chr(i) for i in range(101)]) b = a[::-1].copy() for kind in ['q', 'm', 'h']: msg = "string sort, kind=%s" % kind c = a.copy() c.sort(kind=kind) assert_equal(c, a, msg) c = b.copy() c.sort(kind=kind) assert_equal(c, a, msg) # test unicode sorts. s = 'aaaaaaaa' a = np.array([s + chr(i) for i in range(101)], dtype=np.unicode) b = a[::-1].copy() for kind in ['q', 'm', 'h']: msg = "unicode sort, kind=%s" % kind c = a.copy() c.sort(kind=kind) assert_equal(c, a, msg) c = b.copy() c.sort(kind=kind) assert_equal(c, a, msg) # test object array sorts. a = np.empty((101,), dtype=object) a[:] = list(range(101)) b = a[::-1] for kind in ['q', 'h', 'm']: msg = "object sort, kind=%s" % kind c = a.copy() c.sort(kind=kind) assert_equal(c, a, msg) c = b.copy() c.sort(kind=kind) assert_equal(c, a, msg) # test record array sorts. dt = np.dtype([('f', float), ('i', int)]) a = np.array([(i, i) for i in range(101)], dtype=dt) b = a[::-1] for kind in ['q', 'h', 'm']: msg = "object sort, kind=%s" % kind c = a.copy() c.sort(kind=kind) assert_equal(c, a, msg) c = b.copy() c.sort(kind=kind) assert_equal(c, a, msg) # test datetime64 sorts. a = np.arange(0, 101, dtype='datetime64[D]') b = a[::-1] for kind in ['q', 'h', 'm']: msg = "datetime64 sort, kind=%s" % kind c = a.copy() c.sort(kind=kind) assert_equal(c, a, msg) c = b.copy() c.sort(kind=kind) assert_equal(c, a, msg) # test timedelta64 sorts. a = np.arange(0, 101, dtype='timedelta64[D]') b = a[::-1] for kind in ['q', 'h', 'm']: msg = "timedelta64 sort, kind=%s" % kind c = a.copy() c.sort(kind=kind) assert_equal(c, a, msg) c = b.copy() c.sort(kind=kind) assert_equal(c, a, msg) # check axis handling. This should be the same for all type # specific sorts, so we only check it for one type and one kind a = np.array([[3, 2], [1, 0]]) b = np.array([[1, 0], [3, 2]]) c = np.array([[2, 3], [0, 1]]) d = a.copy() d.sort(axis=0) assert_equal(d, b, "test sort with axis=0") d = a.copy() d.sort(axis=1) assert_equal(d, c, "test sort with axis=1") d = a.copy() d.sort() assert_equal(d, c, "test sort with default axis") # check axis handling for multidimensional empty arrays a = np.array([]) a.shape = (3, 2, 1, 0) for axis in range(-a.ndim, a.ndim): msg = 'test empty array sort with axis={0}'.format(axis) assert_equal(np.sort(a, axis=axis), a, msg) msg = 'test empty array sort with axis=None' assert_equal(np.sort(a, axis=None), a.ravel(), msg) # test generic class with bogus ordering, # should not segfault. class Boom(object): def __lt__(self, other): return True a = np.array([Boom()]*100, dtype=object) for kind in ['q', 'm', 'h']: msg = "bogus comparison object sort, kind=%s" % kind c.sort(kind=kind) def test_void_sort(self): # gh-8210 - previously segfaulted for i in range(4): arr = np.empty(1000, 'V4') arr[::-1].sort() dt = np.dtype([('val', 'i4', (1,))]) for i in range(4): arr = np.empty(1000, dt) arr[::-1].sort() def test_sort_raises(self): #gh-9404 arr = np.array([0, datetime.now(), 1], dtype=object) for kind in ['q', 'm', 'h']: assert_raises(TypeError, arr.sort, kind=kind) #gh-3879 class Raiser(object): def raises_anything(*args, **kwargs): raise TypeError("SOMETHING ERRORED") __eq__ = __ne__ = __lt__ = __gt__ = __ge__ = __le__ = raises_anything arr = np.array([[Raiser(), n] for n in range(10)]).reshape(-1) np.random.shuffle(arr) for kind in ['q', 'm', 'h']: assert_raises(TypeError, arr.sort, kind=kind) def test_sort_degraded(self): # test degraded dataset would take minutes to run with normal qsort d = np.arange(1000000) do = d.copy() x = d # create a median of 3 killer where each median is the sorted second # last element of the quicksort partition while x.size > 3: mid = x.size // 2 x[mid], x[-2] = x[-2], x[mid] x = x[:-2] assert_equal(np.sort(d), do) assert_equal(d[np.argsort(d)], do) def test_copy(self): def assert_fortran(arr): assert_(arr.flags.fortran) assert_(arr.flags.f_contiguous) assert_(not arr.flags.c_contiguous) def assert_c(arr): assert_(not arr.flags.fortran) assert_(not arr.flags.f_contiguous) assert_(arr.flags.c_contiguous) a = np.empty((2, 2), order='F') # Test copying a Fortran array assert_c(a.copy()) assert_c(a.copy('C')) assert_fortran(a.copy('F')) assert_fortran(a.copy('A')) # Now test starting with a C array. a = np.empty((2, 2), order='C') assert_c(a.copy()) assert_c(a.copy('C')) assert_fortran(a.copy('F')) assert_c(a.copy('A')) def test_sort_order(self): # Test sorting an array with fields x1 = np.array([21, 32, 14]) x2 = np.array(['my', 'first', 'name']) x3 = np.array([3.1, 4.5, 6.2]) r = np.rec.fromarrays([x1, x2, x3], names='id,word,number') r.sort(order=['id']) assert_equal(r.id, np.array([14, 21, 32])) assert_equal(r.word, np.array(['name', 'my', 'first'])) assert_equal(r.number, np.array([6.2, 3.1, 4.5])) r.sort(order=['word']) assert_equal(r.id, np.array([32, 21, 14])) assert_equal(r.word, np.array(['first', 'my', 'name'])) assert_equal(r.number, np.array([4.5, 3.1, 6.2])) r.sort(order=['number']) assert_equal(r.id, np.array([21, 32, 14])) assert_equal(r.word, np.array(['my', 'first', 'name'])) assert_equal(r.number, np.array([3.1, 4.5, 6.2])) assert_raises_regex(ValueError, 'duplicate', lambda: r.sort(order=['id', 'id'])) if sys.byteorder == 'little': strtype = '>i2' else: strtype = '<i2' mydtype = [('name', strchar + '5'), ('col2', strtype)] r = np.array([('a', 1), ('b', 255), ('c', 3), ('d', 258)], dtype=mydtype) r.sort(order='col2') assert_equal(r['col2'], [1, 3, 255, 258]) assert_equal(r, np.array([('a', 1), ('c', 3), ('b', 255), ('d', 258)], dtype=mydtype)) def test_argsort(self): # all c scalar argsorts use the same code with different types # so it suffices to run a quick check with one type. The number # of sorted items must be greater than ~50 to check the actual # algorithm because quick and merge sort fall over to insertion # sort for small arrays. a = np.arange(101) b = a[::-1].copy() for kind in ['q', 'm', 'h']: msg = "scalar argsort, kind=%s" % kind assert_equal(a.copy().argsort(kind=kind), a, msg) assert_equal(b.copy().argsort(kind=kind), b, msg) # test complex argsorts. These use the same code as the scalars # but the compare function differs. ai = a*1j + 1 bi = b*1j + 1 for kind in ['q', 'm', 'h']: msg = "complex argsort, kind=%s" % kind assert_equal(ai.copy().argsort(kind=kind), a, msg) assert_equal(bi.copy().argsort(kind=kind), b, msg) ai = a + 1j bi = b + 1j for kind in ['q', 'm', 'h']: msg = "complex argsort, kind=%s" % kind assert_equal(ai.copy().argsort(kind=kind), a, msg) assert_equal(bi.copy().argsort(kind=kind), b, msg) # test argsort of complex arrays requiring byte-swapping, gh-5441 for endianess in '<>': for dt in np.typecodes['Complex']: arr = np.array([1+3.j, 2+2.j, 3+1.j], dtype=endianess + dt) msg = 'byte-swapped complex argsort, dtype={0}'.format(dt) assert_equal(arr.argsort(), np.arange(len(arr), dtype=np.intp), msg) # test string argsorts. s = 'aaaaaaaa' a = np.array([s + chr(i) for i in range(101)]) b = a[::-1].copy() r = np.arange(101) rr = r[::-1] for kind in ['q', 'm', 'h']: msg = "string argsort, kind=%s" % kind assert_equal(a.copy().argsort(kind=kind), r, msg) assert_equal(b.copy().argsort(kind=kind), rr, msg) # test unicode argsorts. s = 'aaaaaaaa' a = np.array([s + chr(i) for i in range(101)], dtype=np.unicode) b = a[::-1] r = np.arange(101) rr = r[::-1] for kind in ['q', 'm', 'h']: msg = "unicode argsort, kind=%s" % kind assert_equal(a.copy().argsort(kind=kind), r, msg) assert_equal(b.copy().argsort(kind=kind), rr, msg) # test object array argsorts. a = np.empty((101,), dtype=object) a[:] = list(range(101)) b = a[::-1] r = np.arange(101) rr = r[::-1] for kind in ['q', 'm', 'h']: msg = "object argsort, kind=%s" % kind assert_equal(a.copy().argsort(kind=kind), r, msg) assert_equal(b.copy().argsort(kind=kind), rr, msg) # test structured array argsorts. dt = np.dtype([('f', float), ('i', int)]) a = np.array([(i, i) for i in range(101)], dtype=dt) b = a[::-1] r = np.arange(101) rr = r[::-1] for kind in ['q', 'm', 'h']: msg = "structured array argsort, kind=%s" % kind assert_equal(a.copy().argsort(kind=kind), r, msg) assert_equal(b.copy().argsort(kind=kind), rr, msg) # test datetime64 argsorts. a = np.arange(0, 101, dtype='datetime64[D]') b = a[::-1] r = np.arange(101) rr = r[::-1] for kind in ['q', 'h', 'm']: msg = "datetime64 argsort, kind=%s" % kind assert_equal(a.copy().argsort(kind=kind), r, msg) assert_equal(b.copy().argsort(kind=kind), rr, msg) # test timedelta64 argsorts. a = np.arange(0, 101, dtype='timedelta64[D]') b = a[::-1] r = np.arange(101) rr = r[::-1] for kind in ['q', 'h', 'm']: msg = "timedelta64 argsort, kind=%s" % kind assert_equal(a.copy().argsort(kind=kind), r, msg) assert_equal(b.copy().argsort(kind=kind), rr, msg) # check axis handling. This should be the same for all type # specific argsorts, so we only check it for one type and one kind a = np.array([[3, 2], [1, 0]]) b = np.array([[1, 1], [0, 0]]) c = np.array([[1, 0], [1, 0]]) assert_equal(a.copy().argsort(axis=0), b) assert_equal(a.copy().argsort(axis=1), c) assert_equal(a.copy().argsort(), c) # check axis handling for multidimensional empty arrays a = np.array([]) a.shape = (3, 2, 1, 0) for axis in range(-a.ndim, a.ndim): msg = 'test empty array argsort with axis={0}'.format(axis) assert_equal(np.argsort(a, axis=axis), np.zeros_like(a, dtype=np.intp), msg) msg = 'test empty array argsort with axis=None' assert_equal(np.argsort(a, axis=None), np.zeros_like(a.ravel(), dtype=np.intp), msg) # check that stable argsorts are stable r = np.arange(100) # scalars a = np.zeros(100) assert_equal(a.argsort(kind='m'), r) # complex a = np.zeros(100, dtype=complex) assert_equal(a.argsort(kind='m'), r) # string a = np.array(['aaaaaaaaa' for i in range(100)]) assert_equal(a.argsort(kind='m'), r) # unicode a = np.array(['aaaaaaaaa' for i in range(100)], dtype=np.unicode) assert_equal(a.argsort(kind='m'), r) def test_sort_unicode_kind(self): d = np.arange(10) k = b'\xc3\xa4'.decode("UTF8") assert_raises(ValueError, d.sort, kind=k) assert_raises(ValueError, d.argsort, kind=k) def test_searchsorted(self): # test for floats and complex containing nans. The logic is the # same for all float types so only test double types for now. # The search sorted routines use the compare functions for the # array type, so this checks if that is consistent with the sort # order. # check double a = np.array([0, 1, np.nan]) msg = "Test real searchsorted with nans, side='l'" b = a.searchsorted(a, side='l') assert_equal(b, np.arange(3), msg) msg = "Test real searchsorted with nans, side='r'" b = a.searchsorted(a, side='r') assert_equal(b, np.arange(1, 4), msg) # check double complex a = np.zeros(9, dtype=np.complex128) a.real += [0, 0, 1, 1, 0, 1, np.nan, np.nan, np.nan] a.imag += [0, 1, 0, 1, np.nan, np.nan, 0, 1, np.nan] msg = "Test complex searchsorted with nans, side='l'" b = a.searchsorted(a, side='l') assert_equal(b, np.arange(9), msg) msg = "Test complex searchsorted with nans, side='r'" b = a.searchsorted(a, side='r') assert_equal(b, np.arange(1, 10), msg) msg = "Test searchsorted with little endian, side='l'" a = np.array([0, 128], dtype='<i4') b = a.searchsorted(np.array(128, dtype='<i4')) assert_equal(b, 1, msg) msg = "Test searchsorted with big endian, side='l'" a = np.array([0, 128], dtype='>i4') b = a.searchsorted(np.array(128, dtype='>i4')) assert_equal(b, 1, msg) # Check 0 elements a = np.ones(0) b = a.searchsorted([0, 1, 2], 'l') assert_equal(b, [0, 0, 0]) b = a.searchsorted([0, 1, 2], 'r') assert_equal(b, [0, 0, 0]) a = np.ones(1) # Check 1 element b = a.searchsorted([0, 1, 2], 'l') assert_equal(b, [0, 0, 1]) b = a.searchsorted([0, 1, 2], 'r') assert_equal(b, [0, 1, 1]) # Check all elements equal a = np.ones(2) b = a.searchsorted([0, 1, 2], 'l') assert_equal(b, [0, 0, 2]) b = a.searchsorted([0, 1, 2], 'r') assert_equal(b, [0, 2, 2]) # Test searching unaligned array a = np.arange(10) aligned = np.empty(a.itemsize * a.size + 1, 'uint8') unaligned = aligned[1:].view(a.dtype) unaligned[:] = a # Test searching unaligned array b = unaligned.searchsorted(a, 'l') assert_equal(b, a) b = unaligned.searchsorted(a, 'r') assert_equal(b, a + 1) # Test searching for unaligned keys b = a.searchsorted(unaligned, 'l') assert_equal(b, a) b = a.searchsorted(unaligned, 'r') assert_equal(b, a + 1) # Test smart resetting of binsearch indices a = np.arange(5) b = a.searchsorted([6, 5, 4], 'l') assert_equal(b, [5, 5, 4]) b = a.searchsorted([6, 5, 4], 'r') assert_equal(b, [5, 5, 5]) # Test all type specific binary search functions types = ''.join((np.typecodes['AllInteger'], np.typecodes['AllFloat'], np.typecodes['Datetime'], '?O')) for dt in types: if dt == 'M': dt = 'M8[D]' if dt == '?': a = np.arange(2, dtype=dt) out = np.arange(2) else: a = np.arange(0, 5, dtype=dt) out = np.arange(5) b = a.searchsorted(a, 'l') assert_equal(b, out) b = a.searchsorted(a, 'r') assert_equal(b, out + 1) def test_searchsorted_unicode(self): # Test searchsorted on unicode strings. # 1.6.1 contained a string length miscalculation in # arraytypes.c.src:UNICODE_compare() which manifested as # incorrect/inconsistent results from searchsorted. a = np.array(['P:\\20x_dapi_cy3\\20x_dapi_cy3_20100185_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100186_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100187_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100189_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100190_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100191_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100192_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100193_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100194_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100195_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100196_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100197_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100198_1', 'P:\\20x_dapi_cy3\\20x_dapi_cy3_20100199_1'], dtype=np.unicode) ind = np.arange(len(a)) assert_equal([a.searchsorted(v, 'left') for v in a], ind) assert_equal([a.searchsorted(v, 'right') for v in a], ind + 1) assert_equal([a.searchsorted(a[i], 'left') for i in ind], ind) assert_equal([a.searchsorted(a[i], 'right') for i in ind], ind + 1) def test_searchsorted_with_sorter(self): a = np.array([5, 2, 1, 3, 4]) s = np.argsort(a) assert_raises(TypeError, np.searchsorted, a, 0, sorter=(1, (2, 3))) assert_raises(TypeError, np.searchsorted, a, 0, sorter=[1.1]) assert_raises(ValueError, np.searchsorted, a, 0, sorter=[1, 2, 3, 4]) assert_raises(ValueError, np.searchsorted, a, 0, sorter=[1, 2, 3, 4, 5, 6]) # bounds check assert_raises(ValueError, np.searchsorted, a, 4, sorter=[0, 1, 2, 3, 5]) assert_raises(ValueError, np.searchsorted, a, 0, sorter=[-1, 0, 1, 2, 3]) assert_raises(ValueError, np.searchsorted, a, 0, sorter=[4, 0, -1, 2, 3]) a = np.random.rand(300) s = a.argsort() b = np.sort(a) k = np.linspace(0, 1, 20) assert_equal(b.searchsorted(k), a.searchsorted(k, sorter=s)) a = np.array([0, 1, 2, 3, 5]*20) s = a.argsort() k = [0, 1, 2, 3, 5] expected = [0, 20, 40, 60, 80] assert_equal(a.searchsorted(k, side='l', sorter=s), expected) expected = [20, 40, 60, 80, 100] assert_equal(a.searchsorted(k, side='r', sorter=s), expected) # Test searching unaligned array keys = np.arange(10) a = keys.copy() np.random.shuffle(s) s = a.argsort() aligned = np.empty(a.itemsize * a.size + 1, 'uint8') unaligned = aligned[1:].view(a.dtype) # Test searching unaligned array unaligned[:] = a b = unaligned.searchsorted(keys, 'l', s) assert_equal(b, keys) b = unaligned.searchsorted(keys, 'r', s) assert_equal(b, keys + 1) # Test searching for unaligned keys unaligned[:] = keys b = a.searchsorted(unaligned, 'l', s) assert_equal(b, keys) b = a.searchsorted(unaligned, 'r', s) assert_equal(b, keys + 1) # Test all type specific indirect binary search functions types = ''.join((np.typecodes['AllInteger'], np.typecodes['AllFloat'], np.typecodes['Datetime'], '?O')) for dt in types: if dt == 'M': dt = 'M8[D]' if dt == '?': a = np.array([1, 0], dtype=dt) # We want the sorter array to be of a type that is different # from np.intp in all platforms, to check for #4698 s = np.array([1, 0], dtype=np.int16) out = np.array([1, 0]) else: a = np.array([3, 4, 1, 2, 0], dtype=dt) # We want the sorter array to be of a type that is different # from np.intp in all platforms, to check for #4698 s = np.array([4, 2, 3, 0, 1], dtype=np.int16) out = np.array([3, 4, 1, 2, 0], dtype=np.intp) b = a.searchsorted(a, 'l', s) assert_equal(b, out) b = a.searchsorted(a, 'r', s) assert_equal(b, out + 1) # Test non-contiguous sorter array a = np.array([3, 4, 1, 2, 0]) srt = np.empty((10,), dtype=np.intp) srt[1::2] = -1 srt[::2] = [4, 2, 3, 0, 1] s = srt[::2] out = np.array([3, 4, 1, 2, 0], dtype=np.intp) b = a.searchsorted(a, 'l', s) assert_equal(b, out) b = a.searchsorted(a, 'r', s) assert_equal(b, out + 1) def test_searchsorted_return_type(self): # Functions returning indices should always return base ndarrays class A(np.ndarray): pass a = np.arange(5).view(A) b = np.arange(1, 3).view(A) s = np.arange(5).view(A) assert_(not isinstance(a.searchsorted(b, 'l'), A)) assert_(not isinstance(a.searchsorted(b, 'r'), A)) assert_(not isinstance(a.searchsorted(b, 'l', s), A)) assert_(not isinstance(a.searchsorted(b, 'r', s), A)) def test_argpartition_out_of_range(self): # Test out of range values in kth raise an error, gh-5469 d = np.arange(10) assert_raises(ValueError, d.argpartition, 10) assert_raises(ValueError, d.argpartition, -11) # Test also for generic type argpartition, which uses sorting # and used to not bound check kth d_obj = np.arange(10, dtype=object) assert_raises(ValueError, d_obj.argpartition, 10) assert_raises(ValueError, d_obj.argpartition, -11) def test_partition_out_of_range(self): # Test out of range values in kth raise an error, gh-5469 d = np.arange(10) assert_raises(ValueError, d.partition, 10) assert_raises(ValueError, d.partition, -11) # Test also for generic type partition, which uses sorting # and used to not bound check kth d_obj = np.arange(10, dtype=object) assert_raises(ValueError, d_obj.partition, 10) assert_raises(ValueError, d_obj.partition, -11) def test_argpartition_integer(self): # Test non-integer values in kth raise an error/ d = np.arange(10) assert_raises(TypeError, d.argpartition, 9.) # Test also for generic type argpartition, which uses sorting # and used to not bound check kth d_obj = np.arange(10, dtype=object) assert_raises(TypeError, d_obj.argpartition, 9.) def test_partition_integer(self): # Test out of range values in kth raise an error, gh-5469 d = np.arange(10) assert_raises(TypeError, d.partition, 9.) # Test also for generic type partition, which uses sorting # and used to not bound check kth d_obj = np.arange(10, dtype=object) assert_raises(TypeError, d_obj.partition, 9.) def test_partition_empty_array(self): # check axis handling for multidimensional empty arrays a = np.array([]) a.shape = (3, 2, 1, 0) for axis in range(-a.ndim, a.ndim): msg = 'test empty array partition with axis={0}'.format(axis) assert_equal(np.partition(a, 0, axis=axis), a, msg) msg = 'test empty array partition with axis=None' assert_equal(np.partition(a, 0, axis=None), a.ravel(), msg) def test_argpartition_empty_array(self): # check axis handling for multidimensional empty arrays a = np.array([]) a.shape = (3, 2, 1, 0) for axis in range(-a.ndim, a.ndim): msg = 'test empty array argpartition with axis={0}'.format(axis) assert_equal(np.partition(a, 0, axis=axis), np.zeros_like(a, dtype=np.intp), msg) msg = 'test empty array argpartition with axis=None' assert_equal(np.partition(a, 0, axis=None), np.zeros_like(a.ravel(), dtype=np.intp), msg) def test_partition(self): d = np.arange(10) assert_raises(TypeError, np.partition, d, 2, kind=1) assert_raises(ValueError, np.partition, d, 2, kind="nonsense") assert_raises(ValueError, np.argpartition, d, 2, kind="nonsense") assert_raises(ValueError, d.partition, 2, axis=0, kind="nonsense") assert_raises(ValueError, d.argpartition, 2, axis=0, kind="nonsense") for k in ("introselect",): d = np.array([]) assert_array_equal(np.partition(d, 0, kind=k), d) assert_array_equal(np.argpartition(d, 0, kind=k), d) d = np.ones(1) assert_array_equal(np.partition(d, 0, kind=k)[0], d) assert_array_equal(d[np.argpartition(d, 0, kind=k)], np.partition(d, 0, kind=k)) # kth not modified kth = np.array([30, 15, 5]) okth = kth.copy() np.partition(np.arange(40), kth) assert_array_equal(kth, okth) for r in ([2, 1], [1, 2], [1, 1]): d = np.array(r) tgt = np.sort(d) assert_array_equal(np.partition(d, 0, kind=k)[0], tgt[0]) assert_array_equal(np.partition(d, 1, kind=k)[1], tgt[1]) assert_array_equal(d[np.argpartition(d, 0, kind=k)], np.partition(d, 0, kind=k)) assert_array_equal(d[np.argpartition(d, 1, kind=k)], np.partition(d, 1, kind=k)) for i in range(d.size): d[i:].partition(0, kind=k) assert_array_equal(d, tgt) for r in ([3, 2, 1], [1, 2, 3], [2, 1, 3], [2, 3, 1], [1, 1, 1], [1, 2, 2], [2, 2, 1], [1, 2, 1]): d = np.array(r) tgt = np.sort(d) assert_array_equal(np.partition(d, 0, kind=k)[0], tgt[0]) assert_array_equal(np.partition(d, 1, kind=k)[1], tgt[1]) assert_array_equal(np.partition(d, 2, kind=k)[2], tgt[2]) assert_array_equal(d[np.argpartition(d, 0, kind=k)], np.partition(d, 0, kind=k)) assert_array_equal(d[np.argpartition(d, 1, kind=k)], np.partition(d, 1, kind=k)) assert_array_equal(d[np.argpartition(d, 2, kind=k)], np.partition(d, 2, kind=k)) for i in range(d.size): d[i:].partition(0, kind=k) assert_array_equal(d, tgt) d = np.ones(50) assert_array_equal(np.partition(d, 0, kind=k), d) assert_array_equal(d[np.argpartition(d, 0, kind=k)], np.partition(d, 0, kind=k)) # sorted d = np.arange(49) assert_equal(np.partition(d, 5, kind=k)[5], 5) assert_equal(np.partition(d, 15, kind=k)[15], 15) assert_array_equal(d[np.argpartition(d, 5, kind=k)], np.partition(d, 5, kind=k)) assert_array_equal(d[np.argpartition(d, 15, kind=k)], np.partition(d, 15, kind=k)) # rsorted d = np.arange(47)[::-1] assert_equal(np.partition(d, 6, kind=k)[6], 6) assert_equal(np.partition(d, 16, kind=k)[16], 16) assert_array_equal(d[np.argpartition(d, 6, kind=k)], np.partition(d, 6, kind=k)) assert_array_equal(d[np.argpartition(d, 16, kind=k)], np.partition(d, 16, kind=k)) assert_array_equal(np.partition(d, -6, kind=k), np.partition(d, 41, kind=k)) assert_array_equal(np.partition(d, -16, kind=k), np.partition(d, 31, kind=k)) assert_array_equal(d[np.argpartition(d, -6, kind=k)], np.partition(d, 41, kind=k)) # median of 3 killer, O(n^2) on pure median 3 pivot quickselect # exercises the median of median of 5 code used to keep O(n) d = np.arange(1000000) x = np.roll(d, d.size // 2) mid = x.size // 2 + 1 assert_equal(np.partition(x, mid)[mid], mid) d = np.arange(1000001) x = np.roll(d, d.size // 2 + 1) mid = x.size // 2 + 1 assert_equal(np.partition(x, mid)[mid], mid) # max d = np.ones(10) d[1] = 4 assert_equal(np.partition(d, (2, -1))[-1], 4) assert_equal(np.partition(d, (2, -1))[2], 1) assert_equal(d[np.argpartition(d, (2, -1))][-1], 4) assert_equal(d[np.argpartition(d, (2, -1))][2], 1) d[1] = np.nan assert_(np.isnan(d[np.argpartition(d, (2, -1))][-1])) assert_(np.isnan(np.partition(d, (2, -1))[-1])) # equal elements d = np.arange(47) % 7 tgt = np.sort(np.arange(47) % 7) np.random.shuffle(d) for i in range(d.size): assert_equal(np.partition(d, i, kind=k)[i], tgt[i]) assert_array_equal(d[np.argpartition(d, 6, kind=k)], np.partition(d, 6, kind=k)) assert_array_equal(d[np.argpartition(d, 16, kind=k)], np.partition(d, 16, kind=k)) for i in range(d.size): d[i:].partition(0, kind=k) assert_array_equal(d, tgt) d = np.array([0, 1, 2, 3, 4, 5, 7, 7, 7, 7, 7, 7, 7, 7, 7, 7, 7, 7, 7, 7, 7, 7, 9]) kth = [0, 3, 19, 20] assert_equal(np.partition(d, kth, kind=k)[kth], (0, 3, 7, 7)) assert_equal(d[np.argpartition(d, kth, kind=k)][kth], (0, 3, 7, 7)) d = np.array([2, 1]) d.partition(0, kind=k) assert_raises(ValueError, d.partition, 2) assert_raises(np.AxisError, d.partition, 3, axis=1) assert_raises(ValueError, np.partition, d, 2) assert_raises(np.AxisError, np.partition, d, 2, axis=1) assert_raises(ValueError, d.argpartition, 2) assert_raises(np.AxisError, d.argpartition, 3, axis=1) assert_raises(ValueError, np.argpartition, d, 2) assert_raises(np.AxisError, np.argpartition, d, 2, axis=1) d = np.arange(10).reshape((2, 5)) d.partition(1, axis=0, kind=k) d.partition(4, axis=1, kind=k) np.partition(d, 1, axis=0, kind=k) np.partition(d, 4, axis=1, kind=k) np.partition(d, 1, axis=None, kind=k) np.partition(d, 9, axis=None, kind=k) d.argpartition(1, axis=0, kind=k) d.argpartition(4, axis=1, kind=k) np.argpartition(d, 1, axis=0, kind=k) np.argpartition(d, 4, axis=1, kind=k) np.argpartition(d, 1, axis=None, kind=k) np.argpartition(d, 9, axis=None, kind=k) assert_raises(ValueError, d.partition, 2, axis=0) assert_raises(ValueError, d.partition, 11, axis=1) assert_raises(TypeError, d.partition, 2, axis=None) assert_raises(ValueError, np.partition, d, 9, axis=1) assert_raises(ValueError, np.partition, d, 11, axis=None) assert_raises(ValueError, d.argpartition, 2, axis=0) assert_raises(ValueError, d.argpartition, 11, axis=1) assert_raises(ValueError, np.argpartition, d, 9, axis=1) assert_raises(ValueError, np.argpartition, d, 11, axis=None) td = [(dt, s) for dt in [np.int32, np.float32, np.complex64] for s in (9, 16)] for dt, s in td: aae = assert_array_equal at = assert_ d = np.arange(s, dtype=dt) np.random.shuffle(d) d1 = np.tile(np.arange(s, dtype=dt), (4, 1)) map(np.random.shuffle, d1) d0 = np.transpose(d1) for i in range(d.size): p = np.partition(d, i, kind=k) assert_equal(p[i], i) # all before are smaller assert_array_less(p[:i], p[i]) # all after are larger assert_array_less(p[i], p[i + 1:]) aae(p, d[np.argpartition(d, i, kind=k)]) p = np.partition(d1, i, axis=1, kind=k) aae(p[:, i], np.array([i] * d1.shape[0], dtype=dt)) # array_less does not seem to work right at((p[:, :i].T <= p[:, i]).all(), msg="%d: %r <= %r" % (i, p[:, i], p[:, :i].T)) at((p[:, i + 1:].T > p[:, i]).all(), msg="%d: %r < %r" % (i, p[:, i], p[:, i + 1:].T)) aae(p, d1[np.arange(d1.shape[0])[:, None], np.argpartition(d1, i, axis=1, kind=k)]) p = np.partition(d0, i, axis=0, kind=k) aae(p[i, :], np.array([i] * d1.shape[0], dtype=dt)) # array_less does not seem to work right at((p[:i, :] <= p[i, :]).all(), msg="%d: %r <= %r" % (i, p[i, :], p[:i, :])) at((p[i + 1:, :] > p[i, :]).all(), msg="%d: %r < %r" % (i, p[i, :], p[:, i + 1:])) aae(p, d0[np.argpartition(d0, i, axis=0, kind=k), np.arange(d0.shape[1])[None, :]]) # check inplace dc = d.copy() dc.partition(i, kind=k) assert_equal(dc, np.partition(d, i, kind=k)) dc = d0.copy() dc.partition(i, axis=0, kind=k) assert_equal(dc, np.partition(d0, i, axis=0, kind=k)) dc = d1.copy() dc.partition(i, axis=1, kind=k) assert_equal(dc, np.partition(d1, i, axis=1, kind=k)) def assert_partitioned(self, d, kth): prev = 0 for k in np.sort(kth): assert_array_less(d[prev:k], d[k], err_msg='kth %d' % k) assert_((d[k:] >= d[k]).all(), msg="kth %d, %r not greater equal %d" % (k, d[k:], d[k])) prev = k + 1 def test_partition_iterative(self): d = np.arange(17) kth = (0, 1, 2, 429, 231) assert_raises(ValueError, d.partition, kth) assert_raises(ValueError, d.argpartition, kth) d = np.arange(10).reshape((2, 5)) assert_raises(ValueError, d.partition, kth, axis=0) assert_raises(ValueError, d.partition, kth, axis=1) assert_raises(ValueError, np.partition, d, kth, axis=1) assert_raises(ValueError, np.partition, d, kth, axis=None) d = np.array([3, 4, 2, 1]) p = np.partition(d, (0, 3)) self.assert_partitioned(p, (0, 3)) self.assert_partitioned(d[np.argpartition(d, (0, 3))], (0, 3)) assert_array_equal(p, np.partition(d, (-3, -1))) assert_array_equal(p, d[np.argpartition(d, (-3, -1))]) d = np.arange(17) np.random.shuffle(d) d.partition(range(d.size)) assert_array_equal(np.arange(17), d) np.random.shuffle(d) assert_array_equal(np.arange(17), d[d.argpartition(range(d.size))]) # test unsorted kth d = np.arange(17) np.random.shuffle(d) keys = np.array([1, 3, 8, -2]) np.random.shuffle(d) p = np.partition(d, keys) self.assert_partitioned(p, keys) p = d[np.argpartition(d, keys)] self.assert_partitioned(p, keys) np.random.shuffle(keys) assert_array_equal(np.partition(d, keys), p) assert_array_equal(d[np.argpartition(d, keys)], p) # equal kth d = np.arange(20)[::-1] self.assert_partitioned(np.partition(d, [5]*4), [5]) self.assert_partitioned(np.partition(d, [5]*4 + [6, 13]), [5]*4 + [6, 13]) self.assert_partitioned(d[np.argpartition(d, [5]*4)], [5]) self.assert_partitioned(d[np.argpartition(d, [5]*4 + [6, 13])], [5]*4 + [6, 13]) d = np.arange(12) np.random.shuffle(d) d1 = np.tile(np.arange(12), (4, 1)) map(np.random.shuffle, d1) d0 = np.transpose(d1) kth = (1, 6, 7, -1) p = np.partition(d1, kth, axis=1) pa = d1[np.arange(d1.shape[0])[:, None], d1.argpartition(kth, axis=1)] assert_array_equal(p, pa) for i in range(d1.shape[0]): self.assert_partitioned(p[i,:], kth) p = np.partition(d0, kth, axis=0) pa = d0[np.argpartition(d0, kth, axis=0), np.arange(d0.shape[1])[None,:]] assert_array_equal(p, pa) for i in range(d0.shape[1]): self.assert_partitioned(p[:, i], kth) def test_partition_cdtype(self): d = np.array([('Galahad', 1.7, 38), ('Arthur', 1.8, 41), ('Lancelot', 1.9, 38)], dtype=[('name', '|S10'), ('height', '<f8'), ('age', '<i4')]) tgt = np.sort(d, order=['age', 'height']) assert_array_equal(np.partition(d, range(d.size), order=['age', 'height']), tgt) assert_array_equal(d[np.argpartition(d, range(d.size), order=['age', 'height'])], tgt) for k in range(d.size): assert_equal(np.partition(d, k, order=['age', 'height'])[k], tgt[k]) assert_equal(d[np.argpartition(d, k, order=['age', 'height'])][k], tgt[k]) d = np.array(['Galahad', 'Arthur', 'zebra', 'Lancelot']) tgt = np.sort(d) assert_array_equal(np.partition(d, range(d.size)), tgt) for k in range(d.size): assert_equal(np.partition(d, k)[k], tgt[k]) assert_equal(d[np.argpartition(d, k)][k], tgt[k]) def test_partition_unicode_kind(self): d = np.arange(10) k = b'\xc3\xa4'.decode("UTF8") assert_raises(ValueError, d.partition, 2, kind=k) assert_raises(ValueError, d.argpartition, 2, kind=k) def test_partition_fuzz(self): # a few rounds of random data testing for j in range(10, 30): for i in range(1, j - 2): d = np.arange(j) np.random.shuffle(d) d = d % np.random.randint(2, 30) idx = np.random.randint(d.size) kth = [0, idx, i, i + 1] tgt = np.sort(d)[kth] assert_array_equal(np.partition(d, kth)[kth], tgt, err_msg="data: %r\n kth: %r" % (d, kth)) def test_argpartition_gh5524(self): # A test for functionality of argpartition on lists. d = [6,7,3,2,9,0] p = np.argpartition(d,1) self.assert_partitioned(np.array(d)[p],[1]) def test_flatten(self): x0 = np.array([[1, 2, 3], [4, 5, 6]], np.int32) x1 = np.array([[[1, 2], [3, 4]], [[5, 6], [7, 8]]], np.int32) y0 = np.array([1, 2, 3, 4, 5, 6], np.int32) y0f = np.array([1, 4, 2, 5, 3, 6], np.int32) y1 = np.array([1, 2, 3, 4, 5, 6, 7, 8], np.int32) y1f = np.array([1, 5, 3, 7, 2, 6, 4, 8], np.int32) assert_equal(x0.flatten(), y0) assert_equal(x0.flatten('F'), y0f) assert_equal(x0.flatten('F'), x0.T.flatten()) assert_equal(x1.flatten(), y1) assert_equal(x1.flatten('F'), y1f) assert_equal(x1.flatten('F'), x1.T.flatten()) def test_dot(self): a = np.array([[1, 0], [0, 1]]) b = np.array([[0, 1], [1, 0]]) c = np.array([[9, 1], [1, -9]]) d = np.arange(24).reshape(4, 6) ddt = np.array( [[ 55, 145, 235, 325], [ 145, 451, 757, 1063], [ 235, 757, 1279, 1801], [ 325, 1063, 1801, 2539]] ) dtd = np.array( [[504, 540, 576, 612, 648, 684], [540, 580, 620, 660, 700, 740], [576, 620, 664, 708, 752, 796], [612, 660, 708, 756, 804, 852], [648, 700, 752, 804, 856, 908], [684, 740, 796, 852, 908, 964]] ) # gemm vs syrk optimizations for et in [np.float32, np.float64, np.complex64, np.complex128]: eaf = a.astype(et) assert_equal(np.dot(eaf, eaf), eaf) assert_equal(np.dot(eaf.T, eaf), eaf) assert_equal(np.dot(eaf, eaf.T), eaf) assert_equal(np.dot(eaf.T, eaf.T), eaf) assert_equal(np.dot(eaf.T.copy(), eaf), eaf) assert_equal(np.dot(eaf, eaf.T.copy()), eaf) assert_equal(np.dot(eaf.T.copy(), eaf.T.copy()), eaf) # syrk validations for et in [np.float32, np.float64, np.complex64, np.complex128]: eaf = a.astype(et) ebf = b.astype(et) assert_equal(np.dot(ebf, ebf), eaf) assert_equal(np.dot(ebf.T, ebf), eaf) assert_equal(np.dot(ebf, ebf.T), eaf) assert_equal(np.dot(ebf.T, ebf.T), eaf) # syrk - different shape, stride, and view validations for et in [np.float32, np.float64, np.complex64, np.complex128]: edf = d.astype(et) assert_equal( np.dot(edf[::-1, :], edf.T), np.dot(edf[::-1, :].copy(), edf.T.copy()) ) assert_equal( np.dot(edf[:, ::-1], edf.T), np.dot(edf[:, ::-1].copy(), edf.T.copy()) ) assert_equal( np.dot(edf, edf[::-1, :].T), np.dot(edf, edf[::-1, :].T.copy()) ) assert_equal( np.dot(edf, edf[:, ::-1].T), np.dot(edf, edf[:, ::-1].T.copy()) ) assert_equal( np.dot(edf[:edf.shape[0] // 2, :], edf[::2, :].T), np.dot(edf[:edf.shape[0] // 2, :].copy(), edf[::2, :].T.copy()) ) assert_equal( np.dot(edf[::2, :], edf[:edf.shape[0] // 2, :].T), np.dot(edf[::2, :].copy(), edf[:edf.shape[0] // 2, :].T.copy()) ) # syrk - different shape for et in [np.float32, np.float64, np.complex64, np.complex128]: edf = d.astype(et) eddtf = ddt.astype(et) edtdf = dtd.astype(et) assert_equal(np.dot(edf, edf.T), eddtf) assert_equal(np.dot(edf.T, edf), edtdf) # function versus methods assert_equal(np.dot(a, b), a.dot(b)) assert_equal(np.dot(np.dot(a, b), c), a.dot(b).dot(c)) # test passing in an output array c = np.zeros_like(a) a.dot(b, c) assert_equal(c, np.dot(a, b)) # test keyword args c = np.zeros_like(a) a.dot(b=b, out=c) assert_equal(c, np.dot(a, b)) def test_dot_type_mismatch(self): c = 1. A = np.array((1,1), dtype='i,i') assert_raises(TypeError, np.dot, c, A) assert_raises(TypeError, np.dot, A, c) def test_dot_out_mem_overlap(self): np.random.seed(1) # Test BLAS and non-BLAS code paths, including all dtypes # that dot() supports dtypes = [np.dtype(code) for code in np.typecodes['All'] if code not in 'USVM'] for dtype in dtypes: a = np.random.rand(3, 3).astype(dtype) # Valid dot() output arrays must be aligned b = _aligned_zeros((3, 3), dtype=dtype) b[...] = np.random.rand(3, 3) y = np.dot(a, b) x = np.dot(a, b, out=b) assert_equal(x, y, err_msg=repr(dtype)) # Check invalid output array assert_raises(ValueError, np.dot, a, b, out=b[::2]) assert_raises(ValueError, np.dot, a, b, out=b.T) def test_dot_matmul_out(self): # gh-9641 class Sub(np.ndarray): pass a = np.ones((2, 2)).view(Sub) b = np.ones((2, 2)).view(Sub) out = np.ones((2, 2)) # make sure out can be any ndarray (not only subclass of inputs) np.dot(a, b, out=out) np.matmul(a, b, out=out) def test_diagonal(self): a = np.arange(12).reshape((3, 4)) assert_equal(a.diagonal(), [0, 5, 10]) assert_equal(a.diagonal(0), [0, 5, 10]) assert_equal(a.diagonal(1), [1, 6, 11]) assert_equal(a.diagonal(-1), [4, 9]) b = np.arange(8).reshape((2, 2, 2)) assert_equal(b.diagonal(), [[0, 6], [1, 7]]) assert_equal(b.diagonal(0), [[0, 6], [1, 7]]) assert_equal(b.diagonal(1), [[2], [3]]) assert_equal(b.diagonal(-1), [[4], [5]]) assert_raises(ValueError, b.diagonal, axis1=0, axis2=0) assert_equal(b.diagonal(0, 1, 2), [[0, 3], [4, 7]]) assert_equal(b.diagonal(0, 0, 1), [[0, 6], [1, 7]]) assert_equal(b.diagonal(offset=1, axis1=0, axis2=2), [[1], [3]]) # Order of axis argument doesn't matter: assert_equal(b.diagonal(0, 2, 1), [[0, 3], [4, 7]]) def test_diagonal_view_notwriteable(self): # this test is only for 1.9, the diagonal view will be # writeable in 1.10. a = np.eye(3).diagonal() assert_(not a.flags.writeable) assert_(not a.flags.owndata) a = np.diagonal(np.eye(3)) assert_(not a.flags.writeable) assert_(not a.flags.owndata) a = np.diag(np.eye(3)) assert_(not a.flags.writeable) assert_(not a.flags.owndata) def test_diagonal_memleak(self): # Regression test for a bug that crept in at one point a = np.zeros((100, 100)) if HAS_REFCOUNT: assert_(sys.getrefcount(a) < 50) for i in range(100): a.diagonal() if HAS_REFCOUNT: assert_(sys.getrefcount(a) < 50) def test_size_zero_memleak(self): # Regression test for issue 9615 # Exercises a special-case code path for dot products of length # zero in cblasfuncs (making it is specific to floating dtypes). a = np.array([], dtype=np.float64) x = np.array(2.0) for _ in range(100): np.dot(a, a, out=x) if HAS_REFCOUNT: assert_(sys.getrefcount(x) < 50) def test_trace(self): a = np.arange(12).reshape((3, 4)) assert_equal(a.trace(), 15) assert_equal(a.trace(0), 15) assert_equal(a.trace(1), 18) assert_equal(a.trace(-1), 13) b = np.arange(8).reshape((2, 2, 2)) assert_equal(b.trace(), [6, 8]) assert_equal(b.trace(0), [6, 8]) assert_equal(b.trace(1), [2, 3]) assert_equal(b.trace(-1), [4, 5]) assert_equal(b.trace(0, 0, 1), [6, 8]) assert_equal(b.trace(0, 0, 2), [5, 9]) assert_equal(b.trace(0, 1, 2), [3, 11]) assert_equal(b.trace(offset=1, axis1=0, axis2=2), [1, 3]) def test_trace_subclass(self): # The class would need to overwrite trace to ensure single-element # output also has the right subclass. class MyArray(np.ndarray): pass b = np.arange(8).reshape((2, 2, 2)).view(MyArray) t = b.trace() assert_(isinstance(t, MyArray)) def test_put(self): icodes = np.typecodes['AllInteger'] fcodes = np.typecodes['AllFloat'] for dt in icodes + fcodes + 'O': tgt = np.array([0, 1, 0, 3, 0, 5], dtype=dt) # test 1-d a = np.zeros(6, dtype=dt) a.put([1, 3, 5], [1, 3, 5]) assert_equal(a, tgt) # test 2-d a = np.zeros((2, 3), dtype=dt) a.put([1, 3, 5], [1, 3, 5]) assert_equal(a, tgt.reshape(2, 3)) for dt in '?': tgt = np.array([False, True, False, True, False, True], dtype=dt) # test 1-d a = np.zeros(6, dtype=dt) a.put([1, 3, 5], [True]*3) assert_equal(a, tgt) # test 2-d a = np.zeros((2, 3), dtype=dt) a.put([1, 3, 5], [True]*3) assert_equal(a, tgt.reshape(2, 3)) # check must be writeable a = np.zeros(6) a.flags.writeable = False assert_raises(ValueError, a.put, [1, 3, 5], [1, 3, 5]) # when calling np.put, make sure a # TypeError is raised if the object # isn't an ndarray bad_array = [1, 2, 3] assert_raises(TypeError, np.put, bad_array, [0, 2], 5) def test_ravel(self): a = np.array([[0, 1], [2, 3]]) assert_equal(a.ravel(), [0, 1, 2, 3]) assert_(not a.ravel().flags.owndata) assert_equal(a.ravel('F'), [0, 2, 1, 3]) assert_equal(a.ravel(order='C'), [0, 1, 2, 3]) assert_equal(a.ravel(order='F'), [0, 2, 1, 3]) assert_equal(a.ravel(order='A'), [0, 1, 2, 3]) assert_(not a.ravel(order='A').flags.owndata) assert_equal(a.ravel(order='K'), [0, 1, 2, 3]) assert_(not a.ravel(order='K').flags.owndata) assert_equal(a.ravel(), a.reshape(-1)) a = np.array([[0, 1], [2, 3]], order='F') assert_equal(a.ravel(), [0, 1, 2, 3]) assert_equal(a.ravel(order='A'), [0, 2, 1, 3]) assert_equal(a.ravel(order='K'), [0, 2, 1, 3]) assert_(not a.ravel(order='A').flags.owndata) assert_(not a.ravel(order='K').flags.owndata) assert_equal(a.ravel(), a.reshape(-1)) assert_equal(a.ravel(order='A'), a.reshape(-1, order='A')) a = np.array([[0, 1], [2, 3]])[::-1, :] assert_equal(a.ravel(), [2, 3, 0, 1]) assert_equal(a.ravel(order='C'), [2, 3, 0, 1]) assert_equal(a.ravel(order='F'), [2, 0, 3, 1]) assert_equal(a.ravel(order='A'), [2, 3, 0, 1]) # 'K' doesn't reverse the axes of negative strides assert_equal(a.ravel(order='K'), [2, 3, 0, 1]) assert_(a.ravel(order='K').flags.owndata) # Test simple 1-d copy behaviour: a = np.arange(10)[::2] assert_(a.ravel('K').flags.owndata) assert_(a.ravel('C').flags.owndata) assert_(a.ravel('F').flags.owndata) # Not contiguous and 1-sized axis with non matching stride a = np.arange(2**3 * 2)[::2] a = a.reshape(2, 1, 2, 2).swapaxes(-1, -2) strides = list(a.strides) strides[1] = 123 a.strides = strides assert_(a.ravel(order='K').flags.owndata) assert_equal(a.ravel('K'), np.arange(0, 15, 2)) # contiguous and 1-sized axis with non matching stride works: a = np.arange(2**3) a = a.reshape(2, 1, 2, 2).swapaxes(-1, -2) strides = list(a.strides) strides[1] = 123 a.strides = strides assert_(np.may_share_memory(a.ravel(order='K'), a)) assert_equal(a.ravel(order='K'), np.arange(2**3)) # Test negative strides (not very interesting since non-contiguous): a = np.arange(4)[::-1].reshape(2, 2) assert_(a.ravel(order='C').flags.owndata) assert_(a.ravel(order='K').flags.owndata) assert_equal(a.ravel('C'), [3, 2, 1, 0]) assert_equal(a.ravel('K'), [3, 2, 1, 0]) # 1-element tidy strides test (NPY_RELAXED_STRIDES_CHECKING): a = np.array([[1]]) a.strides = (123, 432) # If the stride is not 8, NPY_RELAXED_STRIDES_CHECKING is messing # them up on purpose: if np.ones(1).strides == (8,): assert_(np.may_share_memory(a.ravel('K'), a)) assert_equal(a.ravel('K').strides, (a.dtype.itemsize,)) for order in ('C', 'F', 'A', 'K'): # 0-d corner case: a = np.array(0) assert_equal(a.ravel(order), [0]) assert_(np.may_share_memory(a.ravel(order), a)) # Test that certain non-inplace ravels work right (mostly) for 'K': b = np.arange(2**4 * 2)[::2].reshape(2, 2, 2, 2) a = b[..., ::2] assert_equal(a.ravel('K'), [0, 4, 8, 12, 16, 20, 24, 28]) assert_equal(a.ravel('C'), [0, 4, 8, 12, 16, 20, 24, 28]) assert_equal(a.ravel('A'), [0, 4, 8, 12, 16, 20, 24, 28]) assert_equal(a.ravel('F'), [0, 16, 8, 24, 4, 20, 12, 28]) a = b[::2, ...] assert_equal(a.ravel('K'), [0, 2, 4, 6, 8, 10, 12, 14]) assert_equal(a.ravel('C'), [0, 2, 4, 6, 8, 10, 12, 14]) assert_equal(a.ravel('A'), [0, 2, 4, 6, 8, 10, 12, 14]) assert_equal(a.ravel('F'), [0, 8, 4, 12, 2, 10, 6, 14]) def test_ravel_subclass(self): class ArraySubclass(np.ndarray): pass a = np.arange(10).view(ArraySubclass) assert_(isinstance(a.ravel('C'), ArraySubclass)) assert_(isinstance(a.ravel('F'), ArraySubclass)) assert_(isinstance(a.ravel('A'), ArraySubclass)) assert_(isinstance(a.ravel('K'), ArraySubclass)) a = np.arange(10)[::2].view(ArraySubclass) assert_(isinstance(a.ravel('C'), ArraySubclass)) assert_(isinstance(a.ravel('F'), ArraySubclass)) assert_(isinstance(a.ravel('A'), ArraySubclass)) assert_(isinstance(a.ravel('K'), ArraySubclass)) def test_swapaxes(self): a = np.arange(1*2*3*4).reshape(1, 2, 3, 4).copy() idx = np.indices(a.shape) assert_(a.flags['OWNDATA']) b = a.copy() # check exceptions assert_raises(ValueError, a.swapaxes, -5, 0) assert_raises(ValueError, a.swapaxes, 4, 0) assert_raises(ValueError, a.swapaxes, 0, -5) assert_raises(ValueError, a.swapaxes, 0, 4) for i in range(-4, 4): for j in range(-4, 4): for k, src in enumerate((a, b)): c = src.swapaxes(i, j) # check shape shape = list(src.shape) shape[i] = src.shape[j] shape[j] = src.shape[i] assert_equal(c.shape, shape, str((i, j, k))) # check array contents i0, i1, i2, i3 = [dim-1 for dim in c.shape] j0, j1, j2, j3 = [dim-1 for dim in src.shape] assert_equal(src[idx[j0], idx[j1], idx[j2], idx[j3]], c[idx[i0], idx[i1], idx[i2], idx[i3]], str((i, j, k))) # check a view is always returned, gh-5260 assert_(not c.flags['OWNDATA'], str((i, j, k))) # check on non-contiguous input array if k == 1: b = c def test_conjugate(self): a = np.array([1-1j, 1+1j, 23+23.0j]) ac = a.conj() assert_equal(a.real, ac.real) assert_equal(a.imag, -ac.imag) assert_equal(ac, a.conjugate()) assert_equal(ac, np.conjugate(a)) a = np.array([1-1j, 1+1j, 23+23.0j], 'F') ac = a.conj() assert_equal(a.real, ac.real) assert_equal(a.imag, -ac.imag) assert_equal(ac, a.conjugate()) assert_equal(ac, np.conjugate(a)) a = np.array([1, 2, 3]) ac = a.conj() assert_equal(a, ac) assert_equal(ac, a.conjugate()) assert_equal(ac, np.conjugate(a)) a = np.array([1.0, 2.0, 3.0]) ac = a.conj() assert_equal(a, ac) assert_equal(ac, a.conjugate()) assert_equal(ac, np.conjugate(a)) a = np.array([1-1j, 1+1j, 1, 2.0], object) ac = a.conj() assert_equal(ac, [k.conjugate() for k in a]) assert_equal(ac, a.conjugate()) assert_equal(ac, np.conjugate(a)) a = np.array([1-1j, 1, 2.0, 'f'], object) assert_raises(AttributeError, lambda: a.conj()) assert_raises(AttributeError, lambda: a.conjugate()) def test__complex__(self): dtypes = ['i1', 'i2', 'i4', 'i8', 'u1', 'u2', 'u4', 'u8', 'f', 'd', 'g', 'F', 'D', 'G', '?', 'O'] for dt in dtypes: a = np.array(7, dtype=dt) b = np.array([7], dtype=dt) c = np.array([[[[[7]]]]], dtype=dt) msg = 'dtype: {0}'.format(dt) ap = complex(a) assert_equal(ap, a, msg) bp = complex(b) assert_equal(bp, b, msg) cp = complex(c) assert_equal(cp, c, msg) def test__complex__should_not_work(self): dtypes = ['i1', 'i2', 'i4', 'i8', 'u1', 'u2', 'u4', 'u8', 'f', 'd', 'g', 'F', 'D', 'G', '?', 'O'] for dt in dtypes: a = np.array([1, 2, 3], dtype=dt) assert_raises(TypeError, complex, a) dt = np.dtype([('a', 'f8'), ('b', 'i1')]) b = np.array((1.0, 3), dtype=dt) assert_raises(TypeError, complex, b) c = np.array([(1.0, 3), (2e-3, 7)], dtype=dt) assert_raises(TypeError, complex, c) d = np.array('1+1j') assert_raises(TypeError, complex, d) e = np.array(['1+1j'], 'U') assert_raises(TypeError, complex, e) class TestCequenceMethods(object): def test_array_contains(self): assert_(4.0 in np.arange(16.).reshape(4,4)) assert_(20.0 not in np.arange(16.).reshape(4,4)) class TestBinop(object): def test_inplace(self): # test refcount 1 inplace conversion assert_array_almost_equal(np.array([0.5]) * np.array([1.0, 2.0]), [0.5, 1.0]) d = np.array([0.5, 0.5])[::2] assert_array_almost_equal(d * (d * np.array([1.0, 2.0])), [0.25, 0.5]) a = np.array([0.5]) b = np.array([0.5]) c = a + b c = a - b c = a * b c = a / b assert_equal(a, b) assert_almost_equal(c, 1.) c = a + b * 2. / b * a - a / b assert_equal(a, b) assert_equal(c, 0.5) # true divide a = np.array([5]) b = np.array([3]) c = (a * a) / b assert_almost_equal(c, 25 / 3) assert_equal(a, 5) assert_equal(b, 3) # ndarray.__rop__ always calls ufunc # ndarray.__iop__ always calls ufunc # ndarray.__op__, __rop__: # - defer if other has __array_ufunc__ and it is None # or other is not a subclass and has higher array priority # - else, call ufunc def test_ufunc_binop_interaction(self): # Python method name (without underscores) # -> (numpy ufunc, has_in_place_version, preferred_dtype) ops = { 'add': (np.add, True, float), 'sub': (np.subtract, True, float), 'mul': (np.multiply, True, float), 'truediv': (np.true_divide, True, float), 'floordiv': (np.floor_divide, True, float), 'mod': (np.remainder, True, float), 'divmod': (np.divmod, False, float), 'pow': (np.power, True, int), 'lshift': (np.left_shift, True, int), 'rshift': (np.right_shift, True, int), 'and': (np.bitwise_and, True, int), 'xor': (np.bitwise_xor, True, int), 'or': (np.bitwise_or, True, int), # 'ge': (np.less_equal, False), # 'gt': (np.less, False), # 'le': (np.greater_equal, False), # 'lt': (np.greater, False), # 'eq': (np.equal, False), # 'ne': (np.not_equal, False), } class Coerced(Exception): pass def array_impl(self): raise Coerced def op_impl(self, other): return "forward" def rop_impl(self, other): return "reverse" def iop_impl(self, other): return "in-place" def array_ufunc_impl(self, ufunc, method, *args, **kwargs): return ("__array_ufunc__", ufunc, method, args, kwargs) # Create an object with the given base, in the given module, with a # bunch of placeholder __op__ methods, and optionally a # __array_ufunc__ and __array_priority__. def make_obj(base, array_priority=False, array_ufunc=False, alleged_module="__main__"): class_namespace = {"__array__": array_impl} if array_priority is not False: class_namespace["__array_priority__"] = array_priority for op in ops: class_namespace["__{0}__".format(op)] = op_impl class_namespace["__r{0}__".format(op)] = rop_impl class_namespace["__i{0}__".format(op)] = iop_impl if array_ufunc is not False: class_namespace["__array_ufunc__"] = array_ufunc eval_namespace = {"base": base, "class_namespace": class_namespace, "__name__": alleged_module, } MyType = eval("type('MyType', (base,), class_namespace)", eval_namespace) if issubclass(MyType, np.ndarray): # Use this range to avoid special case weirdnesses around # divide-by-0, pow(x, 2), overflow due to pow(big, big), etc. return np.arange(3, 5).view(MyType) else: return MyType() def check(obj, binop_override_expected, ufunc_override_expected, inplace_override_expected, check_scalar=True): for op, (ufunc, has_inplace, dtype) in ops.items(): err_msg = ('op: %s, ufunc: %s, has_inplace: %s, dtype: %s' % (op, ufunc, has_inplace, dtype)) check_objs = [np.arange(3, 5, dtype=dtype)] if check_scalar: check_objs.append(check_objs[0][0]) for arr in check_objs: arr_method = getattr(arr, "__{0}__".format(op)) def first_out_arg(result): if op == "divmod": assert_(isinstance(result, tuple)) return result[0] else: return result # arr __op__ obj if binop_override_expected: assert_equal(arr_method(obj), NotImplemented, err_msg) elif ufunc_override_expected: assert_equal(arr_method(obj)[0], "__array_ufunc__", err_msg) else: if (isinstance(obj, np.ndarray) and (type(obj).__array_ufunc__ is np.ndarray.__array_ufunc__)): # __array__ gets ignored res = first_out_arg(arr_method(obj)) assert_(res.__class__ is obj.__class__, err_msg) else: assert_raises((TypeError, Coerced), arr_method, obj, err_msg=err_msg) # obj __op__ arr arr_rmethod = getattr(arr, "__r{0}__".format(op)) if ufunc_override_expected: res = arr_rmethod(obj) assert_equal(res[0], "__array_ufunc__", err_msg=err_msg) assert_equal(res[1], ufunc, err_msg=err_msg) else: if (isinstance(obj, np.ndarray) and (type(obj).__array_ufunc__ is np.ndarray.__array_ufunc__)): # __array__ gets ignored res = first_out_arg(arr_rmethod(obj)) assert_(res.__class__ is obj.__class__, err_msg) else: # __array_ufunc__ = "asdf" creates a TypeError assert_raises((TypeError, Coerced), arr_rmethod, obj, err_msg=err_msg) # arr __iop__ obj # array scalars don't have in-place operators if has_inplace and isinstance(arr, np.ndarray): arr_imethod = getattr(arr, "__i{0}__".format(op)) if inplace_override_expected: assert_equal(arr_method(obj), NotImplemented, err_msg=err_msg) elif ufunc_override_expected: res = arr_imethod(obj) assert_equal(res[0], "__array_ufunc__", err_msg) assert_equal(res[1], ufunc, err_msg) assert_(type(res[-1]["out"]) is tuple, err_msg) assert_(res[-1]["out"][0] is arr, err_msg) else: if (isinstance(obj, np.ndarray) and (type(obj).__array_ufunc__ is np.ndarray.__array_ufunc__)): # __array__ gets ignored assert_(arr_imethod(obj) is arr, err_msg) else: assert_raises((TypeError, Coerced), arr_imethod, obj, err_msg=err_msg) op_fn = getattr(operator, op, None) if op_fn is None: op_fn = getattr(operator, op + "_", None) if op_fn is None: op_fn = getattr(builtins, op) assert_equal(op_fn(obj, arr), "forward", err_msg) if not isinstance(obj, np.ndarray): if binop_override_expected: assert_equal(op_fn(arr, obj), "reverse", err_msg) elif ufunc_override_expected: assert_equal(op_fn(arr, obj)[0], "__array_ufunc__", err_msg) if ufunc_override_expected: assert_equal(ufunc(obj, arr)[0], "__array_ufunc__", err_msg) # No array priority, no array_ufunc -> nothing called check(make_obj(object), False, False, False) # Negative array priority, no array_ufunc -> nothing called # (has to be very negative, because scalar priority is -1000000.0) check(make_obj(object, array_priority=-2**30), False, False, False) # Positive array priority, no array_ufunc -> binops and iops only check(make_obj(object, array_priority=1), True, False, True) # ndarray ignores array_priority for ndarray subclasses check(make_obj(np.ndarray, array_priority=1), False, False, False, check_scalar=False) # Positive array_priority and array_ufunc -> array_ufunc only check(make_obj(object, array_priority=1, array_ufunc=array_ufunc_impl), False, True, False) check(make_obj(np.ndarray, array_priority=1, array_ufunc=array_ufunc_impl), False, True, False) # array_ufunc set to None -> defer binops only check(make_obj(object, array_ufunc=None), True, False, False) check(make_obj(np.ndarray, array_ufunc=None), True, False, False, check_scalar=False) def test_ufunc_override_normalize_signature(self): # gh-5674 class SomeClass(object): def __array_ufunc__(self, ufunc, method, *inputs, **kw): return kw a = SomeClass() kw = np.add(a, [1]) assert_('sig' not in kw and 'signature' not in kw) kw = np.add(a, [1], sig='ii->i') assert_('sig' not in kw and 'signature' in kw) assert_equal(kw['signature'], 'ii->i') kw = np.add(a, [1], signature='ii->i') assert_('sig' not in kw and 'signature' in kw) assert_equal(kw['signature'], 'ii->i') def test_array_ufunc_index(self): # Check that index is set appropriately, also if only an output # is passed on (latter is another regression tests for github bug 4753) # This also checks implicitly that 'out' is always a tuple. class CheckIndex(object): def __array_ufunc__(self, ufunc, method, *inputs, **kw): for i, a in enumerate(inputs): if a is self: return i # calls below mean we must be in an output. for j, a in enumerate(kw['out']): if a is self: return (j,) a = CheckIndex() dummy = np.arange(2.) # 1 input, 1 output assert_equal(np.sin(a), 0) assert_equal(np.sin(dummy, a), (0,)) assert_equal(np.sin(dummy, out=a), (0,)) assert_equal(np.sin(dummy, out=(a,)), (0,)) assert_equal(np.sin(a, a), 0) assert_equal(np.sin(a, out=a), 0) assert_equal(np.sin(a, out=(a,)), 0) # 1 input, 2 outputs assert_equal(np.modf(dummy, a), (0,)) assert_equal(np.modf(dummy, None, a), (1,)) assert_equal(np.modf(dummy, dummy, a), (1,)) assert_equal(np.modf(dummy, out=(a, None)), (0,)) assert_equal(np.modf(dummy, out=(a, dummy)), (0,)) assert_equal(np.modf(dummy, out=(None, a)), (1,)) assert_equal(np.modf(dummy, out=(dummy, a)), (1,)) assert_equal(np.modf(a, out=(dummy, a)), 0) with warnings.catch_warnings(record=True) as w: warnings.filterwarnings('always', '', DeprecationWarning) assert_equal(np.modf(dummy, out=a), (0,)) assert_(w[0].category is DeprecationWarning) assert_raises(ValueError, np.modf, dummy, out=(a,)) # 2 inputs, 1 output assert_equal(np.add(a, dummy), 0) assert_equal(np.add(dummy, a), 1) assert_equal(np.add(dummy, dummy, a), (0,)) assert_equal(np.add(dummy, a, a), 1) assert_equal(np.add(dummy, dummy, out=a), (0,)) assert_equal(np.add(dummy, dummy, out=(a,)), (0,)) assert_equal(np.add(a, dummy, out=a), 0) def test_out_override(self): # regression test for github bug 4753 class OutClass(np.ndarray): def __array_ufunc__(self, ufunc, method, *inputs, **kw): if 'out' in kw: tmp_kw = kw.copy() tmp_kw.pop('out') func = getattr(ufunc, method) kw['out'][0][...] = func(*inputs, **tmp_kw) A = np.array([0]).view(OutClass) B = np.array([5]) C = np.array([6]) np.multiply(C, B, A) assert_equal(A[0], 30) assert_(isinstance(A, OutClass)) A[0] = 0 np.multiply(C, B, out=A) assert_equal(A[0], 30) assert_(isinstance(A, OutClass)) def test_pow_override_with_errors(self): # regression test for gh-9112 class PowerOnly(np.ndarray): def __array_ufunc__(self, ufunc, method, *inputs, **kw): if ufunc is not np.power: raise NotImplementedError return "POWER!" # explicit cast to float, to ensure the fast power path is taken. a = np.array(5., dtype=np.float64).view(PowerOnly) assert_equal(a ** 2.5, "POWER!") with assert_raises(NotImplementedError): a ** 0.5 with assert_raises(NotImplementedError): a ** 0 with assert_raises(NotImplementedError): a ** 1 with assert_raises(NotImplementedError): a ** -1 with assert_raises(NotImplementedError): a ** 2 class TestTemporaryElide(object): # elision is only triggered on relatively large arrays def test_extension_incref_elide(self): # test extension (e.g. cython) calling PyNumber_* slots without # increasing the reference counts # # def incref_elide(a): # d = input.copy() # refcount 1 # return d, d + d # PyNumber_Add without increasing refcount from numpy.core.multiarray_tests import incref_elide d = np.ones(100000) orig, res = incref_elide(d) d + d # the return original should not be changed to an inplace operation assert_array_equal(orig, d) assert_array_equal(res, d + d) def test_extension_incref_elide_stack(self): # scanning if the refcount == 1 object is on the python stack to check # that we are called directly from python is flawed as object may still # be above the stack pointer and we have no access to the top of it # # def incref_elide_l(d): # return l[4] + l[4] # PyNumber_Add without increasing refcount from numpy.core.multiarray_tests import incref_elide_l # padding with 1 makes sure the object on the stack is not overwriten l = [1, 1, 1, 1, np.ones(100000)] res = incref_elide_l(l) # the return original should not be changed to an inplace operation assert_array_equal(l[4], np.ones(100000)) assert_array_equal(res, l[4] + l[4]) def test_temporary_with_cast(self): # check that we don't elide into a temporary which would need casting d = np.ones(200000, dtype=np.int64) assert_equal(((d + d) + 2**222).dtype, np.dtype('O')) r = ((d + d) / 2) assert_equal(r.dtype, np.dtype('f8')) r = np.true_divide((d + d), 2) assert_equal(r.dtype, np.dtype('f8')) r = ((d + d) / 2.) assert_equal(r.dtype, np.dtype('f8')) r = ((d + d) // 2) assert_equal(r.dtype, np.dtype(np.int64)) # commutative elision into the astype result f = np.ones(100000, dtype=np.float32) assert_equal(((f + f) + f.astype(np.float64)).dtype, np.dtype('f8')) # no elision into lower type d = f.astype(np.float64) assert_equal(((f + f) + d).dtype, d.dtype) l = np.ones(100000, dtype=np.longdouble) assert_equal(((d + d) + l).dtype, l.dtype) # test unary abs with different output dtype for dt in (np.complex64, np.complex128, np.clongdouble): c = np.ones(100000, dtype=dt) r = abs(c * 2.0) assert_equal(r.dtype, np.dtype('f%d' % (c.itemsize // 2))) def test_elide_broadcast(self): # test no elision on broadcast to higher dimension # only triggers elision code path in debug mode as triggering it in # normal mode needs 256kb large matching dimension, so a lot of memory d = np.ones((2000, 1), dtype=int) b = np.ones((2000), dtype=bool) r = (1 - d) + b assert_equal(r, 1) assert_equal(r.shape, (2000, 2000)) def test_elide_scalar(self): # check inplace op does not create ndarray from scalars a = np.bool_() assert_(type(~(a & a)) is np.bool_) def test_elide_scalar_readonly(self): # The imaginary part of a real array is readonly. This needs to go # through fast_scalar_power which is only called for powers of # +1, -1, 0, 0.5, and 2, so use 2. Also need valid refcount for # elision which can be gotten for the imaginary part of a real # array. Should not error. a = np.empty(100000, dtype=np.float64) a.imag ** 2 def test_elide_readonly(self): # don't try to elide readonly temporaries r = np.asarray(np.broadcast_to(np.zeros(1), 100000).flat) * 0.0 assert_equal(r, 0) def test_elide_updateifcopy(self): a = np.ones(2**20)[::2] b = a.flat.__array__() + 1 del b assert_equal(a, 1) class TestCAPI(object): def test_IsPythonScalar(self): from numpy.core.multiarray_tests import IsPythonScalar assert_(IsPythonScalar(b'foobar')) assert_(IsPythonScalar(1)) assert_(IsPythonScalar(2**80)) assert_(IsPythonScalar(2.)) assert_(IsPythonScalar("a")) class TestSubscripting(object): def test_test_zero_rank(self): x = np.array([1, 2, 3]) assert_(isinstance(x[0], np.int_)) if sys.version_info[0] < 3: assert_(isinstance(x[0], int)) assert_(type(x[0, ...]) is np.ndarray) class TestPickling(object): def test_roundtrip(self): import pickle carray = np.array([[2, 9], [7, 0], [3, 8]]) DATA = [ carray, np.transpose(carray), np.array([('xxx', 1, 2.0)], dtype=[('a', (str, 3)), ('b', int), ('c', float)]) ] for a in DATA: assert_equal(a, pickle.loads(a.dumps()), err_msg="%r" % a) def _loads(self, obj): if sys.version_info[0] >= 3: return np.loads(obj, encoding='latin1') else: return np.loads(obj) # version 0 pickles, using protocol=2 to pickle # version 0 doesn't have a version field def test_version0_int8(self): s = b'\x80\x02cnumpy.core._internal\n_reconstruct\nq\x01cnumpy\nndarray\nq\x02K\x00\x85U\x01b\x87Rq\x03(K\x04\x85cnumpy\ndtype\nq\x04U\x02i1K\x00K\x01\x87Rq\x05(U\x01|NNJ\xff\xff\xff\xffJ\xff\xff\xff\xfftb\x89U\x04\x01\x02\x03\x04tb.' a = np.array([1, 2, 3, 4], dtype=np.int8) p = self._loads(s) assert_equal(a, p) def test_version0_float32(self): s = b'\x80\x02cnumpy.core._internal\n_reconstruct\nq\x01cnumpy\nndarray\nq\x02K\x00\x85U\x01b\x87Rq\x03(K\x04\x85cnumpy\ndtype\nq\x04U\x02f4K\x00K\x01\x87Rq\x05(U\x01<NNJ\xff\xff\xff\xffJ\xff\xff\xff\xfftb\x89U\x10\x00\x00\x80?\x00\x00\x00@\x00\x00@@\x00\x00\x80@tb.' a = np.array([1.0, 2.0, 3.0, 4.0], dtype=np.float32) p = self._loads(s) assert_equal(a, p) def test_version0_object(self): s = b'\x80\x02cnumpy.core._internal\n_reconstruct\nq\x01cnumpy\nndarray\nq\x02K\x00\x85U\x01b\x87Rq\x03(K\x02\x85cnumpy\ndtype\nq\x04U\x02O8K\x00K\x01\x87Rq\x05(U\x01|NNJ\xff\xff\xff\xffJ\xff\xff\xff\xfftb\x89]q\x06(}q\x07U\x01aK\x01s}q\x08U\x01bK\x02setb.' a = np.array([{'a': 1}, {'b': 2}]) p = self._loads(s) assert_equal(a, p) # version 1 pickles, using protocol=2 to pickle def test_version1_int8(self): s = b'\x80\x02cnumpy.core._internal\n_reconstruct\nq\x01cnumpy\nndarray\nq\x02K\x00\x85U\x01b\x87Rq\x03(K\x01K\x04\x85cnumpy\ndtype\nq\x04U\x02i1K\x00K\x01\x87Rq\x05(K\x01U\x01|NNJ\xff\xff\xff\xffJ\xff\xff\xff\xfftb\x89U\x04\x01\x02\x03\x04tb.' a = np.array([1, 2, 3, 4], dtype=np.int8) p = self._loads(s) assert_equal(a, p) def test_version1_float32(self): s = b'\x80\x02cnumpy.core._internal\n_reconstruct\nq\x01cnumpy\nndarray\nq\x02K\x00\x85U\x01b\x87Rq\x03(K\x01K\x04\x85cnumpy\ndtype\nq\x04U\x02f4K\x00K\x01\x87Rq\x05(K\x01U\x01<NNJ\xff\xff\xff\xffJ\xff\xff\xff\xfftb\x89U\x10\x00\x00\x80?\x00\x00\x00@\x00\x00@@\x00\x00\x80@tb.' a = np.array([1.0, 2.0, 3.0, 4.0], dtype=np.float32) p = self._loads(s) assert_equal(a, p) def test_version1_object(self): s = b'\x80\x02cnumpy.core._internal\n_reconstruct\nq\x01cnumpy\nndarray\nq\x02K\x00\x85U\x01b\x87Rq\x03(K\x01K\x02\x85cnumpy\ndtype\nq\x04U\x02O8K\x00K\x01\x87Rq\x05(K\x01U\x01|NNJ\xff\xff\xff\xffJ\xff\xff\xff\xfftb\x89]q\x06(}q\x07U\x01aK\x01s}q\x08U\x01bK\x02setb.' a = np.array([{'a': 1}, {'b': 2}]) p = self._loads(s) assert_equal(a, p) def test_subarray_int_shape(self): s = b"cnumpy.core.multiarray\n_reconstruct\np0\n(cnumpy\nndarray\np1\n(I0\ntp2\nS'b'\np3\ntp4\nRp5\n(I1\n(I1\ntp6\ncnumpy\ndtype\np7\n(S'V6'\np8\nI0\nI1\ntp9\nRp10\n(I3\nS'|'\np11\nN(S'a'\np12\ng3\ntp13\n(dp14\ng12\n(g7\n(S'V4'\np15\nI0\nI1\ntp16\nRp17\n(I3\nS'|'\np18\n(g7\n(S'i1'\np19\nI0\nI1\ntp20\nRp21\n(I3\nS'|'\np22\nNNNI-1\nI-1\nI0\ntp23\nb(I2\nI2\ntp24\ntp25\nNNI4\nI1\nI0\ntp26\nbI0\ntp27\nsg3\n(g7\n(S'V2'\np28\nI0\nI1\ntp29\nRp30\n(I3\nS'|'\np31\n(g21\nI2\ntp32\nNNI2\nI1\nI0\ntp33\nbI4\ntp34\nsI6\nI1\nI0\ntp35\nbI00\nS'\\x01\\x01\\x01\\x01\\x01\\x02'\np36\ntp37\nb." a = np.array([(1, (1, 2))], dtype=[('a', 'i1', (2, 2)), ('b', 'i1', 2)]) p = self._loads(s) assert_equal(a, p) class TestFancyIndexing(object): def test_list(self): x = np.ones((1, 1)) x[:, [0]] = 2.0 assert_array_equal(x, np.array([[2.0]])) x = np.ones((1, 1, 1)) x[:, :, [0]] = 2.0 assert_array_equal(x, np.array([[[2.0]]])) def test_tuple(self): x = np.ones((1, 1)) x[:, (0,)] = 2.0 assert_array_equal(x, np.array([[2.0]])) x = np.ones((1, 1, 1)) x[:, :, (0,)] = 2.0 assert_array_equal(x, np.array([[[2.0]]])) def test_mask(self): x = np.array([1, 2, 3, 4]) m = np.array([0, 1, 0, 0], bool) assert_array_equal(x[m], np.array([2])) def test_mask2(self): x = np.array([[1, 2, 3, 4], [5, 6, 7, 8]]) m = np.array([0, 1], bool) m2 = np.array([[0, 1, 0, 0], [1, 0, 0, 0]], bool) m3 = np.array([[0, 1, 0, 0], [0, 0, 0, 0]], bool) assert_array_equal(x[m], np.array([[5, 6, 7, 8]])) assert_array_equal(x[m2], np.array([2, 5])) assert_array_equal(x[m3], np.array([2])) def test_assign_mask(self): x = np.array([1, 2, 3, 4]) m = np.array([0, 1, 0, 0], bool) x[m] = 5 assert_array_equal(x, np.array([1, 5, 3, 4])) def test_assign_mask2(self): xorig = np.array([[1, 2, 3, 4], [5, 6, 7, 8]]) m = np.array([0, 1], bool) m2 = np.array([[0, 1, 0, 0], [1, 0, 0, 0]], bool) m3 = np.array([[0, 1, 0, 0], [0, 0, 0, 0]], bool) x = xorig.copy() x[m] = 10 assert_array_equal(x, np.array([[1, 2, 3, 4], [10, 10, 10, 10]])) x = xorig.copy() x[m2] = 10 assert_array_equal(x, np.array([[1, 10, 3, 4], [10, 6, 7, 8]])) x = xorig.copy() x[m3] = 10 assert_array_equal(x, np.array([[1, 10, 3, 4], [5, 6, 7, 8]])) class TestStringCompare(object): def test_string(self): g1 = np.array(["This", "is", "example"]) g2 = np.array(["This", "was", "example"]) assert_array_equal(g1 == g2, [g1[i] == g2[i] for i in [0, 1, 2]]) assert_array_equal(g1 != g2, [g1[i] != g2[i] for i in [0, 1, 2]]) assert_array_equal(g1 <= g2, [g1[i] <= g2[i] for i in [0, 1, 2]]) assert_array_equal(g1 >= g2, [g1[i] >= g2[i] for i in [0, 1, 2]]) assert_array_equal(g1 < g2, [g1[i] < g2[i] for i in [0, 1, 2]]) assert_array_equal(g1 > g2, [g1[i] > g2[i] for i in [0, 1, 2]]) def test_mixed(self): g1 = np.array(["spam", "spa", "spammer", "and eggs"]) g2 = "spam" assert_array_equal(g1 == g2, [x == g2 for x in g1]) assert_array_equal(g1 != g2, [x != g2 for x in g1]) assert_array_equal(g1 < g2, [x < g2 for x in g1]) assert_array_equal(g1 > g2, [x > g2 for x in g1]) assert_array_equal(g1 <= g2, [x <= g2 for x in g1]) assert_array_equal(g1 >= g2, [x >= g2 for x in g1]) def test_unicode(self): g1 = np.array([u"This", u"is", u"example"]) g2 = np.array([u"This", u"was", u"example"]) assert_array_equal(g1 == g2, [g1[i] == g2[i] for i in [0, 1, 2]]) assert_array_equal(g1 != g2, [g1[i] != g2[i] for i in [0, 1, 2]]) assert_array_equal(g1 <= g2, [g1[i] <= g2[i] for i in [0, 1, 2]]) assert_array_equal(g1 >= g2, [g1[i] >= g2[i] for i in [0, 1, 2]]) assert_array_equal(g1 < g2, [g1[i] < g2[i] for i in [0, 1, 2]]) assert_array_equal(g1 > g2, [g1[i] > g2[i] for i in [0, 1, 2]]) class TestArgmax(object): nan_arr = [ ([0, 1, 2, 3, np.nan], 4), ([0, 1, 2, np.nan, 3], 3), ([np.nan, 0, 1, 2, 3], 0), ([np.nan, 0, np.nan, 2, 3], 0), ([0, 1, 2, 3, complex(0, np.nan)], 4), ([0, 1, 2, 3, complex(np.nan, 0)], 4), ([0, 1, 2, complex(np.nan, 0), 3], 3), ([0, 1, 2, complex(0, np.nan), 3], 3), ([complex(0, np.nan), 0, 1, 2, 3], 0), ([complex(np.nan, np.nan), 0, 1, 2, 3], 0), ([complex(np.nan, 0), complex(np.nan, 2), complex(np.nan, 1)], 0), ([complex(np.nan, np.nan), complex(np.nan, 2), complex(np.nan, 1)], 0), ([complex(np.nan, 0), complex(np.nan, 2), complex(np.nan, np.nan)], 0), ([complex(0, 0), complex(0, 2), complex(0, 1)], 1), ([complex(1, 0), complex(0, 2), complex(0, 1)], 0), ([complex(1, 0), complex(0, 2), complex(1, 1)], 2), ([np.datetime64('1923-04-14T12:43:12'), np.datetime64('1994-06-21T14:43:15'), np.datetime64('2001-10-15T04:10:32'), np.datetime64('1995-11-25T16:02:16'), np.datetime64('2005-01-04T03:14:12'), np.datetime64('2041-12-03T14:05:03')], 5), ([np.datetime64('1935-09-14T04:40:11'), np.datetime64('1949-10-12T12:32:11'), np.datetime64('2010-01-03T05:14:12'), np.datetime64('2015-11-20T12:20:59'), np.datetime64('1932-09-23T10:10:13'), np.datetime64('2014-10-10T03:50:30')], 3), # Assorted tests with NaTs ([np.datetime64('NaT'), np.datetime64('NaT'), np.datetime64('2010-01-03T05:14:12'), np.datetime64('NaT'), np.datetime64('2015-09-23T10:10:13'), np.datetime64('1932-10-10T03:50:30')], 4), ([np.datetime64('2059-03-14T12:43:12'), np.datetime64('1996-09-21T14:43:15'), np.datetime64('NaT'), np.datetime64('2022-12-25T16:02:16'), np.datetime64('1963-10-04T03:14:12'), np.datetime64('2013-05-08T18:15:23')], 0), ([np.timedelta64(2, 's'), np.timedelta64(1, 's'), np.timedelta64('NaT', 's'), np.timedelta64(3, 's')], 3), ([np.timedelta64('NaT', 's')] * 3, 0), ([timedelta(days=5, seconds=14), timedelta(days=2, seconds=35), timedelta(days=-1, seconds=23)], 0), ([timedelta(days=1, seconds=43), timedelta(days=10, seconds=5), timedelta(days=5, seconds=14)], 1), ([timedelta(days=10, seconds=24), timedelta(days=10, seconds=5), timedelta(days=10, seconds=43)], 2), ([False, False, False, False, True], 4), ([False, False, False, True, False], 3), ([True, False, False, False, False], 0), ([True, False, True, False, False], 0), ] def test_all(self): a = np.random.normal(0, 1, (4, 5, 6, 7, 8)) for i in range(a.ndim): amax = a.max(i) aargmax = a.argmax(i) axes = list(range(a.ndim)) axes.remove(i) assert_(np.all(amax == aargmax.choose(*a.transpose(i,*axes)))) def test_combinations(self): for arr, pos in self.nan_arr: with suppress_warnings() as sup: sup.filter(RuntimeWarning, "invalid value encountered in reduce") max_val = np.max(arr) assert_equal(np.argmax(arr), pos, err_msg="%r" % arr) assert_equal(arr[np.argmax(arr)], max_val, err_msg="%r" % arr) def test_output_shape(self): # see also gh-616 a = np.ones((10, 5)) # Check some simple shape mismatches out = np.ones(11, dtype=np.int_) assert_raises(ValueError, a.argmax, -1, out) out = np.ones((2, 5), dtype=np.int_) assert_raises(ValueError, a.argmax, -1, out) # these could be relaxed possibly (used to allow even the previous) out = np.ones((1, 10), dtype=np.int_) assert_raises(ValueError, a.argmax, -1, out) out = np.ones(10, dtype=np.int_) a.argmax(-1, out=out) assert_equal(out, a.argmax(-1)) def test_argmax_unicode(self): d = np.zeros(6031, dtype='<U9') d[5942] = "as" assert_equal(d.argmax(), 5942) def test_np_vs_ndarray(self): # make sure both ndarray.argmax and numpy.argmax support out/axis args a = np.random.normal(size=(2,3)) # check positional args out1 = np.zeros(2, dtype=int) out2 = np.zeros(2, dtype=int) assert_equal(a.argmax(1, out1), np.argmax(a, 1, out2)) assert_equal(out1, out2) # check keyword args out1 = np.zeros(3, dtype=int) out2 = np.zeros(3, dtype=int) assert_equal(a.argmax(out=out1, axis=0), np.argmax(a, out=out2, axis=0)) assert_equal(out1, out2) def test_object_argmax_with_NULLs(self): # See gh-6032 a = np.empty(4, dtype='O') ctypes.memset(a.ctypes.data, 0, a.nbytes) assert_equal(a.argmax(), 0) a[3] = 10 assert_equal(a.argmax(), 3) a[1] = 30 assert_equal(a.argmax(), 1) class TestArgmin(object): nan_arr = [ ([0, 1, 2, 3, np.nan], 4), ([0, 1, 2, np.nan, 3], 3), ([np.nan, 0, 1, 2, 3], 0), ([np.nan, 0, np.nan, 2, 3], 0), ([0, 1, 2, 3, complex(0, np.nan)], 4), ([0, 1, 2, 3, complex(np.nan, 0)], 4), ([0, 1, 2, complex(np.nan, 0), 3], 3), ([0, 1, 2, complex(0, np.nan), 3], 3), ([complex(0, np.nan), 0, 1, 2, 3], 0), ([complex(np.nan, np.nan), 0, 1, 2, 3], 0), ([complex(np.nan, 0), complex(np.nan, 2), complex(np.nan, 1)], 0), ([complex(np.nan, np.nan), complex(np.nan, 2), complex(np.nan, 1)], 0), ([complex(np.nan, 0), complex(np.nan, 2), complex(np.nan, np.nan)], 0), ([complex(0, 0), complex(0, 2), complex(0, 1)], 0), ([complex(1, 0), complex(0, 2), complex(0, 1)], 2), ([complex(1, 0), complex(0, 2), complex(1, 1)], 1), ([np.datetime64('1923-04-14T12:43:12'), np.datetime64('1994-06-21T14:43:15'), np.datetime64('2001-10-15T04:10:32'), np.datetime64('1995-11-25T16:02:16'), np.datetime64('2005-01-04T03:14:12'), np.datetime64('2041-12-03T14:05:03')], 0), ([np.datetime64('1935-09-14T04:40:11'), np.datetime64('1949-10-12T12:32:11'), np.datetime64('2010-01-03T05:14:12'), np.datetime64('2014-11-20T12:20:59'), np.datetime64('2015-09-23T10:10:13'), np.datetime64('1932-10-10T03:50:30')], 5), # Assorted tests with NaTs ([np.datetime64('NaT'), np.datetime64('NaT'), np.datetime64('2010-01-03T05:14:12'), np.datetime64('NaT'), np.datetime64('2015-09-23T10:10:13'), np.datetime64('1932-10-10T03:50:30')], 5), ([np.datetime64('2059-03-14T12:43:12'), np.datetime64('1996-09-21T14:43:15'), np.datetime64('NaT'), np.datetime64('2022-12-25T16:02:16'), np.datetime64('1963-10-04T03:14:12'), np.datetime64('2013-05-08T18:15:23')], 4), ([np.timedelta64(2, 's'), np.timedelta64(1, 's'), np.timedelta64('NaT', 's'), np.timedelta64(3, 's')], 1), ([np.timedelta64('NaT', 's')] * 3, 0), ([timedelta(days=5, seconds=14), timedelta(days=2, seconds=35), timedelta(days=-1, seconds=23)], 2), ([timedelta(days=1, seconds=43), timedelta(days=10, seconds=5), timedelta(days=5, seconds=14)], 0), ([timedelta(days=10, seconds=24), timedelta(days=10, seconds=5), timedelta(days=10, seconds=43)], 1), ([True, True, True, True, False], 4), ([True, True, True, False, True], 3), ([False, True, True, True, True], 0), ([False, True, False, True, True], 0), ] def test_all(self): a = np.random.normal(0, 1, (4, 5, 6, 7, 8)) for i in range(a.ndim): amin = a.min(i) aargmin = a.argmin(i) axes = list(range(a.ndim)) axes.remove(i) assert_(np.all(amin == aargmin.choose(*a.transpose(i,*axes)))) def test_combinations(self): for arr, pos in self.nan_arr: with suppress_warnings() as sup: sup.filter(RuntimeWarning, "invalid value encountered in reduce") min_val = np.min(arr) assert_equal(np.argmin(arr), pos, err_msg="%r" % arr) assert_equal(arr[np.argmin(arr)], min_val, err_msg="%r" % arr) def test_minimum_signed_integers(self): a = np.array([1, -2**7, -2**7 + 1], dtype=np.int8) assert_equal(np.argmin(a), 1) a = np.array([1, -2**15, -2**15 + 1], dtype=np.int16) assert_equal(np.argmin(a), 1) a = np.array([1, -2**31, -2**31 + 1], dtype=np.int32) assert_equal(np.argmin(a), 1) a = np.array([1, -2**63, -2**63 + 1], dtype=np.int64) assert_equal(np.argmin(a), 1) def test_output_shape(self): # see also gh-616 a = np.ones((10, 5)) # Check some simple shape mismatches out = np.ones(11, dtype=np.int_) assert_raises(ValueError, a.argmin, -1, out) out = np.ones((2, 5), dtype=np.int_) assert_raises(ValueError, a.argmin, -1, out) # these could be relaxed possibly (used to allow even the previous) out = np.ones((1, 10), dtype=np.int_) assert_raises(ValueError, a.argmin, -1, out) out = np.ones(10, dtype=np.int_) a.argmin(-1, out=out) assert_equal(out, a.argmin(-1)) def test_argmin_unicode(self): d = np.ones(6031, dtype='<U9') d[6001] = "0" assert_equal(d.argmin(), 6001) def test_np_vs_ndarray(self): # make sure both ndarray.argmin and numpy.argmin support out/axis args a = np.random.normal(size=(2, 3)) # check positional args out1 = np.zeros(2, dtype=int) out2 = np.ones(2, dtype=int) assert_equal(a.argmin(1, out1), np.argmin(a, 1, out2)) assert_equal(out1, out2) # check keyword args out1 = np.zeros(3, dtype=int) out2 = np.ones(3, dtype=int) assert_equal(a.argmin(out=out1, axis=0), np.argmin(a, out=out2, axis=0)) assert_equal(out1, out2) def test_object_argmin_with_NULLs(self): # See gh-6032 a = np.empty(4, dtype='O') ctypes.memset(a.ctypes.data, 0, a.nbytes) assert_equal(a.argmin(), 0) a[3] = 30 assert_equal(a.argmin(), 3) a[1] = 10 assert_equal(a.argmin(), 1) class TestMinMax(object): def test_scalar(self): assert_raises(np.AxisError, np.amax, 1, 1) assert_raises(np.AxisError, np.amin, 1, 1) assert_equal(np.amax(1, axis=0), 1) assert_equal(np.amin(1, axis=0), 1) assert_equal(np.amax(1, axis=None), 1) assert_equal(np.amin(1, axis=None), 1) def test_axis(self): assert_raises(np.AxisError, np.amax, [1, 2, 3], 1000) assert_equal(np.amax([[1, 2, 3]], axis=1), 3) def test_datetime(self): # NaTs are ignored for dtype in ('m8[s]', 'm8[Y]'): a = np.arange(10).astype(dtype) a[3] = 'NaT' assert_equal(np.amin(a), a[0]) assert_equal(np.amax(a), a[9]) a[0] = 'NaT' assert_equal(np.amin(a), a[1]) assert_equal(np.amax(a), a[9]) a.fill('NaT') assert_equal(np.amin(a), a[0]) assert_equal(np.amax(a), a[0]) class TestNewaxis(object): def test_basic(self): sk = np.array([0, -0.1, 0.1]) res = 250*sk[:, np.newaxis] assert_almost_equal(res.ravel(), 250*sk) class TestClip(object): def _check_range(self, x, cmin, cmax): assert_(np.all(x >= cmin)) assert_(np.all(x <= cmax)) def _clip_type(self, type_group, array_max, clip_min, clip_max, inplace=False, expected_min=None, expected_max=None): if expected_min is None: expected_min = clip_min if expected_max is None: expected_max = clip_max for T in np.sctypes[type_group]: if sys.byteorder == 'little': byte_orders = ['=', '>'] else: byte_orders = ['<', '='] for byteorder in byte_orders: dtype = np.dtype(T).newbyteorder(byteorder) x = (np.random.random(1000) * array_max).astype(dtype) if inplace: x.clip(clip_min, clip_max, x) else: x = x.clip(clip_min, clip_max) byteorder = '=' if x.dtype.byteorder == '|': byteorder = '|' assert_equal(x.dtype.byteorder, byteorder) self._check_range(x, expected_min, expected_max) return x def test_basic(self): for inplace in [False, True]: self._clip_type( 'float', 1024, -12.8, 100.2, inplace=inplace) self._clip_type( 'float', 1024, 0, 0, inplace=inplace) self._clip_type( 'int', 1024, -120, 100.5, inplace=inplace) self._clip_type( 'int', 1024, 0, 0, inplace=inplace) self._clip_type( 'uint', 1024, 0, 0, inplace=inplace) self._clip_type( 'uint', 1024, -120, 100, inplace=inplace, expected_min=0) def test_record_array(self): rec = np.array([(-5, 2.0, 3.0), (5.0, 4.0, 3.0)], dtype=[('x', '<f8'), ('y', '<f8'), ('z', '<f8')]) y = rec['x'].clip(-0.3, 0.5) self._check_range(y, -0.3, 0.5) def test_max_or_min(self): val = np.array([0, 1, 2, 3, 4, 5, 6, 7]) x = val.clip(3) assert_(np.all(x >= 3)) x = val.clip(min=3) assert_(np.all(x >= 3)) x = val.clip(max=4) assert_(np.all(x <= 4)) def test_nan(self): input_arr = np.array([-2., np.nan, 0.5, 3., 0.25, np.nan]) result = input_arr.clip(-1, 1) expected = np.array([-1., np.nan, 0.5, 1., 0.25, np.nan]) assert_array_equal(result, expected) class TestCompress(object): def test_axis(self): tgt = [[5, 6, 7, 8, 9]] arr = np.arange(10).reshape(2, 5) out = np.compress([0, 1], arr, axis=0) assert_equal(out, tgt) tgt = [[1, 3], [6, 8]] out = np.compress([0, 1, 0, 1, 0], arr, axis=1) assert_equal(out, tgt) def test_truncate(self): tgt = [[1], [6]] arr = np.arange(10).reshape(2, 5) out = np.compress([0, 1], arr, axis=1) assert_equal(out, tgt) def test_flatten(self): arr = np.arange(10).reshape(2, 5) out = np.compress([0, 1], arr) assert_equal(out, 1) class TestPutmask(object): def tst_basic(self, x, T, mask, val): np.putmask(x, mask, val) assert_equal(x[mask], T(val)) assert_equal(x.dtype, T) def test_ip_types(self): unchecked_types = [bytes, unicode, np.void, object] x = np.random.random(1000)*100 mask = x < 40 for val in [-100, 0, 15]: for types in np.sctypes.values(): for T in types: if T not in unchecked_types: yield self.tst_basic, x.copy().astype(T), T, mask, val def test_mask_size(self): assert_raises(ValueError, np.putmask, np.array([1, 2, 3]), [True], 5) def tst_byteorder(self, dtype): x = np.array([1, 2, 3], dtype) np.putmask(x, [True, False, True], -1) assert_array_equal(x, [-1, 2, -1]) def test_ip_byteorder(self): for dtype in ('>i4', '<i4'): yield self.tst_byteorder, dtype def test_record_array(self): # Note mixed byteorder. rec = np.array([(-5, 2.0, 3.0), (5.0, 4.0, 3.0)], dtype=[('x', '<f8'), ('y', '>f8'), ('z', '<f8')]) np.putmask(rec['x'], [True, False], 10) assert_array_equal(rec['x'], [10, 5]) assert_array_equal(rec['y'], [2, 4]) assert_array_equal(rec['z'], [3, 3]) np.putmask(rec['y'], [True, False], 11) assert_array_equal(rec['x'], [10, 5]) assert_array_equal(rec['y'], [11, 4]) assert_array_equal(rec['z'], [3, 3]) class TestTake(object): def tst_basic(self, x): ind = list(range(x.shape[0])) assert_array_equal(x.take(ind, axis=0), x) def test_ip_types(self): unchecked_types = [bytes, unicode, np.void, object] x = np.random.random(24)*100 x.shape = 2, 3, 4 for types in np.sctypes.values(): for T in types: if T not in unchecked_types: yield self.tst_basic, x.copy().astype(T) def test_raise(self): x = np.random.random(24)*100 x.shape = 2, 3, 4 assert_raises(IndexError, x.take, [0, 1, 2], axis=0) assert_raises(IndexError, x.take, [-3], axis=0) assert_array_equal(x.take([-1], axis=0)[0], x[1]) def test_clip(self): x = np.random.random(24)*100 x.shape = 2, 3, 4 assert_array_equal(x.take([-1], axis=0, mode='clip')[0], x[0]) assert_array_equal(x.take([2], axis=0, mode='clip')[0], x[1]) def test_wrap(self): x = np.random.random(24)*100 x.shape = 2, 3, 4 assert_array_equal(x.take([-1], axis=0, mode='wrap')[0], x[1]) assert_array_equal(x.take([2], axis=0, mode='wrap')[0], x[0]) assert_array_equal(x.take([3], axis=0, mode='wrap')[0], x[1]) def tst_byteorder(self, dtype): x = np.array([1, 2, 3], dtype) assert_array_equal(x.take([0, 2, 1]), [1, 3, 2]) def test_ip_byteorder(self): for dtype in ('>i4', '<i4'): yield self.tst_byteorder, dtype def test_record_array(self): # Note mixed byteorder. rec = np.array([(-5, 2.0, 3.0), (5.0, 4.0, 3.0)], dtype=[('x', '<f8'), ('y', '>f8'), ('z', '<f8')]) rec1 = rec.take([1]) assert_(rec1['x'] == 5.0 and rec1['y'] == 4.0) class TestLexsort(object): def test_basic(self): a = [1, 2, 1, 3, 1, 5] b = [0, 4, 5, 6, 2, 3] idx = np.lexsort((b, a)) expected_idx = np.array([0, 4, 2, 1, 3, 5]) assert_array_equal(idx, expected_idx) x = np.vstack((b, a)) idx = np.lexsort(x) assert_array_equal(idx, expected_idx) assert_array_equal(x[1][idx], np.sort(x[1])) def test_datetime(self): a = np.array([0,0,0], dtype='datetime64[D]') b = np.array([2,1,0], dtype='datetime64[D]') idx = np.lexsort((b, a)) expected_idx = np.array([2, 1, 0]) assert_array_equal(idx, expected_idx) a = np.array([0,0,0], dtype='timedelta64[D]') b = np.array([2,1,0], dtype='timedelta64[D]') idx = np.lexsort((b, a)) expected_idx = np.array([2, 1, 0]) assert_array_equal(idx, expected_idx) def test_object(self): # gh-6312 a = np.random.choice(10, 1000) b = np.random.choice(['abc', 'xy', 'wz', 'efghi', 'qwst', 'x'], 1000) for u in a, b: left = np.lexsort((u.astype('O'),)) right = np.argsort(u, kind='mergesort') assert_array_equal(left, right) for u, v in (a, b), (b, a): idx = np.lexsort((u, v)) assert_array_equal(idx, np.lexsort((u.astype('O'), v))) assert_array_equal(idx, np.lexsort((u, v.astype('O')))) u, v = np.array(u, dtype='object'), np.array(v, dtype='object') assert_array_equal(idx, np.lexsort((u, v))) def test_invalid_axis(self): # gh-7528 x = np.linspace(0., 1., 42*3).reshape(42, 3) assert_raises(np.AxisError, np.lexsort, x, axis=2) class TestIO(object): """Test tofile, fromfile, tobytes, and fromstring""" def setup(self): shape = (2, 4, 3) rand = np.random.random self.x = rand(shape) + rand(shape).astype(complex)*1j self.x[0,:, 1] = [np.nan, np.inf, -np.inf, np.nan] self.dtype = self.x.dtype self.tempdir = tempfile.mkdtemp() self.filename = tempfile.mktemp(dir=self.tempdir) def teardown(self): shutil.rmtree(self.tempdir) def test_nofile(self): # this should probably be supported as a file # but for now test for proper errors b = io.BytesIO() assert_raises(IOError, np.fromfile, b, np.uint8, 80) d = np.ones(7) assert_raises(IOError, lambda x: x.tofile(b), d) def test_bool_fromstring(self): v = np.array([True, False, True, False], dtype=np.bool_) y = np.fromstring('1 0 -2.3 0.0', sep=' ', dtype=np.bool_) assert_array_equal(v, y) def test_uint64_fromstring(self): d = np.fromstring("9923372036854775807 104783749223640", dtype=np.uint64, sep=' ') e = np.array([9923372036854775807, 104783749223640], dtype=np.uint64) assert_array_equal(d, e) def test_int64_fromstring(self): d = np.fromstring("-25041670086757 104783749223640", dtype=np.int64, sep=' ') e = np.array([-25041670086757, 104783749223640], dtype=np.int64) assert_array_equal(d, e) def test_empty_files_binary(self): f = open(self.filename, 'w') f.close() y = np.fromfile(self.filename) assert_(y.size == 0, "Array not empty") def test_empty_files_text(self): f = open(self.filename, 'w') f.close() y = np.fromfile(self.filename, sep=" ") assert_(y.size == 0, "Array not empty") def test_roundtrip_file(self): f = open(self.filename, 'wb') self.x.tofile(f) f.close() # NB. doesn't work with flush+seek, due to use of C stdio f = open(self.filename, 'rb') y = np.fromfile(f, dtype=self.dtype) f.close() assert_array_equal(y, self.x.flat) def test_roundtrip_filename(self): self.x.tofile(self.filename) y = np.fromfile(self.filename, dtype=self.dtype) assert_array_equal(y, self.x.flat) def test_roundtrip_binary_str(self): s = self.x.tobytes() y = np.frombuffer(s, dtype=self.dtype) assert_array_equal(y, self.x.flat) s = self.x.tobytes('F') y = np.frombuffer(s, dtype=self.dtype) assert_array_equal(y, self.x.flatten('F')) def test_roundtrip_str(self): x = self.x.real.ravel() s = "@".join(map(str, x)) y = np.fromstring(s, sep="@") # NB. str imbues less precision nan_mask = ~np.isfinite(x) assert_array_equal(x[nan_mask], y[nan_mask]) assert_array_almost_equal(x[~nan_mask], y[~nan_mask], decimal=5) def test_roundtrip_repr(self): x = self.x.real.ravel() s = "@".join(map(repr, x)) y = np.fromstring(s, sep="@") assert_array_equal(x, y) def test_unseekable_fromfile(self): # gh-6246 self.x.tofile(self.filename) def fail(*args, **kwargs): raise IOError('Can not tell or seek') with io.open(self.filename, 'rb', buffering=0) as f: f.seek = fail f.tell = fail assert_raises(IOError, np.fromfile, f, dtype=self.dtype) def test_io_open_unbuffered_fromfile(self): # gh-6632 self.x.tofile(self.filename) with io.open(self.filename, 'rb', buffering=0) as f: y = np.fromfile(f, dtype=self.dtype) assert_array_equal(y, self.x.flat) def test_largish_file(self): # check the fallocate path on files > 16MB d = np.zeros(4 * 1024 ** 2) d.tofile(self.filename) assert_equal(os.path.getsize(self.filename), d.nbytes) assert_array_equal(d, np.fromfile(self.filename)) # check offset with open(self.filename, "r+b") as f: f.seek(d.nbytes) d.tofile(f) assert_equal(os.path.getsize(self.filename), d.nbytes * 2) # check append mode (gh-8329) open(self.filename, "w").close() # delete file contents with open(self.filename, "ab") as f: d.tofile(f) assert_array_equal(d, np.fromfile(self.filename)) with open(self.filename, "ab") as f: d.tofile(f) assert_equal(os.path.getsize(self.filename), d.nbytes * 2) def test_io_open_buffered_fromfile(self): # gh-6632 self.x.tofile(self.filename) with io.open(self.filename, 'rb', buffering=-1) as f: y = np.fromfile(f, dtype=self.dtype) assert_array_equal(y, self.x.flat) def test_file_position_after_fromfile(self): # gh-4118 sizes = [io.DEFAULT_BUFFER_SIZE//8, io.DEFAULT_BUFFER_SIZE, io.DEFAULT_BUFFER_SIZE*8] for size in sizes: f = open(self.filename, 'wb') f.seek(size-1) f.write(b'\0') f.close() for mode in ['rb', 'r+b']: err_msg = "%d %s" % (size, mode) f = open(self.filename, mode) f.read(2) np.fromfile(f, dtype=np.float64, count=1) pos = f.tell() f.close() assert_equal(pos, 10, err_msg=err_msg) def test_file_position_after_tofile(self): # gh-4118 sizes = [io.DEFAULT_BUFFER_SIZE//8, io.DEFAULT_BUFFER_SIZE, io.DEFAULT_BUFFER_SIZE*8] for size in sizes: err_msg = "%d" % (size,) f = open(self.filename, 'wb') f.seek(size-1) f.write(b'\0') f.seek(10) f.write(b'12') np.array([0], dtype=np.float64).tofile(f) pos = f.tell() f.close() assert_equal(pos, 10 + 2 + 8, err_msg=err_msg) f = open(self.filename, 'r+b') f.read(2) f.seek(0, 1) # seek between read&write required by ANSI C np.array([0], dtype=np.float64).tofile(f) pos = f.tell() f.close() assert_equal(pos, 10, err_msg=err_msg) def _check_from(self, s, value, **kw): if 'sep' not in kw: y = np.frombuffer(s, **kw) else: y = np.fromstring(s, **kw) assert_array_equal(y, value) f = open(self.filename, 'wb') f.write(s) f.close() y = np.fromfile(self.filename, **kw) assert_array_equal(y, value) def test_nan(self): self._check_from( b"nan +nan -nan NaN nan(foo) +NaN(BAR) -NAN(q_u_u_x_)", [np.nan, np.nan, np.nan, np.nan, np.nan, np.nan, np.nan], sep=' ') def test_inf(self): self._check_from( b"inf +inf -inf infinity -Infinity iNfInItY -inF", [np.inf, np.inf, -np.inf, np.inf, -np.inf, np.inf, -np.inf], sep=' ') def test_numbers(self): self._check_from(b"1.234 -1.234 .3 .3e55 -123133.1231e+133", [1.234, -1.234, .3, .3e55, -123133.1231e+133], sep=' ') def test_binary(self): self._check_from(b'\x00\x00\x80?\x00\x00\x00@\x00\x00@@\x00\x00\x80@', np.array([1, 2, 3, 4]), dtype='<f4') @dec.slow # takes > 1 minute on mechanical hard drive def test_big_binary(self): """Test workarounds for 32-bit limited fwrite, fseek, and ftell calls in windows. These normally would hang doing something like this. See http://projects.scipy.org/numpy/ticket/1660""" if sys.platform != 'win32': return try: # before workarounds, only up to 2**32-1 worked fourgbplus = 2**32 + 2**16 testbytes = np.arange(8, dtype=np.int8) n = len(testbytes) flike = tempfile.NamedTemporaryFile() f = flike.file np.tile(testbytes, fourgbplus // testbytes.nbytes).tofile(f) flike.seek(0) a = np.fromfile(f, dtype=np.int8) flike.close() assert_(len(a) == fourgbplus) # check only start and end for speed: assert_((a[:n] == testbytes).all()) assert_((a[-n:] == testbytes).all()) except (MemoryError, ValueError): pass def test_string(self): self._check_from(b'1,2,3,4', [1., 2., 3., 4.], sep=',') def test_counted_string(self): self._check_from(b'1,2,3,4', [1., 2., 3., 4.], count=4, sep=',') self._check_from(b'1,2,3,4', [1., 2., 3.], count=3, sep=',') self._check_from(b'1,2,3,4', [1., 2., 3., 4.], count=-1, sep=',') def test_string_with_ws(self): self._check_from(b'1 2 3 4 ', [1, 2, 3, 4], dtype=int, sep=' ') def test_counted_string_with_ws(self): self._check_from(b'1 2 3 4 ', [1, 2, 3], count=3, dtype=int, sep=' ') def test_ascii(self): self._check_from(b'1 , 2 , 3 , 4', [1., 2., 3., 4.], sep=',') self._check_from(b'1,2,3,4', [1., 2., 3., 4.], dtype=float, sep=',') def test_malformed(self): self._check_from(b'1.234 1,234', [1.234, 1.], sep=' ') def test_long_sep(self): self._check_from(b'1_x_3_x_4_x_5', [1, 3, 4, 5], sep='_x_') def test_dtype(self): v = np.array([1, 2, 3, 4], dtype=np.int_) self._check_from(b'1,2,3,4', v, sep=',', dtype=np.int_) def test_dtype_bool(self): # can't use _check_from because fromstring can't handle True/False v = np.array([True, False, True, False], dtype=np.bool_) s = b'1,0,-2.3,0' f = open(self.filename, 'wb') f.write(s) f.close() y = np.fromfile(self.filename, sep=',', dtype=np.bool_) assert_(y.dtype == '?') assert_array_equal(y, v) def test_tofile_sep(self): x = np.array([1.51, 2, 3.51, 4], dtype=float) f = open(self.filename, 'w') x.tofile(f, sep=',') f.close() f = open(self.filename, 'r') s = f.read() f.close() #assert_equal(s, '1.51,2.0,3.51,4.0') y = np.array([float(p) for p in s.split(',')]) assert_array_equal(x,y) def test_tofile_format(self): x = np.array([1.51, 2, 3.51, 4], dtype=float) f = open(self.filename, 'w') x.tofile(f, sep=',', format='%.2f') f.close() f = open(self.filename, 'r') s = f.read() f.close() assert_equal(s, '1.51,2.00,3.51,4.00') def test_locale(self): in_foreign_locale(self.test_numbers)() in_foreign_locale(self.test_nan)() in_foreign_locale(self.test_inf)() in_foreign_locale(self.test_counted_string)() in_foreign_locale(self.test_ascii)() in_foreign_locale(self.test_malformed)() in_foreign_locale(self.test_tofile_sep)() in_foreign_locale(self.test_tofile_format)() class TestFromBuffer(object): def tst_basic(self, buffer, expected, kwargs): assert_array_equal(np.frombuffer(buffer,**kwargs), expected) def test_ip_basic(self): for byteorder in ['<', '>']: for dtype in [float, int, complex]: dt = np.dtype(dtype).newbyteorder(byteorder) x = (np.random.random((4, 7))*5).astype(dt) buf = x.tobytes() yield self.tst_basic, buf, x.flat, {'dtype':dt} def test_empty(self): yield self.tst_basic, b'', np.array([]), {} class TestFlat(object): def setup(self): a0 = np.arange(20.0) a = a0.reshape(4, 5) a0.shape = (4, 5) a.flags.writeable = False self.a = a self.b = a[::2, ::2] self.a0 = a0 self.b0 = a0[::2, ::2] def test_contiguous(self): testpassed = False try: self.a.flat[12] = 100.0 except ValueError: testpassed = True assert_(testpassed) assert_(self.a.flat[12] == 12.0) def test_discontiguous(self): testpassed = False try: self.b.flat[4] = 100.0 except ValueError: testpassed = True assert_(testpassed) assert_(self.b.flat[4] == 12.0) def test___array__(self): c = self.a.flat.__array__() d = self.b.flat.__array__() e = self.a0.flat.__array__() f = self.b0.flat.__array__() assert_(c.flags.writeable is False) assert_(d.flags.writeable is False) # for 1.14 all are set to non-writeable on the way to replacing the # UPDATEIFCOPY array returned for non-contiguous arrays. assert_(e.flags.writeable is True) assert_(f.flags.writeable is False) with assert_warns(DeprecationWarning): assert_(c.flags.updateifcopy is False) with assert_warns(DeprecationWarning): assert_(d.flags.updateifcopy is False) with assert_warns(DeprecationWarning): assert_(e.flags.updateifcopy is False) with assert_warns(DeprecationWarning): # UPDATEIFCOPY is removed. assert_(f.flags.updateifcopy is False) assert_(c.flags.writebackifcopy is False) assert_(d.flags.writebackifcopy is False) assert_(e.flags.writebackifcopy is False) assert_(f.flags.writebackifcopy is False) class TestResize(object): def test_basic(self): x = np.array([[1, 0, 0], [0, 1, 0], [0, 0, 1]]) if IS_PYPY: x.resize((5, 5), refcheck=False) else: x.resize((5, 5)) assert_array_equal(x.flat[:9], np.array([[1, 0, 0], [0, 1, 0], [0, 0, 1]]).flat) assert_array_equal(x[9:].flat, 0) def test_check_reference(self): x = np.array([[1, 0, 0], [0, 1, 0], [0, 0, 1]]) y = x assert_raises(ValueError, x.resize, (5, 1)) del y # avoid pyflakes unused variable warning. def test_int_shape(self): x = np.eye(3) if IS_PYPY: x.resize(3, refcheck=False) else: x.resize(3) assert_array_equal(x, np.eye(3)[0,:]) def test_none_shape(self): x = np.eye(3) x.resize(None) assert_array_equal(x, np.eye(3)) x.resize() assert_array_equal(x, np.eye(3)) def test_0d_shape(self): # to it multiple times to test it does not break alloc cache gh-9216 for i in range(10): x = np.empty((1,)) x.resize(()) assert_equal(x.shape, ()) assert_equal(x.size, 1) x = np.empty(()) x.resize((1,)) assert_equal(x.shape, (1,)) assert_equal(x.size, 1) def test_invalid_arguments(self): assert_raises(TypeError, np.eye(3).resize, 'hi') assert_raises(ValueError, np.eye(3).resize, -1) assert_raises(TypeError, np.eye(3).resize, order=1) assert_raises(TypeError, np.eye(3).resize, refcheck='hi') def test_freeform_shape(self): x = np.eye(3) if IS_PYPY: x.resize(3, 2, 1, refcheck=False) else: x.resize(3, 2, 1) assert_(x.shape == (3, 2, 1)) def test_zeros_appended(self): x = np.eye(3) if IS_PYPY: x.resize(2, 3, 3, refcheck=False) else: x.resize(2, 3, 3) assert_array_equal(x[0], np.eye(3)) assert_array_equal(x[1], np.zeros((3, 3))) def test_obj_obj(self): # check memory is initialized on resize, gh-4857 a = np.ones(10, dtype=[('k', object, 2)]) if IS_PYPY: a.resize(15, refcheck=False) else: a.resize(15,) assert_equal(a.shape, (15,)) assert_array_equal(a['k'][-5:], 0) assert_array_equal(a['k'][:-5], 1) def test_empty_view(self): # check that sizes containing a zero don't trigger a reallocate for # already empty arrays x = np.zeros((10, 0), int) x_view = x[...] x_view.resize((0, 10)) x_view.resize((0, 100)) class TestRecord(object): def test_field_rename(self): dt = np.dtype([('f', float), ('i', int)]) dt.names = ['p', 'q'] assert_equal(dt.names, ['p', 'q']) def test_multiple_field_name_occurrence(self): def test_assign(): dtype = np.dtype([("A", "f8"), ("B", "f8"), ("A", "f8")]) # Error raised when multiple fields have the same name assert_raises(ValueError, test_assign) if sys.version_info[0] >= 3: def test_bytes_fields(self): # Bytes are not allowed in field names and not recognized in titles # on Py3 assert_raises(TypeError, np.dtype, [(b'a', int)]) assert_raises(TypeError, np.dtype, [(('b', b'a'), int)]) dt = np.dtype([((b'a', 'b'), int)]) assert_raises(TypeError, dt.__getitem__, b'a') x = np.array([(1,), (2,), (3,)], dtype=dt) assert_raises(IndexError, x.__getitem__, b'a') y = x[0] assert_raises(IndexError, y.__getitem__, b'a') def test_multiple_field_name_unicode(self): def test_assign_unicode(): dt = np.dtype([("\u20B9", "f8"), ("B", "f8"), ("\u20B9", "f8")]) # Error raised when multiple fields have the same name(unicode included) assert_raises(ValueError, test_assign_unicode) else: def test_unicode_field_titles(self): # Unicode field titles are added to field dict on Py2 title = u'b' dt = np.dtype([((title, 'a'), int)]) dt[title] dt['a'] x = np.array([(1,), (2,), (3,)], dtype=dt) x[title] x['a'] y = x[0] y[title] y['a'] def test_unicode_field_names(self): # Unicode field names are not allowed on Py2 title = u'b' assert_raises(TypeError, np.dtype, [(title, int)]) assert_raises(TypeError, np.dtype, [(('a', title), int)]) def test_field_names(self): # Test unicode and 8-bit / byte strings can be used a = np.zeros((1,), dtype=[('f1', 'i4'), ('f2', 'i4'), ('f3', [('sf1', 'i4')])]) is_py3 = sys.version_info[0] >= 3 if is_py3: funcs = (str,) # byte string indexing fails gracefully assert_raises(IndexError, a.__setitem__, b'f1', 1) assert_raises(IndexError, a.__getitem__, b'f1') assert_raises(IndexError, a['f1'].__setitem__, b'sf1', 1) assert_raises(IndexError, a['f1'].__getitem__, b'sf1') else: funcs = (str, unicode) for func in funcs: b = a.copy() fn1 = func('f1') b[fn1] = 1 assert_equal(b[fn1], 1) fnn = func('not at all') assert_raises(ValueError, b.__setitem__, fnn, 1) assert_raises(ValueError, b.__getitem__, fnn) b[0][fn1] = 2 assert_equal(b[fn1], 2) # Subfield assert_raises(ValueError, b[0].__setitem__, fnn, 1) assert_raises(ValueError, b[0].__getitem__, fnn) # Subfield fn3 = func('f3') sfn1 = func('sf1') b[fn3][sfn1] = 1 assert_equal(b[fn3][sfn1], 1) assert_raises(ValueError, b[fn3].__setitem__, fnn, 1) assert_raises(ValueError, b[fn3].__getitem__, fnn) # multiple subfields fn2 = func('f2') b[fn2] = 3 with suppress_warnings() as sup: sup.filter(FutureWarning, "Numpy has detected that you .*") assert_equal(b[['f1', 'f2']][0].tolist(), (2, 3)) assert_equal(b[['f2', 'f1']][0].tolist(), (3, 2)) assert_equal(b[['f1', 'f3']][0].tolist(), (2, (1,))) # view of subfield view/copy assert_equal(b[['f1', 'f2']][0].view(('i4', 2)).tolist(), (2, 3)) assert_equal(b[['f2', 'f1']][0].view(('i4', 2)).tolist(), (3, 2)) view_dtype = [('f1', 'i4'), ('f3', [('', 'i4')])] assert_equal(b[['f1', 'f3']][0].view(view_dtype).tolist(), (2, (1,))) # non-ascii unicode field indexing is well behaved if not is_py3: raise SkipTest('non ascii unicode field indexing skipped; ' 'raises segfault on python 2.x') else: assert_raises(ValueError, a.__setitem__, u'\u03e0', 1) assert_raises(ValueError, a.__getitem__, u'\u03e0') def test_field_names_deprecation(self): def collect_warnings(f, *args, **kwargs): with warnings.catch_warnings(record=True) as log: warnings.simplefilter("always") f(*args, **kwargs) return [w.category for w in log] a = np.zeros((1,), dtype=[('f1', 'i4'), ('f2', 'i4'), ('f3', [('sf1', 'i4')])]) a['f1'][0] = 1 a['f2'][0] = 2 a['f3'][0] = (3,) b = np.zeros((1,), dtype=[('f1', 'i4'), ('f2', 'i4'), ('f3', [('sf1', 'i4')])]) b['f1'][0] = 1 b['f2'][0] = 2 b['f3'][0] = (3,) # All the different functions raise a warning, but not an error assert_equal(collect_warnings(a[['f1', 'f2']].__setitem__, 0, (10, 20)), [FutureWarning]) # For <=1.12 a is not modified, but it will be in 1.13 assert_equal(a, b) # Views also warn subset = a[['f1', 'f2']] subset_view = subset.view() assert_equal(collect_warnings(subset_view['f1'].__setitem__, 0, 10), [FutureWarning]) # But the write goes through: assert_equal(subset['f1'][0], 10) # Only one warning per multiple field indexing, though (even if there # are multiple views involved): assert_equal(collect_warnings(subset['f1'].__setitem__, 0, 10), []) # make sure views of a multi-field index warn too c = np.zeros(3, dtype='i8,i8,i8') assert_equal(collect_warnings(c[['f0', 'f2']].view, 'i8,i8'), [FutureWarning]) def test_record_hash(self): a = np.array([(1, 2), (1, 2)], dtype='i1,i2') a.flags.writeable = False b = np.array([(1, 2), (3, 4)], dtype=[('num1', 'i1'), ('num2', 'i2')]) b.flags.writeable = False c = np.array([(1, 2), (3, 4)], dtype='i1,i2') c.flags.writeable = False assert_(hash(a[0]) == hash(a[1])) assert_(hash(a[0]) == hash(b[0])) assert_(hash(a[0]) != hash(b[1])) assert_(hash(c[0]) == hash(a[0]) and c[0] == a[0]) def test_record_no_hash(self): a = np.array([(1, 2), (1, 2)], dtype='i1,i2') assert_raises(TypeError, hash, a[0]) def test_empty_structure_creation(self): # make sure these do not raise errors (gh-5631) np.array([()], dtype={'names': [], 'formats': [], 'offsets': [], 'itemsize': 12}) np.array([(), (), (), (), ()], dtype={'names': [], 'formats': [], 'offsets': [], 'itemsize': 12}) class TestView(object): def test_basic(self): x = np.array([(1, 2, 3, 4), (5, 6, 7, 8)], dtype=[('r', np.int8), ('g', np.int8), ('b', np.int8), ('a', np.int8)]) # We must be specific about the endianness here: y = x.view(dtype='<i4') # ... and again without the keyword. z = x.view('<i4') assert_array_equal(y, z) assert_array_equal(y, [67305985, 134678021]) def _mean(a, **args): return a.mean(**args) def _var(a, **args): return a.var(**args) def _std(a, **args): return a.std(**args) class TestStats(object): funcs = [_mean, _var, _std] def setup(self): np.random.seed(range(3)) self.rmat = np.random.random((4, 5)) self.cmat = self.rmat + 1j * self.rmat self.omat = np.array([Decimal(repr(r)) for r in self.rmat.flat]) self.omat = self.omat.reshape(4, 5) def test_python_type(self): for x in (np.float16(1.), 1, 1., 1+0j): assert_equal(np.mean([x]), 1.) assert_equal(np.std([x]), 0.) assert_equal(np.var([x]), 0.) def test_keepdims(self): mat = np.eye(3) for f in self.funcs: for axis in [0, 1]: res = f(mat, axis=axis, keepdims=True) assert_(res.ndim == mat.ndim) assert_(res.shape[axis] == 1) for axis in [None]: res = f(mat, axis=axis, keepdims=True) assert_(res.shape == (1, 1)) def test_out(self): mat = np.eye(3) for f in self.funcs: out = np.zeros(3) tgt = f(mat, axis=1) res = f(mat, axis=1, out=out) assert_almost_equal(res, out) assert_almost_equal(res, tgt) out = np.empty(2) assert_raises(ValueError, f, mat, axis=1, out=out) out = np.empty((2, 2)) assert_raises(ValueError, f, mat, axis=1, out=out) def test_dtype_from_input(self): icodes = np.typecodes['AllInteger'] fcodes = np.typecodes['AllFloat'] # object type for f in self.funcs: mat = np.array([[Decimal(1)]*3]*3) tgt = mat.dtype.type res = f(mat, axis=1).dtype.type assert_(res is tgt) # scalar case res = type(f(mat, axis=None)) assert_(res is Decimal) # integer types for f in self.funcs: for c in icodes: mat = np.eye(3, dtype=c) tgt = np.float64 res = f(mat, axis=1).dtype.type assert_(res is tgt) # scalar case res = f(mat, axis=None).dtype.type assert_(res is tgt) # mean for float types for f in [_mean]: for c in fcodes: mat = np.eye(3, dtype=c) tgt = mat.dtype.type res = f(mat, axis=1).dtype.type assert_(res is tgt) # scalar case res = f(mat, axis=None).dtype.type assert_(res is tgt) # var, std for float types for f in [_var, _std]: for c in fcodes: mat = np.eye(3, dtype=c) # deal with complex types tgt = mat.real.dtype.type res = f(mat, axis=1).dtype.type assert_(res is tgt) # scalar case res = f(mat, axis=None).dtype.type assert_(res is tgt) def test_dtype_from_dtype(self): mat = np.eye(3) # stats for integer types # FIXME: # this needs definition as there are lots places along the line # where type casting may take place. # for f in self.funcs: # for c in np.typecodes['AllInteger']: # tgt = np.dtype(c).type # res = f(mat, axis=1, dtype=c).dtype.type # assert_(res is tgt) # # scalar case # res = f(mat, axis=None, dtype=c).dtype.type # assert_(res is tgt) # stats for float types for f in self.funcs: for c in np.typecodes['AllFloat']: tgt = np.dtype(c).type res = f(mat, axis=1, dtype=c).dtype.type assert_(res is tgt) # scalar case res = f(mat, axis=None, dtype=c).dtype.type assert_(res is tgt) def test_ddof(self): for f in [_var]: for ddof in range(3): dim = self.rmat.shape[1] tgt = f(self.rmat, axis=1) * dim res = f(self.rmat, axis=1, ddof=ddof) * (dim - ddof) for f in [_std]: for ddof in range(3): dim = self.rmat.shape[1] tgt = f(self.rmat, axis=1) * np.sqrt(dim) res = f(self.rmat, axis=1, ddof=ddof) * np.sqrt(dim - ddof) assert_almost_equal(res, tgt) assert_almost_equal(res, tgt) def test_ddof_too_big(self): dim = self.rmat.shape[1] for f in [_var, _std]: for ddof in range(dim, dim + 2): with warnings.catch_warnings(record=True) as w: warnings.simplefilter('always') res = f(self.rmat, axis=1, ddof=ddof) assert_(not (res < 0).any()) assert_(len(w) > 0) assert_(issubclass(w[0].category, RuntimeWarning)) def test_empty(self): A = np.zeros((0, 3)) for f in self.funcs: for axis in [0, None]: with warnings.catch_warnings(record=True) as w: warnings.simplefilter('always') assert_(np.isnan(f(A, axis=axis)).all()) assert_(len(w) > 0) assert_(issubclass(w[0].category, RuntimeWarning)) for axis in [1]: with warnings.catch_warnings(record=True) as w: warnings.simplefilter('always') assert_equal(f(A, axis=axis), np.zeros([])) def test_mean_values(self): for mat in [self.rmat, self.cmat, self.omat]: for axis in [0, 1]: tgt = mat.sum(axis=axis) res = _mean(mat, axis=axis) * mat.shape[axis] assert_almost_equal(res, tgt) for axis in [None]: tgt = mat.sum(axis=axis) res = _mean(mat, axis=axis) * np.prod(mat.shape) assert_almost_equal(res, tgt) def test_mean_float16(self): # This fail if the sum inside mean is done in float16 instead # of float32. assert_(_mean(np.ones(100000, dtype='float16')) == 1) def test_var_values(self): for mat in [self.rmat, self.cmat, self.omat]: for axis in [0, 1, None]: msqr = _mean(mat * mat.conj(), axis=axis) mean = _mean(mat, axis=axis) tgt = msqr - mean * mean.conjugate() res = _var(mat, axis=axis) assert_almost_equal(res, tgt) def test_std_values(self): for mat in [self.rmat, self.cmat, self.omat]: for axis in [0, 1, None]: tgt = np.sqrt(_var(mat, axis=axis)) res = _std(mat, axis=axis) assert_almost_equal(res, tgt) def test_subclass(self): class TestArray(np.ndarray): def __new__(cls, data, info): result = np.array(data) result = result.view(cls) result.info = info return result def __array_finalize__(self, obj): self.info = getattr(obj, "info", '') dat = TestArray([[1, 2, 3, 4], [5, 6, 7, 8]], 'jubba') res = dat.mean(1) assert_(res.info == dat.info) res = dat.std(1) assert_(res.info == dat.info) res = dat.var(1) assert_(res.info == dat.info) class TestVdot(object): def test_basic(self): dt_numeric = np.typecodes['AllFloat'] + np.typecodes['AllInteger'] dt_complex = np.typecodes['Complex'] # test real a = np.eye(3) for dt in dt_numeric + 'O': b = a.astype(dt) res = np.vdot(b, b) assert_(np.isscalar(res)) assert_equal(np.vdot(b, b), 3) # test complex a = np.eye(3) * 1j for dt in dt_complex + 'O': b = a.astype(dt) res = np.vdot(b, b) assert_(np.isscalar(res)) assert_equal(np.vdot(b, b), 3) # test boolean b = np.eye(3, dtype=bool) res = np.vdot(b, b) assert_(np.isscalar(res)) assert_equal(np.vdot(b, b), True) def test_vdot_array_order(self): a = np.array([[1, 2], [3, 4]], order='C') b = np.array([[1, 2], [3, 4]], order='F') res = np.vdot(a, a) # integer arrays are exact assert_equal(np.vdot(a, b), res) assert_equal(np.vdot(b, a), res) assert_equal(np.vdot(b, b), res) def test_vdot_uncontiguous(self): for size in [2, 1000]: # Different sizes match different branches in vdot. a = np.zeros((size, 2, 2)) b = np.zeros((size, 2, 2)) a[:, 0, 0] = np.arange(size) b[:, 0, 0] = np.arange(size) + 1 # Make a and b uncontiguous: a = a[..., 0] b = b[..., 0] assert_equal(np.vdot(a, b), np.vdot(a.flatten(), b.flatten())) assert_equal(np.vdot(a, b.copy()), np.vdot(a.flatten(), b.flatten())) assert_equal(np.vdot(a.copy(), b), np.vdot(a.flatten(), b.flatten())) assert_equal(np.vdot(a.copy('F'), b), np.vdot(a.flatten(), b.flatten())) assert_equal(np.vdot(a, b.copy('F')), np.vdot(a.flatten(), b.flatten())) class TestDot(object): def setup(self): np.random.seed(128) self.A = np.random.rand(4, 2) self.b1 = np.random.rand(2, 1) self.b2 = np.random.rand(2) self.b3 = np.random.rand(1, 2) self.b4 = np.random.rand(4) self.N = 7 def test_dotmatmat(self): A = self.A res = np.dot(A.transpose(), A) tgt = np.array([[1.45046013, 0.86323640], [0.86323640, 0.84934569]]) assert_almost_equal(res, tgt, decimal=self.N) def test_dotmatvec(self): A, b1 = self.A, self.b1 res = np.dot(A, b1) tgt = np.array([[0.32114320], [0.04889721], [0.15696029], [0.33612621]]) assert_almost_equal(res, tgt, decimal=self.N) def test_dotmatvec2(self): A, b2 = self.A, self.b2 res = np.dot(A, b2) tgt = np.array([0.29677940, 0.04518649, 0.14468333, 0.31039293]) assert_almost_equal(res, tgt, decimal=self.N) def test_dotvecmat(self): A, b4 = self.A, self.b4 res = np.dot(b4, A) tgt = np.array([1.23495091, 1.12222648]) assert_almost_equal(res, tgt, decimal=self.N) def test_dotvecmat2(self): b3, A = self.b3, self.A res = np.dot(b3, A.transpose()) tgt = np.array([[0.58793804, 0.08957460, 0.30605758, 0.62716383]]) assert_almost_equal(res, tgt, decimal=self.N) def test_dotvecmat3(self): A, b4 = self.A, self.b4 res = np.dot(A.transpose(), b4) tgt = np.array([1.23495091, 1.12222648]) assert_almost_equal(res, tgt, decimal=self.N) def test_dotvecvecouter(self): b1, b3 = self.b1, self.b3 res = np.dot(b1, b3) tgt = np.array([[0.20128610, 0.08400440], [0.07190947, 0.03001058]]) assert_almost_equal(res, tgt, decimal=self.N) def test_dotvecvecinner(self): b1, b3 = self.b1, self.b3 res = np.dot(b3, b1) tgt = np.array([[ 0.23129668]]) assert_almost_equal(res, tgt, decimal=self.N) def test_dotcolumnvect1(self): b1 = np.ones((3, 1)) b2 = [5.3] res = np.dot(b1, b2) tgt = np.array([5.3, 5.3, 5.3]) assert_almost_equal(res, tgt, decimal=self.N) def test_dotcolumnvect2(self): b1 = np.ones((3, 1)).transpose() b2 = [6.2] res = np.dot(b2, b1) tgt = np.array([6.2, 6.2, 6.2]) assert_almost_equal(res, tgt, decimal=self.N) def test_dotvecscalar(self): np.random.seed(100) b1 = np.random.rand(1, 1) b2 = np.random.rand(1, 4) res = np.dot(b1, b2) tgt = np.array([[0.15126730, 0.23068496, 0.45905553, 0.00256425]]) assert_almost_equal(res, tgt, decimal=self.N) def test_dotvecscalar2(self): np.random.seed(100) b1 = np.random.rand(4, 1) b2 = np.random.rand(1, 1) res = np.dot(b1, b2) tgt = np.array([[0.00256425],[0.00131359],[0.00200324],[ 0.00398638]]) assert_almost_equal(res, tgt, decimal=self.N) def test_all(self): dims = [(), (1,), (1, 1)] dout = [(), (1,), (1, 1), (1,), (), (1,), (1, 1), (1,), (1, 1)] for dim, (dim1, dim2) in zip(dout, itertools.product(dims, dims)): b1 = np.zeros(dim1) b2 = np.zeros(dim2) res = np.dot(b1, b2) tgt = np.zeros(dim) assert_(res.shape == tgt.shape) assert_almost_equal(res, tgt, decimal=self.N) def test_vecobject(self): class Vec(object): def __init__(self, sequence=None): if sequence is None: sequence = [] self.array = np.array(sequence) def __add__(self, other): out = Vec() out.array = self.array + other.array return out def __sub__(self, other): out = Vec() out.array = self.array - other.array return out def __mul__(self, other): # with scalar out = Vec(self.array.copy()) out.array *= other return out def __rmul__(self, other): return self*other U_non_cont = np.transpose([[1., 1.], [1., 2.]]) U_cont = np.ascontiguousarray(U_non_cont) x = np.array([Vec([1., 0.]), Vec([0., 1.])]) zeros = np.array([Vec([0., 0.]), Vec([0., 0.])]) zeros_test = np.dot(U_cont, x) - np.dot(U_non_cont, x) assert_equal(zeros[0].array, zeros_test[0].array) assert_equal(zeros[1].array, zeros_test[1].array) def test_dot_2args(self): from numpy.core.multiarray import dot a = np.array([[1, 2], [3, 4]], dtype=float) b = np.array([[1, 0], [1, 1]], dtype=float) c = np.array([[3, 2], [7, 4]], dtype=float) d = dot(a, b) assert_allclose(c, d) def test_dot_3args(self): from numpy.core.multiarray import dot np.random.seed(22) f = np.random.random_sample((1024, 16)) v = np.random.random_sample((16, 32)) r = np.empty((1024, 32)) for i in range(12): dot(f, v, r) if HAS_REFCOUNT: assert_equal(sys.getrefcount(r), 2) r2 = dot(f, v, out=None) assert_array_equal(r2, r) assert_(r is dot(f, v, out=r)) v = v[:, 0].copy() # v.shape == (16,) r = r[:, 0].copy() # r.shape == (1024,) r2 = dot(f, v) assert_(r is dot(f, v, r)) assert_array_equal(r2, r) def test_dot_3args_errors(self): from numpy.core.multiarray import dot np.random.seed(22) f = np.random.random_sample((1024, 16)) v = np.random.random_sample((16, 32)) r = np.empty((1024, 31)) assert_raises(ValueError, dot, f, v, r) r = np.empty((1024,)) assert_raises(ValueError, dot, f, v, r) r = np.empty((32,)) assert_raises(ValueError, dot, f, v, r) r = np.empty((32, 1024)) assert_raises(ValueError, dot, f, v, r) assert_raises(ValueError, dot, f, v, r.T) r = np.empty((1024, 64)) assert_raises(ValueError, dot, f, v, r[:, ::2]) assert_raises(ValueError, dot, f, v, r[:, :32]) r = np.empty((1024, 32), dtype=np.float32) assert_raises(ValueError, dot, f, v, r) r = np.empty((1024, 32), dtype=int) assert_raises(ValueError, dot, f, v, r) def test_dot_array_order(self): a = np.array([[1, 2], [3, 4]], order='C') b = np.array([[1, 2], [3, 4]], order='F') res = np.dot(a, a) # integer arrays are exact assert_equal(np.dot(a, b), res) assert_equal(np.dot(b, a), res) assert_equal(np.dot(b, b), res) def test_dot_scalar_and_matrix_of_objects(self): # Ticket #2469 arr = np.matrix([1, 2], dtype=object) desired = np.matrix([[3, 6]], dtype=object) assert_equal(np.dot(arr, 3), desired) assert_equal(np.dot(3, arr), desired) def test_accelerate_framework_sgemv_fix(self): def aligned_array(shape, align, dtype, order='C'): d = dtype(0) N = np.prod(shape) tmp = np.zeros(N * d.nbytes + align, dtype=np.uint8) address = tmp.__array_interface__["data"][0] for offset in range(align): if (address + offset) % align == 0: break tmp = tmp[offset:offset+N*d.nbytes].view(dtype=dtype) return tmp.reshape(shape, order=order) def as_aligned(arr, align, dtype, order='C'): aligned = aligned_array(arr.shape, align, dtype, order) aligned[:] = arr[:] return aligned def assert_dot_close(A, X, desired): assert_allclose(np.dot(A, X), desired, rtol=1e-5, atol=1e-7) m = aligned_array(100, 15, np.float32) s = aligned_array((100, 100), 15, np.float32) np.dot(s, m) # this will always segfault if the bug is present testdata = itertools.product((15,32), (10000,), (200,89), ('C','F')) for align, m, n, a_order in testdata: # Calculation in double precision A_d = np.random.rand(m, n) X_d = np.random.rand(n) desired = np.dot(A_d, X_d) # Calculation with aligned single precision A_f = as_aligned(A_d, align, np.float32, order=a_order) X_f = as_aligned(X_d, align, np.float32) assert_dot_close(A_f, X_f, desired) # Strided A rows A_d_2 = A_d[::2] desired = np.dot(A_d_2, X_d) A_f_2 = A_f[::2] assert_dot_close(A_f_2, X_f, desired) # Strided A columns, strided X vector A_d_22 = A_d_2[:, ::2] X_d_2 = X_d[::2] desired = np.dot(A_d_22, X_d_2) A_f_22 = A_f_2[:, ::2] X_f_2 = X_f[::2] assert_dot_close(A_f_22, X_f_2, desired) # Check the strides are as expected if a_order == 'F': assert_equal(A_f_22.strides, (8, 8 * m)) else: assert_equal(A_f_22.strides, (8 * n, 8)) assert_equal(X_f_2.strides, (8,)) # Strides in A rows + cols only X_f_2c = as_aligned(X_f_2, align, np.float32) assert_dot_close(A_f_22, X_f_2c, desired) # Strides just in A cols A_d_12 = A_d[:, ::2] desired = np.dot(A_d_12, X_d_2) A_f_12 = A_f[:, ::2] assert_dot_close(A_f_12, X_f_2c, desired) # Strides in A cols and X assert_dot_close(A_f_12, X_f_2, desired) class MatmulCommon(object): """Common tests for '@' operator and numpy.matmul. Do not derive from TestCase to avoid nose running it. """ # Should work with these types. Will want to add # "O" at some point types = "?bhilqBHILQefdgFDG" def test_exceptions(self): dims = [ ((1,), (2,)), # mismatched vector vector ((2, 1,), (2,)), # mismatched matrix vector ((2,), (1, 2)), # mismatched vector matrix ((1, 2), (3, 1)), # mismatched matrix matrix ((1,), ()), # vector scalar ((), (1)), # scalar vector ((1, 1), ()), # matrix scalar ((), (1, 1)), # scalar matrix ((2, 2, 1), (3, 1, 2)), # cannot broadcast ] for dt, (dm1, dm2) in itertools.product(self.types, dims): a = np.ones(dm1, dtype=dt) b = np.ones(dm2, dtype=dt) assert_raises(ValueError, self.matmul, a, b) def test_shapes(self): dims = [ ((1, 1), (2, 1, 1)), # broadcast first argument ((2, 1, 1), (1, 1)), # broadcast second argument ((2, 1, 1), (2, 1, 1)), # matrix stack sizes match ] for dt, (dm1, dm2) in itertools.product(self.types, dims): a = np.ones(dm1, dtype=dt) b = np.ones(dm2, dtype=dt) res = self.matmul(a, b) assert_(res.shape == (2, 1, 1)) # vector vector returns scalars. for dt in self.types: a = np.ones((2,), dtype=dt) b = np.ones((2,), dtype=dt) c = self.matmul(a, b) assert_(np.array(c).shape == ()) def test_result_types(self): mat = np.ones((1,1)) vec = np.ones((1,)) for dt in self.types: m = mat.astype(dt) v = vec.astype(dt) for arg in [(m, v), (v, m), (m, m)]: res = self.matmul(*arg) assert_(res.dtype == dt) # vector vector returns scalars res = self.matmul(v, v) assert_(type(res) is np.dtype(dt).type) def test_vector_vector_values(self): vec = np.array([1, 2]) tgt = 5 for dt in self.types[1:]: v1 = vec.astype(dt) res = self.matmul(v1, v1) assert_equal(res, tgt) # boolean type vec = np.array([True, True], dtype='?') res = self.matmul(vec, vec) assert_equal(res, True) def test_vector_matrix_values(self): vec = np.array([1, 2]) mat1 = np.array([[1, 2], [3, 4]]) mat2 = np.stack([mat1]*2, axis=0) tgt1 = np.array([7, 10]) tgt2 = np.stack([tgt1]*2, axis=0) for dt in self.types[1:]: v = vec.astype(dt) m1 = mat1.astype(dt) m2 = mat2.astype(dt) res = self.matmul(v, m1) assert_equal(res, tgt1) res = self.matmul(v, m2) assert_equal(res, tgt2) # boolean type vec = np.array([True, False]) mat1 = np.array([[True, False], [False, True]]) mat2 = np.stack([mat1]*2, axis=0) tgt1 = np.array([True, False]) tgt2 = np.stack([tgt1]*2, axis=0) res = self.matmul(vec, mat1) assert_equal(res, tgt1) res = self.matmul(vec, mat2) assert_equal(res, tgt2) def test_matrix_vector_values(self): vec = np.array([1, 2]) mat1 = np.array([[1, 2], [3, 4]]) mat2 = np.stack([mat1]*2, axis=0) tgt1 = np.array([5, 11]) tgt2 = np.stack([tgt1]*2, axis=0) for dt in self.types[1:]: v = vec.astype(dt) m1 = mat1.astype(dt) m2 = mat2.astype(dt) res = self.matmul(m1, v) assert_equal(res, tgt1) res = self.matmul(m2, v) assert_equal(res, tgt2) # boolean type vec = np.array([True, False]) mat1 = np.array([[True, False], [False, True]]) mat2 = np.stack([mat1]*2, axis=0) tgt1 = np.array([True, False]) tgt2 = np.stack([tgt1]*2, axis=0) res = self.matmul(vec, mat1) assert_equal(res, tgt1) res = self.matmul(vec, mat2) assert_equal(res, tgt2) def test_matrix_matrix_values(self): mat1 = np.array([[1, 2], [3, 4]]) mat2 = np.array([[1, 0], [1, 1]]) mat12 = np.stack([mat1, mat2], axis=0) mat21 = np.stack([mat2, mat1], axis=0) tgt11 = np.array([[7, 10], [15, 22]]) tgt12 = np.array([[3, 2], [7, 4]]) tgt21 = np.array([[1, 2], [4, 6]]) tgt12_21 = np.stack([tgt12, tgt21], axis=0) tgt11_12 = np.stack((tgt11, tgt12), axis=0) tgt11_21 = np.stack((tgt11, tgt21), axis=0) for dt in self.types[1:]: m1 = mat1.astype(dt) m2 = mat2.astype(dt) m12 = mat12.astype(dt) m21 = mat21.astype(dt) # matrix @ matrix res = self.matmul(m1, m2) assert_equal(res, tgt12) res = self.matmul(m2, m1) assert_equal(res, tgt21) # stacked @ matrix res = self.matmul(m12, m1) assert_equal(res, tgt11_21) # matrix @ stacked res = self.matmul(m1, m12) assert_equal(res, tgt11_12) # stacked @ stacked res = self.matmul(m12, m21) assert_equal(res, tgt12_21) # boolean type m1 = np.array([[1, 1], [0, 0]], dtype=np.bool_) m2 = np.array([[1, 0], [1, 1]], dtype=np.bool_) m12 = np.stack([m1, m2], axis=0) m21 = np.stack([m2, m1], axis=0) tgt11 = m1 tgt12 = m1 tgt21 = np.array([[1, 1], [1, 1]], dtype=np.bool_) tgt12_21 = np.stack([tgt12, tgt21], axis=0) tgt11_12 = np.stack((tgt11, tgt12), axis=0) tgt11_21 = np.stack((tgt11, tgt21), axis=0) # matrix @ matrix res = self.matmul(m1, m2) assert_equal(res, tgt12) res = self.matmul(m2, m1) assert_equal(res, tgt21) # stacked @ matrix res = self.matmul(m12, m1) assert_equal(res, tgt11_21) # matrix @ stacked res = self.matmul(m1, m12) assert_equal(res, tgt11_12) # stacked @ stacked res = self.matmul(m12, m21) assert_equal(res, tgt12_21) class TestMatmul(MatmulCommon): matmul = np.matmul def test_out_arg(self): a = np.ones((2, 2), dtype=float) b = np.ones((2, 2), dtype=float) tgt = np.full((2,2), 2, dtype=float) # test as positional argument msg = "out positional argument" out = np.zeros((2, 2), dtype=float) self.matmul(a, b, out) assert_array_equal(out, tgt, err_msg=msg) # test as keyword argument msg = "out keyword argument" out = np.zeros((2, 2), dtype=float) self.matmul(a, b, out=out) assert_array_equal(out, tgt, err_msg=msg) # test out with not allowed type cast (safe casting) # einsum and cblas raise different error types, so # use Exception. msg = "out argument with illegal cast" out = np.zeros((2, 2), dtype=np.int32) assert_raises(Exception, self.matmul, a, b, out=out) # skip following tests for now, cblas does not allow non-contiguous # outputs and consistency with dot would require same type, # dimensions, subtype, and c_contiguous. # test out with allowed type cast # msg = "out argument with allowed cast" # out = np.zeros((2, 2), dtype=np.complex128) # self.matmul(a, b, out=out) # assert_array_equal(out, tgt, err_msg=msg) # test out non-contiguous # msg = "out argument with non-contiguous layout" # c = np.zeros((2, 2, 2), dtype=float) # self.matmul(a, b, out=c[..., 0]) # assert_array_equal(c, tgt, err_msg=msg) if sys.version_info[:2] >= (3, 5): class TestMatmulOperator(MatmulCommon): import operator matmul = operator.matmul def test_array_priority_override(self): class A(object): __array_priority__ = 1000 def __matmul__(self, other): return "A" def __rmatmul__(self, other): return "A" a = A() b = np.ones(2) assert_equal(self.matmul(a, b), "A") assert_equal(self.matmul(b, a), "A") def test_matmul_inplace(): # It would be nice to support in-place matmul eventually, but for now # we don't have a working implementation, so better just to error out # and nudge people to writing "a = a @ b". a = np.eye(3) b = np.eye(3) assert_raises(TypeError, a.__imatmul__, b) import operator assert_raises(TypeError, operator.imatmul, a, b) # we avoid writing the token `exec` so as not to crash python 2's # parser exec_ = getattr(builtins, "exec") assert_raises(TypeError, exec_, "a @= b", globals(), locals()) class TestInner(object): def test_inner_type_mismatch(self): c = 1. A = np.array((1,1), dtype='i,i') assert_raises(TypeError, np.inner, c, A) assert_raises(TypeError, np.inner, A, c) def test_inner_scalar_and_vector(self): for dt in np.typecodes['AllInteger'] + np.typecodes['AllFloat'] + '?': sca = np.array(3, dtype=dt)[()] vec = np.array([1, 2], dtype=dt) desired = np.array([3, 6], dtype=dt) assert_equal(np.inner(vec, sca), desired) assert_equal(np.inner(sca, vec), desired) def test_inner_scalar_and_matrix(self): for dt in np.typecodes['AllInteger'] + np.typecodes['AllFloat'] + '?': sca = np.array(3, dtype=dt)[()] arr = np.matrix([[1, 2], [3, 4]], dtype=dt) desired = np.matrix([[3, 6], [9, 12]], dtype=dt) assert_equal(np.inner(arr, sca), desired) assert_equal(np.inner(sca, arr), desired) def test_inner_scalar_and_matrix_of_objects(self): # Ticket #4482 arr = np.matrix([1, 2], dtype=object) desired = np.matrix([[3, 6]], dtype=object) assert_equal(np.inner(arr, 3), desired) assert_equal(np.inner(3, arr), desired) def test_vecself(self): # Ticket 844. # Inner product of a vector with itself segfaults or give # meaningless result a = np.zeros(shape=(1, 80), dtype=np.float64) p = np.inner(a, a) assert_almost_equal(p, 0, decimal=14) def test_inner_product_with_various_contiguities(self): # github issue 6532 for dt in np.typecodes['AllInteger'] + np.typecodes['AllFloat'] + '?': # check an inner product involving a matrix transpose A = np.array([[1, 2], [3, 4]], dtype=dt) B = np.array([[1, 3], [2, 4]], dtype=dt) C = np.array([1, 1], dtype=dt) desired = np.array([4, 6], dtype=dt) assert_equal(np.inner(A.T, C), desired) assert_equal(np.inner(C, A.T), desired) assert_equal(np.inner(B, C), desired) assert_equal(np.inner(C, B), desired) # check a matrix product desired = np.array([[7, 10], [15, 22]], dtype=dt) assert_equal(np.inner(A, B), desired) # check the syrk vs. gemm paths desired = np.array([[5, 11], [11, 25]], dtype=dt) assert_equal(np.inner(A, A), desired) assert_equal(np.inner(A, A.copy()), desired) # check an inner product involving an aliased and reversed view a = np.arange(5).astype(dt) b = a[::-1] desired = np.array(10, dtype=dt).item() assert_equal(np.inner(b, a), desired) def test_3d_tensor(self): for dt in np.typecodes['AllInteger'] + np.typecodes['AllFloat'] + '?': a = np.arange(24).reshape(2,3,4).astype(dt) b = np.arange(24, 48).reshape(2,3,4).astype(dt) desired = np.array( [[[[ 158, 182, 206], [ 230, 254, 278]], [[ 566, 654, 742], [ 830, 918, 1006]], [[ 974, 1126, 1278], [1430, 1582, 1734]]], [[[1382, 1598, 1814], [2030, 2246, 2462]], [[1790, 2070, 2350], [2630, 2910, 3190]], [[2198, 2542, 2886], [3230, 3574, 3918]]]], dtype=dt ) assert_equal(np.inner(a, b), desired) assert_equal(np.inner(b, a).transpose(2,3,0,1), desired) class TestAlen(object): def test_basic(self): m = np.array([1, 2, 3]) assert_equal(np.alen(m), 3) m = np.array([[1, 2, 3], [4, 5, 7]]) assert_equal(np.alen(m), 2) m = [1, 2, 3] assert_equal(np.alen(m), 3) m = [[1, 2, 3], [4, 5, 7]] assert_equal(np.alen(m), 2) def test_singleton(self): assert_equal(np.alen(5), 1) class TestChoose(object): def setup(self): self.x = 2*np.ones((3,), dtype=int) self.y = 3*np.ones((3,), dtype=int) self.x2 = 2*np.ones((2, 3), dtype=int) self.y2 = 3*np.ones((2, 3), dtype=int) self.ind = [0, 0, 1] def test_basic(self): A = np.choose(self.ind, (self.x, self.y)) assert_equal(A, [2, 2, 3]) def test_broadcast1(self): A = np.choose(self.ind, (self.x2, self.y2)) assert_equal(A, [[2, 2, 3], [2, 2, 3]]) def test_broadcast2(self): A = np.choose(self.ind, (self.x, self.y2)) assert_equal(A, [[2, 2, 3], [2, 2, 3]]) class TestRepeat(object): def setup(self): self.m = np.array([1, 2, 3, 4, 5, 6]) self.m_rect = self.m.reshape((2, 3)) def test_basic(self): A = np.repeat(self.m, [1, 3, 2, 1, 1, 2]) assert_equal(A, [1, 2, 2, 2, 3, 3, 4, 5, 6, 6]) def test_broadcast1(self): A = np.repeat(self.m, 2) assert_equal(A, [1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6]) def test_axis_spec(self): A = np.repeat(self.m_rect, [2, 1], axis=0) assert_equal(A, [[1, 2, 3], [1, 2, 3], [4, 5, 6]]) A = np.repeat(self.m_rect, [1, 3, 2], axis=1) assert_equal(A, [[1, 2, 2, 2, 3, 3], [4, 5, 5, 5, 6, 6]]) def test_broadcast2(self): A = np.repeat(self.m_rect, 2, axis=0) assert_equal(A, [[1, 2, 3], [1, 2, 3], [4, 5, 6], [4, 5, 6]]) A = np.repeat(self.m_rect, 2, axis=1) assert_equal(A, [[1, 1, 2, 2, 3, 3], [4, 4, 5, 5, 6, 6]]) # TODO: test for multidimensional NEIGH_MODE = {'zero': 0, 'one': 1, 'constant': 2, 'circular': 3, 'mirror': 4} class TestNeighborhoodIter(object): # Simple, 2d tests def _test_simple2d(self, dt): # Test zero and one padding for simple data type x = np.array([[0, 1], [2, 3]], dtype=dt) r = [np.array([[0, 0, 0], [0, 0, 1]], dtype=dt), np.array([[0, 0, 0], [0, 1, 0]], dtype=dt), np.array([[0, 0, 1], [0, 2, 3]], dtype=dt), np.array([[0, 1, 0], [2, 3, 0]], dtype=dt)] l = test_neighborhood_iterator(x, [-1, 0, -1, 1], x[0], NEIGH_MODE['zero']) assert_array_equal(l, r) r = [np.array([[1, 1, 1], [1, 0, 1]], dtype=dt), np.array([[1, 1, 1], [0, 1, 1]], dtype=dt), np.array([[1, 0, 1], [1, 2, 3]], dtype=dt), np.array([[0, 1, 1], [2, 3, 1]], dtype=dt)] l = test_neighborhood_iterator(x, [-1, 0, -1, 1], x[0], NEIGH_MODE['one']) assert_array_equal(l, r) r = [np.array([[4, 4, 4], [4, 0, 1]], dtype=dt), np.array([[4, 4, 4], [0, 1, 4]], dtype=dt), np.array([[4, 0, 1], [4, 2, 3]], dtype=dt), np.array([[0, 1, 4], [2, 3, 4]], dtype=dt)] l = test_neighborhood_iterator(x, [-1, 0, -1, 1], 4, NEIGH_MODE['constant']) assert_array_equal(l, r) def test_simple2d(self): self._test_simple2d(float) def test_simple2d_object(self): self._test_simple2d(Decimal) def _test_mirror2d(self, dt): x = np.array([[0, 1], [2, 3]], dtype=dt) r = [np.array([[0, 0, 1], [0, 0, 1]], dtype=dt), np.array([[0, 1, 1], [0, 1, 1]], dtype=dt), np.array([[0, 0, 1], [2, 2, 3]], dtype=dt), np.array([[0, 1, 1], [2, 3, 3]], dtype=dt)] l = test_neighborhood_iterator(x, [-1, 0, -1, 1], x[0], NEIGH_MODE['mirror']) assert_array_equal(l, r) def test_mirror2d(self): self._test_mirror2d(float) def test_mirror2d_object(self): self._test_mirror2d(Decimal) # Simple, 1d tests def _test_simple(self, dt): # Test padding with constant values x = np.linspace(1, 5, 5).astype(dt) r = [[0, 1, 2], [1, 2, 3], [2, 3, 4], [3, 4, 5], [4, 5, 0]] l = test_neighborhood_iterator(x, [-1, 1], x[0], NEIGH_MODE['zero']) assert_array_equal(l, r) r = [[1, 1, 2], [1, 2, 3], [2, 3, 4], [3, 4, 5], [4, 5, 1]] l = test_neighborhood_iterator(x, [-1, 1], x[0], NEIGH_MODE['one']) assert_array_equal(l, r) r = [[x[4], 1, 2], [1, 2, 3], [2, 3, 4], [3, 4, 5], [4, 5, x[4]]] l = test_neighborhood_iterator(x, [-1, 1], x[4], NEIGH_MODE['constant']) assert_array_equal(l, r) def test_simple_float(self): self._test_simple(float) def test_simple_object(self): self._test_simple(Decimal) # Test mirror modes def _test_mirror(self, dt): x = np.linspace(1, 5, 5).astype(dt) r = np.array([[2, 1, 1, 2, 3], [1, 1, 2, 3, 4], [1, 2, 3, 4, 5], [2, 3, 4, 5, 5], [3, 4, 5, 5, 4]], dtype=dt) l = test_neighborhood_iterator(x, [-2, 2], x[1], NEIGH_MODE['mirror']) assert_([i.dtype == dt for i in l]) assert_array_equal(l, r) def test_mirror(self): self._test_mirror(float) def test_mirror_object(self): self._test_mirror(Decimal) # Circular mode def _test_circular(self, dt): x = np.linspace(1, 5, 5).astype(dt) r = np.array([[4, 5, 1, 2, 3], [5, 1, 2, 3, 4], [1, 2, 3, 4, 5], [2, 3, 4, 5, 1], [3, 4, 5, 1, 2]], dtype=dt) l = test_neighborhood_iterator(x, [-2, 2], x[0], NEIGH_MODE['circular']) assert_array_equal(l, r) def test_circular(self): self._test_circular(float) def test_circular_object(self): self._test_circular(Decimal) # Test stacking neighborhood iterators class TestStackedNeighborhoodIter(object): # Simple, 1d test: stacking 2 constant-padded neigh iterators def test_simple_const(self): dt = np.float64 # Test zero and one padding for simple data type x = np.array([1, 2, 3], dtype=dt) r = [np.array([0], dtype=dt), np.array([0], dtype=dt), np.array([1], dtype=dt), np.array([2], dtype=dt), np.array([3], dtype=dt), np.array([0], dtype=dt), np.array([0], dtype=dt)] l = test_neighborhood_iterator_oob(x, [-2, 4], NEIGH_MODE['zero'], [0, 0], NEIGH_MODE['zero']) assert_array_equal(l, r) r = [np.array([1, 0, 1], dtype=dt), np.array([0, 1, 2], dtype=dt), np.array([1, 2, 3], dtype=dt), np.array([2, 3, 0], dtype=dt), np.array([3, 0, 1], dtype=dt)] l = test_neighborhood_iterator_oob(x, [-1, 3], NEIGH_MODE['zero'], [-1, 1], NEIGH_MODE['one']) assert_array_equal(l, r) # 2nd simple, 1d test: stacking 2 neigh iterators, mixing const padding and # mirror padding def test_simple_mirror(self): dt = np.float64 # Stacking zero on top of mirror x = np.array([1, 2, 3], dtype=dt) r = [np.array([0, 1, 1], dtype=dt), np.array([1, 1, 2], dtype=dt), np.array([1, 2, 3], dtype=dt), np.array([2, 3, 3], dtype=dt), np.array([3, 3, 0], dtype=dt)] l = test_neighborhood_iterator_oob(x, [-1, 3], NEIGH_MODE['mirror'], [-1, 1], NEIGH_MODE['zero']) assert_array_equal(l, r) # Stacking mirror on top of zero x = np.array([1, 2, 3], dtype=dt) r = [np.array([1, 0, 0], dtype=dt), np.array([0, 0, 1], dtype=dt), np.array([0, 1, 2], dtype=dt), np.array([1, 2, 3], dtype=dt), np.array([2, 3, 0], dtype=dt)] l = test_neighborhood_iterator_oob(x, [-1, 3], NEIGH_MODE['zero'], [-2, 0], NEIGH_MODE['mirror']) assert_array_equal(l, r) # Stacking mirror on top of zero: 2nd x = np.array([1, 2, 3], dtype=dt) r = [np.array([0, 1, 2], dtype=dt), np.array([1, 2, 3], dtype=dt), np.array([2, 3, 0], dtype=dt), np.array([3, 0, 0], dtype=dt), np.array([0, 0, 3], dtype=dt)] l = test_neighborhood_iterator_oob(x, [-1, 3], NEIGH_MODE['zero'], [0, 2], NEIGH_MODE['mirror']) assert_array_equal(l, r) # Stacking mirror on top of zero: 3rd x = np.array([1, 2, 3], dtype=dt) r = [np.array([1, 0, 0, 1, 2], dtype=dt), np.array([0, 0, 1, 2, 3], dtype=dt), np.array([0, 1, 2, 3, 0], dtype=dt), np.array([1, 2, 3, 0, 0], dtype=dt), np.array([2, 3, 0, 0, 3], dtype=dt)] l = test_neighborhood_iterator_oob(x, [-1, 3], NEIGH_MODE['zero'], [-2, 2], NEIGH_MODE['mirror']) assert_array_equal(l, r) # 3rd simple, 1d test: stacking 2 neigh iterators, mixing const padding and # circular padding def test_simple_circular(self): dt = np.float64 # Stacking zero on top of mirror x = np.array([1, 2, 3], dtype=dt) r = [np.array([0, 3, 1], dtype=dt), np.array([3, 1, 2], dtype=dt), np.array([1, 2, 3], dtype=dt), np.array([2, 3, 1], dtype=dt), np.array([3, 1, 0], dtype=dt)] l = test_neighborhood_iterator_oob(x, [-1, 3], NEIGH_MODE['circular'], [-1, 1], NEIGH_MODE['zero']) assert_array_equal(l, r) # Stacking mirror on top of zero x = np.array([1, 2, 3], dtype=dt) r = [np.array([3, 0, 0], dtype=dt), np.array([0, 0, 1], dtype=dt), np.array([0, 1, 2], dtype=dt), np.array([1, 2, 3], dtype=dt), np.array([2, 3, 0], dtype=dt)] l = test_neighborhood_iterator_oob(x, [-1, 3], NEIGH_MODE['zero'], [-2, 0], NEIGH_MODE['circular']) assert_array_equal(l, r) # Stacking mirror on top of zero: 2nd x = np.array([1, 2, 3], dtype=dt) r = [np.array([0, 1, 2], dtype=dt), np.array([1, 2, 3], dtype=dt), np.array([2, 3, 0], dtype=dt), np.array([3, 0, 0], dtype=dt), np.array([0, 0, 1], dtype=dt)] l = test_neighborhood_iterator_oob(x, [-1, 3], NEIGH_MODE['zero'], [0, 2], NEIGH_MODE['circular']) assert_array_equal(l, r) # Stacking mirror on top of zero: 3rd x = np.array([1, 2, 3], dtype=dt) r = [np.array([3, 0, 0, 1, 2], dtype=dt), np.array([0, 0, 1, 2, 3], dtype=dt), np.array([0, 1, 2, 3, 0], dtype=dt), np.array([1, 2, 3, 0, 0], dtype=dt), np.array([2, 3, 0, 0, 1], dtype=dt)] l = test_neighborhood_iterator_oob(x, [-1, 3], NEIGH_MODE['zero'], [-2, 2], NEIGH_MODE['circular']) assert_array_equal(l, r) # 4th simple, 1d test: stacking 2 neigh iterators, but with lower iterator # being strictly within the array def test_simple_strict_within(self): dt = np.float64 # Stacking zero on top of zero, first neighborhood strictly inside the # array x = np.array([1, 2, 3], dtype=dt) r = [np.array([1, 2, 3, 0], dtype=dt)] l = test_neighborhood_iterator_oob(x, [1, 1], NEIGH_MODE['zero'], [-1, 2], NEIGH_MODE['zero']) assert_array_equal(l, r) # Stacking mirror on top of zero, first neighborhood strictly inside the # array x = np.array([1, 2, 3], dtype=dt) r = [np.array([1, 2, 3, 3], dtype=dt)] l = test_neighborhood_iterator_oob(x, [1, 1], NEIGH_MODE['zero'], [-1, 2], NEIGH_MODE['mirror']) assert_array_equal(l, r) # Stacking mirror on top of zero, first neighborhood strictly inside the # array x = np.array([1, 2, 3], dtype=dt) r = [np.array([1, 2, 3, 1], dtype=dt)] l = test_neighborhood_iterator_oob(x, [1, 1], NEIGH_MODE['zero'], [-1, 2], NEIGH_MODE['circular']) assert_array_equal(l, r) class TestWarnings(object): def test_complex_warning(self): x = np.array([1, 2]) y = np.array([1-2j, 1+2j]) with warnings.catch_warnings(): warnings.simplefilter("error", np.ComplexWarning) assert_raises(np.ComplexWarning, x.__setitem__, slice(None), y) assert_equal(x, [1, 2]) class TestMinScalarType(object): def test_usigned_shortshort(self): dt = np.min_scalar_type(2**8-1) wanted = np.dtype('uint8') assert_equal(wanted, dt) def test_usigned_short(self): dt = np.min_scalar_type(2**16-1) wanted = np.dtype('uint16') assert_equal(wanted, dt) def test_usigned_int(self): dt = np.min_scalar_type(2**32-1) wanted = np.dtype('uint32') assert_equal(wanted, dt) def test_usigned_longlong(self): dt = np.min_scalar_type(2**63-1) wanted = np.dtype('uint64') assert_equal(wanted, dt) def test_object(self): dt = np.min_scalar_type(2**64) wanted = np.dtype('O') assert_equal(wanted, dt) from numpy.core._internal import _dtype_from_pep3118 class TestPEP3118Dtype(object): def _check(self, spec, wanted): dt = np.dtype(wanted) actual = _dtype_from_pep3118(spec) assert_equal(actual, dt, err_msg="spec %r != dtype %r" % (spec, wanted)) def test_native_padding(self): align = np.dtype('i').alignment for j in range(8): if j == 0: s = 'bi' else: s = 'b%dxi' % j self._check('@'+s, {'f0': ('i1', 0), 'f1': ('i', align*(1 + j//align))}) self._check('='+s, {'f0': ('i1', 0), 'f1': ('i', 1+j)}) def test_native_padding_2(self): # Native padding should work also for structs and sub-arrays self._check('x3T{xi}', {'f0': (({'f0': ('i', 4)}, (3,)), 4)}) self._check('^x3T{xi}', {'f0': (({'f0': ('i', 1)}, (3,)), 1)}) def test_trailing_padding(self): # Trailing padding should be included, *and*, the item size # should match the alignment if in aligned mode align = np.dtype('i').alignment size = np.dtype('i').itemsize def aligned(n): return align*(1 + (n-1)//align) base = dict(formats=['i'], names=['f0']) self._check('ix', dict(itemsize=aligned(size + 1), **base)) self._check('ixx', dict(itemsize=aligned(size + 2), **base)) self._check('ixxx', dict(itemsize=aligned(size + 3), **base)) self._check('ixxxx', dict(itemsize=aligned(size + 4), **base)) self._check('i7x', dict(itemsize=aligned(size + 7), **base)) self._check('^ix', dict(itemsize=size + 1, **base)) self._check('^ixx', dict(itemsize=size + 2, **base)) self._check('^ixxx', dict(itemsize=size + 3, **base)) self._check('^ixxxx', dict(itemsize=size + 4, **base)) self._check('^i7x', dict(itemsize=size + 7, **base)) def test_native_padding_3(self): dt = np.dtype( [('a', 'b'), ('b', 'i'), ('sub', np.dtype('b,i')), ('c', 'i')], align=True) self._check("T{b:a:xxxi:b:T{b:f0:=i:f1:}:sub:xxxi:c:}", dt) dt = np.dtype( [('a', 'b'), ('b', 'i'), ('c', 'b'), ('d', 'b'), ('e', 'b'), ('sub', np.dtype('b,i', align=True))]) self._check("T{b:a:=i:b:b:c:b:d:b:e:T{b:f0:xxxi:f1:}:sub:}", dt) def test_padding_with_array_inside_struct(self): dt = np.dtype( [('a', 'b'), ('b', 'i'), ('c', 'b', (3,)), ('d', 'i')], align=True) self._check("T{b:a:xxxi:b:3b:c:xi:d:}", dt) def test_byteorder_inside_struct(self): # The byte order after @T{=i} should be '=', not '@'. # Check this by noting the absence of native alignment. self._check('@T{^i}xi', {'f0': ({'f0': ('i', 0)}, 0), 'f1': ('i', 5)}) def test_intra_padding(self): # Natively aligned sub-arrays may require some internal padding align = np.dtype('i').alignment size = np.dtype('i').itemsize def aligned(n): return (align*(1 + (n-1)//align)) self._check('(3)T{ix}', (dict( names=['f0'], formats=['i'], offsets=[0], itemsize=aligned(size + 1) ), (3,))) def test_char_vs_string(self): dt = np.dtype('c') self._check('c', dt) dt = np.dtype([('f0', 'S1', (4,)), ('f1', 'S4')]) self._check('4c4s', dt) def test_field_order(self): # gh-9053 - previously, we relied on dictionary key order self._check("(0)I:a:f:b:", [('a', 'I', (0,)), ('b', 'f')]) self._check("(0)I:b:f:a:", [('b', 'I', (0,)), ('a', 'f')]) def test_unnamed_fields(self): self._check('ii', [('f0', 'i'), ('f1', 'i')]) self._check('ii:f0:', [('f1', 'i'), ('f0', 'i')]) self._check('i', 'i') self._check('i:f0:', [('f0', 'i')]) class TestNewBufferProtocol(object): def _check_roundtrip(self, obj): obj = np.asarray(obj) x = memoryview(obj) y = np.asarray(x) y2 = np.array(x) assert_(not y.flags.owndata) assert_(y2.flags.owndata) assert_equal(y.dtype, obj.dtype) assert_equal(y.shape, obj.shape) assert_array_equal(obj, y) assert_equal(y2.dtype, obj.dtype) assert_equal(y2.shape, obj.shape) assert_array_equal(obj, y2) def test_roundtrip(self): x = np.array([1, 2, 3, 4, 5], dtype='i4') self._check_roundtrip(x) x = np.array([[1, 2], [3, 4]], dtype=np.float64) self._check_roundtrip(x) x = np.zeros((3, 3, 3), dtype=np.float32)[:, 0,:] self._check_roundtrip(x) dt = [('a', 'b'), ('b', 'h'), ('c', 'i'), ('d', 'l'), ('dx', 'q'), ('e', 'B'), ('f', 'H'), ('g', 'I'), ('h', 'L'), ('hx', 'Q'), ('i', np.single), ('j', np.double), ('k', np.longdouble), ('ix', np.csingle), ('jx', np.cdouble), ('kx', np.clongdouble), ('l', 'S4'), ('m', 'U4'), ('n', 'V3'), ('o', '?'), ('p', np.half), ] x = np.array( [(1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, b'aaaa', 'bbbb', b'xxx', True, 1.0)], dtype=dt) self._check_roundtrip(x) x = np.array(([[1, 2], [3, 4]],), dtype=[('a', (int, (2, 2)))]) self._check_roundtrip(x) x = np.array([1, 2, 3], dtype='>i2') self._check_roundtrip(x) x = np.array([1, 2, 3], dtype='<i2') self._check_roundtrip(x) x = np.array([1, 2, 3], dtype='>i4') self._check_roundtrip(x) x = np.array([1, 2, 3], dtype='<i4') self._check_roundtrip(x) # check long long can be represented as non-native x = np.array([1, 2, 3], dtype='>q') self._check_roundtrip(x) # Native-only data types can be passed through the buffer interface # only in native byte order if sys.byteorder == 'little': x = np.array([1, 2, 3], dtype='>g') assert_raises(ValueError, self._check_roundtrip, x) x = np.array([1, 2, 3], dtype='<g') self._check_roundtrip(x) else: x = np.array([1, 2, 3], dtype='>g') self._check_roundtrip(x) x = np.array([1, 2, 3], dtype='<g') assert_raises(ValueError, self._check_roundtrip, x) def test_roundtrip_half(self): half_list = [ 1.0, -2.0, 6.5504 * 10**4, # (max half precision) 2**-14, # ~= 6.10352 * 10**-5 (minimum positive normal) 2**-24, # ~= 5.96046 * 10**-8 (minimum strictly positive subnormal) 0.0, -0.0, float('+inf'), float('-inf'), 0.333251953125, # ~= 1/3 ] x = np.array(half_list, dtype='>e') self._check_roundtrip(x) x = np.array(half_list, dtype='<e') self._check_roundtrip(x) def test_roundtrip_single_types(self): for typ in np.typeDict.values(): dtype = np.dtype(typ) if dtype.char in 'Mm': # datetimes cannot be used in buffers continue if dtype.char == 'V': # skip void continue x = np.zeros(4, dtype=dtype) self._check_roundtrip(x) if dtype.char not in 'qQgG': dt = dtype.newbyteorder('<') x = np.zeros(4, dtype=dt) self._check_roundtrip(x) dt = dtype.newbyteorder('>') x = np.zeros(4, dtype=dt) self._check_roundtrip(x) def test_roundtrip_scalar(self): # Issue #4015. self._check_roundtrip(0) def test_export_simple_1d(self): x = np.array([1, 2, 3, 4, 5], dtype='i') y = memoryview(x) assert_equal(y.format, 'i') assert_equal(y.shape, (5,)) assert_equal(y.ndim, 1) assert_equal(y.strides, (4,)) assert_equal(y.suboffsets, EMPTY) assert_equal(y.itemsize, 4) def test_export_simple_nd(self): x = np.array([[1, 2], [3, 4]], dtype=np.float64) y = memoryview(x) assert_equal(y.format, 'd') assert_equal(y.shape, (2, 2)) assert_equal(y.ndim, 2) assert_equal(y.strides, (16, 8)) assert_equal(y.suboffsets, EMPTY) assert_equal(y.itemsize, 8) def test_export_discontiguous(self): x = np.zeros((3, 3, 3), dtype=np.float32)[:, 0,:] y = memoryview(x) assert_equal(y.format, 'f') assert_equal(y.shape, (3, 3)) assert_equal(y.ndim, 2) assert_equal(y.strides, (36, 4)) assert_equal(y.suboffsets, EMPTY) assert_equal(y.itemsize, 4) def test_export_record(self): dt = [('a', 'b'), ('b', 'h'), ('c', 'i'), ('d', 'l'), ('dx', 'q'), ('e', 'B'), ('f', 'H'), ('g', 'I'), ('h', 'L'), ('hx', 'Q'), ('i', np.single), ('j', np.double), ('k', np.longdouble), ('ix', np.csingle), ('jx', np.cdouble), ('kx', np.clongdouble), ('l', 'S4'), ('m', 'U4'), ('n', 'V3'), ('o', '?'), ('p', np.half), ] x = np.array( [(1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, b'aaaa', 'bbbb', b' ', True, 1.0)], dtype=dt) y = memoryview(x) assert_equal(y.shape, (1,)) assert_equal(y.ndim, 1) assert_equal(y.suboffsets, EMPTY) sz = sum([np.dtype(b).itemsize for a, b in dt]) if np.dtype('l').itemsize == 4: assert_equal(y.format, 'T{b:a:=h:b:i:c:l:d:q:dx:B:e:@H:f:=I:g:L:h:Q:hx:f:i:d:j:^g:k:=Zf:ix:Zd:jx:^Zg:kx:4s:l:=4w:m:3x:n:?:o:@e:p:}') else: assert_equal(y.format, 'T{b:a:=h:b:i:c:q:d:q:dx:B:e:@H:f:=I:g:Q:h:Q:hx:f:i:d:j:^g:k:=Zf:ix:Zd:jx:^Zg:kx:4s:l:=4w:m:3x:n:?:o:@e:p:}') # Cannot test if NPY_RELAXED_STRIDES_CHECKING changes the strides if not (np.ones(1).strides[0] == np.iinfo(np.intp).max): assert_equal(y.strides, (sz,)) assert_equal(y.itemsize, sz) def test_export_subarray(self): x = np.array(([[1, 2], [3, 4]],), dtype=[('a', ('i', (2, 2)))]) y = memoryview(x) assert_equal(y.format, 'T{(2,2)i:a:}') assert_equal(y.shape, EMPTY) assert_equal(y.ndim, 0) assert_equal(y.strides, EMPTY) assert_equal(y.suboffsets, EMPTY) assert_equal(y.itemsize, 16) def test_export_endian(self): x = np.array([1, 2, 3], dtype='>i') y = memoryview(x) if sys.byteorder == 'little': assert_equal(y.format, '>i') else: assert_equal(y.format, 'i') x = np.array([1, 2, 3], dtype='<i') y = memoryview(x) if sys.byteorder == 'little': assert_equal(y.format, 'i') else: assert_equal(y.format, '<i') def test_export_flags(self): # Check SIMPLE flag, see also gh-3613 (exception should be BufferError) assert_raises(ValueError, get_buffer_info, np.arange(5)[::2], ('SIMPLE',)) def test_padding(self): for j in range(8): x = np.array([(1,), (2,)], dtype={'f0': (int, j)}) self._check_roundtrip(x) def test_reference_leak(self): if HAS_REFCOUNT: count_1 = sys.getrefcount(np.core._internal) a = np.zeros(4) b = memoryview(a) c = np.asarray(b) if HAS_REFCOUNT: count_2 = sys.getrefcount(np.core._internal) assert_equal(count_1, count_2) del c # avoid pyflakes unused variable warning. def test_padded_struct_array(self): dt1 = np.dtype( [('a', 'b'), ('b', 'i'), ('sub', np.dtype('b,i')), ('c', 'i')], align=True) x1 = np.arange(dt1.itemsize, dtype=np.int8).view(dt1) self._check_roundtrip(x1) dt2 = np.dtype( [('a', 'b'), ('b', 'i'), ('c', 'b', (3,)), ('d', 'i')], align=True) x2 = np.arange(dt2.itemsize, dtype=np.int8).view(dt2) self._check_roundtrip(x2) dt3 = np.dtype( [('a', 'b'), ('b', 'i'), ('c', 'b'), ('d', 'b'), ('e', 'b'), ('sub', np.dtype('b,i', align=True))]) x3 = np.arange(dt3.itemsize, dtype=np.int8).view(dt3) self._check_roundtrip(x3) def test_relaxed_strides(self): # Test that relaxed strides are converted to non-relaxed c = np.ones((1, 10, 10), dtype='i8') # Check for NPY_RELAXED_STRIDES_CHECKING: if np.ones((10, 1), order="C").flags.f_contiguous: c.strides = (-1, 80, 8) assert_(memoryview(c).strides == (800, 80, 8)) # Writing C-contiguous data to a BytesIO buffer should work fd = io.BytesIO() fd.write(c.data) fortran = c.T assert_(memoryview(fortran).strides == (8, 80, 800)) arr = np.ones((1, 10)) if arr.flags.f_contiguous: shape, strides = get_buffer_info(arr, ['F_CONTIGUOUS']) assert_(strides[0] == 8) arr = np.ones((10, 1), order='F') shape, strides = get_buffer_info(arr, ['C_CONTIGUOUS']) assert_(strides[-1] == 8) def test_out_of_order_fields(self): dt = np.dtype(dict( formats=['<i4', '<i4'], names=['one', 'two'], offsets=[4, 0], itemsize=8 )) # overlapping fields cannot be represented by PEP3118 arr = np.empty(1, dt) with assert_raises(ValueError): memoryview(arr) class TestArrayAttributeDeletion(object): def test_multiarray_writable_attributes_deletion(self): # ticket #2046, should not seqfault, raise AttributeError a = np.ones(2) attr = ['shape', 'strides', 'data', 'dtype', 'real', 'imag', 'flat'] with suppress_warnings() as sup: sup.filter(DeprecationWarning, "Assigning the 'data' attribute") for s in attr: assert_raises(AttributeError, delattr, a, s) def test_multiarray_not_writable_attributes_deletion(self): a = np.ones(2) attr = ["ndim", "flags", "itemsize", "size", "nbytes", "base", "ctypes", "T", "__array_interface__", "__array_struct__", "__array_priority__", "__array_finalize__"] for s in attr: assert_raises(AttributeError, delattr, a, s) def test_multiarray_flags_writable_attribute_deletion(self): a = np.ones(2).flags attr = ['writebackifcopy', 'updateifcopy', 'aligned', 'writeable'] for s in attr: assert_raises(AttributeError, delattr, a, s) def test_multiarray_flags_not_writable_attribute_deletion(self): a = np.ones(2).flags attr = ["contiguous", "c_contiguous", "f_contiguous", "fortran", "owndata", "fnc", "forc", "behaved", "carray", "farray", "num"] for s in attr: assert_raises(AttributeError, delattr, a, s) def test_array_interface(): # Test scalar coercion within the array interface class Foo(object): def __init__(self, value): self.value = value self.iface = {'typestr': '=f8'} def __float__(self): return float(self.value) @property def __array_interface__(self): return self.iface f = Foo(0.5) assert_equal(np.array(f), 0.5) assert_equal(np.array([f]), [0.5]) assert_equal(np.array([f, f]), [0.5, 0.5]) assert_equal(np.array(f).dtype, np.dtype('=f8')) # Test various shape definitions f.iface['shape'] = () assert_equal(np.array(f), 0.5) f.iface['shape'] = None assert_raises(TypeError, np.array, f) f.iface['shape'] = (1, 1) assert_equal(np.array(f), [[0.5]]) f.iface['shape'] = (2,) assert_raises(ValueError, np.array, f) # test scalar with no shape class ArrayLike(object): array = np.array(1) __array_interface__ = array.__array_interface__ assert_equal(np.array(ArrayLike()), 1) def test_array_interface_itemsize(): # See gh-6361 my_dtype = np.dtype({'names': ['A', 'B'], 'formats': ['f4', 'f4'], 'offsets': [0, 8], 'itemsize': 16}) a = np.ones(10, dtype=my_dtype) descr_t = np.dtype(a.__array_interface__['descr']) typestr_t = np.dtype(a.__array_interface__['typestr']) assert_equal(descr_t.itemsize, typestr_t.itemsize) def test_array_interface_empty_shape(): # See gh-7994 arr = np.array([1, 2, 3]) interface1 = dict(arr.__array_interface__) interface1['shape'] = () class DummyArray1(object): __array_interface__ = interface1 # NOTE: Because Py2 str/Py3 bytes supports the buffer interface, setting # the interface data to bytes would invoke the bug this tests for, that # __array_interface__ with shape=() is not allowed if the data is an object # exposing the buffer interface interface2 = dict(interface1) interface2['data'] = arr[0].tobytes() class DummyArray2(object): __array_interface__ = interface2 arr1 = np.asarray(DummyArray1()) arr2 = np.asarray(DummyArray2()) arr3 = arr[:1].reshape(()) assert_equal(arr1, arr2) assert_equal(arr1, arr3) def test_flat_element_deletion(): it = np.ones(3).flat try: del it[1] del it[1:2] except TypeError: pass except Exception: raise AssertionError def test_scalar_element_deletion(): a = np.zeros(2, dtype=[('x', 'int'), ('y', 'int')]) assert_raises(ValueError, a[0].__delitem__, 'x') class TestMemEventHook(object): def test_mem_seteventhook(self): # The actual tests are within the C code in # multiarray/multiarray_tests.c.src test_pydatamem_seteventhook_start() # force an allocation and free of a numpy array # needs to be larger then limit of small memory cacher in ctors.c a = np.zeros(1000) del a gc.collect() test_pydatamem_seteventhook_end() class TestMapIter(object): def test_mapiter(self): # The actual tests are within the C code in # multiarray/multiarray_tests.c.src a = np.arange(12).reshape((3, 4)).astype(float) index = ([1, 1, 2, 0], [0, 0, 2, 3]) vals = [50, 50, 30, 16] test_inplace_increment(a, index, vals) assert_equal(a, [[0.00, 1., 2.0, 19.], [104., 5., 6.0, 7.0], [8.00, 9., 40., 11.]]) b = np.arange(6).astype(float) index = (np.array([1, 2, 0]),) vals = [50, 4, 100.1] test_inplace_increment(b, index, vals) assert_equal(b, [100.1, 51., 6., 3., 4., 5.]) class TestAsCArray(object): def test_1darray(self): array = np.arange(24, dtype=np.double) from_c = test_as_c_array(array, 3) assert_equal(array[3], from_c) def test_2darray(self): array = np.arange(24, dtype=np.double).reshape(3, 8) from_c = test_as_c_array(array, 2, 4) assert_equal(array[2, 4], from_c) def test_3darray(self): array = np.arange(24, dtype=np.double).reshape(2, 3, 4) from_c = test_as_c_array(array, 1, 2, 3) assert_equal(array[1, 2, 3], from_c) class TestConversion(object): def test_array_scalar_relational_operation(self): # All integer for dt1 in np.typecodes['AllInteger']: assert_(1 > np.array(0, dtype=dt1), "type %s failed" % (dt1,)) assert_(not 1 < np.array(0, dtype=dt1), "type %s failed" % (dt1,)) for dt2 in np.typecodes['AllInteger']: assert_(np.array(1, dtype=dt1) > np.array(0, dtype=dt2), "type %s and %s failed" % (dt1, dt2)) assert_(not np.array(1, dtype=dt1) < np.array(0, dtype=dt2), "type %s and %s failed" % (dt1, dt2)) # Unsigned integers for dt1 in 'BHILQP': assert_(-1 < np.array(1, dtype=dt1), "type %s failed" % (dt1,)) assert_(not -1 > np.array(1, dtype=dt1), "type %s failed" % (dt1,)) assert_(-1 != np.array(1, dtype=dt1), "type %s failed" % (dt1,)) # Unsigned vs signed for dt2 in 'bhilqp': assert_(np.array(1, dtype=dt1) > np.array(-1, dtype=dt2), "type %s and %s failed" % (dt1, dt2)) assert_(not np.array(1, dtype=dt1) < np.array(-1, dtype=dt2), "type %s and %s failed" % (dt1, dt2)) assert_(np.array(1, dtype=dt1) != np.array(-1, dtype=dt2), "type %s and %s failed" % (dt1, dt2)) # Signed integers and floats for dt1 in 'bhlqp' + np.typecodes['Float']: assert_(1 > np.array(-1, dtype=dt1), "type %s failed" % (dt1,)) assert_(not 1 < np.array(-1, dtype=dt1), "type %s failed" % (dt1,)) assert_(-1 == np.array(-1, dtype=dt1), "type %s failed" % (dt1,)) for dt2 in 'bhlqp' + np.typecodes['Float']: assert_(np.array(1, dtype=dt1) > np.array(-1, dtype=dt2), "type %s and %s failed" % (dt1, dt2)) assert_(not np.array(1, dtype=dt1) < np.array(-1, dtype=dt2), "type %s and %s failed" % (dt1, dt2)) assert_(np.array(-1, dtype=dt1) == np.array(-1, dtype=dt2), "type %s and %s failed" % (dt1, dt2)) def test_to_bool_scalar(self): assert_equal(bool(np.array([False])), False) assert_equal(bool(np.array([True])), True) assert_equal(bool(np.array([[42]])), True) assert_raises(ValueError, bool, np.array([1, 2])) class NotConvertible(object): def __bool__(self): raise NotImplementedError __nonzero__ = __bool__ # python 2 assert_raises(NotImplementedError, bool, np.array(NotConvertible())) assert_raises(NotImplementedError, bool, np.array([NotConvertible()])) self_containing = np.array([None]) self_containing[0] = self_containing try: Error = RecursionError except NameError: Error = RuntimeError # python < 3.5 assert_raises(Error, bool, self_containing) # previously stack overflow def test_to_int_scalar(self): # gh-9972 means that these aren't always the same int_funcs = (int, lambda x: x.__int__()) for int_func in int_funcs: assert_equal(int_func(np.array([1])), 1) assert_equal(int_func(np.array([0])), 0) assert_equal(int_func(np.array([[42]])), 42) assert_raises(TypeError, int_func, np.array([1, 2])) # gh-9972 assert_equal(4, int_func(np.array('4'))) assert_equal(5, int_func(np.bytes_(b'5'))) assert_equal(6, int_func(np.unicode_(u'6'))) class HasTrunc: def __trunc__(self): return 3 assert_equal(3, int_func(np.array(HasTrunc()))) assert_equal(3, int_func(np.array([HasTrunc()]))) class NotConvertible(object): def __int__(self): raise NotImplementedError assert_raises(NotImplementedError, int_func, np.array(NotConvertible())) assert_raises(NotImplementedError, int_func, np.array([NotConvertible()])) class TestWhere(object): def test_basic(self): dts = [bool, np.int16, np.int32, np.int64, np.double, np.complex128, np.longdouble, np.clongdouble] for dt in dts: c = np.ones(53, dtype=bool) assert_equal(np.where( c, dt(0), dt(1)), dt(0)) assert_equal(np.where(~c, dt(0), dt(1)), dt(1)) assert_equal(np.where(True, dt(0), dt(1)), dt(0)) assert_equal(np.where(False, dt(0), dt(1)), dt(1)) d = np.ones_like(c).astype(dt) e = np.zeros_like(d) r = d.astype(dt) c[7] = False r[7] = e[7] assert_equal(np.where(c, e, e), e) assert_equal(np.where(c, d, e), r) assert_equal(np.where(c, d, e[0]), r) assert_equal(np.where(c, d[0], e), r) assert_equal(np.where(c[::2], d[::2], e[::2]), r[::2]) assert_equal(np.where(c[1::2], d[1::2], e[1::2]), r[1::2]) assert_equal(np.where(c[::3], d[::3], e[::3]), r[::3]) assert_equal(np.where(c[1::3], d[1::3], e[1::3]), r[1::3]) assert_equal(np.where(c[::-2], d[::-2], e[::-2]), r[::-2]) assert_equal(np.where(c[::-3], d[::-3], e[::-3]), r[::-3]) assert_equal(np.where(c[1::-3], d[1::-3], e[1::-3]), r[1::-3]) def test_exotic(self): # object assert_array_equal(np.where(True, None, None), np.array(None)) # zero sized m = np.array([], dtype=bool).reshape(0, 3) b = np.array([], dtype=np.float64).reshape(0, 3) assert_array_equal(np.where(m, 0, b), np.array([]).reshape(0, 3)) # object cast d = np.array([-1.34, -0.16, -0.54, -0.31, -0.08, -0.95, 0.000, 0.313, 0.547, -0.18, 0.876, 0.236, 1.969, 0.310, 0.699, 1.013, 1.267, 0.229, -1.39, 0.487]) nan = float('NaN') e = np.array(['5z', '0l', nan, 'Wz', nan, nan, 'Xq', 'cs', nan, nan, 'QN', nan, nan, 'Fd', nan, nan, 'kp', nan, '36', 'i1'], dtype=object) m = np.array([0, 0, 1, 0, 1, 1, 0, 0, 1, 1, 0, 1, 1, 0, 1, 1, 0, 1, 0, 0], dtype=bool) r = e[:] r[np.where(m)] = d[np.where(m)] assert_array_equal(np.where(m, d, e), r) r = e[:] r[np.where(~m)] = d[np.where(~m)] assert_array_equal(np.where(m, e, d), r) assert_array_equal(np.where(m, e, e), e) # minimal dtype result with NaN scalar (e.g required by pandas) d = np.array([1., 2.], dtype=np.float32) e = float('NaN') assert_equal(np.where(True, d, e).dtype, np.float32) e = float('Infinity') assert_equal(np.where(True, d, e).dtype, np.float32) e = float('-Infinity') assert_equal(np.where(True, d, e).dtype, np.float32) # also check upcast e = float(1e150) assert_equal(np.where(True, d, e).dtype, np.float64) def test_ndim(self): c = [True, False] a = np.zeros((2, 25)) b = np.ones((2, 25)) r = np.where(np.array(c)[:,np.newaxis], a, b) assert_array_equal(r[0], a[0]) assert_array_equal(r[1], b[0]) a = a.T b = b.T r = np.where(c, a, b) assert_array_equal(r[:,0], a[:,0]) assert_array_equal(r[:,1], b[:,0]) def test_dtype_mix(self): c = np.array([False, True, False, False, False, False, True, False, False, False, True, False]) a = np.uint32(1) b = np.array([5., 0., 3., 2., -1., -4., 0., -10., 10., 1., 0., 3.], dtype=np.float64) r = np.array([5., 1., 3., 2., -1., -4., 1., -10., 10., 1., 1., 3.], dtype=np.float64) assert_equal(np.where(c, a, b), r) a = a.astype(np.float32) b = b.astype(np.int64) assert_equal(np.where(c, a, b), r) # non bool mask c = c.astype(int) c[c != 0] = 34242324 assert_equal(np.where(c, a, b), r) # invert tmpmask = c != 0 c[c == 0] = 41247212 c[tmpmask] = 0 assert_equal(np.where(c, b, a), r) def test_foreign(self): c = np.array([False, True, False, False, False, False, True, False, False, False, True, False]) r = np.array([5., 1., 3., 2., -1., -4., 1., -10., 10., 1., 1., 3.], dtype=np.float64) a = np.ones(1, dtype='>i4') b = np.array([5., 0., 3., 2., -1., -4., 0., -10., 10., 1., 0., 3.], dtype=np.float64) assert_equal(np.where(c, a, b), r) b = b.astype('>f8') assert_equal(np.where(c, a, b), r) a = a.astype('<i4') assert_equal(np.where(c, a, b), r) c = c.astype('>i4') assert_equal(np.where(c, a, b), r) def test_error(self): c = [True, True] a = np.ones((4, 5)) b = np.ones((5, 5)) assert_raises(ValueError, np.where, c, a, a) assert_raises(ValueError, np.where, c[0], a, b) def test_string(self): # gh-4778 check strings are properly filled with nulls a = np.array("abc") b = np.array("x" * 753) assert_equal(np.where(True, a, b), "abc") assert_equal(np.where(False, b, a), "abc") # check native datatype sized strings a = np.array("abcd") b = np.array("x" * 8) assert_equal(np.where(True, a, b), "abcd") assert_equal(np.where(False, b, a), "abcd") def test_empty_result(self): # pass empty where result through an assignment which reads the data of # empty arrays, error detectable with valgrind, see gh-8922 x = np.zeros((1, 1)) ibad = np.vstack(np.where(x == 99.)) assert_array_equal(ibad, np.atleast_2d(np.array([[],[]], dtype=np.intp))) def test_largedim(self): # invalid read regression gh-9304 shape = [10, 2, 3, 4, 5, 6] np.random.seed(2) array = np.random.rand(*shape) for i in range(10): benchmark = array.nonzero() result = array.nonzero() assert_array_equal(benchmark, result) if not IS_PYPY: # sys.getsizeof() is not valid on PyPy class TestSizeOf(object): def test_empty_array(self): x = np.array([]) assert_(sys.getsizeof(x) > 0) def check_array(self, dtype): elem_size = dtype(0).itemsize for length in [10, 50, 100, 500]: x = np.arange(length, dtype=dtype) assert_(sys.getsizeof(x) > length * elem_size) def test_array_int32(self): self.check_array(np.int32) def test_array_int64(self): self.check_array(np.int64) def test_array_float32(self): self.check_array(np.float32) def test_array_float64(self): self.check_array(np.float64) def test_view(self): d = np.ones(100) assert_(sys.getsizeof(d[...]) < sys.getsizeof(d)) def test_reshape(self): d = np.ones(100) assert_(sys.getsizeof(d) < sys.getsizeof(d.reshape(100, 1, 1).copy())) def test_resize(self): d = np.ones(100) old = sys.getsizeof(d) d.resize(50) assert_(old > sys.getsizeof(d)) d.resize(150) assert_(old < sys.getsizeof(d)) def test_error(self): d = np.ones(100) assert_raises(TypeError, d.__sizeof__, "a") class TestHashing(object): def test_arrays_not_hashable(self): x = np.ones(3) assert_raises(TypeError, hash, x) def test_collections_hashable(self): x = np.array([]) assert_(not isinstance(x, collections.Hashable)) class TestArrayPriority(object): # This will go away when __array_priority__ is settled, meanwhile # it serves to check unintended changes. op = operator binary_ops = [ op.pow, op.add, op.sub, op.mul, op.floordiv, op.truediv, op.mod, op.and_, op.or_, op.xor, op.lshift, op.rshift, op.mod, op.gt, op.ge, op.lt, op.le, op.ne, op.eq ] # See #7949. Dont use "/" operator With -3 switch, since python reports it # as a DeprecationWarning if sys.version_info[0] < 3 and not sys.py3kwarning: binary_ops.append(op.div) class Foo(np.ndarray): __array_priority__ = 100. def __new__(cls, *args, **kwargs): return np.array(*args, **kwargs).view(cls) class Bar(np.ndarray): __array_priority__ = 101. def __new__(cls, *args, **kwargs): return np.array(*args, **kwargs).view(cls) class Other(object): __array_priority__ = 1000. def _all(self, other): return self.__class__() __add__ = __radd__ = _all __sub__ = __rsub__ = _all __mul__ = __rmul__ = _all __pow__ = __rpow__ = _all __div__ = __rdiv__ = _all __mod__ = __rmod__ = _all __truediv__ = __rtruediv__ = _all __floordiv__ = __rfloordiv__ = _all __and__ = __rand__ = _all __xor__ = __rxor__ = _all __or__ = __ror__ = _all __lshift__ = __rlshift__ = _all __rshift__ = __rrshift__ = _all __eq__ = _all __ne__ = _all __gt__ = _all __ge__ = _all __lt__ = _all __le__ = _all def test_ndarray_subclass(self): a = np.array([1, 2]) b = self.Bar([1, 2]) for f in self.binary_ops: msg = repr(f) assert_(isinstance(f(a, b), self.Bar), msg) assert_(isinstance(f(b, a), self.Bar), msg) def test_ndarray_other(self): a = np.array([1, 2]) b = self.Other() for f in self.binary_ops: msg = repr(f) assert_(isinstance(f(a, b), self.Other), msg) assert_(isinstance(f(b, a), self.Other), msg) def test_subclass_subclass(self): a = self.Foo([1, 2]) b = self.Bar([1, 2]) for f in self.binary_ops: msg = repr(f) assert_(isinstance(f(a, b), self.Bar), msg) assert_(isinstance(f(b, a), self.Bar), msg) def test_subclass_other(self): a = self.Foo([1, 2]) b = self.Other() for f in self.binary_ops: msg = repr(f) assert_(isinstance(f(a, b), self.Other), msg) assert_(isinstance(f(b, a), self.Other), msg) class TestBytestringArrayNonzero(object): def test_empty_bstring_array_is_falsey(self): assert_(not np.array([''], dtype=str)) def test_whitespace_bstring_array_is_falsey(self): a = np.array(['spam'], dtype=str) a[0] = ' \0\0' assert_(not a) def test_all_null_bstring_array_is_falsey(self): a = np.array(['spam'], dtype=str) a[0] = '\0\0\0\0' assert_(not a) def test_null_inside_bstring_array_is_truthy(self): a = np.array(['spam'], dtype=str) a[0] = ' \0 \0' assert_(a) class TestUnicodeArrayNonzero(object): def test_empty_ustring_array_is_falsey(self): assert_(not np.array([''], dtype=np.unicode)) def test_whitespace_ustring_array_is_falsey(self): a = np.array(['eggs'], dtype=np.unicode) a[0] = ' \0\0' assert_(not a) def test_all_null_ustring_array_is_falsey(self): a = np.array(['eggs'], dtype=np.unicode) a[0] = '\0\0\0\0' assert_(not a) def test_null_inside_ustring_array_is_truthy(self): a = np.array(['eggs'], dtype=np.unicode) a[0] = ' \0 \0' assert_(a) class TestFormat(object): def test_0d(self): a = np.array(np.pi) assert_equal('{:0.3g}'.format(a), '3.14') assert_equal('{:0.3g}'.format(a[()]), '3.14') def test_1d_no_format(self): a = np.array([np.pi]) assert_equal('{}'.format(a), str(a)) def test_1d_format(self): # until gh-5543, ensure that the behaviour matches what it used to be a = np.array([np.pi]) if sys.version_info[:2] >= (3, 4): assert_raises(TypeError, '{:30}'.format, a) else: with suppress_warnings() as sup: sup.filter(PendingDeprecationWarning) res = '{:30}'.format(a) dst = object.__format__(a, '30') assert_equal(res, dst) class TestCTypes(object): def test_ctypes_is_available(self): test_arr = np.array([[1, 2, 3], [4, 5, 6]]) assert_equal(ctypes, test_arr.ctypes._ctypes) assert_equal(tuple(test_arr.ctypes.shape), (2, 3)) def test_ctypes_is_not_available(self): from numpy.core import _internal _internal.ctypes = None try: test_arr = np.array([[1, 2, 3], [4, 5, 6]]) assert_(isinstance(test_arr.ctypes._ctypes, _internal._missing_ctypes)) assert_equal(tuple(test_arr.ctypes.shape), (2, 3)) finally: _internal.ctypes = ctypes class TestWritebackIfCopy(TestCase): # all these tests use the WRITEBACKIFCOPY mechanism def test_argmax_with_out(self): mat = np.eye(5) out = np.empty(5, dtype='i2') res = np.argmax(mat, 0, out=out) assert_equal(res, range(5)) def test_argmin_with_out(self): mat = -np.eye(5) out = np.empty(5, dtype='i2') res = np.argmin(mat, 0, out=out) assert_equal(res, range(5)) def test_clip_with_out(self): mat = np.eye(5) out = np.eye(5, dtype='i2') res = np.clip(mat, a_min=-10, a_max=0, out=out) assert_equal(np.sum(out), 0) def test_insert_noncontiguous(self): a = np.arange(6).reshape(2,3).T # force non-c-contiguous # uses arr_insert np.place(a, a>2, [44, 55]) assert_equal(a, np.array([[0, 44], [1, 55], [2, 44]])) def test_put_noncontiguous(self): a = np.arange(6).reshape(2,3).T # force non-c-contiguous np.put(a, [0, 2], [44, 55]) assert_equal(a, np.array([[44, 3], [55, 4], [2, 5]])) def test_putmask_noncontiguous(self): a = np.arange(6).reshape(2,3).T # force non-c-contiguous # uses arr_putmask np.putmask(a, a>2, a**2) assert_equal(a, np.array([[0, 9], [1, 16], [2, 25]])) def test_take_mode_raise(self): a = np.arange(6, dtype='int') out = np.empty(2, dtype='int') np.take(a, [0, 2], out=out, mode='raise') assert_equal(out, np.array([0, 2])) def test_choose_mod_raise(self): a = np.array([[1, 0, 1], [0, 1, 0], [1, 0, 1]]) out = np.empty((3,3), dtype='int') choices = [-10, 10] np.choose(a, choices, out=out, mode='raise') assert_equal(out, np.array([[ 10, -10, 10], [-10, 10, -10], [ 10, -10, 10]])) def test_flatiter__array__(self): a = np.arange(9).reshape(3,3) b = a.T.flat c = b.__array__() # triggers the WRITEBACKIFCOPY resolution, assuming refcount semantics del c def test_dot_out(self): # if HAVE_CBLAS, will use WRITEBACKIFCOPY a = np.arange(9, dtype=float).reshape(3,3) b = np.dot(a, a, out=a) assert_equal(b, np.array([[15, 18, 21], [42, 54, 66], [69, 90, 111]])) def test_view_assign(self): from numpy.core.multiarray_tests import npy_create_writebackifcopy, npy_resolve arr = np.arange(9).reshape(3, 3).T arr_wb = npy_create_writebackifcopy(arr) assert_(arr_wb.flags.writebackifcopy) assert_(arr_wb.base is arr) arr_wb[...] = -100 npy_resolve(arr_wb) # arr changes after resolve, even though we assigned to arr_wb assert_equal(arr, -100) # after resolve, the two arrays no longer reference each other assert_(arr_wb.ctypes.data != 0) assert_equal(arr_wb.base, None) # assigning to arr_wb does not get transfered to arr arr_wb[...] = 100 assert_equal(arr, -100) def test_view_discard_refcount(self): from numpy.core.multiarray_tests import npy_create_writebackifcopy, npy_discard arr = np.arange(9).reshape(3, 3).T orig = arr.copy() if HAS_REFCOUNT: arr_cnt = sys.getrefcount(arr) arr_wb = npy_create_writebackifcopy(arr) assert_(arr_wb.flags.writebackifcopy) assert_(arr_wb.base is arr) arr_wb[...] = -100 npy_discard(arr_wb) # arr remains unchanged after discard assert_equal(arr, orig) # after discard, the two arrays no longer reference each other assert_(arr_wb.ctypes.data != 0) assert_equal(arr_wb.base, None) if HAS_REFCOUNT: assert_equal(arr_cnt, sys.getrefcount(arr)) # assigning to arr_wb does not get transfered to arr arr_wb[...] = 100 assert_equal(arr, orig) class TestArange(object): def test_infinite(self): assert_raises_regex( ValueError, "size exceeded", np.arange, 0, np.inf ) def test_nan_step(self): assert_raises_regex( ValueError, "cannot compute length", np.arange, 0, 1, np.nan ) def test_zero_step(self): assert_raises(ZeroDivisionError, np.arange, 0, 10, 0) assert_raises(ZeroDivisionError, np.arange, 0.0, 10.0, 0.0) # empty range assert_raises(ZeroDivisionError, np.arange, 0, 0, 0) assert_raises(ZeroDivisionError, np.arange, 0.0, 0.0, 0.0) def test_orderconverter_with_nonASCII_unicode_ordering(): # gh-7475 a = np.arange(5) assert_raises(ValueError, a.flatten, order=u'\xe2') def test_equal_override(): # gh-9153: ndarray.__eq__ uses special logic for structured arrays, which # did not respect overrides with __array_priority__ or __array_ufunc__. # The PR fixed this for __array_priority__ and __array_ufunc__ = None. class MyAlwaysEqual(object): def __eq__(self, other): return "eq" def __ne__(self, other): return "ne" class MyAlwaysEqualOld(MyAlwaysEqual): __array_priority__ = 10000 class MyAlwaysEqualNew(MyAlwaysEqual): __array_ufunc__ = None array = np.array([(0, 1), (2, 3)], dtype='i4,i4') for my_always_equal_cls in MyAlwaysEqualOld, MyAlwaysEqualNew: my_always_equal = my_always_equal_cls() assert_equal(my_always_equal == array, 'eq') assert_equal(array == my_always_equal, 'eq') assert_equal(my_always_equal != array, 'ne') assert_equal(array != my_always_equal, 'ne') def test_npymath_complex(): # Smoketest npymath functions from numpy.core.multiarray_tests import ( npy_cabs, npy_carg) funcs = {npy_cabs: np.absolute, npy_carg: np.angle} vals = (1, np.inf, -np.inf, np.nan) types = (np.complex64, np.complex128, np.clongdouble) for fun, npfun in funcs.items(): for x, y in itertools.product(vals, vals): for t in types: z = t(complex(x, y)) got = fun(z) expected = npfun(z) assert_allclose(got, expected) def test_npymath_real(): # Smoketest npymath functions from numpy.core.multiarray_tests import ( npy_log10, npy_cosh, npy_sinh, npy_tan, npy_tanh) funcs = {npy_log10: np.log10, npy_cosh: np.cosh, npy_sinh: np.sinh, npy_tan: np.tan, npy_tanh: np.tanh} vals = (1, np.inf, -np.inf, np.nan) types = (np.float32, np.float64, np.longdouble) with np.errstate(all='ignore'): for fun, npfun in funcs.items(): for x, t in itertools.product(vals, types): z = t(x) got = fun(z) expected = npfun(z) assert_allclose(got, expected) if __name__ == "__main__": run_module_suite()
276,524
36.332928
588
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_mem_overlap.py
from __future__ import division, absolute_import, print_function import sys import itertools import numpy as np from numpy.testing import (run_module_suite, assert_, assert_raises, assert_equal, assert_array_equal, assert_allclose, dec) from numpy.core.multiarray_tests import solve_diophantine, internal_overlap from numpy.core import umath_tests from numpy.lib.stride_tricks import as_strided from numpy.compat import long if sys.version_info[0] >= 3: xrange = range ndims = 2 size = 10 shape = tuple([size] * ndims) MAY_SHARE_BOUNDS = 0 MAY_SHARE_EXACT = -1 def _indices_for_nelems(nelems): """Returns slices of length nelems, from start onwards, in direction sign.""" if nelems == 0: return [size // 2] # int index res = [] for step in (1, 2): for sign in (-1, 1): start = size // 2 - nelems * step * sign // 2 stop = start + nelems * step * sign res.append(slice(start, stop, step * sign)) return res def _indices_for_axis(): """Returns (src, dst) pairs of indices.""" res = [] for nelems in (0, 2, 3): ind = _indices_for_nelems(nelems) # no itertools.product available in Py2.4 res.extend([(a, b) for a in ind for b in ind]) # all assignments of size "nelems" return res def _indices(ndims): """Returns ((axis0_src, axis0_dst), (axis1_src, axis1_dst), ... ) index pairs.""" ind = _indices_for_axis() # no itertools.product available in Py2.4 res = [[]] for i in range(ndims): newres = [] for elem in ind: for others in res: newres.append([elem] + others) res = newres return res def _check_assignment(srcidx, dstidx): """Check assignment arr[dstidx] = arr[srcidx] works.""" arr = np.arange(np.product(shape)).reshape(shape) cpy = arr.copy() cpy[dstidx] = arr[srcidx] arr[dstidx] = arr[srcidx] assert_(np.all(arr == cpy), 'assigning arr[%s] = arr[%s]' % (dstidx, srcidx)) def test_overlapping_assignments(): # Test automatically generated assignments which overlap in memory. inds = _indices(ndims) for ind in inds: srcidx = tuple([a[0] for a in ind]) dstidx = tuple([a[1] for a in ind]) yield _check_assignment, srcidx, dstidx @dec.slow def test_diophantine_fuzz(): # Fuzz test the diophantine solver rng = np.random.RandomState(1234) max_int = np.iinfo(np.intp).max for ndim in range(10): feasible_count = 0 infeasible_count = 0 min_count = 500//(ndim + 1) while min(feasible_count, infeasible_count) < min_count: # Ensure big and small integer problems A_max = 1 + rng.randint(0, 11, dtype=np.intp)**6 U_max = rng.randint(0, 11, dtype=np.intp)**6 A_max = min(max_int, A_max) U_max = min(max_int-1, U_max) A = tuple(int(rng.randint(1, A_max+1, dtype=np.intp)) for j in range(ndim)) U = tuple(int(rng.randint(0, U_max+2, dtype=np.intp)) for j in range(ndim)) b_ub = min(max_int-2, sum(a*ub for a, ub in zip(A, U))) b = rng.randint(-1, b_ub+2, dtype=np.intp) if ndim == 0 and feasible_count < min_count: b = 0 X = solve_diophantine(A, U, b) if X is None: # Check the simplified decision problem agrees X_simplified = solve_diophantine(A, U, b, simplify=1) assert_(X_simplified is None, (A, U, b, X_simplified)) # Check no solution exists (provided the problem is # small enough so that brute force checking doesn't # take too long) try: ranges = tuple(xrange(0, a*ub+1, a) for a, ub in zip(A, U)) except OverflowError: # xrange on 32-bit Python 2 may overflow continue size = 1 for r in ranges: size *= len(r) if size < 100000: assert_(not any(sum(w) == b for w in itertools.product(*ranges))) infeasible_count += 1 else: # Check the simplified decision problem agrees X_simplified = solve_diophantine(A, U, b, simplify=1) assert_(X_simplified is not None, (A, U, b, X_simplified)) # Check validity assert_(sum(a*x for a, x in zip(A, X)) == b) assert_(all(0 <= x <= ub for x, ub in zip(X, U))) feasible_count += 1 def test_diophantine_overflow(): # Smoke test integer overflow detection max_intp = np.iinfo(np.intp).max max_int64 = np.iinfo(np.int64).max if max_int64 <= max_intp: # Check that the algorithm works internally in 128-bit; # solving this problem requires large intermediate numbers A = (max_int64//2, max_int64//2 - 10) U = (max_int64//2, max_int64//2 - 10) b = 2*(max_int64//2) - 10 assert_equal(solve_diophantine(A, U, b), (1, 1)) def check_may_share_memory_exact(a, b): got = np.may_share_memory(a, b, max_work=MAY_SHARE_EXACT) assert_equal(np.may_share_memory(a, b), np.may_share_memory(a, b, max_work=MAY_SHARE_BOUNDS)) a.fill(0) b.fill(0) a.fill(1) exact = b.any() err_msg = "" if got != exact: err_msg = " " + "\n ".join([ "base_a - base_b = %r" % (a.__array_interface__['data'][0] - b.__array_interface__['data'][0],), "shape_a = %r" % (a.shape,), "shape_b = %r" % (b.shape,), "strides_a = %r" % (a.strides,), "strides_b = %r" % (b.strides,), "size_a = %r" % (a.size,), "size_b = %r" % (b.size,) ]) assert_equal(got, exact, err_msg=err_msg) def test_may_share_memory_manual(): # Manual test cases for may_share_memory # Base arrays xs0 = [ np.zeros([13, 21, 23, 22], dtype=np.int8), np.zeros([13, 21, 23*2, 22], dtype=np.int8)[:,:,::2,:] ] # Generate all negative stride combinations xs = [] for x in xs0: for ss in itertools.product(*(([slice(None), slice(None, None, -1)],)*4)): xp = x[ss] xs.append(xp) for x in xs: # The default is a simple extent check assert_(np.may_share_memory(x[:,0,:], x[:,1,:])) assert_(np.may_share_memory(x[:,0,:], x[:,1,:], max_work=None)) # Exact checks check_may_share_memory_exact(x[:,0,:], x[:,1,:]) check_may_share_memory_exact(x[:,::7], x[:,3::3]) try: xp = x.ravel() if xp.flags.owndata: continue xp = xp.view(np.int16) except ValueError: continue # 0-size arrays cannot overlap check_may_share_memory_exact(x.ravel()[6:6], xp.reshape(13, 21, 23, 11)[:,::7]) # Test itemsize is dealt with check_may_share_memory_exact(x[:,::7], xp.reshape(13, 21, 23, 11)) check_may_share_memory_exact(x[:,::7], xp.reshape(13, 21, 23, 11)[:,3::3]) check_may_share_memory_exact(x.ravel()[6:7], xp.reshape(13, 21, 23, 11)[:,::7]) # Check unit size x = np.zeros([1], dtype=np.int8) check_may_share_memory_exact(x, x) check_may_share_memory_exact(x, x.copy()) def iter_random_view_pairs(x, same_steps=True, equal_size=False): rng = np.random.RandomState(1234) if equal_size and same_steps: raise ValueError() def random_slice(n, step): start = rng.randint(0, n+1, dtype=np.intp) stop = rng.randint(start, n+1, dtype=np.intp) if rng.randint(0, 2, dtype=np.intp) == 0: stop, start = start, stop step *= -1 return slice(start, stop, step) def random_slice_fixed_size(n, step, size): start = rng.randint(0, n+1 - size*step) stop = start + (size-1)*step + 1 if rng.randint(0, 2) == 0: stop, start = start-1, stop-1 if stop < 0: stop = None step *= -1 return slice(start, stop, step) # First a few regular views yield x, x for j in range(1, 7, 3): yield x[j:], x[:-j] yield x[...,j:], x[...,:-j] # An array with zero stride internal overlap strides = list(x.strides) strides[0] = 0 xp = as_strided(x, shape=x.shape, strides=strides) yield x, xp yield xp, xp # An array with non-zero stride internal overlap strides = list(x.strides) if strides[0] > 1: strides[0] = 1 xp = as_strided(x, shape=x.shape, strides=strides) yield x, xp yield xp, xp # Then discontiguous views while True: steps = tuple(rng.randint(1, 11, dtype=np.intp) if rng.randint(0, 5, dtype=np.intp) == 0 else 1 for j in range(x.ndim)) s1 = tuple(random_slice(p, s) for p, s in zip(x.shape, steps)) t1 = np.arange(x.ndim) rng.shuffle(t1) if equal_size: t2 = t1 else: t2 = np.arange(x.ndim) rng.shuffle(t2) a = x[s1] if equal_size: if a.size == 0: continue steps2 = tuple(rng.randint(1, max(2, p//(1+pa))) if rng.randint(0, 5) == 0 else 1 for p, s, pa in zip(x.shape, s1, a.shape)) s2 = tuple(random_slice_fixed_size(p, s, pa) for p, s, pa in zip(x.shape, steps2, a.shape)) elif same_steps: steps2 = steps else: steps2 = tuple(rng.randint(1, 11, dtype=np.intp) if rng.randint(0, 5, dtype=np.intp) == 0 else 1 for j in range(x.ndim)) if not equal_size: s2 = tuple(random_slice(p, s) for p, s in zip(x.shape, steps2)) a = a.transpose(t1) b = x[s2].transpose(t2) yield a, b def check_may_share_memory_easy_fuzz(get_max_work, same_steps, min_count): # Check that overlap problems with common strides are solved with # little work. x = np.zeros([17,34,71,97], dtype=np.int16) feasible = 0 infeasible = 0 pair_iter = iter_random_view_pairs(x, same_steps) while min(feasible, infeasible) < min_count: a, b = next(pair_iter) bounds_overlap = np.may_share_memory(a, b) may_share_answer = np.may_share_memory(a, b) easy_answer = np.may_share_memory(a, b, max_work=get_max_work(a, b)) exact_answer = np.may_share_memory(a, b, max_work=MAY_SHARE_EXACT) if easy_answer != exact_answer: # assert_equal is slow... assert_equal(easy_answer, exact_answer) if may_share_answer != bounds_overlap: assert_equal(may_share_answer, bounds_overlap) if bounds_overlap: if exact_answer: feasible += 1 else: infeasible += 1 @dec.slow def test_may_share_memory_easy_fuzz(): # Check that overlap problems with common strides are always # solved with little work. check_may_share_memory_easy_fuzz(get_max_work=lambda a, b: 1, same_steps=True, min_count=2000) @dec.slow def test_may_share_memory_harder_fuzz(): # Overlap problems with not necessarily common strides take more # work. # # The work bound below can't be reduced much. Harder problems can # also exist but not be detected here, as the set of problems # comes from RNG. check_may_share_memory_easy_fuzz(get_max_work=lambda a, b: max(a.size, b.size)//2, same_steps=False, min_count=2000) def test_shares_memory_api(): x = np.zeros([4, 5, 6], dtype=np.int8) assert_equal(np.shares_memory(x, x), True) assert_equal(np.shares_memory(x, x.copy()), False) a = x[:,::2,::3] b = x[:,::3,::2] assert_equal(np.shares_memory(a, b), True) assert_equal(np.shares_memory(a, b, max_work=None), True) assert_raises(np.TooHardError, np.shares_memory, a, b, max_work=1) assert_raises(np.TooHardError, np.shares_memory, a, b, max_work=long(1)) def test_may_share_memory_bad_max_work(): x = np.zeros([1]) assert_raises(OverflowError, np.may_share_memory, x, x, max_work=10**100) assert_raises(OverflowError, np.shares_memory, x, x, max_work=10**100) def test_internal_overlap_diophantine(): def check(A, U, exists=None): X = solve_diophantine(A, U, 0, require_ub_nontrivial=1) if exists is None: exists = (X is not None) if X is not None: assert_(sum(a*x for a, x in zip(A, X)) == sum(a*u//2 for a, u in zip(A, U))) assert_(all(0 <= x <= u for x, u in zip(X, U))) assert_(any(x != u//2 for x, u in zip(X, U))) if exists: assert_(X is not None, repr(X)) else: assert_(X is None, repr(X)) # Smoke tests check((3, 2), (2*2, 3*2), exists=True) check((3*2, 2), (15*2, (3-1)*2), exists=False) def test_internal_overlap_slices(): # Slicing an array never generates internal overlap x = np.zeros([17,34,71,97], dtype=np.int16) rng = np.random.RandomState(1234) def random_slice(n, step): start = rng.randint(0, n+1, dtype=np.intp) stop = rng.randint(start, n+1, dtype=np.intp) if rng.randint(0, 2, dtype=np.intp) == 0: stop, start = start, stop step *= -1 return slice(start, stop, step) cases = 0 min_count = 5000 while cases < min_count: steps = tuple(rng.randint(1, 11, dtype=np.intp) if rng.randint(0, 5, dtype=np.intp) == 0 else 1 for j in range(x.ndim)) t1 = np.arange(x.ndim) rng.shuffle(t1) s1 = tuple(random_slice(p, s) for p, s in zip(x.shape, steps)) a = x[s1].transpose(t1) assert_(not internal_overlap(a)) cases += 1 def check_internal_overlap(a, manual_expected=None): got = internal_overlap(a) # Brute-force check m = set() ranges = tuple(xrange(n) for n in a.shape) for v in itertools.product(*ranges): offset = sum(s*w for s, w in zip(a.strides, v)) if offset in m: expected = True break else: m.add(offset) else: expected = False # Compare if got != expected: assert_equal(got, expected, err_msg=repr((a.strides, a.shape))) if manual_expected is not None and expected != manual_expected: assert_equal(expected, manual_expected) return got def test_internal_overlap_manual(): # Stride tricks can construct arrays with internal overlap # We don't care about memory bounds, the array is not # read/write accessed x = np.arange(1).astype(np.int8) # Check low-dimensional special cases check_internal_overlap(x, False) # 1-dim check_internal_overlap(x.reshape([]), False) # 0-dim a = as_strided(x, strides=(3, 4), shape=(4, 4)) check_internal_overlap(a, False) a = as_strided(x, strides=(3, 4), shape=(5, 4)) check_internal_overlap(a, True) a = as_strided(x, strides=(0,), shape=(0,)) check_internal_overlap(a, False) a = as_strided(x, strides=(0,), shape=(1,)) check_internal_overlap(a, False) a = as_strided(x, strides=(0,), shape=(2,)) check_internal_overlap(a, True) a = as_strided(x, strides=(0, -9993), shape=(87, 22)) check_internal_overlap(a, True) a = as_strided(x, strides=(0, -9993), shape=(1, 22)) check_internal_overlap(a, False) a = as_strided(x, strides=(0, -9993), shape=(0, 22)) check_internal_overlap(a, False) def test_internal_overlap_fuzz(): # Fuzz check; the brute-force check is fairly slow x = np.arange(1).astype(np.int8) overlap = 0 no_overlap = 0 min_count = 100 rng = np.random.RandomState(1234) while min(overlap, no_overlap) < min_count: ndim = rng.randint(1, 4, dtype=np.intp) strides = tuple(rng.randint(-1000, 1000, dtype=np.intp) for j in range(ndim)) shape = tuple(rng.randint(1, 30, dtype=np.intp) for j in range(ndim)) a = as_strided(x, strides=strides, shape=shape) result = check_internal_overlap(a) if result: overlap += 1 else: no_overlap += 1 def test_non_ndarray_inputs(): # Regression check for gh-5604 class MyArray(object): def __init__(self, data): self.data = data @property def __array_interface__(self): return self.data.__array_interface__ class MyArray2(object): def __init__(self, data): self.data = data def __array__(self): return self.data for cls in [MyArray, MyArray2]: x = np.arange(5) assert_(np.may_share_memory(cls(x[::2]), x[1::2])) assert_(not np.shares_memory(cls(x[::2]), x[1::2])) assert_(np.shares_memory(cls(x[1::3]), x[::2])) assert_(np.may_share_memory(cls(x[1::3]), x[::2])) def view_element_first_byte(x): """Construct an array viewing the first byte of each element of `x`""" from numpy.lib.stride_tricks import DummyArray interface = dict(x.__array_interface__) interface['typestr'] = '|b1' interface['descr'] = [('', '|b1')] return np.asarray(DummyArray(interface, x)) def assert_copy_equivalent(operation, args, out, **kwargs): """ Check that operation(*args, out=out) produces results equivalent to out[...] = operation(*args, out=out.copy()) """ kwargs['out'] = out kwargs2 = dict(kwargs) kwargs2['out'] = out.copy() out_orig = out.copy() out[...] = operation(*args, **kwargs2) expected = out.copy() out[...] = out_orig got = operation(*args, **kwargs).copy() if (got != expected).any(): assert_equal(got, expected) class TestUFunc(object): """ Test ufunc call memory overlap handling """ def check_unary_fuzz(self, operation, get_out_axis_size, dtype=np.int16, count=5000): shapes = [7, 13, 8, 21, 29, 32] rng = np.random.RandomState(1234) for ndim in range(1, 6): x = rng.randint(0, 2**16, size=shapes[:ndim]).astype(dtype) it = iter_random_view_pairs(x, same_steps=False, equal_size=True) min_count = count // (ndim + 1)**2 overlapping = 0 while overlapping < min_count: a, b = next(it) a_orig = a.copy() b_orig = b.copy() if get_out_axis_size is None: assert_copy_equivalent(operation, [a], out=b) if np.shares_memory(a, b): overlapping += 1 else: for axis in itertools.chain(range(ndim), [None]): a[...] = a_orig b[...] = b_orig # Determine size for reduction axis (None if scalar) outsize, scalarize = get_out_axis_size(a, b, axis) if outsize == 'skip': continue # Slice b to get an output array of the correct size sl = [slice(None)] * ndim if axis is None: if outsize is None: sl = [slice(0, 1)] + [0]*(ndim - 1) else: sl = [slice(0, outsize)] + [0]*(ndim - 1) else: if outsize is None: k = b.shape[axis]//2 if ndim == 1: sl[axis] = slice(k, k + 1) else: sl[axis] = k else: assert b.shape[axis] >= outsize sl[axis] = slice(0, outsize) b_out = b[tuple(sl)] if scalarize: b_out = b_out.reshape([]) if np.shares_memory(a, b_out): overlapping += 1 # Check result assert_copy_equivalent(operation, [a], out=b_out, axis=axis) @dec.slow def test_unary_ufunc_call_fuzz(self): self.check_unary_fuzz(np.invert, None, np.int16) def test_binary_ufunc_accumulate_fuzz(self): def get_out_axis_size(a, b, axis): if axis is None: if a.ndim == 1: return a.size, False else: return 'skip', False # accumulate doesn't support this else: return a.shape[axis], False self.check_unary_fuzz(np.add.accumulate, get_out_axis_size, dtype=np.int16, count=500) def test_binary_ufunc_reduce_fuzz(self): def get_out_axis_size(a, b, axis): return None, (axis is None or a.ndim == 1) self.check_unary_fuzz(np.add.reduce, get_out_axis_size, dtype=np.int16, count=500) def test_binary_ufunc_reduceat_fuzz(self): def get_out_axis_size(a, b, axis): if axis is None: if a.ndim == 1: return a.size, False else: return 'skip', False # reduceat doesn't support this else: return a.shape[axis], False def do_reduceat(a, out, axis): if axis is None: size = len(a) step = size//len(out) else: size = a.shape[axis] step = a.shape[axis] // out.shape[axis] idx = np.arange(0, size, step) return np.add.reduceat(a, idx, out=out, axis=axis) self.check_unary_fuzz(do_reduceat, get_out_axis_size, dtype=np.int16, count=500) def test_binary_ufunc_reduceat_manual(self): def check(ufunc, a, ind, out): c1 = ufunc.reduceat(a.copy(), ind.copy(), out=out.copy()) c2 = ufunc.reduceat(a, ind, out=out) assert_array_equal(c1, c2) # Exactly same input/output arrays a = np.arange(10000, dtype=np.int16) check(np.add, a, a[::-1].copy(), a) # Overlap with index a = np.arange(10000, dtype=np.int16) check(np.add, a, a[::-1], a) def test_unary_gufunc_fuzz(self): shapes = [7, 13, 8, 21, 29, 32] gufunc = umath_tests.euclidean_pdist rng = np.random.RandomState(1234) for ndim in range(2, 6): x = rng.rand(*shapes[:ndim]) it = iter_random_view_pairs(x, same_steps=False, equal_size=True) min_count = 500 // (ndim + 1)**2 overlapping = 0 while overlapping < min_count: a, b = next(it) if min(a.shape[-2:]) < 2 or min(b.shape[-2:]) < 2 or a.shape[-1] < 2: continue # Ensure the shapes are so that euclidean_pdist is happy if b.shape[-1] > b.shape[-2]: b = b[...,0,:] else: b = b[...,:,0] n = a.shape[-2] p = n * (n - 1) // 2 if p <= b.shape[-1] and p > 0: b = b[...,:p] else: n = max(2, int(np.sqrt(b.shape[-1]))//2) p = n * (n - 1) // 2 a = a[...,:n,:] b = b[...,:p] # Call if np.shares_memory(a, b): overlapping += 1 with np.errstate(over='ignore', invalid='ignore'): assert_copy_equivalent(gufunc, [a], out=b) def test_ufunc_at_manual(self): def check(ufunc, a, ind, b=None): a0 = a.copy() if b is None: ufunc.at(a0, ind.copy()) c1 = a0.copy() ufunc.at(a, ind) c2 = a.copy() else: ufunc.at(a0, ind.copy(), b.copy()) c1 = a0.copy() ufunc.at(a, ind, b) c2 = a.copy() assert_array_equal(c1, c2) # Overlap with index a = np.arange(10000, dtype=np.int16) check(np.invert, a[::-1], a) # Overlap with second data array a = np.arange(100, dtype=np.int16) ind = np.arange(0, 100, 2, dtype=np.int16) check(np.add, a, ind, a[25:75]) def test_unary_ufunc_1d_manual(self): # Exercise branches in PyArray_EQUIVALENTLY_ITERABLE def check(a, b): a_orig = a.copy() b_orig = b.copy() b0 = b.copy() c1 = ufunc(a, out=b0) c2 = ufunc(a, out=b) assert_array_equal(c1, c2) # Trigger "fancy ufunc loop" code path mask = view_element_first_byte(b).view(np.bool_) a[...] = a_orig b[...] = b_orig c1 = ufunc(a, out=b.copy(), where=mask.copy()).copy() a[...] = a_orig b[...] = b_orig c2 = ufunc(a, out=b, where=mask.copy()).copy() # Also, mask overlapping with output a[...] = a_orig b[...] = b_orig c3 = ufunc(a, out=b, where=mask).copy() assert_array_equal(c1, c2) assert_array_equal(c1, c3) dtypes = [np.int8, np.int16, np.int32, np.int64, np.float32, np.float64, np.complex64, np.complex128] dtypes = [np.dtype(x) for x in dtypes] for dtype in dtypes: if np.issubdtype(dtype, np.integer): ufunc = np.invert else: ufunc = np.reciprocal n = 1000 k = 10 indices = [ np.index_exp[:n], np.index_exp[k:k+n], np.index_exp[n-1::-1], np.index_exp[k+n-1:k-1:-1], np.index_exp[:2*n:2], np.index_exp[k:k+2*n:2], np.index_exp[2*n-1::-2], np.index_exp[k+2*n-1:k-1:-2], ] for xi, yi in itertools.product(indices, indices): v = np.arange(1, 1 + n*2 + k, dtype=dtype) x = v[xi] y = v[yi] with np.errstate(all='ignore'): check(x, y) # Scalar cases check(x[:1], y) check(x[-1:], y) check(x[:1].reshape([]), y) check(x[-1:].reshape([]), y) def test_unary_ufunc_where_same(self): # Check behavior at wheremask overlap ufunc = np.invert def check(a, out, mask): c1 = ufunc(a, out=out.copy(), where=mask.copy()) c2 = ufunc(a, out=out, where=mask) assert_array_equal(c1, c2) # Check behavior with same input and output arrays x = np.arange(100).astype(np.bool_) check(x, x, x) check(x, x.copy(), x) check(x, x, x.copy()) @dec.slow def test_binary_ufunc_1d_manual(self): ufunc = np.add def check(a, b, c): c0 = c.copy() c1 = ufunc(a, b, out=c0) c2 = ufunc(a, b, out=c) assert_array_equal(c1, c2) for dtype in [np.int8, np.int16, np.int32, np.int64, np.float32, np.float64, np.complex64, np.complex128]: # Check different data dependency orders n = 1000 k = 10 indices = [] for p in [1, 2]: indices.extend([ np.index_exp[:p*n:p], np.index_exp[k:k+p*n:p], np.index_exp[p*n-1::-p], np.index_exp[k+p*n-1:k-1:-p], ]) for x, y, z in itertools.product(indices, indices, indices): v = np.arange(6*n).astype(dtype) x = v[x] y = v[y] z = v[z] check(x, y, z) # Scalar cases check(x[:1], y, z) check(x[-1:], y, z) check(x[:1].reshape([]), y, z) check(x[-1:].reshape([]), y, z) check(x, y[:1], z) check(x, y[-1:], z) check(x, y[:1].reshape([]), z) check(x, y[-1:].reshape([]), z) def test_inplace_op_simple_manual(self): rng = np.random.RandomState(1234) x = rng.rand(200, 200) # bigger than bufsize x += x.T assert_array_equal(x - x.T, 0) if __name__ == "__main__": run_module_suite()
29,564
29.990566
108
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_longdouble.py
from __future__ import division, absolute_import, print_function import locale import numpy as np from numpy.testing import ( run_module_suite, assert_, assert_equal, dec, assert_raises, assert_array_equal, temppath, ) from .test_print import in_foreign_locale LD_INFO = np.finfo(np.longdouble) longdouble_longer_than_double = (LD_INFO.eps < np.finfo(np.double).eps) _o = 1 + LD_INFO.eps string_to_longdouble_inaccurate = (_o != np.longdouble(repr(_o))) del _o def test_scalar_extraction(): """Confirm that extracting a value doesn't convert to python float""" o = 1 + LD_INFO.eps a = np.array([o, o, o]) assert_equal(a[1], o) # Conversions string -> long double # 0.1 not exactly representable in base 2 floating point. repr_precision = len(repr(np.longdouble(0.1))) # +2 from macro block starting around line 842 in scalartypes.c.src. @dec.skipif(LD_INFO.precision + 2 >= repr_precision, "repr precision not enough to show eps") def test_repr_roundtrip(): # We will only see eps in repr if within printing precision. o = 1 + LD_INFO.eps assert_equal(np.longdouble(repr(o)), o, "repr was %s" % repr(o)) def test_unicode(): np.longdouble(u"1.2") def test_string(): np.longdouble("1.2") def test_bytes(): np.longdouble(b"1.2") @in_foreign_locale def test_fromstring_foreign_repr(): f = 1.234 a = np.fromstring(repr(f), dtype=float, sep=" ") assert_equal(a[0], f) @dec.knownfailureif(string_to_longdouble_inaccurate, "Need strtold_l") def test_repr_roundtrip_bytes(): o = 1 + LD_INFO.eps assert_equal(np.longdouble(repr(o).encode("ascii")), o) @in_foreign_locale def test_repr_roundtrip_foreign(): o = 1.5 assert_equal(o, np.longdouble(repr(o))) def test_bogus_string(): assert_raises(ValueError, np.longdouble, "spam") assert_raises(ValueError, np.longdouble, "1.0 flub") @dec.knownfailureif(string_to_longdouble_inaccurate, "Need strtold_l") def test_fromstring(): o = 1 + LD_INFO.eps s = (" " + repr(o))*5 a = np.array([o]*5) assert_equal(np.fromstring(s, sep=" ", dtype=np.longdouble), a, err_msg="reading '%s'" % s) @in_foreign_locale def test_fromstring_best_effort_float(): assert_equal(np.fromstring("1,234", dtype=float, sep=" "), np.array([1.])) @in_foreign_locale def test_fromstring_best_effort(): assert_equal(np.fromstring("1,234", dtype=np.longdouble, sep=" "), np.array([1.])) def test_fromstring_bogus(): assert_equal(np.fromstring("1. 2. 3. flop 4.", dtype=float, sep=" "), np.array([1., 2., 3.])) def test_fromstring_empty(): assert_equal(np.fromstring("xxxxx", sep="x"), np.array([])) def test_fromstring_missing(): assert_equal(np.fromstring("1xx3x4x5x6", sep="x"), np.array([1])) class TestFileBased(object): ldbl = 1 + LD_INFO.eps tgt = np.array([ldbl]*5) out = ''.join([repr(t) + '\n' for t in tgt]) def test_fromfile_bogus(self): with temppath() as path: with open(path, 'wt') as f: f.write("1. 2. 3. flop 4.\n") res = np.fromfile(path, dtype=float, sep=" ") assert_equal(res, np.array([1., 2., 3.])) @dec.knownfailureif(string_to_longdouble_inaccurate, "Need strtold_l") def test_fromfile(self): with temppath() as path: with open(path, 'wt') as f: f.write(self.out) res = np.fromfile(path, dtype=np.longdouble, sep="\n") assert_equal(res, self.tgt) @dec.knownfailureif(string_to_longdouble_inaccurate, "Need strtold_l") def test_genfromtxt(self): with temppath() as path: with open(path, 'wt') as f: f.write(self.out) res = np.genfromtxt(path, dtype=np.longdouble) assert_equal(res, self.tgt) @dec.knownfailureif(string_to_longdouble_inaccurate, "Need strtold_l") def test_loadtxt(self): with temppath() as path: with open(path, 'wt') as f: f.write(self.out) res = np.loadtxt(path, dtype=np.longdouble) assert_equal(res, self.tgt) @dec.knownfailureif(string_to_longdouble_inaccurate, "Need strtold_l") def test_tofile_roundtrip(self): with temppath() as path: self.tgt.tofile(path, sep=" ") res = np.fromfile(path, dtype=np.longdouble, sep=" ") assert_equal(res, self.tgt) @in_foreign_locale def test_fromstring_foreign(): s = "1.234" a = np.fromstring(s, dtype=np.longdouble, sep=" ") assert_equal(a[0], np.longdouble(s)) @in_foreign_locale def test_fromstring_foreign_sep(): a = np.array([1, 2, 3, 4]) b = np.fromstring("1,2,3,4,", dtype=np.longdouble, sep=",") assert_array_equal(a, b) @in_foreign_locale def test_fromstring_foreign_value(): b = np.fromstring("1,234", dtype=np.longdouble, sep=" ") assert_array_equal(b[0], 1) # Conversions long double -> string def test_repr_exact(): o = 1 + LD_INFO.eps assert_(repr(o) != '1') @dec.knownfailureif(longdouble_longer_than_double, "BUG #2376") @dec.knownfailureif(string_to_longdouble_inaccurate, "Need strtold_l") def test_format(): o = 1 + LD_INFO.eps assert_("{0:.40g}".format(o) != '1') @dec.knownfailureif(longdouble_longer_than_double, "BUG #2376") @dec.knownfailureif(string_to_longdouble_inaccurate, "Need strtold_l") def test_percent(): o = 1 + LD_INFO.eps assert_("%.40g" % o != '1') @dec.knownfailureif(longdouble_longer_than_double, "array repr problem") @dec.knownfailureif(string_to_longdouble_inaccurate, "Need strtold_l") def test_array_repr(): o = 1 + LD_INFO.eps a = np.array([o]) b = np.array([1], dtype=np.longdouble) if not np.all(a != b): raise ValueError("precision loss creating arrays") assert_(repr(a) != repr(b)) if __name__ == "__main__": run_module_suite()
5,960
26.985915
74
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_defchararray.py
from __future__ import division, absolute_import, print_function import sys import numpy as np from numpy.core.multiarray import _vec_string from numpy.testing import ( run_module_suite, assert_, assert_equal, assert_array_equal, assert_raises, suppress_warnings, ) kw_unicode_true = {'unicode': True} # make 2to3 work properly kw_unicode_false = {'unicode': False} class TestBasic(object): def test_from_object_array(self): A = np.array([['abc', 2], ['long ', '0123456789']], dtype='O') B = np.char.array(A) assert_equal(B.dtype.itemsize, 10) assert_array_equal(B, [[b'abc', b'2'], [b'long', b'0123456789']]) def test_from_object_array_unicode(self): A = np.array([['abc', u'Sigma \u03a3'], ['long ', '0123456789']], dtype='O') assert_raises(ValueError, np.char.array, (A,)) B = np.char.array(A, **kw_unicode_true) assert_equal(B.dtype.itemsize, 10 * np.array('a', 'U').dtype.itemsize) assert_array_equal(B, [['abc', u'Sigma \u03a3'], ['long', '0123456789']]) def test_from_string_array(self): A = np.array([[b'abc', b'foo'], [b'long ', b'0123456789']]) assert_equal(A.dtype.type, np.string_) B = np.char.array(A) assert_array_equal(B, A) assert_equal(B.dtype, A.dtype) assert_equal(B.shape, A.shape) B[0, 0] = 'changed' assert_(B[0, 0] != A[0, 0]) C = np.char.asarray(A) assert_array_equal(C, A) assert_equal(C.dtype, A.dtype) C[0, 0] = 'changed again' assert_(C[0, 0] != B[0, 0]) assert_(C[0, 0] == A[0, 0]) def test_from_unicode_array(self): A = np.array([['abc', u'Sigma \u03a3'], ['long ', '0123456789']]) assert_equal(A.dtype.type, np.unicode_) B = np.char.array(A) assert_array_equal(B, A) assert_equal(B.dtype, A.dtype) assert_equal(B.shape, A.shape) B = np.char.array(A, **kw_unicode_true) assert_array_equal(B, A) assert_equal(B.dtype, A.dtype) assert_equal(B.shape, A.shape) def fail(): np.char.array(A, **kw_unicode_false) assert_raises(UnicodeEncodeError, fail) def test_unicode_upconvert(self): A = np.char.array(['abc']) B = np.char.array([u'\u03a3']) assert_(issubclass((A + B).dtype.type, np.unicode_)) def test_from_string(self): A = np.char.array(b'abc') assert_equal(len(A), 1) assert_equal(len(A[0]), 3) assert_(issubclass(A.dtype.type, np.string_)) def test_from_unicode(self): A = np.char.array(u'\u03a3') assert_equal(len(A), 1) assert_equal(len(A[0]), 1) assert_equal(A.itemsize, 4) assert_(issubclass(A.dtype.type, np.unicode_)) class TestVecString(object): def test_non_existent_method(self): def fail(): _vec_string('a', np.string_, 'bogus') assert_raises(AttributeError, fail) def test_non_string_array(self): def fail(): _vec_string(1, np.string_, 'strip') assert_raises(TypeError, fail) def test_invalid_args_tuple(self): def fail(): _vec_string(['a'], np.string_, 'strip', 1) assert_raises(TypeError, fail) def test_invalid_type_descr(self): def fail(): _vec_string(['a'], 'BOGUS', 'strip') assert_raises(TypeError, fail) def test_invalid_function_args(self): def fail(): _vec_string(['a'], np.string_, 'strip', (1,)) assert_raises(TypeError, fail) def test_invalid_result_type(self): def fail(): _vec_string(['a'], np.integer, 'strip') assert_raises(TypeError, fail) def test_broadcast_error(self): def fail(): _vec_string([['abc', 'def']], np.integer, 'find', (['a', 'd', 'j'],)) assert_raises(ValueError, fail) class TestWhitespace(object): def setup(self): self.A = np.array([['abc ', '123 '], ['789 ', 'xyz ']]).view(np.chararray) self.B = np.array([['abc', '123'], ['789', 'xyz']]).view(np.chararray) def test1(self): assert_(np.all(self.A == self.B)) assert_(np.all(self.A >= self.B)) assert_(np.all(self.A <= self.B)) assert_(not np.any(self.A > self.B)) assert_(not np.any(self.A < self.B)) assert_(not np.any(self.A != self.B)) class TestChar(object): def setup(self): self.A = np.array('abc1', dtype='c').view(np.chararray) def test_it(self): assert_equal(self.A.shape, (4,)) assert_equal(self.A.upper()[:2].tobytes(), b'AB') class TestComparisons(object): def setup(self): self.A = np.array([['abc', '123'], ['789', 'xyz']]).view(np.chararray) self.B = np.array([['efg', '123 '], ['051', 'tuv']]).view(np.chararray) def test_not_equal(self): assert_array_equal((self.A != self.B), [[True, False], [True, True]]) def test_equal(self): assert_array_equal((self.A == self.B), [[False, True], [False, False]]) def test_greater_equal(self): assert_array_equal((self.A >= self.B), [[False, True], [True, True]]) def test_less_equal(self): assert_array_equal((self.A <= self.B), [[True, True], [False, False]]) def test_greater(self): assert_array_equal((self.A > self.B), [[False, False], [True, True]]) def test_less(self): assert_array_equal((self.A < self.B), [[True, False], [False, False]]) class TestComparisonsMixed1(TestComparisons): """Ticket #1276""" def setup(self): TestComparisons.setup(self) self.B = np.array([['efg', '123 '], ['051', 'tuv']], np.unicode_).view(np.chararray) class TestComparisonsMixed2(TestComparisons): """Ticket #1276""" def setup(self): TestComparisons.setup(self) self.A = np.array([['abc', '123'], ['789', 'xyz']], np.unicode_).view(np.chararray) class TestInformation(object): def setup(self): self.A = np.array([[' abc ', ''], ['12345', 'MixedCase'], ['123 \t 345 \0 ', 'UPPER']]).view(np.chararray) self.B = np.array([[u' \u03a3 ', u''], [u'12345', u'MixedCase'], [u'123 \t 345 \0 ', u'UPPER']]).view(np.chararray) def test_len(self): assert_(issubclass(np.char.str_len(self.A).dtype.type, np.integer)) assert_array_equal(np.char.str_len(self.A), [[5, 0], [5, 9], [12, 5]]) assert_array_equal(np.char.str_len(self.B), [[3, 0], [5, 9], [12, 5]]) def test_count(self): assert_(issubclass(self.A.count('').dtype.type, np.integer)) assert_array_equal(self.A.count('a'), [[1, 0], [0, 1], [0, 0]]) assert_array_equal(self.A.count('123'), [[0, 0], [1, 0], [1, 0]]) # Python doesn't seem to like counting NULL characters # assert_array_equal(self.A.count('\0'), [[0, 0], [0, 0], [1, 0]]) assert_array_equal(self.A.count('a', 0, 2), [[1, 0], [0, 0], [0, 0]]) assert_array_equal(self.B.count('a'), [[0, 0], [0, 1], [0, 0]]) assert_array_equal(self.B.count('123'), [[0, 0], [1, 0], [1, 0]]) # assert_array_equal(self.B.count('\0'), [[0, 0], [0, 0], [1, 0]]) def test_endswith(self): assert_(issubclass(self.A.endswith('').dtype.type, np.bool_)) assert_array_equal(self.A.endswith(' '), [[1, 0], [0, 0], [1, 0]]) assert_array_equal(self.A.endswith('3', 0, 3), [[0, 0], [1, 0], [1, 0]]) def fail(): self.A.endswith('3', 'fdjk') assert_raises(TypeError, fail) def test_find(self): assert_(issubclass(self.A.find('a').dtype.type, np.integer)) assert_array_equal(self.A.find('a'), [[1, -1], [-1, 6], [-1, -1]]) assert_array_equal(self.A.find('3'), [[-1, -1], [2, -1], [2, -1]]) assert_array_equal(self.A.find('a', 0, 2), [[1, -1], [-1, -1], [-1, -1]]) assert_array_equal(self.A.find(['1', 'P']), [[-1, -1], [0, -1], [0, 1]]) def test_index(self): def fail(): self.A.index('a') assert_raises(ValueError, fail) assert_(np.char.index('abcba', 'b') == 1) assert_(issubclass(np.char.index('abcba', 'b').dtype.type, np.integer)) def test_isalnum(self): assert_(issubclass(self.A.isalnum().dtype.type, np.bool_)) assert_array_equal(self.A.isalnum(), [[False, False], [True, True], [False, True]]) def test_isalpha(self): assert_(issubclass(self.A.isalpha().dtype.type, np.bool_)) assert_array_equal(self.A.isalpha(), [[False, False], [False, True], [False, True]]) def test_isdigit(self): assert_(issubclass(self.A.isdigit().dtype.type, np.bool_)) assert_array_equal(self.A.isdigit(), [[False, False], [True, False], [False, False]]) def test_islower(self): assert_(issubclass(self.A.islower().dtype.type, np.bool_)) assert_array_equal(self.A.islower(), [[True, False], [False, False], [False, False]]) def test_isspace(self): assert_(issubclass(self.A.isspace().dtype.type, np.bool_)) assert_array_equal(self.A.isspace(), [[False, False], [False, False], [False, False]]) def test_istitle(self): assert_(issubclass(self.A.istitle().dtype.type, np.bool_)) assert_array_equal(self.A.istitle(), [[False, False], [False, False], [False, False]]) def test_isupper(self): assert_(issubclass(self.A.isupper().dtype.type, np.bool_)) assert_array_equal(self.A.isupper(), [[False, False], [False, False], [False, True]]) def test_rfind(self): assert_(issubclass(self.A.rfind('a').dtype.type, np.integer)) assert_array_equal(self.A.rfind('a'), [[1, -1], [-1, 6], [-1, -1]]) assert_array_equal(self.A.rfind('3'), [[-1, -1], [2, -1], [6, -1]]) assert_array_equal(self.A.rfind('a', 0, 2), [[1, -1], [-1, -1], [-1, -1]]) assert_array_equal(self.A.rfind(['1', 'P']), [[-1, -1], [0, -1], [0, 2]]) def test_rindex(self): def fail(): self.A.rindex('a') assert_raises(ValueError, fail) assert_(np.char.rindex('abcba', 'b') == 3) assert_(issubclass(np.char.rindex('abcba', 'b').dtype.type, np.integer)) def test_startswith(self): assert_(issubclass(self.A.startswith('').dtype.type, np.bool_)) assert_array_equal(self.A.startswith(' '), [[1, 0], [0, 0], [0, 0]]) assert_array_equal(self.A.startswith('1', 0, 3), [[0, 0], [1, 0], [1, 0]]) def fail(): self.A.startswith('3', 'fdjk') assert_raises(TypeError, fail) class TestMethods(object): def setup(self): self.A = np.array([[' abc ', ''], ['12345', 'MixedCase'], ['123 \t 345 \0 ', 'UPPER']], dtype='S').view(np.chararray) self.B = np.array([[u' \u03a3 ', u''], [u'12345', u'MixedCase'], [u'123 \t 345 \0 ', u'UPPER']]).view(np.chararray) def test_capitalize(self): tgt = [[b' abc ', b''], [b'12345', b'Mixedcase'], [b'123 \t 345 \0 ', b'Upper']] assert_(issubclass(self.A.capitalize().dtype.type, np.string_)) assert_array_equal(self.A.capitalize(), tgt) tgt = [[u' \u03c3 ', ''], ['12345', 'Mixedcase'], ['123 \t 345 \0 ', 'Upper']] assert_(issubclass(self.B.capitalize().dtype.type, np.unicode_)) assert_array_equal(self.B.capitalize(), tgt) def test_center(self): assert_(issubclass(self.A.center(10).dtype.type, np.string_)) C = self.A.center([10, 20]) assert_array_equal(np.char.str_len(C), [[10, 20], [10, 20], [12, 20]]) C = self.A.center(20, b'#') assert_(np.all(C.startswith(b'#'))) assert_(np.all(C.endswith(b'#'))) C = np.char.center(b'FOO', [[10, 20], [15, 8]]) tgt = [[b' FOO ', b' FOO '], [b' FOO ', b' FOO ']] assert_(issubclass(C.dtype.type, np.string_)) assert_array_equal(C, tgt) def test_decode(self): if sys.version_info[0] >= 3: A = np.char.array([b'\\u03a3']) assert_(A.decode('unicode-escape')[0] == '\u03a3') else: with suppress_warnings() as sup: if sys.py3kwarning: sup.filter(DeprecationWarning, "'hex_codec'") A = np.char.array(['736563726574206d657373616765']) assert_(A.decode('hex_codec')[0] == 'secret message') def test_encode(self): B = self.B.encode('unicode_escape') assert_(B[0][0] == str(' \\u03a3 ').encode('latin1')) def test_expandtabs(self): T = self.A.expandtabs() assert_(T[2, 0] == b'123 345 \0') def test_join(self): if sys.version_info[0] >= 3: # NOTE: list(b'123') == [49, 50, 51] # so that b','.join(b'123') results to an error on Py3 A0 = self.A.decode('ascii') else: A0 = self.A A = np.char.join([',', '#'], A0) if sys.version_info[0] >= 3: assert_(issubclass(A.dtype.type, np.unicode_)) else: assert_(issubclass(A.dtype.type, np.string_)) tgt = np.array([[' ,a,b,c, ', ''], ['1,2,3,4,5', 'M#i#x#e#d#C#a#s#e'], ['1,2,3, ,\t, ,3,4,5, ,\x00, ', 'U#P#P#E#R']]) assert_array_equal(np.char.join([',', '#'], A0), tgt) def test_ljust(self): assert_(issubclass(self.A.ljust(10).dtype.type, np.string_)) C = self.A.ljust([10, 20]) assert_array_equal(np.char.str_len(C), [[10, 20], [10, 20], [12, 20]]) C = self.A.ljust(20, b'#') assert_array_equal(C.startswith(b'#'), [ [False, True], [False, False], [False, False]]) assert_(np.all(C.endswith(b'#'))) C = np.char.ljust(b'FOO', [[10, 20], [15, 8]]) tgt = [[b'FOO ', b'FOO '], [b'FOO ', b'FOO ']] assert_(issubclass(C.dtype.type, np.string_)) assert_array_equal(C, tgt) def test_lower(self): tgt = [[b' abc ', b''], [b'12345', b'mixedcase'], [b'123 \t 345 \0 ', b'upper']] assert_(issubclass(self.A.lower().dtype.type, np.string_)) assert_array_equal(self.A.lower(), tgt) tgt = [[u' \u03c3 ', u''], [u'12345', u'mixedcase'], [u'123 \t 345 \0 ', u'upper']] assert_(issubclass(self.B.lower().dtype.type, np.unicode_)) assert_array_equal(self.B.lower(), tgt) def test_lstrip(self): tgt = [[b'abc ', b''], [b'12345', b'MixedCase'], [b'123 \t 345 \0 ', b'UPPER']] assert_(issubclass(self.A.lstrip().dtype.type, np.string_)) assert_array_equal(self.A.lstrip(), tgt) tgt = [[b' abc', b''], [b'2345', b'ixedCase'], [b'23 \t 345 \x00', b'UPPER']] assert_array_equal(self.A.lstrip([b'1', b'M']), tgt) tgt = [[u'\u03a3 ', ''], ['12345', 'MixedCase'], ['123 \t 345 \0 ', 'UPPER']] assert_(issubclass(self.B.lstrip().dtype.type, np.unicode_)) assert_array_equal(self.B.lstrip(), tgt) def test_partition(self): P = self.A.partition([b'3', b'M']) tgt = [[(b' abc ', b'', b''), (b'', b'', b'')], [(b'12', b'3', b'45'), (b'', b'M', b'ixedCase')], [(b'12', b'3', b' \t 345 \0 '), (b'UPPER', b'', b'')]] assert_(issubclass(P.dtype.type, np.string_)) assert_array_equal(P, tgt) def test_replace(self): R = self.A.replace([b'3', b'a'], [b'##########', b'@']) tgt = [[b' abc ', b''], [b'12##########45', b'MixedC@se'], [b'12########## \t ##########45 \x00', b'UPPER']] assert_(issubclass(R.dtype.type, np.string_)) assert_array_equal(R, tgt) if sys.version_info[0] < 3: # NOTE: b'abc'.replace(b'a', 'b') is not allowed on Py3 R = self.A.replace(b'a', u'\u03a3') tgt = [[u' \u03a3bc ', ''], ['12345', u'MixedC\u03a3se'], ['123 \t 345 \x00', 'UPPER']] assert_(issubclass(R.dtype.type, np.unicode_)) assert_array_equal(R, tgt) def test_rjust(self): assert_(issubclass(self.A.rjust(10).dtype.type, np.string_)) C = self.A.rjust([10, 20]) assert_array_equal(np.char.str_len(C), [[10, 20], [10, 20], [12, 20]]) C = self.A.rjust(20, b'#') assert_(np.all(C.startswith(b'#'))) assert_array_equal(C.endswith(b'#'), [[False, True], [False, False], [False, False]]) C = np.char.rjust(b'FOO', [[10, 20], [15, 8]]) tgt = [[b' FOO', b' FOO'], [b' FOO', b' FOO']] assert_(issubclass(C.dtype.type, np.string_)) assert_array_equal(C, tgt) def test_rpartition(self): P = self.A.rpartition([b'3', b'M']) tgt = [[(b'', b'', b' abc '), (b'', b'', b'')], [(b'12', b'3', b'45'), (b'', b'M', b'ixedCase')], [(b'123 \t ', b'3', b'45 \0 '), (b'', b'', b'UPPER')]] assert_(issubclass(P.dtype.type, np.string_)) assert_array_equal(P, tgt) def test_rsplit(self): A = self.A.rsplit(b'3') tgt = [[[b' abc '], [b'']], [[b'12', b'45'], [b'MixedCase']], [[b'12', b' \t ', b'45 \x00 '], [b'UPPER']]] assert_(issubclass(A.dtype.type, np.object_)) assert_equal(A.tolist(), tgt) def test_rstrip(self): assert_(issubclass(self.A.rstrip().dtype.type, np.string_)) tgt = [[b' abc', b''], [b'12345', b'MixedCase'], [b'123 \t 345', b'UPPER']] assert_array_equal(self.A.rstrip(), tgt) tgt = [[b' abc ', b''], [b'1234', b'MixedCase'], [b'123 \t 345 \x00', b'UPP'] ] assert_array_equal(self.A.rstrip([b'5', b'ER']), tgt) tgt = [[u' \u03a3', ''], ['12345', 'MixedCase'], ['123 \t 345', 'UPPER']] assert_(issubclass(self.B.rstrip().dtype.type, np.unicode_)) assert_array_equal(self.B.rstrip(), tgt) def test_strip(self): tgt = [[b'abc', b''], [b'12345', b'MixedCase'], [b'123 \t 345', b'UPPER']] assert_(issubclass(self.A.strip().dtype.type, np.string_)) assert_array_equal(self.A.strip(), tgt) tgt = [[b' abc ', b''], [b'234', b'ixedCas'], [b'23 \t 345 \x00', b'UPP']] assert_array_equal(self.A.strip([b'15', b'EReM']), tgt) tgt = [[u'\u03a3', ''], ['12345', 'MixedCase'], ['123 \t 345', 'UPPER']] assert_(issubclass(self.B.strip().dtype.type, np.unicode_)) assert_array_equal(self.B.strip(), tgt) def test_split(self): A = self.A.split(b'3') tgt = [ [[b' abc '], [b'']], [[b'12', b'45'], [b'MixedCase']], [[b'12', b' \t ', b'45 \x00 '], [b'UPPER']]] assert_(issubclass(A.dtype.type, np.object_)) assert_equal(A.tolist(), tgt) def test_splitlines(self): A = np.char.array(['abc\nfds\nwer']).splitlines() assert_(issubclass(A.dtype.type, np.object_)) assert_(A.shape == (1,)) assert_(len(A[0]) == 3) def test_swapcase(self): tgt = [[b' ABC ', b''], [b'12345', b'mIXEDcASE'], [b'123 \t 345 \0 ', b'upper']] assert_(issubclass(self.A.swapcase().dtype.type, np.string_)) assert_array_equal(self.A.swapcase(), tgt) tgt = [[u' \u03c3 ', u''], [u'12345', u'mIXEDcASE'], [u'123 \t 345 \0 ', u'upper']] assert_(issubclass(self.B.swapcase().dtype.type, np.unicode_)) assert_array_equal(self.B.swapcase(), tgt) def test_title(self): tgt = [[b' Abc ', b''], [b'12345', b'Mixedcase'], [b'123 \t 345 \0 ', b'Upper']] assert_(issubclass(self.A.title().dtype.type, np.string_)) assert_array_equal(self.A.title(), tgt) tgt = [[u' \u03a3 ', u''], [u'12345', u'Mixedcase'], [u'123 \t 345 \0 ', u'Upper']] assert_(issubclass(self.B.title().dtype.type, np.unicode_)) assert_array_equal(self.B.title(), tgt) def test_upper(self): tgt = [[b' ABC ', b''], [b'12345', b'MIXEDCASE'], [b'123 \t 345 \0 ', b'UPPER']] assert_(issubclass(self.A.upper().dtype.type, np.string_)) assert_array_equal(self.A.upper(), tgt) tgt = [[u' \u03a3 ', u''], [u'12345', u'MIXEDCASE'], [u'123 \t 345 \0 ', u'UPPER']] assert_(issubclass(self.B.upper().dtype.type, np.unicode_)) assert_array_equal(self.B.upper(), tgt) def test_isnumeric(self): def fail(): self.A.isnumeric() assert_raises(TypeError, fail) assert_(issubclass(self.B.isnumeric().dtype.type, np.bool_)) assert_array_equal(self.B.isnumeric(), [ [False, False], [True, False], [False, False]]) def test_isdecimal(self): def fail(): self.A.isdecimal() assert_raises(TypeError, fail) assert_(issubclass(self.B.isdecimal().dtype.type, np.bool_)) assert_array_equal(self.B.isdecimal(), [ [False, False], [True, False], [False, False]]) class TestOperations(object): def setup(self): self.A = np.array([['abc', '123'], ['789', 'xyz']]).view(np.chararray) self.B = np.array([['efg', '456'], ['051', 'tuv']]).view(np.chararray) def test_add(self): AB = np.array([['abcefg', '123456'], ['789051', 'xyztuv']]).view(np.chararray) assert_array_equal(AB, (self.A + self.B)) assert_(len((self.A + self.B)[0][0]) == 6) def test_radd(self): QA = np.array([['qabc', 'q123'], ['q789', 'qxyz']]).view(np.chararray) assert_array_equal(QA, ('q' + self.A)) def test_mul(self): A = self.A for r in (2, 3, 5, 7, 197): Ar = np.array([[A[0, 0]*r, A[0, 1]*r], [A[1, 0]*r, A[1, 1]*r]]).view(np.chararray) assert_array_equal(Ar, (self.A * r)) for ob in [object(), 'qrs']: try: A * ob except ValueError: pass else: self.fail("chararray can only be multiplied by integers") def test_rmul(self): A = self.A for r in (2, 3, 5, 7, 197): Ar = np.array([[A[0, 0]*r, A[0, 1]*r], [A[1, 0]*r, A[1, 1]*r]]).view(np.chararray) assert_array_equal(Ar, (r * self.A)) for ob in [object(), 'qrs']: try: ob * A except ValueError: pass else: self.fail("chararray can only be multiplied by integers") def test_mod(self): """Ticket #856""" F = np.array([['%d', '%f'], ['%s', '%r']]).view(np.chararray) C = np.array([[3, 7], [19, 1]]) FC = np.array([['3', '7.000000'], ['19', '1']]).view(np.chararray) assert_array_equal(FC, F % C) A = np.array([['%.3f', '%d'], ['%s', '%r']]).view(np.chararray) A1 = np.array([['1.000', '1'], ['1', '1']]).view(np.chararray) assert_array_equal(A1, (A % 1)) A2 = np.array([['1.000', '2'], ['3', '4']]).view(np.chararray) assert_array_equal(A2, (A % [[1, 2], [3, 4]])) def test_rmod(self): assert_(("%s" % self.A) == str(self.A)) assert_(("%r" % self.A) == repr(self.A)) for ob in [42, object()]: try: ob % self.A except TypeError: pass else: self.fail("chararray __rmod__ should fail with " "non-string objects") def test_slice(self): """Regression test for https://github.com/numpy/numpy/issues/5982""" arr = np.array([['abc ', 'def '], ['geh ', 'ijk ']], dtype='S4').view(np.chararray) sl1 = arr[:] assert_array_equal(sl1, arr) assert_(sl1.base is arr) assert_(sl1.base.base is arr.base) sl2 = arr[:, :] assert_array_equal(sl2, arr) assert_(sl2.base is arr) assert_(sl2.base.base is arr.base) assert_(arr[0, 0] == b'abc') def test_empty_indexing(): """Regression test for ticket 1948.""" # Check that indexing a chararray with an empty list/array returns an # empty chararray instead of a chararray with a single empty string in it. s = np.chararray((4,)) assert_(s[[]].size == 0) if __name__ == "__main__": run_module_suite()
25,693
35.342291
94
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_shape_base.py
from __future__ import division, absolute_import, print_function import warnings import numpy as np from numpy.core import (array, arange, atleast_1d, atleast_2d, atleast_3d, block, vstack, hstack, newaxis, concatenate, stack) from numpy.testing import (assert_, assert_raises, assert_array_equal, assert_equal, run_module_suite, assert_raises_regex, assert_almost_equal) from numpy.compat import long class TestAtleast1d(object): def test_0D_array(self): a = array(1) b = array(2) res = [atleast_1d(a), atleast_1d(b)] desired = [array([1]), array([2])] assert_array_equal(res, desired) def test_1D_array(self): a = array([1, 2]) b = array([2, 3]) res = [atleast_1d(a), atleast_1d(b)] desired = [array([1, 2]), array([2, 3])] assert_array_equal(res, desired) def test_2D_array(self): a = array([[1, 2], [1, 2]]) b = array([[2, 3], [2, 3]]) res = [atleast_1d(a), atleast_1d(b)] desired = [a, b] assert_array_equal(res, desired) def test_3D_array(self): a = array([[1, 2], [1, 2]]) b = array([[2, 3], [2, 3]]) a = array([a, a]) b = array([b, b]) res = [atleast_1d(a), atleast_1d(b)] desired = [a, b] assert_array_equal(res, desired) def test_r1array(self): """ Test to make sure equivalent Travis O's r1array function """ assert_(atleast_1d(3).shape == (1,)) assert_(atleast_1d(3j).shape == (1,)) assert_(atleast_1d(long(3)).shape == (1,)) assert_(atleast_1d(3.0).shape == (1,)) assert_(atleast_1d([[2, 3], [4, 5]]).shape == (2, 2)) class TestAtleast2d(object): def test_0D_array(self): a = array(1) b = array(2) res = [atleast_2d(a), atleast_2d(b)] desired = [array([[1]]), array([[2]])] assert_array_equal(res, desired) def test_1D_array(self): a = array([1, 2]) b = array([2, 3]) res = [atleast_2d(a), atleast_2d(b)] desired = [array([[1, 2]]), array([[2, 3]])] assert_array_equal(res, desired) def test_2D_array(self): a = array([[1, 2], [1, 2]]) b = array([[2, 3], [2, 3]]) res = [atleast_2d(a), atleast_2d(b)] desired = [a, b] assert_array_equal(res, desired) def test_3D_array(self): a = array([[1, 2], [1, 2]]) b = array([[2, 3], [2, 3]]) a = array([a, a]) b = array([b, b]) res = [atleast_2d(a), atleast_2d(b)] desired = [a, b] assert_array_equal(res, desired) def test_r2array(self): """ Test to make sure equivalent Travis O's r2array function """ assert_(atleast_2d(3).shape == (1, 1)) assert_(atleast_2d([3j, 1]).shape == (1, 2)) assert_(atleast_2d([[[3, 1], [4, 5]], [[3, 5], [1, 2]]]).shape == (2, 2, 2)) class TestAtleast3d(object): def test_0D_array(self): a = array(1) b = array(2) res = [atleast_3d(a), atleast_3d(b)] desired = [array([[[1]]]), array([[[2]]])] assert_array_equal(res, desired) def test_1D_array(self): a = array([1, 2]) b = array([2, 3]) res = [atleast_3d(a), atleast_3d(b)] desired = [array([[[1], [2]]]), array([[[2], [3]]])] assert_array_equal(res, desired) def test_2D_array(self): a = array([[1, 2], [1, 2]]) b = array([[2, 3], [2, 3]]) res = [atleast_3d(a), atleast_3d(b)] desired = [a[:,:, newaxis], b[:,:, newaxis]] assert_array_equal(res, desired) def test_3D_array(self): a = array([[1, 2], [1, 2]]) b = array([[2, 3], [2, 3]]) a = array([a, a]) b = array([b, b]) res = [atleast_3d(a), atleast_3d(b)] desired = [a, b] assert_array_equal(res, desired) class TestHstack(object): def test_non_iterable(self): assert_raises(TypeError, hstack, 1) def test_empty_input(self): assert_raises(ValueError, hstack, ()) def test_0D_array(self): a = array(1) b = array(2) res = hstack([a, b]) desired = array([1, 2]) assert_array_equal(res, desired) def test_1D_array(self): a = array([1]) b = array([2]) res = hstack([a, b]) desired = array([1, 2]) assert_array_equal(res, desired) def test_2D_array(self): a = array([[1], [2]]) b = array([[1], [2]]) res = hstack([a, b]) desired = array([[1, 1], [2, 2]]) assert_array_equal(res, desired) class TestVstack(object): def test_non_iterable(self): assert_raises(TypeError, vstack, 1) def test_empty_input(self): assert_raises(ValueError, vstack, ()) def test_0D_array(self): a = array(1) b = array(2) res = vstack([a, b]) desired = array([[1], [2]]) assert_array_equal(res, desired) def test_1D_array(self): a = array([1]) b = array([2]) res = vstack([a, b]) desired = array([[1], [2]]) assert_array_equal(res, desired) def test_2D_array(self): a = array([[1], [2]]) b = array([[1], [2]]) res = vstack([a, b]) desired = array([[1], [2], [1], [2]]) assert_array_equal(res, desired) def test_2D_array2(self): a = array([1, 2]) b = array([1, 2]) res = vstack([a, b]) desired = array([[1, 2], [1, 2]]) assert_array_equal(res, desired) class TestConcatenate(object): def test_exceptions(self): # test axis must be in bounds for ndim in [1, 2, 3]: a = np.ones((1,)*ndim) np.concatenate((a, a), axis=0) # OK assert_raises(np.AxisError, np.concatenate, (a, a), axis=ndim) assert_raises(np.AxisError, np.concatenate, (a, a), axis=-(ndim + 1)) # Scalars cannot be concatenated assert_raises(ValueError, concatenate, (0,)) assert_raises(ValueError, concatenate, (np.array(0),)) # test shapes must match except for concatenation axis a = np.ones((1, 2, 3)) b = np.ones((2, 2, 3)) axis = list(range(3)) for i in range(3): np.concatenate((a, b), axis=axis[0]) # OK assert_raises(ValueError, np.concatenate, (a, b), axis=axis[1]) assert_raises(ValueError, np.concatenate, (a, b), axis=axis[2]) a = np.moveaxis(a, -1, 0) b = np.moveaxis(b, -1, 0) axis.append(axis.pop(0)) # No arrays to concatenate raises ValueError assert_raises(ValueError, concatenate, ()) def test_concatenate_axis_None(self): a = np.arange(4, dtype=np.float64).reshape((2, 2)) b = list(range(3)) c = ['x'] r = np.concatenate((a, a), axis=None) assert_equal(r.dtype, a.dtype) assert_equal(r.ndim, 1) r = np.concatenate((a, b), axis=None) assert_equal(r.size, a.size + len(b)) assert_equal(r.dtype, a.dtype) r = np.concatenate((a, b, c), axis=None) d = array(['0.0', '1.0', '2.0', '3.0', '0', '1', '2', 'x']) assert_array_equal(r, d) out = np.zeros(a.size + len(b)) r = np.concatenate((a, b), axis=None) rout = np.concatenate((a, b), axis=None, out=out) assert_(out is rout) assert_equal(r, rout) def test_large_concatenate_axis_None(self): # When no axis is given, concatenate uses flattened versions. # This also had a bug with many arrays (see gh-5979). x = np.arange(1, 100) r = np.concatenate(x, None) assert_array_equal(x, r) # This should probably be deprecated: r = np.concatenate(x, 100) # axis is >= MAXDIMS assert_array_equal(x, r) def test_concatenate(self): # Test concatenate function # One sequence returns unmodified (but as array) r4 = list(range(4)) assert_array_equal(concatenate((r4,)), r4) # Any sequence assert_array_equal(concatenate((tuple(r4),)), r4) assert_array_equal(concatenate((array(r4),)), r4) # 1D default concatenation r3 = list(range(3)) assert_array_equal(concatenate((r4, r3)), r4 + r3) # Mixed sequence types assert_array_equal(concatenate((tuple(r4), r3)), r4 + r3) assert_array_equal(concatenate((array(r4), r3)), r4 + r3) # Explicit axis specification assert_array_equal(concatenate((r4, r3), 0), r4 + r3) # Including negative assert_array_equal(concatenate((r4, r3), -1), r4 + r3) # 2D a23 = array([[10, 11, 12], [13, 14, 15]]) a13 = array([[0, 1, 2]]) res = array([[10, 11, 12], [13, 14, 15], [0, 1, 2]]) assert_array_equal(concatenate((a23, a13)), res) assert_array_equal(concatenate((a23, a13), 0), res) assert_array_equal(concatenate((a23.T, a13.T), 1), res.T) assert_array_equal(concatenate((a23.T, a13.T), -1), res.T) # Arrays much match shape assert_raises(ValueError, concatenate, (a23.T, a13.T), 0) # 3D res = arange(2 * 3 * 7).reshape((2, 3, 7)) a0 = res[..., :4] a1 = res[..., 4:6] a2 = res[..., 6:] assert_array_equal(concatenate((a0, a1, a2), 2), res) assert_array_equal(concatenate((a0, a1, a2), -1), res) assert_array_equal(concatenate((a0.T, a1.T, a2.T), 0), res.T) out = res.copy() rout = concatenate((a0, a1, a2), 2, out=out) assert_(out is rout) assert_equal(res, rout) def test_bad_out_shape(self): a = array([1, 2]) b = array([3, 4]) assert_raises(ValueError, concatenate, (a, b), out=np.empty(5)) assert_raises(ValueError, concatenate, (a, b), out=np.empty((4,1))) assert_raises(ValueError, concatenate, (a, b), out=np.empty((1,4))) concatenate((a, b), out=np.empty(4)) def test_out_dtype(self): out = np.empty(4, np.float32) res = concatenate((array([1, 2]), array([3, 4])), out=out) assert_(out is res) out = np.empty(4, np.complex64) res = concatenate((array([0.1, 0.2]), array([0.3, 0.4])), out=out) assert_(out is res) # invalid cast out = np.empty(4, np.int32) assert_raises(TypeError, concatenate, (array([0.1, 0.2]), array([0.3, 0.4])), out=out) def test_stack(): # non-iterable input assert_raises(TypeError, stack, 1) # 0d input for input_ in [(1, 2, 3), [np.int32(1), np.int32(2), np.int32(3)], [np.array(1), np.array(2), np.array(3)]]: assert_array_equal(stack(input_), [1, 2, 3]) # 1d input examples a = np.array([1, 2, 3]) b = np.array([4, 5, 6]) r1 = array([[1, 2, 3], [4, 5, 6]]) assert_array_equal(np.stack((a, b)), r1) assert_array_equal(np.stack((a, b), axis=1), r1.T) # all input types assert_array_equal(np.stack(list([a, b])), r1) assert_array_equal(np.stack(array([a, b])), r1) # all shapes for 1d input arrays = [np.random.randn(3) for _ in range(10)] axes = [0, 1, -1, -2] expected_shapes = [(10, 3), (3, 10), (3, 10), (10, 3)] for axis, expected_shape in zip(axes, expected_shapes): assert_equal(np.stack(arrays, axis).shape, expected_shape) assert_raises_regex(np.AxisError, 'out of bounds', stack, arrays, axis=2) assert_raises_regex(np.AxisError, 'out of bounds', stack, arrays, axis=-3) # all shapes for 2d input arrays = [np.random.randn(3, 4) for _ in range(10)] axes = [0, 1, 2, -1, -2, -3] expected_shapes = [(10, 3, 4), (3, 10, 4), (3, 4, 10), (3, 4, 10), (3, 10, 4), (10, 3, 4)] for axis, expected_shape in zip(axes, expected_shapes): assert_equal(np.stack(arrays, axis).shape, expected_shape) # empty arrays assert_(stack([[], [], []]).shape == (3, 0)) assert_(stack([[], [], []], axis=1).shape == (0, 3)) # edge cases assert_raises_regex(ValueError, 'need at least one array', stack, []) assert_raises_regex(ValueError, 'must have the same shape', stack, [1, np.arange(3)]) assert_raises_regex(ValueError, 'must have the same shape', stack, [np.arange(3), 1]) assert_raises_regex(ValueError, 'must have the same shape', stack, [np.arange(3), 1], axis=1) assert_raises_regex(ValueError, 'must have the same shape', stack, [np.zeros((3, 3)), np.zeros(3)], axis=1) assert_raises_regex(ValueError, 'must have the same shape', stack, [np.arange(2), np.arange(3)]) # np.matrix m = np.matrix([[1, 2], [3, 4]]) assert_raises_regex(ValueError, 'shape too large to be a matrix', stack, [m, m]) class TestBlock(object): def test_block_simple_row_wise(self): a_2d = np.ones((2, 2)) b_2d = 2 * a_2d desired = np.array([[1, 1, 2, 2], [1, 1, 2, 2]]) result = block([a_2d, b_2d]) assert_equal(desired, result) def test_block_simple_column_wise(self): a_2d = np.ones((2, 2)) b_2d = 2 * a_2d expected = np.array([[1, 1], [1, 1], [2, 2], [2, 2]]) result = block([[a_2d], [b_2d]]) assert_equal(expected, result) def test_block_with_1d_arrays_row_wise(self): # # # 1-D vectors are treated as row arrays a = np.array([1, 2, 3]) b = np.array([2, 3, 4]) expected = np.array([1, 2, 3, 2, 3, 4]) result = block([a, b]) assert_equal(expected, result) def test_block_with_1d_arrays_multiple_rows(self): a = np.array([1, 2, 3]) b = np.array([2, 3, 4]) expected = np.array([[1, 2, 3, 2, 3, 4], [1, 2, 3, 2, 3, 4]]) result = block([[a, b], [a, b]]) assert_equal(expected, result) def test_block_with_1d_arrays_column_wise(self): # # # 1-D vectors are treated as row arrays a_1d = np.array([1, 2, 3]) b_1d = np.array([2, 3, 4]) expected = np.array([[1, 2, 3], [2, 3, 4]]) result = block([[a_1d], [b_1d]]) assert_equal(expected, result) def test_block_mixed_1d_and_2d(self): a_2d = np.ones((2, 2)) b_1d = np.array([2, 2]) result = block([[a_2d], [b_1d]]) expected = np.array([[1, 1], [1, 1], [2, 2]]) assert_equal(expected, result) def test_block_complicated(self): # a bit more complicated one_2d = np.array([[1, 1, 1]]) two_2d = np.array([[2, 2, 2]]) three_2d = np.array([[3, 3, 3, 3, 3, 3]]) four_1d = np.array([4, 4, 4, 4, 4, 4]) five_0d = np.array(5) six_1d = np.array([6, 6, 6, 6, 6]) zero_2d = np.zeros((2, 6)) expected = np.array([[1, 1, 1, 2, 2, 2], [3, 3, 3, 3, 3, 3], [4, 4, 4, 4, 4, 4], [5, 6, 6, 6, 6, 6], [0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0]]) result = block([[one_2d, two_2d], [three_2d], [four_1d], [five_0d, six_1d], [zero_2d]]) assert_equal(result, expected) def test_nested(self): one = np.array([1, 1, 1]) two = np.array([[2, 2, 2], [2, 2, 2], [2, 2, 2]]) three = np.array([3, 3, 3]) four = np.array([4, 4, 4]) five = np.array(5) six = np.array([6, 6, 6, 6, 6]) zero = np.zeros((2, 6)) result = np.block([ [ np.block([ [one], [three], [four] ]), two ], [five, six], [zero] ]) expected = np.array([[1, 1, 1, 2, 2, 2], [3, 3, 3, 2, 2, 2], [4, 4, 4, 2, 2, 2], [5, 6, 6, 6, 6, 6], [0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0]]) assert_equal(result, expected) def test_3d(self): a000 = np.ones((2, 2, 2), int) * 1 a100 = np.ones((3, 2, 2), int) * 2 a010 = np.ones((2, 3, 2), int) * 3 a001 = np.ones((2, 2, 3), int) * 4 a011 = np.ones((2, 3, 3), int) * 5 a101 = np.ones((3, 2, 3), int) * 6 a110 = np.ones((3, 3, 2), int) * 7 a111 = np.ones((3, 3, 3), int) * 8 result = np.block([ [ [a000, a001], [a010, a011], ], [ [a100, a101], [a110, a111], ] ]) expected = array([[[1, 1, 4, 4, 4], [1, 1, 4, 4, 4], [3, 3, 5, 5, 5], [3, 3, 5, 5, 5], [3, 3, 5, 5, 5]], [[1, 1, 4, 4, 4], [1, 1, 4, 4, 4], [3, 3, 5, 5, 5], [3, 3, 5, 5, 5], [3, 3, 5, 5, 5]], [[2, 2, 6, 6, 6], [2, 2, 6, 6, 6], [7, 7, 8, 8, 8], [7, 7, 8, 8, 8], [7, 7, 8, 8, 8]], [[2, 2, 6, 6, 6], [2, 2, 6, 6, 6], [7, 7, 8, 8, 8], [7, 7, 8, 8, 8], [7, 7, 8, 8, 8]], [[2, 2, 6, 6, 6], [2, 2, 6, 6, 6], [7, 7, 8, 8, 8], [7, 7, 8, 8, 8], [7, 7, 8, 8, 8]]]) assert_array_equal(result, expected) def test_block_with_mismatched_shape(self): a = np.array([0, 0]) b = np.eye(2) assert_raises(ValueError, np.block, [a, b]) assert_raises(ValueError, np.block, [b, a]) def test_no_lists(self): assert_equal(np.block(1), np.array(1)) assert_equal(np.block(np.eye(3)), np.eye(3)) def test_invalid_nesting(self): msg = 'depths are mismatched' assert_raises_regex(ValueError, msg, np.block, [1, [2]]) assert_raises_regex(ValueError, msg, np.block, [1, []]) assert_raises_regex(ValueError, msg, np.block, [[1], 2]) assert_raises_regex(ValueError, msg, np.block, [[], 2]) assert_raises_regex(ValueError, msg, np.block, [ [[1], [2]], [[3, 4]], [5] # missing brackets ]) def test_empty_lists(self): assert_raises_regex(ValueError, 'empty', np.block, []) assert_raises_regex(ValueError, 'empty', np.block, [[]]) assert_raises_regex(ValueError, 'empty', np.block, [[1], []]) def test_tuple(self): assert_raises_regex(TypeError, 'tuple', np.block, ([1, 2], [3, 4])) assert_raises_regex(TypeError, 'tuple', np.block, [(1, 2), (3, 4)]) def test_different_ndims(self): a = 1. b = 2 * np.ones((1, 2)) c = 3 * np.ones((1, 1, 3)) result = np.block([a, b, c]) expected = np.array([[[1., 2., 2., 3., 3., 3.]]]) assert_equal(result, expected) def test_different_ndims_depths(self): a = 1. b = 2 * np.ones((1, 2)) c = 3 * np.ones((1, 2, 3)) result = np.block([[a, b], [c]]) expected = np.array([[[1., 2., 2.], [3., 3., 3.], [3., 3., 3.]]]) assert_equal(result, expected) if __name__ == "__main__": run_module_suite()
20,299
33.52381
84
py
cba-pipeline-public
cba-pipeline-public-master/containernet/ndn-containers/ndn_headless-player/bandits/venv/lib/python3.6/site-packages/numpy/core/tests/test_extint128.py
from __future__ import division, absolute_import, print_function import sys import itertools import contextlib import operator import numpy as np import numpy.core.multiarray_tests as mt from numpy.compat import long from numpy.testing import assert_raises, assert_equal, dec INT64_MAX = np.iinfo(np.int64).max INT64_MIN = np.iinfo(np.int64).min INT64_MID = 2**32 # int128 is not two's complement, the sign bit is separate INT128_MAX = 2**128 - 1 INT128_MIN = -INT128_MAX INT128_MID = 2**64 INT64_VALUES = ( [INT64_MIN + j for j in range(20)] + [INT64_MAX - j for j in range(20)] + [INT64_MID + j for j in range(-20, 20)] + [2*INT64_MID + j for j in range(-20, 20)] + [INT64_MID//2 + j for j in range(-20, 20)] + list(range(-70, 70)) ) INT128_VALUES = ( [INT128_MIN + j for j in range(20)] + [INT128_MAX - j for j in range(20)] + [INT128_MID + j for j in range(-20, 20)] + [2*INT128_MID + j for j in range(-20, 20)] + [INT128_MID//2 + j for j in range(-20, 20)] + list(range(-70, 70)) + [False] # negative zero ) INT64_POS_VALUES = [x for x in INT64_VALUES if x > 0] @contextlib.contextmanager def exc_iter(*args): """ Iterate over Cartesian product of *args, and if an exception is raised, add information of the current iterate. """ value = [None] def iterate(): for v in itertools.product(*args): value[0] = v yield v try: yield iterate() except Exception: import traceback msg = "At: %r\n%s" % (repr(value[0]), traceback.format_exc()) raise AssertionError(msg) def test_safe_binop(): # Test checked arithmetic routines ops = [ (operator.add, 1), (operator.sub, 2), (operator.mul, 3) ] with exc_iter(ops, INT64_VALUES, INT64_VALUES) as it: for xop, a, b in it: pyop, op = xop c = pyop(a, b) if not (INT64_MIN <= c <= INT64_MAX): assert_raises(OverflowError, mt.extint_safe_binop, a, b, op) else: d = mt.extint_safe_binop(a, b, op) if c != d: # assert_equal is slow assert_equal(d, c) def test_to_128(): with exc_iter(INT64_VALUES) as it: for a, in it: b = mt.extint_to_128(a) if a != b: assert_equal(b, a) def test_to_64(): with exc_iter(INT128_VALUES) as it: for a, in it: if not (INT64_MIN <= a <= INT64_MAX): assert_raises(OverflowError, mt.extint_to_64, a) else: b = mt.extint_to_64(a) if a != b: assert_equal(b, a) def test_mul_64_64(): with exc_iter(INT64_VALUES, INT64_VALUES) as it: for a, b in it: c = a * b d = mt.extint_mul_64_64(a, b) if c != d: assert_equal(d, c) def test_add_128(): with exc_iter(INT128_VALUES, INT128_VALUES) as it: for a, b in it: c = a + b if not (INT128_MIN <= c <= INT128_MAX): assert_raises(OverflowError, mt.extint_add_128, a, b) else: d = mt.extint_add_128(a, b) if c != d: assert_equal(d, c) def test_sub_128(): with exc_iter(INT128_VALUES, INT128_VALUES) as it: for a, b in it: c = a - b if not (INT128_MIN <= c <= INT128_MAX): assert_raises(OverflowError, mt.extint_sub_128, a, b) else: d = mt.extint_sub_128(a, b) if c != d: assert_equal(d, c) def test_neg_128(): with exc_iter(INT128_VALUES) as it: for a, in it: b = -a c = mt.extint_neg_128(a) if b != c: assert_equal(c, b) def test_shl_128(): with exc_iter(INT128_VALUES) as it: for a, in it: if a < 0: b = -(((-a) << 1) & (2**128-1)) else: b = (a << 1) & (2**128-1) c = mt.extint_shl_128(a) if b != c: assert_equal(c, b) def test_shr_128(): with exc_iter(INT128_VALUES) as it: for a, in it: if a < 0: b = -((-a) >> 1) else: b = a >> 1 c = mt.extint_shr_128(a) if b != c: assert_equal(c, b) def test_gt_128(): with exc_iter(INT128_VALUES, INT128_VALUES) as it: for a, b in it: c = a > b d = mt.extint_gt_128(a, b) if c != d: assert_equal(d, c) @dec.slow def test_divmod_128_64(): with exc_iter(INT128_VALUES, INT64_POS_VALUES) as it: for a, b in it: if a >= 0: c, cr = divmod(a, b) else: c, cr = divmod(-a, b) c = -c cr = -cr d, dr = mt.extint_divmod_128_64(a, b) if c != d or d != dr or b*d + dr != a: assert_equal(d, c) assert_equal(dr, cr) assert_equal(b*d + dr, a) def test_floordiv_128_64(): with exc_iter(INT128_VALUES, INT64_POS_VALUES) as it: for a, b in it: c = a // b d = mt.extint_floordiv_128_64(a, b) if c != d: assert_equal(d, c) def test_ceildiv_128_64(): with exc_iter(INT128_VALUES, INT64_POS_VALUES) as it: for a, b in it: c = (a + b - 1) // b d = mt.extint_ceildiv_128_64(a, b) if c != d: assert_equal(d, c) if __name__ == "__main__": run_module_suite()
5,784
24.484581
76
py