Spaces:
Sleeping
Sleeping
"""Gradio demo for schemist.""" | |
from typing import Iterable, List, Optional, Union | |
from io import TextIOWrapper | |
import os | |
os.environ["COMMANDLINE_ARGS"] = "--no-gradio-queue" | |
from carabiner import cast, print_err | |
from carabiner.pd import read_table | |
from duvida.autoclass import AutoModelBox | |
import gradio as gr | |
import nemony as nm | |
import numpy as np | |
import pandas as pd | |
from rdkit.Chem import Draw, Mol | |
from schemist.converting import ( | |
_TO_FUNCTIONS, | |
_FROM_FUNCTIONS, | |
convert_string_representation, | |
_x2mol, | |
) | |
from schemist.tables import converter | |
import torch | |
HEADER_FILE = os.path.join("sources", "header.md") | |
MODEL_REPOS = { | |
"Klebsiella pneumoniae": "hf://scbirlab/spark-dv-fp-2503-kpn", | |
} | |
MODELBOXES = { | |
key: AutoModelBox.from_pretrained(val, cache_dir="./cache") | |
for key, val in MODEL_REPOS.items() | |
} | |
EXTRA_METRICS = { | |
"log10(variance)": lambda modelbox, candidates: modelbox.prediction_variance(candidates=candidates).map(lambda x: {modelbox._variance_key: torch.log10(x[modelbox._variance_key])}), | |
"Tanimoto nearest neighbor to training data": lambda modelbox, candidates: modelbox.tanimoto_nn(candidates=candidates), | |
"Doubtscore": lambda modelbox, candidates: modelbox.doubtscore(candidates=candidates).map(lambda x: {"doubtscore": torch.log10(x["doubtscore"])}), | |
"Information sensitivity (approx.)": lambda modelbox, candidates: modelbox.information_sensitivity(candidates=candidates, optimality_approximation=True, approximator="squared_jacobian").map(lambda x: {"information sensitivity": torch.log10(x["information sensitivity"])}), | |
} | |
def load_input_data(file: TextIOWrapper) -> pd.DataFrame: | |
df = read_table(file.name) | |
string_cols = list(df.select_dtypes(exclude=[np.number])) | |
df = gr.Dataframe(value=df, visible=True) | |
return df, gr.Dropdown(choices=string_cols, interactive=True) | |
def _clean_split_input(strings: str) -> List[str]: | |
return [s2.strip() for s in strings.split("\n") for s2 in s.split(",")] | |
def _convert_input( | |
strings: str, | |
input_representation: str = 'smiles', | |
output_representation: Union[Iterable[str], str] = 'smiles' | |
) -> List[str]: | |
strings = _clean_split_input(strings) | |
converted = convert_string_representation( | |
strings=strings, | |
input_representation=input_representation, | |
output_representation=output_representation, | |
) | |
return {key: list(map(str, cast(val, to=list))) for key, val in converted.items()} | |
def convert_one( | |
strings: str, | |
input_representation: str = 'smiles', | |
output_representation: Union[Iterable[str], str] = 'smiles' | |
): | |
df = pd.DataFrame({ | |
input_representation: _clean_split_input(strings), | |
}) | |
return convert_file( | |
df=df, | |
column=input_representation, | |
input_representation=input_representation, | |
output_representation=output_representation, | |
) | |
def predict_one( | |
strings: str, | |
input_representation: str = 'smiles', | |
predict: Union[Iterable[str], str] = 'smiles', | |
extra_metrics: Optional[Union[Iterable[str], str]] = None | |
): | |
if extra_metrics is None: | |
extra_metrics = [] | |
else: | |
extra_metrics = cast(extra_metrics, to=list) | |
prediction_df = convert_one( | |
strings=strings, | |
input_representation=input_representation, | |
output_representation=['id', 'smiles', 'inchikey', "mwt", "clogp"], | |
) | |
species_to_predict = cast(predict, to=list) | |
prediction_cols = [] | |
for species in species_to_predict: | |
message = f"Predicting for species: {species}" | |
print_err(message) | |
gr.Info(message, duration=3) | |
this_modelbox = MODELBOXES[species] | |
this_features = this_modelbox._input_cols | |
this_labels = this_modelbox._label_cols | |
this_prediction_input = ( | |
prediction_df | |
.rename(columns={ | |
"smiles": this_features[0], | |
}) | |
.assign(**{label: np.nan for label in this_labels}) | |
) | |
print(this_prediction_input) | |
prediction = this_modelbox.predict( | |
data=this_prediction_input, | |
features=this_features, | |
labels=this_labels, | |
aggregator="mean", | |
cache="./cache" | |
).with_format("numpy")["__prediction__"].flatten() | |
print(prediction) | |
this_col = f"{species}: predicted MIC (µM)" | |
prediction_df[this_col] = np.power(10., -prediction) * 1e6 | |
prediction_cols.append(this_col) | |
for extra_metric in extra_metrics: | |
# this_modelbox._input_training_data = this_modelbox._input_training_data.remove_columns([this_modelbox._in_key]) | |
this_col = f"{species}: {extra_metric}" | |
prediction_cols.append(this_col) | |
print(">>>", this_modelbox._input_training_data) | |
print(">>>", this_modelbox._input_training_data.format) | |
print(">>>", this_modelbox._in_key, this_modelbox._out_key) | |
this_extra = ( | |
EXTRA_METRICS[extra_metric]( | |
this_modelbox, | |
this_prediction_input, | |
) | |
.with_format("numpy") | |
) | |
prediction_df[this_col] = this_extra[this_extra.column_names[-1]] | |
return gr.DataFrame( | |
prediction_df[['id'] + prediction_cols + ['smiles', 'inchikey', "mwt", "clogp"]], | |
visible=True | |
) | |
def convert_file( | |
df: pd.DataFrame, | |
column: str = 'smiles', | |
input_representation: str = 'smiles', | |
output_representation: Union[str, Iterable[str]] = 'smiles' | |
): | |
message = f"Converting from {input_representation} to {output_representation}..." | |
print_err(message) | |
gr.Info(message, duration=3) | |
errors, df = converter( | |
df=df, | |
column=column, | |
input_representation=input_representation, | |
output_representation=output_representation, | |
) | |
df = df[ | |
cast(output_representation, to=list) + | |
[col for col in df if col not in output_representation] | |
] | |
all_err = sum(err for key, err in errors.items()) | |
message = ( | |
f"Converted {df.shape[0]} molecules from " | |
f"{input_representation} to {output_representation} " | |
f"with {all_err} errors!" | |
) | |
print_err(message) | |
gr.Info(message, duration=5) | |
return df | |
def predict_file( | |
df: pd.DataFrame, | |
column: str = 'smiles', | |
input_representation: str = 'smiles', | |
extra_metrics: Optional[Union[Iterable[str], str]] = None | |
): | |
if extra_metrics is None: | |
extra_metrics = [] | |
else: | |
extra_metrics = cast(extra_metrics, to=list) | |
prediction_df = convert_file( | |
df, | |
column=column, | |
input_representation=input_representation, | |
output_representation=["id", "smiles", "inchikey", "mwt", "clogp"], | |
) | |
species_to_predict = cast(predict, to=list) | |
prediction_cols = [] | |
for species in species_to_predict: | |
this_modelbox = MODELBOXES[species] | |
this_features = this_modelbox._input_cols | |
this_labels = this_modelbox._label_cols | |
this_prediction_input = ( | |
prediction_df | |
.rename(columns={ | |
"smiles": this_features[0], | |
}) | |
.assign(**{label: np.nan for label in this_labels}) | |
) | |
prediction = this_modelbox.predict( | |
data=this_prediction_input, | |
features=this_features, | |
labels=this_labels, | |
cache="./cache" | |
).with_format("numpy")["__prediction__"].flatten() | |
print(prediction) | |
this_col = f"{species}: predicted MIC (µM)" | |
prediction_df[this_col] = np.power(10., -prediction) * 1e6 | |
prediction_cols.append(this_col) | |
for extra_metric in extra_metrics: | |
# this_modelbox._input_training_data = this_modelbox._input_training_data.remove_columns([this_modelbox._in_key]) | |
this_col = f"{species}: {extra_metric}" | |
prediction_cols.append(this_col) | |
print(">>>", this_modelbox._input_training_data) | |
this_extra = ( | |
EXTRA_METRICS[extra_metric]( | |
this_modelbox, | |
this_prediction_input, | |
) | |
.with_format("numpy") | |
) | |
prediction_df[this_col] = this_extra[this_extra.column_names[0]] | |
return prediction_df[['id'] + prediction_cols + ['smiles', 'inchikey', "mwt", "clogp"]] | |
def draw_one( | |
strings: Union[Iterable[str], str], | |
input_representation: str = 'smiles' | |
): | |
_ids = _convert_input( | |
strings, | |
input_representation, | |
["inchikey", "id", "pubchem_name"], | |
) | |
mols = cast(_x2mol(_clean_split_input(strings), input_representation), to=list) | |
if isinstance(mols, Mol): | |
mols = [mols] | |
return Draw.MolsToGridImage( | |
mols, | |
molsPerRow=min(3, len(mols)), | |
subImgSize=(450, 450), | |
legends=["\n".join(items) for items in zip(*_ids.values())], | |
) | |
def download_table( | |
df: pd.DataFrame | |
) -> str: | |
df_hash = nm.hash(pd.util.hash_pandas_object(df).values) | |
filename = f"converted-{df_hash}.csv" | |
df.to_csv(filename, index=False) | |
return gr.DownloadButton(value=filename, visible=True) | |
with gr.Blocks() as demo: | |
with open(HEADER_FILE, 'r') as f: | |
header_md = f.read() | |
gr.Markdown(header_md) | |
with gr.Tab(label="Paste one per line"): | |
input_format_single = gr.Dropdown( | |
label="Input string format", | |
choices=list(_FROM_FUNCTIONS), | |
value="smiles", | |
interactive=True, | |
) | |
input_line = gr.Textbox( | |
label="Input", | |
placeholder="Paste your molecule here, one per line", | |
lines=2, | |
interactive=True, | |
submit_btn=True, | |
) | |
output_species_single = gr.CheckboxGroup( | |
label="Species for prediction", | |
choices=list(MODEL_REPOS), | |
value=list(MODEL_REPOS)[:1], | |
interactive=True, | |
) | |
extra_metric = gr.CheckboxGroup( | |
label="Extra metrics (can increase calculation time!)", | |
choices=list(EXTRA_METRICS), | |
value=list(EXTRA_METRICS)[:2], | |
interactive=True, | |
) | |
examples = gr.Examples( | |
examples=[ | |
[ | |
'\n'.join([ | |
"C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)N4CCNCC4)F)C(=O)O", | |
"CN1C(=NC(=O)C(=O)N1)SCC2=C(N3[C@@H]([C@@H](C3=O)NC(=O)/C(=N\OC)/C4=CSC(=N4)N)SC2)C(=O)O", | |
"CC(=O)NC[C@H]1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCOCC3)F", | |
"C1CC2=CC(=NC=C2OC1)CNC3CCN(CC3)C[C@@H]4CN5C(=O)C=CC6=C5N4C(=O)C=N6", | |
]), | |
list(MODEL_REPOS)[0], | |
list(EXTRA_METRICS)[:2], | |
], # cipro, ceftriaxone, linezolid, gepotidacin | |
[ | |
'\n'.join([ | |
"C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)N)O", | |
"CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)N)C(=O)O)C", | |
"CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)C(=O)O)C", | |
]), | |
list(MODEL_REPOS)[0], | |
list(EXTRA_METRICS)[:2], | |
], # doxorubicin, ampicillin, amoxicillin | |
[ | |
'\n'.join([ | |
"C1=C(SC(=N1)SC2=NN=C(S2)N)[N+](=O)[O-]", | |
"C1CN(CCC12C3=CC=CC=C3NC(=O)O2)CCC4=CC=C(C=C4)C(F)(F)F", | |
"COC1=CC(=CC(=C1OC)OC)CC2=CN=C(N=C2N)N", | |
"CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)N", | |
"C1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1NC(=O)[C@H](CCN)O)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)N)O)O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CN)O)O)O)N\nC1=CN=CC=C1C(=O)NN", | |
]), | |
list(MODEL_REPOS)[0], | |
list(EXTRA_METRICS)[:2], | |
], # Halicin, Abaucin, Trimethoprim, Sulfamethoxazole, Amikacin, Isoniazid | |
], | |
example_labels=[ | |
"Ciprofloxacin, Ceftriaxone, Linezolid, Gepotidacin", | |
"Doxorubicin, Ampicillin, Amoxicillin", | |
"Halicin, Abaucin, Trimethoprim, Sulfamethoxazole, Amikacin, Isoniazid" | |
], | |
inputs=[input_line, output_species_single, extra_metric], | |
cache_mode="eager", | |
) | |
download_single = gr.DownloadButton( | |
label="Download predictions", | |
visible=False, | |
) | |
with gr.Row(): | |
output_line = gr.DataFrame( | |
label="Predictions", | |
interactive=False, | |
visible=False, | |
) | |
drawing = gr.Image(label="Chemical structures") | |
gr.on( | |
[ | |
input_line.submit, | |
], | |
fn=predict_one, | |
inputs=[ | |
input_line, | |
input_format_single, | |
output_species_single, | |
extra_metric, | |
], | |
outputs={ | |
output_line, | |
} | |
).then( | |
draw_one, | |
inputs=[ | |
input_line, | |
input_format_single, | |
], | |
outputs=drawing, | |
).then( | |
download_table, | |
inputs=output_line, | |
outputs=download_single | |
) | |
with gr.Tab("Convert a file"): | |
input_file = gr.File( | |
label="Upload a table of chemical compounds here", | |
file_types=[".xlsx", ".csv", ".tsv", ".txt"], | |
) | |
with gr.Row(): | |
input_column = gr.Dropdown( | |
label="Input column name", | |
choices=[], | |
) | |
input_format = gr.Dropdown( | |
label="Input string format", | |
choices=list(_FROM_FUNCTIONS), | |
value="smiles", | |
interactive=True, | |
) | |
output_species = gr.CheckboxGroup( | |
label="Species for prediction", | |
choices=list(MODEL_REPOS), | |
value=list(MODEL_REPOS)[:1], | |
interactive=True, | |
) | |
go_button2 = gr.Button( | |
value="Predict!", | |
) | |
download = gr.DownloadButton( | |
label="Download converted data", | |
visible=False, | |
) | |
input_data = gr.Dataframe( | |
label="Input data", | |
max_height=100, | |
visible=False, | |
interactive=False, | |
) | |
input_file.upload( | |
load_input_data, | |
inputs=[input_file], | |
outputs=[input_data, input_column] | |
) | |
go_button2.click( | |
convert_file, | |
inputs=[ | |
input_data, | |
input_column, | |
input_format, | |
output_species, | |
], | |
outputs={ | |
input_data, | |
} | |
).then( | |
download_table, | |
inputs=input_data, | |
outputs=download | |
) | |
if __name__ == "__main__": | |
demo.queue() | |
demo.launch(share=True) | |